P. 1
BÀI TẬP VỀ ANKEN

BÀI TẬP VỀ ANKEN

|Views: 53|Likes:
Được xuất bản bởiNgọc Ni

More info:

Published by: Ngọc Ni on May 14, 2013
Bản quyền:Attribution Non-commercial

Availability:

Read on Scribd mobile: iPhone, iPad and Android.
download as DOC, PDF, TXT or read online from Scribd
See more
See less

02/19/2014

pdf

text

original

BÀI TẬP VỀ ANKEN

1) Khi đốt cháy một thể tích hiđrocacbon A có liên kết đôi trong phân tử cần 6 thể tích oxi và sinh ra 4 thể tích CO 2(Các thể tích khí đo cùng điều kiện) Biết rằng A có thể tác dụng với hiđro tạo thành một hiđrocacbon no mạch nhánh. Xác định công thức cấu tạo của A và viết các phương trình phản ứng. 2) Cho 3,36 lít hỗn hợp gồm một anken và một ankan đi qua dung dịch brom thấy có 8g brom tham gia phản ứng. Biết rằng khối lượng 6,72 lít hỗn hợp là 13gam. a. Xác định công thức phân tử của hai hydrocacbon. b. Đốt cháy 3,36 lít hỗn hợp đó thì được bao nhiêu lít khí CO2 và bao nhiêu gam nước. Biết rằng các khí đo ở đktc. 3) Cho 1gam hỗn hợp etan và etilen đi qua dung dịch brom. a. Viết phản ứng xảy ra. b. Xác định thành phần khối lượng của hỗn hợp, biết rằng cho phản ứng xảy ra hoàn toàn là phải dùng hết 80g dung dịch brom 5%. 4) Để hiđro hóa hoàn toàn 0,7gam một anken cần dùng 246,4cm 3 hiđro (ở 27,3oC và 1 atm). Xác định công thức phân tử. Viết công thức cấu tạo, biết rằng anken có cấu tạo mạch không nhánh 5) Cho 2,24 lít một hỗn hợp khí A (đktc) gồm etan, propan, propilen dẫn qua dung dịch brom dư, thấy khối lượng bình tăng thêm 2,1gam. Nếu đốt cháy khí còn lại thu được một lượng CO2 và 3,24 gam H2O. a. Tính thành phần % thể tích mỗi khí. b. Dẫn lượng CO2 nói trên vào bình đựng 200ml dung dịch KOH 2,6 M. Hãy xác định nồng độ mol các chất trong dung dịch sau phản ứng. 6) Một hỗn hợp X gồm ankan A và anken B, số nguyên tử hiđro trong phân tử A bằng số nguyên tử cacbon trong B. Khi đốt cháy 3gam hỗn hợp X thì thu được 5,4 gam nước. Xác định công thức phân tử A, B và tính % thể tích các khí trong hỗn hợp A. 7) Một hỗn hợp gồm H2, một ankan và một anken ( có cùng số nguyên tử cacbon với ankan). Khi đốt 100 ml hỗn hợp thu được 210 ml khí CO2. Mặt khác khi nung nóng 100ml hỗn hợp với Ni thì sau phản ứng còn lại 70ml một hiđrocacbon duy nhất. a. Tìm công thức phân tử của ankan và anken. b. Định % thể tích của ankan và anken. c. Tính thể tích O2 cần để đốt cháy 10ml hỗn hợp (Các khí đo ở cùng điều kiện) 8) Cho hỗn hợp X gồm anken và hiđro có tỉ khối so với heli bằng 3,33. Cho X đi qua bột niken nung nóng đến khi phản ứng xảy ra hoàn toàn thu được hỗn hợp Y có tỉ khối so với heli là 4. Tìm công thức phân tử của anken. 9) Cho hỗn hợp khí A gồm 2 anken. Để đốt cháy hoàn toàn 7 thể tích A cần 31 thể tích oxi ở cùng điều kiện. a. Xác định công thức phân tử 2 anken. Biết rằng olefin nhiều cacbon chiếm tỉ lệ trong khoảng từ 40 đến 50% thể tích của A. b. Tìm % khối lượng các anken trong A. 10) Cho hỗn hợp H2 và etilen có tỉ khối hơi so với hiđro là 7,5. a. Tính thành phần % thể tích khí trong hỗn hợp. b. Cho hỗn hợp trên vào bình kín có bột niken nung nóng làm xúc tác thì sau phản ứng thu được một hỗn hợp khí có tỉ khối so với H2 là 9. Xác định thành phần % hỡn hợp khí sau phản ứng. 11) Đốt cháy hoàn toàn 0,25 mol khí A thu được 33g CO2 và 13,5g hơi nước. a. Tìm công thức phân tử và công thứ cấu tạo của A, biết rằng ở (đktc) khối lượng riêng của A là 1,875g/l. b. Tính khối lượng sản phẩm tạo thành khi cho lượng chất A trên qua dung dịch brom dư. 12) Hai hiđrocacbon A và B đều ở thể khí, A có công thức C2xHy; B có công thức CxH2x (trị số x trong cả 2 công thức là bằng nhau). a. Lập công thức phân tử A và B. Biết rằng tỉ khối của A đối với metan bằng 3,625 và tỉ khối của B đối với He là 7. Viết công thức cấu tạo của A và B. b. Tính lượng sản phẩm thu được khi cho hỗn hợp trên tác dụng vừa đủ với 16g dung dịch brom. 13) Đốt cháy hoàn toàn 0,03696 lít anken X ở 27,3oC và 1 atm, thu toàn bộ khí CO2 vào dung dịch KOH ta được 0,3g muối axit và 0,207g muối trung tính. Xác định công thức phân tử và công thức cấu tạo của X. 14) A và B là hai anken đồng đẳng liên tiếp nhau. Cho 13,44 lít hỗn hợp hai anken A và B (đktc) qua bình đựng dung dịch brom thấy bình tăng thêm 28g. a. Xác định công thức phân tử, viết công thức cấu tạo hai anken. b. Cho hỗn hợp anken tác dụng với HCl thì thu được tối đa 3 sản phẩm cộng. Xác định công thức cấu tạo hai anken và gọi tên chúng. 15) Một hỗn hợp hai anken đồng đẳng kế tiếp nhau có thể tích 17,92 lít (đo ở 0 oC và 2,5 atm) dẫn qua bình chứa dung dịch KMnO4 dư, thấy khối lượng b́nh chứa dung dịch KMnO4 tăng 70g. a. Xác định công thức phân tử, viết công thức cấu tạo hai olefin. b. Tính % khối lượng 2 anken trong hỗn hợp. c. Đốt cháy hoàn toàn thể tích trên của hỗn hợp rối cho sản phẩm vào 5 lít dung dịch NaOH 1,8M sẽ thu được bao nhiêu gam muối khan? 16) Cho 10 lít hỗn hợp khí (54,6oC; 0,8064 atm) gồm 2 anken lội qua bình dung dịch brom dư thấy khối lượng bình brom tăng 16,8g. a. Tính tổng số mol 2 anken b. Xác định công thức phân tử 2 anken, biết số nguyên tử cacbon trong mỗi olefin không quá 5. 17) Hỗn hợp A và B là hai anken có khối lượng 12,6g trộn theo tỉ lệ mol là 1:1 tác dụng vừa đủ với 32g brom. Nếu trộn hỗn hợp trên theo tỉ lệ khối lượng là 1:1 thì 16,8g hỗn hợp tác dụng vừa đủ với 0,6g H2. Tìm công thức phân tử của A và B, biết MA < MB. 18) Cho H2 và 1 anken có thể tích bằng nhau qua Ni nung nóng thu được hỗn hợp A. Biết rằng tỉ khối hơi của A đối với H 2 là 23,2. Hiệu suất phản ứng hydro hóa là 75%. a. Tìm công thức và gọi tên anken. b. Đốt V lít (đktc) hỗn hợp A nói trên rồi cho toàn bộ sản phẩm cháy qua 128g dung dịch H 2SO4 98% sau thí nghiệm nồng độ dung dịch H2SO4 là 62,72%. Tính V

D. 30) Đốt cháy hoàn toàn 4 lít hh 2 hiđrocacbon A. 24) Hỗn hợp X gồm 2 hydrocacbon A và B (B có số cacbon lớn hơn A. B.38. 66.4M. a. CH2 =CH2 . 25) Cho hỗn hợp A gồm C2H4 và H2 qua Ni.8g hỗn hợp hai anken liên tiếp trong dãy đồng đẳng tác dụng với 1 lít dung dịch brom 0. B. Tỉ khối hơi của A so với không khí là 1. Xác định 2 anken trên và % m từng chất trong hỗn hợp ban đầu. suy ra công thức đúng của A. Xác định công thức phân tử ankan.C4H6 31) Hỗn hợp khí X gồm một ankan và một anken. CH4 và C3H6. a. thuđược hỗn hợp khí Y không làm mất màu nước brom. Tính a? b. Khối lượng bình brom tăng hay giảm bao nhiêu? c.15 mol H 2 và 0.72 lít O 2 (đktc). Tỉ khối của X so với H2 bằng 11. Cho A vào bình kín có niken làm xúc tác. p) . a. C.44 lít. B. Đốt cháy hoàn toàn m gam hh X thu được 13. c. CH4. Khi cho 560 ml hỗn hợp X đi qua bình brom thấy 16g dung dịch Br2 5% mất màu đồng thời lượng bình tăng thêm 0. 25. Đốt cháy hoàn toàn 4. Sô mol CO2 và H2O tạo ra khi đôt cháy hoàn toàn A bằng sô mol CO2 và H2O tạo ra khi đôt cháy hoàn toàn B D.B là: A.3% B. Viết tất cả công thức cấu tạo đồng phân mạch hở của 2 anken và cho biết công thức cấu tạo nào khi cộng nước cho 1 sản phẩm duy nhất 22) Có 1.064 lít CO 2 (đktc) và 4. CH4 và C4H8 32) Hỗn hợp A gồm H2 và 2 hiđrcacbon (một ankan. 26) Đốt cháy hoàn toàn 4.C2H2 B. CH4 và C2H4. được hỗn hợp B có dB/H2 = 4. C. Tính thể tích dung dịch brom 0. 11. Sản phẩm cháy lần lượt qua bình P 2O5 thấy bình tăng 3. Hiệu suất phản ứng cộng hiđro của etilen là: A. 50% 34) (ĐH 2009-KB) Hỗn hợp khí X gồm H2 và một anken có khả năng cộng HBr cho sản phẩm hữu cơ duy nhất.1.6 gam. Xác định công thức phân tử của A. Các phản ứng xảy ra hoàn toàn. Cho 22.8g chất hữu cơ A thu được 8.06 lít CO2. C2H6 và C2H4 B. B.32g H2O.Tỉ khối của X so với H2 bằng 9. CH4.0 ml hỗn hợp X gồm C3H6.68 lít khí còn lại đem đốt cháy thu được 4.6 gam rồi qua bình nước vôi trong dư thấy xuất hiện 20 gam kết tủa trắng. Lập công thức thực nghiệm rồi suy ra công thức phân tử của A. một anken). C5H12 và C5H10 29) Đốt cháy hoàn toàn 20. C3H4 C. Cho A tác dụng với dung dịch Br2 được sản phẩm cộng B. Tính khối lượng các chất trong A. C4H10 và C4H8 D. 23) Sau khi cracking butan ta thu được 1 hỗn hợp A các hiđrocacbon. D. C. a.B thu được 6 lít CO 2 và 6 lít hơi H2O (các thể tích đo ở cùng điều kiện t 0. C đều đúng 33) Hỗn hợp khí A chứa etilen và hiđro. b. Xác định thành phần % của hỗn hợp ban đầu theo thể tích. Các thể tích đo đktc. 21) Cho 9.1. Hãy xác định công thức cấu tạo của A 20) Đốt cháy hoàn toàn a gam chất hữu cơ A cần dùng 6. a. b.19) Một hiđrocacbon A chứa 85. thu được 6. b. Công thức cấutạo của anken là A. C2H2 D. Số mol A .5.72 lít CO2 (các thể tích khí đo ở đktc). Mặt khác. 28) Hỗn hợp X gồm 1 ankan và 1 anken có cùng số nguyên tử cacbon trong phân tử và có cùng số mol. Dẫn A đi qua chất xuc tác Ni nung nóng thì thu được hỗn hợp khí B có tỉ khối đối với hiđro là 9. Hiệu suất phản ứng cracking. thu được 24. Tìm công thức đơn giản nhất của A.9.0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất). C2H6. CO (thể tích CO gấp hai lần thể tíchCH4). biết tỉ khối hơi của A so với nitơ là 2. a. B. anken (ankan và anken cùng số nguyên tử cacbon). b. biết A cộng với H2O cho 1 sản phẩm duy nhất.96 lít hỗn hợp X tác dụng hết với nước brom cần tối thiểu 64g brom. Tính % các khí trong hỗn hợp A theo thể tích.14g.575. tỉ khối hơi của X đối với oxi là 0. 12. B chứa 85. b. Đun nóng X có xúc tác Ni. b.14 gam.12 lít(đktc) hỗn hợp X gồm H 2. Tỉ khối của X so với khí hiđro là A. Nếu cho A qua dung dịch Br2 dư thì khối lượng bình brom tăng 0. CH2=CH-CH2-CH3.8g Br2 tham gia phản ứng. Cả A. Phát biểu nào sau đây đúng: A. a.1 mol C2H4.Công thức phân tử của A. b. Lấy 1.5M tối thiểu cần dùng. Lập công thức phân tử của A.44 lít CO 2 (đktc). Sau khi phản ứng xảy ra hoàn toàn nồng độ dung dịch brom giảm đi 50%.2.4g và khối lượng H2O sinh ra từ B lớn hơn A 12. C3H8 và C3H6 C. 22. 25% D. CH4. 27) Một hỗn hợp khí X chứa 0.0. C2H6 .25.7% C. Tỉ khối của A đối với hiđro là 7. Tính hiệu suất phản ứng hiđro hóa.48 lít X. CH2 =C(CH3)2.96 lít hỗn hợp X tổng số CO 2 thu được là 48. Tính tỉ khối của hỗn hợp Y đối với O2. đun nóng bình một thời gian thu được hỗn hợp B. D. CH3-CH=CH-CH3 . Biết m gam hỗn hợp X làm mất màu vừa đủ 80 gam dung dịch Br2 20%. Viết công thức cấu tạo có thể có. a.8. sau khi phản ứng xảy ra hoàn toàn. 8.5. đem đốt 8. 33. Từ B viết phương trình phản ứng điều chế A. B. C2H6 và C2H4. Cho Y qua dung dịch brom thấy có 0. Tổng sô mol hiđrocacbon có trong B luôn bằng tổng sô mol hiđrocacbon có trong A C.số mol B = số mol H2 tham gia phản ứng.11% brom. tỉ khối của Y so với H2 bằng 13.71% C. ankan. Công thức của ankan và anken lần lượt là A.4 lít hỗn hợp qua bình đựng dung dịch brom thì còn lại 13. CTPT của ankan va anken là: A. Cho hỗn hợp X qua bột Ni nóng ta được hỗn hợp khí Y. anken. A và B đều phản ứng với dung dịch Br 2).

3-đimetylbut-1-en (2). ankin. B.8 gam B. isohexan. (1) và (2). D. B. Phản ứng cộng của Br2 với anken đối xứng. 3-metylpent-2-en (4). (V). 6. 2-metylpropen. Câu 13: Cho các chất sau: CH2=CHCH2CH2CH=CH2.đimetylpent-2-en.5 % và 22. Y. (I). C. (2) và (3).điclobut-2-en. C. CH2=CHCH=CHCH2CH3. 4. 1. 2-metylbut-2-en. (V). 5. D. (2). Phản ứng trùng hợp của anken. C. Câu 16: Anken C4H8 có bao nhiêu đồng phân khi tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ? A. B. Câu 12: Những hợp chất nào sau đây có đồng phân hình học (cis-trans) ? CH3CH=CH2 (I). Câu 4: Hợp chất C5H10 có bao nhiêu đồng phân anken ? A. ankađien. C2H6 và C2H4 C. C. Dẫn hỗn hợp đó qua dung dịch brom thấy dung dịch brom nhạt màu và khối lượng bình tăng 2. 3. cho cùng một sản phẩm là: A. C. 4 vòng. CH3-CH2-CHBr-CH2Br.8 gam BÀI TẬP TRẮC NGHIỆM Câu 1: Anken X có công thức cấu tạo: CH3–CH2–C(CH3)=CH–CH3. CH2Br-CH2-CH2-CH2Br . C. Câu 6: Ba hiđrocacbon X. (V).8 gam CO2 và 5. D. Z thuộc dãy đồng đẳng A. đem sản phẩm sau trùng hợp tác dụng với dung dịch brom thì lượng brom phản ứng là 36 gam. Z là đồng đẳng kế tiếp. Câu 11: Hợp chất nào sau đây có đồng phân hình học ? A. Tỉ khối hơi của hỗn hợp A so với H2 bằng 21. 6. B. B. (II). 5 nối đôi. Vậy licopen có A. khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. CH3-CH2-CH2-CH2Br. Phản ứng cộng của HX vào anken đối xứng. Hiệu suất phản ứng trùng hợp và khối lượng poli etilen (PE) thu được là A. 5. C2H6 và C3H6 D. CH4 và C3H6 . 3. cis-but-2-en và but-1-en.8 gam. CH3CH=C(CH3)2 (III). 4. B. 2-etylbut-2-en. 1 vòng. Các chất X. B. C. Câu 9: Licopen. (IV). 4. CH3CH2C(CH3)=C(C2H5)CH(CH3)2. III. Những chất nào là đồng phân của nhau ? A. 66. CH3CH=CHCl (II). sau phản ứng thấy thoát ra 3. A. Dãy gồm các chất sau khi phản ứng với H2 (dư. Câu 14: Áp dụng quy tắc Maccopnhicop vào trường hợp nào sau đây ? A. C. C. D. (IV). 2. 2-metylpropen và cis-but-2-en.35) Một hỗn hợp gồm 1 ankan và 1 anken. D. Câu 8: Vitamin A công thức phân tử C20H30O. . C.4 gam nước. to). CH2=CHCH2CH=CH2. CH3C(CH3)=CHCH2CH3. xiclobutan. B. (IV). (3) và (4). 1 vòng. C3H6. 5. Hiđro hóa hoàn toàn licopen được hiđrocacbon C40H82. Phản ứng cộng của HX vào anken bất đối xứng.3. 3-metylpent-3-en. Câu 7: Anken X có đặc điểm: Trong phân tử có 8 liên kết xích ma. B. Đốt cháy hoàn toàn hỗn hợp khí bay ra thu được 8. Câu 5: Hợp chất C5H10 có bao nhiêu đồng phân cấu tạo ? A. D. but-1-en. 4. C. có chứa 1 vòng 6 cạnh và không có chứa liên kết ba. 36) (Đề thi HSG 2009-TB) Khi Crăckinh V lít butan được hỗn hợp A chỉ gồm các anken và ankan. CH3CH2CH=CHCH2CH3. chỉ chứa liên kết đôi và liên kết đơn trong phân tử.3. B. (II). B. 3. C4H8. Câu 10: Cho các chất sau: 2-metylbut-1-en (1). C2H4. D.7 gam D. CH3C(CH3)=CHCH2. C2H5–C(CH3)=C(CH3)–C2H5 (IV). B. CH3-CH2-CHBr-CH3. anken. Câu 3: Hợp chất C5H10 mạch hở có bao nhiêu đồng phân cấu tạo ? A. 70% và 23. công thức phân tử C40H56 là chất màu đỏ trong quả cà chua. 10. Số liên kết đôi trong phân tử vitamin A là A. 4. 1. mạch hở. Số chất có đồng phân hình học là: A. 2-clo-but-1-en. ankan. 2. (3) và (4). 13 nối đôi.33% B. C2H5–C(CH3)=CCl–CH3 (V).5% và 21.33% C. (1). B. C. C. Vậy công thức của anken và ankan lần lượt là: A. 6. C. B. Câu 17: Cho các chất: xiclobutan. C5H10. Câu 2: Số đồng phân của C4H8 là A. Y. 2-metylbut-2-en. D. 50. 33. 4. 2. 5. (III). Tên của X là A. 3. D. B. CH3CH=CHCH3. theo qui tắc Maccopnhicop sản phẩm nào sau đây là sản phẩm chính A. Hiệu suất của phản ứng Crăckinh butan là bao nhiêu? A. D.67% 37) (Đề thi HSG 2009-TB) Tiến hành trùng hợp 1mol etilen ở điều kiện thích hợp. 7. D. D. 5. 77.4 gam C. 12 nối đôi. D. 6. 3-metylpent-1-en (3).36 lit một hỗn hợp khí (đktc). cis-but-2-en. B. 77. 7. (IV). 2. CTPT của X là A. D.75. C. but-1-en. D. Câu 15: Khi cho but-1-en tác dụng với dung dịch HBr. B. C. D. 6.67% D. 46. 3-metylpent-2-en. xúc tác Ni. 5 nối đôi. 4. 10. 85% và 23. CH4 và C2H4 B.

D.8 gam. B. propen và but-2-en (hoặc buten-2). etilen.8 gam anken A làm mất màu vừa đủ dung dịch chứa 8 gam Br 2. D. m có giá trị là: A. C. but . 2. 2. 0. Xác định CTPT và số mol mỗi anken trong hỗn hợp X. 0.36 lít (đktc) hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp vào bình nước brom dư. C5H10. 48 gam. 4. CH3CH=CHCH3.9% và 26. 2-metylpropen và but-1-en (hoặc buten-1).2 mol C3H6 và 0. B. C. 84 gam. C. 40% C2H6 và 60% C2H4. 0.36 lít hỗn hợp etan và etilen (đktc) đi chậm qua qua dung dịch brom dư. Sau phản ứng khối lượng bình brom tăng thêm 2. but-2-en. Câu 18: Cho hỗn hợp tất cả các đồng phân mạch hở của C 4H8 tác dụng với H2O (H+. 73. 2-metylpropen. B. C. thấy khối lượng bình tăng thêm 7. 36. B.3 mol C3H6. D. A có nhiều hơn B một nguyên tử cacbon. 0. Khi cho X qua nước Br 2 dư thấy khối lượng bình Br2 tăng 15. D. B. 24 gam.12. Hai anken đó là A. C. CH2=CH2 và CH3CH=CHCH3. Câu 48: a.8 gam. Hiđrat hóa A chỉ thu được một ancol duy nhất. 4. 50% C4H10 và 50% C4H8. CH2=CHCH2CH3. 26. 0. Công thức phân tử của X là: A. thể tích khí còn lại chỉ bằng 2/3 thể tích hỗn hợp X ban đầu. Biết X có đồng phân hình học. CH3CH=CHCH2CH3. 196 gam. B.2-en. Câu 40: Dẫn 3. D. 50%. CH2=CH2 và CH2=CHCH3. eten và but-1-en (hoặc buten-1). D. C. C.05 mol hiđrocacbon X làm mất màu vừa đủ dung dịch chứa 8 gam brom cho ra sản phẩm có hàm lượng brom đạt 69. B. 35% và 65%. C4H10.12 và 0. Thành phần % về thể tích metan và olefin trong hỗn hợp X là: A. D. C. B. C5H10 và C6H12. Câu 21: Anken thích hợp để điều chế ancol sau đây (CH3 CH2)3C-OH là A. 12 gam. Cho 10. cis -but-2-en và xiclobutan.7 gam.1%. B.87%.4 gam. thấy khối lượng bình tăng thêm 7. Câu 38: 0. D. B và thành phần % theo thể tích của hỗn hợp X là A.4 gam. D. Câu 42: Dẫn 3. 40%. D.7 gam.3-dimetylbut-2-en. 5. D. CH3CH=CHCH3 và CH2=CHCH2CH3. xiclobutan. 11. eten và but-2-en (hoặc buten-2). 2. (CH3)2C=CH2. C. 12. D.67%. A có tên là: A.to) thu được tối đa bao nhiêu sản phẩm cộng ? A. C4H8. D. Câu 45: Một hỗn hợp X gồm ankan A và một anken B có cùng số nguyên tử C và đều ở thể khí ở đktc. Câu 22: Hiđrat hóa hỗn hợp X gồm 2 anken thu được chỉ thu được 2 ancol. Câu 39: Dẫn từ từ 8. Số mol etan và etilen trong hỗn hợp lần lượt là: A. B. Câu 35: Khối lượng etilen thu được khi đun nóng 230 gam rượu etylic với H2SO4 đậm đặc.03 và 0.3.6 gam.56%. C. C3H6.8 gam.5% và 63. Câu 47: Cho 8960 ml (đktc) anken X qua dung dịch brom dư.8 gam. 33. X gồm 2 anken đồng đẳng kế tiếp nhau. D. Cho hỗn hợp X đi qua nước Br2 dư thì thể tích khí Y còn lại bằng nửa thể tích X.544 gam CO2. 80%. 36 gam. B. B. CTPT của A. D. C. C5H8. B. C. 56 gam. 70%. 5. B. hiệu suất phản ứng đạt 40% là: A. hex.2 mol C4H8. 20% và 80%. but-1-en. B hoặc D. khi kết thúc phản ứng thấy có m gam brom phản ứng.08% Br về khối lượng). .4 mol C2H4 và 0. % thể tích của một trong 2 anken là: A. Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1. CTPT A. 50% C3H8và 50% C3H6 C.2 mol C3H6. C. Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau. khối lượng bình brom tăng lên 2. CTCT của X là: A. C2H4 . C3H6 .33% và 66. Xiclopropan. C. D.05 và 0.05. D. 0.3 mol C2H4 và 0. 40% và 60%.8 gam.5%.8 lít hỗn hợp X qua dung dịch brom dư thấy có 1 chất khí bay ra.13% và 73. 5 Câu 19: Có bao nhiêu anken ở thể khí (đkt) mà khi cho mỗi anken đó tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ? A. C.1.1 và 0. Thành phần phần % về thể tích của hai anken là: A. thu được chất hữu cơ Y (chứa 74. 3.2 lít (đktc). D. Propilen. A và B đều ở thể khí (ở đktc). 3. 0.C. 3-etylpent-1-en.4 gam hỗn hợp X gồm but-1-en và but-2-en lội chậm qua bình đựng dung dịch Br 2. còn khối lượng Y bằng 15/29 khối lượng X. Nếu cho hỗn hợp X đi qua bình đựng nước brom dư. 350 gam. C4H8 và C5H10.1 mol C3H6. C3H8. C3H8. X gồm A.8 gam. D. Câu 36: Cho 3. 3-etylpent-3-en. C2H4 . Khi cho 6. 3-etylpent-2-en. B.đimetylpent-1-en. đốt cháy hoàn toàn khí này thu được 5.48 lít (ở đktc). C.2 mol C2H4 và 0. B và khối lượng của hỗn hợp X là: A. D. C. B.72 lít khí X (đktc) đi qua nước brom dư. khối lượng bình tăng lên 9. A. CTPT của 2 anken là: A. Câu 41: Hỗn hợp X gồm 2 anken là đồng đẳng liên tiếp có thể tích 4. 6. 0. 1. C. 50% C2H6 và 50% C2H4 Câu 46 : Hỗn hợp X gồm metan và 1 olefin.2-en. Câu 43: Một hỗn hợp X có thể tích 11. C2H4 và C3H6. B. C3H6 và C4H8. Câu 44: Một hỗn hợp X gồm ankan A và anken B. Sau phản ứng thấy khối lượng bình brom tăng 22.36 lít (đktc) hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp vào bình nước brom dư. B. Câu 20: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu).03. B. Tên gọi của X là: A. 2-metylbut-2-en và but-1-en. Câu 37: 2. C4H10. 25% và 75%. C3H6 .

C. Câu 61: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu). Công thức phân tử của 2 hiđrocacbon là (cho H = 1. 3. Công thức phân tử của X là (cho H = 1.7 gam.12. propen và but-2-en (hoặc buten-2). cis-but-2-en và but-1-en. 50%. C3H6. Câu 64: Hỗn hợp khí X gồm H2 và C2H4 có tỉ khối so với He là 3. 3. 5. C. Câu 52: Cho buta-1. B. C3H6 và C5H10. Số dẫn xuất đibrom (đồng phân cấu tạo và đồng phân hình học) thu được là A.1 mol chất Y. D.7 gam. C.2. 5.96% clo về khối lượng. cho 5.b. B. 2-metylbut-2-en. Dẫn X qua Ni nung nóng.4. Z kế tiếp nhau trong dãy đồng đẳng. eten và but-2-en (hoặc buten-2). Y. 11. Câu 51: Cho 10 lít hỗn hợp khí (54. C. Hai anken đó là A.0 ml hỗn hợp X gồm C3H6. B. B. 10. C2H2 và C3H8. 0. Giá trị của k là (cho H = 1. X có công thức phân tử là: A.2. 3-etylpent-2-en. A hoặc B. C3H4.36 lít (đktc) hỗn hợp X gồm 2 anken là vào bình nước brom dư. C2H2 và C4H8.72 lít (ở đktc). C2H4. 3. CH2=CH-CH=CH-CH2-CH3. C5H10. D.28 gam và có 2. 25. thu được hỗn hợp khí Z có tỉ khối đối với hiđro bằng 19. trong đó khối lượng phân tử Z gấp đôi khối lượng phân tử X. 40%. C. C = 12) A. eten và but-1-en (hoặc buten-1). D. Số chất có đồng phân hình học là A. B. Câu 63: Chất nào sau đây có đồng phân hình học? A. Sau khi phản ứng hoàn toàn. C.C3H6. 6. C. C. 30. C = 12. 0. B. C. Đốt cháy hoàn toàn hỗn hợp trên thu được hỗn hợp khí Y. B. C2H4 và C4H8. CH2=CH-CH=CH2. Câu 65: Cho các chất: xiclobutan. C = 12.688 lít khí bay ra (đktc). C5H10. Câu 68: Cho hỗn hợp hai anken đồng đẳng kế tiếp nhau tác dụng với nước (có H2SO4 làm xúc tác) thu được hỗn hợp Z gồm hai rượu (ancol) X và Y.1.9. Câu 55: Cho các chất sau: CH2=CH-CH2-CH2-CH=CH2.48 lít hỗn hợp X (ở đktc) gồm 2 hiđrocacbon mạch hở lội từ từ qua bình chứa 1.1 mol C3H4. Số mol. C = 12. C. D. B. trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC. 2-metylpropen.06 gam hỗn hợp Z sau đó hấp thụ toàn bộ sản phẩm cháy vào 2 lít dung dịch NaOH 0.6 lít X qua dung dịch brom dư thấy khối lượng bình brom tăng 7. 2-metylpropen và but-1-en (hoặc buten-1).2. D. Cl = 35. 2-metylpropen. CH3−CH2−CH=C(CH3)2. C2H4. O = 16. 2-metylbut-2-en và but-1-en. D. B.0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất).5) A. Hiệu suất của phản ứng hiđro hoá là A.04%. 2-etylpent-2-en. A hoặc B. Cl = 35. xiclobutan. CO (thể tích CO gấp hai lần thể tích CH 4). thu được 24. C3H6 và C4H8. Hiđrocacbon X cộng HCl theo tỉ lệ mol 1:1 tạo sản phẩm có hàm lượng clo là 55. 0. 4. Đốt cháy 0. C. CH3-CH=C(CH3)2. D. to). B. 2.1 mol C2H2. but-1-en.3. 0.6 oC. C3H4. công thức phân tử của M và N lần lượt là A. D.2 mol C2H4 và 0. C4H8. B. O = 16) A. C. D. CH3−CH=CH−CH=CH2. D. D. CTPT của 2 anken là: A. D.C3H8. B. D. Câu 57: Cho 4. Số chất có đồng phân hình học là A. C2H4 và C5H10. 4. 3-etylpent-1-en.1M thu . CH3-C(CH3)=CH-CH3.4 lít dung dịch Br 2 0. Câu 56: Cho iso-pentan tác dụng với Cl2 theo tỉ lệ số mol 1 : 1. C. D. B. xúc tác Ni. D. Câu 58: Clo hoá PVC thu được một polime chứa 63. C4H8. cis-but-2-en. Câu 59: Ba hiđrocacbon X. 1. Tên của X là A. CTPT của anken là: A.5) A.2 mol C2H2.3-etylpent-3-en.20.3-đien phản ứng cộng với Br2 theo tỉ lệ mol 1:1.12. C2H4 Câu 50: Dẫn 3. Cho Y qua dung dịch H2SO4 đặc. 0. B. B. B.2 mol C3H6 và 0. C = 12. but-1-en. B.75. CH2=CH-CH2-CH3. 40. 4. 3. C. Câu 54: Hỗn hợp khí X gồm anken M và ankin N có cùng số nguyên tử cacbon trong phân tử. D.20%.C2H2 và C4H6. C4H8. Tỉ khối của X so với khí hiđro là A.2 mol C3H4. D. B. C4H8.1 mol C3H6 và 0.8064 atm) gồm 2 olefin lội qua bình dung dịch brom dư thấy khối lượng bình brom tăng 16. Câu 53: Anken X hợp nước tạo thành 3-etylpentan-3-ol. 2.8. B. CH2=CH-CH2-CH=CH2. 4. B.5M. C3H6. CH3−CH=CH−COOH. CH3−CH=CH2. 1. C4H8 và C5H10. sản phẩm khí hấp thụ hoàn toàn vào dung dịch Ca(OH)2 (dư). Câu 67: Đốt cháy hoàn toàn 20.1 mol C2H4 và 0. C. thu được hỗn hợp khí Y có tỉ khối so với He là 5. Đốt cháy hoàn toàn 1. cis-but-2-en và xiclobutan. Câu 60: Một hiđrocacbon X cộng hợp với axit HCl theo tỉ lệ mol 1:1 tạo sản phẩm có thành phần khối lượng clo l 45. Câu 66: Cho các chất: CH2=CH−CH=CH2. 2-metylpropen và cis-but-2-en. 25%. D. 1. CH3-CH=CH-CH=CH2. Dãy gồm các chất sau khi phản ứng với H 2 (dư. CTPT của 2 anken là (Biết số C trong các anken không vượt quá 5) A. Công thức phân tử của X là (cho H = 1. C3H6. C. D. C4H8 và C5H10. số sản phẩm monoclo tối đa thu được là A. số mol Br2 giảm đi một nửa và khối lượng bình tăng thêm 6.8 gam. Câu 62: Hỗn hợp gồm hiđrocacbon X và oxi có tỉ lệ số mol tương ứng là 1:10. D. C. thu được số gam kết tủa là (cho H = 1. C. C.223%. CH4. Ca = 40) A. thấy khối lượng bình tăng thêm 7. Câu 49: Hỗn hợp X gồm metan và anken.4 gam và thể tích 6. Hỗn hợp X có khối lượng A. C. xiclobutan. cho cùng một sản phẩm là: A. C3H4 và C4H8. 22.

B. thu được chất hữu cơ Y (chứa 74. Tên gọi của X là A. B. 31. CH4 và C3H4. 31. C = 12. CH4 và C4H8. C. CH4 và C3H6.8. 3-metylbutan-2-ol.43%. D. Tổng hệ số (nguyên. CH4 và C2H4. 24.08% Br về khối lượng). Câu 69: Cho phản ứng: C6H5-CH=CH2 + KMnO4 → C6H5-COOK + K2CO3 + MnO2 + KOH + H2O.5. 80%. Câu 70: Số đồng phân cấu tạo của C5H10 phản ứng được với dung dịch brom là A. Sau khi phản ứng xảy ra hoàn toàn. 2-metylbutan-3-ol. anken. C. C3H7OH và C4H9OH. . D. B. B. D. có 4 gam brom đã phản ứng và còn lại 1. áp suất). Câu 75: Hiđro hóa hoàn toàn hiđrocacbon mạch hở X thu được isopentan.48 lít X. but-1-en. 34. ankan.CH4 và C2H4.68 lít hỗn hợp khí X gồm hai hiđrocacbon vào bình đựng dung dịch brom (dư). Câu 77: Hỗn hợp X gồm H2 và C2H4 có tỉ khối so với H2 là 7. Câu 72: Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1. Câu 76: Đốt cháy hoàn toàn 3 lít hỗn hợp X gồm 2 anken kế tiếp nhau trong dãy đồng đẳng cần vừa đủ 10. 10. B. O = 16. 5. D. thu được 6.58%.được dung dịch T trong đó nồngđộ của NaOH bằng 0. Phần trăm khối lượng của ancol bậc một (có số nguyên tử cacbon lớn hơn) trong Y là A. C. D. Câu 73: Dẫn 1. xiclopropan. thu được hỗn hợp Y có tỉ khối so với H2 là 12.89%. B.05M. trong đó khối lượng ancol bậc hai bằng 6/13 lần tổng khối lượng các ancol bậc một.8 lít khí CO 2.5 lít O 2 (các thể tích khí đo trong cùng điều kiện nhiệt độ. D. Công thức cấu tạo thu gọn của X và Y là (Cho: H = 1. C.68 lít X thì sinh ra 2.5. B. C. Z là đồng đẳng kế tiếp. but-2-en. Câu 71: Hỗn hợp khí X gồm một ankan và một anken. Z thuộc dãy đồng đẳng A.72 lít CO2 (các thể tích khí đo ở đktc). C2H6 và C3H6 Câu 74: Ba hiđrocacbon X. C2H6 và C2H4. Tỉ khối của X so với H2 bằng 11. C4H9OH và C5H11OH. B. Hiđrat hóa hoàn toàn X trong điều kiện thích hợp thu được hỗn hợp ancol Y. 7. C2H5OH và C4H9OH. C. propilen. 50%. 5. B. thể tích dung dịch thay đổi không đáng kể) A.12 lít khí. 4. Đốt cháy hoàn toàn 4. C. xúc tác thích hợp) thu được sản phẩm chính là A. Hiệu suất của phản ứng hiđro hóa là A. Y. CH4 và C3H6. Câu 78: Hiđrat hóa 2-metylbut-2-en (điều kiện nhiệt độ. C2H5OH và C3H7OH. 46. Y. Dẫn X qua Ni nung nóng. 3-metylbutan-1-ol. D. 2-metylbutan-2-ol. tối giản) tất cả các chất trong phương trình hoá học của phản ứng trên là A. ankin. 7. C. D. Công thức của ankan và anken lần lượt là A. Nếu đốt cháy hoàn toàn 1. C. 60%. C.27.25. 6. ankađien.88%. B. D. Các chất X. B. 9. khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. C. Công thức phân tử của hai hiđrocacbon là (biết các thể tích khí đều đo ở đktc) A. D. 70%. Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau. 7. D. Số công thức cấu tạo có thể có của X là A.

You're Reading a Free Preview

Tải về
scribd
/*********** DO NOT ALTER ANYTHING BELOW THIS LINE ! ************/ var s_code=s.t();if(s_code)document.write(s_code)//-->