BÀI TẬP VỀ ANKEN

1) Khi đốt cháy một thể tích hiđrocacbon A có liên kết đôi trong phân tử cần 6 thể tích oxi và sinh ra 4 thể tích CO 2(Các thể tích khí đo cùng điều kiện) Biết rằng A có thể tác dụng với hiđro tạo thành một hiđrocacbon no mạch nhánh. Xác định công thức cấu tạo của A và viết các phương trình phản ứng. 2) Cho 3,36 lít hỗn hợp gồm một anken và một ankan đi qua dung dịch brom thấy có 8g brom tham gia phản ứng. Biết rằng khối lượng 6,72 lít hỗn hợp là 13gam. a. Xác định công thức phân tử của hai hydrocacbon. b. Đốt cháy 3,36 lít hỗn hợp đó thì được bao nhiêu lít khí CO2 và bao nhiêu gam nước. Biết rằng các khí đo ở đktc. 3) Cho 1gam hỗn hợp etan và etilen đi qua dung dịch brom. a. Viết phản ứng xảy ra. b. Xác định thành phần khối lượng của hỗn hợp, biết rằng cho phản ứng xảy ra hoàn toàn là phải dùng hết 80g dung dịch brom 5%. 4) Để hiđro hóa hoàn toàn 0,7gam một anken cần dùng 246,4cm 3 hiđro (ở 27,3oC và 1 atm). Xác định công thức phân tử. Viết công thức cấu tạo, biết rằng anken có cấu tạo mạch không nhánh 5) Cho 2,24 lít một hỗn hợp khí A (đktc) gồm etan, propan, propilen dẫn qua dung dịch brom dư, thấy khối lượng bình tăng thêm 2,1gam. Nếu đốt cháy khí còn lại thu được một lượng CO2 và 3,24 gam H2O. a. Tính thành phần % thể tích mỗi khí. b. Dẫn lượng CO2 nói trên vào bình đựng 200ml dung dịch KOH 2,6 M. Hãy xác định nồng độ mol các chất trong dung dịch sau phản ứng. 6) Một hỗn hợp X gồm ankan A và anken B, số nguyên tử hiđro trong phân tử A bằng số nguyên tử cacbon trong B. Khi đốt cháy 3gam hỗn hợp X thì thu được 5,4 gam nước. Xác định công thức phân tử A, B và tính % thể tích các khí trong hỗn hợp A. 7) Một hỗn hợp gồm H2, một ankan và một anken ( có cùng số nguyên tử cacbon với ankan). Khi đốt 100 ml hỗn hợp thu được 210 ml khí CO2. Mặt khác khi nung nóng 100ml hỗn hợp với Ni thì sau phản ứng còn lại 70ml một hiđrocacbon duy nhất. a. Tìm công thức phân tử của ankan và anken. b. Định % thể tích của ankan và anken. c. Tính thể tích O2 cần để đốt cháy 10ml hỗn hợp (Các khí đo ở cùng điều kiện) 8) Cho hỗn hợp X gồm anken và hiđro có tỉ khối so với heli bằng 3,33. Cho X đi qua bột niken nung nóng đến khi phản ứng xảy ra hoàn toàn thu được hỗn hợp Y có tỉ khối so với heli là 4. Tìm công thức phân tử của anken. 9) Cho hỗn hợp khí A gồm 2 anken. Để đốt cháy hoàn toàn 7 thể tích A cần 31 thể tích oxi ở cùng điều kiện. a. Xác định công thức phân tử 2 anken. Biết rằng olefin nhiều cacbon chiếm tỉ lệ trong khoảng từ 40 đến 50% thể tích của A. b. Tìm % khối lượng các anken trong A. 10) Cho hỗn hợp H2 và etilen có tỉ khối hơi so với hiđro là 7,5. a. Tính thành phần % thể tích khí trong hỗn hợp. b. Cho hỗn hợp trên vào bình kín có bột niken nung nóng làm xúc tác thì sau phản ứng thu được một hỗn hợp khí có tỉ khối so với H2 là 9. Xác định thành phần % hỡn hợp khí sau phản ứng. 11) Đốt cháy hoàn toàn 0,25 mol khí A thu được 33g CO2 và 13,5g hơi nước. a. Tìm công thức phân tử và công thứ cấu tạo của A, biết rằng ở (đktc) khối lượng riêng của A là 1,875g/l. b. Tính khối lượng sản phẩm tạo thành khi cho lượng chất A trên qua dung dịch brom dư. 12) Hai hiđrocacbon A và B đều ở thể khí, A có công thức C2xHy; B có công thức CxH2x (trị số x trong cả 2 công thức là bằng nhau). a. Lập công thức phân tử A và B. Biết rằng tỉ khối của A đối với metan bằng 3,625 và tỉ khối của B đối với He là 7. Viết công thức cấu tạo của A và B. b. Tính lượng sản phẩm thu được khi cho hỗn hợp trên tác dụng vừa đủ với 16g dung dịch brom. 13) Đốt cháy hoàn toàn 0,03696 lít anken X ở 27,3oC và 1 atm, thu toàn bộ khí CO2 vào dung dịch KOH ta được 0,3g muối axit và 0,207g muối trung tính. Xác định công thức phân tử và công thức cấu tạo của X. 14) A và B là hai anken đồng đẳng liên tiếp nhau. Cho 13,44 lít hỗn hợp hai anken A và B (đktc) qua bình đựng dung dịch brom thấy bình tăng thêm 28g. a. Xác định công thức phân tử, viết công thức cấu tạo hai anken. b. Cho hỗn hợp anken tác dụng với HCl thì thu được tối đa 3 sản phẩm cộng. Xác định công thức cấu tạo hai anken và gọi tên chúng. 15) Một hỗn hợp hai anken đồng đẳng kế tiếp nhau có thể tích 17,92 lít (đo ở 0 oC và 2,5 atm) dẫn qua bình chứa dung dịch KMnO4 dư, thấy khối lượng b́nh chứa dung dịch KMnO4 tăng 70g. a. Xác định công thức phân tử, viết công thức cấu tạo hai olefin. b. Tính % khối lượng 2 anken trong hỗn hợp. c. Đốt cháy hoàn toàn thể tích trên của hỗn hợp rối cho sản phẩm vào 5 lít dung dịch NaOH 1,8M sẽ thu được bao nhiêu gam muối khan? 16) Cho 10 lít hỗn hợp khí (54,6oC; 0,8064 atm) gồm 2 anken lội qua bình dung dịch brom dư thấy khối lượng bình brom tăng 16,8g. a. Tính tổng số mol 2 anken b. Xác định công thức phân tử 2 anken, biết số nguyên tử cacbon trong mỗi olefin không quá 5. 17) Hỗn hợp A và B là hai anken có khối lượng 12,6g trộn theo tỉ lệ mol là 1:1 tác dụng vừa đủ với 32g brom. Nếu trộn hỗn hợp trên theo tỉ lệ khối lượng là 1:1 thì 16,8g hỗn hợp tác dụng vừa đủ với 0,6g H2. Tìm công thức phân tử của A và B, biết MA < MB. 18) Cho H2 và 1 anken có thể tích bằng nhau qua Ni nung nóng thu được hỗn hợp A. Biết rằng tỉ khối hơi của A đối với H 2 là 23,2. Hiệu suất phản ứng hydro hóa là 75%. a. Tìm công thức và gọi tên anken. b. Đốt V lít (đktc) hỗn hợp A nói trên rồi cho toàn bộ sản phẩm cháy qua 128g dung dịch H 2SO4 98% sau thí nghiệm nồng độ dung dịch H2SO4 là 62,72%. Tính V

a.14 gam.5M tối thiểu cần dùng. 25. 26) Đốt cháy hoàn toàn 4. 27) Một hỗn hợp khí X chứa 0. Khi cho 560 ml hỗn hợp X đi qua bình brom thấy 16g dung dịch Br2 5% mất màu đồng thời lượng bình tăng thêm 0. anken. Tính khối lượng các chất trong A.4 lít hỗn hợp qua bình đựng dung dịch brom thì còn lại 13.71% C. C2H6 và C2H4. CH4 và C3H6.25. biết tỉ khối hơi của A so với nitơ là 2. Công thức của ankan và anken lần lượt là A. a. CH4. Viết tất cả công thức cấu tạo đồng phân mạch hở của 2 anken và cho biết công thức cấu tạo nào khi cộng nước cho 1 sản phẩm duy nhất 22) Có 1. Lập công thức thực nghiệm rồi suy ra công thức phân tử của A. tỉ khối hơi của X đối với oxi là 0. 11. Đun nóng X có xúc tác Ni. C. b. sau khi phản ứng xảy ra hoàn toàn.B thu được 6 lít CO 2 và 6 lít hơi H2O (các thể tích đo ở cùng điều kiện t 0. CH3-CH=CH-CH3 . Từ B viết phương trình phản ứng điều chế A. thu được 6. thuđược hỗn hợp khí Y không làm mất màu nước brom. Tỉ khối của X so với H2 bằng 11. C3H8 và C3H6 C. 66. được hỗn hợp B có dB/H2 = 4.96 lít hỗn hợp X tác dụng hết với nước brom cần tối thiểu 64g brom. đem đốt 8. CH4. A và B đều phản ứng với dung dịch Br 2). a. CH2=CH-CH2-CH3. Tính thể tích dung dịch brom 0.15 mol H 2 và 0. suy ra công thức đúng của A. Mặt khác.44 lít CO 2 (đktc).6 gam. Đốt cháy hoàn toàn m gam hh X thu được 13.4g và khối lượng H2O sinh ra từ B lớn hơn A 12.8. B.68 lít khí còn lại đem đốt cháy thu được 4. b. CO (thể tích CO gấp hai lần thể tíchCH4). C2H6.C4H6 31) Hỗn hợp khí X gồm một ankan và một anken. 33. p) . a. a. D. một anken).14g. CH4 và C2H4. Xác định 2 anken trên và % m từng chất trong hỗn hợp ban đầu. 21) Cho 9. Tính % các khí trong hỗn hợp A theo thể tích. C đều đúng 33) Hỗn hợp khí A chứa etilen và hiđro.19) Một hiđrocacbon A chứa 85.44 lít. C2H6 và C2H4 B.4M. b. Tính hiệu suất phản ứng hiđro hóa.số mol B = số mol H2 tham gia phản ứng.06 lít CO2.064 lít CO 2 (đktc) và 4. 28) Hỗn hợp X gồm 1 ankan và 1 anken có cùng số nguyên tử cacbon trong phân tử và có cùng số mol. đun nóng bình một thời gian thu được hỗn hợp B. 30) Đốt cháy hoàn toàn 4 lít hh 2 hiđrocacbon A. Tỉ khối của X so với khí hiđro là A.9.1. 24) Hỗn hợp X gồm 2 hydrocacbon A và B (B có số cacbon lớn hơn A.8g hỗn hợp hai anken liên tiếp trong dãy đồng đẳng tác dụng với 1 lít dung dịch brom 0. CH2 =C(CH3)2. thu được 24. B. Các phản ứng xảy ra hoàn toàn.8g Br2 tham gia phản ứng. Lập công thức phân tử của A. C2H2 D. 25% D. B.0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất). 50% 34) (ĐH 2009-KB) Hỗn hợp khí X gồm H2 và một anken có khả năng cộng HBr cho sản phẩm hữu cơ duy nhất.Công thức phân tử của A. Cả A.1. D. anken (ankan và anken cùng số nguyên tử cacbon).8g chất hữu cơ A thu được 8.48 lít X.Tỉ khối của X so với H2 bằng 9. Đốt cháy hoàn toàn 4. Tỉ khối của A đối với hiđro là 7. Hãy xác định công thức cấu tạo của A 20) Đốt cháy hoàn toàn a gam chất hữu cơ A cần dùng 6. C. CTPT của ankan va anken là: A. Viết công thức cấu tạo có thể có. C2H6 . b. Phát biểu nào sau đây đúng: A.32g H2O. B chứa 85.2. Số mol A .0 ml hỗn hợp X gồm C3H6. Nếu cho A qua dung dịch Br2 dư thì khối lượng bình brom tăng 0. a. 22.5. Công thức cấutạo của anken là A. a. Tỉ khối hơi của A so với không khí là 1. Tổng sô mol hiđrocacbon có trong B luôn bằng tổng sô mol hiđrocacbon có trong A C.72 lít O 2 (đktc).6 gam rồi qua bình nước vôi trong dư thấy xuất hiện 20 gam kết tủa trắng. Tìm công thức đơn giản nhất của A. ankan. Biết m gam hỗn hợp X làm mất màu vừa đủ 80 gam dung dịch Br2 20%.11% brom. Lấy 1. Tính a? b. Hiệu suất phản ứng cracking. b. Xác định công thức phân tử của A. biết A cộng với H2O cho 1 sản phẩm duy nhất. C. tỉ khối của Y so với H2 bằng 13. Khối lượng bình brom tăng hay giảm bao nhiêu? c. Sô mol CO2 và H2O tạo ra khi đôt cháy hoàn toàn A bằng sô mol CO2 và H2O tạo ra khi đôt cháy hoàn toàn B D.0.C2H2 B. 25) Cho hỗn hợp A gồm C2H4 và H2 qua Ni. Cho 22. Cho A tác dụng với dung dịch Br2 được sản phẩm cộng B. a. Hiệu suất phản ứng cộng hiđro của etilen là: A. C3H4 C.96 lít hỗn hợp X tổng số CO 2 thu được là 48. Xác định thành phần % của hỗn hợp ban đầu theo thể tích. CH4 và C4H8 32) Hỗn hợp A gồm H2 và 2 hiđrcacbon (một ankan. Xác định công thức phân tử ankan. C5H12 và C5H10 29) Đốt cháy hoàn toàn 20. C4H10 và C4H8 D. CH4. Cho hỗn hợp X qua bột Ni nóng ta được hỗn hợp khí Y.5. b. Cho Y qua dung dịch brom thấy có 0.12 lít(đktc) hỗn hợp X gồm H 2. B.38. B. Các thể tích đo đktc. D. B. Sản phẩm cháy lần lượt qua bình P 2O5 thấy bình tăng 3. b.3% B. CH2 =CH2 .575. c. Tính tỉ khối của hỗn hợp Y đối với O2.1 mol C2H4. 12. 8.72 lít CO2 (các thể tích khí đo ở đktc). Dẫn A đi qua chất xuc tác Ni nung nóng thì thu được hỗn hợp khí B có tỉ khối đối với hiđro là 9.7% C.B là: A. Cho A vào bình kín có niken làm xúc tác. 23) Sau khi cracking butan ta thu được 1 hỗn hợp A các hiđrocacbon. Sau khi phản ứng xảy ra hoàn toàn nồng độ dung dịch brom giảm đi 50%.

3. Câu 16: Anken C4H8 có bao nhiêu đồng phân khi tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ? A. C. 77. D. (V). Câu 12: Những hợp chất nào sau đây có đồng phân hình học (cis-trans) ? CH3CH=CH2 (I). Y.8 gam CO2 và 5. Câu 17: Cho các chất: xiclobutan. CTPT của X là A. công thức phân tử C40H56 là chất màu đỏ trong quả cà chua. anken.36 lit một hỗn hợp khí (đktc). 4. Hiệu suất phản ứng trùng hợp và khối lượng poli etilen (PE) thu được là A. D. (1). B. 2-etylbut-2-en. Dãy gồm các chất sau khi phản ứng với H2 (dư. D. 3-metylpent-2-en (4).đimetylpent-2-en. B. theo qui tắc Maccopnhicop sản phẩm nào sau đây là sản phẩm chính A. 5. xúc tác Ni. D. (III). cho cùng một sản phẩm là: A. D. Câu 2: Số đồng phân của C4H8 là A. A. 13 nối đôi. B. C. B. Câu 9: Licopen. 1 vòng. C. C. 6. B. C2H6 và C3H6 D. 4 vòng. Phản ứng cộng của Br2 với anken đối xứng. D.5% và 21. 4. 6. Z thuộc dãy đồng đẳng A. C2H5–C(CH3)=CCl–CH3 (V). CH2Br-CH2-CH2-CH2Br . 46. 3. Các chất X. C.35) Một hỗn hợp gồm 1 ankan và 1 anken. C. ankin. có chứa 1 vòng 6 cạnh và không có chứa liên kết ba. (V). 10. 10. Câu 7: Anken X có đặc điểm: Trong phân tử có 8 liên kết xích ma. 7. B. CH3CH=C(CH3)2 (III). C4H8.8 gam B. 12 nối đôi. C. (II). CH3-CH2-CHBr-CH2Br. D. 2-metylpropen và cis-but-2-en. C. 1 vòng. (I). C. 7. B. cis-but-2-en và but-1-en. 3-metylpent-1-en (3). 5. 5 nối đôi. CH3C(CH3)=CHCH2. 1. Phản ứng cộng của HX vào anken bất đối xứng. C. C3H6. 70% và 23. Câu 15: Khi cho but-1-en tác dụng với dung dịch HBr. III. Câu 11: Hợp chất nào sau đây có đồng phân hình học ? A. 3-metylpent-3-en. 5. B. Đốt cháy hoàn toàn hỗn hợp khí bay ra thu được 8. 66. Phản ứng trùng hợp của anken. B. Câu 5: Hợp chất C5H10 có bao nhiêu đồng phân cấu tạo ? A. D. 4. to). (3) và (4). 6.4 gam C. (2) và (3). 36) (Đề thi HSG 2009-TB) Khi Crăckinh V lít butan được hỗn hợp A chỉ gồm các anken và ankan. (2). C.67% 37) (Đề thi HSG 2009-TB) Tiến hành trùng hợp 1mol etilen ở điều kiện thích hợp. CH3CH2CH=CHCH2CH3. B. Câu 6: Ba hiđrocacbon X. 5 nối đôi. D. D. 5.4 gam nước. cis-but-2-en. 85% và 23.5 % và 22. 50. CH2=CHCH2CH=CH2.7 gam D. B. ankan. 77. Hiệu suất của phản ứng Crăckinh butan là bao nhiêu? A. 2. Y. Z là đồng đẳng kế tiếp. Câu 13: Cho các chất sau: CH2=CHCH2CH2CH=CH2. . C.75. Câu 8: Vitamin A công thức phân tử C20H30O. Hiđro hóa hoàn toàn licopen được hiđrocacbon C40H82. 3-metylpent-2-en. isohexan. D. ankađien. B. 4. Tỉ khối hơi của hỗn hợp A so với H2 bằng 21. 4. CH2=CHCH=CHCH2CH3. Số liên kết đôi trong phân tử vitamin A là A. đem sản phẩm sau trùng hợp tác dụng với dung dịch brom thì lượng brom phản ứng là 36 gam. chỉ chứa liên kết đôi và liên kết đơn trong phân tử.3. (II). xiclobutan. B. 33. CH4 và C3H6 . Câu 10: Cho các chất sau: 2-metylbut-1-en (1). (IV). 1.33% C. D. Vậy công thức của anken và ankan lần lượt là: A. 2-metylbut-2-en. (IV). (3) và (4). 2-metylbut-2-en. 2. sau phản ứng thấy thoát ra 3.67% D. C2H5–C(CH3)=C(CH3)–C2H5 (IV). 2-clo-but-1-en.điclobut-2-en. (1) và (2). C. 4. B. CH4 và C2H4 B. Câu 4: Hợp chất C5H10 có bao nhiêu đồng phân anken ? A. CH3CH=CHCl (II). 2. B. B. but-1-en. Câu 14: Áp dụng quy tắc Maccopnhicop vào trường hợp nào sau đây ? A. 6. 4.3-đimetylbut-1-en (2). C2H6 và C2H4 C. 6. mạch hở. C. khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. C2H4. B. Những chất nào là đồng phân của nhau ? A. 3. Vậy licopen có A. D. CH3CH=CHCH3. CH3-CH2-CH2-CH2Br. CH3CH2C(CH3)=C(C2H5)CH(CH3)2. Số chất có đồng phân hình học là: A. but-1-en. (IV). C5H10. 3. CH3-CH2-CHBr-CH3.33% B. CH3C(CH3)=CHCH2CH3. (V). D. 2. C. 3. C.8 gam BÀI TẬP TRẮC NGHIỆM Câu 1: Anken X có công thức cấu tạo: CH3–CH2–C(CH3)=CH–CH3. 5. Phản ứng cộng của HX vào anken đối xứng. 2-metylpropen. D. (IV). Dẫn hỗn hợp đó qua dung dịch brom thấy dung dịch brom nhạt màu và khối lượng bình tăng 2.8 gam. Câu 3: Hợp chất C5H10 mạch hở có bao nhiêu đồng phân cấu tạo ? A. Tên của X là A. D.

CH3CH=CHCH3 và CH2=CHCH2CH3. B và khối lượng của hỗn hợp X là: A. Số mol etan và etilen trong hỗn hợp lần lượt là: A. 73. D. 25% và 75%. Câu 37: 2. 2-metylpropen và but-1-en (hoặc buten-1). C. D. B. B. Khi cho 6. 3. thấy khối lượng bình tăng thêm 7. 0. C.3.1 và 0. D. 2.544 gam CO2.1. Sau phản ứng thấy khối lượng bình brom tăng 22. 5 Câu 19: Có bao nhiêu anken ở thể khí (đkt) mà khi cho mỗi anken đó tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ? A. D. B. Hiđrat hóa A chỉ thu được một ancol duy nhất. 5. D. B. B. C3H8. CTPT của A. thể tích khí còn lại chỉ bằng 2/3 thể tích hỗn hợp X ban đầu. B. C5H8. B. C. 20% và 80%. Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau.1%. 40% và 60%. B. C.4 gam. 50%. D. C3H6 . CH2=CH2 và CH3CH=CHCH3. D. 3-etylpent-2-en. B.67%. Nếu cho hỗn hợp X đi qua bình đựng nước brom dư. X gồm 2 anken đồng đẳng kế tiếp nhau.05 mol hiđrocacbon X làm mất màu vừa đủ dung dịch chứa 8 gam brom cho ra sản phẩm có hàm lượng brom đạt 69. D. D. B. 2-metylbut-2-en và but-1-en. B.4 gam hỗn hợp X gồm but-1-en và but-2-en lội chậm qua bình đựng dung dịch Br 2. 70%. D.3 mol C3H6. C. B. 80%. Câu 36: Cho 3. CH2=CHCH2CH3.36 lít (đktc) hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp vào bình nước brom dư. CH2=CH2 và CH2=CHCH3. CH3CH=CHCH2CH3. Hai anken đó là A. D. Thành phần % về thể tích metan và olefin trong hỗn hợp X là: A. Tên gọi của X là: A. Câu 41: Hỗn hợp X gồm 2 anken là đồng đẳng liên tiếp có thể tích 4.1 mol C3H6.05. 0. 4.2 mol C3H6 và 0. 36 gam. C. 35% và 65%. B. 350 gam.3 mol C2H4 và 0. C3H6 . 4.8 gam. Câu 40: Dẫn 3. Câu 38: 0.33% và 66. Câu 35: Khối lượng etilen thu được khi đun nóng 230 gam rượu etylic với H2SO4 đậm đặc. Câu 45: Một hỗn hợp X gồm ankan A và một anken B có cùng số nguyên tử C và đều ở thể khí ở đktc.72 lít khí X (đktc) đi qua nước brom dư. 0. 196 gam.03. 50% C3H8và 50% C3H6 C. C3H8. Câu 44: Một hỗn hợp X gồm ankan A và anken B. Thành phần phần % về thể tích của hai anken là: A. D.2 mol C3H6.2 lít (đktc). C. hiệu suất phản ứng đạt 40% là: A. C. B và thành phần % theo thể tích của hỗn hợp X là A.8 gam. 56 gam. 2. 26. 24 gam. D. đốt cháy hoàn toàn khí này thu được 5. khối lượng bình brom tăng lên 2. còn khối lượng Y bằng 15/29 khối lượng X.4 mol C2H4 và 0. 84 gam.2-en. C4H8 và C5H10. Propilen.8 gam.9% và 26.3-dimetylbut-2-en. eten và but-2-en (hoặc buten-2). Câu 22: Hiđrat hóa hỗn hợp X gồm 2 anken thu được chỉ thu được 2 ancol. D. 0.2 mol C4H8. B. CTCT của X là: A. A và B đều ở thể khí (ở đktc).to) thu được tối đa bao nhiêu sản phẩm cộng ? A.12. Câu 39: Dẫn từ từ 8. 6. C. C4H10. Cho hỗn hợp X đi qua nước Br2 dư thì thể tích khí Y còn lại bằng nửa thể tích X. 48 gam.87%. Câu 42: Dẫn 3.7 gam. but . 36. A có tên là: A.7 gam. 2-metylpropen. C. C4H8. but-2-en. 50% C2H6 và 50% C2H4 Câu 46 : Hỗn hợp X gồm metan và 1 olefin. 12 gam. C. 50% C4H10 và 50% C4H8. Công thức phân tử của X là: A. D. B. 40%. 3. Xiclopropan.03 và 0. Câu 20: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu). B hoặc D.05 và 0.8 gam anken A làm mất màu vừa đủ dung dịch chứa 8 gam Br 2. 2. CH3CH=CHCH3.8 gam. thấy khối lượng bình tăng thêm 7.8 lít hỗn hợp X qua dung dịch brom dư thấy có 1 chất khí bay ra. (CH3)2C=CH2. B. C. xiclobutan.36 lít hỗn hợp etan và etilen (đktc) đi chậm qua qua dung dịch brom dư. Biết X có đồng phân hình học.36 lít (đktc) hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp vào bình nước brom dư. C. 0. m có giá trị là: A.C. Câu 48: a. C.8 gam.56%.2 mol C2H4 và 0. % thể tích của một trong 2 anken là: A. hex. 3-etylpent-1-en. A. 1. Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1. propen và but-2-en (hoặc buten-2). 0. C.6 gam. 3-etylpent-3-en. Câu 18: Cho hỗn hợp tất cả các đồng phân mạch hở của C 4H8 tác dụng với H2O (H+. D. X gồm A. 11. C2H4 .4 gam.2-en. C5H10. khối lượng bình tăng lên 9. 0.8 gam. C3H6 và C4H8. etilen.13% và 73. thu được chất hữu cơ Y (chứa 74. D. khi kết thúc phản ứng thấy có m gam brom phản ứng. C5H10 và C6H12. 40% C2H6 và 60% C2H4.12 và 0.5% và 63. 0.08% Br về khối lượng). Câu 47: Cho 8960 ml (đktc) anken X qua dung dịch brom dư. C2H4 và C3H6.48 lít (ở đktc). 33. A có nhiều hơn B một nguyên tử cacbon. eten và but-1-en (hoặc buten-1). C2H4 .đimetylpent-1-en. C3H6. . B.5%. Khi cho X qua nước Br 2 dư thấy khối lượng bình Br2 tăng 15. cis -but-2-en và xiclobutan. Xác định CTPT và số mol mỗi anken trong hỗn hợp X. C. C. Câu 21: Anken thích hợp để điều chế ancol sau đây (CH3 CH2)3C-OH là A. 5. C4H10. Sau phản ứng khối lượng bình brom tăng thêm 2. 12. D. D. Cho 10. CTPT A. B. D. B. C. CTPT của 2 anken là: A. Câu 43: Một hỗn hợp X có thể tích 11. but-1-en.

C. C4H8. C3H6. CH2=CH-CH=CH2. cis-but-2-en. Cho Y qua dung dịch H2SO4 đặc. C.1 mol C2H4 và 0.688 lít khí bay ra (đktc). số mol Br2 giảm đi một nửa và khối lượng bình tăng thêm 6. CTPT của 2 anken là: A. cho cùng một sản phẩm là: A. Câu 52: Cho buta-1. 4. C4H8. B. thu được hỗn hợp khí Z có tỉ khối đối với hiđro bằng 19. D. B. thấy khối lượng bình tăng thêm 7. C3H6 và C5H10. 0. 2.3-etylpent-3-en.2 mol C2H4 và 0. 0. C5H10. B. B. 3. Câu 63: Chất nào sau đây có đồng phân hình học? A.b. D. C = 12) A. C. O = 16.3-đien phản ứng cộng với Br2 theo tỉ lệ mol 1:1. Câu 66: Cho các chất: CH2=CH−CH=CH2. CTPT của anken là: A. Câu 49: Hỗn hợp X gồm metan và anken. D.7 gam. C = 12. C. Hiđrocacbon X cộng HCl theo tỉ lệ mol 1:1 tạo sản phẩm có hàm lượng clo là 55. C4H8 và C5H10. xiclobutan. 3. D.06 gam hỗn hợp Z sau đó hấp thụ toàn bộ sản phẩm cháy vào 2 lít dung dịch NaOH 0.5M. Câu 61: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu).4 gam và thể tích 6. B.2 mol C3H6 và 0. 0. Hỗn hợp X có khối lượng A. 4. CH4. 2. D. C2H2 và C3H8. CH2=CH-CH=CH-CH2-CH3. C.20%. 1. D. C. Công thức phân tử của 2 hiđrocacbon là (cho H = 1. Đốt cháy hoàn toàn hỗn hợp trên thu được hỗn hợp khí Y. C2H4 và C5H10. trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC. C. X có công thức phân tử là: A. B. Tỉ khối của X so với khí hiđro là A. CH3−CH=CH2. D. C.1 mol C2H2. C. D. công thức phân tử của M và N lần lượt là A.6 oC. C3H6. D.3. C. C2H2 và C4H8.0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất). B. B. Câu 67: Đốt cháy hoàn toàn 20. Hiệu suất của phản ứng hiđro hoá là A.6 lít X qua dung dịch brom dư thấy khối lượng bình brom tăng 7. Hai anken đó là A. thu được số gam kết tủa là (cho H = 1.8 gam. 5. CH3−CH2−CH=C(CH3)2.2. CH3-C(CH3)=CH-CH3. Số chất có đồng phân hình học là A.75. Dẫn X qua Ni nung nóng. Đốt cháy 0. 4.96% clo về khối lượng. C = 12. Công thức phân tử của X là (cho H = 1.1 mol chất Y. D.1. D. 2-metylpropen. D. cis-but-2-en và xiclobutan. CH2=CH-CH2-CH=CH2. CO (thể tích CO gấp hai lần thể tích CH 4). 0. B. C3H6 và C4H8. 4. Câu 56: Cho iso-pentan tác dụng với Cl2 theo tỉ lệ số mol 1 : 1. C2H4.2.223%.2 mol C2H2.1 mol C3H6 và 0. cis-but-2-en và but-1-en. Số chất có đồng phân hình học là A. trong đó khối lượng phân tử Z gấp đôi khối lượng phân tử X. Câu 51: Cho 10 lít hỗn hợp khí (54.C3H6. 6. Cl = 35. Câu 68: Cho hỗn hợp hai anken đồng đẳng kế tiếp nhau tác dụng với nước (có H2SO4 làm xúc tác) thu được hỗn hợp Z gồm hai rượu (ancol) X và Y. xiclobutan. eten và but-2-en (hoặc buten-2). C = 12. D. C. C.12. 40. C3H4. cho 5. Đốt cháy hoàn toàn 1. D. C. A hoặc B.8.5) A. C4H8. Câu 55: Cho các chất sau: CH2=CH-CH2-CH2-CH=CH2. Giá trị của k là (cho H = 1. B. 2-etylpent-2-en. B. thu được 24. thu được hỗn hợp khí Y có tỉ khối so với He là 5. 30. xúc tác Ni. CTPT của 2 anken là (Biết số C trong các anken không vượt quá 5) A.36 lít (đktc) hỗn hợp X gồm 2 anken là vào bình nước brom dư. A hoặc B. B. 40%. C = 12. Câu 53: Anken X hợp nước tạo thành 3-etylpentan-3-ol. B. propen và but-2-en (hoặc buten-2). C2H4 và C4H8. Cl = 35. C2H4. eten và but-1-en (hoặc buten-1). B. 50%.12. but-1-en. C2H4 Câu 50: Dẫn 3.48 lít hỗn hợp X (ở đktc) gồm 2 hiđrocacbon mạch hở lội từ từ qua bình chứa 1. Số mol. sản phẩm khí hấp thụ hoàn toàn vào dung dịch Ca(OH)2 (dư).7 gam. B. C. D. 1. 3-etylpent-2-en. C3H4 và C4H8.28 gam và có 2. but-1-en. 1. C4H8 và C5H10. D. B. C4H8. B. 2-metylpropen và but-1-en (hoặc buten-1). Câu 62: Hỗn hợp gồm hiđrocacbon X và oxi có tỉ lệ số mol tương ứng là 1:10. CH3-CH=C(CH3)2. 3. C. 2-metylpropen và cis-but-2-en. 11. C.04%. Câu 64: Hỗn hợp khí X gồm H2 và C2H4 có tỉ khối so với He là 3. 3-etylpent-1-en. C. Z kế tiếp nhau trong dãy đồng đẳng. D.C2H2 và C4H6. 25%.0 ml hỗn hợp X gồm C3H6. CH3−CH=CH−COOH. Dãy gồm các chất sau khi phản ứng với H 2 (dư. 2-metylpropen. Câu 57: Cho 4. 2-metylbut-2-en. C3H6.1M thu . Câu 58: Clo hoá PVC thu được một polime chứa 63. Số dẫn xuất đibrom (đồng phân cấu tạo và đồng phân hình học) thu được là A. C5H10.C3H8. 10. D. to). D. Tên của X là A. Câu 59: Ba hiđrocacbon X. Sau khi phản ứng hoàn toàn. 0. D. Câu 54: Hỗn hợp khí X gồm anken M và ankin N có cùng số nguyên tử cacbon trong phân tử. Ca = 40) A. 5. B.1 mol C3H4. 25. O = 16) A.72 lít (ở đktc). 22.5) A. CH3−CH=CH−CH=CH2.4 lít dung dịch Br 2 0. B. B.2.9.20.4. C3H4. C. C. số sản phẩm monoclo tối đa thu được là A. Câu 60: Một hiđrocacbon X cộng hợp với axit HCl theo tỉ lệ mol 1:1 tạo sản phẩm có thành phần khối lượng clo l 45. Câu 65: Cho các chất: xiclobutan. 3. 2-metylbut-2-en và but-1-en. C. Y.2 mol C3H4.8064 atm) gồm 2 olefin lội qua bình dung dịch brom dư thấy khối lượng bình brom tăng 16. CH2=CH-CH2-CH3. Công thức phân tử của X là (cho H = 1. CH3-CH=CH-CH=CH2.

7. 50%.5 lít O 2 (các thể tích khí đo trong cùng điều kiện nhiệt độ.88%. . 4.08% Br về khối lượng). B. D. Hiệu suất của phản ứng hiđro hóa là A. 7. C2H6 và C2H4.68 lít hỗn hợp khí X gồm hai hiđrocacbon vào bình đựng dung dịch brom (dư). 70%. thu được chất hữu cơ Y (chứa 74. C. 60%. ankin. Câu 72: Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1. 9. D. Nếu đốt cháy hoàn toàn 1. D.27. C. khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. 5. C2H5OH và C3H7OH. CH4 và C3H6. Công thức cấu tạo thu gọn của X và Y là (Cho: H = 1. Câu 78: Hiđrat hóa 2-metylbut-2-en (điều kiện nhiệt độ. 2-metylbutan-3-ol. CH4 và C2H4.58%. Dẫn X qua Ni nung nóng.5.được dung dịch T trong đó nồngđộ của NaOH bằng 0. B. 5. B. C.48 lít X. Các chất X.68 lít X thì sinh ra 2. Đốt cháy hoàn toàn 4. C. Tổng hệ số (nguyên. CH4 và C3H6. thể tích dung dịch thay đổi không đáng kể) A. có 4 gam brom đã phản ứng và còn lại 1. xúc tác thích hợp) thu được sản phẩm chính là A. thu được 6. 10. CH4 và C3H4. Số công thức cấu tạo có thể có của X là A. Sau khi phản ứng xảy ra hoàn toàn. D. Z thuộc dãy đồng đẳng A. 80%. C. D. xiclopropan. C.8. Y. 31. D. 24. C3H7OH và C4H9OH. C.5. áp suất). D. B. Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau. C. anken.89%. D. B. Câu 71: Hỗn hợp khí X gồm một ankan và một anken. B.8 lít khí CO 2. Công thức của ankan và anken lần lượt là A.05M. D. Câu 70: Số đồng phân cấu tạo của C5H10 phản ứng được với dung dịch brom là A. 7. B.12 lít khí. B. Câu 75: Hiđro hóa hoàn toàn hiđrocacbon mạch hở X thu được isopentan. D.43%. Tỉ khối của X so với H2 bằng 11. Phần trăm khối lượng của ancol bậc một (có số nguyên tử cacbon lớn hơn) trong Y là A. O = 16.25.72 lít CO2 (các thể tích khí đo ở đktc). ankan. 3-metylbutan-1-ol. propilen. Công thức phân tử của hai hiđrocacbon là (biết các thể tích khí đều đo ở đktc) A. 6. 31. B. but-2-en. D.CH4 và C2H4. C4H9OH và C5H11OH. tối giản) tất cả các chất trong phương trình hoá học của phản ứng trên là A. B. 2-metylbutan-2-ol. 46. but-1-en. C. Câu 73: Dẫn 1. ankađien. trong đó khối lượng ancol bậc hai bằng 6/13 lần tổng khối lượng các ancol bậc một. 34. thu được hỗn hợp Y có tỉ khối so với H2 là 12. CH4 và C4H8. Hiđrat hóa hoàn toàn X trong điều kiện thích hợp thu được hỗn hợp ancol Y. C2H5OH và C4H9OH. 3-metylbutan-2-ol. C = 12. B. Câu 76: Đốt cháy hoàn toàn 3 lít hỗn hợp X gồm 2 anken kế tiếp nhau trong dãy đồng đẳng cần vừa đủ 10. C. C2H6 và C3H6 Câu 74: Ba hiđrocacbon X. Y. Câu 69: Cho phản ứng: C6H5-CH=CH2 + KMnO4 → C6H5-COOK + K2CO3 + MnO2 + KOH + H2O. Câu 77: Hỗn hợp X gồm H2 và C2H4 có tỉ khối so với H2 là 7. C. Z là đồng đẳng kế tiếp. Tên gọi của X là A.