BÀI TẬP VỀ ANKEN

1) Khi đốt cháy một thể tích hiđrocacbon A có liên kết đôi trong phân tử cần 6 thể tích oxi và sinh ra 4 thể tích CO 2(Các thể tích khí đo cùng điều kiện) Biết rằng A có thể tác dụng với hiđro tạo thành một hiđrocacbon no mạch nhánh. Xác định công thức cấu tạo của A và viết các phương trình phản ứng. 2) Cho 3,36 lít hỗn hợp gồm một anken và một ankan đi qua dung dịch brom thấy có 8g brom tham gia phản ứng. Biết rằng khối lượng 6,72 lít hỗn hợp là 13gam. a. Xác định công thức phân tử của hai hydrocacbon. b. Đốt cháy 3,36 lít hỗn hợp đó thì được bao nhiêu lít khí CO2 và bao nhiêu gam nước. Biết rằng các khí đo ở đktc. 3) Cho 1gam hỗn hợp etan và etilen đi qua dung dịch brom. a. Viết phản ứng xảy ra. b. Xác định thành phần khối lượng của hỗn hợp, biết rằng cho phản ứng xảy ra hoàn toàn là phải dùng hết 80g dung dịch brom 5%. 4) Để hiđro hóa hoàn toàn 0,7gam một anken cần dùng 246,4cm 3 hiđro (ở 27,3oC và 1 atm). Xác định công thức phân tử. Viết công thức cấu tạo, biết rằng anken có cấu tạo mạch không nhánh 5) Cho 2,24 lít một hỗn hợp khí A (đktc) gồm etan, propan, propilen dẫn qua dung dịch brom dư, thấy khối lượng bình tăng thêm 2,1gam. Nếu đốt cháy khí còn lại thu được một lượng CO2 và 3,24 gam H2O. a. Tính thành phần % thể tích mỗi khí. b. Dẫn lượng CO2 nói trên vào bình đựng 200ml dung dịch KOH 2,6 M. Hãy xác định nồng độ mol các chất trong dung dịch sau phản ứng. 6) Một hỗn hợp X gồm ankan A và anken B, số nguyên tử hiđro trong phân tử A bằng số nguyên tử cacbon trong B. Khi đốt cháy 3gam hỗn hợp X thì thu được 5,4 gam nước. Xác định công thức phân tử A, B và tính % thể tích các khí trong hỗn hợp A. 7) Một hỗn hợp gồm H2, một ankan và một anken ( có cùng số nguyên tử cacbon với ankan). Khi đốt 100 ml hỗn hợp thu được 210 ml khí CO2. Mặt khác khi nung nóng 100ml hỗn hợp với Ni thì sau phản ứng còn lại 70ml một hiđrocacbon duy nhất. a. Tìm công thức phân tử của ankan và anken. b. Định % thể tích của ankan và anken. c. Tính thể tích O2 cần để đốt cháy 10ml hỗn hợp (Các khí đo ở cùng điều kiện) 8) Cho hỗn hợp X gồm anken và hiđro có tỉ khối so với heli bằng 3,33. Cho X đi qua bột niken nung nóng đến khi phản ứng xảy ra hoàn toàn thu được hỗn hợp Y có tỉ khối so với heli là 4. Tìm công thức phân tử của anken. 9) Cho hỗn hợp khí A gồm 2 anken. Để đốt cháy hoàn toàn 7 thể tích A cần 31 thể tích oxi ở cùng điều kiện. a. Xác định công thức phân tử 2 anken. Biết rằng olefin nhiều cacbon chiếm tỉ lệ trong khoảng từ 40 đến 50% thể tích của A. b. Tìm % khối lượng các anken trong A. 10) Cho hỗn hợp H2 và etilen có tỉ khối hơi so với hiđro là 7,5. a. Tính thành phần % thể tích khí trong hỗn hợp. b. Cho hỗn hợp trên vào bình kín có bột niken nung nóng làm xúc tác thì sau phản ứng thu được một hỗn hợp khí có tỉ khối so với H2 là 9. Xác định thành phần % hỡn hợp khí sau phản ứng. 11) Đốt cháy hoàn toàn 0,25 mol khí A thu được 33g CO2 và 13,5g hơi nước. a. Tìm công thức phân tử và công thứ cấu tạo của A, biết rằng ở (đktc) khối lượng riêng của A là 1,875g/l. b. Tính khối lượng sản phẩm tạo thành khi cho lượng chất A trên qua dung dịch brom dư. 12) Hai hiđrocacbon A và B đều ở thể khí, A có công thức C2xHy; B có công thức CxH2x (trị số x trong cả 2 công thức là bằng nhau). a. Lập công thức phân tử A và B. Biết rằng tỉ khối của A đối với metan bằng 3,625 và tỉ khối của B đối với He là 7. Viết công thức cấu tạo của A và B. b. Tính lượng sản phẩm thu được khi cho hỗn hợp trên tác dụng vừa đủ với 16g dung dịch brom. 13) Đốt cháy hoàn toàn 0,03696 lít anken X ở 27,3oC và 1 atm, thu toàn bộ khí CO2 vào dung dịch KOH ta được 0,3g muối axit và 0,207g muối trung tính. Xác định công thức phân tử và công thức cấu tạo của X. 14) A và B là hai anken đồng đẳng liên tiếp nhau. Cho 13,44 lít hỗn hợp hai anken A và B (đktc) qua bình đựng dung dịch brom thấy bình tăng thêm 28g. a. Xác định công thức phân tử, viết công thức cấu tạo hai anken. b. Cho hỗn hợp anken tác dụng với HCl thì thu được tối đa 3 sản phẩm cộng. Xác định công thức cấu tạo hai anken và gọi tên chúng. 15) Một hỗn hợp hai anken đồng đẳng kế tiếp nhau có thể tích 17,92 lít (đo ở 0 oC và 2,5 atm) dẫn qua bình chứa dung dịch KMnO4 dư, thấy khối lượng b́nh chứa dung dịch KMnO4 tăng 70g. a. Xác định công thức phân tử, viết công thức cấu tạo hai olefin. b. Tính % khối lượng 2 anken trong hỗn hợp. c. Đốt cháy hoàn toàn thể tích trên của hỗn hợp rối cho sản phẩm vào 5 lít dung dịch NaOH 1,8M sẽ thu được bao nhiêu gam muối khan? 16) Cho 10 lít hỗn hợp khí (54,6oC; 0,8064 atm) gồm 2 anken lội qua bình dung dịch brom dư thấy khối lượng bình brom tăng 16,8g. a. Tính tổng số mol 2 anken b. Xác định công thức phân tử 2 anken, biết số nguyên tử cacbon trong mỗi olefin không quá 5. 17) Hỗn hợp A và B là hai anken có khối lượng 12,6g trộn theo tỉ lệ mol là 1:1 tác dụng vừa đủ với 32g brom. Nếu trộn hỗn hợp trên theo tỉ lệ khối lượng là 1:1 thì 16,8g hỗn hợp tác dụng vừa đủ với 0,6g H2. Tìm công thức phân tử của A và B, biết MA < MB. 18) Cho H2 và 1 anken có thể tích bằng nhau qua Ni nung nóng thu được hỗn hợp A. Biết rằng tỉ khối hơi của A đối với H 2 là 23,2. Hiệu suất phản ứng hydro hóa là 75%. a. Tìm công thức và gọi tên anken. b. Đốt V lít (đktc) hỗn hợp A nói trên rồi cho toàn bộ sản phẩm cháy qua 128g dung dịch H 2SO4 98% sau thí nghiệm nồng độ dung dịch H2SO4 là 62,72%. Tính V

Tính a? b.72 lít O 2 (đktc). A và B đều phản ứng với dung dịch Br 2). Tính tỉ khối của hỗn hợp Y đối với O2. thu được 6. được hỗn hợp B có dB/H2 = 4.8.96 lít hỗn hợp X tác dụng hết với nước brom cần tối thiểu 64g brom. a. b. a. Phát biểu nào sau đây đúng: A. 30) Đốt cháy hoàn toàn 4 lít hh 2 hiđrocacbon A. Sau khi phản ứng xảy ra hoàn toàn nồng độ dung dịch brom giảm đi 50%. CO (thể tích CO gấp hai lần thể tíchCH4).14g. 8. Số mol A . anken.12 lít(đktc) hỗn hợp X gồm H 2. B chứa 85. Hãy xác định công thức cấu tạo của A 20) Đốt cháy hoàn toàn a gam chất hữu cơ A cần dùng 6. Cho Y qua dung dịch brom thấy có 0. Công thức của ankan và anken lần lượt là A. c. biết A cộng với H2O cho 1 sản phẩm duy nhất. C2H6. a.0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất). ankan.68 lít khí còn lại đem đốt cháy thu được 4.5. Hiệu suất phản ứng cracking. 50% 34) (ĐH 2009-KB) Hỗn hợp khí X gồm H2 và một anken có khả năng cộng HBr cho sản phẩm hữu cơ duy nhất. đem đốt 8. b. sau khi phản ứng xảy ra hoàn toàn. CH4. CTPT của ankan va anken là: A. C3H4 C.48 lít X. Tính hiệu suất phản ứng hiđro hóa. Các thể tích đo đktc. Công thức cấutạo của anken là A. C2H6 và C2H4. CH4 và C3H6. Tìm công thức đơn giản nhất của A. C. a. CH2=CH-CH2-CH3. C2H6 và C2H4 B. a.8g Br2 tham gia phản ứng. b.44 lít.4g và khối lượng H2O sinh ra từ B lớn hơn A 12. 66.B thu được 6 lít CO 2 và 6 lít hơi H2O (các thể tích đo ở cùng điều kiện t 0. Đốt cháy hoàn toàn 4.8g chất hữu cơ A thu được 8.575.71% C. 25) Cho hỗn hợp A gồm C2H4 và H2 qua Ni. Tỉ khối của X so với H2 bằng 11. Tính khối lượng các chất trong A. CH4 và C4H8 32) Hỗn hợp A gồm H2 và 2 hiđrcacbon (một ankan. 23) Sau khi cracking butan ta thu được 1 hỗn hợp A các hiđrocacbon. CH3-CH=CH-CH3 . Khối lượng bình brom tăng hay giảm bao nhiêu? c. 22. a. Cho hỗn hợp X qua bột Ni nóng ta được hỗn hợp khí Y.6 gam. 12. C. p) .C2H2 B. Khi cho 560 ml hỗn hợp X đi qua bình brom thấy 16g dung dịch Br2 5% mất màu đồng thời lượng bình tăng thêm 0. B.0 ml hỗn hợp X gồm C3H6.Tỉ khối của X so với H2 bằng 9.9.Công thức phân tử của A.72 lít CO2 (các thể tích khí đo ở đktc). D. biết tỉ khối hơi của A so với nitơ là 2. Viết tất cả công thức cấu tạo đồng phân mạch hở của 2 anken và cho biết công thức cấu tạo nào khi cộng nước cho 1 sản phẩm duy nhất 22) Có 1. b.14 gam. C3H8 và C3H6 C. B.5.0. thuđược hỗn hợp khí Y không làm mất màu nước brom. CH2 =C(CH3)2.7% C. Xác định công thức phân tử ankan. tỉ khối của Y so với H2 bằng 13. B.25. C5H12 và C5H10 29) Đốt cháy hoàn toàn 20.5M tối thiểu cần dùng. 24) Hỗn hợp X gồm 2 hydrocacbon A và B (B có số cacbon lớn hơn A. a. CH4. Đốt cháy hoàn toàn m gam hh X thu được 13. Xác định 2 anken trên và % m từng chất trong hỗn hợp ban đầu.11% brom. Tỉ khối hơi của A so với không khí là 1. B.32g H2O. 25.4M. C2H2 D. 27) Một hỗn hợp khí X chứa 0. C. Lập công thức phân tử của A. Tính % các khí trong hỗn hợp A theo thể tích.15 mol H 2 và 0. 28) Hỗn hợp X gồm 1 ankan và 1 anken có cùng số nguyên tử cacbon trong phân tử và có cùng số mol. CH4 và C2H4. B. 11. Sản phẩm cháy lần lượt qua bình P 2O5 thấy bình tăng 3. 33. Tỉ khối của X so với khí hiđro là A.1. C đều đúng 33) Hỗn hợp khí A chứa etilen và hiđro.số mol B = số mol H2 tham gia phản ứng. Tỉ khối của A đối với hiđro là 7. D. 25% D. Tính thể tích dung dịch brom 0. Sô mol CO2 và H2O tạo ra khi đôt cháy hoàn toàn A bằng sô mol CO2 và H2O tạo ra khi đôt cháy hoàn toàn B D. Tổng sô mol hiđrocacbon có trong B luôn bằng tổng sô mol hiđrocacbon có trong A C. Cho A tác dụng với dung dịch Br2 được sản phẩm cộng B. Viết công thức cấu tạo có thể có. đun nóng bình một thời gian thu được hỗn hợp B. Đun nóng X có xúc tác Ni. CH2 =CH2 .4 lít hỗn hợp qua bình đựng dung dịch brom thì còn lại 13.19) Một hiđrocacbon A chứa 85. 26) Đốt cháy hoàn toàn 4. suy ra công thức đúng của A. b. Các phản ứng xảy ra hoàn toàn. thu được 24. b.38.064 lít CO 2 (đktc) và 4.C4H6 31) Hỗn hợp khí X gồm một ankan và một anken.2. Từ B viết phương trình phản ứng điều chế A. B. D. tỉ khối hơi của X đối với oxi là 0. Lấy 1.44 lít CO 2 (đktc). Cả A. CH4. Lập công thức thực nghiệm rồi suy ra công thức phân tử của A.6 gam rồi qua bình nước vôi trong dư thấy xuất hiện 20 gam kết tủa trắng. Xác định thành phần % của hỗn hợp ban đầu theo thể tích. Hiệu suất phản ứng cộng hiđro của etilen là: A.1 mol C2H4. a. anken (ankan và anken cùng số nguyên tử cacbon). C4H10 và C4H8 D.96 lít hỗn hợp X tổng số CO 2 thu được là 48. Mặt khác.3% B.06 lít CO2. Dẫn A đi qua chất xuc tác Ni nung nóng thì thu được hỗn hợp khí B có tỉ khối đối với hiđro là 9.8g hỗn hợp hai anken liên tiếp trong dãy đồng đẳng tác dụng với 1 lít dung dịch brom 0. một anken). b. Xác định công thức phân tử của A. Cho 22. Nếu cho A qua dung dịch Br2 dư thì khối lượng bình brom tăng 0. Cho A vào bình kín có niken làm xúc tác.1. C2H6 . Biết m gam hỗn hợp X làm mất màu vừa đủ 80 gam dung dịch Br2 20%.B là: A. 21) Cho 9.

33. đem sản phẩm sau trùng hợp tác dụng với dung dịch brom thì lượng brom phản ứng là 36 gam. C. Câu 16: Anken C4H8 có bao nhiêu đồng phân khi tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ? A. (1) và (2). Câu 3: Hợp chất C5H10 mạch hở có bao nhiêu đồng phân cấu tạo ? A. xúc tác Ni. Dẫn hỗn hợp đó qua dung dịch brom thấy dung dịch brom nhạt màu và khối lượng bình tăng 2. III. Câu 10: Cho các chất sau: 2-metylbut-1-en (1).7 gam D.3-đimetylbut-1-en (2). isohexan. D. 7. B. 4. Đốt cháy hoàn toàn hỗn hợp khí bay ra thu được 8. CH3CH2C(CH3)=C(C2H5)CH(CH3)2.3. CH2Br-CH2-CH2-CH2Br . Phản ứng cộng của HX vào anken đối xứng. (I).36 lit một hỗn hợp khí (đktc). (2). Vậy công thức của anken và ankan lần lượt là: A. C. C2H5–C(CH3)=C(CH3)–C2H5 (IV). 13 nối đôi. (IV). 2-metylbut-2-en. D. 6. ankin. Câu 14: Áp dụng quy tắc Maccopnhicop vào trường hợp nào sau đây ? A. CH3C(CH3)=CHCH2. Phản ứng cộng của Br2 với anken đối xứng. (V). 4. CTPT của X là A. Câu 2: Số đồng phân của C4H8 là A. CH3CH=CHCl (II). (V). B.8 gam B. CH3C(CH3)=CHCH2CH3. Câu 9: Licopen. 5. D. 4. (3) và (4).33% B. (V). 50. CH2=CHCH2CH=CH2.4 gam C. B. 2-metylpropen và cis-but-2-en. D.5 % và 22. D. D. cis-but-2-en. B. D. B. Hiđro hóa hoàn toàn licopen được hiđrocacbon C40H82. D. 7. but-1-en. (IV). 4.33% C. D.8 gam BÀI TẬP TRẮC NGHIỆM Câu 1: Anken X có công thức cấu tạo: CH3–CH2–C(CH3)=CH–CH3. CH3-CH2-CHBr-CH3.67% D. 5. công thức phân tử C40H56 là chất màu đỏ trong quả cà chua. 3. Hiệu suất phản ứng trùng hợp và khối lượng poli etilen (PE) thu được là A. B. C3H6. C. 77. Y. C4H8. C. ankađien. Câu 7: Anken X có đặc điểm: Trong phân tử có 8 liên kết xích ma. D. D. (2) và (3).điclobut-2-en. 2. 6. 3-metylpent-1-en (3).đimetylpent-2-en. 2-metylbut-2-en. C2H5–C(CH3)=CCl–CH3 (V). 2. Vậy licopen có A. 1. CH4 và C2H4 B. B. B.8 gam CO2 và 5. D. C. 3-metylpent-2-en. (3) và (4). xiclobutan. C2H6 và C3H6 D.8 gam. C. CH3CH2CH=CHCH2CH3. C. B. Phản ứng trùng hợp của anken. Những chất nào là đồng phân của nhau ? A. 5. 46. Tỉ khối hơi của hỗn hợp A so với H2 bằng 21. 1 vòng. Câu 11: Hợp chất nào sau đây có đồng phân hình học ? A. chỉ chứa liên kết đôi và liên kết đơn trong phân tử. (III). CH3-CH2-CHBr-CH2Br. C. D. B. 70% và 23. 5 nối đôi. 3-metylpent-3-en. Hiệu suất của phản ứng Crăckinh butan là bao nhiêu? A. 2-etylbut-2-en. 4. Số liên kết đôi trong phân tử vitamin A là A. 6. (II). 5. (1). cis-but-2-en và but-1-en. B. C. khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. Câu 8: Vitamin A công thức phân tử C20H30O. B. 2. B. 1. C. Phản ứng cộng của HX vào anken bất đối xứng. 10. sau phản ứng thấy thoát ra 3. C. Các chất X. 3-metylpent-2-en (4). 4. 3. C2H4. 6. 4. có chứa 1 vòng 6 cạnh và không có chứa liên kết ba. Câu 13: Cho các chất sau: CH2=CHCH2CH2CH=CH2. ankan. 36) (Đề thi HSG 2009-TB) Khi Crăckinh V lít butan được hỗn hợp A chỉ gồm các anken và ankan. CH2=CHCH=CHCH2CH3. 5 nối đôi.4 gam nước. cho cùng một sản phẩm là: A. (IV). Y. A. C. C2H6 và C2H4 C.67% 37) (Đề thi HSG 2009-TB) Tiến hành trùng hợp 1mol etilen ở điều kiện thích hợp. Câu 12: Những hợp chất nào sau đây có đồng phân hình học (cis-trans) ? CH3CH=CH2 (I). Câu 15: Khi cho but-1-en tác dụng với dung dịch HBr. D. 6. B. D. Tên của X là A. C. Số chất có đồng phân hình học là: A. CH4 và C3H6 .35) Một hỗn hợp gồm 1 ankan và 1 anken. B. 2. C5H10. 1 vòng. (IV). C. mạch hở. C. 77. 2-metylpropen. 3. 10.3. CH3CH=CHCH3. theo qui tắc Maccopnhicop sản phẩm nào sau đây là sản phẩm chính A. CH3-CH2-CH2-CH2Br. 85% và 23. CH3CH=C(CH3)2 (III). (II). Z là đồng đẳng kế tiếp. Dãy gồm các chất sau khi phản ứng với H2 (dư. D. 4 vòng. Câu 4: Hợp chất C5H10 có bao nhiêu đồng phân anken ? A.5% và 21. anken. B. Z thuộc dãy đồng đẳng A. but-1-en. C. 5. Câu 17: Cho các chất: xiclobutan.75. 12 nối đôi. 66. 2-clo-but-1-en. 3. . Câu 6: Ba hiđrocacbon X. Câu 5: Hợp chất C5H10 có bao nhiêu đồng phân cấu tạo ? A. B. to).

4. thể tích khí còn lại chỉ bằng 2/3 thể tích hỗn hợp X ban đầu. 70%.67%. Câu 39: Dẫn từ từ 8. 0.1 và 0. 5. D. 196 gam. C. C. 12. etilen. Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau. 2-metylbut-2-en và but-1-en. Câu 22: Hiđrat hóa hỗn hợp X gồm 2 anken thu được chỉ thu được 2 ancol. propen và but-2-en (hoặc buten-2).to) thu được tối đa bao nhiêu sản phẩm cộng ? A. C3H6 và C4H8.03 và 0. 2. 50% C3H8và 50% C3H6 C. Câu 42: Dẫn 3. B. m có giá trị là: A. D. C4H8 và C5H10. C. Hiđrat hóa A chỉ thu được một ancol duy nhất. Câu 36: Cho 3.56%. khối lượng bình brom tăng lên 2.33% và 66. D. Câu 21: Anken thích hợp để điều chế ancol sau đây (CH3 CH2)3C-OH là A.8 gam. D. 25% và 75%. C3H8. D. D. Sau phản ứng thấy khối lượng bình brom tăng 22. Xác định CTPT và số mol mỗi anken trong hỗn hợp X. 3. eten và but-1-en (hoặc buten-1). Tên gọi của X là: A. 73. CH3CH=CHCH3 và CH2=CHCH2CH3. CH2=CHCH2CH3. khối lượng bình tăng lên 9. C4H10. 0. khi kết thúc phản ứng thấy có m gam brom phản ứng. Hai anken đó là A.2 lít (đktc). C2H4 . Câu 48: a. 0. thu được chất hữu cơ Y (chứa 74. Câu 43: Một hỗn hợp X có thể tích 11. 2-metylpropen và but-1-en (hoặc buten-1). Thành phần phần % về thể tích của hai anken là: A. 84 gam.36 lít hỗn hợp etan và etilen (đktc) đi chậm qua qua dung dịch brom dư. D. Câu 47: Cho 8960 ml (đktc) anken X qua dung dịch brom dư. B và khối lượng của hỗn hợp X là: A. D.8 gam. hex.1%. 0.03. X gồm 2 anken đồng đẳng kế tiếp nhau. D. Công thức phân tử của X là: A. 3-etylpent-1-en.đimetylpent-1-en. 5 Câu 19: Có bao nhiêu anken ở thể khí (đkt) mà khi cho mỗi anken đó tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ? A.544 gam CO2.2 mol C2H4 và 0. D.2-en. thấy khối lượng bình tăng thêm 7.08% Br về khối lượng). CH2=CH2 và CH3CH=CHCH3. C. Câu 20: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu). Câu 41: Hỗn hợp X gồm 2 anken là đồng đẳng liên tiếp có thể tích 4. C4H10.7 gam. 0. CTPT của A. B. C3H6 .2 mol C3H6 và 0. C. CTCT của X là: A. D.12 và 0. thấy khối lượng bình tăng thêm 7.4 gam hỗn hợp X gồm but-1-en và but-2-en lội chậm qua bình đựng dung dịch Br 2. D. A có nhiều hơn B một nguyên tử cacbon.12.8 gam. A và B đều ở thể khí (ở đktc). Câu 35: Khối lượng etilen thu được khi đun nóng 230 gam rượu etylic với H2SO4 đậm đặc. 24 gam. C. 6. C3H6.6 gam. 48 gam. 2.2-en. D.13% và 73. 0.5% và 63. 12 gam. 3-etylpent-3-en. CH2=CH2 và CH2=CHCH3. 50% C4H10 và 50% C4H8. B hoặc D. 0. Thành phần % về thể tích metan và olefin trong hỗn hợp X là: A. Câu 38: 0. X gồm A. C.4 mol C2H4 và 0. Xiclopropan. Cho 10. xiclobutan. Cho hỗn hợp X đi qua nước Br2 dư thì thể tích khí Y còn lại bằng nửa thể tích X. B. % thể tích của một trong 2 anken là: A.5%. 56 gam.8 gam. D. B. C. Câu 45: Một hỗn hợp X gồm ankan A và một anken B có cùng số nguyên tử C và đều ở thể khí ở đktc.7 gam. 40% và 60%.8 gam. B.36 lít (đktc) hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp vào bình nước brom dư. B. C. D. B. Câu 18: Cho hỗn hợp tất cả các đồng phân mạch hở của C 4H8 tác dụng với H2O (H+. 50% C2H6 và 50% C2H4 Câu 46 : Hỗn hợp X gồm metan và 1 olefin. C2H4 và C3H6. 5. 1. còn khối lượng Y bằng 15/29 khối lượng X. B. B. C. A có tên là: A. D.05 và 0. 11.8 lít hỗn hợp X qua dung dịch brom dư thấy có 1 chất khí bay ra. đốt cháy hoàn toàn khí này thu được 5. 36. CTPT của 2 anken là: A. B.1 mol C3H6.4 gam. CH3CH=CHCH2CH3. A.C. B.2 mol C3H6. hiệu suất phản ứng đạt 40% là: A. 26. B. 0. CTPT A. B. Khi cho 6. C4H8. 80%.3 mol C3H6. C.48 lít (ở đktc).3 mol C2H4 và 0. D. 2. B. (CH3)2C=CH2. D. Khi cho X qua nước Br 2 dư thấy khối lượng bình Br2 tăng 15. 40%.05 mol hiđrocacbon X làm mất màu vừa đủ dung dịch chứa 8 gam brom cho ra sản phẩm có hàm lượng brom đạt 69. CH3CH=CHCH3. C. Sau phản ứng khối lượng bình brom tăng thêm 2. 2-metylpropen. 33. 36 gam. C. C. C. B.2 mol C4H8. 4. Câu 40: Dẫn 3. 3. Câu 37: 2. . C3H6 . Biết X có đồng phân hình học. Nếu cho hỗn hợp X đi qua bình đựng nước brom dư. B và thành phần % theo thể tích của hỗn hợp X là A. D. but-2-en. 40% C2H6 và 60% C2H4. 3-etylpent-2-en. C. B. 35% và 65%.4 gam. D.05. Câu 44: Một hỗn hợp X gồm ankan A và anken B. C5H8. B. eten và but-2-en (hoặc buten-2).3-dimetylbut-2-en. but . Propilen. 20% và 80%. Số mol etan và etilen trong hỗn hợp lần lượt là: A. C2H4 . C. B. but-1-en.72 lít khí X (đktc) đi qua nước brom dư. Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1. B.87%.1. C5H10 và C6H12.8 gam. C5H10. cis -but-2-en và xiclobutan. C. 350 gam.8 gam anken A làm mất màu vừa đủ dung dịch chứa 8 gam Br 2. C3H8.9% và 26.3.36 lít (đktc) hỗn hợp X gồm 2 anken là đồng đẳng kế tiếp vào bình nước brom dư. 50%.

1M thu . D. CH3-CH=CH-CH=CH2.1 mol C3H4.C3H8. Tên của X là A. C. CTPT của 2 anken là (Biết số C trong các anken không vượt quá 5) A. số sản phẩm monoclo tối đa thu được là A. 40. Câu 56: Cho iso-pentan tác dụng với Cl2 theo tỉ lệ số mol 1 : 1. Giá trị của k là (cho H = 1. B. Y.688 lít khí bay ra (đktc). 5. Công thức phân tử của X là (cho H = 1. 25%.1 mol C2H4 và 0. 3. B. D. D. Câu 65: Cho các chất: xiclobutan. cho cùng một sản phẩm là: A.2 mol C2H2. Câu 63: Chất nào sau đây có đồng phân hình học? A. sản phẩm khí hấp thụ hoàn toàn vào dung dịch Ca(OH)2 (dư). D. B. 0. CH3−CH2−CH=C(CH3)2. Câu 58: Clo hoá PVC thu được một polime chứa 63. 25.C3H6. CTPT của 2 anken là: A. CH3−CH=CH−COOH. 4. 2. Số mol. B. 30. C2H2 và C4H8. D. C4H8. C. 4. C3H4 và C4H8. C. C5H10.06 gam hỗn hợp Z sau đó hấp thụ toàn bộ sản phẩm cháy vào 2 lít dung dịch NaOH 0. C3H6 và C5H10. Cl = 35. 0. 1. Hiệu suất của phản ứng hiđro hoá là A. Câu 55: Cho các chất sau: CH2=CH-CH2-CH2-CH=CH2.C2H2 và C4H6. C4H8.36 lít (đktc) hỗn hợp X gồm 2 anken là vào bình nước brom dư. C = 12. 6. trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC. C3H6. 3. Hiđrocacbon X cộng HCl theo tỉ lệ mol 1:1 tạo sản phẩm có hàm lượng clo là 55. Câu 64: Hỗn hợp khí X gồm H2 và C2H4 có tỉ khối so với He là 3. C. D. B. Câu 53: Anken X hợp nước tạo thành 3-etylpentan-3-ol. C = 12. C.4 gam và thể tích 6.04%. C. X có công thức phân tử là: A. Câu 57: Cho 4. Số dẫn xuất đibrom (đồng phân cấu tạo và đồng phân hình học) thu được là A. CH3-C(CH3)=CH-CH3. thu được hỗn hợp khí Z có tỉ khối đối với hiđro bằng 19. B. B. D. C4H8 và C5H10.2 mol C3H4. C5H10. thu được hỗn hợp khí Y có tỉ khối so với He là 5. Câu 61: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu).28 gam và có 2. trong đó khối lượng phân tử Z gấp đôi khối lượng phân tử X. C4H8. cis-but-2-en và xiclobutan. D. 2-metylpropen và but-1-en (hoặc buten-1). thấy khối lượng bình tăng thêm 7.3-đien phản ứng cộng với Br2 theo tỉ lệ mol 1:1. B. C2H4 và C4H8. C = 12. 2. CO (thể tích CO gấp hai lần thể tích CH 4).3. C. D. C.7 gam.7 gam. CH2=CH-CH2-CH3. 3. but-1-en. C. C3H4. 1. công thức phân tử của M và N lần lượt là A. Số chất có đồng phân hình học là A. Dãy gồm các chất sau khi phản ứng với H 2 (dư. Câu 68: Cho hỗn hợp hai anken đồng đẳng kế tiếp nhau tác dụng với nước (có H2SO4 làm xúc tác) thu được hỗn hợp Z gồm hai rượu (ancol) X và Y. C3H4. 2-metylpropen. C3H6 và C4H8. D. D. C = 12. C. CH2=CH-CH=CH-CH2-CH3. C. Đốt cháy hoàn toàn 1. C2H2 và C3H8.4. C. cis-but-2-en và but-1-en.8 gam. Tỉ khối của X so với khí hiđro là A. C4H8 và C5H10. B. 0. C.20. 11. Đốt cháy hoàn toàn hỗn hợp trên thu được hỗn hợp khí Y. D. B. Hai anken đó là A. cho 5. Câu 59: Ba hiđrocacbon X. thu được số gam kết tủa là (cho H = 1. C.2.1 mol chất Y.1 mol C3H6 và 0. Công thức phân tử của X là (cho H = 1. B.12. CH3−CH=CH−CH=CH2. 2-metylpropen và cis-but-2-en.75. C4H8. Câu 52: Cho buta-1.5) A. Cho Y qua dung dịch H2SO4 đặc.5M. xúc tác Ni. 1. Cl = 35. 40%. C = 12) A.1. D. số mol Br2 giảm đi một nửa và khối lượng bình tăng thêm 6. B.96% clo về khối lượng. D. C2H4. C.2 mol C2H4 và 0. 4. B. CH2=CH-CH2-CH=CH2. 4.6 oC. B. 2-etylpent-2-en. Câu 66: Cho các chất: CH2=CH−CH=CH2. Câu 60: Một hiđrocacbon X cộng hợp với axit HCl theo tỉ lệ mol 1:1 tạo sản phẩm có thành phần khối lượng clo l 45. CH3-CH=C(CH3)2.8. 5. C2H4 và C5H10. C3H6. C. O = 16) A. Công thức phân tử của 2 hiđrocacbon là (cho H = 1. Ca = 40) A.0 ml CO2 (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất). D.72 lít (ở đktc). C. D.b. Câu 51: Cho 10 lít hỗn hợp khí (54. 3.12. O = 16. C2H4. propen và but-2-en (hoặc buten-2). C2H4 Câu 50: Dẫn 3.2 mol C3H6 và 0. Câu 54: Hỗn hợp khí X gồm anken M và ankin N có cùng số nguyên tử cacbon trong phân tử. xiclobutan. CTPT của anken là: A. 3-etylpent-1-en. D. D. xiclobutan.6 lít X qua dung dịch brom dư thấy khối lượng bình brom tăng 7. Số chất có đồng phân hình học là A. 10. 0. D. 0. eten và but-1-en (hoặc buten-1). B. B. C. Câu 62: Hỗn hợp gồm hiđrocacbon X và oxi có tỉ lệ số mol tương ứng là 1:10.48 lít hỗn hợp X (ở đktc) gồm 2 hiđrocacbon mạch hở lội từ từ qua bình chứa 1. C3H6. Hỗn hợp X có khối lượng A. cis-but-2-en. D. CH3−CH=CH2. eten và but-2-en (hoặc buten-2). B. B. to).0 ml hỗn hợp X gồm C3H6.2. 50%. C. Sau khi phản ứng hoàn toàn. 2-metylbut-2-en và but-1-en. 3-etylpent-2-en. Câu 49: Hỗn hợp X gồm metan và anken.20%. but-1-en. B.9.8064 atm) gồm 2 olefin lội qua bình dung dịch brom dư thấy khối lượng bình brom tăng 16. C.223%. Dẫn X qua Ni nung nóng.4 lít dung dịch Br 2 0. B. 2-metylpropen.5) A. thu được 24.3-etylpent-3-en. A hoặc B.2. 22. Đốt cháy 0.1 mol C2H2. Câu 67: Đốt cháy hoàn toàn 20. A hoặc B. Z kế tiếp nhau trong dãy đồng đẳng. 2-metylbut-2-en. CH4. CH2=CH-CH=CH2.

ankin. D.68 lít hỗn hợp khí X gồm hai hiđrocacbon vào bình đựng dung dịch brom (dư). O = 16. áp suất). CH4 và C2H4. 60%. Tỉ khối của X so với H2 bằng 11. Câu 72: Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1. CH4 và C3H6.CH4 và C2H4. . 46.được dung dịch T trong đó nồngđộ của NaOH bằng 0. 7. C. Các chất X.89%. Hiệu suất của phản ứng hiđro hóa là A. B. B. C. Câu 78: Hiđrat hóa 2-metylbut-2-en (điều kiện nhiệt độ. C = 12. 3-metylbutan-1-ol. C2H6 và C3H6 Câu 74: Ba hiđrocacbon X. D. C3H7OH và C4H9OH. C. ankađien.27. 34. 2-metylbutan-2-ol. C4H9OH và C5H11OH. ankan. B. D. Câu 75: Hiđro hóa hoàn toàn hiđrocacbon mạch hở X thu được isopentan. trong đó khối lượng ancol bậc hai bằng 6/13 lần tổng khối lượng các ancol bậc một. C2H6 và C2H4. xiclopropan. C. 7. Z là đồng đẳng kế tiếp. 70%. Câu 70: Số đồng phân cấu tạo của C5H10 phản ứng được với dung dịch brom là A.5. Công thức cấu tạo thu gọn của X và Y là (Cho: H = 1.5.48 lít X. Câu 76: Đốt cháy hoàn toàn 3 lít hỗn hợp X gồm 2 anken kế tiếp nhau trong dãy đồng đẳng cần vừa đủ 10. B. D. 4. propilen. thu được hỗn hợp Y có tỉ khối so với H2 là 12. D. Số công thức cấu tạo có thể có của X là A.08% Br về khối lượng). B. tối giản) tất cả các chất trong phương trình hoá học của phản ứng trên là A. khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. Sau khi phản ứng xảy ra hoàn toàn. 2-metylbutan-3-ol. có 4 gam brom đã phản ứng và còn lại 1. but-2-en. 31. 5. B.5 lít O 2 (các thể tích khí đo trong cùng điều kiện nhiệt độ. CH4 và C3H6. C. anken. D.12 lít khí. 31. Tổng hệ số (nguyên. Tên gọi của X là A. Câu 71: Hỗn hợp khí X gồm một ankan và một anken. C. D. Y. C.58%. C2H5OH và C4H9OH. Y. 6.88%. D. C.43%. C. C2H5OH và C3H7OH. 10.8 lít khí CO 2.25. B. CH4 và C4H8. B. thu được chất hữu cơ Y (chứa 74. CH4 và C3H4. Hiđrat hóa hoàn toàn X trong điều kiện thích hợp thu được hỗn hợp ancol Y.8. 7. B.68 lít X thì sinh ra 2. B. Nếu đốt cháy hoàn toàn 1. Dẫn X qua Ni nung nóng. thể tích dung dịch thay đổi không đáng kể) A. Câu 69: Cho phản ứng: C6H5-CH=CH2 + KMnO4 → C6H5-COOK + K2CO3 + MnO2 + KOH + H2O. D. Công thức phân tử của hai hiđrocacbon là (biết các thể tích khí đều đo ở đktc) A. Đốt cháy hoàn toàn 4. 9. 50%. C. Công thức của ankan và anken lần lượt là A. 5. 3-metylbutan-2-ol. thu được 6. C. D. Câu 73: Dẫn 1. D. 24. Phần trăm khối lượng của ancol bậc một (có số nguyên tử cacbon lớn hơn) trong Y là A.05M. Z thuộc dãy đồng đẳng A. Câu 77: Hỗn hợp X gồm H2 và C2H4 có tỉ khối so với H2 là 7. xúc tác thích hợp) thu được sản phẩm chính là A. 80%. Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau.72 lít CO2 (các thể tích khí đo ở đktc). B. but-1-en.

Sign up to vote on this title
UsefulNot useful