HÓA HỌC 12

• • • • • • • • • Chương 1: Este – Lipit Chương 2: Cacbohidrat Chương 3: Amin – Amino axit – Protein Chương 4: Polime – Vật liệu polime Chương 5: Đại cương về kim lọai Chương 6: Kim lọai kiềm – Kim lọai kiềm thổ - Nhôm Chương7: Sắt và một số kim lọai quan trọng Chương 8: Phân biệt một số chất vô cơ Chương 9: Hóa học và vấn đề phát triển kinh tế, xã hội và môi trường

TÀI LIỆU LƯU HÀNH NỘI BỘ

CHƯƠNG I. ESTE - LIPIT A- MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Khái niệm về dẫn xuất của axit cacboxylic - Dẫn xuất của axit cacboxylic là những sản phẩm tạo ra khi thay thế nhóm hiđroxyl -OH trong nhóm cacboxyl -COOH bằng nguyên tử hay nhóm nguyên tử khác: -COOH → -COZ (với Z: OR', NH2, OCOR, halogen, …) - Este là dẫn xuất của axit cacboxylic. Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR' thì được este. - Halogenua axit (quan trọng nhất là clorua axit RCOCl). Để tạo ra halogenua axit có thể dùng các tác nhân như PCl5 (photpho pentaclorua), PCl3 (photpho triclorua), COCl2 (photgen), SOCl2 (thionyl clorua), … RCOOH + PCl5 → RCOCl + POCl3 + HCl 3RCOOH + PCl3 → 3RCOCl + H3PO3 RCOOH + SOCl2 → RCOCl + SO2 + HCl RCOOH + COCl2 → RCOCl + CO2 + HCl - Anhiđrit axit, có 2 loại: đối xứng (dạng (RCO)2O hoặc (ArCO)2O; gọi tên bằng cách thay từ axit bằng anhiđrit (CH3CO)2O là anhiđrit axetic), và không cân đối (sinh ra từ hai axit monocacboxylic khác nhau như CH3CO-O-OCC6H5; gọi tên bằng từ anhiđrit cộng với tên của hai axit - anhiđrit axetic benzoic). Để tạo thành anhiđrit axit có thể sử dụng nhiều phương pháp khác nhau như dùng tác nhân hút nước P2O5 hay tác dụng của nhiệt, … 2. Công thức tổng quát của este a/ Trường hợp đơn giản: là este không chứa nhóm chức nào khác, ta có các công thức như sau :
- Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đơn chức R'OH: RCOOR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đơn chức R'OH: R(COOR')a. - Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đa chức R'(OH)b: (RCOO)bR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đa chức R'(OH)b: Rb(COO)abR'a. Trong đó, R và R' là gốc hiđrocacbon (no, không no hoặc thơm); trường hợp đặc biệt, R có thể là H (đó là este của axit fomic H-COOH).

b/ Trường hợp phức tạp: là trường hợp este còn chứa nhóm OH (hiđroxi este) hoặc este
còn chứa nhóm COOH (este - axit) hoặc các este vòng nội phân tử … Este trong trường hợp này sẽ phải xét cụ thể mà không thể có CTTQ chung được. Ví dụ với glixerol và axit axetic có thể có các hiđroxi este như HOC 3H5(OOCCH3)2 hoặc (HO)2C3H5OOCCH3; hoặc với axit oxalic và metanol có thể có este - axit là HOOC-COOCH3.

c/ Công thức tổng quát dạng phân tử của este không chứa nhóm chức khác Nên sử dụng CTTQ dạng C n H 2n + 2 −2∆ O2a (trong đó n là số cacbon trong phân tử este n ≥ 2, nguyên; ∆ là tổng số liên kết π và số vòng trong phân tử ∆ ≥ 1, 2

nguyên; a là số nhóm chức este a ≥ 1, nguyên), để viết phản ứng cháy hoặc thiết lập công thức theo phần trăm khối lượng của nguyên tố cụ thể. 3. Tính chất hoá học của este a/ Phản ứng thuỷ phân este Tính chất hoá học quan trọng nhất của este là phản ứng thuỷ phân. Sơ đồ thuỷ phân este (về cơ bản, chưa xét các trường hợp đặc biệt) là :

C

O

+H

OH

H +, t o

C O

H

+

OH

O O (este) (nước) (axit) (ancol) Thuỷ phân chính là quá trình nghịch của của phản ứng este hoá.
Phản ứng thuỷ phân có thể xảy ra trong môi trường axit hoặc môi trường bazơ. - Phản ứng thuỷ phân trong môi trường kiềm được gọi là phản ứng xà phòng hoá. Đặc điểm của phản ứng thuỷ phân este: - Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Sản phẩm của phản ứng trong điều kiện này luôn có axit cacboxylic. Để chuyển dịch cân bằng về phía tạo axit và ancol, ta dùng lượng dư nước.

- Phản ứng thuỷ phân este không những thuận nghịch mà còn rất chậm. Để tăng tốc độ phản ứng thuỷ phân ta đun nóng hỗn hợp phản ứng với với chất xúc tác axit (H2SO4, HCl…). - Phản ứng xà phòng hoá chỉ xảy ra một chiều, sản phẩm thu được luôn có muối của axit cacboxylic.

C O

+ OH-

to

C
(muối)

O-

+

OH

(este) (kiềm) O b/ Phản ứng của gốc hiđrocacbon

O (ancol, phenol, anđehit …)

Este không no (este của axit không no hoặc ancol không no) có khả năng tham gia phản ứng cộng và phản ứng trùng hợp – đây là tính chất do liên kết π quy định (tương tự như hiđrocacbon tương ứng). Một số phản ứng thuộc loại này có ứng dụng quan trọng là : - Phản ứng chuyển hoá dầu (chất béo lỏng) thành mỡ (chất béo rắn)
Ni, t , p (C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5 (Triolein) (Tristearin) - Phản ứng trùng hợp vinyl axetat thành poli(vinyl axetat)
0

nCH2

CH OCOCH3

xt, to, p

CH CH2 n OCOCH3

- Trùng hợp metyl metacrylat thành poli(metyl metacrylat) – thuỷ tinh hữu cơ plexiglas).

3

4.axit : HOOC-R-COOR’ • Este + NaOH  2 muối + H2O → Este của phenol: C6H5OOC-R • Este + NaOH  1 muối + anđehit + H2O → Hiđroxi. halogenua axit cũng bị líti-nhôm hiđrua khử tương tự). Một số phản ứng thuỷ phân đặc biệt của este Căn cứ vào sơ đồ phản ứng xà phòng hoá hay phản ứng thuỷ phân este ta có thể căn cứ vào sản phẩm tạo thành để suy đoán cấu tạo của este ban đầu. to. • Este + NaOH  1 muối + 1 ancol + H2O → Este. p CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) CH3 metyl metacrylat . Phản ứng khử este bởi líti-nhôm hiđrua LiAlH4 thành ancol bậc I 1) LiAlH 4 → RCOOR'  RCH2OH + R'OH 2) H3O + (Chú ý: anhiđrit axit. 5.Phản ứng tráng gương của este của axit fomic– (xem lại anđehit). tuỳ thuộc vào việc nhóm – OH đính vào gốc hiđrocacbon có cấu tạo như thế nào mà sẽ có các phản ứng tiếp theo xảy ra để có sản phẩm cuối cùng hoàn toàn khác nhau. hoặc nữa là do cấu tạo bất thường của este gây nên. Không nhất thiết sản phẩm cuối cùng phải có ancol. Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : • Este + NaOH  1 muối + 1 anđehit → Este đơn chức có gốc ancol dạng công thức R-CH=CHThí dụ CH3COOCH=CH-CH3 • Este + NaOH  1 muối + 1 xeton → Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân. Este vòng (được tạo bởi hiđroxi axit) CH 3 CH C O • Este + NaOH  Có MSP = MEste + MO → NaOH R C O O Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi 4 .nCH2 CH COOCH3 xt.este: RCOOCH(OH)-R’ • Este + NaOH  1 muối + xeton + H2O → Hiđroxi.este: RCOOC(R)(OH)-R’ • Este + NaOH  1 sản phẩm duy nhất → hoặc “m RẮN = mESTE + mNaOH”.

anhiđrit axit. Lipit . H . các em chỉ được vận dụng khi không có dấu hiệu cho phép xác định cụ thể số nhóm chức este trước đó. …hầu hết chúng đều là các este phức tạp. sáp. Lipit bao gồm chất béo.Phản ứng của ancol với axit cacboxylic (xem axit).Chỉ số axit: là số mg KOH cần để trung hoà axit béo tự do có trong 1g chất béo. photpholipit.Khi đun nóng chất béo với dung dịch kiềm thì tạo ra glixerol và hỗn hợp muối của các axit béo. Muối natri (hoặc kali) của các axit béo chính là xà phòng. tạo ra este.Lipit là những hợp chất hữu cơ có trong tế bào sống.Phản ứng của ancol với anhiđrit axit hoặc clorua axit thì phản ứng xảy ra nhanh hơn và một chiều (không thuận nghịch như khi tác dụng với axit) (CH3CO)2O + C2H5OH  CH3COOC2H5 + CH3COOH → CH3COCl + C2H5OH  CH3COOC2H5 + HCl → b/ Phản ứng của phenol với anhiđrit axit hoặc clorua axit (phenol không tác dụng với axit cacboxylic) tạo este của phenol.Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử C (thường từ 12C đến 24C) không phân nhánh. gọi chung là triglixerit. Phản ứng xà phòng hoá xảy ra nhanh hơn phản ứng thuỷ phân trong môi trường axit và không thuận nghịch. . .t  → RCOOH + R'OH ← RCOOR' + H2O  + 0 . t 0 CH3COOH + CH≡ CH  CH3COOCH=CH2 → d/ Phản ứng ankyl halogenua và muối bạc hay cacboxylat của kim loại kiềm RCOOAg + R'I → RCOOR' + AgI RCOONa + R′ I → RCOOR' + NaI 7. Phản ứng của chất béo với chất kiềm được gọi là phản ứng xà phòng hoá. .đơn giản nhất. sterit. . Ví dụ: phản ứng tạo phenyl axetat (CH3CO)2O + C6H5OH  CH3COOC6H5 + CH3COOH → CH3COCl + C6H5OH  CH3COOC6H5 + HCl → c/ Phản ứng cộng vào hiđrocacbon không no của axit cacboxylic Ví dụ: phản ứng tạo vinyl axetat xt. Một số phương pháp điều chế este a/ Phản ứng của ancol với axit cacboxylic và dẫn xuất như clorua axit. 5 . Khi thuỷ phân chất béo thì thu được glixerol và axit béo. t CH3 CH C O + NaOH CH3 CH C ONa O Chú ý các kết luận in nghiêng ngay dưới mỗi trường hợp trênO chỉ là một thí dụ OH đây o 6.

. bR(COOH)a + aR'(OH)b ← Rb(COO)abR'a + abH2O  t 5. 3CH3COOH + POCl3  3CH3COCl + H3PO4 → CaO. R-Cl + KCN → R-CN + KCl 13. 8. CH3CH2COOH + Br2  CH3CHBrCOOH + HBr → 10. C3H5(OOC R )3 + 3NaOH  3 R COONa + C3H5(OH)3 → H+ . RCOOC(CH3)=CH2 + NaOH  RCOONa + CH3COCH3 → 6 .Chỉ số iot: là số gam iot có thể cộng hợp vào các liên kết bội có trong 100g chất béo. C6H5-CH(CH3)2  C6H5OH + CH3COCH3 2) H 2 O. t 0 8. RCOOC6H5 + 2NaOH  RCOONa + C6H5ONa + H2O → t0 3. CH3COONa(r) + NaOH(r)  CH4 + Na2CO3 → photpho. RCOOCH=CH2 + NaOH  RCOONa + CH3CHO → 0 t 2. Xà phòng và chất tẩy rửa tổng hợp B . (CH3)2C(OH)CN + 2H2O → (CH3)2C(OH)COOH + NH3↑ 12. CxHy(COOM)a + O2  M2CO3 + CO2 + H2O → (sơ đồ phản ứng đốt cháy muối cacboxylat). RCOONa + HCl (dd loãng) → RCOOH + NaCl t0 16. t 0 9. t0  → 4. t0 18. (C17H35COO)3C3H5 + 3KOH  C17H35COOK + C3H5(OH)3 → 6. CH3-CO-CH3 + HCN → (CH3)2C(OH)CN 11. R-CN + 2H2O → R-COOH + NH3↑ 1) O 2 → 14. 2CH3COONa(r) + 4O2  Na2CO3 + 3CO2↑ + 3H2O → t0 17.Chỉ số xà phòng hoá là tổng số mg KOH cần để xà phòng hoá glixerit và trung hoà axit béo tự do có trong 1g chất béo. H + 0 0 15. 3CH3COOH + PCl3 → 3CH3COCl + H3PO3 t0 7.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP t 1. .

Câu 1. (2). 15. (4) Hợp chất CH3COOC2H5 thuộc loại este. (1). Đietyl ete. Câu 1. có thể thu được este có tên là A. Nung Y với NaOH (có mặt CaO) thì được một chất khí là CH4. C. D. D. Các tên gọi đúng ứng với este có thể có của công thức phân tử đã cho là A. HOOC – CH = CH – COO – CH3 và CH2 = CH – COO – CH3. (3). (2). (4). a.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 1. (3). (3) metyl iso-propylonat. (3). (5). chỉ (4). (2). Đun hỗn hợp X với dung dịch NaOH dư.2 Có các nhận định sau : (1) Este là sản phẩm của phản ứng giữa axit và ancol. (3). (2). b/ (1) tạo sản phẩm axit. (4) Phản ứng este hoá là phản ứng thuận . (5). c. mạch hở có công thức phân tử CnH2nO2 . D. b. B. 4. B. đơn chức.7 Phản ứng thuỷ phân của este trong môi trường axit (1) và môi trường bazơ (2) khác nhau ở các điểm : a/ (1) thuận nghịch. Câu 1. (5). c. (1). (3). b. (2) metyl propionat. D. (2) Không thể điều chế được vinyl axetat bằng cách đun sôi hỗn hợp ancol và axit có axit H2SO4 đặc làm xúc tác. (4) propyl fomiat. c/ (1) cần đun nóng. (4). còn (2) chỉ một chiều. Vậy công thức cấu tạo của E và F là A. Etyl fomiat. (1). (1). B.C. và (4). (5). (3) Để điều chế este của phenol không dùng axit cacboxylic để thực hiện phản ứng với phenol. (1).. Các nhận định đúng là A. (2).4 Hỗn hợp X gồm 2 este mạch hở E (C5H6O4) và F (C4H6O2). (4). (2) Este là hợp chất hữu cơ trong phân tử có nhóm – COO. c. Câu 1. Câu 1. C. (4). với n ≥ 2 .6 Ứng với công thức phân tử C4H8O2. còn (2) không cần đun nóng. thu chất rắn Y. HOOC – CH2 – COO – CH = CH2 và CH3 – COO – CH = CH2.nghịch. (2). C. sau đó cô cạn dung dịch. (3). (3). 3. C. (4). sẽ tồn tại các este với tên gọi : (1) etyl axetat. C. B. (5).5 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit benzoic là A. còn (2) tạo sản phẩm muối. b. D. C. B. 14. (1) và (4). (4). Nhận xét đúng là A. D.1 Khi đun hỗn hợp gồm etanol và axit axetic (có mặt H2SO4 đặc làm xúc tác).3 Xét các nhận định sau: (1) Trong phản ứng este hoá. (5) Sản phẩm của phản ứng giữa axit và ancol là este. axit sunfuric vừa làm xúc tác vừa có tác dụng hút nước. (3). D. (5) isopropyl fomiat. Câu 1. a. Etyl axetat. a. Các nhận định đúng gồm A. do đó làm tăng hiệu suất tạo este. HOOC – COO – CH2 – CH = CH2 và H – COO – CH2 – CH = CH2. (5). (3). B. (2). B. Etyl axetic. (1). (4). (4). (3) Este no. 7 . C. HOOC–CH = CH– COO–CH3 và CH3–OOC – CH = CH2. (1). (1). (4).

D. C. (3). đơn chức chứa 50%C (về khối lượng) có tên gọi là A.15 Este mạch hở. Số lượng công thức cấu tạo của các trieste có thể có trong loại sơn nói trên là A. (3) và (4).16 Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. (4).10O6. (4) phản ứng oxi hóa. vinyl axtetat. B. CH3COOC2H5 D. D.10 Este của glixerol với axit cacboxylic (RCOOH) được một số học sinh viết như sau: (1) (RCOO)3C3H5. HCOOC3H5. 8 . (2). C. HCOOC3H7 B. Câu 1. D. phenyl fomiat. metyl benzoat. Câu 1. Câu 1. (1). Câu 1. (2) phản ứng cộng. (4) (ROOC)2C3H5(OH). Công thức cấu tạo của X là A. CnH2n – 2O2.18O12. C. etyl axetat. Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức C2H3O2Na. B. D. phenyl axetat. (1). D.13 Những phát biểu sau đây : (1) Chất béo không tan trong nước. Các phát biểu đúng là A.8 Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là A. (3) Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. C2H5COOCH3 C. Câu 1. B. (3). (4). B. Câu 1. Câu 1. B. Công thức đã viết đúng là A. ba chức là A. Câu 1. (3). CnH2n . C. metyl axetat. 18.9 Công thức tổng quát của este tạo bởi một axit cacboxylic no đơn chức và một ancol no đơn chức (cả axit và ancol đều mạch hở) là A.6O4. (4). (1).17 Chất X có công thức phân tử C4H8O2. Rb(COO)abR’a. B. CnH2n+2O2. (3) phản ứng thuỷ phân. D. X có tên gọi là A. (2) Chất béo không tan trong nước. (2). CnH2nO2. CnH2n -16O12. RCOOR’.11 Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi. (2). (2). (5) C3H5(COOR)3. (2). C.14 Trong thành phần của một số loại sơn có trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. D. vinyl fomiat. B. CnH2n + 1COOCmH2m +1. Câu 1. (1). CnH2n . (5). C. benzyl fomiat. 12. (4). phản ứng đặc trưng cho mọi este là A. C. (2) (RCOO)2C3H5(OH). D. (3). CnH2nO2. 6. CnH2n – 2O2. chỉ có (1). (1). chỉ có (5). C. C. (4). D. CnH2n . B. (1). (4) Chất béo là este của glixerol và axit hữu cơ.Câu 1. B.12 Trong số các phản ứng có thể có của este gồm: (1) phản ứng trùng hợp. 8. (3) (HO)2C3H5OOCR.

6. 2. D. (4). 1. y = 1.05. 9 . 1.Câu 1. C. số đồng phân có khả năng tác dụng với dung dịch NaOH.00. C. (1). natri cacbonat. 2. (2) và (3).21 Số nguyên tử cacbon tối thiểu trong phân tử este (được tạo nên từ axit và ancol) no đa chức. (2) metyl acrylat. 0. x = 1. 2. (2) metyl axetat. (1) và (2).18 Khi đun hỗn hợp 2 axit R1COOH và R2COOH với glixerol (axit H2SO4 làm xúc tác) có thể thu được mấy trieste ? A. x = 1. 5. Vinyl axetat. B. 2. y = 1. Tại thời điểm cân bằng thu được 0.2 mol este tạo thành. Metyl metacrylat. y = 0. (2). 1. chỉ có (3). C. Khi đạt trạng thái cân bằng trong hỗn hợp có 1.25 Tên gọi của este (được tạo nên từ axit và ancol thích hợp) có công thức phân tử C4H6O2 là A. y = 0. Metyl propionat.75 mol este (không tác dụng với Na). 2. B.23 Trong số các đồng phân mạch hở có công thức phân tử C2H4O2. C. x = 1. 18. 2. Ở nhiệt độ đó hằng số cân bằng Kc của phản ứng este hoá là A. B.19 Trong số các este: (1) metyl axetat.75.2.00. C.4. este mà polime của nó được dùng để sản xuất chất dẻo gồm A. Câu 1. (3) iso propyl fomiat. 1.20. (2). 4. B.05. y có giá trị là A. D. natri kim loại.22 Đun nóng hỗn hợp gồm x mol axit axetic và y mol etylen glicol (xt H2SO4 đặc). B. C. một học sinh gọi tên các đồng phân este có thể có gồm: (1) etyl fomiat. 2. 2.30 mol axit.80. chỉ có (1). 4. mạch hở là A.2. 3.24 Ứng với công thức phân tử C3H6O2. (4) vinyl fomiat. D. 2. 5. (3). 3. Câu 1. B.25 mol ancol và 0.26 Cho 2 mol CH3COOH thực hiện phản ứng este hoá với 3 mol C2H5OH. Câu 1. x = 1. 4. (3). Metyl acrylat. C. 2. Câu 1. (1). 1. 3. 2. 1. 2. 2. (1). C.90. C. B. (4). Câu 1. D. C. 2. mạch hở là A. Câu 1. D. dung dịch AgNO3 trong amoniac lần lượt là A. 1. Câu 1. D. 1. D. Câu 1. (4) metyl benzoat. B. Các tên gọi đúng là A. D. (3). (3) metyl metacrylat. B.20 Số nguyên tử cacbon tối thiểu trong phân tử este không no. (4). x.

Đun hồi lưu hỗn hợp etanol. Đun hồi lưu hỗn hợp axit axetic. D. Y mạch hở (C. B. d. Vậy công thức cấu tạo của X là A. c. Y (chứa các nguyên tử C. H. C. Thuỷ phân X bằng dung dịch NaOH dư. Y thuộc dãy đồng đẳng A. Chưng cất X3 thu được chất X4. metyl propionat. 10 . isopropyl fomiat. Cô cạn X1 được chất rắn X2 và hỗn hợp hơi X3. giấm và axit sunfuric đặc. a. d. b. c. B. Vậy X.32 Thuỷ phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng. C. Câu 1. C. b/ Các este không tan trong nước do chúng nhẹ hơn nước.H. B. D. d/ Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn.30 Cách nào sau đây có thể dùng để điều chế etyl axetat ? A. C. e. este đơn no. HCOO –C(CH3) = CH2. Chất béo là este của glixerol với các axit béo. thu 6.33 Cho các câu sau : a/ Chất béo thuộc loại hợp chất este.72 lít (đktc) CO2 và 5. thu được một muối và một ancol. Phản ứng xà phòng hoá là phản ứng thuỷ phân este trong môi trường kiềm. CH2 = CH – OCOCH3. Glixerol khử nước hoàn toàn cho sản phẩm là acrolein. Cho X5 tác dụng với NaOH lại thu được X2. b.Câu 1. a. C. HCOO – CH = CH – CH3. D. etyl axetat. este đơn. a. có một nối ba. HOOC–CH2–CH = CH–OOCH. d. D. D. HOOC–CH = CH–OOC–CH3. d. Câu 1.31 Chất hữu cơ X có công thức phân tử là C5H6O4. e. Đốt cháy hoàn toàn m g T. B. e/ Chất béo lỏng là các triglixerit chứa gốc axit không no trong phân tử. Câu 1.28 Hỗn hợp T gồm 2 chất X. D. axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. c/ Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước.29 Phát biểu nào sau đây sai ? A.4g H2O. B. a. C. Chất E là A. Công thức cấu tạo của X có thể là A. B. este đơn có 2 nối đôi. HOOC–CH2–COO–CH = CH2. Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. CH2 = CH – CH2 – OCOH. Câu 1. e. propyl fomiat. no. este đơn. axit axetic và axit sunfuric đặc. Câu 1. rượu trắng và axit sunfuric đặc. B. Đun sôi hỗn hợp etanol. thu được 2 sản phẩm hữu cơ X. Các axit béo có mạch cacbon không phân nhánh. số nguyên tử cacbon chẵn. Câu 1. O). Đun hồi lưu hỗn hợp etanol. nhưng đều tác dụng với dung dịch NaOH khi đun nóng. Những câu đúng là đáp án nào sau đây ? A. Cho X4 tráng gương được sản phẩm X5. đun nóng. HOOC–COO–CH2–CH = CH2. D. có 1 nối đôi. C.27 Chất X tác dụng với NaOH cho dung dịch X1.O) đơn chức đều không tác dụng được với Na.

1. 5. CâuCH3COOCH2 hữu cơ CHcông thứcCH2 tử C2H8O2. CH2=CH–CH2–CH2 – COOH và CH3–CH2–CH=CH–COOH. axit fomic. Công thức cấu tạo của X là A. (4) axit axetic. 1. vinyl axetat và etyl fomiat cần phải dùng các thuốc thử là A. F tác dụng với NaOH tạo ra một ancol T. CH3–CH(OH)–CH(OH)–CH=CH2 và CH2=CH–CH2–CH2–COOH.4 mol.15 mol este đơn chức X (C5H8O2) tác dụng vừa đủ với dung dịch NaOH. D.38 Cho 10 gam hỗn hợp X gồm etanol và etyl axetat tác dụng vừa đủ với 50g dung dịch natri hiđroxit 4%.6 mol.41 F là chất CH có 2 . C. CH2 CH(CH3)COOCH3. D.39 Trong phòng thí nghiệm có các hoá chất được dùng làm thuốc thử gồm: (1) dd brom. Số miligam NaOH cần để trung hoà các axit tự do có trong 1 gam chất béo. D. 1. cô cạn dung dịch sau phản ứng thu 21g muối khan. D.5 mol. 1. Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng A. O=HC–CH2–CH2–CH2–CH=O và O=HC–CH(OH)–CH2–CH=CH2. Để phân biệt 3 este: anlyl axetat. 3. để điều chế được ba polime gồm polistiren. 50%. 0. axit acrylic. Câu 1. B. C. C. B. (2) dd NaOH. Công thức cấu tạo của X và Y là A. cần thực hiện số lượng phản ứng hoá học ít nhất là A.37 Từ nguyên liệu đầu là eten và benzen (xúc tác và điều kiện phản ứng có đủ). CH3–CH2–COO–CH=CH2 và CH2=CH–COO–CH2–CH3. D. C. C3H3O2Na và 2 sản phẩm khác. 5. B. 0. 2. 3. Câu 1. thu sản phẩm 2 muối C3H5O2Na. B. 51%. C. khi đốt cháy một thể tích ancol T cần 3 thể tích oxi (đo ở cùng điều CH2 CH2 O kiện). 3. D. 2. D.3 mol.40 Cho 0. Axit tạo F là A. a có giá trị là A.6. axit valeric. phân CH 5 C O. 7. CH2 CH COOC2H5 . Câu 1. B. 0. 2.36 Đun nóng hỗn hợp X và Y có công thức C5H8O2 trong dung dịch NaOH. C.Câu 1. D. 8 Câu 1. 0. axit axetic.35 Cho a mol chất béo (C17H35COO)3C3H5 tác dụng hết với NaOH thu được 46g glixerol. (3) dd AgNO3/NH3. Số mol KOH cần để xà phòng hoá một gam chất béo. C. Câu 1. B. Câu 1. 44%. C. (5) cồn iot. 22%. B. B. Số miligam KOH cần để trung hoà các axit tự do có trong 1 gam chất béo. 11 . Số liên kết π có trong gốc hiđrocacbon của axit béo. polibutađien và poli(butađienstiren).34 Chỉ số axit của chất béo là A.

axit fomic. HCOOCH3.6g một ancol Y. B. B. 0. HCOOC2H5 (2.4g một este X thu được một thể tích hơi bằng thể tích của 3.43 Cho ancol X tác dụng với axit Y thu được este Z. CH3COOCH3 (2. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A. 10g. C. Câu 1. C.4g muối của axit đa chức và 9.4g). mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4.49 Đốt hoàn toàn 4. CH3COOC2H5 (4. Câu 1. CH(COOCH3)3.32 lít (ở 1270C. Etyl axetat. B. D. 12g. C.48 Đốt cháy hoàn toàn 2. D. Câu 1. C. HCOOC2H5 (1.Câu 1. C2H5COOCH3 (4.48g). Propyl axetat. D. HCOOCH3. có thể tích 8. 10g.01 mol.8g este đơn chức.47 Làm bay hơi 7. Tên gọi của X là A. CH3COOCH3. D. làm bay hơi 8. Công thức cấu tạo của E là A.4g X với dung dịch NaOH (phản ứng hoàn toàn) thu được sản phẩm có 6.1 mol. 0.6g). Khi thực hiện phản ứng xà phòng hoá 7. Câu 1.50 Đun nóng 0. C.2g khí oxi ở cùng điều kiện nhiệt độ. áp suất. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối lượng bình tăng 6.2g ancol đơn chức. 12 B. metyl axetat. Câu 1.44 Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6. CH3COOCH3 (1. C2H3COOC2H5.2g. D. Nếu đun X trong dung dịch H 2SO4 loãng thu được axit Y có dY / H 2 = 36 và ancol đơn chức Z. 0. 1. HCOO – C2H5. D. etyl fomiat. Câu 1.1 mol X với dung dịch NaOH (đủ). thu 13. D.6g). isopropyl fomiat. 600 mmHg).22g). C2H4(COOC2H5)2.2g. X có công thức A.6g Z thu được thể tích bằng thể tích của 3. Câu 1.45 Đốt cháy 6g este E thu được 4. C2H3COOC3H7. CH3COOCH3. C.14g hỗn hợp 2 muối và 3. B. CH3COOC2H5.28g X cần 3. .8g muối. C.1 mol. HCOO – CH2CH2CH3. vinyl fomiat. axit acrylic. Vậy công thức cấu tạo của E là A. Biết E có phản ứng tráng gương với dung dịch AgNO3/NH3. đơn chức.22g). 0.48g).4375. B. Tên gọi của Y là A. B. C2H5COOCH3 (6. Etyl fomiat. Công thức của X là A.2g O2 ở cùng điều kiện nhiệt độ và áp suất.4g).42 Đốt cháy hoàn toàn m g hỗn hợp các este no.46 Thuỷ phân hoàn toàn 8. D. C. C. CH3COO – CH2CH2CH3.6g H2O. C2H5COOC2H5. axit axetic. B.01mol.2g một este E thu được 6. (COOC3H5)2.68g một ancol Y duy nhất có tỉ khối so với oxi là 1.48 lít CO2 (đktc) và 3. axit metacrylic.16g CO2 và 2. mạch hở. Câu 1. D. Biết MY > MX. HCOOC2H5.52g H2O. Tên gọi của X là A. (COOC2H5)2. B. CH3COOC2H5 (6. Công thức cấu tạo mỗi este và số gam tương ứng là A. Etyl propionat.36 lít oxi (đktc) thu hỗn hợp CO 2 và H2O có tỉ lệ thể tích tương ứng 6 : 5.

16. 20.4g. CH3–C(COOCH3)3. 175.82g .57 Khi thuỷ phân (xúc tác axit) một este thu được glixerol và hỗn hợp các axit stearic và axit panmitic theo tỉ lệ mol tương ứng bằng 2 : 1. 7.3 mol NaOH.08g. C17 H 33COO C H | C15 H 31COOCH 2 D. % khối lượng của X trong hỗn hợp ban đầu và giá trị m là A. 6. D. 185. Y cần 200ml dung dịch NaOH 1.53 Cho 21.02g natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa). CTCT. thu 9. 7. 165. C17 H 35COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | B.4g. HCOOC2H5 16. C.1M.55 Trong chất béo luôn có một lượng axit béo tự do.6g. D. 15.18%. CH3CH2OOC-COOCH2CH3.54 Khi thuỷ phân a g một este X thu được 0.6g muối và 0.4g hỗn hợp 2 este đơn chức X.2g .Câu 1. CH3COOCH3 19.67%.51 Xà phòng hoá hoàn toàn 0. C.8g chất béo cần 3ml dung dịch KOH 0.56 Tổng số miligam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong một gam chất béo gọi là chỉ số xà phòng hoá của chất béo. 6.2g ancol Y và 20. Vậy chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa 89% tristearin là A.1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0. C. B.5M. C15 H 31COO C H | C15 H 31COOCH 2 13 . (C2H5COO)3C2H5.92g glixerol. Số miligam KOH dùng để trung hoà lượng axit béo tự do trong một gam chất béo gọi là chỉ số axit của chất béo. C3H5(COOCH3)3. Chỉ số axit của mẫu chất béo trên là A. C.08g. 20. B. Công thức cấu tạo thu gọn của X là A. C. Để trung hoà 2. B. Este có thể có công thức cấu tạo nào sau đây? C17 H 35COO C H 2 C17 H 35COO C H 2 | | A. 8. D. Câu 1. B. 8.5M thu được 24.20%. HCOOCH3 66. 8. B. Câu 1.0g. CH3CH2COOCH3. 19. cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và m g một muối khan duy nhất Z. C15 H 31COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | C. 8. 155. (HCOO)3C3H5. C3H5(COOCH3)3. Lượng NaOH dư được trung hoà hết bởi 0. D. C3H5(OOCH)3. Câu 1.2g. 18.2 mol HCl. C. 3. m lần lượt là A. Giá trị của a. Câu 1. Câu 1. D.2g .82g . Sau khi phản ứng hoàn toàn.82g. Câu 1.1 mol một ancol Y. 6. Công thức của X là A.4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức). B.8g chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0. (CH3COO)3C3H5.52 Để xà phòng hoá hoàn toàn 19. 7. D.

175g. D. etyl axetat. B. (1). C. (2) C17H31COOC3H5(OOCC17H29)2.145kg chất béo. B. 3. B. (3). 988kg. (4). 14 . thu 0. Tên X là A. C4H8O2.3kg NaOH. thu được 0.2kg. 917kg.58g hỗn hợp Y gồm muối của axit linoleic và axit oleic. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng lớn hơn khối lượng X đã phản ứng. Chất béo đó là A. 9.092kg glixerol. C.58 Trong chất béo luôn có một lượng axit béo tự do. (C17H35COO)3C3H5. 7. (2).90g. (3). 8. (1). 10.7g chất hữu cơ X cần dùng 3. (2). Giá trị của a là A. B.92g. B. 8. C2H4O2.24g muối của axit béo duy nhất.84kg. Câu 1. Câu 1. (1). C.92 lít O2 (đktc) thu được CO2 và H2O có tỉ lệ mol 1:1. D. (C15H31COO)3C3H5. (C17H33COO)3C3H5. (4). Khối lượng xà phòng 60% (về khối lượng) thu được là A.92g glixerol và 9. (3) (C17H31OOC)2C3H5OOCC17H29.62 Thuỷ phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1. metyl propionat.787kg. B. C. iso propyl fomiat. D. (C15H29COO)3C3H5.Câu 1.65 Một chất hữu cơ X có d X CO2 = 2 . Câu 1.91g. và mg hỗn hợp muối Na. Câu 1. (2). D. C3H4O2. cần dùng 0.92kg. 100g. Vậy công thức phân tử của X là A. (4).84g glixerol và 18. D. Những công thức đúng là A.59 Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. C. Câu 1. C3H6O2. 30% tripanmitoyl glixerol (panmitin) và 20% tristearoyl glixerol (stearin) về khối lượng) khi xà phòng hoá bằng natri hiđroxit. Khối lượng este metyl metacrylat thu được là A.61kg. giả sử hiệu suất quá trình đạt 90% là A. 889. Câu 1. (2). D. B.82g. 3. C. D.64 Đun nóng 215g axit metacrylic với 100g metanol (với Hpứ = 60%).61 Khối lượng xà phòng thu được từ 1 tấn mỡ động vật (chứa 50% trioleoyl glixerol. metyl axetat. (4) (C17H31OCO)2C3H5COOC17H29. Khi thuỷ phân hoàn toàn 2. B. Câu 1.3kg. 125g. C. D. Biết X tác dụng với KOH tạo ra 2 chất hữu cơ. 2. Công thức cấu tạo có thể có của các trieste đó là : (1) (C 17H31COO)2C3H5OOCC17H29. 150g.60 Đun sôi a g một triglixerit X với dung dịch KOH cho đến khi phản ứng hoàn toàn. C.63 Đốt cháy 3. 929.

Công thức cấu tạo của X là A. C. B. C. B. B. 0.2 mol. Tên gọi của X là A.15 mol D.492g muối khan (hao hụt 6%). (CH3COO)2C2H4.Câu 1. C. 7. Nếu đốt cháy cùng một lượng X1 hay X2 sẽ thu được cùng một thể tích CO2 (ở cùng nhiệt độ và áp suất). etyl axetat. Câu 1. Đốt cháy hỗn hợp X sẽ thu được nCO2 − nH 2O = 0. Trong hỗn hợp X. mạch hở. C.71 X là một este hữu cơ đơn chức. 02 . C.70 Cho 7. D. CH2=CH–COOCH3. B. Thuỷ phân X tạo nên 2 hợp chất hữu cơ X1. Trong X chắc chắn có một este với công thức và số mol tương ứng là A.67 Xà phòng hoá 22. D. thu được muối có khối lượng bằng khối lượng 37 este ban đầu. 15 . H – COOC2H5 0. Câu 1. D.2g hỗn hợp gồm 2 este đồng phân. isopropyl fomiat. thu được hỗn hợp muối natri của hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và một chất lỏng L (tỉ khối hơi d L / CH 4 = 3. 625 ). B. C17H35COO(CH2)16CH3. Nung một trong hai muối thu được với NaOH (vôi tôi – xút) sẽ tạo metan. etyl fomiat. Câu 1. CH3 – CH = CH – OCOH. C. Cho lượng 10 chất L phản ứng với Na được 0. Nhận định nào sau đây là sai ? A. thu 20. X là A. CH3COOCH3. CH3COOCH3. C.66 Este X có d X / H 2 = 44 . metyl propionat. CH3 – COOC2H3 0. Câu 1. D.2g muối natriaxetat. X2. II – BÀI TẬP NÂNG CAO Câu 1. B. hai chất Y và Z có số mol bằng nhau.72 Thuỷ phân este X (C4H6O2) trong môi trường axit ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. Cho một lượng X tác dụng hoàn 41 toàn với dung dịch NaOH vừa đủ. CH3 – COOCH3 0. CH2 = CH – OCO – CH3. Câu 1. B. 6. (CH3COO)3C3H5. Công thức của este E là A.4g este E thuỷ phân trong dung dịch NaOH thì thu được 8.69 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit ađipic là A. H – COOC2H5 0. Tên gọi của L là ancol anlylic. cần dùng 12g NaOH. CH3(CH2)2COOCH3. HCOO – CH2 – CH = CH2.68 Đun nóng 3.21g hỗn hợp X gồm hai chất hữu cơ Y và Z cùng nhóm chức với dung dịch NaOH dư.015 mol H2.2 mol. D. D. Chất L 1 phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. H-COOCH3. CH2 = CH – COO – CH3.15 mol. 8.

C. Y. axit valeric. Y lần lượt là A. B. HCOOCH2CH2CH3. glixerol. Nung X với vôi tôi xút thu được ancol Y và muối vô cơ Z. HCOOCH2CH=CH2. Biết rằng một trong 2 chất (X hoặc Y) tạo thành este là đơn chức. Để đốt cháy hoàn toàn 2.6g chất Y cho 1. CH2− O C. ancol isopropylic. Y: C3H8O. Biết oxi hoá X bằng CuO đun nóng được sản phẩm có phản ứng tráng gương. Biết Z là ancol đơn chức. Cho hơi Z qua ống bột đựng Cu xúc tác đun nóng thì sinh ra chất T có khả năng tham gia phản ứng tráng gương. CH3COOCH=CH2. ancol propylic. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng bằng lượng 22 este đã phản ứng. Câu 1. Công thức cấu tạo của E là A.9g một este đơn chức (mạch hở) tác dụng vừa đủ với 150ml dung dịch KOH 1M. B. CH3− CH− 2 CH 2 2 O O − C=O. glixerol.32g CO2. thu được 20. B. Tên X là A. sau phản ứng thu được một muối và một anđehit.76 3.92 lít O2 (đktc) và thu được VCO : V H O = 3 : 2 .Câu 1. D.8g X thì cần 3. Y: C3H8O3. A. X: CH2O2. B. Y: C3H8O3. CH2− 2 CH C=O.4g muối của axit hữu cơ X và 9.77 Thuỷ phân hoàn toàn 0. C2H5− CH− C=O. Câu 1. Đốt cháy hoàn toàn Y thu được CO 2 và H2O có tỉ lệ thể tích 3 : 4.78 Cho 12. axit axetic. Câu 1.73 Một este X tạo bởi axit đơn chức và ancol đơn chức có tỉ khối với He bằng 17 22.52g một este E của axit cacboxylic no đơn chức và ancol no đơn chức (cả hai đều mạch hở) phản ứng vừa hết với 40ml dung dịch NaOH 1M. axit axetic. Câu 1. CTCT của este E và chất Y là (giả sử các phản ứng đều đạt 100%) A. HCOOCH=CH–CH3 và CH3COOCH=CH2. CH3CH2OH. axit fomic. axit metacrylic. D. B. Khi bị oxi hoá chất Y chuyển thành anđehit. D. C2H5COOCH3. Tên gọi của X. axit acrylic. CH3CH2OH. HCOOCH=CH–CH3. Metyl axetat.1 mol este E (chứa một loại nhóm chức) cần dùng vừa đủ 100g dung dịch NaOH 12%. CH3COOCH2CH3. D. CTCT của este không thể là A. 16 . Đốt cháy 0. B.74 Đun hợp chất X với H2O (xúc tác H+) được axit hữu cơ Y ( dY / N2 = 2. CH3CH2OH. ancol benzylic. X: C2H4O2. thu được chất X và chất Y. axit propionic.2g ancol Y. Isopropyl fomiat. glixerol.75 Xà phòng hoá một este no đơn chức E bằng một lượng vừa đủ dung dịch NaOH chỉ thu được một sản phẩm X duy nhất. axit acrylic. C. Xác định công thức phân tử và gọi tên X. ancol anlylic. CH3OCO− CH=CH2. C. HCOOCH(CH3)CH3. X: C2H4O2. C. Metyl propionat. CH3CH2CH2OH Câu 1. X: C3H6O2. D. C. Y: C3H8O3. ancol etanol.57 ) và ancol Z. Etyl axetat. D.

Cho G tác dụng với axit vô cơ loãng thu được G 1 không phân nhánh.83 Đun a gam este mạch không phân nhánh CnH2n+1COOC2H5 với 100ml dd KOH. etyl valerat.445kg. (D = 1. C. (H–COO)3C3H5. C2H5O–C6H4–COOC2H5. Câu 1. Mặt khác muốn trung hoà 20ml dd KOH ban đầu phải dùng 15ml dd H2SO4 nói trên. D.16%. Tên gọi của este đó là A. C.14%.82 Muốn thuỷ phân 5. (CH2=C(CH3)–COO)3C3H5. Biết rằng H 2O n 86 CTCT thu gọn của X. Thành phần % khối lượng của etyl axetat trong hỗn hợp là A.79 Đốt cháy 1. benzyl fomiat. 117. B. C. 36.245kg. etyl butyrat. D. Muốn trung hoà dung dịch chứa 0. B. Câu 1.9035g X cần 54.2M. (CH2=CH–COO)3C3H5.6kg. 52.85 Để thuỷ phân 0.18%.01 mol este của một ancol đa chức với một axit cacboxylic đơn chức cần dùng 1. phenyl fomiat.81 Khi thuỷ phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. 17 . CTCT của este là A. C. 6. etyl axetat. khối lượng muối natri thu được là A. D. còn Y tác dụng với nước brom sinh ra kết tủa trắng. 103. Câu 1. C.60g một este E đơn chức được 3.10kg natri hiđroxit.20%. Cho 10g E tác dụng với lượng NaOH vừa đủ. 2. B. D. C2H5OOC–C6H4–COOC2H5 D. Giả sử phản ứng xảy ra hoàn toàn.84 Thuốc chống muỗi (DEP) thu được khi cho axit thơm (X) tác dụng với ancol Y. B. B.35g este đó cần 3g NaOH và thu được 7. Y lần lượt là A. C.6g hỗn hợp etyl axetat và etyl fomiat cần 25. Khi a = 5. Sau phản ứng phải dùng 25ml dd H2SO4 0. Câu 1.08g/ml). B. Câu 1. 108. 8.80 Để xà phòng hoá 100kg dầu ăn thuộc loại trioleoyl glixerol có chỉ số axit bằng 7 cần 14.8g thì tên gọi của este là A. CH3–C6H4–COOC2H5.89kg.52g CO2 và 1.2g NaOH. etyl propionat. 100 < M X < 200 . anlyl butyrat.05g muối. X khử được AgNO3 trong amoniac. Trong ancol = dung dịch ancol Y 94% (theo khối lượng) tỉ số mol n 14 .Câu 1. 4. Câu 1. C.5M để trung hoà KOH còn dư.00g muối khan G. B. C2H5OOC–C3H4–COOC2H5. (CH3COO)2C2H4. 50. Mặc khác để thuỷ phân 6.96ml NaOH 10%. cô cạn dung dịch sau phản ứng thu được 14. Số lượng CTCT thoả mãn tính chất đã nêu của E là A. vinyl pentanoat. D.152g H2O. 118. D.5ml NaOH 0. 47.

90. Câu 1. 2.05 mol khí. metyl acrylat. Câu 1. Y) với dung dịch H2SO4 loãng. CTCT của X. C. vinyl axetat. D. Biết rằng các gốc hiđrocacbon đều có độ phân nhánh cao nhất. 3. 170kg và 80kg. Câu 1.2M.20%.18%. Y là A. (CH3)2CHCOOH. (CH3)2CHCOOH. A.5kg và 41kg. 190. B. CH3CH2CH2COOH. etyl axetat. (CH3)3CCOOH. 20.Câu 1. Khi cho 3. Câu 1. cần dùng 30ml dd NaOH 1M. D. 20. 188. metyl propionat. CH3CH2CH2CH2COOH. B. (CH3)2CHCOOH. Cho hỗn hợp muối đó tác dụng H2SO4 dư được hỗn hợp 3 axit X. Số CTCT của E và CTCT của các axit X.92 Một mẫu chất béo chứa gồm trilein và tripanmitin có chỉ số iot là 19. HCOOC(CH3)3 và CH3COOCH(CH3)2.5M.19%. (CH3)2CHCOOH.9g A với NaOH cho tới phản ứng hoàn toàn. C. 18. Z là đồng đẳng kế tiếp của Y và có mạch cacbon không phân nhánh. mạch hở. B.920.3M. để trung hoà NaOH dư phải dùng 10ml HCl 0. 85. C. 173.188. 3. trong đó X và Y là đồng phân của nhau.22g hỗn hợp hai este là đồng phân X và Y. (CH3)2CH-COOC2H5 và (CH3)2CHCH2COOCH3. C. CH3COOC(CH3)3 và CH3CH2COOCH(CH3)2. Z. D. Câu 1.05. D. C. C.6g hỗn hợp muối. Đun 7. (CH3)3CCOOH.736. 273. Khi đốt cháy hoàn toàn hỗn hợp hai este đó thì thu được khí CO2 và hơi nước với tỉ lệ thể tích VH2O :VCO2 = 1:1 . Y.88 Đun nóng hỗn hợp hai chất đồng phân (X.90 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu. thu được 8.9g hỗn hợp ancol trên tác dụng hết với Na thu được 0. B.89 E là este của glixerol với một số axit monocacboxylic no. 191.868. Y. CH3CH2CH2CH2COOH. 228. (CH3)2CH-COOC2H5 và (CH3)3COOCH3. D. D. metyl axetat. Câu 1. CH3(CH2)3COOH. Tên gọi của hai este là A. Hoà tan 1g hỗn hợp axit trên vào 50ml NaOH 0. CH3CH2CH2COOH. Biết hiệu suất quá trình este hoá và quá trình trùng hợp lần lượt là 60% và 80%. etyl fomiat. Z lần lượt là A.91 Số gam iot có thể cộng vào liên kết bội trong mạch cacbon của 100g chất béo được gọi là chỉ số iot của chất béo. propyl fomiat. 192. 215kg và 80kg. 2. C. Phân tử 10 khối trung bình của các axit béo trong thành phần cấu tạo của lipit và chỉ số xà phòng hoá của lipit và lần lượt là A. cần dùng 90ml dung dịch HCl 0. Chỉ số iot của chất béo được tạo nên từ axit linoleic là A.87 Để xà phòng hoá hoàn toàn 2. 86. isopropyl fomiat. 286. thu được hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và hai ankanol. B.86 Đun 20g lipit với dung dịch chứa 10g NaOH. 196. CH3(CH2)3COOH. 287.1%. 22. 1 để trung hoà dung dịch thu được. B. Phần trăm về khối lượng của một trong hai glixerit phải là A. D. 18 . B. Sau khi kết thúc phản ứng. 65kg và 40kg.

nên không có khả năng mở vòng. glucozơ tồn tại chủ yếu ở hai dạng α -glucozơ và β glucozơ (dạng mạch vòng). Trong thiên nhiên. cấu tạo bởi C 1 của gốc α . CACBOHIĐRAT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.glucozơ qua nguyên tử O (C1 – O – C4).CHƯƠNG II. hai dạng vòng này chiếm ưu thế và luôn chuyển hoá lẫn nhau theo một cân bằng qua dạng mạch hở. CH2OH[CHOH]3-CO-CH2OH CH2OH[CHOH]4CHO b) Saccarozơ và mantozơ (C12H22O11) Saccarozơ là một đisaccarit. cấu tạo bởi một nhóm cacbonyl ở C1 (là anđehit) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]4CHO. Mantozơ là đồng phân của saccarozơ. cấu tạo bởi C1 của gốc α . Cấu trúc phân tử a) Glucozơ và fructozơ (C6H12O6) Glucozơ là monosaccarit. Trong phân tử không còn nhóm OH semiaxetal. do đó có thể mở vòng tạo thành nhóm anđehit (– CHO). fructozơ có sự chuyển hoá thành glucozơ. Trong dung dịch. cấu tạo bởi một nhóm cacbonyl ở vị trí C2 (là xeton) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]3COCH2OH. H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 1 OH H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 6 CH2OH 5 OH 3 H O H 2 OH H OH 1 O C 1 H H 4 OH α -glucozơ glucozơ β -glucozơ Glucozơ có đầy đủ các tính chất của rượu đa chức và anđehit đơn chức. Đơn vị monosaccarit thứ hai có nhóm OH semiaxetal tự do. 19 .hoặc β .glucozơ nối với C2 của gốc β fructozơ qua nguyên tử O (C1 – O – C2). Fructozơ là đồng phân của glucozơ.glucozơ nối với C4 của gốc α . Cùng với dạng mạch hở fructozơ có thể tồn tại ở dạng mạch vòng 5 cạnh hoặc 6 cạnh H OH 2 H O OH H 5 2 1 O H O OH H 5 1 CH2OH 2 OH H 3 OH O OH H 5 HOCH2 3 1 OH 4 CH2OH H 6 HOCH2 3 OH H 4 CH2OH 6 4 CH2OH H 6 α -fructozơ fructozơ OH- β -fructozơ Trong môi trường bazơ.

phân tử không có nhóm CHO và các nhóm OH bị che lấp đi. (-) không có phản ứng. cấu tạo bởi các mắt xích α -glucozơ liên kết với nhau thành mạch xoắn lò xo. 20 . (*) phản ứng trong môi trường kiềm.c) Tinh bột và xenlulozơ (C6H10O5)n Tinh bột là polisaccarit. nên công thức của xenlulozơ còn có thể viết [C6H7O2(OH)3]n. Xenlulozơ là đồng phân của tinh bột. phân tử không có nhóm CHO và mỗi mắt xích còn 3 nhóm OH tự do. 2. Tính chất hoá học Cacbohiđrat Glucozơ Tính chất T/c của anđehit + [Ag(NH3)2]OH T/c riêng của –OH hemiaxetal + CH3OH/HCl T/c của poliancol + Cu(OH)2 T/c của ancol (P/ư este hoá) + (CH3CO)2O Ag↓ + Ag↓ Fructozơ Saccarozơ Mantozơ Tinh bột Xenlulozơ Metyl glucozit - - Metyl glucozit - - dd màu xanh lam dd màu xanh lam dd màu xanh lam dd màu xanh lam - - + + + + + Xenlulozơ triaxetat Xenlulozơ trinitrat + + HNO3/H2SO4 P/ư thuỷ phân + H2O/H+ P/ư màu + I2 - + + + + - Glucozơ + Fructozơ Glucozơ Glucozơ Glucozơ - - - - màu xanh đặc trưng - (+) có phản ứng. không yêu cầu viết sản phẩm. cấu tạo bởi các mắt xích β -glucozơ liên kết với nhau thành mạch kéo dài.

MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP  → 1.t0 Men lactic 6. 6H–CHO → C6H12O6 10.2H2O 16. C6H12O6  2CH3–CHOH–COOH → Axit lactic (axit sữa chua) Men → 7. C6H12O6  2C2H5OH + 2CO2↑ → o Ni. CH 2 OH[CHOH]4 CHO + 2[Ag(NH 3) 2]OH  CH 2OH[CHOH] 4COONH 4 +2Ag ↓ + glucozơ amoni gluconat Men röôï u 5. (C6H10O5)n + nH2O  → hoaë men c Axit voâ loaõ g.CaO.B . CH2OH[CHOH]3COCH2OH ← CH2OH[CHOH]4CHO  12. t 0 cô n nC6H12O6 21 . 6 CH2OH H 4 OH 5 OH 3 H O H 2 OH H 1 OH H 6 CH2OH 5 OH 3 H OH − O H 2 OH H 1 + HOCH3 HCl 4 OH + H2O OCH3 metyl α -glucozit  → 11.CaO.CH2OH[CHOH]4CHO+5CH3COOH ← CH3COOCH2[CHOOCCH3]4CHO  Xt. CH2OH[CHOH]4CHO + H2  CH2OH[CHOH]4CH2OH → Sobit (Sobitol) t0 3.2H2O + CO2  C12H22O11 + CaCO3↓ 2H2O + → 17. (C6H10O5)n + nH2O t0  → xt: H + (Glucozơ) nC6H12O6 (Xenlulozơ) (Glucozơ) Ca(OH)2 9. CH2OH[CHOH]4CHO + 2Cu(OH)2  CH2OH[CHOH]4COOH + Cu2O↓ + → +2H2O t → 3NH 3 + O H 2 4. C12H22O11. (C6H10O5)n + nH2O  nC6H12O6 Hoaë H+ c (Tinh bột) 8. C12H22O11 + H2O  C6H12O6(Glucozơ) + C6H12O6(Fructozơ) → → 15. C12H22O11 + Ca(OH)2 + H2O  C12H22O11. CH2OH[CHOH]4CHO + Br2 + H2O  CH2OH[CHOH]4COOH + 2HBr → 3+ 13. → H 2SO4 loaõ g n 14. CH2OH[CHOH]4COOH + Fe  tạo phức màu vàng xanh.t0 (pentaaxetyl glucozơ) + H2O 2.

phản ứng với Na và với dung dịch AgNO3 trong amoniac. C.0g. [C6H7O2(OH)3]n + 3nHONO2  [C6H7O2(ONO2)3]n + 3nH2O → (HNO3) xenlulozơ trinitrat C. phản ứng với Cu(OH)2 và với dung dịch AgNO3 trong amoniac. C.1 Tìm từ thích hợp để điền vào chỗ trống trong đoạn văn sau: Ở dạng mạch hở glucozơ và fructozơ đều có nhóm cacbonyl.3 Có mấy loại cacbohiđrat quan trọng? A.0g. B. 2. C. Câu 2. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)m. D. t 0 20. B.2g. nhưng trong phân tử glucozơ nhóm cacbonyl ở nguyên tử C số …. 1. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)n. 1.BÀI TẬP CƠ BẢN Câu 2. glucozơ. Câu 2. phản ứng với NaOH và với dung dịch AgNO3 trong amoniac. 6nCO2 + 5nH2O Dieä luï p c  → a/ s maë trôø t i glucozơ (C6H10O5)n 0 Axit voâ loaõ g. C. Khối lượng bạc đã sinh ra bám vào mặt kính của gương và khối lượng AgNO 3 cần dùng lần lượt là (biết các phản ứng xảy ra hoàn toàn) A. Cacbohiđrat là những hợp chất hữu cơ tạp chức và đa số chúng có công thức chung là Cn(H2O)m. B.0g. Trong môi trường bazơ. 2. 43. t cô n 19.BÀI TẬP TRẮC NGHIỆM I. Câu 2. (C6H10O5)n + nH2O  nC6H12O6 → xenlulozơ glucozơ H 2SO4 ñ. 43. glucozơ. 68.2g.2g. 21. 2 loại. ngược lại. D. 1 loại. 2. glucozơ. mantozơ. 43. ngược lại. glucozơ.0g.tinh bột 18. D. D. ngược lại. 22 . B.4 Những thí nghiệm nào chứng minh được cấu tạo phân tử của glucozơ? A. B. C. 1. 4 loại. 2. fructozơ có thể chuyển hoá thành … và … A. phản ứng với CuO và với dung dịch AgNO3 trong amoniac.5 Để tráng bạc một chiếc gương soi. Cacbohiđrat là những hợp chất hữu cơ tạp chức. 68. 68. 2. người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac. 34. 3 loại. D.6g. Câu 2. còn trong phân tử fructozơ nhóm cacbonyl ở nguyên tử C số….2 Cacbohiđrat là gì? A.

glixerol tác dụng với Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. lòng trắng trứng và rượu etylic. Cu(OH)2/OH . C. D. Cả B. B. B.8 Có bốn lọ mất nhãn chứa: Glixerol. D. Câu 2. Câu 2. B. C. Na kim loại. C. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên ? A. Cho từng chất tác dụng với dung dịch iot. tinh bột và xenlulozơ ở dạng bột? A. dung dịch HNO3 đặc. có thể chỉ dùng một thuốc thử nào sau đây? − A. Câu 2. B.12 Chọn câu phát biểu sai: A. tinh bột và xenlulozơ đều cho một loại monosaccarit. C đều đúng. D. [Ag(NH3)2]OH. glixerol. Cho từng chất tác dụng với dung dịch HNO3/H2SO4. Hoà tan từng chất vào nước. glixerol. còn lại glixerol. sau đó đun nóng và thử với dung dịch iot. Saccarozơ là một đisaccarit. dung dịch AgNO3/NH3. Glixerol tác dụng Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. saccarozơ và anđehit axetic có thể dùng chất nào trong các chất sau làm thuốc thử ? − A. còn lại hồ tinh bột. chỉ khác nhau về cấu tạo của gốc glucozơ. B. NaOH. glucozơ và axit axetic. Câu 2. D. A. B. C. C. Câu 2. Iot làm hồ tinh bột hoá xanh. dung dịch KMnO4.11 Có 4 dung dịch loãng không màu gồm: Lòng trắng trứng.10 Chọn cách phân biệt các dung dịch sau đây: Lòng trắng trứng. C. C.6 Phương án nào dưới đây có thể phân biệt được saccarozơ. 23 . dung dịch CuSO4. dung dịch HCl.9 Để phân biệt các chất: Glucozơ. Khi thuỷ phân đến cùng saccarozơ. B. AgNO3/NH3. Cu(OH)2/OH .7 Để phân biệt các dung dịch glucozơ. lòng trắng trứng tác dụng Cu(OH)2 cho màu xanh tím. Iot làm hồ tinh bột hoá xanh. glixerol.Câu 2. Chỉ dùng một thuốc thử nào sau đây để phân biệt chúng. KOH và axit axetic. dung dịch brom. Nước brom. Cu(OH)2 trong môi trường kiềm. anđehit axetic. khi đun nóng lòng trắng trứng đông tụ. ancol etylic. D. HNO3. Cho từng chất tác dụng với vôi sữa Ca(OH)2. D. A. còn lại lòng trắng trứng. dung dịch HNO3. Câu 2. hồ tinh bột. Tinh bột và xenlulozơ đều là polisaccarit.

690kg. mantozơ. tinh bột và xenlulozơ đều cho glucozơ.74g.14 Cho các chất glucozơ. xenlulozơ.74g. 24 . Câu 2.99kg. glucozơ. Chất đó là chất nào trong các chất sau ? A. 18. không mùi. B. B.90kg.8g.5g.500kg. A. không màu. khối lượng ancol thu được là A.4g. 0. glucozơ. tinh bột. D. thì khối lượng glucozơ thu được là bao nhiêu ? Giả thiết rằng. C.13 Cùng là chất rắn kết tinh. 52. tinh bột.21 Cho glucozơ lên men tạo thành ancol.0g. 0. fructozơ. Glucozơ. C. 91. D. C. Câu 2.17 Khi thuỷ phân 1kg bột gạo có 80% tinh bột. glucozơ và xenlulozơ. 0. khí CO2 tạo thành được dẫn qua dung dịch nước vôi trong dư. Câu 2. xenlulozơ. saccarozơ và tinh bột.0g. B.5g. C.18 Tính khối lượng glucozơ tạo thành khi thuỷ phân 1kg mùn cưa có 50% xenlulozơ. 27. 52. B. chỉ có glucozơ. xenlulozơ. 64. C. glucozơ và fructozơ.0g. 0. fructozơ. 88. 23. B.80kg. vừa có tính chất của anđehit là A. Khi thuỷ phân đến cùng. fructozơ.19 Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. saccarozơ. fructozơ. người ta phải dùng 100g saccarozơ. 91. Câu 2. Câu 2. Saccarozơ. Saccarozơ.16 Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol là 1:1. axit axetic. 102. A. D. mantozơ.D. sự chuyển hoá của fructozơ là không đáng kể và hiệu suất các phản ứng đều đạt 90%) A. D. Glucozơ. D. Giả thiết hiệu suất phản ứng là 80%. Glucozơ. tinh bột. C. C. fructozơ. glucozơ và saccarozơ. 28. tất cả các chất đã cho. có vị ngọt là tính chất vật lí và trạng thái tự nhiên của nhóm chất nào sau đây? A. Chất vừa có tính chất của ancol đa chức. D. D.444kg. phản ứng xảy ra hoàn toàn.8g. D. thu được 50g kết tủa.8g. biết hiệu suất lên men là 80%. Câu 2. Khối lượng AgNO3 cần dùng và khối lượng Ag tạo ra lần lượt là (giả thiết rằng.20 Nhóm gluxit đều có khả năng tham gia phản ứng tráng gương là A. fructozơ và saccarozơ. 50. Câu 2. fructozơ. Chất này có thể lên men rượu (ancol). Saccarozơ. tinh bột. Câu 2. C. C. B. Glucozơ. Câu 2. dễ tan trong nước. 0.6g. 0. 0. Mantozơ. glucozơ. B. D. xenlulozơ. B.555kg. sacacrozơ. glucozơ. saccarozơ.15 Để tráng bạc một số ruột phích. 0. glucozơ và tinh bột. hex-3-en.89kg. B.

mantozơ. 25 .23 Nhóm gluxit khi thuỷ phân hoàn toàn đều chỉ tạo thành glucozơ là: A. 336. đun nóng. đun nóng. Cu(OH)2. C. C. thể tích không khí (đktc) cần cung cấp cho cây xanh quang hợp để tạo 162g tinh bột là A. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. Saccarozơ.22 Chọn sơ đồ phản ứng đúng của glucozơ A. D. C6H12O6  m e → C2H5OH + O2 Câu 2. Tinh bột có cấu trúc phân tử mạch không phân nhánh. Mantozơ. Phân biệt glucozơ và saccarozơ bằng phản ứng tráng gương. Câu 2.103 lít. NaOH. xenlulozơ. B. Phân biệt saccarozơ và glixerol bằng Cu(OH)2. B. H2/Ni . D. nhiệt độ. CH3COOH/H2SO4 đặc. B. nhiệt độ. H2O/H+.03% thể tích không khí.Câu 2.27 Chọn câu phát biểu sai: A.103 lít. Cu(OH)2.28 Chọn câu phát biểu đúng: A. [Ag(NH3)2]OH. mantozơ. C. Phân biệt mantozơ và saccarozơ bằng phản ứng tráng gương.103 lít. D. Phân biệt tinh bột và xenlulozơ bằng I2. Metyl α . nhiệt độ. C. Trong dung dịch. Câu 2. mantozơ. H2/Ni. [Ag(NH3)2]OH. D.103 lít.26 Glucozơ tác dụng được với tất cả chất trong nhóm chất nào sau đây? A. D. 448. Glucozơ và fructozơ là đồng phân cấu tạo của nhau. [Ag(NH3)2]OH. Phân biệt glucozơ và fructozơ bằng phản ứng tráng gương.24 Phát biểu nào sau đây không đúng ? A. nhiệt độ. C6H12O6  m e → CH3–CH(OH)–COOH C.glucozit không thể chuyển sang dạng mạch hở.25 Biết CO2 chiếm 0. tinh bột. Câu 2. Na2CO3. xenlulozơ. B. xenlulozơ. C6H12O6 + Cu(OH)2  → kết tủa đỏ gạch n B. tinh bột. Câu 2. Cu(OH)2. B. [Ag(NH3)2]OH. 224. C. tinh bột. C6H12O6 + CuO  → Dung dịch màu xanh n D. 112. B. Câu 2. H2/Ni . glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở. H2/Ni . Cu(OH)2. Saccarozơ. Saccarozơ.

56g. 60g. to.39 Cacbohiđrat khi thuỷ phân tạo ra 2 phân tử monosaccarit là 26 . Câu 2. Câu 2. C. (C6H12O6)n. (C6H10O5)n. phản ứng tráng gương.37 Một polisaccarit (C6H10O5)n có khối lượng phân tử là 162000u. 50g. quá trình oxi hoá. dung dịch Br2. C. Câu 2. phản ứng với kim loại Na.29 Phương trình: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. tinh bột. Tên gọi X. 56. Câu 2. D. D.38 Gluxit không thể thuỷ phân được nữa là A. 900. Câu 2. tinh bột. n có giá trị là A. C. [C6H7O2(OH)3]n. [C6H7O2(OH)3]n. C. Glucozơ. D. B. mantozơ.36 Công thức phân tử và công thức cấu tạo của xenlulozơ lần lượt là A. fructozơ thành những sản phẩm giống nhau là A. D. B. Glucozơ → etanol. etanol. asmt → Câu 2. [C6H7O2(OH)3]n. B. B. saccarozơ. B.25g. D. 950. Glucozơ + H2/Ni . [C6H7O2(OH)2]n. Glucozơ + [Ag(NH3)2]OH. Y lần lượt là A. Glucozơ. D. Glucozơ. D.C. CxHyOz. fructozơ. o C. B.31 Phản ứng khử glucozơ là phản ứng nào sau đây ? A. D. B. etanol. C. C. xenlulozơ. xenlulozơ. Câu 2. Phân biệt saccarozơ và glixerol bằng phản ứng thuỷ phân. B. [Ag(NH3)2]OH. C. B. Cu(OH)2. men C. t . Câu 2. D. Câu 2. quá trình quang hợp. quá trình khử. Cn(H2O)m. 1000. C. D. H2. R(OH)x(CHO)y. Câu 2. etanol. quá trình hô hấp.30 Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → sobit. Khối lượng tinh bột cần dùng là A.nH2O. phản ứng với H2/Ni. Dung dịch mantozơ có tính khử và bị thuỷ phân thành glucozơ. mantozơ. glucozơ. Câu 2. là phản ứng Clorofin hoá học chính của quá trình nào sau đây? A. Glucozơ. 1500. (C6H10O5)n.32 Để điều chế 45g axit lactic từ tinh bột và qua con đường lên men lactic. (C6H10O5)n. D.33 Phản ứng chuyển glucozơ. phản ứng với Cu(OH)2.35 Cacbohiđrat (gluxit) là những hợp chất hữu cơ tạp chức và có công thức chung là A. hiệu suất thuỷ phân tinh bột và lên men lactic tương ứng là 90% và 80%.34 Thuốc thử phân biệt glucozơ với fructozơ là A. Glucozơ + Cu(OH)2. C. B.

27 . C. Câu 2. Xenlulozơ. saccarozơ. Cu(OH)2 ở nhiệt độ thường. amilozơ. Câu 2. đều hoà tan Cu(OH)2 ở nhiệt độ thường tạo dung dịch màu xanh đặc trưng. phản ứng cộng hiđro. D. D. Xenlulozơ.4%. phản ứng khử Cu(OH)2.48 Phản ứng chứng tỏ glucozơ có nhiều nhóm OH ở các nguyên tử cacbon liên tiếp nhau là phản ứng với A. nồng độ của glucozơ có giá trị hầu như không đổi là A. saccarozơ. [Ag(NH3)2]OH. glucozơ tác dụng với Cu(OH)2. B. saccarozơ. Câu 2. C. Câu 2. xenlulozơ. đều có trong biệt dược “huyết thanh ngọt”. alanin. C. B. B. D. đều lấy từ củ cải đường. glucozơ. glixerol. tinh bột.1%.44 Để xác định trong nước tiểu của người bị bệnh tiểu đường có chứa một lượng nhỏ glucozơ. Tinh bột. có thể dùng 2 phản ứng hoá học là A. D.42 Chất không phản ứng với glucozơ là A. B. 0. đều tham gia phản ứng tráng gương. D. I2.2%. fructozơ. D. Tinh bột. tinh bột. phản ứng tráng gương. D. B.40 Saccarozơ và glucozơ có đặc điểm giống nhau là A.47 Tinh bột trong gạo nếp chứa khoảng 98% là A. B. B. Câu 2. khử glucozơ bằng H2/Ni. Câu 2. to. phản ứng tráng gương.45 Sobit (sobitol) là sản phẩm của phản ứng A. D.A. 0. D. C. C. B. Saccarozơ. amilopectin. oxi hoá glucozơ bằng [Ag(NH3)2]OH. xenlulozơ. Câu 2.3%. phản ứng lên men rượu etylic. Câu 2. B. dung dịch AgNO3 trong dung dịch NH3. 0. Câu 2. Saccarozơ. phản ứng tráng gương. C. C. amilopectin. 0. amilozơ. phản ứng thuỷ phân. C. phản ứng tráng gương.43 Trong máu người. amilozơ. Cu(OH)2. B. mantozơ. lên men rượu etylic.41 Polisaccarit khi thuỷ phân đến cùng tạo ra nhiều monosaccarit là A. H2/Ni.46 Gluxit chuyển hoá thành glucozơ trong môi trường kiềm là A. Mantozơ. C.

AgNO3/NH3. bị oxi hoá bởi … trong môi trường bazơ. t . dung dịch brom. phản ứng với Cu(OH)2. (5). (5).1%. B.1%.50 Phân tử glucozơ tác dụng với Cu(OH)2 cho ….52 Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm ? A. D. (3).53 Fructozơ không phản ứng với chất nào sau đây? A. (3). (1). Cacbohiđrat là những … và đa số chúng có công thức chung là … (1) dung dịch màu xanh lam. (7). tác dụng với axit tạo sobitol. C.49 Phản ứng chứng minh glucozơ có nhóm chức anđehit là A. C. D. phản ứng với H2/Ni. tác dụng với axit tạo este có 5 gốc axit. C. (2).1% → 0. Câu 2. nóng.51 Khi nào bệnh nhân được truyền trực tiếp dung dịch glucozơ (còn được gọi với biệt danh “huyết thanh ngọt”). Câu 2.1%. B. (8). (4) fructozơ. (1). (5) poliancol. (7). phản ứng với AgNO3/NH3. (7) hợp chất hữu cơ tạp chức.C.2%. vậy trong phân tử … ở … Tương tự như glucozơ. Câu 2. Câu 2. Từ hay cụm từ thích hợp ở những chỗ trống trong các câu ở đoạn văn trên lần lượt là A. (6) phức bạc amoniac. phản ứng với CH3OH/HCl. Khi bệnh nhân có lượng glucozơ trong máu > 0. (1). B. Cu(OH)2. Cho etilen tác dụng với dung dịch H2SO4 loãng. Khi bệnh nhân có lượng glucozơ trong máu = 0. C. (2). (2). C. (7). phản ứng tráng gương. … cộng với hiđro cho …. (4). D.54 Phản ứng nào sau đây chứng tỏ glucozơ có dạng mạch vòng? A. tác dụng với Cu(OH)2 tạo dung dịch có màu xanh đặc trưng. (4). H2/Ni. (3). Cu(OH)2 ở nhiệt độ cao. (3). B. (8). (6). Lên men glucozơ. (4). (6). to. Khi bệnh nhân có lượng glucozơ trong máu < 0. Câu 2. Câu 2. (5). (8). (4). o C. D. 28 . D. (1). D. (8). (2). (5). (3) vị trí kề nhau. Khi bệnh nhân có lượng glucozơ trong máu từ 0. (6). D. A. Thuỷ phân dẫn xuất etyl halogenua trong môi trường kiềm. (8) Cn(H2O)m. B. B. Cho hỗn hợp etilen và hơi nước qua tháp chứa H3PO4. (7). phản ứng lên men rượu etylic. (6). (2) có nhiều nhóm OH.

B. lên men thành ancol etylic.26g. C2H4O2. C6H12O6. C3H6O3. C. C6H12O6. C6H12O6.60 Một cacbohiđrat (Z) có các phản ứng diễn ra theo sơ đồ chuyển hoá sau Cu(OH)2/NaOH to dung dịch xanh lam kết tủa đỏ gạch Z Vậy Z không thể là A. (4). Câu 2.32g. C. (4) CH3COOH (H2SO4 đặc) A. 90.65kg. C3H6O3. C2H4O2. 6CO2 + 6H2O C6H12O6 + 6O2 Nếu trong một phút. T. 14. Khối lượng ancol etylic thu được bằng bao nhiêu? A. lượng glucozơ tổng hợp được bao nhiêu? A.4g CO2 thì kèm theo 1. Câu 2. Khối lượng dung dịch so với ban đầu giảm 3. B. Câu 2. giá trị của a là A. ancol bị hao hụt 5%.55 Phản ứng tổng hợp glucozơ trong cây xanh cần được cung cấp năng lượng là 2813kJ cho mỗi mol glucozơ tạo thành.37kg. 4. C2H4O2. Trong quá trình chế biến.58 Cho 4 chất hữu cơ X. cho toàn bộ lượng CO2 sinh ra hấp thụ vào dung dịch nước vôi trong tạo thành 10g kết tủa. Z. CH2O. (2) Cu(OH)2. Y. Z. CH2O. 6.26g. T lần lượt là A.BÀI TẬP NÂNG CAO Câu 2.II.4g. Câu 2. nhưng chỉ 10% được sử dụng vào phản ứng tổng hợp glucozơ. C. Công thức phân tử của X. (2). T lần lượt là 6:1:3:2 và số nguyên tử cacbon trong mỗi chất không nhiều hơn 6.09J năng lượng mặt trời. 88. C3H6O3. Câu 2. (1). 15. CH2O. 13. to. Khi oxi hoá hoàn toàn từng chất đều cho cùng kết quả: Cứ tạo ra 4. B. D. Y. B. 29 . Y. Biết hiệu suất của quá trình lên men là 90%. C6H12O6. (2). Tỉ lệ phân tử khối của X. B.32g. D. Với một ngày nắng (từ 6h00 – 17h00) diện tích lá xanh là 1m2. saccarozơ. C2H4O2. (1). C3H6O3. Z. B.84kg. D. D. C. 5.8g H2O và cần một thể tích oxi vừa đúng bằng thể tích CO2 thu được. C.59 Saccarozơ đều tác dụng được với nhóm chất nào sau đây ? (1) H2/Ni.56 Cho 10kg glucozơ chứa 10% tạp chất. (2). (3) [Ag(NH3)2]OH. mỗi cm2 lá xanh nhận được khoảng 2. (3). 12. CH2O. (4). 4.57 Lên men a g glucozơ. 88. D.56kg. 90. glucozơ.

được đều chế từ xenlulozơ và axit nitric. (C6H10O5)n C6H12O6 CH3CHO CH3COOH CH3COOC2H5 C. hiệu suất quá trình là 70% thì khối lượng nguyên liệu xấp xỉ A. Giá trị m cần dùng là bao nhiêu ? A. 950. C12H22O11.0g kết tủa. Câu 2. D.2. C.39 lít.5.61 Đốt cháy hoàn toàn 0. mỗi mũi tên biểu thị một phản ứng hoá học).63 Cho sơ đồ chuyển đổi sau (E.01 mol một cacbohiđrat (X). D. Z phù hợp với sơ đồ sau là Q X E CO2 C2H5OH Z Y E Q X Y Z A. C đều sai. tỉ lệ khối lượng H và O trong X là 0. Xenlulozơ và tinh bột có phân tử khối gần bằng nhau.98g H2O. toàn bộ lượng CO2 sinh ra cho qua dung dịch Ca(OH)2 dư. B. 949. mantozơ.70kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric 96% (D=1. 30 . Câu 2. 5031kg.65 Chọn câu đúng trong các câu sau: A. C. 15. (C6H10O5)n C6H12O6 CH3CHO CH3COONH4 CH3COOH D. 5000kg. B. B. Nếu muốn điều chế một tấn ancol etylic. Xenlulozơ và tinh bột có phân tử khối nhỏ. Y. Xenlulozơ có phân tử khối nhỏ hơn tinh bột. C. Công thức của E. X. Câu 2.0.00 lít. 940. Công thức phân tử của X là A. fructozơ.39 lít. A. Z là hợp chất hữu cơ. Câu 2. 1000. Câu 2. Xenlulozơ và tinh bột đều có phân tử khối rất lớn. C. 14. D. Y.C. D.66 Để sản xuất ancol etylic người ta dùng nguyên liệu là mùn cưa và vỏ bào từ gỗ chứa 50% xenlulozơ.28g CO2 và 1. X. thu được 750.62 Cho m g tinh bột lên men để sản xuất ancol etylic.52 g/ml) cần dùng là bao nhiêu ? A. C12H22O11 C6H12O6 CH3COOH CH3COOC2H5 CH3COONa B.64 Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh. nhưng phân tử khối của xenlulozơ lớn hơn nhiều so với tinh bột. D. B. Q.0. Biết hiệu suất mỗi giai đoạn lên men là 80%.125:1. C12H24O12. Biết rằng. (C6H10O5)n.39 lít. 24. thu được 5. B. Muốn điều chế 29. B. Câu 2. 15. C6H12O6. Q.

Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A.8kg. C.67 Chọn phát biểu sai: A. B.4104g X thu được thể tích khí đúng bằng thể tích 0. 1218.0552g hỗn hợp hơi ancol etylic và axit fomic đo trong cùng điều kiện.7 lít. 400kg. C6H12O6. B. B.84% và 22.8kg ancol etylic thành ancol 40o. đồng thời khối lượng dung dịch tăng 0. 76. Câu 2. 1382666. Câu 2.1g kết tủa và dung dịch A. tất cả đều sai. D. 389. 1382600 lít.16%. 398.8 g/cm3. 31 . Câu 2. C.8kg.70 Pha loãng 389. D. hiệu suất của mỗi quá trình lên men là 85%. (C6H10O5)n. xenlulozơ điaxetat và 6.1g kết tủa nữa. D.68 Cho xenlulozơ phản ứng với anhiđrit axetic (xúc tác H2SO4 đặc). B.7 lít. Thể tích dung dịch ancol thu được là A. 77.03% thể tích không khí. D. C18H36O18. C. tất cả đều sai. 5100kg. Công thức phân tử của X là A. to. Biết khi làm bay hơi 0.25 lít. 70% và 30%. 77% và 23%.16%. Tinh bột và xenlulozơ không thể hiện tính khử vì trong phân tử không có nhóm chức anđehit (–CH=O). C. thu được 11. 1246. C12H22O11. 6200kg.0815g.1g hỗn hợp X gồm xenlulozơ triaxetat. Sản phẩm được dẫn vào nước vôi trong thu được 0.72 Đốt cháy hoàn toàn 0.C. C.25 lít. Khối lượng ancol thu được là A. 1206. 1402666. 390kg. C. Muốn tạo ra 500g tinh bột thì cần bao nhiêu lít không khí (đktc) để cung cấp đủ lượng CO2 cho phản ứng quang hợp? Giả thiết hiệu suất quá trình là 100% A. biết khối lượng riêng của ancol etylic là 0. Đun nóng dung dịch A lại được 0. B. Câu 2.69 Lên men 1 tấn tinh bột chứa 5% tạp chất trơ thành ancol etylic.6g CH3COOH. D. Có thể phân biệt glucozơ và saccarozơ bằng phản ứng với Cu(OH)2 /OH-. Tinh bột có phản ứng màu với iot do tinh bột có cấu tạo mạch ở dạng xoắn có lỗ rỗng. Có thể phân biệt mantozơ và đường nho bằng vị giác. Câu 2. D. B.125 lít. D.84% và 23.71 Khí cacbonic chiếm tỉ lệ 0.0855g một cacbohiđrat X. Câu 2.

36 B 2.65 D 2. NH2 H2N CH CO 1 R .64 A 2.17 D 2.33 C 2.32 B 2.71 A 2.2 B 2.27 D 2.29 B 2.15 A 2.55 A 2.14 A 2. R CH COOH.3 C 2.13 A 2..58 C 2.70 C CHƯƠNG III.40 C 2. 32 .10 D 2.22 B 2.46 C 2.66 A 2.21 A 2.68 B 2.48 B 2.25 B 2.57 D 2.72 A 2.4 D 2. Cấu tạo phân tử: Các nhóm đặc trưng R NH2.53 C 2.8 C 2.24 D 2.51 B 2.39 C 2.6 C 2..37 C 2.50 C 2.63 B 2.69 C 2.amino axit peptit 2.62 B 2.31 A 2.30 A 2.52 B 2.38 D 2.7 A 2.19 C 2.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG II 2.45 A 2.23 C 2.42 D 2.61 C 2.54 D 2.41 B 2.35 A 2.47 B 2.  Những nhóm đẩy electron.28 C 2.5 C 2. NH CH COOH n R amin α .59 B 2.34 C 2.44 C 2.11 B 2.18 B 2.43 A 2.1 A 2.60 B 2. AMIN – AMINO AXIT – PROTEIN A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.9 B 2.56 B 2. Tính chất a) Tính chất của nhóm NH2 + Tính bazơ R NH2 + H2O [R NH3]+ + OH- Tác dụng với axit cho muối: R NH2 + HCl [R NH3]+Cl- Lưu ý: Mọi yếu tố làm tăng mật độ electron ở nguyên tử nitơ trong phân tử amin trung hoà nói chung đều làm tăng tính bazơ (trừ trường hợp chịu ảnh hưởng của hiệu ứng che chắn không gian và khả năng solvat hoá trong dung môi nước).20 D 2.12 C 2.26 B 2. chẳng hạn các gốc ankyl có hiệu ứng +I.16 B 2. sẽ làm cho tính bazơ tăng lên.67 A 2.49 D 2.

ngược lại càng có nhiều nhóm gây hiệu ứng –C tính bazơ sẽ càng giảm. ArNH2 + HNO2 + HCl 0-5oC -2H2O ArN2+Cl.π theo chiều chuyển dịch electron hướng vào vòng benzen. sẽ làm tính bazơ yếu đi. đun nóng dung dịch muối điazoni sẽ tạo ra phenol và giải phóng nitơ.  Về nguyên tắc. Thực tế HNO2 không bền. Điều này được giải thích là: Amin thơm chứa vòng benzen hút electron. ta có thể viết: (CH3)2NH > CH3NH2 > NH3 > C6H5NH2 > (C6H5)2NH > (C6H5)3N. đồng thời trong phân tử xuất hiện hiệu ứng liên hợp p . do đó khả năng nhận proton của anilin giảm. Vì vậy các amin mạch hở có tính bazơ mạnh hơn (dung dịch trong nước của chúng có thể làm xanh giấy quỳ) so với amin thơm (Anilin không làm xanh giấy quỳ). − Amin bậc 1 • Amin béo bậc 1 Tác dụng với axit nitrơ tạo ancol tương ứng và giải phóng khí nitơ (hiện tượng sủi bọt khí). Ngược lại nhóm phenyl có hiệu ứng –C hút electron. Vì vậy. HCl R NH2 + HONO R OH + N2 + H2O NaNO + HCl 2 Thí dụ: C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  • Amin thơm bậc 1 Tác dụng với axit nitrơ trong môi trường axit ở nhiệt độ thấp tạo muối điazoni. chỉ cần nêu hiện tượng.hay ArN2Cl + NaNO2 + HCl  Thí dụ: C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O (1*)    (anilin) (phenylđiazoni clorua) Đun nóng dung dịch muối điazoni: +  t0 C 6 H N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl (2*) →  5   Lưu ý: Trong công thức phân tử không cần viết các phản ứng (1* và 2*). 33 . nên phải dùng hỗn hợp (NaNO2 + HCl). + Tác dụng với HNO2 Dựa vào khả năng phản ứng khác nhau đối với HNO 2 của các amin mỗi bậc. người ta có thể phân biệt được chúng. càng thay thế nhiều nguyên tử H trong phân tử NH3 bằng những nhóm có hiệu ứng đẩy electron +I tính bazơ càng tăng. làm giảm mật độ điện tích âm ở nguyên tử N.

e) Anilin và nhiều protein có phản ứng thế dễ dàng nguyên tử H của vòng benzen NH2 NH2 Br Br (trắng) Br (dd) + 3Br2(dd) + 3HBr(dd) 34 . NH CH R3 CH R2 COOH + H2N R3 COOH + H2N Rn COOH+ ...− Amin bậc 2 Các amin bậc 2 thuộc dãy thơm hay dãy béo đều dễ dàng phản ứng với HNO2 tạo thành nitrozamin (Nitroso) màu vàng: R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (Nitroso – màu vàng) − Amin bậc 3: Không phản ứng (không có hiện tượng gì).và ω ... + H2N 4 COOH + nH2O hay2enzim H SO CH2 Rn COOH + Phản ứng màu với Cu(OH)2 cho dung dịch màu xanh tím (dùng để nhận biết protein). + Tác dụng với dẫn xuất halogen: R NH2 + CH3I R NHCH3 + HI b) Amino axit có tính chất của nhóm COOH Tính axit RCH(NH2)COOH + NaOH RCH(NH2)COONa + H2O Phản ứng este hoá: 2 4 RCH(NH2)COOH + R1OH RCH(NH2)COOR1 + H2O c) Amino axit có phản ứng giữa nhóm COOH và nhóm NH2 Tạo muối nội (ion lưỡng cực): H SO H3N+ CH COO- H2N CH COOH R R Phản ứng trùng ngưng của các ε .amino axit tạo poliamit: NH [CH2]5 CO n + nH2O d) Protein có phản ứng của nhóm peptit CO-NH + Phản ứng thuỷ phân: H 2N CH 1 R H2 N nH2N [CH2]5 COOH to CO HN CH R1 CH CO HN CH R2 CH CO .

3R – OH + NH3  (R)3N + 3H2O → C2H5OH → 20. CH3 – NH2 + H2O ← CH3 – NH3+ + OH 6. R – NH2 + HCl  R – NH3Cl → 35 . C 6 H 5 N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl →   t0 4. C6H5NH2 + HCl  C6H5NH3Cl → phenylamoni clorua 8. 2R – OH + NH3  (R)2NH + 2H2O → Al 2O3. P 19. R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (nitroso – màu vàng)  → 5. C6H5NH2 + H2SO4  C6H5NH3HSO4 → 11. CH3NH2 + H–COOH  H–COONH3CH3 → metylamoni fomiat 7. P 17. C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  + NaNO + HCl  2 2. R–NO2 + 6 [ H ]  R–NH2 + 2H2O → Fe + HCl C6H5–NH2 + 2H2O 15.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP NaNO + HCl 2 1. R – OH + NH3  R–NH2 + H2O → Al 2O3. 2C6H5NH2 + H2SO4  [C6H5NH3]2SO4 → 12. P 18. H2N + H2SO4 180oC H2N NH2 SO3H + H2O 13. R–NO2 + 6HCl + 3Fe  R–NH2 + 3FeCl2 + 2H2O → Al 2O3. R – Cl + NH3  R – NH2 + HCl 1000C 21. C6H5–NO2 + 6 [ H ]  → Cũng có thể viết: 16. C6H5NH2 + CH3COOH  CH3COONH3C6H5 → 10.B . C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O    +   3. NH2 Br Br (dd) + 3Br2(dd) Br Fe + HCl + 3HBr(dd) 14. CH3NH3Cl + NaOH  CH3NH2 + NaCl + H2O → 9.

phenylamin < etylamin < amoniac. Câu 3. amoniac < etylamin < phenylamin. H2NR(COOH)a + aNaOH  H2N(COONa)a + aH2O → 28. H2N–R–COOH + R’–OH ←  H2N–R–COOR’ + H2O  HCl   → 33. R – NH3Cl + NaOH  R – NH2 + NaCl + H2O → C2H5OH → 24. p NH[CH2]5CO n + nH2O HN[CH2]6CO n + nH2O 40. B. D. to. nhận biết bằng mùi. p . C.1 Sự sắp xếp theo trật tự tăng dần tính bazơ giữa etylamin.BÀI TẬP TRẮC NGHIỆM I.+ NH3  H2N–R–COOR’ + NH4Cl → 35. [H3N+–R–COOR’]Cl.2 Cách thuận lợi nhất để nhận biết lọ đựng dung dịch CH3NH2 là A. 36 xt. ClH3N–R–COOH + 2NaOH  H2N–R–COONa + NaCl + H2O → HCl 38. thêm vài giọt dung dịch H2SO4. (H2N)b R (COOH)a + aNa  (H2N)bR(COONa)a + → a 2 H2 31.+ H2O  34.C2H5OH → 22. CH3CH(Br)COOH + 3NH3  CH3CH(NH2)COONH4 + NH4Br → C. H2N–R–COOH + HONO  HO–R–COOH + N2↑ + H2O → 39.BÀI TẬP CƠ BẢN Câu 3. 2(H2N)bR(COOH)a + aBa(OH)2  [(H2N)bR(COO)a]2Baa + 2aH2O → 1 29. thêm vài giọt dung dịch Na2CO3 D. 3R – Cl + NH3  (R)3N + 3HCl 1000 C  →  → 26. H2N–R–COOH + Na  H2N–R–COONa + H2 → 2 30. 2(H2N)bR(COOH)a + bH2SO4  [(H3N)bR(COOH)a]2(SO4)b → 37. Đưa đầu đũa thuỷ tinh đã nhúng vào dung dịch HCl đậm đặc lên phía trên miệng lọ đựng dung dịch CH3NH2. phenylamin < amoniac < etylamin. etylamin < amoniac < phenylamin. nH2N[CH2]5COOH nH2N[CH2]6COOH xt. to. R – Cl + NH3  R – NH3Cl 1000C 23. B. 41. H2N–R–COOH + R’–OH + HCl ←  [H3N+–R–COOR’]Cl. 2R – Cl + NH3  (R)2NH + 2HCl 1000 C C2H5OH → 25. H2N–R–COOH + HCl  ClH3N–R–COOH → 36. C.+ H+ ← H3N+–R – COO  27. phenylamin và amoniac đúng là A. H2N–R–COOH ← H2N–R–COO. 2(H2N)bR(COOH)a + aNa2O  2(H2N)b R(COONa)a + aH2O → HCl  → 32.

CH2(NH2)COOH. D. 4. B.3g H2O và 1. D. 3. Câu 3. B.5 Số lượng đồng phân amin có chứa vòng benzen ứng với công thức phân tử C7H9N là A. quỳ tím. 3. Để nhận ra dung dịch của các hợp chất trên. chỉ cần dùng thuốc thử nào sau đây? A.3 Số lượng đồng phân ứng với công thức phân tử C3H9N là A. CH2(NH2)COOH. CH3OH/HCl. glixerol. amino cacboxyl bazơ Axit phân tử cực C. Amino axit thường tồn tại dưới dạng …(5)…cân bằng với dạng …(6)… (1) (2) (3) (4) (5) (6) A. Cu(OH)2. C. CH3CH2COOH và CH3[CH2]3NH2.9g este A thu được 13. CH(NH2)2COOCH3.2g CO2. hiđroxyl metylen khử oxi hoá cation anion D. xeton metyl axit lưỡng tính nguyên tử cation Câu 3. 37 . NaOH. Câu 3. amin cacbonyl oxi hoá Axit phân tử phân tử ion lưỡng B. AgNO3/NH3.5. 191. B. D. 4. 2.10 Khi thuỷ phân 500g protein A thu được 170g alanin.7 Có 3 chất hữu cơ gồm NH2CH2COOH. D. C. 6. 2. B. CH(NH2)2COOH. HNO3. Câu 3. C. C. B. Câu 3. Đốt cháy hoàn toàn 8.Câu 3. trong phân tử của nó vừa có nhóm …(1)…vừa có nhóm …(2)…nên vừa có tính chất …(3)…vừa có tính chất … (4)…. 190. H. HCl. Câu 3. C. O. Nếu phân tử khối của A là 50. D. 2.000. Câu 3. etanol và lòng trắng trứng? A. Công thức cấu tạo thu gọn của A. 3. 189. C. thì số mắt xích alanin trong phân tử A là bao nhiêu? A. CH2(NH2)COOCH3. 5. CH2(NH2)COOCH3. N) và ancol metylic.4 Số lượng đồng phân amin bậc 2 ứng với công thức phân tử C4H11N là A.6 Amino axit là một hợp chất hữu cơ tạp chức. D. 4. NaOH. B lần lượt là A. C.9 Thuốc thử nào dưới đây dùng để phân biệt các dung dịch glucozơ. 5. D. 5. CH(NH2)2COOH. B. B. Tỉ khối hơi của A so với H2 là 44.8 Este A được điều chế từ amino axit B (chỉ chứa C. 192. CH(NH2)2COOCH3.12 lít N2 (đktc).

Câu 3.11 Chất nào sau đây không có phản ứng với dung dịch C2H5NH2 trong H2O? A. HCl. B. H2SO4. C. NaOH. D. quỳ tím. Câu 3.12 Glixin phản ứng được với tất cả các chất trong nhóm chất nào sau đây (điều kiện phản ứng xem như có đủ): A. Quỳ tím , HCl , NH3 , C2H5OH. B. NaOH, HCl, C2H5OH, CH2 COOH.
NH2

C. Phenoltalein , HCl , C2H5OH , Na. D. Na , NaOH , Br2 , C2H5OH. Câu 3.13 Tìm công thức cấu tạo của hợp chất hữu cơ X chứa 32% C; 6,667% H; 42,667% O; 18,666% N. Biết phân tử X có một nguyên tử N và X có khả năng tham gia phản ứng trùng ngưng. A. H2NCH2COOH. B. C2H5NO2. C. HCOONH3CH3. D. CH3COONH4. Câu 3.14 Hợp chất hữu cơ A có công thức phân tử là C3H7O2N, A tác dụng được với dung dịch NaOH, dung dịch HCl và làm mất màu dung dịch brom. Công thức cấu tạo đúng của A là A. CH3CH(NH2)COOH. B. CH2=CHCOONH4. C. HCOOCH2CH2NH2. D. H2NCH2CH2COOH. Câu 3.15 Cho các chất: etylen glicol (1), axit aminoaxetic (2), axit oxalic (3), axit acrylic (4). Những chất có thể tham gia phản ứng trùng ngưng là A. (1), (2), (3). B. (1), (2). C. Chỉ có (2). D. Cả bốn chất. Câu 3.16 Có các dung dịch chứa trong các lọ mất nhãn sau: Lòng trắng trứng, hồ tinh bột, glixerol. Thuốc thử có thể dùng để phân biệt các dung dịch trên là A. Cu(OH)2. B. I2. C. AgNO3. D. cả A, B đều đúng. Câu 3.17 Số đồng phân của hợp chất hữu cơ thơm có công thức phân tử C7H7NO2 là A. 7. B. 6. C. 5. D. 8. Câu 3.18 Số đồng phân của các chất có công thức phân tử C4H10O (1), C4H9Cl (2), C4H10 (3), C4H11N (4) theo chiều tăng dần là A. (3), (2), (1), (4). B. (4), (1), (2), (3). C. (2), (4), (1), (3). D. (4), (3), (2), (1). 38

Câu 3.19 Cho sơ đồ phản ứng: NaOH C9H17O4N (X)  C5H7O4NNa2 (Y) + 2C2H5OH. → Công thức cấu tạo thu gọn của X, Y lần lượt là A. C2H5OOCCH2CH(NH2)CH2COOC2H5, NaOOCCH2CH(NH2)CH2COONa. B. CH3OOCCH2CH(NH2)CH2COOC3H7, NaOOCCH2CH(NH2)CH2COONa. C. HOOCCH2CH(NH2)CH2COOC4H9, NaOOCCH2CH(NH2)CH2COONa. D. CH3OOCCH2CH(NH2)CH2COOCH(CH3)2, NaOOCCH2CH(NH2)CH2COONa. Câu 3.20 Chọn phát biểu đúng về hợp chất tạp chức: A. Hợp chất hữu cơ có từ hai loại nhóm chức trở lên. B. Hợp chất hữu cơ có từ hai nhóm chức trở lên. C. Hợp chất hữu cơ có nhiều nhóm chức. D. Hợp chất hữu cơ có hai nhóm chức. Câu 3.21 Trong sơ đồ sau, công thức cấu tạo thu gọn phù hợp của A, B, C, D, E lần lượt là
2 2 2 2 + NH 3 + dd NaOH → → → → Etan  A  B  C  D  E  → → 1:1 Cu 1:1 Mn2+ Glixin. A. C2H5Cl, C2H5OH , CH3CHO, CH3COOH , CH3COOCl. B. C2H5Cl, C2H5OH , CH3CHO, CH3COOH, CH2ClCOOH. C. C2H5Cl, C2H5OH , CH3 COCH3, CH3COOH, CH2ClCOOH. D. C2H5Cl, C2H5OH , CH3COOH, CH3COCH3, CH2ClCOOH. Câu 3.22 Cho 3 chất hữu cơ: NH2CH2COOH (1); CH3CH2CH2CH2NH2 (2); CH3CH2COOH (3). Nhiệt độ nóng chảy của chúng được xếp theo trình tự giảm dần là A. (2) < (3) < (1). B. (1) > (3) > (2). C. (3) < (2) < (1). D. (2) > (1) > (3). Câu 3.23 Hợp chất đa chức và hợp chất tạp chức giống nhau ở chỗ A. đều là hợp chất có nhiều nhóm chức. B. đều là hợp chất chứa các nhóm chức giống nhau. C. phân tử luôn có liên kết π. D. mạch cacbon trong phân tử có liên kết π . Câu 3.24 X là một axit α -monoamino monocacboxylic, có tỉ khối hơi so với không khí là 3,07. X là A. glixin. B. alanin. C. axit α - aminobutiric. D. axit glutamic.

+ Cl

+O

+O

+ Cl

39

Câu 3.25 Khi đun nóng chất béo với dung dịch kiềm “....”
A. luôn thu được glixerol và phản ứng xảy ra thuận nghịch. B. luôn thu được glixerol, phản ứng xảy ra nhanh hơn và một chiều. C. luôn thu được muối của axit béo và phản ứng xảy ra thuận nghịch. D. luôn thu được xà phòng, phản ứng xảy ra chậm hơn. Chọn một phương án trong số các phương án trên để điền vào chỗ trống trong câu sao cho đúng ý nghĩa hoá học.

Câu 3.26 Amino axit là
A. hợp chất hữu cơ đa chức, có chứa 2 nhóm chức COOH và NH2. B. hợp chất hữu cơ đa chức, có chứa 2 loại nhóm chức COOH và NH2. C. hợp chất hữu cơ tạp chức, có chứa 2 nhóm chức COOH và NH2. D. hợp chất hữu cơ tạp chức, có chứa 2 loại nhóm chức COOH và NH2.

Câu 3.27 Công thức tổng quát của amino axit là A. RCH(NH2)COOH. B. R(NH2)x(COOH)y. C. R(NH2)(COOH). D. RCH(NH3Cl)COOH. Câu 3.28 Chọn câu phát biểu sai: A. Amino axit là hợp chất hữu cơ tạp chức. B. Tính bazơ của C6H5NH2 yếu hơn NH3. C. Công thức tổng quát của amin no, mạch hở, đơn chức là CnH2n + 3N (n ≥ 1). D. Dung dịch của các amino axit đều làm quỳ tím chuyển sang màu đỏ. Câu 3.29 Hai phương trình phản ứng hoá học sau, chứng minh được nhận định rằng: H2NCH2COOH + NaOH → H2NCH2COONa + H2O. H2NCH2COOH + HCl → HOOCCH2NH3Cl. A. Glixin là một axit. B. Glixin là một bazơ. C. Glixin là một chất lưỡng tính. D. Glixin là một chất trung tính. Câu 3.30 Hợp chất hữu cơ X có công thức cấu tạo thu gọn: HOOCCH2CH2CH(NH2)COOH. Tên gọi của X là A. glixin. B. alanin. C. axit ađipic. D. axit glutamic. Câu 3.31 Cho sơ đồ chuyển hoá sau:
X
H2SO4 - Na2SO4

Y

C2H5OH, H2SO4, to - Na2SO4

CH3

CH

COO

C2H5

NH3HSO4
CH COONa, CH3 CH COOH.

Công thức cấu tạo phù hợp của X, Y lần lượt là
A. CH3 C. CH3 CH COONa, CH3 CH COOH. B. CH3 D. CH3 NH2 CH COONa, CH3 NH2 NH2 CH COOH. NH3HSO4 NH3HSO4 CH COOH, CH3 NH3HSO4 NH2 CH COOH. NH2

Câu 3.32 Phương trình phản ứng hoá học sau chứng minh được rằng: H2NCH2COOH + C2H5OH 40
H+, to

H2NCH2COOC2H5 + H2O.

B. D. axit glutamic. B. C6H5 NH2 D. CH3 CH2 CH C6H5 NH2 COOH. N. Câu 3. Amin đơn chức đều chứa một số lẻ nguyên tử H trong phân tử. Clo và amin. D. C.225. C đều sai. NaOOC – CH2 – CH2 – CH(NH2) – COONa. Tên gọi của X là A. protein bị thuỷ phân tạo ra các amino axit. D. Glixin có nhóm NH2. có công thức cấu tạo thu gọn là A. Protein có trong mọi bộ phận của cơ thể động vật là hợp chất hữu cơ đa chức. Câu 3.37 Để điều chế glixin theo sơ đồ: Axit axetic → axit cloaxetic → glixin.36 Chọn câu phát biểu sai: A. Clo và amoniac.34 Muối của axit glutamic dùng làm bột ngọt (còn gọi là mì chính). H . B. D. Câu 3. D. Câu 3. C. Câu 3. CH2 CH COOH. Axit clohiđric và muối amoni. Glixin có nhóm COOH. triphenylamin.39 Sản phẩm của phản ứng este hoá giữa amino axit X và metanol thu được este có tỉ khối hơi so với propin bằng 2.A. B. Amino axit tham gia phản ứng trùng ngưng. CuSO4. NaOOC – CH2 – CH2 – CH(NH2) – COOH. Zn(NO3)2. D.40 Cho dung dịch metylamin đến dư vào các dung dịch sau: FeCl3. C.38 Tính bazơ của amin nào trong số các amin sau đây là yếu nhất ? A. Ở nhiệt độ thường dưới tác dụng của men.35 Công thức cấu tạo thu gọn của axit 2 – amino – 3 – phenylpropanoic là A. Amino axit có tính lưỡng tính. B. Một số protein bị đông tụ khi đun nóng. B. B. CH3COOK thì số lượng kết tủa thu được là A. C. B. O . C. Câu 3. CH3 CH2 CH NH2 C6H5 COOH. HOOC – CH2 – CH2 – CH(NH2) – COOH. D. Hiđroclorua và amoniac.33 Điều khẳng định nào sau đây là sai ? A. C. NH2 C6H5 C. glixin. B. điphenylamin. Các protein đều chứa các nguyên tố C . 0. alanin. Cần dùng thêm các chất phản ứng nào sau đây (không kể xúc tác): A. CH2 CH COOH. HOOC – CH2 – CH2 – CH(NH2) – COONH4. H nối với O của axit linh động hơn ancol. 1. tất cả A. Câu 3. không xác định được. anilin. Phân tử khối của một amin đơn chức luôn là số chẵn. Câu 3. 41 . C. B. H nối với O của ancol linh động hơn axit.

04g hỗn hợp Y gồm hai amin đơn chức. H2N[CH2]4 CHO. Metylamin có tính bazơ mạnh hơn anilin. D.06 mol và 0. Câu 3. không đủ dữ kiện để tính. riêu cua nổi lên được giải thích là do: A.42 Cho dung dịch metylamin đến dư vào các dung dịch sau: (CH3COO)2Cu. CH3COOAg. C.47 Hợp chất hữu cơ (X) có công thức phân tử CxHyNO có khối lượng phân tử bằng 113u. 2. Có phản ứng hoá học của NaCl với chất có trong nước lọc khi xay (giã) cua. đietylmetylamin tác dụng vừa đủ với 50ml dung dịch HCl 1M. Câu 3. Khối lượng sản phẩm thu được có giá trị là A. C. 3. Công thức tổng quát của amin no. Câu 3. Câu 3. B. D.123g. CH5N và C2H7N. 21. Fe + dung dịch HCl.46 Cho 3. mạch hở tác dụng vừa đủ với dung dịch HCl thu được 5. Ngoài ra. Câu 3.1M. CH3 CH2 CH2 CH2 C NH2. 0. X có đặc điểm cấu tạo và các tính chất sau: phân tử có mạch cacbon không phân nhánh. CH2 CH2 NH O C.48 Hãy chỉ ra câu sai trong các câu sau: A. D. kết quả khác. Tính bazơ của các amin đều mạnh hơn NH3. metylamin.04 mol và 0. không làm mất màu dung dịch Br2. Công thức cấu tạo của X là CH2 CH2 CH2 A. no. B. Cho 1. 20. 1. B. C. B. kết quả khác. D. Các chất bẩn trong cua chưa được làm sạch hết.98g muối. Câu 3. D.18g. B. cacbon. 0.44 Điều chế anilin bằng cách khử nitrobenzen thì dùng chất khử nào sau đây ? A. D. Sự đông tụ của protit. D. Các amin đều kết hợp với proton. Tất cả các nguyên nhân nêu ở A. Tổng số mol hai amin và nồng độ mol/l của dung dịch HCl là A. C. C. C3H9N và C2H7N. (CH3COO)2Pb. 16.45 Hỗn hợp (X) gồm hai amin đơn chức. Công thức phân tử của hai amin là A. số mol hai amin bằng nhau.41 Cho 15g hỗn hợp các amin gồm anilin.825g. D.3M. Biết trong hỗn hợp.52g X tác dụng vừa đủ với 200ml dung dịch HCl thu được 2. B. X còn có khả năng tham gia phản ứng trùng hợp. 2.C. thì số lượng kết tủa thu được là A. kết quả khác. C = O. C. B. mạch hở là CnH2n+2+kNk.43 Khi nấu canh cua. 0. C. Câu 3. 3.2M. B.96g muối. B. 0. khí H2. C. 42 . D. Câu 3.02 mol và 0. NH3. (CH3COO)2Mg. C3H9N và C4H11N. đimetylamin. khi tác dụng với dung dịch NaOH chỉ thu được sản phẩm hữu cơ duy nhất.

Giá trị m và tên gọi của amin là A. C3H7NH2 và C4H9NH2. C. C2H5NH2 và C4H9NH2. đimetylamin. 8. bậc I (có số nguyên tử C nhỏ hơn hoặc bằng 4) phải dùng một lít dung dịch X. C3H9N. C. kết quả khác. C3H7N. D.4 lít khí CO2 và 1. Biết rằng tên của A có tiếp đầu ngữ “para”. C3H9N. C2H7N và C3H9N.24 lít khí CO2 (đktc) và 3.4 lít N2 (các V đo ở đktc). C3H9N và C4H11N. D. C2H7N.21g amin A sinh ra khí CO 2. 8. C. CH3 . Câu 3.6g khí cacbonic. etylamin. cô cạn dung dịch thu được 31.Câu 3.54 Dung dịch X chứa HCl và H2SO4 có pH = 2. Khi đốt cháy amin B thấy VCO2 : VH2O = 2 : 3 .53 Cho 20g hỗn hợp gồm 3 amin no. 12.125g H2O. C. trong đó nitơ chiếm 80% thể tích (các V đo ở đktc). Công thức phân tử của 2 amin là A. CH3 Câu 3. C2H7N. CH3-CH2-CH2-NH2. C.49 Đốt cháy hoàn toàn hỗn hợp hai amin no. B. đơn chức là đồng đẳng liên tiếp của nhau. thu được 17. X có công thức phân tử là A. CH3-CH2-CH2-NH2. B. Giả thiết không khí chỉ gồm nitơ và oxi.50 Có hai amin bậc một gồm A (đồng đẳng của anilin) và B (đồng đẳng của metylamin). CH3N. hơi H2O và 336 cm3 khí N2 (đktc). C. D. D. người ta thu được 10. CH3-CH-NH2. Câu 3. 7. Đốt cháy hoàn toàn 3. là đồng đẳng liên tiếp. CH3NH2 và C4H9NH2. CH3 . D. C4H11N. A và C đúng. Công thức phân tử của hai amin lần lượt là A. C3H9N. etylamin hoặc đimetylamin. Nếu 3 amin trên được trộn theo tỉ lệ số mol 1:10:5 và thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là A. II.51 Đốt cháy hoàn toàn m g một amin A bằng lượng không khí vừa đủ.44 lít khí nitơ.6g hơi nước và 69. B. C5H11N. etylamin. đơn chức. C4H9N. B. D. B lần lượt là NH2 NH2 A.59g hỗn hợp 2 amin no. 9. CH3-C6H4-NH2 . B. CH5N và C2H7N.52 Khi đốt cháy hoàn toàn một amin đơn chất X. C4H11N.BÀI TẬP NÂNG CAO Câu 3. C3H9N. C2H7N. 9. C5H13N.6g H2O.68g hỗn hợp muối. C5H13N. Công thức cấu tạo của A. B. Câu 3. CH3-C6H4-NH2 . thu được 2. đơn chức. tác dụng vừa đủ với dung dịch HCl. Để trung hoà hoàn toàn 0. C4H11N. C4H9-NH2. 43 .

Câu 3. C4H9NO2.(4)…mà phân tử chứa …(5)…. C. Biết X là amin bậc I. B” tác dụng với NaOH tạo ra B’. C.. amino nguyên tử hiđro luỡng tính luỡng tính luỡng tính C. C4H9NO2. C có cùng công thức phân tử C 4H9O2N. Câu 3. Để trung hoà 0. D. cả A. C3H5COONH4. B. Câu 3. H2NC3H6COOH. nguyên tử hiđro khi thay thế amino cacboxyl D.75 < X ≤ 1. Amino axit là loại hợp chất hữu cơ . B. H2NCH2CH2COONH4. Câu 3. H2NC3H6COOH. 0. C4H9NO2. C lần lượt là A. amino cacboxyl 44 .59 Những từ hay cụm từ thích hợp với những chỗ trống ở các câu trong đoạn văn sau là Amin là những hợp chất hữu cơ được tạo thành …(1)…một hay nhiều …(2)… trong phân tử amoniac bởi …(3)…. B. A và B đều đúng. A và B đều sai. CH3CH(NH2)COONH4.4 ≤ X < 1.2.55 Khi đốt cháy mỗi đồng đẳng của ankylamin.57 Các chất A. khi thay thế khi thay thế khi thay thế nguy ên tử hiđr o (2) nguyên tử hiđro cacboxyl (3) một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon (4) luỡng tính tạp chức tạp chức tạp chức (5) đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino (6) tạp chức (7) cacboxyl (8) amino (9) trùng ngưng trùng ngưng trùng ngưng trùng ngưng B.4 ≤ X < 1. D. B.58 Một hợp chất hữu cơ A mạch thẳng có công thức phân tử là C3H10O2N2.99g H2O và 336ml N2 (đktc). B. Biết A tác dụng với cả HCl và Na2O. công thức cấu tạo thu gọn có thể có của X là A. CH3C6H2(NH2)3. Công thức cấu tạo của A là A.1 mol X cần 600ml dung dịch HCl 0.56 Đốt cháy hoàn toàn một amin thơm X thu được 3. C đều đúng. C3H5COONH4. 0. amino axit biểu hiện tính chất …(8)…và tính chất đặc biệt là phản ứng …(9)… (1) A.. B’ tác dụng với HCl tạo ra B”. CH3NHC6H3(NH2)2. Vì có nhóm …(6)… và nhóm …(7)… trong phân tử. 0. A tác dụng với kiềm tạo thành NH3. Mặt khác. C. thì tỉ lệ thể tích X = VCO2 : VH2O biến đổi như thế nào theo số lượng nguyên tử cacbon tăng dần trong phân tử ? A. 0. Công thức cấu tạo thu gọn của A. C. A tác dụng với dung dịch axit tạo thành muối amin bậc I.5. D. 0. B. C3H5COONH4. H2NC3H6COOH.5M. C tác dụng với NaOH tạo ra muối và NH 3. B tác dụng với H mới sinh tạo ra B’.08g CO2.8 ≤ X < 2. H2NCH2C6H3(NH2)2. D. C4H9NO2.Câu 3. C3H5COONH4. H2NC3H6COOH.

cả A. Câu 3. H2N[CH2]4COOH. B.7g chất X. cả A. CH3NH[CH2]2COOH. H2N[CH2]3COOH. Công thức cấu tạo thu gọn của X là A. Đốt cháy 7. Mặt khác. B đều no. Công thức cấu tạo thu gọn của hai amino axit lần lượt là A. C. mạch hở. tạo ra 28. H2N[CH2]3COOH. B.63 Hợp chất hữu cơ X có phân tử khối nhỏ hơn phân tử khối của benzen. H2NCH2COOH. B. H2NCH2COOH. CH3CH(NH2)CH2COOH. H2NCH2CH2COOH. CH3CH(NH2)COOH. D. 45 .62 Hợp chất X chứa các nguyên tố C. D. thu được 4. H2NCH2COOH. B. C. X vừa tác dụng được với dung dịch HCl vừa tác dụng được với dung dịch NaOH. Câu 3. thì thấy khối lượng bình này tăng thêm 32. H. chỉ chứa nguyên tố C. 1 chức amino tác dụng với 40.928 lít khí CO2 (đo ở 27.Câu 3. B.65g muối khan. C. Câu 3. C đều sai. N và có phân tử khối là 89.8g. HOOCCH2CH(NH2)COOH. kết quả khác.1 mol A phản ứng vừa hết với 100ml dung dịch HCl 1M tạo ra 18. 3 mol CO2 và 0. khi đốt cháy thu được khí nitơ ở dạng đơn chất. CH2=C(NH2)-COOH. X là hợp chất nào sau đây? A. Câu 3. cả A.37. 1atm). CH3NHCH2COOH. Đốt cháy hoàn toàn một lượng X thu được CO2 và N2 theo tỉ lệ thể tích 4:1. D. thu được VCO2 : VH 2O = 6 : 7 . B. không phân nhánh . C2H5COONH4 hoặc HCOONH3CH3. D. B.09%. H2NCH2COOH. C đều sai. C. H2NCH2COOH. tất cả đều sai. Biết rằng. CH3NH[CH2]3COOH. N trong đó hiđro chiếm 9.15g dung dịch HCl 20% được dung dịch A. X là hợp chất nào sau đây? A.05g A khi tác dụng với một lượng NaOH dư.35g muối. HOOCCH(NH2)COOH.5 mol N2.18%. H2N[CH2]3COOH. ngoài ra còn tác dụng được với nước brom. C. Công thức cấu tạo thu gọn của A là A. chứa 1 chức axit. 22. H. Biết rằng. H2NCH(NH2)[CH2]2COOH. B. H2NCH(NH2)COOH. B đều đúng. Khi đốt cháy 1 mol X thu được hơi nước. Câu 3. Để tác dụng hết với các chất trong dung dịch A.3oC. O. CH3COONH4 hoặc HCOONH3CH3. O. Mặt khác. CH2=CH-COONH4. H2NCH2CH2COOH.64 Cho a g hỗn hợp hai amino axit A. H2N-CH=CH-COOH.61 Khi đốt cháy hoàn toàn đồng đẳng X của axit aminoaxetic. Biết X tác dụng với dung dịch NaOH và dung dịch HCl. D. Công thức cấu tạo thu gọn có thể có của X là A. Biết A có cấu tạo mạch không phân nhánh và nhóm amino ở vị trí α . cần 140ml dung dịch KOH 3M.65 A là một amino axit trong phân tử ngoài các nhóm cacboxyl và amino không có nhóm chức nào khác. H2N[CH2]4COOH. Biết 0. đốt cháy a g hỗn hợp hai amino axit trên và cho sản phẩm cháy qua dung dịch NaOH dư. Cho tỉ lệ phân tử khối của chúng là 1. nitơ chiếm 18.60 Amino axit X chứa một nhóm chức amin bậc I trong phân tử.

70 Cho các chất: (1) amoniac. Lấy một lượng axit aminoaxetic (X) và 3. Amin luôn luôn phản ứng với H+. (4). H2NCH2CH2NH2. H2NCH2CH2COOH.82g (Y). C. B. Câu 3. B. N với tỉ lệ khối lượng tương ứng là 3:1:4:7. D. C. CH3CH2CH(NH2)COOH. Biết phân tử X có 2 nguyên tử nitơ.0g kết tủa. Câu 3. (4) < (3) < (2) < (1) < (5) < (6). Mọi amin đơn chức đều chứa một số lẻ số nguyên tử H trong phân tử. Câu 3. C. Hai chất (X) và (Y) có cùng số mol. (1). oxi. (4) p-nitrotoluen. CH3CH(NH2)2. Thuỷ phân protein bằng axit khi đun nóng sẽ cho một hỗn hợp các amino axit.1g X tác dụng với dung dịch HCl dư.Một số protein bị … khi đun nóng hoặc khi cho thêm một số hoá chất. Trình tự tính bazơ tăng dần theo chiều từ trái sang phải là A. B. (3) cacbon. D. X có công thức cấu tạo nào sau đây? A. Đốt cháy hoàn toàn lượng (X) và (Y) trên. (1) < (2) < (4) < (3) < (5) < (6). CH3CH(NH2)COOH. (2) anilin. kết quả khác. (3). D. (1). (5) metylamin. thu được 18. N(CH2COOH)3.73 Hợp chất X chứa các nguyên tố C. (1).67 Chọn phát biểu sai: A.448 lít (đktc) một khí không bị hấp thụ. (4). thể tích khí oxi cần dùng để đốt cháy hết (Y) nhiều hơn để đốt cháy hết (X) là 1. B. kết quả khác. (3) p-nitroanilin. Phân tử khối của một amin đơn chức luôn là số chẵn. Dung dịch amino axit không làm giấy quỳ đổi màu. (2) < (1) < (3) < (4) < (5) < (6). B. (3). C. C.71 Đốt cháy hoàn toàn 0.69 Câu khẳng định nào sau đây luôn đúng: A. C. D. Các amino axit đều tan trong nước. nitơ.Ở nhiệt độ thường dưới tác dụng của men.Protein có trong … . NC4H8(COOH)2.68 Hãy điền những từ hoặc cụm từ thích hợp vào các chỗ trống ở các câu sau . (4) đông tụ Những từ hoặc cụm từ thích hợp theo trình tự từ trên xuống là A. C3H8ON2. CH3NHCH2COOH. (3). Câu 3. Cho 15. H2NCH2CH2COOH. D. thu toàn bộ sản phẩm qua bình chứa nước vôi trong dư. protein … tạo ra các amino axit. D. D. (2). B. Công thức cấu tạo của X là A.C. B. Câu 3. . (1) mọi bộ phận của cơ thể. CH4ON2. C3H8O2N2. HOOCCH2CH2CH(NH2)COOH. (3). (2). (4). (1). O. D. Câu 3. hiđro. Công thức phân tử của X là A.75g muối của X. Câu 3. C.344 lít (đktc). Phân tử khối của một amino axit (gồm một chức amino và một chức cacboxyl) luôn luôn là số lẻ. B. Công thức cấu tạo thu gọn của (Y) là A. (2) bị thuỷ phân. (2). C. (2). (1) < (4) < (3) < (2) < (5) < (6). B và C đều đúng. Câu 3. H.66 X là một α -amino axit no chỉ chứa một nhóm –NH2 và một nhóm –COOH. CH3CH2NH2. B. CH3CH2CH(NH2)COOH. 46 . (6) đimetylamin. (4).72 Amino axit (Y) có công thức dạng NCxHy(COOH)m. D.02 mol một amin bậc I (X) với lượng oxi vừa đủ. thấy khối lượng bình đựng nước vôi trong tăng 3. khi lọc dung dịch thu được 4. C đều đúng.2g và còn lại 0.Các protein đều chứa các nguyên tố … .

12 B 3.26 D 3.67 D 3.6 B 3.38 C 3.69 D 3.7 D 3. ta phân biệt polime trùng hợp và polime trùng ngưng.35 B 3.27 B 3.4 B 3.36 A 3.60 A 3.46 A 3.25 B 3.11 C 3.44 D 3.2 D 3.3 C 3. polime tổng hợp.n n.33 A 3.15 A 3.Theo nguồn gốc.59 C 3.14 B 3.20 A 3.10 C 3. .61 A 3. polime nhân tạo (bán tổng hợp).19 A 3.M = M’.29 C 3.9 C 3.73 A 3.21 B 3.M = M.37 D 3.54 D 3.48 B 3.43 C 3.56 D 3.65 C 3.40 B 3.17 A 3.Theo phản ứng polime hoá.53 A 3.41 A 3.n + n.64 D 3.57 D 3. Phản ứng Trùng hợp Mục so sánh Là quá trình kết hợp nhiều phân tử nhỏ giống nhau hoặc tương tự nhau (monome) thành phân tử lớn (polime) Là quá trình kết hợp nhiều phân tử nhỏ thành phân tử lớn (polime). đồng thời giải phóng những phân tử nhỏ (như H2O. ta phân biệt polime thiên nhiên.23 A 3.Số mắt xích (n) trong phân tử polime được gọi là hệ số polime hoá hay độ polime hoá.55 C 3.52 C 3.1 C 3.66 D 3.45 A 5.18 Có liên kết đôi hoặc vòng Có hai nhóm chức có khả không bền năng phản ứng trở lên Trùng ngưng Định nghĩa Quá trình Sản phẩm Khối luợng Điều kiện của monome 47 .28 D 3.13 A 3. .58 C 3. .18 A 3.…) n Monome → Polime n Monome → Polime+ nH2O Polime trùng hợp Polime trùng ngưng n.72 C 3.47 A 3.5 D 3.32 D 3.24 B 3. Khái niệm về polime Polime là các hợp chất có phân tử khối rất lớn do nhiều đơn vị nhỏ gọi là mắt xích liên kết với nhau tạo nên.8 C 3.34 B 3.50 B 3.39 B 3.49 A 3.51 D 3.16 A 3.68 B 3.31 C 3.62 C 3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.22 B 3. POLIME A.63 B 3.70 C CHƯƠNG IV.30 D 3.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG III 3.42 C 3.71 D 3.

Phản ứng giữ nguyên mạch polime: Phản ứng cộng vào liên kết đôi hoặc thay thế các nhóm chức ngoại mạch. . Khái niệm về các vật liệu polime o . p CH2 etilen CH2 n polietilen(PE) b) Nhựa PVC nCH2 CH Cl vinyl clorua xt. 4. . B . Nhựa a) Nhựa PE nCH2 CH2 xt.Phản ứng cắt mạch polime: Polime bị giải trùng ở nhiệt độ thích hợp. -COOCH2. 3. .Phản ứng khâu mạch polime: Phản ứng tạo cầu nối giữa các mạch (cầu -S-S. dạng mạch phân nhánh và dạng mạch không gian.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1.Phân tử polime có thể tồn tại ở dạng mạch không phân nhánh. bền. một số tan trong các dung môi hữu cơ. Polime có nhóm chức trong mạch như –CO-NH.Cao su: vật liệu có tính đàn hồi.Phân tử polime có thể có cấu tạo điều hoà (nếu các mắt xích nối với nhau theo một trật tự xác định) và không điều hoà (nếu các mắt xích nối với nhau không theo một trật tự nào cả). Tính chất a) Tính chất vật lí Hầu hết polime là chất rắn.2. Đa số polime có tính dẻo.Vật liệu compozit: vật liệu tổ hợp gồm polime làm nhựa nền và các vật liệu vô cơ. b) Tính chất hoá học: có 3 loại phản ứng . Thí dụ: t CH2 CH n + nCH3COONa CH CH2 n + nNaOH OCOCH3 OH . .hay -CH2-) thành polime mạng không gian hoặc phản ứng kéo dài thêm mạch polime. một số có tính dai. một số polime có tính đàn hồi. có thể kéo thành sợi. . to. hữu cơ khác. to.Chất dẻo: vật liệu polime có tính dẻo. .Keo dán hữu cơ: vật liệu polime có khả năng kết nối chắc chắn hai mảnh vật liệu khác. không có nhiệt nóng chảy xác định. p CH2 CH n Cl poli(vinyl clorua) (PVC) c) Nhựa PS 48 . dài và mảnh. Cấu trúc .Tơ: vật liệu polime hình sợi. không bay hơi.dễ bị thuỷ phân khi có mặt axit hay bazơ.

OH OH n + nHCHO H .t + o CH2 n + nH2O − Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. nhựa rezit. − Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. p CH CH2 n OCOCH3 Thuỷ phân PVA trong môi trường kiềm: CH CH2 n + nNaOH OCOCH3 to CH2 CH n + nCH3COONa OH CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) e) Nhựa PMM (thuỷ tinh hữu cơ . 49 ..nCH C6H5 CH2 xt. CH2 CH2 CH2OH CH2 CH2 OH . p CH3 metyl metacrylat f) Nhựa PPF Poli(phenol . to. nhựa rezol. to.plexiglas) nCH2 CH COOCH3 xt. to.fomanđehit) (PPF) có 3 dạng: nhựa novolac... − Nhựa novolac: Nếu dư phenol và xúc tác axit.. p CH CH2 C6H5 n d) Nhựa PVA nCH2 CH OCOCH3 xt. OH .

... . p. p. xt CH2 CH CH CH2 CH C6 H 5 CH2 n d) Cao su buna – N nCH2 CH CH CH2 + nCH CN o CH2 t . H2 C ..3-đien (butađien) b) Cao su isopren polibutađien (cao su buna) C CH CH2 CH3 2-metylbuta-1... H2C .. p CH2 C F CH CH2 n 3.. Cao su a) Cao su buna Na.. . t nCH2=CH− CH=CH2  → 0 ( CH 2 CH = CH CH 2 )n buta-1. to.. xt CH2 CH C Cl CH2 n f) Cao su flopren nCH2 C F xt.3-dien (isopren) c) Cao su buna – S nCH2 CH CH CH2 + nCH C6 H 5 nCH2 xt. ... to. 2.CH2 OH OH CH2 OH CH2 OH CH2 CH2 OH CH2 CH2 OH CH2 CH2 CH2 . p. p C CH CH2 n CH3 poliisopren (cao su isopren) CH2 o CH2 t . Tơ a) Tơ capron (nilon – 6) 50 . xt CH2 CH CH CH2 CH CN CH2 n e) Cao su clopren nCH2 CH C CH2 Cl CH CH2 to.

p NH[CH2]5CO n + nH2O xt. to.NH -) trong phân tử kém bền với nhiệt. Len. C. D. 3 → → 2 → 4 → 5 → 1. NH[CH2]5CO n . p NH[CH2]5CO n b) Tơ enang (nilon – 7) nH2N[CH2]6COOH c) Tơ nilon – 6. Len. tơ tằm. C. to.1 Hợp chất đầu và các hợp chất trung gian trong quá trình điều chế ra cao su buna (1) là: etilen (2). p HN[CH2]6CO n + nH2O NH[CH2]6NHCO[CH2]4CO n + 2nH2O d) Tơ clorin CH2 CH CH2 Cl CH Cl n 2 + n 2 Cl2 xt. 6 B. 4 → 6 → 3 → 2 → 5 → 1. rượu etylic (4). tơ tằm.6 có công thức là A. to. Len. B. C. 2 → 6 → 3 → 4 → 5 → 1. vì: A. tơ nilon kém bền với nhiệt. NH[CH2]6CO n .nH2N[CH2]5COOH n CH2 CH2 CH2 CH2 xt. D. to. đivinyl (5). p CH2 C=O NH xt. 6 → 4 → 2 → 5 → 3 → 1. to.3 Không nên ủi (là) quá nóng quần áo bằng nilon. p CH2 CH CH CH Cl xt. 51 . Len. Câu 4.6) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH xt. tơ tằm. axetilen (6). Hãy sắp xếp các chất theo đúng thứ tự xảy ra trong quá trình điều chế A. Câu 4. tơ tằm. to. NH[CH2]6NHCO[CH2]4CO n .BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 4.2 Tơ nilon – 6. metan (3). p n 2 n + HCl 2 Cl Cl e) Tơ dacron (lapsan) nHOOC C6H4 COOH + nHO CH2 CH2 axit terephtalic etylen glicol CO OH C6H4 CO O CH2 CH2 O n + 2nH2O poli(etylen terephtalat) (lapsan) C. len. tơ nilon dễ cháy.CO . tơ tằm. NHCH(CH3)CO n . B. tơ nilon mềm mại. tơ nilon có các nhóm (. D.

Polimetyl metacrylat (PMM). butađien. (4). Câu 4. etanol. C. cacbon. tơ poliamit. vinylaxetilen. D. D. C.11 Tơ enang thuộc loại A. Câu 4.6 Cho sơ đồ sau: CH4 → X → Y → Z → cao su buna. Z trong sơ đồ trên lần lượt là A. B. Tên gọi của X . Phản ứng trùng hợp. CH CH CH2 CH CH2 C6H5 . Phản ứng đồng trùng ngưng. C. Axetilen.8 Cao su buna . C. butađien. (3). C. B. Etilen. Câu 4. n . Axetilen. C. B. S. (2). etanol. B. C.9 Thuỷ tinh plexiglas là polime nào sau đây? A. CH3–CH3(4) A. (3). D. nhựa phenol-fomanđehit. (1). Phản ứng trùng ngưng. tơ polieste. Tất cả đều sai. butađien.Câu 4.4 Những phân tử nào sau đây có thể tham gia phản ứng trùng hợp ? CH2=CH2(1).7 Cao su buna – S có công thức là A. Phản ứng đồng trùng hợp.5 Khi H2SO4 đậm đặc rơi vào quần áo bằng vải sợi bông. CH2=CH–Cl(3). B. (3). Câu 4. CH CH2 C6H5 n . nhựa dẻo. Câu 4. PbS. Polimetyl acrylat (PMA). (3). Y . (2). Câu 4. tơ axetat. nhựa bakelít. (1). D. vinylaxetilen. B. butađien. CH2 CH CH CH2 n . (2).10 Tên của polime có công thức sau là OH CH2 n A. CH ≡ CH(2). D. chỗ vải đó bị đen lại do có sản phẩm tạo thành là A. Polivinyl axetat (PVA). B.S được điều chế bằng : A. Anđehit axetic. H2S. polistiren. CH2 C. Câu 4. D. (1). Câu 4. D. B. CH2 C(COOCH3) CH3 n D.12 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – S? 52 . tơ tằm.

xt to. CH C CH2 n CH3 CH2 CH CH CH2 n CH C6H5 CH2 . nCH2 CH CH CH CH CH C Cl C CH CH2 to. nCH2 D. . axit axetic.CH2 CH3 CH CH CH2 . p. D. nCH2 CH CH CH CH CH C Cl C CH CH2 CH2 CH2 to.6 người ta dùng axit nào để trùng ngưng với hexametylen điamin ? A. p. p. CH2 CH2 n n . p.6. axit oxalic. p. xt Câu 4. . p. CH2 CH2 n n . C. xt to. Cl .A. xt CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . p. nCH2 CH CH CH CH CH C Cl C CH CH2 to.CH3 C C CH2 . xt CH2 CH2 to.14 Phản ứng nào sau đây tạo ra sản phẩm là cao su cloropren? A. xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. A. xt to. xt to. X tham gia phản ứng trùng hợp được một loại cao su. nCH2 B.16 Để điều chế nilon . CH3 CH2 + mCH C6H5 o CH2 t . xt CH2 CH2 CH2 CH CH CH2 n . CH C CH2 n . nCH2 B. Câu 4. B.13 Phản ứng nào sau đây tạo ra sản phẩm là cao su isopren? A. . xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. xt CH2 CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . m CH3 CH2 + mCH C6H5 o CH2 t . C. axit stearic. m CH3 CH2 + mCH C6H5 to.15 Hiđro hoá hợp chất hữu cơ X được isopentan. nCH2 D.CH2 C CH CH2 . p. nCH2 C. p. p. xt CH2 CH2 to. p. nCH2 B. p.17 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – N? 53 . D. nCH2 C. nCH2 C. CH3 Câu 4. nCH2 D. axit ađipic. m . Công thức cấu tạo thu gọn của X là .CH3 CH2 C CH B.

xt C6H5 n Câu 4.26 Một polime Y có cấu tạo mạch như sau: 54 . p. C. trùng hợp axit acrylic. nCH2 CH D. B. C. D. . C. nhựa bakelít. trùng ngưng H2N-(CH2)6-COOH. Câu 4. B.19 Sản phẩm của phản ứng trùng hợp metyl metacrylat được gọi là A. axit metacrylic. nCH2 CH CH CH2 + nCH CN CH o CH2 t . D.CH2 CH CH2 OH. nhựa PVC.25 Tơ poliamit là những polime tổng hợp có chứa nhiều nhóm A. stiren. C. C.21 Tơ enang được điều chế bằng cách A. p. B. p.CH2 CH3 CH CH2 CH2 CH3. D.A. Câu 4.23 Chất có khả năng trùng hợp thành cao su là B. Câu 4. xt CH3 n n . axit metacrylic. CH C6H5 CH2 . phenol. chất dẻo. A.18 Tên của monome tạo ra polime có công thức CH3 C CH2 n COOH là A. B.24 Từ monome nào sau đây có thể điều chế được poli(vinyl ancol) ? A. D. Câu 4. C. metyl metacrylat.22 Nhựa PS được điều chế từ monome nào sau đây? A. C.20 Tơ capron được điều chế từ monome nào sau đây ? A.CH2 CH OCOCH3. Câu 4.CH2 CH COOC2H5. –CH(CN)– trong phân tử. trùng ngưng HOOC-(CH2)4-COOH. Câu 4. nCH2 CH CH C CH2 CH3 C Cl CH2 to. xt CH2 CH2 CH C CH C Cl CH2 CH2 to. caprolactam. trùng ngưng alanin. –CO– trong phân tử. thuỷ tinh hữu cơ. xt CH2 CH CH2 CH o CH2 + mCH CH2 t . caprolactam. B. Câu 4. CH3 C C CH2. CH CH CH2 CH2 CH CN CH2 n . metyl acrylat. –CO–NH– trong phân tử. D. axit caproic. p. m C. D. –NH– trong phân tử. C. B. axit metacrylic. D. B. Câu 4. phenol. D.CH2 CH COOCH3.CH2 C CH CH2.CH3 CH3 CH2 C CH. axit acrylic. nCH2 B.

D. C6H5CH(CH3)OH. D. 2. C. 1 : 2. Câu 4. D. B. Trong X có chứa 66. NH[CH2]6CO n . → X có công thức phân tử C8H10O không tác dụng với NaOH. C. − 2− CH . B. 1 : 1. p − H 2O X  Y  polime.18% clo theo khối lượng. Câu 4. C. C.29 Tiến hành phản ứng đồng trùng hợp giữa stiren và buta – 1. Polietilen và poli(vinyl clorua) là loại polime thiên nhiên. C6H5CH2CH2OH. A. C6H5CH=CH2. t o . B.30 Chọn câu phát biểu sai: A. Hầu hết các polime không tan trong nước và các dung môi thông thường. thu được polime X. D. Cứ 2. − 2− 2− 2− 2− CH CH CH CH . Y lần lượt là: A.27 Tiến hành clo hoá poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. D. II – BÀI TẬP NÂNG CAO Câu 4. C6H5CH2CH2OH. 3. Vậy. CH3-C6H4CH2OH . C6H5CH2CHO.3 – đien (butađien). 1 : 3.B.… − 2− 2− 2− 2− 2− 2− 2− 2− … CH CH CH CH CH CH CH CH Công thức một mắt xích của polime Y là A. Câu 4. Công thức cấu tạo thu gọn của X. − 2− 2− 2− CH CH CH .32 Hệ số trùng hợp (số mắt xích) của tơ nilon – 6. còn tinh bột và xenlulozơ là loại polime tổng hợp. Các vật liệu polime thường là chất rắn không bay hơi. trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo ? B. Polime là những chất có phân tử khối rất lớn do nhiều mắt xích liên kết với nhau. C6H5COCH3.28 Tơ capron (nilon – 6) có công thức là NH[CH2]5CO n . − 2− 2− CH CH . Câu 4.6 có phân tử khối (M = 2500) là 55 . D. 4. B.834 gam X phản ứng vừa hết với 1. A.31 Cho sơ đồ phản ứng sau: → xt . C6H5CH=CH2. 2 : 3. C.731 gam Br2. Câu 4. NH[CH2]6NHCO[CH2]4CO n . Tỉ lệ số mắt xích (butađien : stiren) trong loại polime trên là A. 1. NHCH(CH3)CO n . C.

7225 m3. Chọn các chất thích hợp cho sơ đồ đó là A. cao su buna . (1).34 Đun nóng poli (vinyl axetat) với kiềm ở điều kiện thích hợp ta thu được sản phẩm trong đó có A. metan (3). (2). vinyl clorua (5). x 3 = . (2). ancol etylic. cao su lưu hoá. (7). xenlulozơ. (4). (5). 5883 m3. 4576 m3. 10. (8). Đốt cháy hoàn toàn một lượng polime này. N2) trong đó có 57. (9). xenlulozơ.37 Đồng trùng hợp đimetyl buta–1. (7). = .36 Chất dẻo PVC được điều chế theo sơ đồ sau: CH 4  H = 1 → A  H = 9%→ B  H = 9 → PVC. (6). B. etilen (4). (1). etilen (9). 13. amilopectin. anđehit fomic (4). B. Câu 4. PVC. xenlulozơ.cao su buna. PE. poli(vinyl ancol). 56 . amilozơ. Polime có dạng cấu trúc mạch không phân nhánh là A. D. amilozơ. (8). D. Câu 4. phenol (5). (5). (3). benzyl clorua (6). (4). x 3 = . B.38 Cho các chất sau: butan (1). các chất đầu và chất trung gian trong quá trình điều chế là: metan (2). D. thu được một loại polime. C.35 Cho các polime : PE. nhựa PVC (6).A. Biết CH4 chiếm 95% thể tích khí thiên nhiên. PVC. 11. Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 x 2 A. (9). ancol vinylic. H2O. C. 6235 m3. B. 12.69% CO2 về thể tích. vậy để điều chế một tấn  0% PVC thì số m3 khí thiên nhiên (đktc) cần là A. Câu 4. cao su lưu hoá. PE. etin (2). y 2 D. (5). axeton. (10). D. (1) → (3) → (2) → (5) → (6). PE. (2). benzen (3). (1). amilopectin. (4). phenyl clorua (10). D. xenlulozơ. y 3 y 3 C. amilozơ. amilopectin. y 5 Câu 4. C. B. PE. (3). C. C.3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y. PVC.  5%  5 Câu 4. Câu 4. PVC. B. (6). (7). = . B.33 Điều chế nhựa phenol-fomanđehit (1). cả A và B. (3). (1) → (4) → (5) → (6). thu được hỗn hợp khí và hơi (CO2. C. axetilen (8). D. (6). (5). (1) → (2) → (4) → (5) → (6). (1). Hãy cho biết sơ đồ chuyển hoá nào sau đây có thể dùng để điều chế poli(vinyl clorua) ? A. amilozơ . cao su buna. PVC. natri phenolat (7). (3). (2). cao su buna.

B. B. D.41 Đun nóng vinyl axetat với kiềm ở điều kiện thích hợp. anđehit axetic. len).43 Để phân biệt lụa sản xuất từ tơ nhân tạo (tơ visco. còn da nhân tạo không cho mùi D. Cl Cl Cl 2 (2) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH (3) CH2 CH CH2 CH Cl Cl n 2 2 xt. So sánh độ bóng của lụa.Câu 4. mẫu lụa sản xuất từ tơ thiên nhiên cho mùi khét. mẫu da thật cho mùi khét. da thật ở vết cắt bị xơ. So sánh độ mềm mại của chúng. So sánh độ mềm mại của chúng. da thật mềm mại hơn da nhân tạo. Dùng dao cắt ngang hai mẫu da. phản ứng nào thuộc loại phản ứng trùng ngưng ? (1) nH2N[CH2]6COOH xt. ancol vinylic. So sánh khả năng thấm nước của chúng. còn da nhân tạo thì bóng. tơ xenlulozơ axetat) và tơ thiên nhiên (tơ tằm.39 Khi cho hai chất X và Y trùng ngưng tạo ra polime Z có công thức O CH2 CH2 O C C6H4 C n O O . HO-C6H4-COOH. chỉ phản ứng (3). Y lần lượt là A. lụa sản xuất từ tơ thiên nhiên dễ may hơn lụa sản xuất từ tơ nhân tạo. D. to. p n + nH2O . C. to. C. chỉ phản ứng (1). HO-CH2-COOH. B. HO-CH2-CH2-OH.42 Xét các phản ứng sau đây. còn mẫu lụa sản xuất từ tơ nhân tạo không cho mùi khét. D. da thật dễ thấm nước hơn. Dùng kim may (máy may) may thử vài đường chỉ trên lụa. Câu 4. Đốt hai mẫu lụa. p HN[CH2]6CO xt. Công thức của X. nhẵn Câu 4. D. HOOC-C6H4-COOH. ta thu được sản phẩm trong đó có: A. C. tơ thiên nhiên (tơ tằm. p + n Cl2 A. n CH2 CH CH CH n + 2HCl . ancol etylic. Đốt hai mẫu da. NH[CH2]6NHCO[CH2]4CO n + 2nH2O . axeton. Câu 4. B. C. cả A. mềm mại hơn tơ nhân tạo. Câu 4.40 Có thể phân biệt các đồ dùng làm bằng da thật và da nhân tạo (PVC) bằng cách nào sau đây? A. hai phản ứng (1) và (2). hai phản ứng (2) và (3). B. len) người ta dùng cách nào sau đây? A. B. lụa sản xuất từ tơ thiên nhiên có độ bóng cao hơn lụa sản xuất từ tơ nhân tạo. HOOC-CH2CH2-COOH. C. to. 57 . C đều đúng. khét. HO-C6H4-OH.

– CCl = CCl – . số thứ tự nhóm B (số electron ngoài cùng + số electron kề ngoài cùng chưa bão hoà).6 C 4. (7) tơ axetat. (2).13 C 4. Câu 4. (7).42 C 4. D. Cl) có hệ số trùng hợp là 560 và phân tử khối là 35.18 C 4.39 A 4. 58 . – CHCl – CHCl – .48 Cho các polime sau đây: (1) tơ tằm.25 A 4. D.14 B 4. B. D. tơ visco. (6). 2. 2.19 D 4. Cấu tạo của kim loại: thường có 1.48 B 4.49 Khi đốt cháy một loại polime chỉ thu được khí CO 2 và hơi H2O với tỉ lệ n CO2 : n H2O = 1:1 . (5).45 C 4.12 D 4. tinh bột. B. protein.28 A 4. B. (2).32 B 4. Vị trí của kim loại: ô nguyên tố (Z). 3 electron ở lớp ngoài cùng. 65kg và 40kg.8 B 4.47 A 4.46 Polime ( CH 2 CH(OH) ) n là sản phẩm của phản ứng trùng hợp sau đó thuỷ phân trong môi trường kiềm của monome nào sau đây ? A.37 A 4. C. polietilen. (6) nilon – 6. tơ polieste. B. Công thức một mắt xích của X là A. chu kì (số lớp electron).7 C 4. H. (6).31 C 4. (2) sợi bông. (5) tơ visco. Loại tơ có nguồn gốc xenlulozơ là A.38 D 4. C2H5COOCH2CH = CH2.9 A 4.16 D 4. Câu 4. 215kg và 80kg.21 C 4.46 B 4.34 C 4. CH2 = CH – COOCH3. (5). Câu 4. C. (3) sợi đay.35 D 4. 175kg và 70kg.30 D 4.40 C CHƯƠNG V. Vậy.000. C. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IV 4. – CH = CCl – . – CH2 – CHCl – . số thứ tự nhóm A (số electron ngoài cùng).41 C 4.27 B 4.23 A 4. ĐẠI CƯƠNG VỀ KIM LOẠI A.5 A 4.24 B 4.20 B 4.1 A 4. (7). C. B. (6).17 C 4.6.2 C 4. D. D.29 B 4. D.36 A 4. Câu 4.43 C 4.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. tơ axetat. B. (3).4 D 4.11 B 4. tơ poliamit.45 Tơ lapsan thuộc loại A.26 D 4. C. (3).3 B 4. Câu 4. poli(vinyl clorua).10 A 4.47 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu ? Biết hiệu suất quá trình este hoá và trùng hợp lần lượt là 60% và 80%.44 A 4.15 C 4. CH2 = CHCOOCH2CH = CH2.Câu 4. A. C.49 B 4.22 D 4. 171kg và 82kg. CH3COOCH = CH2. (2). (1). polime trên thuộc loại nào trong số các polime sau ? A.33B 4.44 Polime X (chứa C. (4) tơ enang.

ánh kim do các electron tự do gây ra. . K. Al.Tác dụng với dd muối Kim loại mạnh (trừ Ba. Ca.Dãy điện hoá kim loại cho phép dự đoán chiều phản ứng giữa 2 cặp oxi hoá khử : chất oxi hoá mạnh nhất sẽ oxi hoá chất khử mạnh nhất sinh ra chất oxi hoá yếu hơn và chất khử yếu hơn. với cặp kim loại A─B. các điện cực tiếp xúc với nhau. H2SO4 đặc oxi hoá kim loại (trừ Pt. Sự ăn mòn kim loại: là sự oxi hoá kim loại do tác dụng của các chất trong môi trường xung quanh : M → Mn+ + ne . Fe + Cu2+ → Fe2+ + Cu . phi kim. trong đó các electron của kim loại được chuyển trực tiếp đến các chất trong môi trường. Au). Hợp kim: là vật liệu kim loại có chứa một kim loại cơ bản và một số kim loại khác hay với một vài hợp kim. . IIA (trừ Be. Tính chất vật lí chung của kim loại: tính dẻo. Hợp kim có t0 nóng chảy thấp hơn. 4. dẫn điện và dẫn nhiệt kém hơn kim loại nguyên chất. H2SO4 đặc Dung dịch HNO3. Nhớ thứ tự các cặp oxi hoá khử sau : Cu2+/Cu Fe3+/Fe2+ Ag+/Ag 2 Fe3+ + Cu → Cu2+ + 2Fe2+ Fe3+ không oxi hoá Ag. Tính chất hoá học chung: tính khử : M  M n+ + ne → . Mg) khử H2O ở t0 thường thành H2. muốn B được bảo vệ thì A phải có tính khử mạnh hơn B.3. hợp chất khử chứa nguyên tố có số oxi hoá thấp lên cao và nó bị khử xuống mức oxi hoá thấp hơn. 6. H2SO4 loãng : M + n H+ → Mn+ + Kim loại sau H không khử được H+ thành H2.khử.Tác dụng với dd HNO3. Na + 2H2O → 2NaOH + H2 . Na) khử ion của kim loại yếu hơn trong dd muối thành kim loại tự do. 8. H2SO4 đặc nguội. . Cr thụ động trong dd HNO3 đặc nguội.khử. 3Cu + 8HNO3 → 3Cu(NO3)2 + 2NO + 4H2O . .Chú ý rằng. trong đó kim loại bị oxi hoá do tác dụng của dung dịch chất điện li và tạo nên dòng electron chuyển dời từ cực âm đến cực dương.Ăn mòn hoá học là quá trình oxi hoá . các điện cực cùng tiếp xúc với 1 dung dịch chất điện li. Liên kết kim loại: lực hút tĩnh điện giữa các electron tự do và các ion dương kim loại. 59 .3 điều kiện cần và đủ để kim loại bị ăn mòn điện hoá : các điện cực khác chất.Ăn mòn điện hoá là quá trình oxi hoá . Cấu tạo của đơn chất kim loại: mạng tinh thể gồm có các ion dương dao động liên tục ở các nút mạng và các electron tự do chuyển động hỗn loạn giữa các ion dương. dẫn điện. dẫn nhiệt. 5.Tác dụng với H2O IA.Tác dụng với phi kim : xM + M+ y O2 → MxOy 2 n Cl2 → MCln 2 n H2 2 .Tác dụng với axit HCl.Fe. nhưng cứng hơn kim loại nguyên chất. . 9.

b) It = ne. n là hoá trị (hoặc số mol electrron trao đổi tính cho 1 mol chất thoát ra ở điện cực. Nguyên tắc điều chế kim loại: là sự khử ion kim loại : Mn+ + ne → M . 11. t là thời gian điện phân tính bằng giây. 60 . CO. K. . ne là số mol electron trao đổi trong quá trình điện phân. A là nguyên tử khối (hoặc phân tử khối). m là lượng chất thoát ra ở điện cực theo gam. C. IIA.96500 Trong đó I là cường độ dòng điện tính bằng Ampe. Al) và oxit của kim loại cần điều chế (sau Al). * Phương pháp điện phân dung dịch để điều chế kim loại sau Al.10. * Phương pháp điện phân nóng chảy để điều chế kim loại IA. Na) * Phương pháp nhiệt luyện cần có 1 trong 4 chất khử (H2.Các phương pháp điều chế kim loại : * Phương pháp thuỷ luyện cần có dung dịch muối của kim loại cần điều chế (sau Al) và kim loại có tính khử mạnh hơn (trừ Ba.It n 96500 Trong đó I là cường độ dòng điện tính bằng Ampe. Al. Công thức của định luật Farađay a) m = A 1 . t là thời gian điện phân tính bằng giây. Ca.

2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 61 . 2NaCl  2 Na + Cl2 → 1 ñpnc 19. Na + H2O  NaOH + H2 → 2 8. Fe + 4HNO3  Fe(NO3)3 + NO + 2H2O → >570 C 6. Fe + CuSO4  FeSO4 + Cu → 10. 3Fe + 2O2  → 4.B. Fe + 2AgNO3  Fe(NO3)2 + 2Ag → 13. 2Fe + 3Cl2  → 0 t 2. 2NaOH  2Na + O2 + H2O → 2 ñpnc 20. Fe + H2O → FeO + H2 1 7. CuSO4 + H2O  Cu + → 26. CuCl2  Cu + Cl2 → 0 1 O2 + H2SO4 2 1 ñpdd 25. 2FeCl3 + Fe  3FeCl2 → 11.MỘT SỐ PHẢN ỨNG THƯỜNG GẶP t 1. Fe2(SO4)3 + Cu  CuSO4 + 2FeSO4 → 12. Fe2O3 + 3CO  2Fe + 3CO2 → t0 16. MgCl2  Mg + Cl2 → ñpdd 23. Fe + 2HCl  → 0 2FeCl3 FeS Fe3O4 FeCl2 + H2 5. Al2O3  2Al + O2 → 2 ñpnc 18. 3Fe3O4 + 8Al  4Al2O3 + 9Fe → 3 ñpnc 17. Ba + 2H2O  Ba(OH)2 + H2 → 0 9. dư  Fe(NO3)3 + 3Ag → t 14. Fe + S  → t0 3. 2AgNO3 + H2O  2Ag + O2 + 2HNO3 → 2 ñpdd 24. Fe + 3AgNO3. H2 + PbO  H2O + Pb → t0 15.

B. F. chu kì 4. B. Dãy gồm các nguyên tử và ion có cấu hình electron trên là A. 53. C. D. nhóm VIIIA. Ca2+. ô 26. chu kì 3. Ba. F. 82%. Ar.1 Vị trí của nguyên tử M (Z = 26) trong bảng hệ thống tuần hoàn là A. các nguyên tử kim loại. Cl.6g khí H2 bay ra.Ni. Mg. chu kì 4. B. D. 35. C. Câu 5. Ar.4g hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 0.4 Cho cấu hình electron: 1s22s22p63s23p6. nhóm IIB. 2+ Câu 5. C. Ar. C. Câu 5.C .BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 5. C.3 Trong mạng tinh thể kim loại có A. ô 26. D. C. Ca2+. D.7 Hoà tan hoàn toàn 15. Phần trăm khối lượng của Al trong hợp kim là A. nhóm VIIIB. 36. Na. nhóm IIB. nhóm VIIIA.6 Hoà tan 1.44g một kim loại hoá trị II trong 150ml dung dịch H 2SO40.8 Liên kết kim loại là A. nhóm VIIIB.5M. D. D. liên kết sinh ra bởi lực hút tĩnh điện giữa nguyên tử H tích điện dương và nguyên tử O tích điện âm. chu kì 4. D. B. B. B. chu kì 4. Câu 5. Be. 84%. B. chu kì 4. ion âm phi kim và ion dương kim loại. Cl. các electron tự do. Kim loại đó là A. Cl-. ô 18. C. C. ô 26. C. Cl. + Câu 5.7. Câu 5. cứ 10 mol Al thì có 1 mol Ni. 81%. chu kì 3. B. B. Ar. 83%. Nguyên tử M là A. D. D.7. Muốn trung hoà axit dư trong dung dịch thu được phải dùng hết 30ml dung dịch NaOH 1M. các ion dương kim loại và các electron tự do. Câu 5.7. 63. liên kết sinh ra bởi lực hút tĩnh điện giữa các ion dương và các electron tự do. Vị trí M trong bảng hệ thống tuần hoàn là A. Câu 5. nhóm IIA. ô 18. 62 . K+. Số g muối tạo ra là A. nhóm IIA. liên kết giữa các nguyên tử bằng các cặp electron dùng chung. liên kết sinh ra bởi lực hút tĩnh điện giữa ion dương và các ion âm. ô 20.2 Ion M có cấu hình electron ở lớp ngoài cùng là 3s 23p6. ô 26.9 Trong hợp kim Al. chu kì 4.7. K. K+. Ca. ô 20.5 Cation M có cấu hình electron ở phân lớp ngoài cùng là 2p6.

D.Fe khử Cu2+ thành Cu. Công thức hoá học của hợp kim là A. Pb2+.16 Ngâm một lá kẽm nhỏ trong một dung dịch có chứa 2. Y lần lượt là A. Na+. D.13 Hợp kim có A. Câu 5. Zn(NO3)2. Câu 5. Fe2+).Zn trong dung dịch HCl đến phản ứng hoàn toàn thu được 0. Cu.18 Cho lá sắt vào dung dịch HCl loãng có một lượng nhỏ CuSO4 thấy H2 thoát ra càng lúc càng nhanh do A. X có thể là A. Ni khử được các ion kim loại A. ánh kim. Ag+.1%. D. Cu2+. dẫn nhiệt.3% Al. C. C. Y ( Cu2+. Fe. B. X ( Ag). C. Pb(NO3)2. 73. D. 63%. CuSO4.33g hợp kim Fe. khối lượng lá kẽm tăng thêm 0. X ( Ag). Y (Cu2+). D. Zn.20 Cho bột Cu đến dư vào dung dịch hỗn hợp gồm Fe(NO3)3 và AgNO3 thu được chất rắn X và dung dịch Y. Câu 5. ánh kim. Ag+. Câu 5. Sn. 63 . C. Cu2+.Câu 5. Tính cứng. dẫn nhiệt cao hơn kim loại nguyên chất. B.896 lít H2 (đktc). CuAl.1%. Ni. Nhiệt độ nóng chảy cao. dẫn nhiệt. Mg2+.19 Ngâm một lá Ni lần lượt trong những dung dịch muối sau : MgSO4.15 Một phương pháp hoá học làm sạch một loại thuỷ ngân có lẫn Zn. tính cứng hơn kim loại nguyên chất. B. Cu. C. M là A.24g ion M 2+. dẫn điện. B. D. B. Thêm dung dịch HCl vào dung dịch trên. C.5g hợp kim của Ag vào dung dịch HNO3. Ag+. dẫn điện.17 Để bảo vệ vỏ tàu đi biển phần ngâm dưới nước người ta nối nó với A. Cu3Al2.11 Hoà tan 0. dẫn điện.Fe tan trong dung dịch HCl tạo khí H2. Lá sắt bị ăn mòn kiểu hoá học. 72. Tính dẻo. nhiệt độ nóng chảy cao hơn kim loại nguyên chất. C. AgNO3. Câu 5. C. Cd. Phản ứng xong. B. ánh kim. 75. Sn. Cu2+.14 Một hợp kim Cu-Al chứa 12. Sn(NO3)2. Câu 5. Câu 5. Tính mềm. 61%. Câu 5. X ( Ag. Fe2+). C. B. Y (Cu2+). Cu2+. CuAl3. NaCl.1%. tính dẫn điện. 60%. D. dẫn điện. 62%. Y ( Cu2+. B. Thành phần % của Fe là A. C. thu được 0. B.1%. 74.398g kết tủa. Ag. Ag+. Câu 5.94g. Thành phần %Ag trong hợp kim là A. dẫn nhiệt. Cu). D. X (Fe).12 Tính chất vật lí chung của kim loại là A. C. Lá sắt bị ăn mòn kiểu điện hoá. B.10 Ngâm 2. ZnCl2. D. Pb(NO3)2. Pb là ngâm hỗn hợp trong dung dịch X dư. B. D. ánh kim. Câu 5. Al3+. D. X. Hg(NO3)2. tính dẻo hơn kim loại nguyên chất. dẫn nhiệt. Cu3Al. AlCl3.

giảm 1. Cu2+/ Cu. Fe3+/ Fe2+. Câu 5.25 Trong một dung dịch A có chứa đồng thời các cation sau : K+. C. SO42-. sau đó kết tủa không tan.. xuất hiện Cu màu đỏ. FeO. 2+ + C. B. Câu 5. không bị khử. sau đó kết tủa tan. Fe. Câu 5. C. Al3+. Cu2+.22 Ngâm một lá Zn trong 200ml dung dịch AgNO3 0. D. (2). B. có khí thoát ra. Kim loại khử được ion Fe3+ thành Fe là A. Ag+/Ag. C. NO3-. xuất hiện kết tủa xanh. tăng 0. Fe2+. Ag+. Ag. Fe2+/ Fe. Kim loại Cu khử được các ion trong các cặp oxi hoá trên là A. B. Fe2+. Al3+. Fe3+/ Fe2+.28 Khi nung Fe(OH)2 trong không khí ẩm đến khối lượng không đổi. D. C. Ag+/ Ag. AgNO3. CO32-. Ag+. Ag+ và các kim loại : Fe. Câu 5. Ag. Fe2+. B. B. Al3+. C.43g. Fe3+. D. Cu2+/ Cu. Câu 5. Fe3+/ Fe2+. Cu2+/Cu. Fe3+. B. Câu 5. Fe3+.51g. Cu. Cu(NO3)2.24 Có một hỗn hợp gồm: Fe. Cu2+. Fe3O4. C. Al. 2+ Câu 5. Fe2+/ Fe. Ion Cu2+ bị khử thành Cu trong thí nghiệm A. B. D.1M. Cu. Câu 5. (1). Ag+. Cu2+/ Cu. tính khử của kim loại giảm A. ống nghiệm (2) một đinh Fe đã làm sạch. Fe2+. dung dịch mất màu xanh.26 Cho các cặp oxi hoá. Ag . Ba2+. Ag+.Câu 5. Cho vào ống nghiệm (1) một miếng nhỏ Na. Fe3+.khử : Al3+/Al. Fe2+/ Fe.khử : Al3+/Al. có khí thoát ra. Al3+. (1) và (2). Cu. Fe2+/ Fe. Cu2+. Fe3+/ Fe2+. Fe2+. Al3+. Khi phản ứng kết thúc khối lượng lá Zn A. Fe3+. Chọn một dãy điện hoá gồm các cặp oxi hoá. Cl-. B. Trong dung dịch A chỉ chứa một loại anion là A. Ag+/Ag. Fe3+.Ag+/Ag. Ag+. C. giảm 0. xuất hiện kết tủa xanh.23 Cho các ion : Fe . Fe3+/ Fe2+.khử xếp theo chiều tính oxi hoá của ion kim loại tăng. Fe(OH)3. Fe2O3. xuất hiện Cu màu đỏ. dung dịch có màu xanh. Fe2+. Fe2+.29 Thả Na vào dung dịch CuSO4 quan sát thấy hiện tượng A. Cu2+. Tách Ag ra khỏi hỗn hợp với khối lượng không đổi người ta dùng dung dịch A. Cu. B. FeCl2. Cu2+. D. Ag+/Ag.30 Có 2 ống nghiệm đựng dung dịch CuSO4. Cu2+/Cu. D. C. Fe3+. Câu 5. D. Fe . FeCl3. Fe3+/Fe2+. C.43g.21 Chọn một dãy chất tính oxi hoá tăng A. ta thu được chất rắn là A. Ag+. B. 64 . D. D. D.51g. Fe2+/ Fe. tăng 1. Ag+/Ag. Cu2+/Cu.27 Cho các cặp oxi hoá. Fe2+/ Fe.

Ag. Mg. C. C. B.15g. B. B.35 Cho sơ đồ : CaCO3 → CaO → CaCl2 → Ca.6%. C.685g. FeO. dung dịch HCl. Fe. Sau phản ứng khối lượng kim loại có trong bình là 1. Câu 5.12g bột Fe và 0.7%.40 Hoà tan m g Ba vào nước thu được 1 lít dung dịch có pH = 12. Na. B. Câu 5. Giá trị của m là A.92 gam. 4.68%. 0. Câu 5.Câu 5. D. Cl2 ở anot. D. B. Tên kim loại là A.36 Từ dung dịch CuSO4 để điều chế Cu. D. Điều kiện phản ứng và hoá chất thích hợp cho sơ đồ trên lần lượt là A. Cl2 ở catot. Fe.88g. 8. C. 23. C.37 Điện phân NaCl nóng chảy với điện cực trơ. 0.74g. Sau khi thu được 336ml H2 (đktc) thì thấy khối lượng lá kim loại giảm 1.7%. C. người ta thu được A. dung dịch HNO3. Al. D.06M. 3. D. NaClO. NaOH. 9000C. 2. 9000C. 8. Câu 5.9%. Fe. sau 1930 giây thấy khối lượng catot tăng 1.7%. 0.38 Một loại quặng sắt chứa 80% Fe2O3 và 10% SiO2. D.87%. Câu 5. 54%. Fe. 0.1M. 56%. Na ở catot. 0. Cu. dung dịch HCl. Nồng độ C% của dung dịch CuSO4 còn lại là A. 53%.7%. Câu 5. D.154g. điện phân CaCl2 nóng chảy.39 Điện phân (điện cực trơ) dung dịch muối sunfat của một kim loại hoá trị II với cường độ dòng điện 3A. Ba. C.53%. có màng ngăn 2 điện cực. 9000C. MgO cần dùng 7g khí CO. B. 9. H2 ở catot. điện phân dung dịch CaCl2.33 Ngâm một lá kim loại có khối lượng 50g trong dung dịch HCl. 4. B.12 g/ml). người ta dùng A. 2.34 Để khử hoàn toàn 30g hỗn hợp gồm CuO. Câu 5. D. 3.31 Cho 1. 3. Hg. Cu. Ni. Khi que sắt đã được mạ kín thì có khối lượng là 5. điện phân CaSO4 nóng chảy. B. dung dịch H2SO4 loãng. Kim loại đó là A. 65 .15g. Fe 2O3 Fe3O4. 9000C. 25. 9. Nồng độ mol/lít của dung dịch CuSO4 trước phản ứng là A.12M.04M. Cl2 ở anot. B. B. Câu 5. D. D. C. 26. 52%. 24.24g bột Mg vào một bình chứa sẵn 250ml dung dịch CuSO4. C. Na ở anot. Câu 5. Thành phần % theo khối lượng của Fe và Si trong quặng này lần lượt là A. điện phân Ca(NO3)2 nóng chảy. Số gam chất rắn thu được sau phản ứng là A.32 Nhúng một que sắt nặng 5g vào 50ml dung dịch CuSO 4 15% (D = 1. C.

D.2g Cu vào 500 ml dung dịch NaNO3 1M. C. 12. Fe. D. Câu 5. C.47 Cho 16.49 Cho 19.44 lít khí (đktc).48 Có 5 mẫu kim loại: Mg. Fe.2 gam kim loại và 6.72 lít khí (đktc).2g. Mg. Câu 5. D.25g. Al.45 Sau một thời gian điện phân dung dịch CuCl2 thu được 1.72 lít. Điện phân MgCl2 nóng chảy. 0. phản ứng xong thấy khối lượng đinh Fe tăng thêm 1. C. B. Ngâm một đinh Fe trong dung dịch còn lại sau điện phân.75g. 9. B. D. Ba. người ta lọc lấy dung dịch có pH = 2. NaClO.5g khí H2. Al. CaCl2. Thể tích khí NO (đktc) thu được là A. C. Câu 5. Al. 2. Sau một thời gian. Cl2. Khi cô cạn dung dịch thu được số gam muối khan là A.24 lít. C.15 mol O 2. MgCl2. người ta thu được sản phẩm là A. NaCl. D.Câu 5.42 Điện phân nóng chảy muối clorua của kim loại M. NaCl. Câu 5. Chất rắn sau phản ứng tan trong dung dịch HCl dư tạo 13.26g. Câu 5.6g. Cho dd MgCl2 tác dụng dd Na2CO3. Thả Na vào dung dịch MgCl2. 1. Fe. Ca. D. Ở catot thu được 7. KCl. Cu. 0. không có màng ngăn 2 điện cực.2g.44 Ion Mg bị khử trong trường hợp A.43 Điện phân dung dịch NaOH với điện cực trơ. Điện phân dung dịch MgCl2. 28. B. Câu 5. 3.1M. Mg. B. B. B. Rót 250ml dung dịch này vào cốc đựng mạt sắt. Mg. Al. Al. Cu. 27. Mg.46 Hoà tan hoàn toàn 10g hỗn hợp Al và Mg trong dung dịch HCl thu được 0. Câu 5. Ba. 3.63g. 66 . 2+ Câu 5. 2g. Kim loại M là A. B. Ba.25g.50 Có dung dịch HCl 0. C. sau đó thêm 500ml dung dịch HCl 2M.8g. D. 28. 4. D. Mg. C.2g kim loại M (hoá trị không đổi) tác dụng với 0. Al. Muối clorua đó là A.48 lít. Nếu chỉ dùng thêm dung dịch H2SO4 loãng thì có thể nhận biết A. C. Khối lượng sắt đã tham gia phản ứng là A. NaOH. Fe. Mg.14g.41 Điện phân muối clorua nóng chảy của kim loại M thu được 12g kim loại và 0.75g. Số gam Cu điều chế được từ các thí nghiệm trên là A. 0. C. Ba. M là A.12 lít khí (đktc) ở anot. Ba. B.3 mol khí. B. Cu.36 lít. 27. D. C. 6. Ca. B. Na.7g. D. Câu 5.

C. C. D. D. Cu. 1. D. 0. C.Câu 5. C. D. Nồng độ mol/l của dung dịch CuSO4 đã pha chế là A. BaSO4. 3.725M.52 Cho dòng khí CO2 liên tục đi qua cốc đựng dung dịch Ca(OH)2.53 Hiện tượng tạo thành các thạch nhũ trong các hang động được giải thích bằng phản ứng A.76.54g.02.54 Một hỗn hợp X gồm Na và Al được trộn theo tỉ lệ mol 1: 2.58 Cho các chất: CaCO3. D.6. C. Giá trị của m là A. sau khi kết thúc phản ứng thu được 8.92. Ag. C. thuốc thử đó là A. Số phương trình phản ứng hoá học (dạng phân tử) xảy ra khi cho các chất tác dụng với nhau từng đôi một là A. C. B. Câu 5. Cho X vào một lượng nước dư.8g muối sunfat của một kim loại nhóm IIA trong nước rồi pha loãng cho đủ 50ml dung dịch. D.7g. Dung dịch HNO3. Ag. B.464M. Câu 5. Câu 5.232M. n CO2 = 2 n Ca(OH)2 . n CO2 = n Ca(OH)2 . Câu 5.5H2O trong nước được 500ml dung dịch. B. CO2 + Ca(OH)2 → CaCO3 + H2O. D. BeSO4. B. Câu 5. Mg.4g. CaO + CO2 → CaCO3. lượng kết tủa thu được lớn nhất là A. Tên kim loại đó là A. 0.55 Hoà tan 1. 0.3625M. C.44g hỗn hợp 2 muối. CaSO4. B.55g muối khan.2. Dung dịch H2SO4 loãng. kẽm. n CO2 > n Ca(OH)2 . Câu 5. 0. 2.51 Cho 0.96 lít khí H 2 và m g một chất rắn.52 và 8. Câu 5. dung dịch HCl. 67 . Fe. magie.27g.11 mol khí CO2 đi qua dung dịch NaOH sinh ra 11. 5.84 và 10. Cu. Số g mỗi muối trong hỗn hợp là A. 0. Hai kim loại X. B. Dung dịch CuSO4. sau đó cô cạn dung dịch thu được 5. n CO2 < n Ca(OH)2 . Y lần lượt là A.60 Cho phương trình phản ứng : a X + b Y(NO3)a → a X(NO3)b + b Y Biết dung dịch X(NO3)b có màu xanh. 4. B.68 và 9.0g một kim loại hoá trị II trong dung dịch HCl. bari. C. Câu 5. dung dịch NaHCO3. B. Dung dịch HCl. 2. Công thức của muối sunfat là A. dung dịch NaOH. 0.59 Dùng một thuốc thử phân biệt Fe2O3 và Fe3O4. D. Để phản ứng hết với dung dịch này cần 20ml dung dịch BaCl2 0. B. 0. D. canxi. D. Cu. Fe.42 và 11. C.75M. Ca(HCO3)2 → CaCO3 + CO2 + H2O. Na2CO3 + Ca(OH)2 → CaCO3 + 2 NaOH. Câu 5. B. 0. 1.57 Hoà tan 58g muối CuSO4.56 Hoà tan 2. MgSO4.

MnO4. B. dư thu được 0. C. AgNO3. Câu 5. Câu 5. 2a + 3b = 2c + d. c. 10.68 Trong một cốc nước chứa a mol Al3+.64g. Ag.10. Vai trò của ion NO3.8g. C. Cho A tác dụng hết với dung dịch HNO3 loãng. D. B.63 Khuấy một thanh kim loại M hoá trị 2 trong 200ml dung dịch Cu(NO3)2 0. bị khử.4M đến khi dung dịch hết màu xanh. d là A. Câu 5. Biết hiệu suất phản ứng điện phân là 80%. MgSO4.62 Điện phân nóng chảy 76g muối MCl2 thu được 0. khối lượng thanh M tăng 0. b. B.tạo thành phức với Fe2+. D. MgSO4.64 Khi phản ứng với Fe2+ trong môi trường axit dư. MnO4. Số phương trình phản ứng hoá học xảy ra khi cho kim loại và muối tác dụng với nhau là A. D. Ag. Nguyên tử khối của M là A. Biết rằng toàn bộ Cu sinh ra đều bám hết vào thanh M. vừa bị khử vừa bị oxi hoá. V có giá trị là A. C. dung dịch KMnO4 bị mất màu là do A. D. Câu 5. C. Fe2(SO4)3. MnO4. FeSO4. C. Mg. không bị khử không bị oxi hoá. 4. c mol Cl-.là A.bị khử thành Mn2+. D. b mol Cu2+.1 mol khí duy nhất NO (đktc). 9. thu được dung dịch Y và một phần sắt không tan. 3.65 Có các kim loại Cu. 1. Câu 5. B. MgSO4. 0.Câu 5.3) g muối MCln. D.08g. Fe2(SO4)3.66 Một kim loại dùng để loại bỏ tạp chất Fe2(SO4)3 trong dung dịch FeSO4 là A. 0. C. Biểu thức liên hệ giữa a. D. C. Câu 5. Cu. B. 65.70 m g phoi sắt để ngoài không khí lâu ngày bị gỉ tạo thành hỗn hợp A có khối lượng 12g gồm 4 chất rắn. 2.64 mol khí Cl2 ở anot. 2a + 2b = c + d. Fe và các dung dịch muối Cu(NO3)2. Chất tan có trong dung dịch Y là A.6 lít. 3a + 2b = c + d.không màu trong môi trường axit. 24.2 lít.3 lít. B. B.4 lít. B. Fe(NO3)2. Cu. C. II – BÀI TẬP NÂNG CAO Câu 5. Zn. B. 68 . Câu 5. Ca. MnO4. MgSO4.61 Cho a g kim loại M tác dụng vừa đủ với V lít dung dịch HCl 2M thu được (a + 21. B. d mol SO42-.08g.bị oxi hoá. Giá trị m là A. C. 9. D. 0. bị oxi hoá. 0.80g. Câu 5. Ba. D. 27.67 Cho hỗn hợp X gồm Mg và Fe vào dung dịch axit H 2SO4 đặc nóng đến khi các phản ứng xảy ra hoàn toàn. C. 56. D. Tên của M là A. Fe.69 Cho Cu vào hỗn hợp gồm NaNO3 và H2SO4 loãng. 3a + 2b = c + 2d. FeSO4.

Câu 5.48 lít.2g hỗn hợp 3 kim loại Mg.73 Nung nóng 16. C. 3. dư thu được 6. 2. Câu 5. 3. X2 có hoá trị không đổi.63 lít. 22g. D.224 lít.6 lít.24 lít. 5. 0. Zn. nóng thu được 5. D.12 lít NO duy nhất (đktc). được 1. C. 2.36 lít H2 (đktc). 25.368 lít H 2 (đktc).21 %. C.87g. Hoà tan hết hỗn hợp X bằng H2SO4 đặc. không tác dụng với nước và đứng trước Cu. D.36 lít.8g. 24g. 20g.95g. Giá trị m là A. C. C. Cho A tác dụng hết với dung dịch HNO3 loãng.53g. 26%.24 lít. D. Be và Mg. D. Thành phần % về khối lượng Mg trong hỗn hợp X là A. dư thì thể tích N2 (đktc) là A. 2. Giá trị của V là A. C. 3. 2. 39. Mg và Ca. B. D.72 lít khí (đktc). 0. Sr và Ba. Cô cạn dung dịch thì số gam muối khan thu được là A.77 Cho 10.5g. D. B. 25. 0.2g. B. 36%.025 mol khí NO thoát ra.336 lít. 29g. C. 35. Hoà tan hết X bằng dung dịch HNO3 thấy có 0. sau một thời gian thu được m g hỗn hợp X gồm các oxit và sắt dư. Vậy 2 kim loại đó là A. B. D.3 mol khí (đktc). 27.76 Cho 36.71 11. Nếu cho X tác dụng hết với dung dịch HNO3 loãng. thu được Cu.6 lít khí (đktc).8g bột sắt ngoài không khí.242 lít.7g.Câu 5. 26g. B.2g sắt để ngoài không khí bị gỉ thành 13.79 Cho 22g hỗn hợp muối cacbonat của kim loại IA và IIA tác dụng với dung dịch HCl dư thu được 0. Giá trị m là A.8g hỗn hợp 2 muối cacbonat của 2 kim loại thuộc nhóm II ở 2 chu kì kế tiếp nhau khi tác dụng hết với dung dịch HCl thu được 0.6 lít SO2 (đktc). 37. 18. 35g. Câu 5. 0. dư thu được V lít NO (đktc) duy nhất. 3. Chia X thành phần bằng nhau: .01%. Câu 5. V có giá trị là A. Câu 5.0. Cô cạn dung dịch thì số gam muối khan là A.224 lít. Al tác dụng hết với dung dịch HCl dư thu được 5. Câu 5.75 Hỗn hợp X gồm 2 kim loại X1.74 Hỗn hợp X gồm 2 kim loại đều có hoá trị không đổi.5M được dung dịch Z và 4. C. 1.Phần 1: hoà tan hết trong dung dịch chứa HCl và H2SO4 loãng thu được 3.4 mol khí CO2.336 lít. C. B. Cho X tan hết trong dung dịch CuSO 4 dư. D.2. 27g. B. C.52g. 69 . Câu 5. 3. Câu 5. B.78 Cho 11g hỗn hợp nhiều kim loại trước hiđro tác dụng với dung dịch H2SO4 loãng. .72 Oxi hoá m g sắt ngoài không khí.87g hỗn hợp X gồm Mg và Al vào 250ml dung dịch Y chứa axit HCl 1M và H2SO4 0.25g. D. 0.36 lít. B.3g. Câu 5. Đem Cu cho tan hết trong dung dịch HNO3 loãng dư.80 Cho 3.98g. B. được 3g hỗn hợp rắn gồm 4 chất. 4.Phần 2: hoà tan hết trong dung dịch HNO3 loãng thu được V lít khí NO (đktc).252g. 28g. Cô cạn dung dịch thì số gam muối khan thu được là A. Ca và Sr.6g chất rắn A.

Câu 5.81 Hoà tan hoàn toàn 2,81g hỗn hợp gồm Fe2O3, Al2O3, MgO, ZnO trong 500ml dung dịch axit H2SO4 0,2M (vừa đủ). Cô cạn dung dịch sau phản ứng, muối sunfat khan thu được có khối lượng là A. 6,81g. B. 10,81g. C. 5,81g. D. 4,81g. Câu 5.82 Cho 1,935g hỗn hợp gồm 2 kim loại Mg và Al tác dụng với 125ml dung dịch gồm HCl 1M và H2SO4 loãng 0,28M, thu được dung dịch X và 2,184 lít H 2 (đktc). Cô cạn dung dịch, thu được số gam muối là A. 9,7325g. B. 9,3725g. C. 9,7532g. D. 9,2357g. Câu 5.83 Cho 10g hỗn hợp gồm Al và một kim loại M (hoá trị x) tác dụng với 100ml dung dịch gồm H2SO4 aM và HCl 3aM, thu được 5,6 lít H2 (đktc), dung dịch X và 1,7g chất rắn. Khối lượng muối thu được là A. 2,85g. B. 2,855g. C. 28,55g. D. 28,5g. Câu 5.84 Cho 7,2g Mg tác dụng hết với dung dịch HNO 3 loãng, dư thu được 6,72 lít khí Y và dung dịch Z. Làm bay hơi Z thu được 47,4g chất rắn khan. Công thức phân tử của khí Y là A. N2O. B. NO. C. N2. D. NO2. Câu 5.85 Đốt nóng một hỗn hợp X gồm Al và Fe3O4 trong điều kiện không có không khí được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: Phần 1: tác dụng với dung dịch NaOH dư thu được 3,36 lít H2 (đktc). Phần 2 : tác dụng với dung dịch HCl dư thu được 13,44 lít H 2 (đktc). Thành phần % về khối lượng của Al trong hỗn hợp X là (hiệu suất phản ứng 100%) A. 27,95%. B. 2,795%. C. 72,05%. D. 7,205%. Câu 5.86 Cho hỗn hợp A gồm bột Al và Fe3O4. Nung nóng A ở nhiệt độ cao trong môi trường không có không khí để phản ứng xảy ra hoàn toàn thu được hỗn hợp B. Nghiền nhỏ B rồi chia làm 2 phần: - Phần 1 (ít) tác dụng với dung dịch NaOH dư thu được 1,176 lít H2 (đktc). Tách riêng chất không tan đem hoà tan trong dung dịch HCl dư thu được 1,008 lít khí (đktc) - Phần 2 (nhiều) tác dụng với dung dịch HCl dư thu được 6,552 lít khí (đktc).Khối lượng hỗn hợp A là A. 22,02g. B. 8,1g. C. 13,92g. D. 3,465g. Câu 5.87 Một hỗn hợp gồm Na, Ba có tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí B. Thể tích dung dịch HCl 0,1 M để trung hoà

1 dung dịch A là 10

A. 0,4 lít. B. 0,2 lít. C. 0,6 lít. D. 6 lít. Câu 5.88 Cho m gam hỗn hợp X gồm K và Al tác dụng với nước dư thu được 0,25 mol khí. Nếu cho m gam X tác dụng với Ba(OH)2 dư thu được 0,4 mol khí (các phản ứng đều xảy ra hoàn toàn). m có giá trị là A. 12,8g. B. 16g. C. 18g. D. 10,95g.

70

Câu 5.89 Dùng CO khử m g Fe2O3 ở nhiệt độ cao được 0,4 mol CO2 và hỗn hợp rắn X (gồm 4 chất). Hoà tan hết X cần 0,9 lít dung dịch HCl 1M thấy có 0,25 mol khí thoát ra. Giá trị m là A. 32g. B. 40g. C. 80g. D. 3,2g. Câu 5.90 Dùng CO khử m g Fe2O3 ở nhiệt độ cao thu được 1,1 gam CO2 và chất rắn X gồm 3 oxit. X phản ứng vừa đủ với 0,25 lít dung dịch H2SO4 loãng 0,5M. Giá trị m là A. 8,0g. B. 4,0g. C. 1,6g. D. 3,2g. Câu 5.91 Cho 0,1 mol CO (đktc) từ từ đi qua ống sứ nung nóng đựng 4 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Hỗn hợp khí thu được sau phản ứng có tỉ khối hơi so với H2 bằng 20. Công thức của oxit sắt và thành phần % CO 2 theo thể tích trong hỗn hợp khí sau phản ứng là A. FeO ; 75% B. Fe2O3 ; 75% C. Fe2O3 ; 65% D. Fe3O4 ; 75% Câu 5.92 Một dung dịch có chứa 2 cation là Fe2+ (0,1 mol); Al3+ (0,2 mol) và 2 anion Cl- (x mol), SO42- (y mol). Khi cô cạn dung dịch thu được 46,9 gam chất rắn khan. x và y có giá trị lần lượt là A. 0,02 và 0,03. B. 0,03 và 0,02. C. 0,2 và 0,3. D. 0,3 và 0,2. Câu 5.93 Thêm V lít dung dịch Na2CO3 1M vào một dung dịch có chứa đồng thời các ion − − sau: Ba2+; Ca2+; Mg2+; 0,2 mol Cl ; 0,3 mol NO3 . Để tạo lượng kết tủa lớn nhất thì giá trị của V là B. 0,25 lít. A. 2,5 lít. C. 0,5 lít. D. 5 lít. Câu 5.94 Hoà tan 16,2g Al trong dung dịch HNO3 loãng, dư thu được hỗn hợp khí gồm NO và N2 có tỉ khối hơi so với H2 là 14,4. Thể tích (tính theo lít) của NO, N2 lần lượt là A. 2,24 và 3,36. B. 0,224 và 0,336. C. 22,4 và 33,6. D. 2,24 và 4,48. Câu 5.95 Cho 13,5g nhôm tác dụng vừa đủ với dung dịch HNO 3 0,86M thu được hỗn hợp khí gồm NO và N2O có tỉ khối hơi đối với H 2 bằng 19,2. Thể tích dung dịch HNO3 cần dùng là A. 2,2 lít. B. 0,22 lít. C. 0,46 lít. D. 4,65 lít. Câu 5.96 Hoà tan một hợp kim Ba-Na với tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí. Thêm m g NaOH vào

1 dung dịch A ta được dung dịch B. Cho dung dịch B tác 10

dụng với 100ml dung dịch Al2(SO4)3 0,2M được kết tủa C. Giá trị m để được kết tủa C lớn nhất, nhỏ nhất lần lượt là A. 2,4g và 4g. B. 4g và 2,4g. C. 4,8g và 6,4g. D. 6,4g và 4,8g. Câu 5.97 Rót 150ml dung dịch NaOH 7M vào 50ml dung dịch Al 2(SO4)3 2M. Khối lượng chất dư sau thí nghiệm là A. 10g. B. 14g. C. 12g. D. 16g.

71

Câu 5.98 Dung dịch chứa 16,8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3, thêm vào 13,68g Al2(SO4)3 thu được kết tủa và dung dịch A. Đun nóng kết tủa đến khối lượng không đổi được chất rắn B. Khối lượng chất rắn B là A. 2,12g. B. 21,2g. C. 42,2g. D. 4,22g. Câu 5.99 Cho 18,9g muối Na2SO3 tác dụng hết với dung dịch HCl thu được khí A (đktc). Dẫn khí A vào dung dịch Ba(OH)2 dư. Sau khi hấp thụ, khối lượng dung dịch sẽ A. tăng 22,95g. B. giảm 22,95g. C. tăng 20,25g. D. giảm 20,25g. Câu 5.100 Đốt cháy hoàn toàn 0,336 lít C3H8 (đktc) bằng lượng oxi vừa đủ. Thu được toàn bộ sản phẩm cháy cho vào 35 ml dung dịch Ca(OH) 2 1M. Sau khi hấp thụ, khối lượng dung dịch A. tăng 0,56g. B. giảm 0,56g. C. tăng 5,6g. D. giảm 5,6g. Câu 5.101 m g hỗn hợp Mg, Al tác dụng với 250ml dung dịch X chứa hỗn hợp HCl 1M và H2SO4 0,5M sinh ra 5,32 lít H2 (đktc) và dung dịch Y (coi Vdung dịch không đổi). dung dịch có pH là A. 1. B. 7. C. 2. D. 6. Câu 5.102 Trộn 100ml dung dịch gồm Ba(OH)2 0,1M và NaOH 0,1M với 400ml dung dịch gồm H2SO4 0,0375M và HCl 0,0125M thu được dung dịch X. pH của dung dịch X là A. 2. B. 7. C. 6. D. 1.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG V
5.1 A 5.11 A 5.21 A 5.31 A 5.41 A 5.51 A 5.61 C 5.71 A 5.81 B 5.91 B 5.101 A 5.2 A 5.12 A 5.22 B 5.32 D 5.42 B 5.52 A 5.62 A 5.72 A 5.82 A 5.92 C 5.102 A 5.3 C 5.13 A 5.23 A 5.33 A 5.43 B 5.53 B 5.63 B 5.73 C 5.83 C 5.93 A 5.4 D 5.14 A 5.24 C 5.34 D 5.44 B 5.54 C 5.64 A 5.74 A 5.84 D 5.94 A 5.5 D 5.15 D 5.25 B 5.35 D 5.45 A 5.55 B 5.65 C 5.75 D 5.85 A 5.95 A 5.6 A 5.16 C 5.26 D 5.36 C 5.46 A 5.56 A 5.66 A 5.76 C 5.86 A 5.96 A 5.7 B 5.17 A 5.27 A 5.37 A 5.47 B 5.57 A 5.67 C 5.77 B 5.87 C 5.97 A 5.8 A 5.18 B 5.28 B 5.38 A 5.48 D 5.58 D 5.68 B 5.78 B 5.88 D 5.98 D 5.9 B 5.19 C 5.29 B 5.39 B 5.49 C 5.59 C 5.69 A 5.79 D 5.89 A 5.99 B 5.10 D 5.20 A 5.30 B 5.40 A 5.50 D 5.60 B 5.70 B 5.80 A 5.90 A 5.100 A

72

ta nên dùng công thức phân tử của các muối để xác định tỉ lệ giữa số mol nguyên tử kim loại với số mol nguyên tử phi kim trong oxit axit (axit) 8. Ca(NO3)2 bị phân huỷ ở t > 330 C thành muối nitrit và oxi 1 t0 KNO3  KNO2 + O2 → 2 t0 Ca(NO3)2  Ca(NO2)2 + O2 → 73 . H2O (trừ Be). . Ca. Na. muối. bazơ mạnh. để xác định muối sinh ra. ns2 4. 6.CHƯƠNG VI. dung dịch axit. Điều chế bazơ tan: sử dụng phương pháp điện phân dung dịch muối tương ứng với điện cực trơ.→ CO32. +2. Tính chất của một số hiđroxit . IIA: sử dụng phương pháp điện phân nóng chảy n ñpnc MXn  M + X2 (X = halogen).NaHCO3. 2). Kim loại kiềm thổ (IIA): Be. Fr 2.CaCO3 bị nhiệt phân. tác dụng với axit.+ OH.NaOH. H3PO4 … vào dung dịch bazơ.KNO3. ñpdd 2NaCl + 2H2O  2NaOH + H2 + Cl2 → (nếu không có màng ngăn : 2NaOH + Cl2 → NaCl + NaClO + H2O) 9.+ H2O t0 Ca(HCO3)2  CaCO3 + H2O + CO2 → . Sr. 5. Mg. SO2. và tan cả trong nước có hoà tan CO2 t0 CaCO3  CaO + CO2 →  → CaCO3 + H2O + CO2 ← Ca(HCO3)2  0 0 . IIA: ns1. Tính khử: IA. Sơ lược về muối cacbonat và hiđrocacbonat . mang gần như đầy đủ tính chất chung của muối như tác dụng với dung dịch axit mạnh. Ca(HCO3)2 lưỡng tính. Tất cả các kim loại ở hai nhóm này đều tác dụng với phi kim. Kim loại kiềm (IA): Li.Na2CO3 dễ tan trong nước. Cs. Số oxi hoá: trong các hợp chất IA. Rb. P2O5 hay axit H2S. Ra 3. . có màng ngăn hai điện cực. → 2 ñpnc 4MOH  4M + O2 + 2H2O → 7. hay dung dịch muối khác. Cấu hình electron ở lớp ngoài cùng của IA.+ H+ → H2O + CO2 HCO3. IIA đều có tính khử (IIA khử yếu hơn IA). KIM LOẠI KIỀM.Khi cho CO2. kém bền với nhiệt HCO3. KIM LOẠI KIỀM THỔ VÀ NHÔM A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. và tăng theo chiều Z tăng : M → Mn+ + ne (n = 1. Ba. IIA có số oxi hoá +1. Điều chế IA. oxit axit. Ca(OH)2 có đầy đủ tính chất của một dung dịch bazơ như làm quỳ tím hoá xanh. tan trong axit mạnh.

Mg2+ trong nước cứng. dd Na2CO3.10. Mg + O2  MgO → 2 3 t0 3. .Nước cứng là nước chứa nhiều ion Ca2+. 11. . Nhôm .Nguyên tắc làm mềm nước cứng là làm giảm nồng độ các ion Ca2+. MgCl2. CaSO4. H2O vì trên bề mặt nhôm được phủ kín một lớp Al2O3 bảo vệ. dùng bazơ tan. Ca + Cl2  CaCl2 → 3 t0 6.Cách làm mềm nước cứng tạm thời: đun. 2Al + O2  Al2O3 → 2 1 t0 4. chu kì 3. Mg + 2HCl → MgCl2 + H2 3 9. K + Cl2  KCl → 2 t0 5. Al + 4HNO3 đặc  Al(NO3)3 + NO + 2H2O → 12. Mg2+.Cách làm mềm nước cứng vĩnh cửu dùng Na2CO3 hoặc Na3PO4. 2Al + 6H2SO4 đặc  Al2(SO4)3 + 3SO2 + 6H2O → 14. Al + Cl2  AlCl3 → 2 1 7.Vật bằng nhôm bền trong không khí. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O t0 11. nhóm IIIA. Na + HCl → NaCl + H2 2 8. 2K + 2H2O → 2KOH + H2 15. . . Al + 3HCl → AlCl3 + H2 2 10. Al(OH)3 lưỡng tính. B . Nước cứng tạm thời chứa muối Ca(HCO3)2 hay Mg(HCO3)2. .Nhôm bị phá huỷ trong kiềm.Al2O3. IIA.Nhôm có tính khử mạnh (Al → Al3+ + 3e) nhưng kém kim loại nhóm IA. MgSO4). . .Điện phân Al2O3 nóng chảy (không thể điện phân nóng chảy AlCl3) để điều chế Al kim loại. Nước cứng vĩnh cửu chứa muối clorua hay sunfat của Ca2+ hay Mg2+ (CaCl2. .Vị trí Al trong bảng tuần hoàn: ô 13. Nước cứng . 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O t0 13. 2Al + 6H2O → 2Al(OH)3 + 3H2 74 . Ca + 2H2O → Ca(OH)2 + H2 16.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1 t0 1. tham gia phản ứng nhiệt nhôm. 2Na + O2  Na2O → 2 1 t0 2.

NaOH + HCl → NaCl + H2O 31. NaHCO3 + HCl → NaCl + CO2↑ + H2O 37. 2Al2O3  4Al + 3O2 → → 25. 2NaOH  2Na + O2 + H2O → 2 ñpnc 23.17. 2NaOH + CO2 → Na2CO3 + H2O 29. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 t0 33. Na2CO3 + 2HCl → 2NaCl + H2O + CO2↑ 39. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. Mg2+ + HPO42. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 ñpnc 21. CaCO3 + 2HCl → CaCl2 + H2O + CO2↑  → 40. MgCl2  Mg + Cl2 → ñpnc 24. 2Al + Fe2O3  Al2O3 + 2Fe → 20. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. Al(OH)3 + NaOH → Na[Al(OH)4] 0 ñpdd 75 . 2NaCl  2Na + Cl2 → 1 ñpnc 22.+ NH3 → MgNH4PO4 ↓ (màu trắng) 50. 2NaHCO3  Na2CO3 + CO2↑ + H2O → t0 34. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2↓ 32. 2NaCl + 2H2O  2NaOH + H2 + Cl2 coù ng ngaê maø n 26. Ca(NO3)2  Ca(NO2)2 + O2 → t0 45. Mg(HCO3)2  MgCO3 + CO2↑ + H2O → 36. 2KNO3 + 3C + S  N2 + 3CO2 + K2S → t0 44. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. Mg + CuSO4 → MgSO4 + Cu t0 19. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. Ca(OH)2 + CO2 → CaCO3 + H2O 30. CaCO3  CaO + CO2 → t0 42. NaOH + CO2 → NaHCO3 27. 2Mg(NO3)2  2MgO + 4NO2 + O2 → 46. NaHCO3 + NaOH → Na2CO3 + H2O 38. Ca(HCO3)2  CaCO3 + CO2↑ + H2O → t0 35. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. CaCO3 + H2O + CO2 ← Ca(HCO3)2  t 41. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. 2KNO3  2KNO2 + O2 → t0 43.

M+ là cation: A.1g hỗn hợp 2 kim loại kiềm ở hai chu kì kế tiếp nhau trong bảng tuần hoàn tác dụng hết với nước thu được 1.BÀI TẬP TRẮC NGHIỆM I.04 mol khí ở anot và 3. NH4Cl.79%. D. Na2CO3. C. Câu 6. Ag+.7 Nung 100g hỗn hợp gồm Na2CO3 và NaHCO3 cho đến khi khối lượng của hỗn hợp không đổi được 69g chất rắn. 16% .57%.72%. 4. 48g. 84% . 2Al(OH)3  Al2O3 + 3H2O → C.9 Dung dịch muối có pH > 7 là A. 25. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl t0 55. 12. Thành phần % theo khối lượng của Na2CO3 và NaHCO3 lần lượt là A. Độ cứng cao. Câu 6. 11.Cu+. 2. C. B.45%. D.8g. B. Na . 24g. 32%. Câu 6. Có nhiệt độ nóng chảy thấp nhất trong tất cả kim loại. B. D. Câu 6. K+. 16%. 76 .8 Cho 3. + C.8g.5 Cho 200g CaCO3 tác dụng hoàn toàn với dung dịch H2SO4 loãng để lấy khí CO2 sục vào dung dịch chứa 60g NaOH. D. 84%. D. B. D.69g. D. B.BÀI TẬP CƠ BẢN Câu 6. D. Công thức phân tử của muối kim loại kiềm là A.2 Tính chất không phải của kim loại kiềm là A.54. 32% . Kim loại kiềm có tính khử mạnh. 12. 16. NaHSO4 .8 gam kali kim loại vào 36. NaCl. B. C. C. C.1 Cation M+ có cấu hình electron ở lớp ngoài cùng là 3s23p6.9g. Có số oxi hoá +1 trong các hợp chất. D.4g. 168g. B.3 Nồng độ phần trăm của dung dịch tạo thành khi hoà tan 7. 68% . Khối lượng muối thu được là A.2 gam nước là A. Khối lượng kiềm là A. B. Câu 6. 25. KCl. C. Câu 6. Câu 6. 68%.6 Cho 197g BaCO3 tác dụng hoàn toàn với dung dịch HCl để lấy khí CO2 sục vào dung dịch chứa 84g KOH.4 Điện phân muối clorua kim loại kiềm nóng chảy thu được 0.12 lít H2 (đktc) và dung dịch kiềm. C. 126g. B. 12. KCl. LiCl.12 gam kim loại ở catot. RbCl. C.119g.6g. Khối lượng muối natri thu được là A. Câu 6. 50g.

Ba. 70.15% và 40. Câu 6. Câu 6. 2. B. B.16 Cho 2. Ba. Điện phân dung dịch CaCl2 với điện cực trơ. C. C.03 mol khí CO2. D. Cho dung dịch CaCl2 tác dụng với dung dịch AgNO3.48 và 3. BaSO4 . Chỉ dùng nước và khí CO2 phân biệt được số chất là A. D. D. Ca.6%. B.2.14 Cho 4. Ba.84g hỗn hợp CaCO3 và MgCO3 tác dụng hết với dung dịch HCl thu được 0. 4. Câu 6. 4.18 Kim loại thuộc nhóm IIA không tác dụng với nước ngay cả ở nhiệt độ cao là A. 4 và 4.4%. B. Kim loại đó là A.11 Cho 2. Dung dịch thu được có pH A. Ba. Mg. pH = 5. D. 3. Ca.2 và 4. Số gam CaCO3 và MgCO3 lần lượt là A. D.0 gam kim loại nhóm IIA tác dụng hết với dung dịch HCl tạo ra 11. Mg. B. BaCO3 . Câu 6. Câu 6. Be. D.8g CaO tác dụng với một lượng nước dư thu được dung dịch X.2g hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2.55g. B. D.Câu 6. Na2CO3 . 7.12 Hoà tan hoàn toàn 1. pH = 7.4% và 29. pH > 7.85% và 59. 6. C. 2. B. 5. Be. Ca.1 gam muối clorua.19 Trường hợp ion canxi bị khử thành Ca là A. Be.15 Hoà tan 8. C.05g.6% và 70.36 và 4. khối lượng kết tủa thu được là A. Câu 6. B. B. Mg. Mg.68 lít khí CO2 (đktc) vào dung dịch X. C. Câu 6. D. Điện phân CaCl2 nóng chảy. 4. Ca.5M.5g. Na2SO4 . C.10 Cho a mol NO2 hấp thụ hoàn toàn vào dung dịch chứa a mol NaOH. 77 . 29.25g muối clorua của một kim loại hoá trị II và một lượng muối nitrat của kim loại đó có số mol bằng số mol muối clorua thì thấy khác nhau 7.36. có màng ngăn. C. Kim loại đó là A. C. Câu 6. Be. 40. 4. Câu 6. 59.95g.15%. Để trung hoà axit dư phải dùng hết 30ml dung dịch NaOH 1M. pH < 7. B. Kim loại đó là A. 3. Thành phần % theo khối lượng của CaCO3 và MgCO3 trong hỗn hợp lần lượt là A. C. C.17 Có 5 chất bột trắng là: NaCl.13 Khi lấy 14.5g. Sục 1.44g kim loại hoá trị II trong 150ml dung dịch H2SO4 0. D.48.25.85%.016 lít CO2 (đktc).

D. Câu 6. 0. Số g chất kết tủa sau phản ứng là A. nước mềm.29 Ion Al bị khử trong trường hợp A. Câu 6. Na2CO3 + Ca(HCO3)2 CaCO3 + 2NaHCO3. 0. Ca(OH)2. B. Nước cứng vĩnh cửu.25 Trong một bình nước có chứa 0. C.22 Cho 10 lít hỗn hợp khí (đktc) gồm CO và CO2 trong đó CO2 chiếm 39. B. D. 2. D. C. Tính cứng toàn phần. Ca(OH)2. Na2CO3 + Ca(OH)2 CaCO3 + 2NaOH.01 mol Mg2+. 3+ Câu 6.05 mol HCO3–. Zeolít. D. Nước khoáng.24 Dung dịch làm mềm nước cứng tạm thời và vĩnh cửu là A.20 Phân biệt dung dịch Ca(HCO3)2 với dung dịch CaCl2 bằng A. D. Câu 6.2% (theo thể tích) đi qua dung dịch chứa 7. Dung dịch Na2CO3. 0. 0. B. Na3PO4. C. Thành phần % theo khối lượng của CaCO3.21 Khi nung 40g quặng đôlômit thu được 11. 0.25g. C. Cho dung dịch Ca(OH)2 tác dụng với dung dịch HCl. Dung dịch HCl.02 mol Cl– . Nước trong bình có A. Điện phân dung dịch AlCl3 với điện cực trơ có màng ngăn.4g Ca(OH)2 . Na2CO3 + 2HCl 2NaCl + H2O + CO2. D. D. Tính cứng vĩnh cửu. Dung dịch Na3PO4. vĩnh cửu. Câu 6. C. B. C. B. D. Tính mềm. tạm thời. D. Điện phân Al2O3 nóng chảy. 100%. Nước cứng tạm thời. 40%. 12. Câu 6. 0. C. 0. B.26 Đun sôi nước chứa 0. 0.28 Trong phương pháp trao đổi ion để làm mềm nước cứng người ta dùng A. 4.65g.02 mol Ca2+.2 lít khí CO2 (0oC.01 mol Na+. Tính cứng tạm thời. Na2CO3. C. 14. 50%. Dùng H2 khử Al2O3 ở nhiệt độ cao. C. B.05g. B. B.8 atm). Na2CO3.23 Một loại nước có chứa nhiều muối Ca(HCO3)2 thuộc loại A. 92%.01 mol Mg2+.05 mol HCO3–.D. B. toàn phần.5g.02 mol Ca2+.02 mol Cl– ta được nước cứng A.27 Một phương trình phản ứng hoá học giải thích việc dùng dung dịch Na2CO3 làm mềm nước cứng vĩnh cửu là A. 78 . HCl. Dung dịch NaCl. Câu 6. C. Nước cứng toàn phần. Na2CO3 + CaCl2 CaCO3 + 2NaCl.MgCO3 trong quặng là A. Thả Na vào dung dịch Al2(SO4)3. D. Câu 6. Câu 6. Câu 6. NaNO3. 0.01 mol Na+.

Ba(OH)2. ở (1) kết tủa không tan. NaOH dư. đpnc. AlCl3 + 3NaOH Al(OH)3 + 3NaCl. C. nhóm IIIB. B. dẫn nhiệt tốt. Y. H2SO4 đặc nóng. Nhôm có tính khử mạnh chỉ sau kim loại kiềm và kiềm thổ. C. Z.35 Để làm kết tủa hoàn toàn Al(OH)3 người ta thực hiện phản ứng A. ô 13.31 Cation M có cấu hình electron ở lớp ngoài cùng là 2s22p6. C. C. 3 D. Câu 6. D. dung dịch NH3 (2) lần lượt đến dư vào ống đựng dung dịch AlCl3 thấy A. B. t0. sau đó kết tủa không tan ra. Ba(OH)2. NaHCO3. ô 13. Nhôm bị phá hủy trong môi trường kiềm. HCl. Al2O3. 2Al(OH)3 2Al + 3H2O + O2. t0. Lúc đầu đều có kết tủa keo trắng. chu kì 3.32 Chọn câu không đúng A. Ba(OH)2. B. chu kì 3. Nhôm là kim loại lưỡng tính. X. nhóm IB. HCl. Lúc đ ầu đều có kết tủa keo trắng. NaOH dư.34 Cho sơ đồ : +X +Y +Z → Al → Al2(SO4)3 → Al(OH)3  Ba [ Al(OH) 4 ] 2 Al(OH)3 Al2O3 Al. Al(OH)3 + NaOH Na[Al(OH)4]. Nhôm là kim loại nhẹ. ô 13. Câu 6. HCl. ZnSO4. (2) lần lượt là A. D. H2SO4 đặc nguội. H2SO4 loãng. H2SO4 loãng. ở (2) kết tủa không tan. ở (1) kết tủa tan. nhóm IIIA. 2 3+ Câu 6. chu kì 3. Ba(OH)2. NaOH đủ. đpnc. Lúc đầu đều có kết tủa keo trắng. D. AlCl3 + 3H2O + 3NH3 Al(OH)3 + 3NH4Cl. chu kì 3. C. Lúc đầu đều có kết tủa keo trắng. Al2O3 + 3H2O 2Al(OH)3. dẫn điện. D. NaOH. D. t0. NaAlO2 + H2O + HCl Al(OH)3 + NaCl. 2Al(OH)3 Al2O3 + 3H2O. Al(OH)3 . sau đó kết tủa tan ra.Câu 6.36 Cho dần từng giọt dung dịch NaOH (1). 79 . Vị trí M trong bảng tuần hoàn là A. đpnc. B. Câu 6. B. HCl. D. t0. C. E (dung dịch) và (1). B.33 Trong những chất sau. Câu 6.30 Phương trình phản ứng hoá học chứng minh Al(OH)3 có tính axit là A. B. ô 13. chất không có tính lưỡng tính là A. Al(OH)3 + 3HCl AlCl3 + 3H2O. C. ở (2) kết tủa tan. đpnc. Câu 6. nhóm IA.

90%. ở (3) xuất hiện kết tủa trắng không tan. B.2. Lúc đầu đều có kết tủa keo trắng. Câu 6.44 Điện phân Al2O3 nóng chảy với dòng điện cường độ 9. Kết tủa tạo thành được làm khô và nung đến khi khối lượng không đổi cân nặng 2.65A trong thời gian 3000 giây thu được 2. D. Mg2+ (3) ta quan sát thấy A.37 Cho dần từng giọt dung dịch HCl (1) . (2) là NaOH.75M và 0.55g. B. B.Câu 6. 1. Mg. 80 .4g bột Al vào 150ml dung dịch hỗn hợp chứa Fe(NO3)3 1M và Cu(NO3)2 1M. Kết thúc phản ứng thu được số gam chất rắn là A. 80%.75M và 0. D. Al3+ (2). Không dùng thêm chất khác. Al2O3. MgSO4. (2) là NaOH. D.42 Cho 100ml dung dịch AlCl3 1M tác dụng với 200ml dung dịch NaOH.40 Có 2 lọ không ghi nhãn đựng dung dịch AlCl 3 (1) và dung dịch NaOH (2). D.35M.75M. Câu 6. Nồng độ mol/l của dung dịch NaOH ban đầu là A. 10. B. 0. ở (3) xuất hiện kết tủa trắng. nhận ra (1) là AlCl3 . kết tủa trắng tăng dần.75M. ở (2) kết tủa tan. không tan. 15. ở (2) và (3) xuất hiện kết tủa trắng rồi tan. Na3AlF6.2.75M và 0. 2. 3.8. 70%. (2) là NaOH. C. D. 60%. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa rồi tan ra.16g Al. B. ở (2) xuất hiện kết tủa trắng rồi tan. 13. (2) là NaOH. Lúc đầu đều có kết tủa keo trắng. Lúc đầu đều có kết tủa keo trắng. C.38 Phèn chua có công thức là A. C. ở (1) không hiện tượng. Fe.24H2O. rồi kết tủa không tan.95.43 Hoà tan 5. D.35M và 0. nhận ra (1) là AlCl3 . ở (2) xuất hiện kết tủa trắng. 4. người ta phân biệt chúng bằng cách A. nhận ra (1) là AlCl3 . B. rồi không tan. ở (1) kết tủa tan. ở (1) kết tủa không tan. Câu 6. C. nhận ra (1) là AlCl3 . D. Chỉ dùng thêm nước làm thuốc thử thì số kim loại có thể phân biệt được là A.39 Cho từ từ đến dư dung dịch NaOH lần lượt vào các dung dịch đựng Na+ (1).24H2O. 2. K2SO4. 2. Al. Câu 6. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa. B. B. sau đó kết tủa tan ra.41 Có 4 mẫu bột kim loại là Na. D. Câu 6. C. ở (1) không hiện tượng. C. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. kết tủa trắng tăng dần rồi tan. CO 2 (2) lần lượt vào ống đựng dung dịch Na[Al(OH)4] thấy A. Câu 6. 13. Câu 6.35M. Lúc đầu đều có kết tủa keo trắng. sau đó kết tủa không tan ra. 0. Hiệu suất điện phân là A. C. ở (1) không hiện tượng. ở (1) không hiện tượng.Al2(SO4)3.Al2(SO4)3. không tan. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. C. ở (2) kết tủa không tan.nH2O.

12.50 Hoà tan hết 3. Dung dịch Na2CO3.22g hỗn hợp kim loại gồm K.20g. là A. B.136 lít khí (đktc) và m g muối clorua. dư thu được V lít khí NO (đktc) và dung dịch X.22g muối khan. Cô cạn dung dịch X thu được 35. Dung dịch HCl. m có giá trị là A. Giá trị của V là A. Sau đó cô cạn dung dịch thu được x gam muối khan. 12. D. D.45g. Câu 6. Dung dịch Na2CO3. Câu 6. AlCl3 . 18g. B. 12. Câu 6. AlCl3. D. Al (điều kiện phản ứng coi như có đủ) có thể điều chế được A.80g.6000 lít.45 Một thuốc thử phân biệt 3 chất rắn Mg. B. Dung dịch NaOH. C. B. 3. Al và Fe bằng dung dịch HCl.6 lít khí. B. Câu 6. 11.2g.00g.51 Cho 2. C.8g. 4.54 Hoà tan 4. H2O.49 Hoà tan hết 10g hỗn hợp muối cacbonat của kim loại IA và IIA bằng dung dịch HCl dư. H2SO4 đặc nguội. x có giá trị là A. Câu 6. thu được 2. D.34g. H2O. B. 4.48 Một hoá chất để phân biệt các dung dịch riêng biệt NaCl. 11. Al. 3. AlCl3 là A. C. m nhận giá trị bằng A. D.5088 lít. thu được 3. CaCl2 . m có giá trị là A. B. CuO. 9. amoniac. B. 2. Al(OH)3. Al2O3 đựng trong các lọ riêng biệt là dung dịch A. Al2O3 D.5g hỗn hợp kim loại gồm Mg. (Các phản ứng đều xảy ra hoàn toàn.96 lít khí. 5. Na. Ca. m g X tác dụng với nước dư được 5.44g. Al(OH)3. Câu 6. C. C.32 gam nhôm kim loại bằng dung dịch HNO3 loãng. dung dịch NaOH. các thể tích khí đo ở đktc). BaO.02g. Câu 6.6g. Mg.06g oxit của kim loại M (có hoá trị n) tan trong HNO3 dư thì thu được 5.15.10. 81 . H2O. D. D. ZnO.47 Một hoá chất để phân biệt Al.52 gam muối. C. Mặt khác. Cô cạn dung dịch X được m g chất rắn. 14.95g.4800 lít. C.46 Chỉ dùng các chất ban đầu là NaCl. Câu 6.52 Cho 3.24 lít khí (đktc).05g. B. C. B. 3. 13.10g. dung dịch HCl.4048 lít.53 Hỗn hợp X gồm K và Al. m g X tác dụng với dung dịch Ba(OH)2 dư thu được 8. Na và Ba vào nước được 500ml dung dịch X có pH = 13. HCl đặc. MgO. Câu 6. 16g. C. Công thức của oxit là A. 3. Al2O3 . NaOH.Câu 6. C. D. D.07g.

8g. D. 2. Ca. D. Cũng lượng hợp kim trên tác dụng vừa đủ với dung dịch NaOH thu được 6. Biết đã dùng dư 10ml thì thể tích dung dịch NaOH 4M đã lấy ban đầu là A. Hỗn hợp sau phản ứng nhiệt nhôm nếu đem tác dụng với NaOH dư thu được 6. Khối lượng Al trong hỗn hợp ban đầu là A.2g hỗn hợp Al và Al2O3 tác dụng với dung dịch NaOH dư thu được 16.92%. 210ml. Câu 6. % Fe theo khối lượng là A.72 lít H2(đktc). 5.54 tấn Al bằng phương pháp điện phân nóng chảy Al2O3 với anot bằng cacbon (coi như hiệu suất điện phân bằng 100%. 8.08 lít H2 (đktc). B.4g. 200ml. 4.2%.58 Hợp kim Al-Mg tác dụng vừa đủ với dung dịch HCl thu được 8. 6. 82 . C. 102kg.72 lít H2 (đktc). C. 9%. 8.59 Khối lượng Al2O3 và khối lượng cacbon bị tiêu hao cần để sản xuất được 0.63 2.52g một kim loại tan hết trong dung dịch H 2SO4 loãng thu được 6.1 mol Ba và 0.8 lít H2 (00C. 3. 6. D.102kg. C. nếu đem tác dụng với dung dịch HCl dư thu được 26. D.7g.96 lít H2 (đktc). Câu 6. 36. % Al trong hợp kim là A. Câu 6.3%.61 Hỗn hợp Al và Fe3O4 đem nung không có không khí. 90%. và khí thoát ra ở anot chỉ là CO2) có giá trị lần lượt bằng A. B. 4.04g hỗn hợp Fe và Cu tác dụng với dung dịch HNO 3 loãng thu được 0. C. Câu 6. 9. D.1020kg.6g nước để thu được dung dịch có nồng độ 14% là A. C. 0. 63.1800kg Câu 6. 10200kg .96 lít. K. 6. Câu 6. 3.62 3. Kim loại là A. B. 69. 54g. D. 2. C.88 lít H2(đktc).60 31.Câu 6. C.57 Cho 9g hợp kim Al tác dụng với dung dịch NaOH đặc.6%.2%. Al. 20ml. B. 7. Fe. B.46%.4g.8%.2 mol Al vào nước dư thì thể tích khí thoát ra (đktc) là A. Câu 6. 180kg D. B.896 lít NO (đktc).24 lít.8atm). 27g.68%. 180kg B. % Al tính theo khối lượng là A. C. D.84g muối sunfat. dư thu được 10. 4.55 Khối lượng K2O cần lấy để hoà tan vào 70.72 lít.56 Cho hỗn hợp 0. 18kg C.9g. nóng. 73%. Câu 6.48 lít. 34.32%. B. B. 21ml. D.4g.

64 Cho a g hỗn hợp gồm Al và Fe tác dụng với dung dịch NaOH dư thu được 1 thể tích H2 bằng thể tích của 9. dung dịch thu được cho bay hơi H2O được 55. 625. 5. 21. nguyên tử Zn. C.12g. Giá trị a là A. catot là nơi xảy ra A.sự oxi hoá chất khử.136g. Câu 6. Câu 6.72 lít.22g. Câu 6. Câu 6. sự điện li dung dịch muối. C. electron. sự khử chất oxi hoá.5g.73 Trong cầu muối của pin điện hoá Zn – Cu xảy ra sự di chuyển các A. E0 (pin) = E0 (catot) – E0 (anot).8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3.2g. 0.8g so với ban đầu. B.6255g.65 Cho Fe tác dụng với dung dịch H2SO4 loãng. B.69 50g một lá kim loại tan hết trong dung dịch HCl thu được 336ml H 2(đktc) và thấy khối lượng lá kim loại giảm 1.255g. D. D. D. Khối lượng chất rắn Y là A. Câu 6.2g Fe. 62.70 Suất điện động chuẩn E0 (pin) tính bằng A. Fe C. D. 16.5g.96 lít. Nhiệt phân hoàn toàn X. anot là nơi xảy ra A. 83 .2g. sự điện phân dung dịch muối. tiếp tục thêm vào dung dịch sau phản ứng 13. 4. C. C. 4. C. Al B.36g.36 lít. B. thu được chất rắn Y.Câu 6. E0 (pin) = E0 (anot) + E0 (catot). 11g. B. B. Na II. E0 (pin) = E0 (anot) − E0 (catot).72 Trong pin điện hoá. D. Câu 6. Mg D.22g.1M. ion. 8. 1. 2. D. 6. C. Câu 6.BÀI TẬP NÂNG CAO Câu 6.68%. 0.66 Cho a g FeSO4.71 Trong pin điện hoá. E0 (pin) = E0 (catot) + E0 (anot). B.6 gam FeSO4. 13.48 lít.7H2O tác dụng với H2O thu được 300ml dung dịch. Tên lá kim loại là A.7H2O.5g. Thêm H2SO4 vào 20ml dung dịch trên thấy làm mất màu 30ml dung dịch KMnO 4 0. Nếu cho a g hỗn hợp trên tác dụng với dung dịch HCl dư thì được 8. sự điện li dung dịch muối. 6. Thể tích H2 (đktc) là A. nguyên tử Cu. sự điện phân dung dịch muối. 3.55g. Giá trị a là A.0136g. B. D. Còn nếu cho a g hỗn hợp trên tác dụng với dung dịch CuSO4 dư thì được chất rắn có khối lượng tăng thêm 0. sự oxi hoá chất khử B.96 lít H2 (đktc). D.68 Cho dung dịch chứa 16. 42.6g. D.68g Al2(SO4)3 nữa thì thu được kết tủa X.6g O2 (đktc). C. a có giá trị là A. sự khử chất oxi hoá.67 Khi khử hoàn toàn a g hỗn hợp gồm Fe và Fe 2O3 ở nhiệt độ cao thu đựơc 11. C. C. 0. B. Câu 6.

Câu 6.79 Cho 3. D.8%. MgCO3. C.2%. FeCO3. 12.6H2O.6%.yMgCl2.44V.H2O. Câu 6.78 Cho công thức hoá học của muối cacnalít là xKCl.09V. − 0.79V. D. Na2CO3. lọc lấy kết tủa đem nung đến khối lượng không đổi thì được chất rắn có khối lượng giảm 0.5cm3 dung dịch HCl 0. B.xH2O trong 250cm3 nước cất. 77%.2MgCl2.55g cacnalít tác dụng với dung dịch KOH dư.44V.0.4%.6H2O.2M hoặc 2. 2. D. 2Ag+ + Fe → Fe2+ + 2Ag B.1M.MgCl2. Dung dịch X trung hoà vừa đủ 200ml dung dịch HCl 1M. Fe + 3Ag3+ → Fe3+ + 3Ag D. 2KCl.10H2O. B.36g so với trước khi nung. Công thức hoá học của cacnalit là A. B. B. B.80 Điện phân dung dịch NaOH với cường độ không đổi là 10A trong 268 giờ. Biết 25cm3 dung dịch này tác dụng vừa đủ với 17.76V. B.24M hoặc 0.12M hoặc 0. KCl.77 Hoà tan 2. D. 24%. Công thức hoá học của muối ngậm nước là A.28M. D. 20. Fe3+ + 3Ag → Fe + 3Ag3+ Câu 6. C.Câu 6.MgCl2. –1. C.875 lít khí Y (đktc).6H2O.08M.78g chất kết tủa.2MgCl2. C.6g muối sunfat trung hoà khan. Sau điện phân còn lại 100g dung dịch 24%. thế điện cực chuẩn (E0) của cặp oxi hoá – khử Zn2+/Zn là A. Câu 6.56M. Biết khi nung nóng 11. Na2CO3.5H2O. Công thức hoá học của muối cacbonat là A. thu được một chất khí và dung dịch X. C. 0. Fe2+ + 2Ag → 2Ag+ + Fe C. C.76V. C.8M. Mặt khác khi cho 5.94V. 1. Nồng độ % của dung dịch NaOH trước điện phân là A. 84 . 7. 2. 1.81 Cho 5g Na có lẫn Na2O và tạp chất trơ tác dụng với H2O thu được dung dịch X và 1. C.75 Suất điện động chuẩn của pin điện hoá Sn −Ag là A. ZnCO3. Nồng độ mol/lít của dung dịch NaOH đã dùng là A. + 1. B. 0. Câu 6.7%. Thành phần % theo khối lượng của tạp chất trơ là A.66V. 0.10V và E0(Cu2+/Cu) = +0.6H2O. CaCO3.1. Na2CO3.khử Ag+/Ag và Fe2+/Fe là A.76 Biết E pin (Zn – Cu) = 1.26%.1g cacnalít thì khối lượng giảm 4.42g Al2(SO4)3 tác dụng với 250ml dung dịch NaOH aM.04M hoặc 0. 0. + 0.8g muối cacbonat của một kim loại hoá trị II hoà tan trong dung dịch H2SO4 loãng vừa đủ. D.5g muối Na2CO3.34V. thu được 0. Cô cạn X thu được 7.74 Phản ứng xảy ra trong pin điện hoá được cấu tạo bởi cặp oxi hoá.32g. 0 Câu 6.82 Cho 5. Câu 6. 0. D. B.zH2O. 2KCl.7H2O. Câu 6. KCl. Na2CO3. D.

Thành phần % theo khối lượng của Al trong X là A. lúc đầu không thấy kết tủa. B.6. D.32g. 3. 1. C.1s22s22p63s23p1. n.2g so với ban đầu.03%.32g kết tủa.06 mol khí. R có hoá trị II. Số gam K là A. Dẫn từ từ toàn bộ Y vào ống chứa bột CuO dư. Câu 6. C.22g. 5.88 Cho dung dịch X chứa các ion Mg2+. 0.6g hỗn hợp chất rắn. NO và còn dư Fe.84 Cho 21g hỗn hợp 2 kim loại K và Al hoà tan hoàn toàn trong nước được dung dịch X.2 Câu 6.675 mol SO2.Câu 6.4.4. 3 D. 2 C. nóng. Fe(NO3)2. Tổng khối lượng các ion trong dung dịch X là A. Dung dịch X chứa chất tan A.8.3 mol Mg phản ứng hết với hỗn hợp Y (vừa đủ) gồm b mol Cl2 và 0. Fe.4g X tác dụng với dung dịch H2SO4 loãng dư thu được khí Y. 1. Cu tác dụng với dung dịch H 2SO4 đặc. Giá trị của a là A. Câu 6.6g. 6.89 Cho 5.4 C. B. Hấp thụ hoàn toàn X vào nước được 300ml dung dịch Y. nung nóng thấy khối lượng chất rắn trong ống giảm 7.85 Cho 23.08%. 1s22s22p63s2. Câu 6. HNO3 Câu 6. Nếu cho 23. 23. . pH của dung dịch Y là A. Thêm từ từ dung dịch HCl 1M vào X. 0. 5. Câu 6. dư thu được 0.Fe(NO3)2. 1 B. 7. D. 0. 15.86 Hỗn hợp X gồm a mol Al và 0. NH4+.4g.3 D.56g. 1s22s22p63s23p3.95g.15g hỗn hợp X gồm Zn và Cu vào 140ml dung dịch AgNO3 1M.89%. B. Chấm dứt phản ứng thu được dung dịch X. 0. . Sau khi phản ứng xong được 15.87 Khuấy đều một lượng bột Fe và Fe3O4 vào dung dịch HNO3 loãng.Thí nghiệm 2: X tác dụng với dung dịch BaCl2 dư thu được 9. 35. Fe(NO3)3. 41.Fe(NO3)3 và HNO3 D.11g. 2. sau một thời gian thu được 4. 58.83 Nung 6. C.90 Nguyên tố R có tổng số hạt (p.Thí nghiệm 1: X tác dụng với dung dịch NaOH dư. B.97%. B.2g.4 mol O2 thu được 64. đến khi kết tủa hoàn toàn thì cần 400ml dung dịch HCl.16g kết tủa và 0. SO42-.76g hỗn hợp 2 kim loại và dung dịch Y.8. 4 Câu 6. 85 . Fe(NO3)2 và Fe(NO3)3 C. C. D. 10. cấu hình electron của R là A. e) là 40. Cl-.4g X gồm Al. Khối lượng Zn trong hỗn hợp là A.1s22s22p63s23p2. D.12. B.58g Cu(NO3)2 trong bình kín.6 B. C.96g chất rắn và hỗn hợp khí X. đun nóng thu được 1. D.

Mặt khác cho 7. trong đó tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện là 42 hạt. C.100 Điện phân 100ml một dung dịch có hoà tan 13. nguyên tử của nguyên tố Y có tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện của X là 8. NaOH. 0. [ KOH] = 0. Câu 6.3M B.99 Điện phân 200ml dung dịch có chứa 2 muối là Cu(NO3)2 và AgNO3 với cường độ dòng điện là 0. 1s22s22p2. D. AlCl3.1A. Câu 6. Ba(OH)2.1M. Fe và Cu.18M. Al và Fe.[KCldư] = 0. Ca và Fe.804A đến khi bọt khí bắt đầu thoát ra ở cực âm thì mất 2 giờ. C. NH3.12 hoặc 0. NaOH. Câu 6.96 Cho x mol CO2 hấp thụ hoàn toàn vào 200ml dung dịch hỗn hợp gồm KOH 1M và Ba(OH)2 0. O.12 C.75M. 0.35M.52M. Z = 8). D. Câu 6. 0. NH3. khối lượng dung dịch giảm 8g.88 D. 1M.5M D. Nồng độ mol các chất có trong dung dịch sau điện phân đã được pha loãng cho đủ 200ml là A. D. cần dùng 100ml dung dịch H2S 0. B. B. NaCl. C.02M.9M. O. 0.92 Cation X2+ và anion Y2. Công thức hoá học của hợp chất tạo bởi X và Y là A. Nồng độ mol/l của dung dịch CuSO4 ban đầu là A.95 Tổng số hạt (p. B. 86 . Mg và Fe. D. 0. Nồng độ mol/l của dung dịch HCl là A.15M C. Vậy X có cấu hình electron là A. 1. FeCl3. B. [ KOH] = 0.90. Câu 6. e) trong 2 nguyên tử kim loại X và Y là 142.12 hoặc 0. 0. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 43 hạt. NH3.56g chất kết tủa. O. Câu 6. 0. X và Y lần lượt là A. C. 2 2 6 2 4 C. MgCl2. Khi trộn dung dịch X vào dung dịch Y tạo thành 1.275M. Để kết tủa hết ion Cu2+ còn lại trong dung dịch sau điện phân. Nồng độ mol/l của dung dịch CuSO4 trước điện phân là A. B.9M. Biết H (A = 1. NH3.5g CuCl2 và 14. 0. C.[ KOH] = 0. khi đó khối lượng cực âm tăng thêm 3. Z = 1).Câu 6. 0. Ca.75M thu được 23.94 Cho ion HXO3-.đều có cấu hình electron ở phân lớp ngoài cùng là 2p 6. D.62g Al trong 280ml dung dịch HNO3 1M thu được dung dịch X và khí NO (sản phẩm khử duy nhất). Be. cường độ dòng điện là 5.93 Hoà tan hoàn toàn 1. 0. Ba(OH)2 là A. 0. B. C. Giá trị của x là A.9M. D. Ba(OH)2. n. B. C. Câu 6. Tổng các hạt trong ion đó là 123. 1s 2s 2p 3s 3p . X và Y lần lượt là A. Số hạt mang điện của nguyên tử Y nhiều hơn X là 12 hạt.44g.9g KCl có màng ngăn và địên cực trơ mất 2 giờ. Ba(OH)2.64g kết tủa.2M. B. D. Câu 6.35g hai kim loại kiềm thuộc 2 chu kì liên tiếp vào 500ml dung dịch HCl được dung dịch Y và 2.5M.97 Thứ tự pH theo chiều tăng dần các dung dịch có cùng nồng độ mol của NH 3.[ KOH] = 0. NaOH. NaOH. 1s22s22p63s23p3. O (A = 16. 1s22s22p63s23p63d64s2. 3M Câu 6.[KCldư] = 0. Ba(OH)2. Ba.38. O.1M. B. NaOH.8 lít khí H2 (đktc).91 Nguyên tử của nguyên tố X có tổng số electron trong các phân lớp p là 7. D. Mg. 0.9M.98 Sau một thời gian điện phân 200ml dung dịch CuSO4 với điện cực trơ. 3.

82 6. Lấy 2 lá kim loại M có khối lượng bằng nhau.91 6.87 6. B.94 6.72g hỗn hợp bột các chất Fe.8 B 6.23 6.14 6.102 M là kim loại hoá trị II. D.70 A A D A B C D D B A 6. C.33 6.37 6.98 6.45 6. lá (2) tăng 8.47 6.30 A C C C C B A A B C 6. lá (2) vào dung dịch Cu(NO 3)2 đến khi thấy số mol Pb(NO3)2 và Cu(NO3)2 trong hai dung dịch giảm như nhau thì nhấc ra.16 6.Câu 6. CuO. Fe. Fe 2O3 tác dụng với CO dư ở nhiệt độ cao thu được 3. cần 2.96g.016 lít khí H2 (đktc).4 A 6.6% so với ban đầu.41 6.8g một oxit của kim loại trong dãy điện hoá ở nhiệt độ cao.68 6. Kim loại thu được đem hoà tan trong dung dịch HCl thu được 1.11 6. Nhỏ từ từ dung dịch KMnO4 0.53 6.46 6.60 C B A D D D A B C D 6.1M vào X đến khi dung dịch X bắt đầu có màu hồng.93 6.48 6.84 6.54 6. Cu.34 6.24 6.1 D 6.86 6. Công thức hoá học của oxit kim loại là A.76 6.85 6.2 D 6.3 A 6.104 Khử 4.105 A A A A A 87 .39 6.27 6. D.20 A B C C A A D A B A 6. Câu 6. thu được chất rắn và dung dịch X.12 6. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VI 6.14g vào dung dịch H 2SO4 loãng dư.100 A C A C A A A B B A 6.22 6.89 6.77 6. D.32 6.5 A 6. thấy đã dùng hết 40ml dung dịch KMnO4.83 6. lá (2) vào dung dịch CdCl2 đến khi thấy số mol CuCl2 và CdCl2 trong hai dung dịch giảm như nhau thì nhấc ra.74 6.51 6.92g Fe.103 Cho một cây đinh thép nặng 1.69 6.40 A D C B A C C A A C 6.97 6.18 6.6g.61 6.44 6. Kết quả về khối lượng: lá (1) tăng 1.9 6. C.8g.58 6. B. 88%.2 %.6 A 6.38 6.42 6. B.10 D A 6.2%.101 M là kim loại hoá trị II.52 6.13 6.96 6.28 6.90 C A A A A A A B B B 6.102 6.49 6.88 6. D.7 B 6.15 6.59 6.68g. Cd. Lấy 2 lá kim loại M có khối lượng bằng nhau. Nhúng lá (1) vào dung dịch Pb(NO3)2. ZnO. %Fe trong đinh thép là A.43 6. B. 1.95 6. FeO. lá (2) giảm 9.35 6.36 6.78 6.71 6.101 6. D. 98.21 6.56 6.79 6.19 6. Câu 6. Fe2O3 .31 6.25 6. Nhúng lá (1) vào dung dịch CuCl2.66 6. 16.344 lít H2 (đktc). Kết quả về khối lượng : lá (1) tăng 19%.67 6.72 6.62 6.104 6.99 6.105 4. C. Zn. M là A. Cũng lượng hỗn hợp trên ngâm trong dung dịch CuSO4 dư thì khối lượng chất rắn thu được là 4. B.1%.103 6. Mg. M là A. Câu 6.26 6.55 6. Khối lượng Fe trong hỗn hợp là A.80 A B A A C A A A B A 6.75 6. C. 1. Câu 6.81 6.73 6.44g. 90%.64 6.57 6. Zn .92 6. 1. Mg.17 6.4% so với ban đầu. Cu. 49.50 D A B C B B A A B A 6. Fe3O4. C.63 6.29 6.65 6.

3. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 . t0 2 Nước CrCl3 (r) + Cl +Zn 2 +(O +H O) 2 2 H2CrO47 H2Cr2O Cr HCl H2SO4(l) Cr (dd) Axit Cr(OH)2 +2 Cr +3 +Br (dd) +SO2.2 KI Cr +6 (dd) Kiềm Axit Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 . Số oxi hoá +3 Số oxi hoá +6 .Tính khử.34V. CROM − SẮT − ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. E Cu 2+ /Cu = 0.Tính oxi hoá. Fe : [Ar]3d64s2.Oxit và hiđroxit có tính bazơ.Cấu hình electron nguyên tử Cr : [Ar]3d54s1. 4. t0 2 Cr2O3 (r) + NH 3 CrO3 + bột Al + Cl . . E Fe2+ /Fe = -0. . Sơ đồ minh hoạ tính chất hoá học của crom + O . tính axit.77V.44V.Tính oxi hoá.Oxit và hiđroxit có lưỡng tính.Tính khử.Oxit và hiđroxit có tính bazơ.CHƯƠNG VII. .Oxit và hiđroxit có tính bazơ.74V. Sơ đồ minh hoạ tính chất hoá học đồng + + 88 .Thế điện cực chuẩn E Cr3+ /Cr = -0. 2.Oxit và hiđroxit có tính . E Fe3+ /Fe2+ = 0. Số oxi hoá +3 .Tính khử và tính oxi hoá. Cu : [Ar]3d104s1. 0 0 0 0 . . Crom − Sắt − Đồng . .

→ 0 t 3. Ni.14 Yếu Pb +2.5H2O Cu(NO3)2. Fe + 2HCl  → FeCl2 + H2. Fe + 6HNO3 đặc  → Fe(NO3)3 + 3NO2 + 3H2O.Oxit và hiđroxit có tính bazơ. 2Fe + 6H2SO4 đặc  Fe2(SO4)3 + 3SO2 + 6H2O. Fe + 4HNO3 loãng  → Fe(NO3)3 + NO + 2H2O. H2SO4 đ dd FeCl3. NH . 5. 2Fe + 3Cl2  2FeCl3. Fe + H2SO4 loãng  → FeSO4 + H2. 89 . Pb Số oxi hoá Eo(V) Tính khử Ag +1. 3Fe + 2O2  Fe3O4. t Không khi ẩm Khí Clo khô t0 CuCO3.13 Yếu B .76 Mạnh Sn +2. → t0 2.[Cu(NH3)4]2+ NH3 Cu(OH)2 OH - H + HCl + O2. → 7. +4 Sn2+/Sn -0. +4 Pb2+/Pb -0. HNO3. +1. → 4. Sn. AgNO3 Cu2+ (dd) H + Kết tinh CuSO4.3H2O Không khí. 5.Cu(OH)2 (r) CuCl2 (r) Số oxi hoá +2 . . Zn. Sơ lược về các kim loại Ag.5 -0.Tính oxi hoá. (+2) Ag+/Ag +0.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) t0 1.08 Rất yếu Ni +2. Fe + S  FeS.Bình Au Zn +2 Zn2+/Zn -0. 10000C Cu 0 Không khí. +3 (+3) Au3+/Au Ni2+/Ni +1. Au.26 Rất yếu T. 8. t 0 CuO (đen) 3 Cu2O (đỏ) Chất khử CO. t0 6.

20.. 12. 37..9. 0 t 3Fe2O3 + CO  2Fe3O4 + CO2. 35. 10FeSO4 + 2KMnO4 + 8H2SO4  → 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. → Fe2O3 + 3H2SO4 loãng  → Fe2(SO4)3 + 3H2O. 2FeCl3 + Cu  → 2FeCl2 + CuCl2. FeCl2 + 2NaOH  → Fe(OH)2 + 2NaCl. t0 2Fe(OH)3  Fe2O3 + 3H2O. 44. FeO + 2HCl  → FeCl2 + H2O. 2FeCl2 + Cl2  → 2FeCl3. → 0 t 2Cr + 3Cl2  2CrCl3. 31. → Fe(OH)2 + 2HCl  → FeCl2 + 2H2O. 25. 19. 28. 43.. → 2Fe(OH)3 + 3H2SO4  → Fe2(SO4)3 + 6H2O. 27. → 0 t Fe2O3 + 3CO  2Fe + 3CO2. Fe(OH)3 + 3HCl  → FeCl3 + 3H2O.. 2FeCl3 + Fe  → 3FeCl2. 15. 42.. 10. → . >5700 C Fe + H2O → FeO + H2. 14. → 0 t 2FeO + 4H2SO4 đặc  Fe2(SO4)3 + SO2 + 4H2O. Fe(OH)2 + H2SO4  → FeSO4 + 2H2O.. 21. 26. 34.. Fe + 3AgNO3 (dư)  → Fe(NO3)3 + . Fe + 2AgNO3  → Fe(NO3)2 + 2Ag. Fe (dư) + H2SO4 (đặc)  → FeSO4 + . 29.. t0 FeO + CO  Fe + CO2. → t0 2Cr + 3S  Cr2S3. FeCl3 + 3NaOH  → Fe(OH)3 + 3NaCl. 2FeS2 + 14H2SO4  → Fe2(SO4)3 + 15SO2 + 14H2O. 13. 17. 32. 30. Fe2O3 + 6HCl  → 2FeCl3 + 3H2O. 33. → FeO + H2SO4 loãng  → FeSO4 + H2O.. Fe2O3 + 3H2SO4  → Fe2(SO4)3 + 3H2O. → t0 Fe2O3 + CO  2FeO + CO2.. 41.. 18. 90 Fe (dư) + HNO3  → Fe(NO3)2 + . 16. <5700 C 3Fe + 4H2O → Fe3O4 + 4H2. t0 4FeS2 + 11O2  2Fe2O3 + 8SO2. 38. Fe + CuSO4  → FeSO4 + Cu. 23. 39. 4Fe(OH)2 + O2 + 2H2O  → 4Fe(OH)3. 11. t0 3FeO + 10HNO3 đặc  3Fe(NO3)3 + NO + 5H2O. → t0 4Cr + 3O2  2Cr2O3. 24. 40. 2FeCl3 + 2KI  → 2FeCl2 + 2KCl + I2. 22. 36.

Na2Cr2O7 + S  → Na2SO4 + Cr2O3. 77. 56. CrCl2 + 2NaOH  → Cr(OH)2 + 2NaCl. 60. 72. 75. Cr(OH)3 + NaOH  → Na[Cr(OH)4] (hay NaCrO2). 66. 2NaCrO2 + 3Br2 + 8NaOH  → 2Na2CrO4 + 6NaBr +4H2O 2Na2Cr2O7 + 3C  → 2Na2CO3 + CO2 + 2Cr2O3. to 4Cr(OH)2 + O2 + 2H2O  4Cr(OH)3. 76. → CrO + 2HCl  → CrCl2 + H2O. 49. 79. 57. K2Cr2O7 + 3K2SO3 + 4H2SO4  → Cr2(SO4)3 + 4K2SO4 + 4H2O. o t 2Cr(OH)3  Cr2O3 + 3H2O. → CrO3 + H2O  → H2CrO4. 71. 78. 0 t Cr2O3 + 2Al  2Cr + Al2O3. 70. → >1000 C 2CrO + O2  2Cr2O3. 2CrCl2 + Cl2  → 2CrCl3. 47. 50. → t0 2Cu + O2  2CuO. 2CrCl3 + 3Cl2 + 16NaOH  → 2Na2CrO4 + 12NaCl + 8H2O. 2Cr + 3SnCl2  → 2CrCl3 + 3Sn. 2Cr2O3 + 8NaOH + 3O2  → 4Na2CrO4 + 4H2O. 64. → K2Cr2O7 + 6FeSO4 + 7H2SO4  → 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. Cr2O3 + 3H2SO4  → Cr2(SO4)3 + 3H2O. 48. 62. Cr(OH)3 + 3HCl  → CrCl3 + 3H2O. → t0 2Na2Cr2O7  2Na2O + 2Cr2O3 + 3O2. 4200 C 4CrO3  2Cr2O3 + 3O2. 53. → 2CrO3 + 2NH3  → Cr2O3 + N2 + 3H2O. Na2Cr2O7 + 14HCl  → 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 80.45. 65. → 2Na2CrO4 + H2SO4  → Na2Cr2O7 + Na2SO4 + H2O. 69. 59. 54. 4CrCl2 + O2 + 4HCl  → 4CrCl3 + 2H2O. 2CrCl3 + Zn  → ZnCl2 + 2CrCl2. 63. 0 t (NH4)2Cr2O7  Cr2O3 + N2 + 4H2O. → Cr(OH)2 + 2HCl  → CrCl2 + 2H2O. 55. 46. 68. 58. 0 t Cu + Cl2  CuCl2. CrCl3 + 3NaOH  → Cr(OH)3 + 3NaCl. 51. K2Cr2O7+6KI+7H2SO4  Cr2(SO4)3+4K2SO4+3I2+7H2O. 61. 73. 2CrO3 + H2O  → H2Cr2O7. 52. 67. K2Cr2O7 + 3H2S + 4H2SO4  → Cr2(SO4)3 +3S + K2SO4 + 7H2O. → 91 . Cr + H2SO4  → CrSO4 + H2. 74. Cr + 2HCl  → CrCl2 + H2.

92 t Cu + S  CuS. 91. 88. → t0 Zn + Cl2  ZnCl2. 84. → t0 Zn + O2  2ZnO. → 0 t Ni + Cl2  NiCl2. → Cu(OH)2 + 4NH3  → [Cu(NH3)4]2+ + 2OH-. Cu(OH)2 + 2HCl  → CuCl2 + 2H2O. 3Cu + 8HNO3 loãng  → 3Cu(NO3)2 + 2NO + 4H2O. 0 t 2Cu(NO3)2  2CuO + 2NO2 + 3O2. → Cu2O + H2SO4 loãng  → CuSO4 + Cu + H2O. 113. 0 t Cu(OH)2  CuO + H2O. 108. → 0 t CuCO3. → t0 3CuO + 2NH3  N2 + 3Cu + 3H2O. → ñieä phaâ dung dò n n ch 2CuSO4 + 2H2O  2Cu + 2H2SO4 + O2. → 0 t 2Pb + O2  2PbO. 93. 94. t0 Sn + O2  SnO2. 107. CuO + 2HCl  → CuCl2 + H2O. 82. CuO + H2SO4  → CuSO4 + H2O. 0 t CuO + H2  Cu + H2O. 95. Cu + 4HNO3 đặc  → Cu(NO3)2 + 2NO2 + 2H2O. Cu + 2FeCl3  → CuCl2 + 2FeCl2. → t0 Pb + S  PbS. 112. 99.81. 102.Cu(OH)2  2CuO + CO2 + H2O. 106. Cu(OH)2 + H2SO4  → CuSO4 + 2H2O. → 0 . 89. 115. 100. 90. Cu + 2AgNO3  → Cu(NO3)2 + 2Ag. 98. 110. 104. → 0 t Zn + S  ZnS. 3Cu + 8NaNO3 + 4H2SO4  → 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. 92. Sn + 2HCl  → SnCl2 + H2. 96. 2Cu + 4HCl + O2  → 2CuCl2 + 2H2O. CuS + 4H2SO4 đặc  → CuSO4 + 4SO2 + 4H2O. 5000 C 2Ni + O2  2NiO. → Cu + 2H2SO4 đặc  → CuSO4 + SO2 + 2H2O. 109. 87. → t0 CuO + Cu  Cu2O. 86. → CuS + 2AgNO3  → 2AgS + Cu(NO3)2. 116. 111. → ñieä phaâ dung dò n n ch CuCl2  Cu + Cl2. 97. 85. 103. 101. 83. → t0 CuO + CO  Cu + CO2. 114. 105. → ñieä phaâ dung dò n n ch 2Cu(NO3)2 + 2H2O  2Cu + 4HNO3 + O2. → 3Pb + 8HNO3 loãng  → 3Pb(NO3)2 + 2NO + 4H2O.

121. [Ar]3d6. Pirit sắt. Câu 7.6. ZnO. Câu 7. B. O2. Cấu hình electron của ion Cu2+ là A. MgSO4. C . +4. B. Ba. +3. Phản ứng oxi hoá. D. 9 C. Câu 7. Ag. Ba.khử phức tạp. D. C. B. B. B. 118. Cr2O3.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ? A. +6. 122.5 Khi nung Na2Cr2O7 thu được Na2O. +1. Mg.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư. +4. +6. Đó là muối nào sau đây ? A. D. Mg. Xiđerit. B. Zn(OH)2. CaSO4. Câu 7. +2.khử. C. D.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ? 93 . Ag + 2HNO3(đặc)  → AgNO3 + NO2 + H2O. D. [Ar]3d . ZnSO4. Câu 7. 124. +6. Phản ứng phân huỷ không phải là oxi hoá. Fe. D.khử. Zn(HCO3)2. Câu 7. +2. +4. +2. Ag2O + H2O2  → 2Ag + H2O + O2. − 5Sn 2+ + 2 MnO4 + 16 H + → 5Sn4+ + 2 Mn2+ + 8 H2 O. C. D. Ag. [Ar]3d3. Na. 2Ag + 2H2S + O2  → 2Ag2S + 2H2O. D. MnSO4. t0 2AgNO3  2Ag + 2NO2 + O2. Mg.2 Cấu hình electron nào sau đây là của ion Fe3+ ? A. ZnSO4. C. Câu 7. 2Ag + O3  → Ag2O + O2. B. +3. Câu 7. Phản ứng tự oxi hoá. +6. 119. [Ar]3d5. Na. [Ar]3d10. Manhetit.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 7.khử nội phân tử. [Ar]3d8.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ? A. → Au +HNO3 + 3HCl  → AuCl3 + 2H2O + NO. Phản ứng oxi hoá. C. [Ar]3d . C. 123. 4 C.4 Các số oxi hoá đặc trưng của crom là ? A. [Ar]3d7. Hematit. Na. → ñieä phaâ dung dò n n ch 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2. Hg. 120. B.117.7 Hợp chất nào sau đây không có tính chất lưỡng tính ? A. Phản ứng trên thuộc loại phản ứng nào sau đây ? A.

Fe2O3(2). HNO3 đặc nguội. Không thay đổi. Câu 7. m2>m1. Dung dịch : KOH.5H2O(6). D. C.17 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất: CuO(1). sắt kim loại. Kim loại Cr có thể cắt được thuỷ tinh. Các chất có % khối lượng đồng bằng nhau là……………. Câu 7. b. a. D. Chất có phần trăm khối lượng sắt nhỏ nhất là………… Câu 7. B.13 Có 2 lá sắt khối lượng bằng nhau. D. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép. Cu2S(4). Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan. C. Fe2(SO4)3(7). D. Hoá chất cần dùng là : A. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2. Mối liên hệ giữa m1 và m2 là A. Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy. Không xác định được.14 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất : FeO(1). NO. NH3. Al-Cu.16 Trong phòng thí nghiệm.. để bảo quản dung dịch muối sắt (II). Dung dịch : NaOH. Câu 7.15 Cho biết câu sai trong các câu sau : A.. Cu có khả năng tan trong dung dịch FeCl3. C. B. Chất có phần trăm khối lượng sắt lớn nhất là………… b. B. Câu 7. Câu 7. a. B. B. Tăng lên. Crom là kim loại có tính khử mạnh hơn sắt. dung dịch AgNO3. FeS2(5).. Ag có khả năng tan trong dung dịch FeCl3. Cu2O(2). m1>m2.10 Phân biệt 3 mẫu hợp kim sau : Al-Fe.12 Cho biết câu nào không đúng trong các câu sau: A. N2O. Cu-Fe bằng phương pháp hoá học. Câu 7. dung dịch NaOH. c. Chất có % khối lượng đồng nhỏ nhất là……………. Cả A. CrO là oxít bazơ. C. C. FeSO4(6). NO2. CuSO4. FeSO3(8). D. Giảm đi. CuS(3). B. Câu 7. HCl. B. C. H2SO4 loãng.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau : 94 . dung dịch H2SO4. Fe có khả năng tan trong dung dịch FeCl3. Chất có % khối lượng đồng lớn nhất là……………. Câu 7. C. người ta thường cho vào đó : A.A. D.11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ? A. CuSO4(5). FeS(4). C đều đúng. dung dịch HCl. m1=m2. Fe3O4(3). D. Lá 2 đốt trong khí clo dư thu được m2g muối. B.

B. C.48 lít. 1. 27. D. C.52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi. Phần 1 tác dụng hết với dung dịch HCl thu được 2.36. 3. 3. 3. Cu có thể tan trong dung dịch FeCl2.22 Cho 2. 10. Fe. D.16M và H2SO4 0. Thể tích khí (ở đktc) là A.27 Hỗn hợp A gồm FeO. 0. sau một thời gian lấy đinh sắt ra. Câu 7. B. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư.36.84. Câu 7. Câu 7. Ngâm lá sắt vào dung dịch. Khối lượng mol của M.68.24 Lấy 5.26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO 4.6g. Câu 7. Trong hỗn hợp A mỗi oxit đều có 0.2857g.7H2O có khối lượng là 55. 2. B. C.92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0.16. FeCl2. Mg.16. HCl. D. Cho AgNO3 vào dung dịch. Ngâm lá kẽm vào dung dịch. HCl.19. 1. 2. 4. 7. B. 18. 0.252g. Câu 7. D. B. Chọn câu đúng trong các câu sau : A. xăng. 8.20 Cấu hình electron của Cr3+ là phương án nào ? A. Khối lượng của hỗn hợp A là bao nhiêu gam ? 95 .52g một kim loại tác dụng hết với H2SO4 loãng. CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi. 0. Zn.36g hỗn hợp gồm Fe3O4 và oxit của M.36. 2.16. Ngâm lá đồng vào dung dịch. FeCl3. D. Câu 7. C. Fe3O4.36 lít. số gam của Fe. Câu 7. C. C. dung dịch thu được cho bay hơi được tinh thể FeSO4. 0.3584 lít.016 lít hiđro (đktc). Kim loại đó là kim loại nào ? A. FeCl3. 54. Đốt cháy hết phần 2 trong oxi thu được 4.4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15.A. Câu 7. Fe2O3. cân nặng 4. B. HCl.52g hỗn hợp A) lần lượt là A. D. B. 0. 27. FeCl2. 2. [Ar]3d5. 0. M (trong 5.25 Cho Fe tác dụng với dung dịch H2SO4 loãng. 3. chia làm 2 phần bằng nhau.23 Cho 1. [Ar]3d . [Ar]3d2. [Ar]3d4. Câu 7.33 lít. FeCl3.84g muối sunfat.0896 lít. Khối lượng sắt tham gia phản ứng là bao nhiêu ? A.448 lít. Al. 3 C.672 lít. sấy khô. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ? A.5 mol.999g. C. C. B. thu được 6.3999g . FeCl2. D.16 lít. Cu có thể tan trong dung dịch AlCl3. D. CuSO4 có thể dùng làm khô khí NH3. B. D.100g. Dung dịch thu được sau phản ứng gồm các chất A.

54.69.2.56.65. Câu 7. Khối lượng chất rắn X là A. D. 232. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ? A. C. 88. 0. B.5M thu được 448 ml khí NO (đktc).56.5 mol. Cr2O3 và 48g oxi. D. B.33 Cho 7.1M. 21. B. C. Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là A. D. Đáp số khác.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao.8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171.36 lít.84 lít. 21.8g đồng trong không khí thu được chất rắn X. Câu 7. 0.5M thu được 448 ml khí NO (đktc).9333 lít D. Câu 7. CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0. 16g. C.2g kim loại M tác dụng với dung dịch HNO3 loãng. Câu 7. B. 177 lít. B. Hoà tan chất rắn X trên vào dung dịch HNO3 0. Fe. Biết hiệu suất của quá trình 96%. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư. Câu 7.52g. Zn. D. 1.2 g/ml) đã tác dụng với thanh đồng là A. C. B. Câu 7.31 Một thanh đồng nặng 140. 15.4. 3. Khối lượng kết tủa thu được là bao nhiêu gam ? A. 25. 2. C.48 lít khí duy nhất NO (đktc). 88.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%. D. 30.A. C.405g D. B.68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra. dư thu được 4. Na2Cr2O7 còn dư 1 mol.8g đồng trong không khí thu được chất rắn X.08g. Na2Cr2O7 còn dư 0. Na2Cr2O7 đã hết. Phản ứng này không thể xảy ra. 10. Câu 7. Thể tích dung dịch AgNO3 32% (D=1.2g. M là kim loại nào ? A. B. 35. C. 25.32 Cho 19. 20. 177 ml. Câu 7.12 lít. 15. C.65.8 lít. Câu 7. C.405g hỗn hợp Fe2O3. C. 22. Khối lượng muối sunfat khan thu được là A. 22. C. Đáp số khác.5 ml. 3. B.35 Đốt 12. 0.04 lít. Giá trị của m là A.5 lít.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H 2SO4 loãng thu được 560ml khí ở đktc.34 Đốt 12. D.36 Cho 1. Hoà tan chất rắn X trên vào dung dịch HNO3 0. 116. D. ZnO. Mg. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO 4 96 . Cu. B. 464. 50.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O. 0.24 lít. Vậy: A. Câu 7.

38 Khử 2. Fe2O3.12 lít.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X. C. 80%. Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38. 10. Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4. Cho 14.24 lít.4g. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là A.8g. Nguyên tố X là A. C.5g.8 lít khí. 80%.2g. 4%. C. Câu 7.98 lít khí. Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là A.76g chất rắn. 75%. D. sau một thời gian lấy thanh sắt ra rửa sạch. 60g. Câu 7. D. 4.41 Hỗn hợp X gồm Cu và Fe. Câu 7. p. 84%. Cu. 84%. 55. 60.8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra. D. 1. D. Al. Thành phần phần trăm của Fe. Sau phản ứng thu được 1. 12%.4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1. 4.95%.48 lít. Có bao nhiêu gam Cu đã bám vào thanh sắt ? A.48 lít NO (đktc). Hiệu suất của phản ứng khử CuO là A. B. 70%.36 lít.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra. 2. Fe3O4. Zn. 14g. Tên của kim loại đã dùng là A.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32.thì thu được một chất rắn. C photpho. 4. nếu sục thật 97 . 2. B.05%. B. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4. Oxit sắt đó là ? A. Câu 7. Câu 7. 15%. Cr và Al trong hợp kim lần lượt là A. Câu 7. B. D. 4%. 1. sấy khô thấy khối lượng tăng 1. brom.5g. Giá trị của V là bao nhiêu ? A. D.2g. 50g. n) là 82.5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6.448 lít khí (đktc). C. Không xác định được. 32g. D. D. B. B.72 lít (đktc). B. Fe.4g. 1.4. B. C. FeO. C. Mặt khác. 28g. trong đó Cu chiếm 43.40 Cho 100g hợp kim gồm có Fe. D. sắt.6.8.8g.43 Nhúng thanh sắt vào dung dịch CuSO4. Các khí đo ở đktc. Đáp số khác. 5%. crom. 3. 9.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e. 2. 13%. 19. C. cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1. Câu 7. 3. 2.8g.2.24% khối lượng. đem hoà tan vào dung dịch HCl thấy bay ra 0. 83%. B.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22. Câu 7. 85%. 11. Câu 7. C.

3.0053 lít. FeCl2. 3. 22. C. 4. C. D. B. Câu 7. 1. C.08g. Câu 7. Đáp số khác. m có giá trị là A. C. 2.24 lít. D. 6. 16g. 9g. Công thức của muối sắt là A. thu được sắt và 2. Câu 7. Fe2O3.64g. 6.196 lít khí CO2 (0oC và 0. Thể tích CO (đktc) đã dùng là A. thấy có 0. B. FeCl3. Thể tích hiđro đã dùng (170C và 725mmHg) là A.88 lít hiđro (đktc). C.8 at) thoát ra. 5.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH. D. nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26. 27g.84%.42%. sau đó làm bay hơi 98 .48 lít khí CO2 (đktc) thoát ra.48 lít. B.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO.2g. Câu 7. Thành phần phần trăm cacbon trong mẫu thép là A.12 lít. 6.6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3. Đáp số khác. 5. Không xác định được. B. Fe3O4 thấy có 4. 0. 46. Câu 7. 0.4%.6g. Cả FeCl2 và FeCl3. 6. 69. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là A. Câu 7.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO 3 tạo ra 2.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư.54 Hoà tan hoàn toàn 19. 4. B. Công thức của muối sắt đã dùng là A.4g. C.4 lít.72 lít hiđro (đktc). Câu 7. nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6.36 lít. 4 lít.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao.6492 g AgCl.88g nước. C. B.61g kết tủa trắng. 0. D. FeCl2. 8. D. 27g.92g. 4. D. 0. chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO 3. Câu 7.53 Khử 9. B. 42g.36 lít.672 lít. D. Không xác định được. 3. FeCl3.6g.48 lít. B.47 Một dung dịch có hoà tan 3.24 lít. thu được chất rắn có khối lượng 11. Câu 7.chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m 1 + 1. Sau khi phản ứng kết thúc.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí. Thể tích CO (đktc) đã tham gia phản ứng là A. 69.42)g muối khan.48 lít. C.2g Cu vào dung dịch HNO3 loãng.584 lít.72 lít. D.72 lít.89g. D. B.25g sắt clorua tác dụng với dung dịch AgNO 3 dư tạo ra 8. Cả FeCl2 và FeCl3. Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là A. C. 2. Những chất còn lại sau phản ứng.

0.1 mol Fe2O3 và 0. 2. thu được 560ml hiđro. 0. 0. kim loại Mg. C. Câu 7. thu được chất rắn có khối lượng là 0. 8. Lọc lấy kết tủa. Fe và Ni.58 Chia 4g hỗn hợp bột kim loại gồm nhôm. D. thu được 336ml hiđro.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb. 32%.63 Chỉ ra câu đúng trong các câu sau : 1. Cho NaOH vào Y. B. V1<V2. kim loại Ba. số cặp kim loại trong đó Fe bị phá huỷ trước là A.02. Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là A.01. Câu 7. thu được dung dịch Y. C. 3 và 8.02. Thêm dung dịch kiềm vào muối đicromat. B.01. 4. 99 . C.4g. Câu 7. V1>V2. 4.Phần 2 : tác dụng với lượng dư dung dịch NaOH. Câu 7. Fe và Sn. 40%. 3 và 2. sắt và đồng thành 2 phần đều nhau. còn hợp chất Cr(VI) có tính oxi hoá mạnh. 32.72g. B. Các khí đo ở đktc. B. Khối lượng muối khan thu được sau phản ứng là A. kim loại Cu.1 mol Fe3O4. Đáp số khác. 1. Hoà tan X bằng dung dịch HCl dư. . C. C. C. 40.Phần 1 : tác dụng với lượng dư dung dịch HCl. 48.84g.57 Chất rắn X gồm 0.01. V1=V2. D. D.448 lít khí không màu hoá nâu trong không khí (đo ở đktc). Hợp chất Cr(II) có tính khử đặc trưng.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO 3 thấy thoát ra 0. 60%. 32%. 5. 3 và 6. D. 64. D. Mối liên hệ giữa V1 và V2 là A. 3 và 3. 0. C. B. II – BÀI TẬP NÂNG CAO Câu 7. Phần trăm về khối lượng của đồng.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V 1 lít khí (đktc). 3. 68%. B. Câu 7. Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc). . D. Khi nhúng các cặp kim loại trên vào dung dịch axit.4g. 40%. Giá trị của m là A. D. Đáp số khác. Câu 7. 0. 2.02.dung dịch và đun nóng. Fe trong 4g hỗn hợp lần lượt là: A. B. muối này chuyển thành muối cromat. 60%. Số mol của Al. nhôm trong hợp kim lần lượt là A. C. Không đủ cơ sở để so sánh. rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn. D. 68%. Câu 7. kim loại Ag. 0.61 Để khử ion Fe3+ trong dung dịch thành ion Fe2+ có thể dùng một lượng dư A. thu được kết tủa Z. B.59 Cho sơ đồ phản ứng sau : Cu + HNO3  → muối + NO + nước.

H2CrO4. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo. B. (4) X2 + NaOH → X5  NaCl.68 Cho sơ đồ phản ứng : Cr + Sn2+  → Cr3+ + Sn (1) Cr + Cu2+  → Cr3+ + Cu (2) a. 7. 100 . 2. Fe(NO3)2. 8. 3. K2CrO4. K2CrO4. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy. Fe(OH)3. C. Cr(OH)3. 8. Dung dịch X chứa chất có công thức phân tử là A. 5. 5. D. Các hợp chất CrO. 7. Fe3O4. Na2Cr2O7. D. 6. 8. Na2Cr2O7. 3. Biết 0 ECr 3+ / Cr = −0. X5. 4. Câu 7. 2. 8. Nếu cho thêm vào một lượng KOH. 3. C. 1.66 Dung dịch X có màu đỏ cam.6 V. K2Cr2O7. FeCO3 lần lượt phản ứng với HNO3 đặc nóng.khử là A. 3. C. Fe2O3. CrO. (7) X5 + O2 + H2O → X6 Các chất X1. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ. 2. 74 V. 1. X3. Câu 7. b. 6. (3) X2 + Cl2 → X3. FeSO4. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1).64 Cho từng chất Fe. 8. Cr2O3. Na2CrO4. X4. Na2CrO4. 6. Crom là kim loại có tính khử mạnh hơn sắt. A. chất B tác dụng với axit chuyển thành chất C có màu da cam. X2. B. D. KCr2O4. 7. D. Số phản ứng thuộc loại oxi hoá. B. 5. 5. Câu 7. B. 6.67 Cho các sơ đồ phản ứng : (1) X1 + HCl → X2 + H2. + (5) X4 + NaOH → X6  + NaNO3. Cr(OH)2 tác dụng được với dung dịch HCl còn CrO 3 tác dụng được với dung dịch NaOH. 4. 7. Suất điện động chuẩn của pin điện hoá là A. B. Cr2O3. Fe(NO3)3. Fe(OH) 2. Nếu thêm vào đó một lượng H 2SO4.88 V. 8. K2Cr2O7. Các hợp chất Cr2O3.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. (2) X1 + HNO3 → X4 + NO2 + H2O. màu của dung dịch dần dần trở lại đỏ cam. Cr2O3. 0. 5. Khi cân bằng 2 phản ứng trên. hệ số của ion Cr3+ sẽ là A. Kim loại crom có thể cắt được thuỷ tinh. Công thức phân tử các chất A. 4. Fe2(SO4)3. B và C lần lượt là : A. Cr2O3. 1. D. 2. 5.3. FeO. -0. Câu 7. K2CrO4. 3. K2Cr2O7. màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. B. X6 lần lượt là X1 A B C D Cu Fe Fe Fe X2 CuCl FeCl2 FeCl3 Fe(NO3)3 X3 CuCl2 FeCl3 FeC2 FeCl3 X4 Cu(NO3)2 Fe(NO3)3 Fe(NO3)3 Fe(NO3)2 X5 CuOH Fe(OH)2 Fe(OH)2 Fe(OH)3 X6 Cu(OH)2 Fe(OH)3 Fe(OH)3 Fe(OH)2 Câu 7. C. C. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước. Cr(OH)2 đều có tính chất lưỡng tính.

6 tấn.03M là A. B. Đáp án khác. 11. 57%. Câu 7. rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0.8 V. b.4 V. C.C.02625g. 0. Tăng 22. 1. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ? A.7%. D. -0. Câu 7.8 tấn.1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%) A. 113.272g. -0. 2 tấn.88 V. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M. D. Phần trăm theo khối lượng FeSO4 tinh khiết là A. C. được 200 cm3 dung dịch. a. B. Nếu lấy quặng hematit trên đem luyện gang. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2). B. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là A. 74g. C. B. B.72. a.21g.82 tấn. 1. c. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0. B. 1. 2. Đáp số khác.9g. 139.5H2O trong nước. B.0075 mol. D. c. 74 V. Giảm 1.28 tấn.8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87.71 Khối lượng quặng chứa 92. D. Sau phản ứng. 0. 5.725 M. 16. Câu 7. D. C.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước. C. đem cân thấy lá kẽm có khối lượng là A. -0.464 M. 0. D. C. b. C. Tăng 1. Biết 20 cm3 dung dịch này được axit hoá bằng H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0. 21%.3265 tấn. Cho dần dần mạt sắt đến dư vào phương trình trên.2 tấn. 0. được 500 ml dung dịch. B.73.5 tấn.00075 mol. D.6 V.5 tấn.856g. a.00375 mol. 12. 0.03 M. Đáp số khác.1g.9g. b. Biết 0 ECr 3+ / Cr = −0. B. Câu 7.4 V. 0. Câu 7. D. Đáp số khác. D. 0. C. C.5%) là : A.08 V. 0. 0. 1. D. lấy lá kẽm ra khỏi dung dịch. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là A.432 M. Đáp số khác.68g. 0. 0. Đáp số khác. 2.69 Hoà tan 58g muối CuSO4. Suất điện động chuẩn của pin điện hoá là A. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu : A. B. rửa nhẹ. D. 90g.856g. C.4 tấn. sấy khô. 3. 101 .

12. 200ml. Kim loại X là A. Ni. 1: 5.2g gồm Fe. Cr. Câu 7. Cho 40g hỗn hợp vàng.04g.88g. FeO và Fe2O3. Câu 7. thu được 1. 6. 3. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư. C. Khử 16g hỗn hợp các oxit kim loại FeO. 10. Câu 7. 10.32. 9. C. D. 2. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2. 2.72 lít. Pb. C. D. 2. Fe2O3. Sn. 10. Nung m g bột sắt trong oxi. B. kẽm tác dụng với oxi dư nung nóng thu được 46.04g.27.22.36 lít. D.768 lít. Cho 23. Câu 7. khí CO 2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH) 2 thu được m2g kết tủa trắng.24 lít. 63. PbO bằng khí CO ở nhiệt độ cao. Hoà tan hoàn toàn 3.4g chất rắn X.75. 5. D.84 lít. 3.81.25. 1: 3. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư). A. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. đồng.62.685g D. Giá trị m và nồng độ dung dịch HNO3 lần lượt là A. nung nóng rồi cho một luồng khí CO đi qua. B. Fe3O4) với số mol bằng nhau. 300ml. Tỉ lệ là m2 A.68 lít. 127. 10. 1.74.3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất). 10. Giá trị của m là A.12 lít. D.44g. B. 20. 7. 10. Câu 7. D.76. 20.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4. Giá trị của V (ở đktc) là A. Thể tích khí CO phản ứng (đktc) là A.98. B.44g.7. thoát ra 0.72 lít khí (có màu nâu đỏ) duy nhất (đktc). D.2M.5g. 1: 4. D. Câu 7. 10.5M. B.8g.78. cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6. 1: 6.344 lít hiđro (đktc) và dung dịch chứa m g muối. khối lượng chất rắn thu được giảm 4. bạc.80. 20.685g. sắt. 56 lít. 0. B. Câu 7. 400ml. C. Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng. Tính khối lượng m1.08g. Giá trị của m là A. C.8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+.88g. 1M. B. B. 2. C. FeO. 1. CuO.24 lít khí NO duy nhất (đktc). 5. B. 2. 102 .5g.56 lít (đktc) NO (là sản phẩm khử duy nhất).22g hỗn hợp X gồm Fe. 100ml.52.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3.5H2O cho m1 vào m2g dung dịch CuSO4 8%.77.6M. Fe3O4. m2. Hoà tan hết hỗn hợp gồm 0.08g. C. Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là A. B. 20. thu được 3g hỗn hợp chất rắn X. Câu 7. Lấy m1g X cho vào một ống sứ chịu nhiệt. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19.52. 8. C.2 mol FeS2 và 0.

X là A. A.05 mol. Tính khối lượng m của X. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4. A.05 và 0.48 lít.83 Đốt cháy hết mg hỗn hợp A gồm (Zn. D. thu được V lít khí (đktc) và 3. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0.85 Cho 4. C. Zn và Fe bằng dung dịch HCl.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy).85g kết tủa. Câu 7.08g. Câu 7. Câu 7.24 lít. Zn. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12. C. Al và Fe bằng dung dịch H 2SO4 loãng. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH) 2 0.1M.3g. C. thu được 5g kết tủa. 0. Chưa đủ dữ kiện để xác định. B.48 lít.12 lít.56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2.1M.86 Cho 19. Câu 7. Bari D. 0. thu được 3.91 Hoà tan hết 5.0g C.075 mol. C. 19. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7. m nhận giá trị bằng A.36 lít khí SO2 duy nhất (đktc).02g. C. 2. 0.85g muối clorua khan.84 Để mg phoi bào sắt (X) ngoài không khí.224 lít. C. HBr) thì thể tích H2 (đktc) thu được là A.16g.Câu 7. 18.18g.12 lít. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0. 1. 4. 2. 1.36 lít. B. 0.2M.72g hỗn hợp kim loại gồm Mg. C. Fe3O4. Mặt khác.3g hỗn hợp kim loại gồm Mg. V nhận giá trị bằng A. 5. Thể tích khí NO duy nhất thu được ở đktc là . Câu 7.62g chất rắn. Al) bằng oxi thu được (m +1.9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao.136 lít khí (đktc) và m g muối sunfat. D.89 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt. 103 . Beri Câu 7. Magie C.76g kết tủa trắng. 0.26g Câu 7.05 và 0.1M.025 mol. FeO. D. D. B. Mg. 19. 1. 11. B. Số mol khí CO2 thu được là A. Canxi B. 1.00g.2g Cu vào 1 lít dung dịch gồm H2SO4 0.016 lít khí (đktc). 8. Công thức của sắt oxit là A.36 lít.00g.2g. 2.64g D. 3.92 Hoà tan hết 1. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15. 4. 15.688 lít. 3.448 lít. 6.6)g oxit. Fe2O3. sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO. thu được 9. B. C. thu được 5g kết tủa. Giá trị của m là A.6g. 5. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy). 8.04g. D. A. 32.24 lít.7g muối khan. Al. B. 5. 16. D.74g.1g.25g muối khan. 4.2g B. Fe3O4. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16. Câu 7. 10.15 mol. D. 0.5M và KNO3 0. HCl. Fe2O3.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại. m có giá trị là A. Câu 7.344 lít. 7. B. C.

03 và y = 0. người ta thu được 6.4 B 7. Tìm công thức của oxit.13 7. 0. C.Câu 7. Fe2O3.525g.2.2g. 8.101 Oxi hoá hoàn toàn 0.5 B 7. 5. x = 0. C.10 D 7. sau một thời gian thu được 13. Câu 7. Thể tích khí NO duy nhất bay ra (ở đktc) là A. SO42. C.72g hỗn hợp gồm 4 chất rắn khác nhau.16 B 7. D.2g. FeO nung nóng. Câu 7. x = 0.9 A 7. D. 0.9g chất rắn khan.81g hỗn hợp các oxit Fe3O4. Tính a ? A.02 và y = 0. x = 0.2 B 7. B.8g bột sắt ngoài không khí.3 và y = 0. 0.16g.375g. m có giá trị là A. D.4256 lít.448 lít khí NO duy nhất. Không xác định được.1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ? A. Câu 7. Câu 7. Nung nóng 16.016g hỗn hợp các oxit sắt (hỗn hợp X).6g rắn X và hỗn hợp khí Y. Câu 7. 0. Câu 7.14 C a/1.5g.0336 lít.1 mol.45g.3g. 4.26 A 7.21 D 7. D. B. Giá trị m là A. Giá trị của m là A. Cho 2. 0. 1.100 Oxi hoá hoàn toàn 0. C. B.896 lít. B.8g. D. Chưa thể xác định.102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian. 3.88g khí CO2.y mol.3 . 24g.24 A 104 .4 7. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0. b/7 7.7 C 7. thu được mg kết tủa Z.3 B 7. b/6 c/1.03. MgO.99 Cho CO qua ống sứ chứa 15. C.19 C 7.21g . ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VII 7. 7. Sục Y vào dung dịch nước vôi trong có dư. 22g. 20g.97 Cho 1.17 a/2.75g hỗn hợp gồm 3 kim loại Fe. 0.22 C 7.96. Một dung dịch có chứa 2 cation là Fe2+ 0. C.72g. dư. x = 0.2 mol và 2 anion Cl.032g hỗn hợp các oxit (hỗn hợp X). D.98. Fe3O4. 26g. 5. Oxit khác. B. Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là A. Fe2O3.12 khí (đktc) và dung dịch X.27 A 7. Zn tan hết trong dung dịch HCl thì thu được 1. 1. 7. A. 8g.11 B 7. FeO.20 C 7.25 C 7. B.2 và y = 0.016 lít H2 (đktc). 10 g. m có giá trị là A.94. 0.02. D. 5. C. 5 g. Khử hoàn toàn 4.12 D 7.5 g.48g.93.6 C 7. Kim loại thu được đem hoà tan hết bằng dung dịch H 2SO4 loãng thấy tạo ra 1. 5.336 lít. Câu 7. C. D.4g.896 lít.18 D 7. Al. C.2g hỗn hợp CuO. thu được 46. Al3+ 0.792g hỗn hợp bột gồm Fe và Cu ta thu được 1. Câu 7. Khi cô cạn dung dịch.1 B 7.15 B 7.6 lít SO2 (đktc). Hoà tan X bằng dung lịch HNO3 loãng. Câu 7. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0. 3.728g bột Fe ta thu được 1.28 D 7.336 lít. B. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5. CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0. sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt.672 lít. 6.84g Fe và 0.23 C 7.30 C 7. D.8 D 7.8g một oxit của kim loại M thành kim loại cần 2. C.0224 lít. D.95. 1. B.x mol. x và y có giá trị là A. và sắt dư. 0. B.344 lít H2. B. Cô cạn x thu được m g muối.29 A 7. Kết quả khác.

59 D 7.83 B 7.70.46 C 7.61 B 7.82 A 7.78 B 7.68.b C 7.40 A 7.b B 7.71 B 7.70.50 B 7.90 A 7.95 C 7.41 D 7.a B 7.96 C 7.99 A + 7.32 B 7.63 A 7.08(mol) → 3Cu 2+ + 2NO + H2 O.101 D 7.85 A 7.a A 7. 0.51 B 7.91 C 7.55 C 7.52 B 7.80 A 7.74 D 7.7.34 A 7.44 B 7.65 B 7.53 B 7.62 D 7.81 C 7.64 D 7.84 D 7.72.69.75 A 7.76 A 7.45 D 7.42 B 7.a B 7.73 A 7.58 A 7.72.35 B 7.93 C 7.33 C 7.98 B 7.49 D 7.86 C 7.31 B 7.b C 7.56 A 7.92 B 7.c B 7.47 B 7.68.016(mol) 0.57 A 7.89 C 7.36 C 7.54 B 7.97 C 7.77 C 7.70.a A 7.c B 7.03(mol) − 3Cu + 2NO3 + 8H 0.43 D 7.94 C 0.016(mol) 105 .38 B 7.66 A 7.39 A 7.60 A 7.79 D 7.87 C 7.37 A 7.67 B 7.102 C 7.68.69.b C 7.48 B 7.100 D 7.88 B 7.

to O2↑ (que đóm t0 có MnO2 2KClO3  2KCl + 3O2↑ → bùng cháy) x. Nhận biết một số anion Tt Anion Thuốc thử Dấu hiệu 1 OH– Quỳ tím Hoá xanh SO32– HSO3– + 2 H CO32– HCO3– SiO32– 3 SO42– Ba2+ 4 S2– Cl– Ag+ Br– I– 5 PO43– 6 NO3 – Phương trình phản ứng SO32– + 2HCl → SO2 + H2O CO32– + 2HCl → 2Cl– + CO2 SO2 làm mất màu dung dịch KMnO4 CO2 làm vẩn đục dung dịch Ca(OH)2 trong SiO32– + 2HCl → H2SiO3 + 2Cl– Ba2+ + SO42– → BaSO4↓ 2Ag+ + S2– → Ag2S↓ ↑ SO2 ↑ CO2 Ag+ 7 ClO3– 8 NO2– H2SO4 loãng.t. ↓ keo trắng ↓ trắng ↓ đen ↓trắng vàng nhạt Ag+ + X– → AgX↓ vàng ↓ vàng (tan 3Ag+ + PO43– → Ag3PO4↓ trong HNO3) (↑) nâu NO2 3Cu+8H++2NO3–→2Cu2++2NO+4H2O dung dịch Cu2+ (2NO + O2 → 2NO2) xanh 106 .MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. không ↑ NO2 nâu NO  NO2↑ (nâu) → khí Dùng phân biệt NO2– và NO3– (vì NO3– không có phản ứng này). 3NaNO2 + H2SO4 (l) → Na2SO4+NaNO3+2NO↑+H2O H2SO4 (l) + O2 KK to. vụn Cu Cô cạn. PHÂN BIỆT MỘT SỐ CHẤT VÔ CƠ & CHUẨN ĐỘ DUNG DỊCH A.CHƯƠNG VIII.

to − ↓ đỏ máu ↓ đỏ nâu NH3 ↑ khai. Ca2+ + SO42 → CaSO4↓ (it tan) − Ba2+ + SO42 → BaSO4↓ − Mg2+ + 2OH → Mg(OH)2↓ − 11 Fe3+ 12 NH4+ OH . Nhận biết một số cation Stt ion 1 2 3 4 Li Na+ K+ Ca2+ + Thuốc thử Dấu hiệu Đốt trên ngọn lửa vô sắc − Phương trình phản ứng (phương pháp vật lí) 5 Ba2+ 6 Ca2+ 7 Ba2+ 8 Mg2+ SO42 9 Cu2+ 10 Fe2+ − 2+ OH 2 Cu + 2OH → Cu(OH) ↓ (riêng với Fe3+ đặc +2 NH + 2H O Cu 2+  Cu(OH)2 ↓ → trưng nhất −2NH là dùng ion 2+ +4NH  [ Cu(NH 3 )4 ] → −2OH thioxianat SCN-. − 3 4 + 2 3 - − Đỏ thẫm Vàng tươi Tím hồng Đỏ da cam Lục (hơi vàng) ↓ trắng ↓ trắng ↓ trắng ↓ xanh (nếu dùng dd NH3 thì tạo kết tủa xanh sau đó tan tạo ion phức màu xanh thẫm đặc trưng. tan ngay khi (OH–) dư dd H2S PbS ↓ đen − OH − 3  Cr 3+  Cr (OH )3 ↓   Cr ( OH )6 − → →     18 Pb 2+ (dd màu xanh) Pb + S → PbS↓ (màu đen) 2+ 2− 107 . còn Fe2+ làm KK 2 + OH − mất màu Fe     Fe OH2 → ( ) ↓    Fe OH3 đỏ↓nâu →( ) dd thuốc ↓ trắng xanh − 2+ + 2+ 3+ MnO4 + 5Fe + 8H → Mn + 5Fe + tím khi có + + 4H2O mặt H ).2. làm xanh quỳ ẩm) Fe + 3SCN → Fe(SCN) ↓ đỏ máu − Fe3+ + 3OH → Fe(OH)3↓ đỏ nâu NH4+ + OH → NH3↑ + H2O +3OH Al3+  Al(OH)3 ↓ → + OH  [ Al(OH) 4 ] → - 3+ 3 − - 13 Al3+ − 14 Zn 2+ 15 Be2+ 16 Pb2+ 17 Cr 3+ OH từ từ đến dư − +2OH ↓ trắng tan Zn 2+  Zn(OH) 2 ↓ → ngay khi 2− + OH  [ Zn(OH) 4 ] → OH– dư + OH − Be2+  Be( OH )2 ↓  BeO 2 − → → 2 Pb2+ →Pb(OH)2↓ →PbO22 ↓ xanh.

to Hoá đen CuO Trắng hoá xanh 13 H2 14 SO3 15 N2 CuSO4 khan CuO (đen) Hoá đỏ (Cu) to Dung dịch Kết tủa BaCl2 trắng BaSO4 (còn lại sau cùng) CuSO4 + 5H2O → CuSO4. nếu chỉ dùng H2O và một chất khí (không dùng nhiệt độ. Nhận biết một số chất khí Stt Khí 1 Cl2 2 I2 3 SO2 4 H2S 5 HCl 6 NH3 7 NO 8 NO2 9 CO 10 CO2 11 O2 12 Hơi H2O Thuốc thử Dung dịch (KI + hồ tinh bột) Hồ tinh bột Dấu hiệu Phương trình phản ứng Không màu Cl2 + 2KI → 2KCl+ I2 + I2 → hoá xanh (Hồ tinh bột) → xanh Không màu → hoá xanh SO2 + Br2 + 2H2O → 2HBr + H2SO4 5SO2+2KMnO4+ 2H2O → 2H2SO4+2MnSO4+K2SO4 Pb2+ + H2S → PbS↓ + 2H+ Ag+ + Cl– → AgCl↓ NH3 + H2O→ NH4OH NH3 + HCl → NH4Cl 2NO + O2 → 2NO2 3NO2 + H2O → 2HNO3 + NO dd Br2 hay Mất màu dd KMnO4 dung dịch dd Pb(NO3)2 dd AgNO3 Quỳ tím ẩm HCl (đậm đặc) Không khí Quỳ tím ẩm dd PdCl2 (hay + CuO đen) Cho ↓ đen Cho ↓ trắng Hoá xanh Tạo khói trắng Hoá nâu Hoá đỏ Tạo ↓ Pd CO + PdCl2 + H2O → (hoá đỏ Cu) Pd↓ + 2HCl + CO2↑ CO2 + Ca(OH)2 → CaCO3↓ + H2O t 2Cu + O2  2CuO → 0 ddCa(OH)2 Vẩn đục Cu (đỏ). O3. Na2CO3. điện phân) để phân biệt chúng thì chất khí phải chọn là A. NaHCO3. 108 .3. CO2.5H2O t CuO + H2  Cu↓ + H2O → 0 SO3 + H2O → H2SO4 H2SO4 + BaCl2 → BaSO4 + 2HCl B .1 Có 4 mẫu chất rắn màu trắng BaCO3. B.BÀI TẬP TRẮC NGHIỆM Câu 8. BaSO4.

dd BaCl2. Có thể sử dụng thuốc thử nào sau đây đề phân biệt các lọ dung dịch trên? A. đồng sunfat khan. NaOH. C. dd HCl. không thể thực hiện được. Câu 8. NaOH. BaCl2.2 Có 4 lọ hoá chất bị mất nhãn đựng riêng biệt 4 dung dịch không màu sau đây: NH4Cl. Câu 8. Câu 8.1M). H2SO4. H2SO4 loãng. Câu 8. C.7 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là NaAlO2. B. NH4NO3. Câu 8. H2SO4 đặc nguội. C. B. Câu 8. Câu 8. axit clo hiđric. C. Zn(OH)2. D. D. KNO3. dd KOH Câu 8. ta có thể dùng A. C đều đúng.9 Để nhận biết 3 dd natri sunfat. NaOH. C. dd H2SO4 đặc nguội. quỳ tím.5 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. vôi sống. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. D. SO2 ta có thể dùng thuốc thử là A. NH3. Câu 8. dd ammoniac. nguội. NaNO3. D. B. Quỳ tím. KCl. dd HNO3.8 Để làm khô khí amoniac người ta dùng hoá chất là A. C. H2O D. CO2 và H2O. dd HCl. Cu(OH)2. Na2CO3. Mg và Al 2O3. dd KMnO4 và dd Br2 C. thuốc thử được chọn là A. CO2. Fe3O4 và FeO người ta dùng A. SO2. NaCl. CuO. kali sunfit và nhôm sunfat (đều có nồng độ khoảng 0. dd PdCl2 và dd Br2. Dung dịch Ba(OH)2 và dd AgNO3. 109 . NaCl. B. HCl.3 Để loại bỏ Al ra khỏi hỗn hợp Al. HCl. Câu 8. B. Nếu chỉ được dùng một thuốc thử để nhận biết 5 chất lỏng trên. Cả A. H2. dd HNO3 đặc. AlCl3. mỗi ống nghiệm chứa một trong các dd HCl. Dung dịch AgNO3 và dd phenolphthalein. P2O5. B. chỉ cần dùng duy nhất một dd là A. C. D. BaCl2. H2SO4 đặc nóng B. dd BaCl2 và dd Br2. FeCl2. B.10 Để thu được Al(OH)3 từ hỗn hợp bột Al(OH)3. AgNO3. bari clorua. kali hiđroxit. chỉ cần dùng một thuốc thử duy nhất là A. Al. để nhận biết 4 chất lỏng trên. ta có thể dùng dd A.4 Để phân biệt 3 khí CO. axit sunfuric đặc. D. D. C.11 Có 4 ống nghiệm bị mất nhãn. B.C. Giấy quỳ tím và dd Ba(OH)2. C. HNO3 . B. Dùng 2 hoá chất nào trong các cặp hoá chất sau đây để có thể phân biệt được các dd trên? A. B.6 Có 5 dd đựng trong 5 lọ mất nhãn là FeCl3. D. MgO. Na2S. dd KOH. D.

Ba. chỉ một trong 4 dung dịch. Cu để chứng minh sự có mặt của các ion trong X. natri sunfat và thạch cao sống (CaSO4. Cl2 D. dd NaOH. cả 3 dung dịch. Câu 8. Kết luận đúng là A. Fe. B. NO3. D. D. Fe2+. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. D. Ag. C. C. D. Ba. CO2 B. P2O5. CaO. Cu và vài giọt dd H2SO4đặc. đun nóng. Dung dịch kiềm.ta nên dùng thuốc thử là A. dd BaCl2. Ag. Fe. C đều đúng Câu 8. dd AgNO3. B. Chỉ dùng thêm một hoá chất bên ngoài là dd H2SO4 loãng có thể nhận biết được tối đa bao nhiêu kim loại trong các dãy sau? A. Ag. Câu 8. X là A. HNO3 đặc nguội. D.18 Có 4 chất rắn riêng biệt gồm natri cacbonat. C. Ba. Br2 (Hơi) C. Cả A. Fe. B. 110 . Câu 8. Mg. dd FeCl2. Ag. NO3-. người ta ngâm mẫu bạc này vào một lượng dư dd A. Fe. Câu 8. B. C. AgNO3. H2SO4 loãng. Fe3+. C. Câu 8. Giấy quỳ tím và dd AgNO3. dd NaOH. ta có thể dùng A. Ca(OH)2. Fe.D. Để phân biệt 2 kim loại Al và Ag cần phải dùng A. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion.15 Cho các dd: AgNO3. Chỉ dùng H2O và một khí X có thể phân biệt được cả 4 chất. B. chỉ 2 trong 4 dung dịch. dd HCl. Câu 8.trong dd chứa các ion: NH4+. Ba. HCl. FeCl3 Câu 8. H2O.16 Có 5 mẫu kim loại Ba. CuSO4 khan. cả 4 dung dịch. Al.19 Dung dịch X có chứa các ion: NH4+. C. Mg. Fe3+. tuỳ thuộc vào trật tự tiến hành các thí nghiệm. Al. Ag. dd H2SO4. Có thể nhận biết 3 lọ trên bằng 1 thuốc thử duy nhất là A. đá vôi.14 Có 3 lọ đựng 3 chất bột riêng biệt: Al. Al2O3. Mg. Cu có trong mẫu Ag và không làm thay đổi lượng Ag. C. H2SO4 đặc nguội. giấy quỳ B. B. Một học sinh dùng các hoá chất dd NaOH.17 Để làm khô khí H2S.13 Để loại bỏ tạp chất Fe.12 Để chứng tỏ sự có mặt của ion NO3. D. vì Fe2+ và Fe3+ khi tác dụng với kiềm tạo kết tủa có màu sắc khác nhau. B.2H2O). HCl.

dd AlCl3. Câu 8. NaOH. dùng giấy quỳ tím trước. D. D. B. Câu 8. dd NH4Cl. giấy quỳ tím sau. D. C. Ba(OH)2. NaCl. Câu 8. Câu 8. C đều đúng. C. mỗi ống đựng 1 dd Na2CO3. (3) mẩu bông tẩm dd HCl đặc.20 Có 4 ống nghiệm mất nhãn. D. dùng AgNO3 trước. D. (1). Phương pháp đúng là A. (4). BaCl2. (1).28 Chỉ dùng Na2CO3 có thể phân biệt được mỗi dd trong dãy dd nào sau đây? A. (2).21 Để nhận biết trong thành phần của khí nitơ có lẫn tạp chất hiđroclorua. dd NH3. Ca(NO3)2. KNO3. (5) mẩu AgCl. dd muối Sắt(II) dư. Fe(NO3)3. (3) nước cất có vài giọt quỳ tím. NaCl. dd phenolphthalein. NaNO3. Fe(NO3)3. C đều được. (2) dd NaOH. C. B. dd muối sắt(III) dư. D.25 Chỉ dùng một dd làm thuốc thử để nhận biết các dd muối sau: Al(NO3)3. (NH4)2SO4. có thể dùng chất nào sau đây? A. MgCl2. Mg(NO3)2. C. D. (2) mẩu bông tẩm nước. (3). chỉ dùng AgNO3. B.27 Có 3 lọ mất nhãn chứa 3 dd riêng biệt HCl. dd NaOH. dd HCl. BaCl2. AgNO3. Hoá chất cần dùng và thứ tự thực hiện để nhận biết các chất đó là A. Câu 8. HCl. (4). B. HNO 3. D. C. Fe(NO3)3 và Cu(NO3)2 là A. Fe(NO3)2. MgCl2. (3). B. Cu. C. Các cách đúng là A. (5). AgNO3 sau. ta có thể dẫn khí qua: (1) dd bạc nitrat. C. C. Câu 8. FeCl2 thì chọn thuốc thử là A. Na2CO3. B. B. H2SO4 (loãng).24 Để thu được Al2O3 từ hỗn hợp bột Al2O3 và CuO mà khối lượng Al2O3 không thay đổi. Có thể dùng thuốc thử nào sau đây để nhận biết chúng? A. chỉ (1). CaCl2. Al(NO3)3. Cả A. MgSO4. dd AgNO3 dư. NaAlO2. (1). (1). Học sinh đó không chứng minh được sự tồn tại của Fe 2+ và Fe3+ vì chúng đều tạo kết tủa với kiềm. CO2 là: (1) dùng mẩu giấy quỳ tím ướt. C. (2). (4). cả A. Al. (3). Ba(NO3)2.22 Thuốc thử duy nhất dùng để nhận biết NH4NO3. Câu 8. NaNO3. (1). (1). AlCl3. NH4NO3. (2).23 Một học sinh đề nghị các cách để nhận ra lọ chứa khí NH3 lẫn trong các lọ riêng biệt chứa các khí N2.26 Tách Ag ra khỏi hỗn hợp bột gồm Ag. (3). Câu 8. MgCl2. Cl2. (3). dd CuCl2 dư. (1). D. Quỳ tím. Fe với khối lượng Ag không đổi. NaCl. (3). 111 . B. (3). (2). O2. (4) mẩu Cu(OH)2. chỉ cần dùng một hoá chất là A. B.D. (5). B. MgCl2. Câu 8. NaOH. (4) nước vôi trong.

NH3. ta dùng A. X là muối Pb(NO3)2. Câu 8. (NH4)2SO4.33 Để loại được H2SO4 có lẫn trong dd HNO3. khí (2) làm mất màu của giấy.Câu 8. người ta dùng dư hoá chất nào sau đây? A. Thuốc thử có thể dùng để nhận biết ba dd trên đơn giản nhất là A. khí (2) là Cl2. dd Ba(OH)2. dd NaOH đặc nóng và HCl. cả A. khí còn lại là N2. NaOH. dd NaOH. dd NaOH đặc nóng và CO2. C. SiO2 dùng cho sản xuất Al người ta dùng chất nào trong số các chất sau đây là tốt nhất? A. dd NaOH loãng và CO2. Kết luận sai là A. Câu 8. D. 112 . NH4Cl.31 Chỉ có giấy màu ẩm. Na. dd Ba(OH)2. Ca với axit H2SO4 đặc. D. dd H2SO4. (NH4)2SO4. lửa. Na. dd AgNO3 vừa đủ. dd H2SO4 đặc nguội. B. K2SO4. C. Ca mà khối lượng Al không thay đổi (giả sử phản ứng của Mg. B. C. kẽm sunfat. C. HNO3 đặc nguội. khí (1) là O2. NH4NO3. X là muối CuSO4.36 Chỉ dùng H2O có thể phân biệt được các chất trong dãy A. FeCl3. D. dd HClđặc. kali sunfit. AgNO3. quỳ tím ẩm. B. nguội không thay đổi đáng kể nồng độ và không sinh nhiệt)? A. D. Để xác định lọ đựng khí NH3 chỉ cần dùng thuốc thử duy nhất là A.35 Chỉ dùng một thuốc thử duy nhất nào sau đây để phân biệt hai khí SO2 và CO2? A. X là muối CuSO4. CuSO4. dd HCl. C.29 Để thu được Ag tinh khiết từ hỗn hợp bột Ag-Fe. Na. Cl2. BaCl2. khí (1) là O2. AgNO3.32 Có ba dd kali clorua. N2. dd BaCl2. H2S và Cl2 do có hiện tượng: khí (1) làm tàn lửa cháy bùng lên. NH4Cl. dd NaOH. D. H2O. dd Br2. dd Ca(OH)2 vừa đủ. B. D. O2. K. Mg. NH4Cl. Na. C. NH4NO3. Câu 8. dd Ca(OH)2 . khí (3) là Cl2.30 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là (NH4)2SO4. Câu 8. K. dd HCl. chỉ cần dùng dd A. Ba(OH)2. Ba. Ba. B. và giấy tẩm dd muối X người ta có thể phân biệt 4 lọ chứa khí riêng biệt O2. KOH. C. D. Câu 8. Câu 8. D. D. NH4Cl. C. NH4NO3.37 Chỉ dùng duy nhất một dd nào sau đây để tách lấy riêng Al ra khỏi hỗn hợp Al. C. giấy quỳ tím.34 Có 5 lọ đựng riêng biệt các khí sau: N2. B.B. B.38 Để làm sạch quặng boxit thường có lẫn Fe2O3. dd H2SO4 loãng. D. Câu 8. để nhận biết 4 chất lỏng trên. B đều đúng. dd NaOH loãng và dd HCl. dd Ba(NO3)2 vừa đủ. B. C. B. Câu 8. CO2. Câu 8. khí (3) làm giấy có tẩm dd muối X hoá đen.

dd HCl.2 B 8.7 A 8. D. C. dd KOH. Na2CO3. B. B.Câu 8. D. Al.42 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH.27 D A 113 . Zn. BaCO3. AgNO3. Mg(NO3)2. B.12 D 8.39 Cho các dd: FeCl3.26 C 8. dd CH3COOAg.29 B 8. chỉ cần dùng giấy quỳ tím.40 Đốt cháy Fe trong clo dư thu được chất X. quỳ tím Câu 8.30 A 8. ĐÁP ÁN 8. H2SO4 thì chọn A. B. và hỗn hợp NaNO3 và KHSO4. dd H2SO4 và dd AgNO3. NH3.1 B 8.16 B 8. 3.15 A 8. Câu 8.10 A 8. B.17 8.19 C 8. A. D. K2CO3. B. BaCl2. BaCl2.8 A 8. nguội. LiNO3 (đều có nồng độ khoảng 0. C.43 “Để phân biệt các dd riêng biệt gồm NaCl. quỳ tím. 2. không cần dùng bất kể hoá chất nào. C. NaOH và O2. dd H2SO4 và dd BaCl2. dd HNO3 và dd Ba(OH)2. Số dd không hoà tan được đồng kim loại là A. D. Câu 8. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. B. dd HCl. 1.9 B 8.20 D 8.18 D 8. C. FeCl2. Thuốc thử để phân biệt các dd đó là A. HCl. Câu 8. chì clorua.13 D 8. Mg và Al 2O3.14 8. Câu 8.21 C 8.25 B 8. nung sắt với lưu huỳnh thu được chất Y.23 C 8.45 Nếu chỉ dùng một thuốc thử duy nhất để phân biệt 3 dd NaOH.28 D 8. D. chỉ cần dùng một chất duy nhất là A.3 C 8. bari hiđroxit. Y có thể dùng hoá chất nào sau đây? A. NaNO3. H2O. natri hiđroxit.11 D 8. D. C. C. dd BaCl2. H2SO4. Để xác định thành phần cấu tạo và hoá trị các nguyên tố trong X. B. D. axit sunfuric. Câu 8. CuSO4.6 C 8.24 C C 8. C.44 Có các dd Al(NO3)3.41 Để nhận biết 4 dd: Na2SO4. thuốc thử được chọn là A. dd HNO3 đặc. cả A.4 A 8. 4.22 D 8. H2SO4. C đều đúng. Hãy chọn đáp án để nối thêm vào phần còn trống sao cho kết luận trên luôn đúng.5 D 8. dd NaOH.1M) bị mất nhãn. KOH ta có thể …”. chỉ cần Fe kim loại.

32 C 8. 2. năng lượng thuỷ triều… . dầu.34 A 8. sinh học mới ngày càng cao. MÔI TRƯỜNG A.45 D 8. nhu cầu của nhân loại về các vật liệu mới với những tính năng vật lí và hoá học. .Khai thác và sử dụng năng lượng hoá thạch còn là một trong những nguyên nhân chủ yếu gây nên ô nhiễm môi trường và làm thay đổi khí hậu toàn cầu. .Sản xuất ra chất thay cho xăng từ nguồn nguyên liệu vô tận là không khí và nước.Năng lượng điện hoá trong pin điện hoá hoặc acquy.44 B 8.Các nguồn năng lượng. .MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Vấn đề năng lượng và nhiên liệu * Vấn đề về năng lượng và về nhiên liệu đang đặt ra cho nhân loại hiện nay là : .Vật liệu có nguồn gốc vô cơ. * Hoá học đã góp phần giải quyết vấn đề về vật liệu như thế nào? . Như : .8.33 A 8.36 A 8.Vật liệu có nguồn gốc hữu cơ. năng lượng mặt trời. khí tự nhiên… không phải là vô tận mà có giới hạn và ngày càng cạn kiệt. năng lượng gió. nhiên liệu hoá thạch như dầu mỏ. XÃ HỘI.39 C 8. HOÁ HỌC VÀ VẤN ĐỀ PHÁT TRIỂN KINH TẾ.42 D 8.Điều chế etanol từ crackinh dầu mỏ để thay thế xăng.43 A 8.41 B 8. năng lượng địa nhiệt. Vấn đề vật liệu * Vấn đề về vật liệu đang đặt ra cho nhân loại là gì ? Cùng với sự phát triển của các ngành kinh tế và khoa học kĩ thuật. * Hoá học đã góp phần giải quyết vấn đề năng lượng và nhiên liệu như thế nào trong hiện tại và tương lai? Hoá học đã nghiên cứu góp phần sản xuất và sử dụng nguồn nhiên liệu. .31 B 8. .38 D 8.Điều chế khí metan trong lò biogaz. .Sản xuất khí than khô và khí than ướt từ than đá và nước.Năng lượng thuỷ điện.Vật liệu mới: 114 .40 B CHƯƠNG IX. . .35 C 8.Năng lượng được sản sinh ra trong các lò phản ứng hạt nhân được sử dụng cho mục đích hoà bình. than đá.37 A 8. năng lượng nhân tạo thay thế.

* Hoá học góp phần giải quyết vấn đề may mặc của nhân loại như : . chất ma tuý và cách phòng chống ma tuý (dưới dạng những viên thuốc tân dược. 4.Sản xuất nhiều loại phẩm nhuộm. động vật: . . . .Dân số thế giới ngày càng tăng.Vật liệu nano (còn gọi là vật liệu nanomet) . vì vậy tơ sợi tự nhiên không thể đáp ứng đủ nhu cầu về số lượng cũng như chất lượng.Vấn đề vi phạm vệ sinh an toàn thực phẩm. phát triển thực vật.Sản xuất các loại phân bón hoá học. Hoá học và vấn đề may mặc * Vấn đề may mặc đang đặt ra cho nhân loại hiện nay là : .Nghiên cứu ra các loại vacxin. * Chất gây nghiện. Hoá học và vấn đề sức khỏe con người * Dược phẩm . . 4. . .Diện tích trồng trọt ngày càng bị thu hẹp.Góp phần sản xuất ra tơ.Góp phần nghiên cứu thành phần hoá học của một số dược liệu tự nhiên. . . * Hoá học đã góp phần giải quyết vấn đề về lương thực.… . . .Phòng chống những căn bệnh. sợi hoá học có nhiều ưu điểm nổi bật. . 3.Tổng hợp hoá chất có tác dụng diệt trừ cỏ dại.Nhu cầu của con người không chỉ mặc ấm. bột trắng dùng để hít.Thuốc bổ dưỡng cơ thể.Vật liệu compozit.Thuốc tránh thai.Tổng hợp hoá chất diệt nấm bệnh. .Sản xuất những hoá chất bảo quản lương thực và thực phẩm. nạn dịch của thế kỉ. .. thực phẩm đang đặt ra thách thức lớn cho nhân loại hiện nay . hợp thời trang.Dân số thế giới gia tăng không ngừng.Nghiên cứu chế biến thức ăn tổng hợp.Các vật liệu cơ bản để chế tạo các thiết bị chuyên dụng trong các nhà máy dệt và trong ngành dệt may. 115 .Vật liệu quang điện tử. Hoá học và vấn đề thực phẩm * Vấn đề lương thực. thực phẩm cho nhân loại như : nghiên cứu và sản xuất các chất hoá học có tác dụng bảo vệ. viên để uống. mà còn mặc đẹp. dung dịch để tiêm chích).

Câu 9. các chất hữu cơ tổng hợp. Than đá. mưa axit. các vi sinh vật gây bệnh. máy đo pH. Khí butan (gaz) D. B. 4. NH3. 116 . hô hấp.. C. chất độc hoá học. Lên men các chất thải hữu cơ như phân gia súc trong lò biogaz. Nhiên liệu nào sau đây thuộc loại nhiên liệu sạch đang được nghiên cứu sử dụng thay thế một số nhiên liệu khác gây ô nhiễm môi trường ? A. … * Ô nhiễm không khí Không khí bị ô nhiễm thường có chứa quá mức cho phép nồng độ các khí CO2. CH4 và một số khí độc khác. . như rối loạn tiêu hoá. rối loạn tuần hoàn. Tiêm chích ma tuý có thể gây trụy tim mạch dễ dẫn đến tử vong. sắc kí. * Nhận biết môi trường bị ô nhiễm a) Quan sát qua mùi. các chất phóng xạ.… * Ô nhiễm nước Nước ô nhiễm thường có chứa các chất thải hữu cơ. nước) gây suy giảm sức khỏe của con người. sử dụng chúng như là một loại thuốc chữa bệnh. hiệu ứng nhà kính. làm diệt vong một số loại sinh vật. chất có hại cho cây trồng vượt quá nồng độ được quy định. các hoá chất vô cơ.Luôn nói không với ma tuý. B. SO2. Xăng. sinh lí.Nghiện ma tuý sẽ dẫn đến rối loạn tâm.… * Ô nhiễm môi trường đất Đất bị ô nhiễm có chứa độc tố. bụi. dầu.Hoá học đã nghiên cứu ma tuý. rối loạn chức năng thần kinh. B. gây thay đổi khí hậu toàn cầu. thí dụ CO.2. màu sắc. * Vai trò của hoá học trong việc xử lí chất ô nhiễm Xử lí ô nhiễm đất. Thu khí metan từ khí bùn ao.1. các chất dinh dưỡng thực vật. c) Bằng dụng cụ đo : nhiệt kế.… Thí dụ : hiện tượng thủng tầng ôzôn. .… một số vi khuẩn gây bệnh. Người ta đã sản xuất khí metan thay thế một phần cho nguồn nguyên liệu hoá thạch bằng cách nào sau đây ? A. Khí hiđro. nước.BÀI TẬP TRẮC NGHIỆM Câu 9.… b) Xác định chất ô nhiễm bằng các thuốc thử. đất. Hoá học và vấn đề ô nhiễm môi trường Tác hại của ô nhiễm môi trường (không khí. HCl. không khí dựa trên cơ sở khoa học hoá học có kết hợp với khoa học vật lí và sinh học.

Trường hợp nào sau đây được coi là nước không bị ô nhiễm ? A. Cách bảo quản thực phẩm (thịt. C. chứa các ion : Cu2+.7. 2% hỗn hợp CO2. B.C. Panadol. Không khí chứa 78% N2. Dùng phân đạm. H2O. đó là : A. Câu 9. Nước ruộng lúa chứa khoảng 1% thuốc trừ sâu và phân bón hoá học. D. nước đá.8. B. D. Năng lượng gió. Năng lượng mặt trời. C. Cho hơi nước đi qua than nóng đỏ trong lò. dùng nước đá khô. Một trong những hướng con người đã nghiên cứu để tạo ra nguồn năng lượng nhân tạo to lớn để sử dụng cho mục đích hoà bình. SO2.9. Câu 9. B. Lên men ngũ cốc. 20% O2. C. H2. 117 . Penixilin. Câu 9. Hg2+. sắt…quá mức cho phép. nước đá. Loại thuốc nào sau đây thuộc loại gây nghiện cho con người ? A. Ni2+. CH4. NH3. Nước vôi dư. B. H2. C. Khí nào sau đây gây ra hiện tượng mưa axit ? A. 6% hỗn hợp CO2. Nước thải từ các bệnh viện. D. Không khí chứa 78% N2. Dùng nước đá hay ướp muối rồi sấy khô. Dùng fomon. D. Hg2+…Dùng chất nào sau đây để xử lí sơ bộ các chất thải trên ? A. C. Amoxilin. Fe3+. Năng lượng thuỷ điện. Không khí chứa 78% N2. Không khí chứa 78% N2.3. B. CH4 và bụi. Câu 9.6. Câu 9. 16% O2. 4% hỗn hợp CO2. khu vệ sinh chứa các khuẩn gây bệnh. Nước từ các nhà máy nước hoặc nước giếng khoan không chứa các độc tố như asen. Thuốc cảm Pamin. 18% O2. Pb2+. Zn2+. HNO3. trong một số chất thải dạng dung dịch. Seđuxen. Nước thải nhà máy có chứa nồng độ lớn các ion kim loại nặng như Pb2+. 1% hỗn hợp CO2. D. Trường hợp nào sau đây được coi là không khí sạch ? A. Câu 9. C. D.4. H2. B. C. HCl. D. fomon. Etanol. Vitamin C. moocphin. 21% O2. Giấm ăn. Câu 9. Cd2+. Sau bài thực hành hoá học. H2O.5. B. Năng lượng hạt nhân. cá…) bằng cách nào sau đây được coi là an toàn ? A. D. H2O. glucozơ.

Trong công nghệ xử lí khí thải do quá trình hô hấp của các nhà du hành vũ trụ hay thuỷ thủ trong tàu ngầm người ta thường dùng hoá chất nào sau đây ? A. Câu 9.6 A 9. 1. Hiệu suất của quá trình là 80%.7 D 9. 5. 3. D. Có thể điều chế Ancol etylic bằng 2 cách sau : . Khí lò cao.0257 mg/l. .12. Nhiều loại sản phẩm hoá học được điều chế từ muối ăn trong nước biển như : HCl. Câu 9. B.Câu 9. Để đánh giá độ nhiễm bẩn không khí của một nhà máy. Ancol etylic là sản phẩm trung gian từ đó sản xuất được cao su nhân tạo. D. 0. B. 0. 1.30 tấn.15.1 D 118 9. C. Câu 9.0 tấn. người ta tiến hành như sau : Lấy 2 lít không khí rồi dẫn qua dung dịch Pb(NO 3)2 dư thì thu được 0. C. B.422 tấn. 8. A. NH3. H2S. A.422 tấn.5 C 9.2 tấn.2 tấn.3 tấn. CO2.14. C.3 D 9. C. Câu 9. SO2.0125 tấn. Na2CO3.15 tấn nguyên liệu chứa 80% CuS. KClO3 rắn. C. (Nên biết thêm : hàm lượng cho phép là 0.0250 mg/l. b. 12. Biết rằng hao hụt trong quá trình sản xuất là 25%. C.4 tấn.Cho lên men các nguyên liệu chứa tinh bột.8 A .11. A. Khí tự nhiên. B. B. B. tơ sợi tổng hợp.4 C 9. NaOH rắn. Hãy tính lượng ngũ cốc chứa 65% tinh bột để sản xuất được 2.422 tấn.Cho khí etilen (lấy từ cracking dầu mỏ) hợp nước có xúc tác. 17.3585 mg chất kết tủa màu đen.0225 mg/l. NaOH. Chất khí CO (cacbon monoxit) có trong thành phần loại khí nào sau đây ? A. Than hoạt tính. C. D.2 A 9. a. Tính khối lượng NaCl cần thiết để sản xuất 15 tấn NaOH. coi hiệu suất phản ứng là 100%. Hãy cho biết hiện tượng đó chứng tỏ trong không khí đã có khí nào trong các khí sau đây ? A.55 tấn.01 mg/l). Tính hàm lượng khí đó trong không khí. Có thể điều chế thuốc diệt nấm 5% CuSO4 theo sơ đồ sau : CuS → CuO → CuSO 4 . B. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IX 9. A. 4.56 tấn. 0.3 tấn ancol etylic.10. D.13. 15. D. nước Gia-ven. 27. Khí dầu mỏ. 0. D. Na2O2 rắn. Không khí. 1. Tính khối lượng dung dịch CuSO4 5% thu được từ 0. Biết hiệu suất của quá trình là 80%. D. 2.0253 mg/l. Câu 9.

9.12 D 9.a 9.14 C 9.b A C 119 .9. C 9.13 B 9.11 A 9.15.10 D 9.15.

Sign up to vote on this title
UsefulNot useful