P. 1
On thi hoa hoc lop 12

On thi hoa hoc lop 12

|Views: 1,316|Likes:
Được xuất bản bởiNgoc Phu Nguyen

More info:

Published by: Ngoc Phu Nguyen on Feb 28, 2011
Bản quyền:Attribution Non-commercial

Availability:

Read on Scribd mobile: iPhone, iPad and Android.
download as DOC, PDF, TXT or read online from Scribd
See more
See less

07/19/2013

pdf

text

original

HÓA HỌC 12

• • • • • • • • • Chương 1: Este – Lipit Chương 2: Cacbohidrat Chương 3: Amin – Amino axit – Protein Chương 4: Polime – Vật liệu polime Chương 5: Đại cương về kim lọai Chương 6: Kim lọai kiềm – Kim lọai kiềm thổ - Nhôm Chương7: Sắt và một số kim lọai quan trọng Chương 8: Phân biệt một số chất vô cơ Chương 9: Hóa học và vấn đề phát triển kinh tế, xã hội và môi trường

TÀI LIỆU LƯU HÀNH NỘI BỘ

CHƯƠNG I. ESTE - LIPIT A- MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Khái niệm về dẫn xuất của axit cacboxylic - Dẫn xuất của axit cacboxylic là những sản phẩm tạo ra khi thay thế nhóm hiđroxyl -OH trong nhóm cacboxyl -COOH bằng nguyên tử hay nhóm nguyên tử khác: -COOH → -COZ (với Z: OR', NH2, OCOR, halogen, …) - Este là dẫn xuất của axit cacboxylic. Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR' thì được este. - Halogenua axit (quan trọng nhất là clorua axit RCOCl). Để tạo ra halogenua axit có thể dùng các tác nhân như PCl5 (photpho pentaclorua), PCl3 (photpho triclorua), COCl2 (photgen), SOCl2 (thionyl clorua), … RCOOH + PCl5 → RCOCl + POCl3 + HCl 3RCOOH + PCl3 → 3RCOCl + H3PO3 RCOOH + SOCl2 → RCOCl + SO2 + HCl RCOOH + COCl2 → RCOCl + CO2 + HCl - Anhiđrit axit, có 2 loại: đối xứng (dạng (RCO)2O hoặc (ArCO)2O; gọi tên bằng cách thay từ axit bằng anhiđrit (CH3CO)2O là anhiđrit axetic), và không cân đối (sinh ra từ hai axit monocacboxylic khác nhau như CH3CO-O-OCC6H5; gọi tên bằng từ anhiđrit cộng với tên của hai axit - anhiđrit axetic benzoic). Để tạo thành anhiđrit axit có thể sử dụng nhiều phương pháp khác nhau như dùng tác nhân hút nước P2O5 hay tác dụng của nhiệt, … 2. Công thức tổng quát của este a/ Trường hợp đơn giản: là este không chứa nhóm chức nào khác, ta có các công thức như sau :
- Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đơn chức R'OH: RCOOR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đơn chức R'OH: R(COOR')a. - Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đa chức R'(OH)b: (RCOO)bR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đa chức R'(OH)b: Rb(COO)abR'a. Trong đó, R và R' là gốc hiđrocacbon (no, không no hoặc thơm); trường hợp đặc biệt, R có thể là H (đó là este của axit fomic H-COOH).

b/ Trường hợp phức tạp: là trường hợp este còn chứa nhóm OH (hiđroxi este) hoặc este
còn chứa nhóm COOH (este - axit) hoặc các este vòng nội phân tử … Este trong trường hợp này sẽ phải xét cụ thể mà không thể có CTTQ chung được. Ví dụ với glixerol và axit axetic có thể có các hiđroxi este như HOC 3H5(OOCCH3)2 hoặc (HO)2C3H5OOCCH3; hoặc với axit oxalic và metanol có thể có este - axit là HOOC-COOCH3.

c/ Công thức tổng quát dạng phân tử của este không chứa nhóm chức khác Nên sử dụng CTTQ dạng C n H 2n + 2 −2∆ O2a (trong đó n là số cacbon trong phân tử este n ≥ 2, nguyên; ∆ là tổng số liên kết π và số vòng trong phân tử ∆ ≥ 1, 2

nguyên; a là số nhóm chức este a ≥ 1, nguyên), để viết phản ứng cháy hoặc thiết lập công thức theo phần trăm khối lượng của nguyên tố cụ thể. 3. Tính chất hoá học của este a/ Phản ứng thuỷ phân este Tính chất hoá học quan trọng nhất của este là phản ứng thuỷ phân. Sơ đồ thuỷ phân este (về cơ bản, chưa xét các trường hợp đặc biệt) là :

C

O

+H

OH

H +, t o

C O

H

+

OH

O O (este) (nước) (axit) (ancol) Thuỷ phân chính là quá trình nghịch của của phản ứng este hoá.
Phản ứng thuỷ phân có thể xảy ra trong môi trường axit hoặc môi trường bazơ. - Phản ứng thuỷ phân trong môi trường kiềm được gọi là phản ứng xà phòng hoá. Đặc điểm của phản ứng thuỷ phân este: - Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Sản phẩm của phản ứng trong điều kiện này luôn có axit cacboxylic. Để chuyển dịch cân bằng về phía tạo axit và ancol, ta dùng lượng dư nước.

- Phản ứng thuỷ phân este không những thuận nghịch mà còn rất chậm. Để tăng tốc độ phản ứng thuỷ phân ta đun nóng hỗn hợp phản ứng với với chất xúc tác axit (H2SO4, HCl…). - Phản ứng xà phòng hoá chỉ xảy ra một chiều, sản phẩm thu được luôn có muối của axit cacboxylic.

C O

+ OH-

to

C
(muối)

O-

+

OH

(este) (kiềm) O b/ Phản ứng của gốc hiđrocacbon

O (ancol, phenol, anđehit …)

Este không no (este của axit không no hoặc ancol không no) có khả năng tham gia phản ứng cộng và phản ứng trùng hợp – đây là tính chất do liên kết π quy định (tương tự như hiđrocacbon tương ứng). Một số phản ứng thuộc loại này có ứng dụng quan trọng là : - Phản ứng chuyển hoá dầu (chất béo lỏng) thành mỡ (chất béo rắn)
Ni, t , p (C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5 (Triolein) (Tristearin) - Phản ứng trùng hợp vinyl axetat thành poli(vinyl axetat)
0

nCH2

CH OCOCH3

xt, to, p

CH CH2 n OCOCH3

- Trùng hợp metyl metacrylat thành poli(metyl metacrylat) – thuỷ tinh hữu cơ plexiglas).

3

Este vòng (được tạo bởi hiđroxi axit) CH 3 CH C O • Este + NaOH  Có MSP = MEste + MO → NaOH R C O O Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi 4 . Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : • Este + NaOH  1 muối + 1 anđehit → Este đơn chức có gốc ancol dạng công thức R-CH=CHThí dụ CH3COOCH=CH-CH3 • Este + NaOH  1 muối + 1 xeton → Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân.axit : HOOC-R-COOR’ • Este + NaOH  2 muối + H2O → Este của phenol: C6H5OOC-R • Este + NaOH  1 muối + anđehit + H2O → Hiđroxi.Phản ứng tráng gương của este của axit fomic– (xem lại anđehit).este: RCOOCH(OH)-R’ • Este + NaOH  1 muối + xeton + H2O → Hiđroxi. 4. hoặc nữa là do cấu tạo bất thường của este gây nên. Một số phản ứng thuỷ phân đặc biệt của este Căn cứ vào sơ đồ phản ứng xà phòng hoá hay phản ứng thuỷ phân este ta có thể căn cứ vào sản phẩm tạo thành để suy đoán cấu tạo của este ban đầu. • Este + NaOH  1 muối + 1 ancol + H2O → Este. tuỳ thuộc vào việc nhóm – OH đính vào gốc hiđrocacbon có cấu tạo như thế nào mà sẽ có các phản ứng tiếp theo xảy ra để có sản phẩm cuối cùng hoàn toàn khác nhau. Phản ứng khử este bởi líti-nhôm hiđrua LiAlH4 thành ancol bậc I 1) LiAlH 4 → RCOOR'  RCH2OH + R'OH 2) H3O + (Chú ý: anhiđrit axit.nCH2 CH COOCH3 xt. p CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) CH3 metyl metacrylat . halogenua axit cũng bị líti-nhôm hiđrua khử tương tự). 5.este: RCOOC(R)(OH)-R’ • Este + NaOH  1 sản phẩm duy nhất → hoặc “m RẮN = mESTE + mNaOH”. to. Không nhất thiết sản phẩm cuối cùng phải có ancol.

anhiđrit axit.t  → RCOOH + R'OH ← RCOOR' + H2O  + 0 . 5 . Ví dụ: phản ứng tạo phenyl axetat (CH3CO)2O + C6H5OH  CH3COOC6H5 + CH3COOH → CH3COCl + C6H5OH  CH3COOC6H5 + HCl → c/ Phản ứng cộng vào hiđrocacbon không no của axit cacboxylic Ví dụ: phản ứng tạo vinyl axetat xt.Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử C (thường từ 12C đến 24C) không phân nhánh.đơn giản nhất. t 0 CH3COOH + CH≡ CH  CH3COOCH=CH2 → d/ Phản ứng ankyl halogenua và muối bạc hay cacboxylat của kim loại kiềm RCOOAg + R'I → RCOOR' + AgI RCOONa + R′ I → RCOOR' + NaI 7.Lipit là những hợp chất hữu cơ có trong tế bào sống. Khi thuỷ phân chất béo thì thu được glixerol và axit béo. Lipit . các em chỉ được vận dụng khi không có dấu hiệu cho phép xác định cụ thể số nhóm chức este trước đó. sáp. …hầu hết chúng đều là các este phức tạp. gọi chung là triglixerit. t CH3 CH C O + NaOH CH3 CH C ONa O Chú ý các kết luận in nghiêng ngay dưới mỗi trường hợp trênO chỉ là một thí dụ OH đây o 6. sterit. .Khi đun nóng chất béo với dung dịch kiềm thì tạo ra glixerol và hỗn hợp muối của các axit béo. Phản ứng xà phòng hoá xảy ra nhanh hơn phản ứng thuỷ phân trong môi trường axit và không thuận nghịch. . . Lipit bao gồm chất béo.Phản ứng của ancol với axit cacboxylic (xem axit). tạo ra este. Muối natri (hoặc kali) của các axit béo chính là xà phòng. Một số phương pháp điều chế este a/ Phản ứng của ancol với axit cacboxylic và dẫn xuất như clorua axit. . photpholipit.Phản ứng của ancol với anhiđrit axit hoặc clorua axit thì phản ứng xảy ra nhanh hơn và một chiều (không thuận nghịch như khi tác dụng với axit) (CH3CO)2O + C2H5OH  CH3COOC2H5 + CH3COOH → CH3COCl + C2H5OH  CH3COOC2H5 + HCl → b/ Phản ứng của phenol với anhiđrit axit hoặc clorua axit (phenol không tác dụng với axit cacboxylic) tạo este của phenol. H . Phản ứng của chất béo với chất kiềm được gọi là phản ứng xà phòng hoá.Chỉ số axit: là số mg KOH cần để trung hoà axit béo tự do có trong 1g chất béo.

. R-Cl + KCN → R-CN + KCl 13. H + 0 0 15. t 0 8.Chỉ số xà phòng hoá là tổng số mg KOH cần để xà phòng hoá glixerit và trung hoà axit béo tự do có trong 1g chất béo. t0 18. C3H5(OOC R )3 + 3NaOH  3 R COONa + C3H5(OH)3 → H+ .MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP t 1. (CH3)2C(OH)CN + 2H2O → (CH3)2C(OH)COOH + NH3↑ 12. RCOOCH=CH2 + NaOH  RCOONa + CH3CHO → 0 t 2.. CH3COONa(r) + NaOH(r)  CH4 + Na2CO3 → photpho. R-CN + 2H2O → R-COOH + NH3↑ 1) O 2 → 14. bR(COOH)a + aR'(OH)b ← Rb(COO)abR'a + abH2O  t 5. Xà phòng và chất tẩy rửa tổng hợp B . CH3CH2COOH + Br2  CH3CHBrCOOH + HBr → 10. RCOOC(CH3)=CH2 + NaOH  RCOONa + CH3COCH3 → 6 . 3CH3COOH + POCl3  3CH3COCl + H3PO4 → CaO. RCOOC6H5 + 2NaOH  RCOONa + C6H5ONa + H2O → t0 3.Chỉ số iot: là số gam iot có thể cộng hợp vào các liên kết bội có trong 100g chất béo. (C17H35COO)3C3H5 + 3KOH  C17H35COOK + C3H5(OH)3 → 6. CH3-CO-CH3 + HCN → (CH3)2C(OH)CN 11. RCOONa + HCl (dd loãng) → RCOOH + NaCl t0 16. t0  → 4. CxHy(COOM)a + O2  M2CO3 + CO2 + H2O → (sơ đồ phản ứng đốt cháy muối cacboxylat). t 0 9. C6H5-CH(CH3)2  C6H5OH + CH3COCH3 2) H 2 O. 2CH3COONa(r) + 4O2  Na2CO3 + 3CO2↑ + 3H2O → t0 17. 8. 3CH3COOH + PCl3 → 3CH3COCl + H3PO3 t0 7.

(2). Câu 1. B. (1) và (4). (4).. (1). b/ (1) tạo sản phẩm axit. (3) Để điều chế este của phenol không dùng axit cacboxylic để thực hiện phản ứng với phenol. với n ≥ 2 . 4. a. (1). (1). C. (1). (5). (2) metyl propionat. có thể thu được este có tên là A. 3. (1). (2). D. (3). Nhận xét đúng là A. C. D. Etyl fomiat. b. do đó làm tăng hiệu suất tạo este. (2). (3).7 Phản ứng thuỷ phân của este trong môi trường axit (1) và môi trường bazơ (2) khác nhau ở các điểm : a/ (1) thuận nghịch. (4). B.1 Khi đun hỗn hợp gồm etanol và axit axetic (có mặt H2SO4 đặc làm xúc tác). (3). C.6 Ứng với công thức phân tử C4H8O2. B. đơn chức. D.4 Hỗn hợp X gồm 2 este mạch hở E (C5H6O4) và F (C4H6O2). Các tên gọi đúng ứng với este có thể có của công thức phân tử đã cho là A. Các nhận định đúng là A. (2). Etyl axetic. (5) isopropyl fomiat. (5). (5). (1). (2). C. (4). (3) metyl iso-propylonat. (3).2 Có các nhận định sau : (1) Este là sản phẩm của phản ứng giữa axit và ancol. c/ (1) cần đun nóng. D. Các nhận định đúng gồm A. (3) Este no. a. Câu 1. (4). c. (5). còn (2) chỉ một chiều. 14. (2) Không thể điều chế được vinyl axetat bằng cách đun sôi hỗn hợp ancol và axit có axit H2SO4 đặc làm xúc tác. thu chất rắn Y. Đietyl ete. sẽ tồn tại các este với tên gọi : (1) etyl axetat. (5) Sản phẩm của phản ứng giữa axit và ancol là este. C. (4) Phản ứng este hoá là phản ứng thuận . HOOC – CH2 – COO – CH = CH2 và CH3 – COO – CH = CH2. chỉ (4). (1). (4). còn (2) không cần đun nóng. axit sunfuric vừa làm xúc tác vừa có tác dụng hút nước. mạch hở có công thức phân tử CnH2nO2 . và (4). Nung Y với NaOH (có mặt CaO) thì được một chất khí là CH4.3 Xét các nhận định sau: (1) Trong phản ứng este hoá. Vậy công thức cấu tạo của E và F là A. (1). B. (4). D. sau đó cô cạn dung dịch. Câu 1. (5).5 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit benzoic là A. (4) Hợp chất CH3COOC2H5 thuộc loại este. Câu 1. (3). a. D. 7 . B. (2). 15. (4). (4). C. (2) Este là hợp chất hữu cơ trong phân tử có nhóm – COO. (2). Câu 1.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 1. B.C. Etyl axetat. c. Câu 1. D. (3). (4). HOOC–CH = CH– COO–CH3 và CH3–OOC – CH = CH2. (3). b. c. HOOC – CH = CH – COO – CH3 và CH2 = CH – COO – CH3. Đun hỗn hợp X với dung dịch NaOH dư. B. (3). HOOC – COO – CH2 – CH = CH2 và H – COO – CH2 – CH = CH2. (5). C. b.nghịch. còn (2) tạo sản phẩm muối. (3). (4) propyl fomiat.

18. (4) phản ứng oxi hóa. Câu 1. (2) Chất béo không tan trong nước. RCOOR’. phenyl axetat. Công thức đã viết đúng là A.Câu 1. (3) phản ứng thuỷ phân. (4). (3) (HO)2C3H5OOCR. (3). CH3COOC2H5 D. Công thức cấu tạo của X là A.16 Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. 8 . (2).15 Este mạch hở. (3) Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. Câu 1.10 Este của glixerol với axit cacboxylic (RCOOH) được một số học sinh viết như sau: (1) (RCOO)3C3H5. 6. CnH2n . B. D. D. CnH2n + 1COOCmH2m +1. B. D. C. Câu 1. CnH2n – 2O2. ba chức là A. (1). đơn chức chứa 50%C (về khối lượng) có tên gọi là A. C. metyl benzoat.18O12. (2). D. (1). (2). metyl axetat. (3). C. phenyl fomiat. Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức C2H3O2Na. (4). CnH2n . B. (2) phản ứng cộng. C. D.12 Trong số các phản ứng có thể có của este gồm: (1) phản ứng trùng hợp. (5) C3H5(COOR)3. (2) (RCOO)2C3H5(OH).10O6. D. C. (3) và (4). CnH2n -16O12. phản ứng đặc trưng cho mọi este là A.13 Những phát biểu sau đây : (1) Chất béo không tan trong nước. 8. D. Các phát biểu đúng là A. CnH2n+2O2.8 Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là A. (1). Câu 1. (3). Câu 1. CnH2n – 2O2. B. C.6O4. (4) (ROOC)2C3H5(OH). (4). vinyl fomiat. (1). HCOOC3H7 B. CnH2n . C. Số lượng công thức cấu tạo của các trieste có thể có trong loại sơn nói trên là A. B. (3). 12. vinyl axtetat. HCOOC3H5. CnH2nO2. (2). D. B. X có tên gọi là A. CnH2nO2. C. (4). B.14 Trong thành phần của một số loại sơn có trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. (1). (4) Chất béo là este của glixerol và axit hữu cơ.17 Chất X có công thức phân tử C4H8O2.11 Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi. D.9 Công thức tổng quát của este tạo bởi một axit cacboxylic no đơn chức và một ancol no đơn chức (cả axit và ancol đều mạch hở) là A. chỉ có (1). benzyl fomiat. Câu 1. (5). B. Câu 1. Câu 1. (2). B. C2H5COOCH3 C. Rb(COO)abR’a. nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. Câu 1. (1). (4). C. etyl axetat. chỉ có (5).

Metyl acrylat.2 mol este tạo thành. Câu 1. y = 1. (3) metyl metacrylat. chỉ có (1). 1.Câu 1.19 Trong số các este: (1) metyl axetat. Câu 1.20 Số nguyên tử cacbon tối thiểu trong phân tử este không no. B. y = 0. 0.18 Khi đun hỗn hợp 2 axit R1COOH và R2COOH với glixerol (axit H2SO4 làm xúc tác) có thể thu được mấy trieste ? A. C. (1).05. natri kim loại. D. 2.00. 4. một học sinh gọi tên các đồng phân este có thể có gồm: (1) etyl fomiat. (3) iso propyl fomiat. C.22 Đun nóng hỗn hợp gồm x mol axit axetic và y mol etylen glicol (xt H2SO4 đặc). 1. este mà polime của nó được dùng để sản xuất chất dẻo gồm A. 2. 2. D. y = 0. x = 1.75. Ở nhiệt độ đó hằng số cân bằng Kc của phản ứng este hoá là A. (2) metyl axetat. Khi đạt trạng thái cân bằng trong hỗn hợp có 1. 5. D. 18.30 mol axit.26 Cho 2 mol CH3COOH thực hiện phản ứng este hoá với 3 mol C2H5OH. 4.25 Tên gọi của este (được tạo nên từ axit và ancol thích hợp) có công thức phân tử C4H6O2 là A. x = 1. (1). (2) và (3). Câu 1.4. D. 1. Câu 1.24 Ứng với công thức phân tử C3H6O2. (1) và (2). mạch hở là A. D. 2. 1. (4) metyl benzoat. B.2. C. 1. 2. (2).00. B. 2. x = 1. D. C. 2. 3. x. B. C. Câu 1. Vinyl axetat. (2) metyl acrylat. (1). B.25 mol ancol và 0. B. 2. 1. 1. (4). số đồng phân có khả năng tác dụng với dung dịch NaOH. mạch hở là A. 2. 2.05. C. 2. 9 . 2. Metyl propionat.80. 4. Câu 1.21 Số nguyên tử cacbon tối thiểu trong phân tử este (được tạo nên từ axit và ancol) no đa chức. Câu 1. 3. Metyl metacrylat. D. 2.2. B. 2. y = 1. (3). B. dung dịch AgNO3 trong amoniac lần lượt là A. D. Tại thời điểm cân bằng thu được 0. B. C. C.23 Trong số các đồng phân mạch hở có công thức phân tử C2H4O2. C. Các tên gọi đúng là A. (3). 6. chỉ có (3). (4). y có giá trị là A.90. (3). (4) vinyl fomiat.20. 3. x = 1. (4). 5. (2). natri cacbonat.75 mol este (không tác dụng với Na). Câu 1. 1. C.

H. Câu 1. Các axit béo có mạch cacbon không phân nhánh. B. a. d. d. isopropyl fomiat. e.O) đơn chức đều không tác dụng được với Na. D. B. Đun hồi lưu hỗn hợp etanol. Câu 1. d/ Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. D. axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. rượu trắng và axit sunfuric đặc. có 1 nối đôi. B. Cho X5 tác dụng với NaOH lại thu được X2. Phản ứng xà phòng hoá là phản ứng thuỷ phân este trong môi trường kiềm. thu được một muối và một ancol.33 Cho các câu sau : a/ Chất béo thuộc loại hợp chất este. số nguyên tử cacbon chẵn. Y thuộc dãy đồng đẳng A. D. este đơn. 10 . metyl propionat. Vậy công thức cấu tạo của X là A. C. c. D. D. nhưng đều tác dụng với dung dịch NaOH khi đun nóng. Đun hồi lưu hỗn hợp axit axetic. c/ Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. Những câu đúng là đáp án nào sau đây ? A. Câu 1. este đơn có 2 nối đôi. Câu 1. Đun sôi hỗn hợp etanol. HOOC–COO–CH2–CH = CH2. HOOC–CH2–COO–CH = CH2. este đơn no. Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. thu được 2 sản phẩm hữu cơ X. propyl fomiat. no. b. thu 6. Công thức cấu tạo của X có thể là A. Đốt cháy hoàn toàn m g T. b. e/ Chất béo lỏng là các triglixerit chứa gốc axit không no trong phân tử.72 lít (đktc) CO2 và 5. a. Câu 1. Thuỷ phân X bằng dung dịch NaOH dư.Câu 1. B. HOOC–CH = CH–OOC–CH3. O). CH2 = CH – OCOCH3. e. C. a. c. d. có một nối ba. C. Glixerol khử nước hoàn toàn cho sản phẩm là acrolein. axit axetic và axit sunfuric đặc. Vậy X. CH2 = CH – CH2 – OCOH.4g H2O. HCOO – CH = CH – CH3. este đơn. D. HOOC–CH2–CH = CH–OOCH. đun nóng. e.28 Hỗn hợp T gồm 2 chất X. C. Câu 1.H. a. giấm và axit sunfuric đặc. D. B. b/ Các este không tan trong nước do chúng nhẹ hơn nước. Chất E là A.31 Chất hữu cơ X có công thức phân tử là C5H6O4. Y mạch hở (C.29 Phát biểu nào sau đây sai ? A. Đun hồi lưu hỗn hợp etanol. d. Chất béo là este của glixerol với các axit béo. C.32 Thuỷ phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng. Y (chứa các nguyên tử C. Cho X4 tráng gương được sản phẩm X5. Chưng cất X3 thu được chất X4. B. etyl axetat. C. B.30 Cách nào sau đây có thể dùng để điều chế etyl axetat ? A. Cô cạn X1 được chất rắn X2 và hỗn hợp hơi X3.27 Chất X tác dụng với NaOH cho dung dịch X1. HCOO –C(CH3) = CH2. C.

D. D. 2.6. D. 8 Câu 1. Để phân biệt 3 este: anlyl axetat.35 Cho a mol chất béo (C17H35COO)3C3H5 tác dụng hết với NaOH thu được 46g glixerol. 1. Số liên kết π có trong gốc hiđrocacbon của axit béo. 2. Số miligam KOH cần để trung hoà các axit tự do có trong 1 gam chất béo. D. phân CH 5 C O.36 Đun nóng hỗn hợp X và Y có công thức C5H8O2 trong dung dịch NaOH. D. Câu 1. 44%. CH3–CH(OH)–CH(OH)–CH=CH2 và CH2=CH–CH2–CH2–COOH. axit fomic. để điều chế được ba polime gồm polistiren. C. (4) axit axetic. 0. CH2 CH(CH3)COOCH3. C. 5. C. CH2=CH–CH2–CH2 – COOH và CH3–CH2–CH=CH–COOH. D. 3. Câu 1. khi đốt cháy một thể tích ancol T cần 3 thể tích oxi (đo ở cùng điều CH2 CH2 O kiện). 5. B. Câu 1. 7. 11 . 3. 50%. Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng A. Câu 1. Công thức cấu tạo của X là A. C.6 mol. axit axetic.41 F là chất CH có 2 .40 Cho 0. (3) dd AgNO3/NH3.39 Trong phòng thí nghiệm có các hoá chất được dùng làm thuốc thử gồm: (1) dd brom.34 Chỉ số axit của chất béo là A. thu sản phẩm 2 muối C3H5O2Na. 1. 0. 0. B. (5) cồn iot.5 mol.Câu 1. CâuCH3COOCH2 hữu cơ CHcông thứcCH2 tử C2H8O2. Câu 1. 1. cô cạn dung dịch sau phản ứng thu 21g muối khan. (2) dd NaOH. axit acrylic. a có giá trị là A. F tác dụng với NaOH tạo ra một ancol T. B. D.38 Cho 10 gam hỗn hợp X gồm etanol và etyl axetat tác dụng vừa đủ với 50g dung dịch natri hiđroxit 4%. polibutađien và poli(butađienstiren). C. 2. axit valeric. Công thức cấu tạo của X và Y là A. 3. 22%. B. Số miligam NaOH cần để trung hoà các axit tự do có trong 1 gam chất béo. B. Axit tạo F là A. cần thực hiện số lượng phản ứng hoá học ít nhất là A.15 mol este đơn chức X (C5H8O2) tác dụng vừa đủ với dung dịch NaOH. C3H3O2Na và 2 sản phẩm khác. B. C. O=HC–CH2–CH2–CH2–CH=O và O=HC–CH(OH)–CH2–CH=CH2. C. vinyl axetat và etyl fomiat cần phải dùng các thuốc thử là A. D.4 mol. B. CH3–CH2–COO–CH=CH2 và CH2=CH–COO–CH2–CH3. 1. C. 51%.37 Từ nguyên liệu đầu là eten và benzen (xúc tác và điều kiện phản ứng có đủ).3 mol. 0. CH2 CH COOC2H5 . B. Số mol KOH cần để xà phòng hoá một gam chất béo.

1 mol. 0. axit axetic.4g muối của axit đa chức và 9. Vậy công thức cấu tạo của E là A. áp suất. Câu 1. vinyl fomiat. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A. B.42 Đốt cháy hoàn toàn m g hỗn hợp các este no. Tên gọi của Y là A.4375.Câu 1. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối lượng bình tăng 6.47 Làm bay hơi 7. CH3COOCH3 (2. B. Tên gọi của X là A. HCOOC2H5 (1.32 lít (ở 1270C. Công thức cấu tạo của E là A.43 Cho ancol X tác dụng với axit Y thu được este Z.22g). X có công thức A. Câu 1. C2H5COOCH3 (4. HCOOC2H5. CH3COO – CH2CH2CH3.6g một ancol Y.2g. 12 B.2g ancol đơn chức. metyl axetat. C. Câu 1.45 Đốt cháy 6g este E thu được 4. C2H4(COOC2H5)2. (COOC2H5)2. 10g. làm bay hơi 8. Câu 1. B. CH3COOCH3. C.48 Đốt cháy hoàn toàn 2.6g H2O. C. 10g. B.48g). C2H3COOC3H7.44 Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6. C2H5COOC2H5.4g).49 Đốt hoàn toàn 4. mạch hở. D.1 mol. 12g. C. D. HCOO – CH2CH2CH3. HCOOC2H5 (2. HCOOCH3. CH3COOC2H5 (6.2g một este E thu được 6.8g muối. CH3COOC2H5 (4. Propyl axetat. 0. Câu 1. axit acrylic. 1. B.52g H2O. D. etyl fomiat. Tên gọi của X là A. Etyl fomiat. CH3COOC2H5. HCOO – C2H5. isopropyl fomiat. Biết MY > MX.48 lít CO2 (đktc) và 3.6g). D. HCOOCH3.01 mol. đơn chức. B. Câu 1. C. (COOC3H5)2.2g.6g). Câu 1.4g X với dung dịch NaOH (phản ứng hoàn toàn) thu được sản phẩm có 6.8g este đơn chức.01mol. Công thức của X là A. C.4g).22g). Câu 1. 0. mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4.50 Đun nóng 0. 0. Khi thực hiện phản ứng xà phòng hoá 7. .14g hỗn hợp 2 muối và 3.48g).1 mol X với dung dịch NaOH (đủ). CH3COOCH3.28g X cần 3. C2H5COOCH3 (6. B. D. CH(COOCH3)3. Etyl propionat.4g một este X thu được một thể tích hơi bằng thể tích của 3.6g Z thu được thể tích bằng thể tích của 3.46 Thuỷ phân hoàn toàn 8. axit fomic. D. CH3COOCH3 (1. thu 13. Etyl axetat. có thể tích 8. D.36 lít oxi (đktc) thu hỗn hợp CO 2 và H2O có tỉ lệ thể tích tương ứng 6 : 5. Công thức cấu tạo mỗi este và số gam tương ứng là A. D. D. C.68g một ancol Y duy nhất có tỉ khối so với oxi là 1. B. Biết E có phản ứng tráng gương với dung dịch AgNO3/NH3.16g CO2 và 2.2g khí oxi ở cùng điều kiện nhiệt độ. 600 mmHg). Nếu đun X trong dung dịch H 2SO4 loãng thu được axit Y có dY / H 2 = 36 và ancol đơn chức Z. C. C.2g O2 ở cùng điều kiện nhiệt độ và áp suất. axit metacrylic. C2H3COOC2H5.

19.5M thu được 24. D. C. 7.53 Cho 21. Câu 1. Câu 1.52 Để xà phòng hoá hoàn toàn 19.0g. m lần lượt là A.82g .2 mol HCl. CH3–C(COOCH3)3. Để trung hoà 2. CH3COOCH3 19. 3. 8. 8. C3H5(OOCH)3. C17 H 35COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | B.1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0. 6. 15. Số miligam KOH dùng để trung hoà lượng axit béo tự do trong một gam chất béo gọi là chỉ số axit của chất béo. D. 7. B. 7. thu 9.8g chất béo cần 3ml dung dịch KOH 0. B. D. Câu 1.6g muối và 0. Công thức cấu tạo thu gọn của X là A. D. C3H5(COOCH3)3. CTCT. 20. C.5M.4g.18%. C3H5(COOCH3)3.1 mol một ancol Y. cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và m g một muối khan duy nhất Z. B. C15 H 31COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | C.82g.1M.51 Xà phòng hoá hoàn toàn 0. D. Câu 1.92g glixerol.Câu 1. HCOOCH3 66.4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức). 18. 155.55 Trong chất béo luôn có một lượng axit béo tự do.54 Khi thuỷ phân a g một este X thu được 0.08g. 8.6g.56 Tổng số miligam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong một gam chất béo gọi là chỉ số xà phòng hoá của chất béo. C15 H 31COO C H | C15 H 31COOCH 2 13 .8g chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0. Sau khi phản ứng hoàn toàn. 20. 8. Giá trị của a.02g natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa). 185. CH3CH2OOC-COOCH2CH3.67%. Câu 1. 175. C.20%. B.2g .2g ancol Y và 20. C17 H 33COO C H | C15 H 31COOCH 2 D.3 mol NaOH.82g . CH3CH2COOCH3. (C2H5COO)3C2H5. 165. Chỉ số axit của mẫu chất béo trên là A. B. HCOOC2H5 16.57 Khi thuỷ phân (xúc tác axit) một este thu được glixerol và hỗn hợp các axit stearic và axit panmitic theo tỉ lệ mol tương ứng bằng 2 : 1. % khối lượng của X trong hỗn hợp ban đầu và giá trị m là A. 6.08g. Este có thể có công thức cấu tạo nào sau đây? C17 H 35COO C H 2 C17 H 35COO C H 2 | | A. 6. C. C.2g. Công thức của X là A. Vậy chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa 89% tristearin là A. C. Câu 1.4g hỗn hợp 2 este đơn chức X. (HCOO)3C3H5. (CH3COO)3C3H5.4g.2g . Lượng NaOH dư được trung hoà hết bởi 0. Y cần 200ml dung dịch NaOH 1. B. D. 16.

D. B. 929. C. (1). B. (2).62 Thuỷ phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1. D. C4H8O2. 14 . thu được 0. Câu 1. (2) C17H31COOC3H5(OOCC17H29)2. Khi thuỷ phân hoàn toàn 2.7g chất hữu cơ X cần dùng 3. D.145kg chất béo.90g.3kg NaOH. 7.Câu 1. B. Câu 1. Tên X là A. Vậy công thức phân tử của X là A. 100g. (2). C. 8. B. metyl axetat. D.64 Đun nóng 215g axit metacrylic với 100g metanol (với Hpứ = 60%). (C17H33COO)3C3H5. (4) (C17H31OCO)2C3H5COOC17H29.58g hỗn hợp Y gồm muối của axit linoleic và axit oleic. 3. và mg hỗn hợp muối Na. Chất béo đó là A. Câu 1.63 Đốt cháy 3. D. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng lớn hơn khối lượng X đã phản ứng.82g. 175g. 8. Câu 1. C. C.61kg. C. C.3kg. giả sử hiệu suất quá trình đạt 90% là A.2kg.24g muối của axit béo duy nhất. (2). C2H4O2. 30% tripanmitoyl glixerol (panmitin) và 20% tristearoyl glixerol (stearin) về khối lượng) khi xà phòng hoá bằng natri hiđroxit. C3H6O2.92 lít O2 (đktc) thu được CO2 và H2O có tỉ lệ mol 1:1.61 Khối lượng xà phòng thu được từ 1 tấn mỡ động vật (chứa 50% trioleoyl glixerol. Công thức cấu tạo có thể có của các trieste đó là : (1) (C 17H31COO)2C3H5OOCC17H29. 9. etyl axetat. (3). (2). Câu 1. 2. (C17H35COO)3C3H5. (1). metyl propionat.84kg. 917kg.58 Trong chất béo luôn có một lượng axit béo tự do. (3). Khối lượng este metyl metacrylat thu được là A.59 Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. B.91g. Câu 1.092kg glixerol. (C15H29COO)3C3H5. (4). B. Khối lượng xà phòng 60% (về khối lượng) thu được là A.92kg. (4). C. C3H4O2. D. thu 0. D. (3) (C17H31OOC)2C3H5OOCC17H29. B.787kg.65 Một chất hữu cơ X có d X CO2 = 2 . (1). 125g. Giá trị của a là A. B. cần dùng 0. (4). 10. Những công thức đúng là A.84g glixerol và 18.60 Đun sôi a g một triglixerit X với dung dịch KOH cho đến khi phản ứng hoàn toàn. C. iso propyl fomiat.92g glixerol và 9. (C15H31COO)3C3H5. 889. 3. 150g. D. Câu 1. 988kg. Biết X tác dụng với KOH tạo ra 2 chất hữu cơ.92g.

0. 02 .015 mol H2. Nung một trong hai muối thu được với NaOH (vôi tôi – xút) sẽ tạo metan.71 X là một este hữu cơ đơn chức. Câu 1. B. CH2=CH–COOCH3. D. X2. Câu 1. Thuỷ phân X tạo nên 2 hợp chất hữu cơ X1. C. Trong hỗn hợp X. B. Cho lượng 10 chất L phản ứng với Na được 0. C. thu được muối có khối lượng bằng khối lượng 37 este ban đầu. 8. D. H-COOCH3. H – COOC2H5 0. B.2 mol.15 mol. 15 . (CH3COO)2C2H4. Câu 1.72 Thuỷ phân este X (C4H6O2) trong môi trường axit ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. mạch hở. CH2 = CH – OCO – CH3. D. C. Tên gọi của L là ancol anlylic. II – BÀI TẬP NÂNG CAO Câu 1. thu 20. etyl fomiat. (CH3COO)3C3H5. D. cần dùng 12g NaOH. hai chất Y và Z có số mol bằng nhau.15 mol D.69 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit ađipic là A. Công thức cấu tạo của X là A. B. Đốt cháy hỗn hợp X sẽ thu được nCO2 − nH 2O = 0. B. B. CH3COOCH3.492g muối khan (hao hụt 6%). isopropyl fomiat. B.2 mol. 625 ). CH3 – CH = CH – OCOH. 7. CH3 – COOC2H3 0. CH2 = CH – COO – CH3. C. Nếu đốt cháy cùng một lượng X1 hay X2 sẽ thu được cùng một thể tích CO2 (ở cùng nhiệt độ và áp suất). CH3 – COOCH3 0. Tên gọi của X là A. C. thu được hỗn hợp muối natri của hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và một chất lỏng L (tỉ khối hơi d L / CH 4 = 3. Chất L 1 phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. CH3(CH2)2COOCH3.66 Este X có d X / H 2 = 44 . X là A.2g muối natriaxetat. D.68 Đun nóng 3. CH3COOCH3. Câu 1.21g hỗn hợp X gồm hai chất hữu cơ Y và Z cùng nhóm chức với dung dịch NaOH dư. Công thức của este E là A. C17H35COO(CH2)16CH3. D. H – COOC2H5 0. Nhận định nào sau đây là sai ? A. etyl axetat. Trong X chắc chắn có một este với công thức và số mol tương ứng là A. metyl propionat. C. HCOO – CH2 – CH = CH2.2g hỗn hợp gồm 2 este đồng phân. Cho một lượng X tác dụng hoàn 41 toàn với dung dịch NaOH vừa đủ.Câu 1.4g este E thuỷ phân trong dung dịch NaOH thì thu được 8. 6.70 Cho 7. C.67 Xà phòng hoá 22. Câu 1.

B. D. ancol isopropylic. B.4g muối của axit hữu cơ X và 9. Câu 1. Câu 1. sau phản ứng thu được một muối và một anđehit. C. C2H5COOCH3. axit acrylic. axit acrylic. Xác định công thức phân tử và gọi tên X. Y. B. ancol anlylic. axit metacrylic. CTCT của este E và chất Y là (giả sử các phản ứng đều đạt 100%) A.9g một este đơn chức (mạch hở) tác dụng vừa đủ với 150ml dung dịch KOH 1M. C. Metyl propionat. ancol etanol. CH3COOCH2CH3. C. Biết oxi hoá X bằng CuO đun nóng được sản phẩm có phản ứng tráng gương. Khi bị oxi hoá chất Y chuyển thành anđehit. glixerol. CH2− O C.74 Đun hợp chất X với H2O (xúc tác H+) được axit hữu cơ Y ( dY / N2 = 2. Y: C3H8O3. ancol propylic. A. HCOOCH2CH2CH3.1 mol este E (chứa một loại nhóm chức) cần dùng vừa đủ 100g dung dịch NaOH 12%. Tên gọi của X. X: C2H4O2. Tên X là A. Câu 1. Để đốt cháy hoàn toàn 2. axit propionic. ancol benzylic. Đốt cháy 0.77 Thuỷ phân hoàn toàn 0. axit axetic. Biết rằng một trong 2 chất (X hoặc Y) tạo thành este là đơn chức. Y: C3H8O3. B. Y lần lượt là A. thu được chất X và chất Y. HCOOCH=CH–CH3. glixerol. CH3OCO− CH=CH2.52g một este E của axit cacboxylic no đơn chức và ancol no đơn chức (cả hai đều mạch hở) phản ứng vừa hết với 40ml dung dịch NaOH 1M. D. axit axetic.2g ancol Y. Nung X với vôi tôi xút thu được ancol Y và muối vô cơ Z.92 lít O2 (đktc) và thu được VCO : V H O = 3 : 2 . CH3CH2OH.78 Cho 12. D. D. CTCT của este không thể là A. B. CH3COOCH=CH2.32g CO2. CH3− CH− 2 CH 2 2 O O − C=O. Câu 1. X: C2H4O2. glixerol. Y: C3H8O. HCOOCH=CH–CH3 và CH3COOCH=CH2. X: C3H6O2.8g X thì cần 3. C2H5− CH− C=O. thu được 20. CH3CH2CH2OH Câu 1. B.Câu 1. D.6g chất Y cho 1. CH3CH2OH.57 ) và ancol Z. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng bằng lượng 22 este đã phản ứng. axit valeric. Đốt cháy hoàn toàn Y thu được CO 2 và H2O có tỉ lệ thể tích 3 : 4. Metyl axetat. Etyl axetat. Công thức cấu tạo của E là A. D. CH2− 2 CH C=O. Isopropyl fomiat. HCOOCH(CH3)CH3. Cho hơi Z qua ống bột đựng Cu xúc tác đun nóng thì sinh ra chất T có khả năng tham gia phản ứng tráng gương. CH3CH2OH.73 Một este X tạo bởi axit đơn chức và ancol đơn chức có tỉ khối với He bằng 17 22. axit fomic.76 3. Y: C3H8O3. C. Biết Z là ancol đơn chức. HCOOCH2CH=CH2. 16 . X: CH2O2.75 Xà phòng hoá một este no đơn chức E bằng một lượng vừa đủ dung dịch NaOH chỉ thu được một sản phẩm X duy nhất. C.

B. Muốn trung hoà dung dịch chứa 0. B. Y lần lượt là A. còn Y tác dụng với nước brom sinh ra kết tủa trắng. C. C. D. anlyl butyrat.80 Để xà phòng hoá 100kg dầu ăn thuộc loại trioleoyl glixerol có chỉ số axit bằng 7 cần 14. Câu 1. Khi a = 5. Tên gọi của este đó là A. etyl axetat. C. C. D. Câu 1.84 Thuốc chống muỗi (DEP) thu được khi cho axit thơm (X) tác dụng với ancol Y. Câu 1.6g hỗn hợp etyl axetat và etyl fomiat cần 25.152g H2O. Cho 10g E tác dụng với lượng NaOH vừa đủ.10kg natri hiđroxit. D. CTCT của este là A. 117. 103.2M. Số lượng CTCT thoả mãn tính chất đã nêu của E là A. 118.00g muối khan G.96ml NaOH 10%.85 Để thuỷ phân 0. D.35g este đó cần 3g NaOH và thu được 7. C. CH3–C6H4–COOC2H5. khối lượng muối natri thu được là A. Câu 1.81 Khi thuỷ phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. Mặc khác để thuỷ phân 6. C2H5O–C6H4–COOC2H5.01 mol este của một ancol đa chức với một axit cacboxylic đơn chức cần dùng 1. B.245kg. (CH3COO)2C2H4.8g thì tên gọi của este là A.9035g X cần 54. Câu 1. 6.6kg. 17 . 52. Giả sử phản ứng xảy ra hoàn toàn.18%. (CH2=C(CH3)–COO)3C3H5.445kg. vinyl pentanoat. benzyl fomiat. etyl valerat.52g CO2 và 1. C. 50. Câu 1.79 Đốt cháy 1. Trong ancol = dung dịch ancol Y 94% (theo khối lượng) tỉ số mol n 14 . C. cô cạn dung dịch sau phản ứng thu được 14. X khử được AgNO3 trong amoniac. Mặt khác muốn trung hoà 20ml dd KOH ban đầu phải dùng 15ml dd H2SO4 nói trên.82 Muốn thuỷ phân 5.5M để trung hoà KOH còn dư. (D = 1. Thành phần % khối lượng của etyl axetat trong hỗn hợp là A.14%. Biết rằng H 2O n 86 CTCT thu gọn của X.16%. 8.20%. Sau phản ứng phải dùng 25ml dd H2SO4 0. Cho G tác dụng với axit vô cơ loãng thu được G 1 không phân nhánh. phenyl fomiat. 2. (CH2=CH–COO)3C3H5.89kg. B. etyl propionat. 36. B. D. etyl butyrat.Câu 1. D. B. C2H5OOC–C3H4–COOC2H5. 100 < M X < 200 .83 Đun a gam este mạch không phân nhánh CnH2n+1COOC2H5 với 100ml dd KOH.08g/ml). 108.5ml NaOH 0. (H–COO)3C3H5. C2H5OOC–C6H4–COOC2H5 D. B.05g muối.2g NaOH. 47. 4.60g một este E đơn chức được 3.

vinyl axetat.90 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu. B. 273. 170kg và 80kg. 191. 2. Biết rằng các gốc hiđrocacbon đều có độ phân nhánh cao nhất. (CH3)2CHCOOH. Cho hỗn hợp muối đó tác dụng H2SO4 dư được hỗn hợp 3 axit X. Câu 1.9g A với NaOH cho tới phản ứng hoàn toàn. D. Tên gọi của hai este là A. 85.05 mol khí. 3. Phần trăm về khối lượng của một trong hai glixerit phải là A. 18. isopropyl fomiat. 215kg và 80kg. Câu 1. C. Số CTCT của E và CTCT của các axit X. Z là đồng đẳng kế tiếp của Y và có mạch cacbon không phân nhánh. Z. 287. 196. 86. Y) với dung dịch H2SO4 loãng. Khi đốt cháy hoàn toàn hỗn hợp hai este đó thì thu được khí CO2 và hơi nước với tỉ lệ thể tích VH2O :VCO2 = 1:1 . 18 .736. 190.1%. D. thu được 8. Biết hiệu suất quá trình este hoá và quá trình trùng hợp lần lượt là 60% và 80%. (CH3)2CHCOOH. (CH3)3CCOOH. propyl fomiat. etyl fomiat. 90. CH3(CH2)3COOH.89 E là este của glixerol với một số axit monocacboxylic no.5M. CH3COOC(CH3)3 và CH3CH2COOCH(CH3)2. Khi cho 3. Sau khi kết thúc phản ứng. Câu 1. Y là A.22g hỗn hợp hai este là đồng phân X và Y. B. A.920. C. C. cần dùng 30ml dd NaOH 1M. D.6g hỗn hợp muối. etyl axetat. CH3CH2CH2COOH. Câu 1. (CH3)2CH-COOC2H5 và (CH3)2CHCH2COOCH3. B. 192.188. B. CH3CH2CH2CH2COOH. Y. D. metyl propionat. 1 để trung hoà dung dịch thu được. 173. 65kg và 40kg. C. 286. D. B. (CH3)3CCOOH.5kg và 41kg. Y. 2. CTCT của X. Câu 1. D. HCOOC(CH3)3 và CH3COOCH(CH3)2. (CH3)2CHCOOH. B. Câu 1.91 Số gam iot có thể cộng vào liên kết bội trong mạch cacbon của 100g chất béo được gọi là chỉ số iot của chất béo. trong đó X và Y là đồng phân của nhau.9g hỗn hợp ancol trên tác dụng hết với Na thu được 0. Chỉ số iot của chất béo được tạo nên từ axit linoleic là A.Câu 1.20%.2M. CH3CH2CH2COOH. Phân tử 10 khối trung bình của các axit béo trong thành phần cấu tạo của lipit và chỉ số xà phòng hoá của lipit và lần lượt là A. 3. 20. thu được hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và hai ankanol.92 Một mẫu chất béo chứa gồm trilein và tripanmitin có chỉ số iot là 19. Z lần lượt là A.19%.868.05. để trung hoà NaOH dư phải dùng 10ml HCl 0. CH3CH2CH2CH2COOH. CH3(CH2)3COOH. B. 20.18%.86 Đun 20g lipit với dung dịch chứa 10g NaOH. 228. mạch hở.88 Đun nóng hỗn hợp hai chất đồng phân (X. Hoà tan 1g hỗn hợp axit trên vào 50ml NaOH 0.87 Để xà phòng hoá hoàn toàn 2. C. (CH3)2CH-COOC2H5 và (CH3)3COOCH3.3M. D. Đun 7. cần dùng 90ml dung dịch HCl 0. 188. C. C. metyl acrylat. 22. metyl axetat. (CH3)2CHCOOH.

do đó có thể mở vòng tạo thành nhóm anđehit (– CHO). CH2OH[CHOH]3-CO-CH2OH CH2OH[CHOH]4CHO b) Saccarozơ và mantozơ (C12H22O11) Saccarozơ là một đisaccarit. Mantozơ là đồng phân của saccarozơ. Trong phân tử không còn nhóm OH semiaxetal.hoặc β . 19 . cấu tạo bởi một nhóm cacbonyl ở vị trí C2 (là xeton) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]3COCH2OH.glucozơ nối với C4 của gốc α . glucozơ tồn tại chủ yếu ở hai dạng α -glucozơ và β glucozơ (dạng mạch vòng). nên không có khả năng mở vòng. hai dạng vòng này chiếm ưu thế và luôn chuyển hoá lẫn nhau theo một cân bằng qua dạng mạch hở. cấu tạo bởi C1 của gốc α . Trong dung dịch. fructozơ có sự chuyển hoá thành glucozơ. Đơn vị monosaccarit thứ hai có nhóm OH semiaxetal tự do. Fructozơ là đồng phân của glucozơ.glucozơ nối với C2 của gốc β fructozơ qua nguyên tử O (C1 – O – C2). Trong thiên nhiên. CACBOHIĐRAT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.glucozơ qua nguyên tử O (C1 – O – C4).CHƯƠNG II. Cấu trúc phân tử a) Glucozơ và fructozơ (C6H12O6) Glucozơ là monosaccarit. cấu tạo bởi C 1 của gốc α . Cùng với dạng mạch hở fructozơ có thể tồn tại ở dạng mạch vòng 5 cạnh hoặc 6 cạnh H OH 2 H O OH H 5 2 1 O H O OH H 5 1 CH2OH 2 OH H 3 OH O OH H 5 HOCH2 3 1 OH 4 CH2OH H 6 HOCH2 3 OH H 4 CH2OH 6 4 CH2OH H 6 α -fructozơ fructozơ OH- β -fructozơ Trong môi trường bazơ. cấu tạo bởi một nhóm cacbonyl ở C1 (là anđehit) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]4CHO. H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 1 OH H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 6 CH2OH 5 OH 3 H O H 2 OH H OH 1 O C 1 H H 4 OH α -glucozơ glucozơ β -glucozơ Glucozơ có đầy đủ các tính chất của rượu đa chức và anđehit đơn chức.

(-) không có phản ứng. không yêu cầu viết sản phẩm. Xenlulozơ là đồng phân của tinh bột. (*) phản ứng trong môi trường kiềm. cấu tạo bởi các mắt xích β -glucozơ liên kết với nhau thành mạch kéo dài. nên công thức của xenlulozơ còn có thể viết [C6H7O2(OH)3]n. cấu tạo bởi các mắt xích α -glucozơ liên kết với nhau thành mạch xoắn lò xo. Tính chất hoá học Cacbohiđrat Glucozơ Tính chất T/c của anđehit + [Ag(NH3)2]OH T/c riêng của –OH hemiaxetal + CH3OH/HCl T/c của poliancol + Cu(OH)2 T/c của ancol (P/ư este hoá) + (CH3CO)2O Ag↓ + Ag↓ Fructozơ Saccarozơ Mantozơ Tinh bột Xenlulozơ Metyl glucozit - - Metyl glucozit - - dd màu xanh lam dd màu xanh lam dd màu xanh lam dd màu xanh lam - - + + + + + Xenlulozơ triaxetat Xenlulozơ trinitrat + + HNO3/H2SO4 P/ư thuỷ phân + H2O/H+ P/ư màu + I2 - + + + + - Glucozơ + Fructozơ Glucozơ Glucozơ Glucozơ - - - - màu xanh đặc trưng - (+) có phản ứng. 20 .c) Tinh bột và xenlulozơ (C6H10O5)n Tinh bột là polisaccarit. 2. phân tử không có nhóm CHO và mỗi mắt xích còn 3 nhóm OH tự do. phân tử không có nhóm CHO và các nhóm OH bị che lấp đi.

2H2O 16. C12H22O11 + H2O  C6H12O6(Glucozơ) + C6H12O6(Fructozơ) → → 15. (C6H10O5)n + nH2O t0  → xt: H + (Glucozơ) nC6H12O6 (Xenlulozơ) (Glucozơ) Ca(OH)2 9. CH2OH[CHOH]4CHO + Br2 + H2O  CH2OH[CHOH]4COOH + 2HBr → 3+ 13. 6H–CHO → C6H12O6 10.CaO. CH 2 OH[CHOH]4 CHO + 2[Ag(NH 3) 2]OH  CH 2OH[CHOH] 4COONH 4 +2Ag ↓ + glucozơ amoni gluconat Men röôï u 5.B .t0 Men lactic 6.2H2O + CO2  C12H22O11 + CaCO3↓ 2H2O + → 17. → H 2SO4 loaõ g n 14. 6 CH2OH H 4 OH 5 OH 3 H O H 2 OH H 1 OH H 6 CH2OH 5 OH 3 H OH − O H 2 OH H 1 + HOCH3 HCl 4 OH + H2O OCH3 metyl α -glucozit  → 11.CH2OH[CHOH]4CHO+5CH3COOH ← CH3COOCH2[CHOOCCH3]4CHO  Xt. CH2OH[CHOH]4CHO + H2  CH2OH[CHOH]4CH2OH → Sobit (Sobitol) t0 3. CH2OH[CHOH]4CHO + 2Cu(OH)2  CH2OH[CHOH]4COOH + Cu2O↓ + → +2H2O t → 3NH 3 + O H 2 4. (C6H10O5)n + nH2O  nC6H12O6 Hoaë H+ c (Tinh bột) 8.CaO.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP  → 1.t0 (pentaaxetyl glucozơ) + H2O 2. C12H22O11 + Ca(OH)2 + H2O  C12H22O11. CH2OH[CHOH]3COCH2OH ← CH2OH[CHOH]4CHO  12. C6H12O6  2CH3–CHOH–COOH → Axit lactic (axit sữa chua) Men → 7. C12H22O11. C6H12O6  2C2H5OH + 2CO2↑ → o Ni. t 0 cô n nC6H12O6 21 . (C6H10O5)n + nH2O  → hoaë men c Axit voâ loaõ g. CH2OH[CHOH]4COOH + Fe  tạo phức màu vàng xanh.

2g.3 Có mấy loại cacbohiđrat quan trọng? A. C. t 0 20. 68. Câu 2.BÀI TẬP TRẮC NGHIỆM I. 34. còn trong phân tử fructozơ nhóm cacbonyl ở nguyên tử C số…. 68. C. 22 . Cacbohiđrat là những hợp chất hữu cơ tạp chức. D. 21. D. 1. 2. t cô n 19. Câu 2. glucozơ. B. 3 loại. phản ứng với CuO và với dung dịch AgNO3 trong amoniac. ngược lại. [C6H7O2(OH)3]n + 3nHONO2  [C6H7O2(ONO2)3]n + 3nH2O → (HNO3) xenlulozơ trinitrat C. glucozơ.2g. 4 loại. 43. B. 2 loại. D. B.0g. glucozơ.0g.0g.0g. 2. 68. D. C.5 Để tráng bạc một chiếc gương soi.6g. người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac.tinh bột 18. nhưng trong phân tử glucozơ nhóm cacbonyl ở nguyên tử C số …. C.BÀI TẬP CƠ BẢN Câu 2. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)m. C. glucozơ. 43. B. ngược lại. 2. 2. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)n. 43.1 Tìm từ thích hợp để điền vào chỗ trống trong đoạn văn sau: Ở dạng mạch hở glucozơ và fructozơ đều có nhóm cacbonyl. Cacbohiđrat là những hợp chất hữu cơ tạp chức và đa số chúng có công thức chung là Cn(H2O)m. fructozơ có thể chuyển hoá thành … và … A. Khối lượng bạc đã sinh ra bám vào mặt kính của gương và khối lượng AgNO 3 cần dùng lần lượt là (biết các phản ứng xảy ra hoàn toàn) A. 1. ngược lại. 1 loại. Câu 2. B.4 Những thí nghiệm nào chứng minh được cấu tạo phân tử của glucozơ? A. phản ứng với Cu(OH)2 và với dung dịch AgNO3 trong amoniac. 6nCO2 + 5nH2O Dieä luï p c  → a/ s maë trôø t i glucozơ (C6H10O5)n 0 Axit voâ loaõ g. phản ứng với Na và với dung dịch AgNO3 trong amoniac. (C6H10O5)n + nH2O  nC6H12O6 → xenlulozơ glucozơ H 2SO4 ñ. D. 1. 2.2 Cacbohiđrat là gì? A. mantozơ. Câu 2.2g. Trong môi trường bazơ. phản ứng với NaOH và với dung dịch AgNO3 trong amoniac.

Cu(OH)2 trong môi trường kiềm. Chỉ dùng một thuốc thử nào sau đây để phân biệt chúng. Câu 2.9 Để phân biệt các chất: Glucozơ. có thể chỉ dùng một thuốc thử nào sau đây? − A. dung dịch KMnO4. Iot làm hồ tinh bột hoá xanh. B. D. C đều đúng. B. D. dung dịch HCl. Glixerol tác dụng Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. KOH và axit axetic. C. còn lại glixerol. Câu 2. C. dung dịch brom. Cu(OH)2/OH . còn lại hồ tinh bột. A. dung dịch AgNO3/NH3. C. Câu 2. Nước brom. B. Khi thuỷ phân đến cùng saccarozơ. D. Saccarozơ là một đisaccarit. anđehit axetic. sau đó đun nóng và thử với dung dịch iot. HNO3. C. tinh bột và xenlulozơ ở dạng bột? A. C. Tinh bột và xenlulozơ đều là polisaccarit. lòng trắng trứng và rượu etylic.10 Chọn cách phân biệt các dung dịch sau đây: Lòng trắng trứng. Cho từng chất tác dụng với dung dịch HNO3/H2SO4. B. glixerol. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên ? A. glucozơ và axit axetic. Câu 2. D. dung dịch HNO3 đặc. B. glixerol tác dụng với Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng.12 Chọn câu phát biểu sai: A. Cả B.11 Có 4 dung dịch loãng không màu gồm: Lòng trắng trứng.6 Phương án nào dưới đây có thể phân biệt được saccarozơ. dung dịch CuSO4. ancol etylic. còn lại lòng trắng trứng. Cu(OH)2/OH . Iot làm hồ tinh bột hoá xanh. C. D.8 Có bốn lọ mất nhãn chứa: Glixerol. khi đun nóng lòng trắng trứng đông tụ. D. 23 .Câu 2. B. dung dịch HNO3. Câu 2. Câu 2. AgNO3/NH3. Cho từng chất tác dụng với dung dịch iot. hồ tinh bột. B. chỉ khác nhau về cấu tạo của gốc glucozơ. Na kim loại. lòng trắng trứng tác dụng Cu(OH)2 cho màu xanh tím. C. [Ag(NH3)2]OH. A. NaOH. Hoà tan từng chất vào nước. glixerol. tinh bột và xenlulozơ đều cho một loại monosaccarit. glixerol. saccarozơ và anđehit axetic có thể dùng chất nào trong các chất sau làm thuốc thử ? − A.7 Để phân biệt các dung dịch glucozơ. Cho từng chất tác dụng với vôi sữa Ca(OH)2.

glucozơ và tinh bột. B. không mùi. Câu 2. Glucozơ. biết hiệu suất lên men là 80%. Glucozơ. mantozơ. người ta phải dùng 100g saccarozơ. fructozơ. glucozơ và fructozơ. C. Câu 2. Câu 2. Câu 2. 27.74g. 0. fructozơ. khí CO2 tạo thành được dẫn qua dung dịch nước vôi trong dư. D. glucozơ và xenlulozơ.21 Cho glucozơ lên men tạo thành ancol. B.555kg. B. Câu 2. D.0g. 0. C.D. fructozơ. tinh bột. tinh bột và xenlulozơ đều cho glucozơ. B. Câu 2. D.8g.0g. tất cả các chất đã cho. Chất này có thể lên men rượu (ancol). Giả thiết hiệu suất phản ứng là 80%. C. saccarozơ. mantozơ.8g.90kg. C. B. Khi thuỷ phân đến cùng.18 Tính khối lượng glucozơ tạo thành khi thuỷ phân 1kg mùn cưa có 50% xenlulozơ.500kg.15 Để tráng bạc một số ruột phích. fructozơ. B. glucozơ. saccarozơ. 50. 0. sự chuyển hoá của fructozơ là không đáng kể và hiệu suất các phản ứng đều đạt 90%) A. không màu. Glucozơ. tinh bột. D. B. glucozơ. xenlulozơ. phản ứng xảy ra hoàn toàn. axit axetic. 102. xenlulozơ.444kg. Câu 2. 24 .14 Cho các chất glucozơ. A. 91. tinh bột. fructozơ và saccarozơ. vừa có tính chất của anđehit là A.99kg. C.80kg. fructozơ. D. glucozơ. khối lượng ancol thu được là A.8g. sacacrozơ. xenlulozơ.17 Khi thuỷ phân 1kg bột gạo có 80% tinh bột. Khối lượng AgNO3 cần dùng và khối lượng Ag tạo ra lần lượt là (giả thiết rằng. C. 0. D. dễ tan trong nước. fructozơ.13 Cùng là chất rắn kết tinh.5g. chỉ có glucozơ. 52. 23.690kg. B. tinh bột. Saccarozơ. 0. glucozơ và saccarozơ. Chất vừa có tính chất của ancol đa chức. Câu 2.16 Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol là 1:1. D. A. glucozơ. D. C. 0. Mantozơ. 52. hex-3-en. thì khối lượng glucozơ thu được là bao nhiêu ? Giả thiết rằng. Glucozơ.0g.5g. 0.89kg. B. Chất đó là chất nào trong các chất sau ? A. C. D. C. saccarozơ và tinh bột. có vị ngọt là tính chất vật lí và trạng thái tự nhiên của nhóm chất nào sau đây? A. 91. thu được 50g kết tủa.19 Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. 64.6g. 18.4g. xenlulozơ. Saccarozơ.20 Nhóm gluxit đều có khả năng tham gia phản ứng tráng gương là A. 28. Saccarozơ.74g. 88. 0. Câu 2.

D. nhiệt độ. C. tinh bột.22 Chọn sơ đồ phản ứng đúng của glucozơ A. H2/Ni .glucozit không thể chuyển sang dạng mạch hở. đun nóng. nhiệt độ.103 lít.23 Nhóm gluxit khi thuỷ phân hoàn toàn đều chỉ tạo thành glucozơ là: A. 336. H2/Ni . Saccarozơ. NaOH. Phân biệt glucozơ và saccarozơ bằng phản ứng tráng gương. Phân biệt tinh bột và xenlulozơ bằng I2. B. C6H12O6  m e → CH3–CH(OH)–COOH C. Glucozơ và fructozơ là đồng phân cấu tạo của nhau. Câu 2. 448. mantozơ. Phân biệt glucozơ và fructozơ bằng phản ứng tráng gương. [Ag(NH3)2]OH. Na2CO3.Câu 2. Cu(OH)2. tinh bột. C. Câu 2.26 Glucozơ tác dụng được với tất cả chất trong nhóm chất nào sau đây? A. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc.25 Biết CO2 chiếm 0. Metyl α . Trong dung dịch. Saccarozơ. B.103 lít. H2/Ni . CH3COOH/H2SO4 đặc.03% thể tích không khí. 112. H2/Ni. nhiệt độ. D. thể tích không khí (đktc) cần cung cấp cho cây xanh quang hợp để tạo 162g tinh bột là A. C6H12O6 + CuO  → Dung dịch màu xanh n D. xenlulozơ. Tinh bột có cấu trúc phân tử mạch không phân nhánh. H2O/H+. D. mantozơ. Mantozơ. B. C. C. 25 . đun nóng. [Ag(NH3)2]OH.103 lít. C6H12O6 + Cu(OH)2  → kết tủa đỏ gạch n B. glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở.28 Chọn câu phát biểu đúng: A. Saccarozơ. Câu 2. Câu 2. B. xenlulozơ. D.103 lít. C.27 Chọn câu phát biểu sai: A. Câu 2. D. C6H12O6  m e → C2H5OH + O2 Câu 2. Cu(OH)2. 224. B. tinh bột. [Ag(NH3)2]OH. mantozơ. [Ag(NH3)2]OH. Cu(OH)2. B. nhiệt độ. Phân biệt saccarozơ và glixerol bằng Cu(OH)2.24 Phát biểu nào sau đây không đúng ? A. Cu(OH)2. xenlulozơ. Phân biệt mantozơ và saccarozơ bằng phản ứng tráng gương.

tinh bột. 50g. etanol. fructozơ. phản ứng với kim loại Na. B. B. etanol. asmt → Câu 2. Câu 2. 60g. C. dung dịch Br2. B. R(OH)x(CHO)y. Câu 2. men C. D.38 Gluxit không thể thuỷ phân được nữa là A. Câu 2. Cu(OH)2. 56. (C6H10O5)n. Dung dịch mantozơ có tính khử và bị thuỷ phân thành glucozơ. 1000. quá trình oxi hoá.25g.35 Cacbohiđrat (gluxit) là những hợp chất hữu cơ tạp chức và có công thức chung là A. Câu 2. phản ứng với H2/Ni.36 Công thức phân tử và công thức cấu tạo của xenlulozơ lần lượt là A.31 Phản ứng khử glucozơ là phản ứng nào sau đây ? A. Câu 2. B. Glucozơ + [Ag(NH3)2]OH. Cn(H2O)m. 900. quá trình hô hấp. mantozơ. Tên gọi X. [C6H7O2(OH)3]n. B. Câu 2. C. B. Câu 2.30 Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → sobit. Câu 2. [C6H7O2(OH)2]n. D. o C. quá trình khử. t .nH2O. C. Glucozơ. D.34 Thuốc thử phân biệt glucozơ với fructozơ là A. tinh bột. D. etanol. fructozơ thành những sản phẩm giống nhau là A. glucozơ. Glucozơ. [C6H7O2(OH)3]n. C. CxHyOz. xenlulozơ. Khối lượng tinh bột cần dùng là A. Glucozơ → etanol. phản ứng với Cu(OH)2. D. 1500. Câu 2. B. 56g. Glucozơ + Cu(OH)2. H2. C.37 Một polisaccarit (C6H10O5)n có khối lượng phân tử là 162000u. B. C.33 Phản ứng chuyển glucozơ. n có giá trị là A. [C6H7O2(OH)3]n. mantozơ. Glucozơ. saccarozơ. C.32 Để điều chế 45g axit lactic từ tinh bột và qua con đường lên men lactic. B. D. Y lần lượt là A.39 Cacbohiđrat khi thuỷ phân tạo ra 2 phân tử monosaccarit là 26 . D.C. D. B. C. (C6H10O5)n. to. D.29 Phương trình: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. phản ứng tráng gương. Glucozơ + H2/Ni . Phân biệt saccarozơ và glixerol bằng phản ứng thuỷ phân. (C6H12O6)n. xenlulozơ. Câu 2. (C6H10O5)n. 950. là phản ứng Clorofin hoá học chính của quá trình nào sau đây? A. C. Glucozơ. D. D. hiệu suất thuỷ phân tinh bột và lên men lactic tương ứng là 90% và 80%. [Ag(NH3)2]OH. quá trình quang hợp.

Xenlulozơ. Cu(OH)2. Câu 2. C. B. Saccarozơ. phản ứng thuỷ phân. phản ứng tráng gương. B. B. amilozơ. đều tham gia phản ứng tráng gương.43 Trong máu người. D. C. to. alanin. Câu 2. phản ứng lên men rượu etylic. H2/Ni. C. nồng độ của glucozơ có giá trị hầu như không đổi là A. fructozơ. C.42 Chất không phản ứng với glucozơ là A. xenlulozơ. Câu 2. Mantozơ.47 Tinh bột trong gạo nếp chứa khoảng 98% là A. glucozơ tác dụng với Cu(OH)2. C. D. phản ứng tráng gương. Xenlulozơ. B. D. saccarozơ. D.41 Polisaccarit khi thuỷ phân đến cùng tạo ra nhiều monosaccarit là A. B.1%. có thể dùng 2 phản ứng hoá học là A. 0. C. glucozơ.4%. phản ứng tráng gương. saccarozơ.3%. C. Câu 2. tinh bột. C. Câu 2. Cu(OH)2 ở nhiệt độ thường. amilozơ. amilozơ. 0. Tinh bột. amilopectin. 0. đều hoà tan Cu(OH)2 ở nhiệt độ thường tạo dung dịch màu xanh đặc trưng.A. D.46 Gluxit chuyển hoá thành glucozơ trong môi trường kiềm là A.44 Để xác định trong nước tiểu của người bị bệnh tiểu đường có chứa một lượng nhỏ glucozơ. xenlulozơ.48 Phản ứng chứng tỏ glucozơ có nhiều nhóm OH ở các nguyên tử cacbon liên tiếp nhau là phản ứng với A. đều có trong biệt dược “huyết thanh ngọt”. saccarozơ. B. phản ứng tráng gương. Câu 2. D. oxi hoá glucozơ bằng [Ag(NH3)2]OH. Câu 2. phản ứng cộng hiđro. dung dịch AgNO3 trong dung dịch NH3. glixerol. mantozơ. B. B. amilopectin. khử glucozơ bằng H2/Ni. phản ứng khử Cu(OH)2. Câu 2. D. B. Tinh bột. D.2%. 0. lên men rượu etylic. Câu 2. I2.45 Sobit (sobitol) là sản phẩm của phản ứng A. [Ag(NH3)2]OH. Saccarozơ. tinh bột. D. C. đều lấy từ củ cải đường. 27 .40 Saccarozơ và glucozơ có đặc điểm giống nhau là A. B.

28 . Cu(OH)2. (1). B.1%. (3) vị trí kề nhau. B. (6). (5).2%.C. o C. C. Câu 2. (6). vậy trong phân tử … ở … Tương tự như glucozơ. Câu 2.1% → 0. (2). phản ứng với Cu(OH)2. phản ứng với H2/Ni.1%. (2). Câu 2. A. phản ứng với AgNO3/NH3.54 Phản ứng nào sau đây chứng tỏ glucozơ có dạng mạch vòng? A.51 Khi nào bệnh nhân được truyền trực tiếp dung dịch glucozơ (còn được gọi với biệt danh “huyết thanh ngọt”). (8). (3). C. D.49 Phản ứng chứng minh glucozơ có nhóm chức anđehit là A. D. tác dụng với axit tạo sobitol. D. Lên men glucozơ. bị oxi hoá bởi … trong môi trường bazơ. (8). tác dụng với Cu(OH)2 tạo dung dịch có màu xanh đặc trưng. Cho etilen tác dụng với dung dịch H2SO4 loãng. (2). B. t . (1). (4).50 Phân tử glucozơ tác dụng với Cu(OH)2 cho …. (1). tác dụng với axit tạo este có 5 gốc axit. (4). (4). D. (7). D. Khi bệnh nhân có lượng glucozơ trong máu từ 0. Khi bệnh nhân có lượng glucozơ trong máu < 0. (5). (6). B. (4) fructozơ. nóng. (8). (3). phản ứng lên men rượu etylic. D. Khi bệnh nhân có lượng glucozơ trong máu > 0.53 Fructozơ không phản ứng với chất nào sau đây? A. D. C. (4). (8). AgNO3/NH3. (8) Cn(H2O)m.1%. Câu 2. (1). (5) poliancol. Câu 2. (7). phản ứng với CH3OH/HCl. (7). … cộng với hiđro cho …. Cu(OH)2 ở nhiệt độ cao. B.52 Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm ? A. (2). Thuỷ phân dẫn xuất etyl halogenua trong môi trường kiềm. (7). C. to. Cho hỗn hợp etilen và hơi nước qua tháp chứa H3PO4. Câu 2. phản ứng tráng gương. Khi bệnh nhân có lượng glucozơ trong máu = 0. H2/Ni. (3). (6) phức bạc amoniac. (2) có nhiều nhóm OH. (7) hợp chất hữu cơ tạp chức. B. (6). (5). (3). dung dịch brom. Cacbohiđrat là những … và đa số chúng có công thức chung là … (1) dung dịch màu xanh lam. Từ hay cụm từ thích hợp ở những chỗ trống trong các câu ở đoạn văn trên lần lượt là A. C. (5).

26g.4g. to.32g. 6CO2 + 6H2O C6H12O6 + 6O2 Nếu trong một phút. D.59 Saccarozơ đều tác dụng được với nhóm chất nào sau đây ? (1) H2/Ni. Khối lượng ancol etylic thu được bằng bao nhiêu? A. Z. 90. T lần lượt là 6:1:3:2 và số nguyên tử cacbon trong mỗi chất không nhiều hơn 6. Y. lên men thành ancol etylic. CH2O.09J năng lượng mặt trời. C3H6O3.4g CO2 thì kèm theo 1. (2) Cu(OH)2. giá trị của a là A. D. cho toàn bộ lượng CO2 sinh ra hấp thụ vào dung dịch nước vôi trong tạo thành 10g kết tủa.57 Lên men a g glucozơ. Z.II. 14. C2H4O2. T. (1). 5.55 Phản ứng tổng hợp glucozơ trong cây xanh cần được cung cấp năng lượng là 2813kJ cho mỗi mol glucozơ tạo thành. (2). C2H4O2.BÀI TẬP NÂNG CAO Câu 2. C. 13.56 Cho 10kg glucozơ chứa 10% tạp chất. mỗi cm2 lá xanh nhận được khoảng 2. glucozơ. CH2O. nhưng chỉ 10% được sử dụng vào phản ứng tổng hợp glucozơ. B. (4). Câu 2. C6H12O6. ancol bị hao hụt 5%. D. C2H4O2. C. 15.60 Một cacbohiđrat (Z) có các phản ứng diễn ra theo sơ đồ chuyển hoá sau Cu(OH)2/NaOH to dung dịch xanh lam kết tủa đỏ gạch Z Vậy Z không thể là A.56kg.32g. Câu 2. Trong quá trình chế biến. Z.26g. 29 . Biết hiệu suất của quá trình lên men là 90%. saccarozơ.8g H2O và cần một thể tích oxi vừa đúng bằng thể tích CO2 thu được. 6. 88.84kg. 90. B. Công thức phân tử của X.58 Cho 4 chất hữu cơ X. Câu 2.65kg. 88. (4) CH3COOH (H2SO4 đặc) A. D. 4. C3H6O3. C. Khi oxi hoá hoàn toàn từng chất đều cho cùng kết quả: Cứ tạo ra 4. B. 12. Câu 2. (1). C3H6O3. (2). Khối lượng dung dịch so với ban đầu giảm 3. Câu 2. Y. Tỉ lệ phân tử khối của X. C6H12O6. (4). (3). 4.37kg. B. B. B. Với một ngày nắng (từ 6h00 – 17h00) diện tích lá xanh là 1m2. CH2O. (2). C3H6O3. (3) [Ag(NH3)2]OH. lượng glucozơ tổng hợp được bao nhiêu? A. D. C2H4O2. C6H12O6. C. Y. C. C6H12O6. T lần lượt là A. CH2O.

D. Câu 2. tỉ lệ khối lượng H và O trong X là 0.64 Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh. fructozơ.98g H2O. C12H24O12. được đều chế từ xenlulozơ và axit nitric. Q. 30 .65 Chọn câu đúng trong các câu sau: A. Câu 2. 940. Giá trị m cần dùng là bao nhiêu ? A.28g CO2 và 1. C. Biết rằng.0g kết tủa. D.5. 15.62 Cho m g tinh bột lên men để sản xuất ancol etylic.63 Cho sơ đồ chuyển đổi sau (E. 5031kg.39 lít. (C6H10O5)n C6H12O6 CH3CHO CH3COOH CH3COOC2H5 C. 24. toàn bộ lượng CO2 sinh ra cho qua dung dịch Ca(OH)2 dư. 14. 949. Y. B.39 lít. C12H22O11. Câu 2. 5000kg. mỗi mũi tên biểu thị một phản ứng hoá học). C6H12O6. Câu 2. B.61 Đốt cháy hoàn toàn 0. 950. Xenlulozơ có phân tử khối nhỏ hơn tinh bột. C.52 g/ml) cần dùng là bao nhiêu ? A. Nếu muốn điều chế một tấn ancol etylic. 15. (C6H10O5)n C6H12O6 CH3CHO CH3COONH4 CH3COOH D. X. Công thức của E. Muốn điều chế 29.39 lít. X. (C6H10O5)n. B. D. hiệu suất quá trình là 70% thì khối lượng nguyên liệu xấp xỉ A. Công thức phân tử của X là A. B.00 lít.2. C12H22O11 C6H12O6 CH3COOH CH3COOC2H5 CH3COONa B. thu được 750.125:1.70kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric 96% (D=1. D.0. thu được 5.66 Để sản xuất ancol etylic người ta dùng nguyên liệu là mùn cưa và vỏ bào từ gỗ chứa 50% xenlulozơ. Z là hợp chất hữu cơ. 1000.0. D. Xenlulozơ và tinh bột có phân tử khối gần bằng nhau.01 mol một cacbohiđrat (X). C đều sai. nhưng phân tử khối của xenlulozơ lớn hơn nhiều so với tinh bột. B. Câu 2. C. Q. Xenlulozơ và tinh bột đều có phân tử khối rất lớn. Y. Biết hiệu suất mỗi giai đoạn lên men là 80%. mantozơ. B. Xenlulozơ và tinh bột có phân tử khối nhỏ. A. Z phù hợp với sơ đồ sau là Q X E CO2 C2H5OH Z Y E Q X Y Z A. C.C. Câu 2.

8kg ancol etylic thành ancol 40o.69 Lên men 1 tấn tinh bột chứa 5% tạp chất trơ thành ancol etylic. biết khối lượng riêng của ancol etylic là 0. C12H22O11. B. Có thể phân biệt mantozơ và đường nho bằng vị giác. 31 . xenlulozơ điaxetat và 6. Câu 2. 76.7 lít.8kg. Công thức phân tử của X là A. Câu 2. D.25 lít.C. Câu 2. Câu 2. C. B. đồng thời khối lượng dung dịch tăng 0. 5100kg. hiệu suất của mỗi quá trình lên men là 85%. C. 390kg.4104g X thu được thể tích khí đúng bằng thể tích 0. D. Khối lượng ancol thu được là A. Tinh bột có phản ứng màu với iot do tinh bột có cấu tạo mạch ở dạng xoắn có lỗ rỗng. 1218. B.0855g một cacbohiđrat X.6g CH3COOH. C6H12O6.0815g.84% và 23. 398. C.70 Pha loãng 389.8kg.1g hỗn hợp X gồm xenlulozơ triaxetat. tất cả đều sai.16%. D. C. B. 1402666. Tinh bột và xenlulozơ không thể hiện tính khử vì trong phân tử không có nhóm chức anđehit (–CH=O). D. thu được 11. C18H36O18. 1246.72 Đốt cháy hoàn toàn 0.16%. Muốn tạo ra 500g tinh bột thì cần bao nhiêu lít không khí (đktc) để cung cấp đủ lượng CO2 cho phản ứng quang hợp? Giả thiết hiệu suất quá trình là 100% A. Thể tích dung dịch ancol thu được là A.68 Cho xenlulozơ phản ứng với anhiđrit axetic (xúc tác H2SO4 đặc). B.7 lít.0552g hỗn hợp hơi ancol etylic và axit fomic đo trong cùng điều kiện. 1382666.71 Khí cacbonic chiếm tỉ lệ 0. D. D. 70% và 30%. Câu 2. 389. Câu 2.67 Chọn phát biểu sai: A. B. to. 400kg.8 g/cm3. 77% và 23%. Có thể phân biệt glucozơ và saccarozơ bằng phản ứng với Cu(OH)2 /OH-. tất cả đều sai. Đun nóng dung dịch A lại được 0. C.03% thể tích không khí. C.125 lít. Sản phẩm được dẫn vào nước vôi trong thu được 0. Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A. 1382600 lít. 77.84% và 22. 6200kg. (C6H10O5)n.1g kết tủa nữa. D. Biết khi làm bay hơi 0.1g kết tủa và dung dịch A. 1206.25 lít.

AMIN – AMINO AXIT – PROTEIN A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.60 B 2.63 B 2.52 B 2. NH2 H2N CH CO 1 R .49 D 2.5 C 2.66 A 2.44 C 2.45 A 2. sẽ làm cho tính bazơ tăng lên.72 A 2..23 C 2.8 C 2. R CH COOH.39 C 2.22 B 2.4 D 2.15 A 2.42 D 2.17 D 2.43 A 2.70 C CHƯƠNG III.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG II 2.31 A 2. Tính chất a) Tính chất của nhóm NH2 + Tính bazơ R NH2 + H2O [R NH3]+ + OH- Tác dụng với axit cho muối: R NH2 + HCl [R NH3]+Cl- Lưu ý: Mọi yếu tố làm tăng mật độ electron ở nguyên tử nitơ trong phân tử amin trung hoà nói chung đều làm tăng tính bazơ (trừ trường hợp chịu ảnh hưởng của hiệu ứng che chắn không gian và khả năng solvat hoá trong dung môi nước).57 D 2.48 B 2.16 B 2.30 A 2.35 A 2. NH CH COOH n R amin α .28 C 2.33 C 2.amino axit peptit 2.68 B 2.58 C 2.24 D 2.9 B 2.67 A 2.6 C 2.10 D 2.40 C 2.69 C 2.47 B 2.55 A 2.56 B 2.53 C 2.59 B 2.36 B 2. 32 .25 B 2.54 D 2.26 B 2..1 A 2.61 C 2.11 B 2.12 C 2.32 B 2.41 B 2.29 B 2.3 C 2.27 D 2.46 C 2.  Những nhóm đẩy electron.71 A 2.21 A 2.20 D 2.7 A 2.19 C 2.13 A 2.62 B 2.65 D 2.34 C 2.50 C 2.51 B 2.37 C 2. chẳng hạn các gốc ankyl có hiệu ứng +I.2 B 2.14 A 2.18 B 2.38 D 2. Cấu tạo phân tử: Các nhóm đặc trưng R NH2.64 A 2.

hay ArN2Cl + NaNO2 + HCl  Thí dụ: C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O (1*)    (anilin) (phenylđiazoni clorua) Đun nóng dung dịch muối điazoni: +  t0 C 6 H N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl (2*) →  5   Lưu ý: Trong công thức phân tử không cần viết các phản ứng (1* và 2*). đồng thời trong phân tử xuất hiện hiệu ứng liên hợp p . Ngược lại nhóm phenyl có hiệu ứng –C hút electron. Thực tế HNO2 không bền. ta có thể viết: (CH3)2NH > CH3NH2 > NH3 > C6H5NH2 > (C6H5)2NH > (C6H5)3N. chỉ cần nêu hiện tượng.  Về nguyên tắc. Vì vậy. làm giảm mật độ điện tích âm ở nguyên tử N. − Amin bậc 1 • Amin béo bậc 1 Tác dụng với axit nitrơ tạo ancol tương ứng và giải phóng khí nitơ (hiện tượng sủi bọt khí). ngược lại càng có nhiều nhóm gây hiệu ứng –C tính bazơ sẽ càng giảm. HCl R NH2 + HONO R OH + N2 + H2O NaNO + HCl 2 Thí dụ: C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  • Amin thơm bậc 1 Tác dụng với axit nitrơ trong môi trường axit ở nhiệt độ thấp tạo muối điazoni.π theo chiều chuyển dịch electron hướng vào vòng benzen. 33 . nên phải dùng hỗn hợp (NaNO2 + HCl). Điều này được giải thích là: Amin thơm chứa vòng benzen hút electron. do đó khả năng nhận proton của anilin giảm. + Tác dụng với HNO2 Dựa vào khả năng phản ứng khác nhau đối với HNO 2 của các amin mỗi bậc. sẽ làm tính bazơ yếu đi. Vì vậy các amin mạch hở có tính bazơ mạnh hơn (dung dịch trong nước của chúng có thể làm xanh giấy quỳ) so với amin thơm (Anilin không làm xanh giấy quỳ). ArNH2 + HNO2 + HCl 0-5oC -2H2O ArN2+Cl. người ta có thể phân biệt được chúng. đun nóng dung dịch muối điazoni sẽ tạo ra phenol và giải phóng nitơ. càng thay thế nhiều nguyên tử H trong phân tử NH3 bằng những nhóm có hiệu ứng đẩy electron +I tính bazơ càng tăng.

− Amin bậc 2 Các amin bậc 2 thuộc dãy thơm hay dãy béo đều dễ dàng phản ứng với HNO2 tạo thành nitrozamin (Nitroso) màu vàng: R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (Nitroso – màu vàng) − Amin bậc 3: Không phản ứng (không có hiện tượng gì).amino axit tạo poliamit: NH [CH2]5 CO n + nH2O d) Protein có phản ứng của nhóm peptit CO-NH + Phản ứng thuỷ phân: H 2N CH 1 R H2 N nH2N [CH2]5 COOH to CO HN CH R1 CH CO HN CH R2 CH CO .và ω ... + H2N 4 COOH + nH2O hay2enzim H SO CH2 Rn COOH + Phản ứng màu với Cu(OH)2 cho dung dịch màu xanh tím (dùng để nhận biết protein).. + Tác dụng với dẫn xuất halogen: R NH2 + CH3I R NHCH3 + HI b) Amino axit có tính chất của nhóm COOH Tính axit RCH(NH2)COOH + NaOH RCH(NH2)COONa + H2O Phản ứng este hoá: 2 4 RCH(NH2)COOH + R1OH RCH(NH2)COOR1 + H2O c) Amino axit có phản ứng giữa nhóm COOH và nhóm NH2 Tạo muối nội (ion lưỡng cực): H SO H3N+ CH COO- H2N CH COOH R R Phản ứng trùng ngưng của các ε . e) Anilin và nhiều protein có phản ứng thế dễ dàng nguyên tử H của vòng benzen NH2 NH2 Br Br (trắng) Br (dd) + 3Br2(dd) + 3HBr(dd) 34 . NH CH R3 CH R2 COOH + H2N R3 COOH + H2N Rn COOH+ ..

C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O    +   3. 3R – OH + NH3  (R)3N + 3H2O → C2H5OH → 20. CH3NH3Cl + NaOH  CH3NH2 + NaCl + H2O → 9. R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (nitroso – màu vàng)  → 5. 2R – OH + NH3  (R)2NH + 2H2O → Al 2O3. C6H5–NO2 + 6 [ H ]  → Cũng có thể viết: 16. NH2 Br Br (dd) + 3Br2(dd) Br Fe + HCl + 3HBr(dd) 14. C 6 H 5 N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl →   t0 4. C6H5NH2 + HCl  C6H5NH3Cl → phenylamoni clorua 8. R–NO2 + 6HCl + 3Fe  R–NH2 + 3FeCl2 + 2H2O → Al 2O3. P 17.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP NaNO + HCl 2 1.B . CH3NH2 + H–COOH  H–COONH3CH3 → metylamoni fomiat 7. R – OH + NH3  R–NH2 + H2O → Al 2O3. 2C6H5NH2 + H2SO4  [C6H5NH3]2SO4 → 12. H2N + H2SO4 180oC H2N NH2 SO3H + H2O 13. C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  + NaNO + HCl  2 2. P 19. P 18. R – Cl + NH3  R – NH2 + HCl 1000C 21. C6H5NH2 + H2SO4  C6H5NH3HSO4 → 11. R–NO2 + 6 [ H ]  R–NH2 + 2H2O → Fe + HCl C6H5–NH2 + 2H2O 15. C6H5NH2 + CH3COOH  CH3COONH3C6H5 → 10. CH3 – NH2 + H2O ← CH3 – NH3+ + OH 6. R – NH2 + HCl  R – NH3Cl → 35 .

thêm vài giọt dung dịch H2SO4. p NH[CH2]5CO n + nH2O HN[CH2]6CO n + nH2O 40. Câu 3. 2(H2N)bR(COOH)a + aNa2O  2(H2N)b R(COONa)a + aH2O → HCl  → 32. H2N–R–COOH ← H2N–R–COO. 2R – Cl + NH3  (R)2NH + 2HCl 1000 C C2H5OH → 25. 36 xt. thêm vài giọt dung dịch Na2CO3 D. H2N–R–COOH + HONO  HO–R–COOH + N2↑ + H2O → 39. to.2 Cách thuận lợi nhất để nhận biết lọ đựng dung dịch CH3NH2 là A. C. 2(H2N)bR(COOH)a + bH2SO4  [(H3N)bR(COOH)a]2(SO4)b → 37. CH3CH(Br)COOH + 3NH3  CH3CH(NH2)COONH4 + NH4Br → C. nH2N[CH2]5COOH nH2N[CH2]6COOH xt. 41. B. phenylamin và amoniac đúng là A. nhận biết bằng mùi. H2N–R–COOH + R’–OH ←  H2N–R–COOR’ + H2O  HCl   → 33. H2N–R–COOH + Na  H2N–R–COONa + H2 → 2 30.+ H2O  34.BÀI TẬP CƠ BẢN Câu 3. H2N–R–COOH + R’–OH + HCl ←  [H3N+–R–COOR’]Cl. H2N–R–COOH + HCl  ClH3N–R–COOH → 36.BÀI TẬP TRẮC NGHIỆM I. 2(H2N)bR(COOH)a + aBa(OH)2  [(H2N)bR(COO)a]2Baa + 2aH2O → 1 29.C2H5OH → 22. B. etylamin < amoniac < phenylamin.1 Sự sắp xếp theo trật tự tăng dần tính bazơ giữa etylamin. R – Cl + NH3  R – NH3Cl 1000C 23. 3R – Cl + NH3  (R)3N + 3HCl 1000 C  →  → 26. amoniac < etylamin < phenylamin. Đưa đầu đũa thuỷ tinh đã nhúng vào dung dịch HCl đậm đặc lên phía trên miệng lọ đựng dung dịch CH3NH2.+ NH3  H2N–R–COOR’ + NH4Cl → 35. R – NH3Cl + NaOH  R – NH2 + NaCl + H2O → C2H5OH → 24. D.+ H+ ← H3N+–R – COO  27. phenylamin < etylamin < amoniac. to. C. H2NR(COOH)a + aNaOH  H2N(COONa)a + aH2O → 28. [H3N+–R–COOR’]Cl. ClH3N–R–COOH + 2NaOH  H2N–R–COONa + NaCl + H2O → HCl 38. p . (H2N)b R (COOH)a + aNa  (H2N)bR(COONa)a + → a 2 H2 31. phenylamin < amoniac < etylamin.

Cu(OH)2. B. C. Nếu phân tử khối của A là 50. etanol và lòng trắng trứng? A. N) và ancol metylic. 192. NaOH. 2.000.3g H2O và 1.7 Có 3 chất hữu cơ gồm NH2CH2COOH.5 Số lượng đồng phân amin có chứa vòng benzen ứng với công thức phân tử C7H9N là A. 190.2g CO2. Câu 3. D. C. B. D. Để nhận ra dung dịch của các hợp chất trên. C.5. D. B.8 Este A được điều chế từ amino axit B (chỉ chứa C. quỳ tím. CH2(NH2)COOCH3. 4. CH2(NH2)COOH. HNO3.10 Khi thuỷ phân 500g protein A thu được 170g alanin. glixerol. CH3CH2COOH và CH3[CH2]3NH2. 189. amin cacbonyl oxi hoá Axit phân tử phân tử ion lưỡng B. D. H. C.6 Amino axit là một hợp chất hữu cơ tạp chức. Câu 3. 3.4 Số lượng đồng phân amin bậc 2 ứng với công thức phân tử C4H11N là A. thì số mắt xích alanin trong phân tử A là bao nhiêu? A. 191. Câu 3. B. C. D. D.9 Thuốc thử nào dưới đây dùng để phân biệt các dung dịch glucozơ. C. 4. hiđroxyl metylen khử oxi hoá cation anion D. 5. Công thức cấu tạo thu gọn của A. CH(NH2)2COOH. 2. B. 6. B. xeton metyl axit lưỡng tính nguyên tử cation Câu 3. CH2(NH2)COOCH3. trong phân tử của nó vừa có nhóm …(1)…vừa có nhóm …(2)…nên vừa có tính chất …(3)…vừa có tính chất … (4)…. 3. CH(NH2)2COOCH3.12 lít N2 (đktc). 5. Câu 3. AgNO3/NH3. CH(NH2)2COOCH3. B lần lượt là A. 5.9g este A thu được 13. HCl. Amino axit thường tồn tại dưới dạng …(5)…cân bằng với dạng …(6)… (1) (2) (3) (4) (5) (6) A. CH3OH/HCl. 3. B. C. NaOH. Câu 3. D. 2. 4. O. Câu 3. amino cacboxyl bazơ Axit phân tử cực C. Tỉ khối hơi của A so với H2 là 44. CH(NH2)2COOH. CH2(NH2)COOH. Đốt cháy hoàn toàn 8. chỉ cần dùng thuốc thử nào sau đây? A.Câu 3.3 Số lượng đồng phân ứng với công thức phân tử C3H9N là A. 37 .

Câu 3.11 Chất nào sau đây không có phản ứng với dung dịch C2H5NH2 trong H2O? A. HCl. B. H2SO4. C. NaOH. D. quỳ tím. Câu 3.12 Glixin phản ứng được với tất cả các chất trong nhóm chất nào sau đây (điều kiện phản ứng xem như có đủ): A. Quỳ tím , HCl , NH3 , C2H5OH. B. NaOH, HCl, C2H5OH, CH2 COOH.
NH2

C. Phenoltalein , HCl , C2H5OH , Na. D. Na , NaOH , Br2 , C2H5OH. Câu 3.13 Tìm công thức cấu tạo của hợp chất hữu cơ X chứa 32% C; 6,667% H; 42,667% O; 18,666% N. Biết phân tử X có một nguyên tử N và X có khả năng tham gia phản ứng trùng ngưng. A. H2NCH2COOH. B. C2H5NO2. C. HCOONH3CH3. D. CH3COONH4. Câu 3.14 Hợp chất hữu cơ A có công thức phân tử là C3H7O2N, A tác dụng được với dung dịch NaOH, dung dịch HCl và làm mất màu dung dịch brom. Công thức cấu tạo đúng của A là A. CH3CH(NH2)COOH. B. CH2=CHCOONH4. C. HCOOCH2CH2NH2. D. H2NCH2CH2COOH. Câu 3.15 Cho các chất: etylen glicol (1), axit aminoaxetic (2), axit oxalic (3), axit acrylic (4). Những chất có thể tham gia phản ứng trùng ngưng là A. (1), (2), (3). B. (1), (2). C. Chỉ có (2). D. Cả bốn chất. Câu 3.16 Có các dung dịch chứa trong các lọ mất nhãn sau: Lòng trắng trứng, hồ tinh bột, glixerol. Thuốc thử có thể dùng để phân biệt các dung dịch trên là A. Cu(OH)2. B. I2. C. AgNO3. D. cả A, B đều đúng. Câu 3.17 Số đồng phân của hợp chất hữu cơ thơm có công thức phân tử C7H7NO2 là A. 7. B. 6. C. 5. D. 8. Câu 3.18 Số đồng phân của các chất có công thức phân tử C4H10O (1), C4H9Cl (2), C4H10 (3), C4H11N (4) theo chiều tăng dần là A. (3), (2), (1), (4). B. (4), (1), (2), (3). C. (2), (4), (1), (3). D. (4), (3), (2), (1). 38

Câu 3.19 Cho sơ đồ phản ứng: NaOH C9H17O4N (X)  C5H7O4NNa2 (Y) + 2C2H5OH. → Công thức cấu tạo thu gọn của X, Y lần lượt là A. C2H5OOCCH2CH(NH2)CH2COOC2H5, NaOOCCH2CH(NH2)CH2COONa. B. CH3OOCCH2CH(NH2)CH2COOC3H7, NaOOCCH2CH(NH2)CH2COONa. C. HOOCCH2CH(NH2)CH2COOC4H9, NaOOCCH2CH(NH2)CH2COONa. D. CH3OOCCH2CH(NH2)CH2COOCH(CH3)2, NaOOCCH2CH(NH2)CH2COONa. Câu 3.20 Chọn phát biểu đúng về hợp chất tạp chức: A. Hợp chất hữu cơ có từ hai loại nhóm chức trở lên. B. Hợp chất hữu cơ có từ hai nhóm chức trở lên. C. Hợp chất hữu cơ có nhiều nhóm chức. D. Hợp chất hữu cơ có hai nhóm chức. Câu 3.21 Trong sơ đồ sau, công thức cấu tạo thu gọn phù hợp của A, B, C, D, E lần lượt là
2 2 2 2 + NH 3 + dd NaOH → → → → Etan  A  B  C  D  E  → → 1:1 Cu 1:1 Mn2+ Glixin. A. C2H5Cl, C2H5OH , CH3CHO, CH3COOH , CH3COOCl. B. C2H5Cl, C2H5OH , CH3CHO, CH3COOH, CH2ClCOOH. C. C2H5Cl, C2H5OH , CH3 COCH3, CH3COOH, CH2ClCOOH. D. C2H5Cl, C2H5OH , CH3COOH, CH3COCH3, CH2ClCOOH. Câu 3.22 Cho 3 chất hữu cơ: NH2CH2COOH (1); CH3CH2CH2CH2NH2 (2); CH3CH2COOH (3). Nhiệt độ nóng chảy của chúng được xếp theo trình tự giảm dần là A. (2) < (3) < (1). B. (1) > (3) > (2). C. (3) < (2) < (1). D. (2) > (1) > (3). Câu 3.23 Hợp chất đa chức và hợp chất tạp chức giống nhau ở chỗ A. đều là hợp chất có nhiều nhóm chức. B. đều là hợp chất chứa các nhóm chức giống nhau. C. phân tử luôn có liên kết π. D. mạch cacbon trong phân tử có liên kết π . Câu 3.24 X là một axit α -monoamino monocacboxylic, có tỉ khối hơi so với không khí là 3,07. X là A. glixin. B. alanin. C. axit α - aminobutiric. D. axit glutamic.

+ Cl

+O

+O

+ Cl

39

Câu 3.25 Khi đun nóng chất béo với dung dịch kiềm “....”
A. luôn thu được glixerol và phản ứng xảy ra thuận nghịch. B. luôn thu được glixerol, phản ứng xảy ra nhanh hơn và một chiều. C. luôn thu được muối của axit béo và phản ứng xảy ra thuận nghịch. D. luôn thu được xà phòng, phản ứng xảy ra chậm hơn. Chọn một phương án trong số các phương án trên để điền vào chỗ trống trong câu sao cho đúng ý nghĩa hoá học.

Câu 3.26 Amino axit là
A. hợp chất hữu cơ đa chức, có chứa 2 nhóm chức COOH và NH2. B. hợp chất hữu cơ đa chức, có chứa 2 loại nhóm chức COOH và NH2. C. hợp chất hữu cơ tạp chức, có chứa 2 nhóm chức COOH và NH2. D. hợp chất hữu cơ tạp chức, có chứa 2 loại nhóm chức COOH và NH2.

Câu 3.27 Công thức tổng quát của amino axit là A. RCH(NH2)COOH. B. R(NH2)x(COOH)y. C. R(NH2)(COOH). D. RCH(NH3Cl)COOH. Câu 3.28 Chọn câu phát biểu sai: A. Amino axit là hợp chất hữu cơ tạp chức. B. Tính bazơ của C6H5NH2 yếu hơn NH3. C. Công thức tổng quát của amin no, mạch hở, đơn chức là CnH2n + 3N (n ≥ 1). D. Dung dịch của các amino axit đều làm quỳ tím chuyển sang màu đỏ. Câu 3.29 Hai phương trình phản ứng hoá học sau, chứng minh được nhận định rằng: H2NCH2COOH + NaOH → H2NCH2COONa + H2O. H2NCH2COOH + HCl → HOOCCH2NH3Cl. A. Glixin là một axit. B. Glixin là một bazơ. C. Glixin là một chất lưỡng tính. D. Glixin là một chất trung tính. Câu 3.30 Hợp chất hữu cơ X có công thức cấu tạo thu gọn: HOOCCH2CH2CH(NH2)COOH. Tên gọi của X là A. glixin. B. alanin. C. axit ađipic. D. axit glutamic. Câu 3.31 Cho sơ đồ chuyển hoá sau:
X
H2SO4 - Na2SO4

Y

C2H5OH, H2SO4, to - Na2SO4

CH3

CH

COO

C2H5

NH3HSO4
CH COONa, CH3 CH COOH.

Công thức cấu tạo phù hợp của X, Y lần lượt là
A. CH3 C. CH3 CH COONa, CH3 CH COOH. B. CH3 D. CH3 NH2 CH COONa, CH3 NH2 NH2 CH COOH. NH3HSO4 NH3HSO4 CH COOH, CH3 NH3HSO4 NH2 CH COOH. NH2

Câu 3.32 Phương trình phản ứng hoá học sau chứng minh được rằng: H2NCH2COOH + C2H5OH 40
H+, to

H2NCH2COOC2H5 + H2O.

B. Clo và amin. NH2 C6H5 C. D. Protein có trong mọi bộ phận của cơ thể động vật là hợp chất hữu cơ đa chức. N. Cần dùng thêm các chất phản ứng nào sau đây (không kể xúc tác): A.40 Cho dung dịch metylamin đến dư vào các dung dịch sau: FeCl3. Câu 3. HOOC – CH2 – CH2 – CH(NH2) – COOH. D. 1. Phân tử khối của một amin đơn chức luôn là số chẵn. Câu 3. protein bị thuỷ phân tạo ra các amino axit. Ở nhiệt độ thường dưới tác dụng của men. tất cả A.36 Chọn câu phát biểu sai: A. 41 . D. không xác định được. NaOOC – CH2 – CH2 – CH(NH2) – COOH. Các protein đều chứa các nguyên tố C . Zn(NO3)2. triphenylamin. 0. B. D. Hiđroclorua và amoniac. D.37 Để điều chế glixin theo sơ đồ: Axit axetic → axit cloaxetic → glixin. B. B. CH2 CH COOH. Câu 3. C. Amino axit tham gia phản ứng trùng ngưng. NaOOC – CH2 – CH2 – CH(NH2) – COONa. axit glutamic.225. CH3 CH2 CH C6H5 NH2 COOH. B. B. D. Câu 3. C. B. Tên gọi của X là A.A. Câu 3. glixin.39 Sản phẩm của phản ứng este hoá giữa amino axit X và metanol thu được este có tỉ khối hơi so với propin bằng 2. H nối với O của axit linh động hơn ancol. alanin.35 Công thức cấu tạo thu gọn của axit 2 – amino – 3 – phenylpropanoic là A. Glixin có nhóm COOH. có công thức cấu tạo thu gọn là A. C. H nối với O của ancol linh động hơn axit. D. Câu 3. Clo và amoniac. Amino axit có tính lưỡng tính. anilin. CH2 CH COOH. CuSO4.34 Muối của axit glutamic dùng làm bột ngọt (còn gọi là mì chính). H . điphenylamin. B. B. Glixin có nhóm NH2. C. Một số protein bị đông tụ khi đun nóng. Câu 3. B. CH3 CH2 CH NH2 C6H5 COOH. HOOC – CH2 – CH2 – CH(NH2) – COONH4. C đều sai. C. C. Axit clohiđric và muối amoni. Amin đơn chức đều chứa một số lẻ nguyên tử H trong phân tử. O . C. Câu 3. C6H5 NH2 D.33 Điều khẳng định nào sau đây là sai ? A.38 Tính bazơ của amin nào trong số các amin sau đây là yếu nhất ? A. CH3COOK thì số lượng kết tủa thu được là A.

B. B. C. D. D. Biết trong hỗn hợp. 21. không đủ dữ kiện để tính. Công thức tổng quát của amin no. C.45 Hỗn hợp (X) gồm hai amin đơn chức. CH3 CH2 CH2 CH2 C NH2. kết quả khác. Fe + dung dịch HCl. B.44 Điều chế anilin bằng cách khử nitrobenzen thì dùng chất khử nào sau đây ? A.47 Hợp chất hữu cơ (X) có công thức phân tử CxHyNO có khối lượng phân tử bằng 113u. B. riêu cua nổi lên được giải thích là do: A.41 Cho 15g hỗn hợp các amin gồm anilin. C = O. C. Câu 3. 1. Khối lượng sản phẩm thu được có giá trị là A. 20. kết quả khác. khí H2. D.52g X tác dụng vừa đủ với 200ml dung dịch HCl thu được 2. Công thức cấu tạo của X là CH2 CH2 CH2 A. (CH3COO)2Mg. C. Tính bazơ của các amin đều mạnh hơn NH3. 0. mạch hở tác dụng vừa đủ với dung dịch HCl thu được 5. B. 2. 42 . khi tác dụng với dung dịch NaOH chỉ thu được sản phẩm hữu cơ duy nhất. B. B.43 Khi nấu canh cua. Câu 3. 2. Tất cả các nguyên nhân nêu ở A. C3H9N và C2H7N.42 Cho dung dịch metylamin đến dư vào các dung dịch sau: (CH3COO)2Cu. C.2M.3M.1M. 3. B. Câu 3. Sự đông tụ của protit. C3H9N và C4H11N. kết quả khác.123g.04 mol và 0. đietylmetylamin tác dụng vừa đủ với 50ml dung dịch HCl 1M. đimetylamin. Câu 3. Ngoài ra.04g hỗn hợp Y gồm hai amin đơn chức. D. C. C.02 mol và 0. Các chất bẩn trong cua chưa được làm sạch hết. Câu 3. NH3. X có đặc điểm cấu tạo và các tính chất sau: phân tử có mạch cacbon không phân nhánh. D.C. Có phản ứng hoá học của NaCl với chất có trong nước lọc khi xay (giã) cua. Tổng số mol hai amin và nồng độ mol/l của dung dịch HCl là A. không làm mất màu dung dịch Br2. Cho 1. D.98g muối. D. (CH3COO)2Pb. 16.96g muối. Các amin đều kết hợp với proton. thì số lượng kết tủa thu được là A. Metylamin có tính bazơ mạnh hơn anilin. CH2 CH2 NH O C. no. B. cacbon. Câu 3. CH3COOAg.48 Hãy chỉ ra câu sai trong các câu sau: A. Công thức phân tử của hai amin là A. 0.46 Cho 3.06 mol và 0. C. D. X còn có khả năng tham gia phản ứng trùng hợp. CH5N và C2H7N.825g. 0. mạch hở là CnH2n+2+kNk. 3. H2N[CH2]4 CHO. số mol hai amin bằng nhau. Câu 3. D. 0.18g. metylamin. Câu 3.

là đồng đẳng liên tiếp. B. B lần lượt là NH2 NH2 A. B. D. CH5N và C2H7N. 43 . CH3-CH2-CH2-NH2. 8. thu được 2. B. CH3-C6H4-NH2 . Câu 3. etylamin hoặc đimetylamin. C.50 Có hai amin bậc một gồm A (đồng đẳng của anilin) và B (đồng đẳng của metylamin). II. CH3-C6H4-NH2 . C3H7NH2 và C4H9NH2. C2H7N. CH3 . C4H11N. trong đó nitơ chiếm 80% thể tích (các V đo ở đktc). C2H7N và C3H9N. CH3NH2 và C4H9NH2. D. kết quả khác. D. 12. C3H7N. Công thức cấu tạo của A. C3H9N và C4H11N. X có công thức phân tử là A.24 lít khí CO2 (đktc) và 3.54 Dung dịch X chứa HCl và H2SO4 có pH = 2. Công thức phân tử của 2 amin là A. D. bậc I (có số nguyên tử C nhỏ hơn hoặc bằng 4) phải dùng một lít dung dịch X. 8. C. C. Công thức phân tử của hai amin lần lượt là A. CH3 . đơn chức. Đốt cháy hoàn toàn 3.53 Cho 20g hỗn hợp gồm 3 amin no. 7.51 Đốt cháy hoàn toàn m g một amin A bằng lượng không khí vừa đủ. đimetylamin.Câu 3. CH3-CH2-CH2-NH2. A và C đúng. Câu 3. C4H11N. Biết rằng tên của A có tiếp đầu ngữ “para”. B.49 Đốt cháy hoàn toàn hỗn hợp hai amin no. đơn chức.59g hỗn hợp 2 amin no. etylamin. C2H7N.44 lít khí nitơ.6g hơi nước và 69. C5H11N. D. B.6g khí cacbonic.BÀI TẬP NÂNG CAO Câu 3. C. C3H9N. C5H13N. C. cô cạn dung dịch thu được 31. 9. C3H9N. C3H9N. C5H13N.68g hỗn hợp muối. B. Giả thiết không khí chỉ gồm nitơ và oxi.21g amin A sinh ra khí CO 2. C3H9N.4 lít N2 (các V đo ở đktc). C4H9N. Nếu 3 amin trên được trộn theo tỉ lệ số mol 1:10:5 và thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là A.6g H2O. CH3N. Khi đốt cháy amin B thấy VCO2 : VH2O = 2 : 3 . C4H9-NH2.125g H2O. C2H5NH2 và C4H9NH2. người ta thu được 10. Câu 3. C. thu được 17. CH3-CH-NH2. etylamin. tác dụng vừa đủ với dung dịch HCl.4 lít khí CO2 và 1. CH3 Câu 3. Giá trị m và tên gọi của amin là A. đơn chức là đồng đẳng liên tiếp của nhau. 9. C2H7N. hơi H2O và 336 cm3 khí N2 (đktc).52 Khi đốt cháy hoàn toàn một amin đơn chất X. C4H11N. D. Để trung hoà hoàn toàn 0.

(4)…mà phân tử chứa …(5)…. Câu 3. Amino axit là loại hợp chất hữu cơ . C3H5COONH4. CH3NHC6H3(NH2)2.8 ≤ X < 2.56 Đốt cháy hoàn toàn một amin thơm X thu được 3. C đều đúng. B tác dụng với H mới sinh tạo ra B’. C4H9NO2. C tác dụng với NaOH tạo ra muối và NH 3. 0. H2NCH2CH2COONH4.08g CO2.1 mol X cần 600ml dung dịch HCl 0. C3H5COONH4. D.58 Một hợp chất hữu cơ A mạch thẳng có công thức phân tử là C3H10O2N2. Công thức cấu tạo thu gọn của A. Câu 3.. khi thay thế khi thay thế khi thay thế nguy ên tử hiđr o (2) nguyên tử hiđro cacboxyl (3) một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon (4) luỡng tính tạp chức tạp chức tạp chức (5) đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino (6) tạp chức (7) cacboxyl (8) amino (9) trùng ngưng trùng ngưng trùng ngưng trùng ngưng B. A và B đều đúng. H2NC3H6COOH. A và B đều sai. Mặt khác. Vì có nhóm …(6)… và nhóm …(7)… trong phân tử.4 ≤ X < 1. C.5M. amino cacboxyl 44 .99g H2O và 336ml N2 (đktc). H2NC3H6COOH. C4H9NO2. công thức cấu tạo thu gọn có thể có của X là A.55 Khi đốt cháy mỗi đồng đẳng của ankylamin. C4H9NO2. B’ tác dụng với HCl tạo ra B”. amino nguyên tử hiđro luỡng tính luỡng tính luỡng tính C. B.57 Các chất A. cả A. H2NCH2C6H3(NH2)2. B. C có cùng công thức phân tử C 4H9O2N. Câu 3. 0. B.59 Những từ hay cụm từ thích hợp với những chỗ trống ở các câu trong đoạn văn sau là Amin là những hợp chất hữu cơ được tạo thành …(1)…một hay nhiều …(2)… trong phân tử amoniac bởi …(3)….75 < X ≤ 1. A tác dụng với kiềm tạo thành NH3. C.5. H2NC3H6COOH. C. B. thì tỉ lệ thể tích X = VCO2 : VH2O biến đổi như thế nào theo số lượng nguyên tử cacbon tăng dần trong phân tử ? A. Câu 3. amino axit biểu hiện tính chất …(8)…và tính chất đặc biệt là phản ứng …(9)… (1) A. B” tác dụng với NaOH tạo ra B’. CH3C6H2(NH2)3. C3H5COONH4. Công thức cấu tạo của A là A. 0. D.2. nguyên tử hiđro khi thay thế amino cacboxyl D. C. D. B. Biết X là amin bậc I. 0. 0. H2NC3H6COOH. CH3CH(NH2)COONH4. C lần lượt là A. D.4 ≤ X < 1. C3H5COONH4. Để trung hoà 0. A tác dụng với dung dịch axit tạo thành muối amin bậc I. B. C4H9NO2.Câu 3. Biết A tác dụng với cả HCl và Na2O..

C đều sai. không phân nhánh .61 Khi đốt cháy hoàn toàn đồng đẳng X của axit aminoaxetic. Biết X tác dụng với dung dịch NaOH và dung dịch HCl. C đều sai. H2NCH2COOH. B. Câu 3.05g A khi tác dụng với một lượng NaOH dư. D. Biết A có cấu tạo mạch không phân nhánh và nhóm amino ở vị trí α . chỉ chứa nguyên tố C. thu được VCO2 : VH 2O = 6 : 7 . Biết 0. B đều đúng. H2NCH(NH2)[CH2]2COOH.64 Cho a g hỗn hợp hai amino axit A. cả A. D. H2NCH2COOH. H2N[CH2]4COOH.1 mol A phản ứng vừa hết với 100ml dung dịch HCl 1M tạo ra 18.37. HOOCCH2CH(NH2)COOH.Câu 3.7g chất X. X là hợp chất nào sau đây? A. C. C. khi đốt cháy thu được khí nitơ ở dạng đơn chất. Câu 3. thu được 4. H2NCH(NH2)COOH.928 lít khí CO2 (đo ở 27. Công thức cấu tạo thu gọn của X là A. kết quả khác. Biết rằng. X vừa tác dụng được với dung dịch HCl vừa tác dụng được với dung dịch NaOH.65 A là một amino axit trong phân tử ngoài các nhóm cacboxyl và amino không có nhóm chức nào khác. H. CH2=CH-COONH4. H2N-CH=CH-COOH. Câu 3. B. H2NCH2COOH. ngoài ra còn tác dụng được với nước brom. thì thấy khối lượng bình này tăng thêm 32. mạch hở. 45 . cần 140ml dung dịch KOH 3M. Câu 3.3oC. O.8g. Câu 3. C2H5COONH4 hoặc HCOONH3CH3. Công thức cấu tạo thu gọn có thể có của X là A. CH3NHCH2COOH. Để tác dụng hết với các chất trong dung dịch A. Công thức cấu tạo thu gọn của hai amino axit lần lượt là A. 22. B. H2NCH2CH2COOH. tất cả đều sai.18%. Đốt cháy hoàn toàn một lượng X thu được CO2 và N2 theo tỉ lệ thể tích 4:1. cả A. CH3CH(NH2)COOH. H2NCH2CH2COOH. H2N[CH2]4COOH. D. tạo ra 28. B. D. đốt cháy a g hỗn hợp hai amino axit trên và cho sản phẩm cháy qua dung dịch NaOH dư. CH3CH(NH2)CH2COOH. H. CH2=C(NH2)-COOH. X là hợp chất nào sau đây? A.60 Amino axit X chứa một nhóm chức amin bậc I trong phân tử. C. N và có phân tử khối là 89. N trong đó hiđro chiếm 9.35g muối. B. D. B. B. C.5 mol N2. B. H2NCH2COOH. CH3NH[CH2]3COOH. Cho tỉ lệ phân tử khối của chúng là 1.65g muối khan. Biết rằng. 1atm).62 Hợp chất X chứa các nguyên tố C. nitơ chiếm 18.09%. cả A. 1 chức amino tác dụng với 40. CH3NH[CH2]2COOH. Đốt cháy 7. Công thức cấu tạo thu gọn của A là A. Mặt khác. Mặt khác. 3 mol CO2 và 0.15g dung dịch HCl 20% được dung dịch A. Khi đốt cháy 1 mol X thu được hơi nước. H2N[CH2]3COOH. O. H2N[CH2]3COOH. H2N[CH2]3COOH.63 Hợp chất hữu cơ X có phân tử khối nhỏ hơn phân tử khối của benzen. C. HOOCCH(NH2)COOH. CH3COONH4 hoặc HCOONH3CH3. H2NCH2COOH. B đều no. chứa 1 chức axit.

Câu 3. B và C đều đúng. Thuỷ phân protein bằng axit khi đun nóng sẽ cho một hỗn hợp các amino axit. C. H. B. X có công thức cấu tạo nào sau đây? A. Câu 3. (5) metylamin. (4). B. CH3NHCH2COOH. D.02 mol một amin bậc I (X) với lượng oxi vừa đủ. thu được 18.448 lít (đktc) một khí không bị hấp thụ. CH3CH2NH2. (2) < (1) < (3) < (4) < (5) < (6). N(CH2COOH)3. C. D. NC4H8(COOH)2. Phân tử khối của một amino axit (gồm một chức amino và một chức cacboxyl) luôn luôn là số lẻ.66 X là một α -amino axit no chỉ chứa một nhóm –NH2 và một nhóm –COOH. CH3CH(NH2)2. thể tích khí oxi cần dùng để đốt cháy hết (Y) nhiều hơn để đốt cháy hết (X) là 1. Câu 3. N với tỉ lệ khối lượng tương ứng là 3:1:4:7. H2NCH2CH2COOH. B.0g kết tủa. Công thức cấu tạo thu gọn của (Y) là A. (4).Một số protein bị … khi đun nóng hoặc khi cho thêm một số hoá chất. Cho 15. Câu 3. (3). D. nitơ. Amin luôn luôn phản ứng với H+. kết quả khác. (4) < (3) < (2) < (1) < (5) < (6). (3) cacbon. (2) anilin. (4) đông tụ Những từ hoặc cụm từ thích hợp theo trình tự từ trên xuống là A. (1). Dung dịch amino axit không làm giấy quỳ đổi màu. C3H8ON2. CH3CH2CH(NH2)COOH. Câu 3. CH3CH(NH2)COOH. D. thu toàn bộ sản phẩm qua bình chứa nước vôi trong dư. C. Mọi amin đơn chức đều chứa một số lẻ số nguyên tử H trong phân tử.C.69 Câu khẳng định nào sau đây luôn đúng: A. C. B. Phân tử khối của một amin đơn chức luôn là số chẵn. (1). (1). protein … tạo ra các amino axit. C. (3) p-nitroanilin. Câu 3. (6) đimetylamin.2g và còn lại 0.Các protein đều chứa các nguyên tố … . thấy khối lượng bình đựng nước vôi trong tăng 3. Biết phân tử X có 2 nguyên tử nitơ. B. (4). HOOCCH2CH2CH(NH2)COOH. H2NCH2CH2COOH. D. oxi. (3). Công thức cấu tạo của X là A. H2NCH2CH2NH2.344 lít (đktc). C. (2). B. B. (4) p-nitrotoluen. Lấy một lượng axit aminoaxetic (X) và 3. C. CH3CH2CH(NH2)COOH. (3).71 Đốt cháy hoàn toàn 0. Công thức phân tử của X là A.70 Cho các chất: (1) amoniac.1g X tác dụng với dung dịch HCl dư. C. Câu 3. 46 . (3). khi lọc dung dịch thu được 4.82g (Y). C3H8O2N2. Đốt cháy hoàn toàn lượng (X) và (Y) trên. O. D.73 Hợp chất X chứa các nguyên tố C.Ở nhiệt độ thường dưới tác dụng của men.72 Amino axit (Y) có công thức dạng NCxHy(COOH)m. hiđro. C đều đúng. (1). Hai chất (X) và (Y) có cùng số mol. D. (4).Protein có trong … . (2). Các amino axit đều tan trong nước.75g muối của X.67 Chọn phát biểu sai: A. (2). (2) bị thuỷ phân. D. B.68 Hãy điền những từ hoặc cụm từ thích hợp vào các chỗ trống ở các câu sau . (1) < (4) < (3) < (2) < (5) < (6). (1) < (2) < (4) < (3) < (5) < (6). (2). Trình tự tính bazơ tăng dần theo chiều từ trái sang phải là A. . Câu 3. CH4ON2. B. kết quả khác. D. (1) mọi bộ phận của cơ thể.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG III 3. đồng thời giải phóng những phân tử nhỏ (như H2O.Số mắt xích (n) trong phân tử polime được gọi là hệ số polime hoá hay độ polime hoá.55 C 3.70 C CHƯƠNG IV. .44 D 3.n n.9 C 3. ta phân biệt polime trùng hợp và polime trùng ngưng.22 B 3.42 C 3.26 D 3.51 D 3.14 B 3.63 B 3.66 D 3.69 D 3.11 C 3.10 C 3.M = M’. polime nhân tạo (bán tổng hợp).38 C 3.32 D 3.1 C 3.39 B 3.60 A 3.12 B 3.43 C 3.47 A 3.4 B 3.56 D 3.64 D 3.Theo phản ứng polime hoá.37 D 3. POLIME A.58 C 3.53 A 3.17 A 3.23 A 3.40 B 3.30 D 3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Phản ứng Trùng hợp Mục so sánh Là quá trình kết hợp nhiều phân tử nhỏ giống nhau hoặc tương tự nhau (monome) thành phân tử lớn (polime) Là quá trình kết hợp nhiều phân tử nhỏ thành phân tử lớn (polime).41 A 3.73 A 3.48 B 3.20 A 3.33 A 3. . polime tổng hợp.2 D 3.65 C 3.68 B 3.29 C 3.M = M.15 A 3. ta phân biệt polime thiên nhiên.31 C 3.45 A 5.25 B 3. .67 D 3.61 A 3.34 B 3.18 Có liên kết đôi hoặc vòng Có hai nhóm chức có khả không bền năng phản ứng trở lên Trùng ngưng Định nghĩa Quá trình Sản phẩm Khối luợng Điều kiện của monome 47 .n + n.5 D 3.72 C 3.6 B 3.…) n Monome → Polime n Monome → Polime+ nH2O Polime trùng hợp Polime trùng ngưng n.3 C 3. Khái niệm về polime Polime là các hợp chất có phân tử khối rất lớn do nhiều đơn vị nhỏ gọi là mắt xích liên kết với nhau tạo nên.52 C 3.50 B 3.Theo nguồn gốc.24 B 3.7 D 3.62 C 3.35 B 3.18 A 3.36 A 3.49 A 3.57 D 3.13 A 3.59 C 3.54 D 3.21 B 3.46 A 3.28 D 3.71 D 3.16 A 3.19 A 3.8 C 3.27 B 3.

Phản ứng giữ nguyên mạch polime: Phản ứng cộng vào liên kết đôi hoặc thay thế các nhóm chức ngoại mạch. B . Đa số polime có tính dẻo.Phản ứng cắt mạch polime: Polime bị giải trùng ở nhiệt độ thích hợp. Nhựa a) Nhựa PE nCH2 CH2 xt.2.Phân tử polime có thể có cấu tạo điều hoà (nếu các mắt xích nối với nhau theo một trật tự xác định) và không điều hoà (nếu các mắt xích nối với nhau không theo một trật tự nào cả).Vật liệu compozit: vật liệu tổ hợp gồm polime làm nhựa nền và các vật liệu vô cơ.Cao su: vật liệu có tính đàn hồi. to. 3. hữu cơ khác.Chất dẻo: vật liệu polime có tính dẻo. dạng mạch phân nhánh và dạng mạch không gian. to. Polime có nhóm chức trong mạch như –CO-NH. bền. p CH2 etilen CH2 n polietilen(PE) b) Nhựa PVC nCH2 CH Cl vinyl clorua xt. . b) Tính chất hoá học: có 3 loại phản ứng .Phản ứng khâu mạch polime: Phản ứng tạo cầu nối giữa các mạch (cầu -S-S. . . . không có nhiệt nóng chảy xác định. Thí dụ: t CH2 CH n + nCH3COONa CH CH2 n + nNaOH OCOCH3 OH .MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. Cấu trúc . Khái niệm về các vật liệu polime o . p CH2 CH n Cl poli(vinyl clorua) (PVC) c) Nhựa PS 48 .Tơ: vật liệu polime hình sợi. . một số polime có tính đàn hồi. một số tan trong các dung môi hữu cơ. có thể kéo thành sợi.Phân tử polime có thể tồn tại ở dạng mạch không phân nhánh. một số có tính dai. -COOCH2. Tính chất a) Tính chất vật lí Hầu hết polime là chất rắn.hay -CH2-) thành polime mạng không gian hoặc phản ứng kéo dài thêm mạch polime.Keo dán hữu cơ: vật liệu polime có khả năng kết nối chắc chắn hai mảnh vật liệu khác. không bay hơi. .dễ bị thuỷ phân khi có mặt axit hay bazơ. dài và mảnh. 4.

OH OH n + nHCHO H .. CH2 CH2 CH2OH CH2 CH2 OH . p CH CH2 C6H5 n d) Nhựa PVA nCH2 CH OCOCH3 xt. 49 . to. − Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian.. to. OH . − Nhựa novolac: Nếu dư phenol và xúc tác axit. to.fomanđehit) (PPF) có 3 dạng: nhựa novolac..nCH C6H5 CH2 xt.t + o CH2 n + nH2O − Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. nhựa rezit. p CH CH2 n OCOCH3 Thuỷ phân PVA trong môi trường kiềm: CH CH2 n + nNaOH OCOCH3 to CH2 CH n + nCH3COONa OH CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) e) Nhựa PMM (thuỷ tinh hữu cơ . p CH3 metyl metacrylat f) Nhựa PPF Poli(phenol .plexiglas) nCH2 CH COOCH3 xt. nhựa rezol..

Cao su a) Cao su buna Na.. p.... H2C . p C CH CH2 n CH3 poliisopren (cao su isopren) CH2 o CH2 t . p.. to. xt CH2 CH CH CH2 CH C6 H 5 CH2 n d) Cao su buna – N nCH2 CH CH CH2 + nCH CN o CH2 t . Tơ a) Tơ capron (nilon – 6) 50 . p CH2 C F CH CH2 n 3.3-dien (isopren) c) Cao su buna – S nCH2 CH CH CH2 + nCH C6 H 5 nCH2 xt... xt CH2 CH C Cl CH2 n f) Cao su flopren nCH2 C F xt.... xt CH2 CH CH CH2 CH CN CH2 n e) Cao su clopren nCH2 CH C CH2 Cl CH CH2 to. . . t nCH2=CH− CH=CH2  → 0 ( CH 2 CH = CH CH 2 )n buta-1. p. H2 C .CH2 OH OH CH2 OH CH2 OH CH2 CH2 OH CH2 CH2 OH CH2 CH2 CH2 ..3-đien (butađien) b) Cao su isopren polibutađien (cao su buna) C CH CH2 CH3 2-metylbuta-1. 2. . to..

tơ nilon có các nhóm (. tơ nilon kém bền với nhiệt.CO . axetilen (6). tơ nilon mềm mại. to. Len. p CH2 CH CH CH Cl xt. Len. vì: A. to.3 Không nên ủi (là) quá nóng quần áo bằng nilon. NHCH(CH3)CO n . NH[CH2]5CO n .1 Hợp chất đầu và các hợp chất trung gian trong quá trình điều chế ra cao su buna (1) là: etilen (2). p NH[CH2]5CO n b) Tơ enang (nilon – 7) nH2N[CH2]6COOH c) Tơ nilon – 6. B.NH -) trong phân tử kém bền với nhiệt. 6 → 4 → 2 → 5 → 3 → 1. tơ tằm. D. 6 B. to. tơ tằm. Len. Hãy sắp xếp các chất theo đúng thứ tự xảy ra trong quá trình điều chế A. NH[CH2]6CO n . Len. tơ nilon dễ cháy.6 có công thức là A.6) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH xt. len. tơ tằm. NH[CH2]6NHCO[CH2]4CO n . D. C. 4 → 6 → 3 → 2 → 5 → 1. đivinyl (5). Câu 4. p n 2 n + HCl 2 Cl Cl e) Tơ dacron (lapsan) nHOOC C6H4 COOH + nHO CH2 CH2 axit terephtalic etylen glicol CO OH C6H4 CO O CH2 CH2 O n + 2nH2O poli(etylen terephtalat) (lapsan) C. 3 → → 2 → 4 → 5 → 1. to. p HN[CH2]6CO n + nH2O NH[CH2]6NHCO[CH2]4CO n + 2nH2O d) Tơ clorin CH2 CH CH2 Cl CH Cl n 2 + n 2 Cl2 xt. p CH2 C=O NH xt. D. C. tơ tằm. metan (3). tơ tằm.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 4. to. rượu etylic (4). p NH[CH2]5CO n + nH2O xt. Câu 4.2 Tơ nilon – 6. C. B.nH2N[CH2]5COOH n CH2 CH2 CH2 CH2 xt. 51 . 2 → 6 → 3 → 4 → 5 → 1. to.

Z trong sơ đồ trên lần lượt là A. C. B. CH2 C(COOCH3) CH3 n D. D. H2S.12 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – S? 52 .S được điều chế bằng : A. nhựa phenol-fomanđehit. Phản ứng đồng trùng hợp.5 Khi H2SO4 đậm đặc rơi vào quần áo bằng vải sợi bông. butađien. nhựa bakelít. Tất cả đều sai. tơ tằm. Câu 4.10 Tên của polime có công thức sau là OH CH2 n A. Etilen. Polimetyl metacrylat (PMM). Câu 4. (3). Axetilen. nhựa dẻo. CH CH2 C6H5 n . C. butađien.7 Cao su buna – S có công thức là A. (3). Câu 4. Phản ứng trùng hợp. Phản ứng đồng trùng ngưng. (2). PbS.Câu 4. Câu 4.8 Cao su buna . etanol. CH ≡ CH(2). etanol. Phản ứng trùng ngưng. (3). B. vinylaxetilen. n . (2). (2). D. cacbon. polistiren.11 Tơ enang thuộc loại A. chỗ vải đó bị đen lại do có sản phẩm tạo thành là A. Câu 4. butađien. B. D. CH2=CH–Cl(3). Anđehit axetic.6 Cho sơ đồ sau: CH4 → X → Y → Z → cao su buna. (1).9 Thuỷ tinh plexiglas là polime nào sau đây? A. Polivinyl axetat (PVA). B. B. D. CH2 CH CH CH2 n . CH3–CH3(4) A. D. (4). (3). Tên gọi của X . C. Câu 4. Polimetyl acrylat (PMA). D. Câu 4. Y . B. S. C. C. butađien. C. (1). tơ poliamit. CH2 C. D. B. B. CH CH CH2 CH CH2 C6H5 . tơ polieste.4 Những phân tử nào sau đây có thể tham gia phản ứng trùng hợp ? CH2=CH2(1). vinylaxetilen. Axetilen. tơ axetat. (1). C. Câu 4.

nCH2 CH CH CH CH CH C Cl C CH CH2 to. X tham gia phản ứng trùng hợp được một loại cao su. nCH2 D. .13 Phản ứng nào sau đây tạo ra sản phẩm là cao su isopren? A. B. axit oxalic. Công thức cấu tạo thu gọn của X là . xt to. CH2 CH2 n n . CH C CH2 n CH3 CH2 CH CH CH2 n CH C6H5 CH2 .CH2 C CH CH2 . p. xt to.6. axit axetic. nCH2 D. nCH2 CH CH CH CH CH C Cl C CH CH2 CH2 CH2 to. xt CH2 CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . p. xt to.16 Để điều chế nilon . D. . m CH3 CH2 + mCH C6H5 to. CH2 CH2 n n . p.6 người ta dùng axit nào để trùng ngưng với hexametylen điamin ? A.CH3 CH2 C CH B. m . CH3 Câu 4. xt CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . CH C CH2 n . nCH2 B. Cl . A. D. Câu 4. p. axit ađipic. p. nCH2 B. p. p. CH3 CH2 + mCH C6H5 o CH2 t . p. xt CH2 CH2 to. m CH3 CH2 + mCH C6H5 o CH2 t . p. p. .CH2 CH3 CH CH CH2 . xt CH2 CH2 CH2 CH CH CH2 n . xt Câu 4. axit stearic.CH3 C C CH2 . C. C.17 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – N? 53 .15 Hiđro hoá hợp chất hữu cơ X được isopentan. p. nCH2 C. nCH2 D.14 Phản ứng nào sau đây tạo ra sản phẩm là cao su cloropren? A. nCH2 CH CH CH CH CH C Cl C CH CH2 to. xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. nCH2 C. xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. p. xt CH2 CH2 to.A. nCH2 C. xt to. nCH2 B.

p. chất dẻo. D. B. C. Câu 4. B. caprolactam. A. nhựa bakelít. CH CH CH2 CH2 CH CN CH2 n . B. –NH– trong phân tử. trùng hợp axit acrylic. B. Câu 4. axit acrylic. nCH2 CH CH CH2 + nCH CN CH o CH2 t . B.CH2 CH3 CH CH2 CH2 CH3. D. D. trùng ngưng HOOC-(CH2)4-COOH.26 Một polime Y có cấu tạo mạch như sau: 54 . p. nCH2 CH D. C.21 Tơ enang được điều chế bằng cách A. –CH(CN)– trong phân tử.CH3 CH3 CH2 C CH. axit metacrylic.20 Tơ capron được điều chế từ monome nào sau đây ? A. xt CH3 n n .A. Câu 4.24 Từ monome nào sau đây có thể điều chế được poli(vinyl ancol) ? A. nCH2 B. m C. p. B. trùng ngưng alanin. D. C. –CO–NH– trong phân tử. xt CH2 CH CH2 CH o CH2 + mCH CH2 t .CH2 CH OCOCH3. . D. C. C. Câu 4. caprolactam. axit metacrylic. axit caproic.CH2 C CH CH2. Câu 4. nhựa PVC. –CO– trong phân tử.CH2 CH COOC2H5.23 Chất có khả năng trùng hợp thành cao su là B. CH C6H5 CH2 .22 Nhựa PS được điều chế từ monome nào sau đây? A.19 Sản phẩm của phản ứng trùng hợp metyl metacrylat được gọi là A. p. D.18 Tên của monome tạo ra polime có công thức CH3 C CH2 n COOH là A. C. B. C. CH3 C C CH2.CH2 CH COOCH3. C. thuỷ tinh hữu cơ. Câu 4. trùng ngưng H2N-(CH2)6-COOH. D. phenol. xt C6H5 n Câu 4. phenol. D.CH2 CH CH2 OH. stiren. axit metacrylic. Câu 4. metyl metacrylat. Câu 4. xt CH2 CH2 CH C CH C Cl CH2 CH2 to.25 Tơ poliamit là những polime tổng hợp có chứa nhiều nhóm A. metyl acrylat. nCH2 CH CH C CH2 CH3 C Cl CH2 to.

Tỉ lệ số mắt xích (butađien : stiren) trong loại polime trên là A. C. Vậy.6 có phân tử khối (M = 2500) là 55 .… − 2− 2− 2− 2− 2− 2− 2− 2− … CH CH CH CH CH CH CH CH Công thức một mắt xích của polime Y là A. B. Polime là những chất có phân tử khối rất lớn do nhiều mắt xích liên kết với nhau. còn tinh bột và xenlulozơ là loại polime tổng hợp. Y lần lượt là: A. Công thức cấu tạo thu gọn của X. 1.731 gam Br2. Câu 4.31 Cho sơ đồ phản ứng sau: → xt . 3. D. 4. Hầu hết các polime không tan trong nước và các dung môi thông thường. − 2− 2− CH CH . Trong X có chứa 66. C6H5CH2CHO. D. trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo ? B. → X có công thức phân tử C8H10O không tác dụng với NaOH. − 2− 2− 2− CH CH CH . B.29 Tiến hành phản ứng đồng trùng hợp giữa stiren và buta – 1. A.27 Tiến hành clo hoá poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. B. NHCH(CH3)CO n . − 2− 2− 2− 2− CH CH CH CH .B. D. II – BÀI TẬP NÂNG CAO Câu 4. C6H5CH2CH2OH. D.30 Chọn câu phát biểu sai: A. Câu 4. D. C. C. Câu 4. C6H5CH2CH2OH. Polietilen và poli(vinyl clorua) là loại polime thiên nhiên. C. C6H5COCH3. − 2− CH .3 – đien (butađien).28 Tơ capron (nilon – 6) có công thức là NH[CH2]5CO n . Cứ 2. NH[CH2]6NHCO[CH2]4CO n . 2. CH3-C6H4CH2OH . 1 : 3. 2 : 3. Câu 4.32 Hệ số trùng hợp (số mắt xích) của tơ nilon – 6.834 gam X phản ứng vừa hết với 1. C6H5CH=CH2. 1 : 1. B. C6H5CH=CH2. 1 : 2. C. NH[CH2]6CO n . C. thu được polime X. t o . p − H 2O X  Y  polime. Các vật liệu polime thường là chất rắn không bay hơi.18% clo theo khối lượng. Câu 4. D. C6H5CH(CH3)OH. A.

ancol etylic.33 Điều chế nhựa phenol-fomanđehit (1). xenlulozơ. (6). PVC. PVC. axetilen (8).  5%  5 Câu 4. (2). (3). amilozơ . amilozơ. PE. anđehit fomic (4). cao su buna . xenlulozơ. amilozơ. (5). = . 6235 m3. (4). Polime có dạng cấu trúc mạch không phân nhánh là A. (8). D. 56 . (8). 10. poli(vinyl ancol). cao su buna. (7). (1) → (4) → (5) → (6). y 5 Câu 4. = . (5). Câu 4. D. thu được hỗn hợp khí và hơi (CO2. etilen (9). D. D. (1) → (3) → (2) → (5) → (6). x 3 = . (2). benzen (3). y 3 y 3 C. amilopectin. (4). (4). (6). (3). cao su lưu hoá. (1). C. C. benzyl clorua (6). (9). (3). B. (2). xenlulozơ. Câu 4. (10). C. PVC. (9). Hãy cho biết sơ đồ chuyển hoá nào sau đây có thể dùng để điều chế poli(vinyl clorua) ? A. H2O. Biết CH4 chiếm 95% thể tích khí thiên nhiên. B. 11. Chọn các chất thích hợp cho sơ đồ đó là A. 12. 13. C. (3). Đốt cháy hoàn toàn một lượng polime này. phenyl clorua (10). PE. y 2 D. các chất đầu và chất trung gian trong quá trình điều chế là: metan (2). B. (5). 7225 m3. (1). metan (3). xenlulozơ. PVC. (2). thu được một loại polime.A. (1). amilopectin. (1) → (2) → (4) → (5) → (6). Câu 4. 5883 m3.69% CO2 về thể tích. C.38 Cho các chất sau: butan (1). B. nhựa PVC (6). PE. 4576 m3.35 Cho các polime : PE. ancol vinylic. B. (7). natri phenolat (7). Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 x 2 A. B. D. (5). cả A và B. N2) trong đó có 57.37 Đồng trùng hợp đimetyl buta–1. (7).3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y. axeton. (1). x 3 = . cao su lưu hoá. vinyl clorua (5). C. vậy để điều chế một tấn  0% PVC thì số m3 khí thiên nhiên (đktc) cần là A.cao su buna. B.36 Chất dẻo PVC được điều chế theo sơ đồ sau: CH 4  H = 1 → A  H = 9%→ B  H = 9 → PVC. D. etilen (4).34 Đun nóng poli (vinyl axetat) với kiềm ở điều kiện thích hợp ta thu được sản phẩm trong đó có A. etin (2). amilozơ. PE. amilopectin. cao su buna. (6). phenol (5). Câu 4. PVC.

hai phản ứng (1) và (2). ancol etylic.40 Có thể phân biệt các đồ dùng làm bằng da thật và da nhân tạo (PVC) bằng cách nào sau đây? A. p HN[CH2]6CO xt. HOOC-C6H4-COOH. ta thu được sản phẩm trong đó có: A. So sánh khả năng thấm nước của chúng. tơ xenlulozơ axetat) và tơ thiên nhiên (tơ tằm. B. C.41 Đun nóng vinyl axetat với kiềm ở điều kiện thích hợp. n CH2 CH CH CH n + 2HCl . p n + nH2O . C. C đều đúng. lụa sản xuất từ tơ thiên nhiên dễ may hơn lụa sản xuất từ tơ nhân tạo. HO-CH2-COOH. phản ứng nào thuộc loại phản ứng trùng ngưng ? (1) nH2N[CH2]6COOH xt. axeton. cả A. Câu 4. Công thức của X. B. da thật ở vết cắt bị xơ. mẫu da thật cho mùi khét. So sánh độ mềm mại của chúng. D.42 Xét các phản ứng sau đây. tơ thiên nhiên (tơ tằm. còn mẫu lụa sản xuất từ tơ nhân tạo không cho mùi khét. Dùng kim may (máy may) may thử vài đường chỉ trên lụa. hai phản ứng (2) và (3). 57 . mẫu lụa sản xuất từ tơ thiên nhiên cho mùi khét. mềm mại hơn tơ nhân tạo. C. B. anđehit axetic. Đốt hai mẫu da. còn da nhân tạo không cho mùi D. Cl Cl Cl 2 (2) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH (3) CH2 CH CH2 CH Cl Cl n 2 2 xt. HOOC-CH2CH2-COOH. So sánh độ bóng của lụa. D. to. So sánh độ mềm mại của chúng. D.39 Khi cho hai chất X và Y trùng ngưng tạo ra polime Z có công thức O CH2 CH2 O C C6H4 C n O O . còn da nhân tạo thì bóng. Y lần lượt là A. chỉ phản ứng (3). to. B. Đốt hai mẫu lụa. nhẵn Câu 4. D. HO-C6H4-OH. B. lụa sản xuất từ tơ thiên nhiên có độ bóng cao hơn lụa sản xuất từ tơ nhân tạo.43 Để phân biệt lụa sản xuất từ tơ nhân tạo (tơ visco. Câu 4. Dùng dao cắt ngang hai mẫu da. p + n Cl2 A. C. B. len).Câu 4. NH[CH2]6NHCO[CH2]4CO n + 2nH2O . C. chỉ phản ứng (1). HO-C6H4-COOH. da thật dễ thấm nước hơn. khét. ancol vinylic. HO-CH2-CH2-OH. to. len) người ta dùng cách nào sau đây? A. Câu 4. da thật mềm mại hơn da nhân tạo.

tơ polieste.7 C 4. CH2 = CH – COOCH3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. B.49 Khi đốt cháy một loại polime chỉ thu được khí CO 2 và hơi H2O với tỉ lệ n CO2 : n H2O = 1:1 . (6). CH3COOCH = CH2. D.46 Polime ( CH 2 CH(OH) ) n là sản phẩm của phản ứng trùng hợp sau đó thuỷ phân trong môi trường kiềm của monome nào sau đây ? A. – CH2 – CHCl – . (7).12 D 4.9 A 4. protein.48 B 4. Vị trí của kim loại: ô nguyên tố (Z).23 A 4. B. D. Loại tơ có nguồn gốc xenlulozơ là A.45 Tơ lapsan thuộc loại A.43 C 4.13 C 4. Câu 4. CH2 = CHCOOCH2CH = CH2. (7) tơ axetat.33B 4.22 D 4. Công thức một mắt xích của X là A.14 B 4.34 C 4.39 A 4. Cấu tạo của kim loại: thường có 1. C.24 B 4. (2). 2. polime trên thuộc loại nào trong số các polime sau ? A.17 C 4.29 B 4.21 C 4.25 A 4. 2. C.19 D 4.30 D 4.46 B 4. (3).20 B 4. (2). – CHCl – CHCl – .41 C 4.48 Cho các polime sau đây: (1) tơ tằm. (6) nilon – 6.26 D 4. Câu 4. 3 electron ở lớp ngoài cùng.4 D 4.32 B 4. số thứ tự nhóm B (số electron ngoài cùng + số electron kề ngoài cùng chưa bão hoà).10 A 4. – CCl = CCl – . D. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IV 4. 215kg và 80kg. (4) tơ enang. (2).31 C 4. C.11 B 4.1 A 4.8 B 4.6. ĐẠI CƯƠNG VỀ KIM LOẠI A. (7). tơ axetat.47 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu ? Biết hiệu suất quá trình este hoá và trùng hợp lần lượt là 60% và 80%.35 D 4. B. (6). Câu 4. tơ visco. số thứ tự nhóm A (số electron ngoài cùng).47 A 4.5 A 4. (1).15 C 4. C.49 B 4.40 C CHƯƠNG V. 171kg và 82kg.6 C 4.18 C 4. 175kg và 70kg. (5) tơ visco. tinh bột. (3). B. polietilen.38 D 4.27 B 4. H. Vậy.Câu 4. D.44 A 4.37 A 4. B. tơ poliamit. (5). C2H5COOCH2CH = CH2.45 C 4. 65kg và 40kg. chu kì (số lớp electron). Câu 4. Cl) có hệ số trùng hợp là 560 và phân tử khối là 35. (2) sợi bông. B.16 D 4.2 C 4. A. (6).28 A 4. (5). poli(vinyl clorua). Câu 4. C. – CH = CCl – .44 Polime X (chứa C.42 C 4. (3) sợi đay. C.36 A 4. D. D.000. 58 .3 B 4.

Ăn mòn hoá học là quá trình oxi hoá . 6. Fe + Cu2+ → Fe2+ + Cu . các điện cực tiếp xúc với nhau. 3Cu + 8HNO3 → 3Cu(NO3)2 + 2NO + 4H2O .khử. trong đó các electron của kim loại được chuyển trực tiếp đến các chất trong môi trường. H2SO4 đặc nguội.Ăn mòn điện hoá là quá trình oxi hoá . . hợp chất khử chứa nguyên tố có số oxi hoá thấp lên cao và nó bị khử xuống mức oxi hoá thấp hơn. . phi kim.khử.Tác dụng với dd muối Kim loại mạnh (trừ Ba. Nhớ thứ tự các cặp oxi hoá khử sau : Cu2+/Cu Fe3+/Fe2+ Ag+/Ag 2 Fe3+ + Cu → Cu2+ + 2Fe2+ Fe3+ không oxi hoá Ag. H2SO4 loãng : M + n H+ → Mn+ + Kim loại sau H không khử được H+ thành H2. .Tác dụng với dd HNO3. với cặp kim loại A─B. Hợp kim có t0 nóng chảy thấp hơn. Al. các điện cực cùng tiếp xúc với 1 dung dịch chất điện li. 9. K.Tác dụng với H2O IA. H2SO4 đặc Dung dịch HNO3.Dãy điện hoá kim loại cho phép dự đoán chiều phản ứng giữa 2 cặp oxi hoá khử : chất oxi hoá mạnh nhất sẽ oxi hoá chất khử mạnh nhất sinh ra chất oxi hoá yếu hơn và chất khử yếu hơn. Tính chất hoá học chung: tính khử : M  M n+ + ne → . IIA (trừ Be. ánh kim do các electron tự do gây ra. . Na) khử ion của kim loại yếu hơn trong dd muối thành kim loại tự do.3 điều kiện cần và đủ để kim loại bị ăn mòn điện hoá : các điện cực khác chất.Tác dụng với axit HCl. 5. Liên kết kim loại: lực hút tĩnh điện giữa các electron tự do và các ion dương kim loại. nhưng cứng hơn kim loại nguyên chất. 4. H2SO4 đặc oxi hoá kim loại (trừ Pt.Fe. Hợp kim: là vật liệu kim loại có chứa một kim loại cơ bản và một số kim loại khác hay với một vài hợp kim. 59 . Cấu tạo của đơn chất kim loại: mạng tinh thể gồm có các ion dương dao động liên tục ở các nút mạng và các electron tự do chuyển động hỗn loạn giữa các ion dương. Tính chất vật lí chung của kim loại: tính dẻo. Sự ăn mòn kim loại: là sự oxi hoá kim loại do tác dụng của các chất trong môi trường xung quanh : M → Mn+ + ne . Cr thụ động trong dd HNO3 đặc nguội. trong đó kim loại bị oxi hoá do tác dụng của dung dịch chất điện li và tạo nên dòng electron chuyển dời từ cực âm đến cực dương. Mg) khử H2O ở t0 thường thành H2. dẫn điện và dẫn nhiệt kém hơn kim loại nguyên chất. Au). muốn B được bảo vệ thì A phải có tính khử mạnh hơn B. dẫn điện.3. Ca. dẫn nhiệt. Na + 2H2O → 2NaOH + H2 .Tác dụng với phi kim : xM + M+ y O2 → MxOy 2 n Cl2 → MCln 2 n H2 2 . 8.Chú ý rằng. .

Nguyên tắc điều chế kim loại: là sự khử ion kim loại : Mn+ + ne → M . Na) * Phương pháp nhiệt luyện cần có 1 trong 4 chất khử (H2. * Phương pháp điện phân nóng chảy để điều chế kim loại IA. . n là hoá trị (hoặc số mol electrron trao đổi tính cho 1 mol chất thoát ra ở điện cực.96500 Trong đó I là cường độ dòng điện tính bằng Ampe. ne là số mol electron trao đổi trong quá trình điện phân. C. Al. * Phương pháp điện phân dung dịch để điều chế kim loại sau Al. A là nguyên tử khối (hoặc phân tử khối).It n 96500 Trong đó I là cường độ dòng điện tính bằng Ampe. IIA. b) It = ne. K. t là thời gian điện phân tính bằng giây.10. Al) và oxit của kim loại cần điều chế (sau Al). 60 . Công thức của định luật Farađay a) m = A 1 . t là thời gian điện phân tính bằng giây.Các phương pháp điều chế kim loại : * Phương pháp thuỷ luyện cần có dung dịch muối của kim loại cần điều chế (sau Al) và kim loại có tính khử mạnh hơn (trừ Ba. Ca. 11. m là lượng chất thoát ra ở điện cực theo gam. CO.

Na + H2O  NaOH + H2 → 2 8.B. Fe2O3 + 3CO  2Fe + 3CO2 → t0 16. Al2O3  2Al + O2 → 2 ñpnc 18. 2FeCl3 + Fe  3FeCl2 → 11. MgCl2  Mg + Cl2 → ñpdd 23. CuSO4 + H2O  Cu + → 26. Fe + CuSO4  FeSO4 + Cu → 10. Fe + S  → t0 3. 2AgNO3 + H2O  2Ag + O2 + 2HNO3 → 2 ñpdd 24. CuCl2  Cu + Cl2 → 0 1 O2 + H2SO4 2 1 ñpdd 25. 3Fe + 2O2  → 4. 2NaOH  2Na + O2 + H2O → 2 ñpnc 20. Fe + 3AgNO3. H2 + PbO  H2O + Pb → t0 15. Fe + 4HNO3  Fe(NO3)3 + NO + 2H2O → >570 C 6. Fe + H2O → FeO + H2 1 7.MỘT SỐ PHẢN ỨNG THƯỜNG GẶP t 1. Ba + 2H2O  Ba(OH)2 + H2 → 0 9. 2Fe + 3Cl2  → 0 t 2. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 61 . dư  Fe(NO3)3 + 3Ag → t 14. Fe2(SO4)3 + Cu  CuSO4 + 2FeSO4 → 12. 2NaCl  2 Na + Cl2 → 1 ñpnc 19. Fe + 2AgNO3  Fe(NO3)2 + 2Ag → 13. 3Fe3O4 + 8Al  4Al2O3 + 9Fe → 3 ñpnc 17. Fe + 2HCl  → 0 2FeCl3 FeS Fe3O4 FeCl2 + H2 5.

Ca. B. C. Câu 5. D. B. Ca2+. B.6g khí H2 bay ra. 63. 53. C. chu kì 4. Cl. Ar. D.5 Cation M có cấu hình electron ở phân lớp ngoài cùng là 2p6.5M. chu kì 4. nhóm VIIIA. C. ô 26. chu kì 4. C. nhóm IIA. 62 . Câu 5. Câu 5. Ar. D. C. ô 26. chu kì 4. ô 18. D. ô 26. liên kết giữa các nguyên tử bằng các cặp electron dùng chung.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 5. Ar.7. Be.7. ô 18.2 Ion M có cấu hình electron ở lớp ngoài cùng là 3s 23p6.8 Liên kết kim loại là A. Dãy gồm các nguyên tử và ion có cấu hình electron trên là A.4 Cho cấu hình electron: 1s22s22p63s23p6. Câu 5. các electron tự do. Câu 5. F.7 Hoà tan hoàn toàn 15. C. Ba. ion âm phi kim và ion dương kim loại.44g một kim loại hoá trị II trong 150ml dung dịch H 2SO40.7.7. Cl. C.C . các nguyên tử kim loại. ô 26. K.4g hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 0. chu kì 4. 83%. Muốn trung hoà axit dư trong dung dịch thu được phải dùng hết 30ml dung dịch NaOH 1M.9 Trong hợp kim Al. 2+ Câu 5. nhóm IIB. 81%. B. 36. nhóm IIB. nhóm VIIIB. Câu 5. liên kết sinh ra bởi lực hút tĩnh điện giữa ion dương và các ion âm. Mg. ô 20. các ion dương kim loại và các electron tự do.6 Hoà tan 1. nhóm IIA. B. D. chu kì 4. liên kết sinh ra bởi lực hút tĩnh điện giữa nguyên tử H tích điện dương và nguyên tử O tích điện âm. B. Số g muối tạo ra là A. Cl. chu kì 3. cứ 10 mol Al thì có 1 mol Ni. Na. 82%. B. D. K+. C. Ca2+. C. Phần trăm khối lượng của Al trong hợp kim là A. D. ô 20.Ni. Kim loại đó là A. chu kì 3. D. liên kết sinh ra bởi lực hút tĩnh điện giữa các ion dương và các electron tự do. Ar. nhóm VIIIA. + Câu 5. D.1 Vị trí của nguyên tử M (Z = 26) trong bảng hệ thống tuần hoàn là A. B.3 Trong mạng tinh thể kim loại có A. Nguyên tử M là A. nhóm VIIIB. B. Vị trí M trong bảng hệ thống tuần hoàn là A. F. Cl-. 84%. K+. 35.

Hg(NO3)2.13 Hợp kim có A. ánh kim. Zn. dẫn nhiệt. 63%. ánh kim. C.20 Cho bột Cu đến dư vào dung dịch hỗn hợp gồm Fe(NO3)3 và AgNO3 thu được chất rắn X và dung dịch Y. Pb(NO3)2. AlCl3. Pb là ngâm hỗn hợp trong dung dịch X dư.Zn trong dung dịch HCl đến phản ứng hoàn toàn thu được 0. Nhiệt độ nóng chảy cao. Y lần lượt là A. C. Cu2+. Cu). Cu3Al2. Câu 5.15 Một phương pháp hoá học làm sạch một loại thuỷ ngân có lẫn Zn. C. Tính dẻo. C. C.14 Một hợp kim Cu-Al chứa 12. Ag+. D. Y (Cu2+). D. Ag+. Sn. D. Câu 5. C. Sn. tính cứng hơn kim loại nguyên chất. dẫn điện. Thành phần % của Fe là A. Câu 5. Cu. dẫn điện. Thêm dung dịch HCl vào dung dịch trên. Lá sắt bị ăn mòn kiểu điện hoá. Cu2+. CuAl.1%.24g ion M 2+. C. D. Ni. Phản ứng xong. M là A. Ni khử được các ion kim loại A. 74. Câu 5. B. Ag. B.16 Ngâm một lá kẽm nhỏ trong một dung dịch có chứa 2. B. Fe. X (Fe). D. X ( Ag. Fe2+). X ( Ag). Cu2+. B. 72. X ( Ag).3% Al. ánh kim.1%. B. D. Cu2+. B. AgNO3.18 Cho lá sắt vào dung dịch HCl loãng có một lượng nhỏ CuSO4 thấy H2 thoát ra càng lúc càng nhanh do A. Cu3Al.12 Tính chất vật lí chung của kim loại là A. Zn(NO3)2. X. B. khối lượng lá kẽm tăng thêm 0.94g. Tính cứng. Y (Cu2+).17 Để bảo vệ vỏ tàu đi biển phần ngâm dưới nước người ta nối nó với A.Fe khử Cu2+ thành Cu. C.896 lít H2 (đktc).Fe tan trong dung dịch HCl tạo khí H2.Câu 5. ánh kim. D. nhiệt độ nóng chảy cao hơn kim loại nguyên chất. D. 61%. Cu.5g hợp kim của Ag vào dung dịch HNO3. Ag+. B. Thành phần %Ag trong hợp kim là A.1%. thu được 0. Ag+. Mg2+. tính dẻo hơn kim loại nguyên chất. 75. 73. dẫn nhiệt. 60%. dẫn nhiệt. Câu 5. Câu 5. B. Tính mềm. Câu 5. dẫn nhiệt. B. dẫn điện. dẫn điện. Câu 5. tính dẫn điện.398g kết tủa. Y ( Cu2+. Y ( Cu2+. X có thể là A. ZnCl2. Cd. C. C. Câu 5. Câu 5.19 Ngâm một lá Ni lần lượt trong những dung dịch muối sau : MgSO4. D. NaCl. CuAl3. Al3+. dẫn nhiệt cao hơn kim loại nguyên chất. CuSO4.33g hợp kim Fe. Lá sắt bị ăn mòn kiểu hoá học.10 Ngâm 2. Sn(NO3)2. Công thức hoá học của hợp kim là A. Pb2+. D.11 Hoà tan 0. B. 62%.1%. C. Fe2+). Pb(NO3)2. Na+. 63 . D.

Fe3+. B. C. Al3+.22 Ngâm một lá Zn trong 200ml dung dịch AgNO3 0. FeCl3. Fe2+/ Fe. tính khử của kim loại giảm A. Fe3+/ Fe2+. Fe2+/ Fe. B. 2+ Câu 5. Cu2+. tăng 0. Fe3+.23 Cho các ion : Fe . D. xuất hiện kết tủa xanh. SO42-. Cu.43g. Ag+/Ag. không bị khử. Fe3+/ Fe2+. Fe2O3. CO32-. NO3-.Câu 5.28 Khi nung Fe(OH)2 trong không khí ẩm đến khối lượng không đổi. dung dịch mất màu xanh. Ag+/ Ag. Cu2+/ Cu. Fe3+/ Fe2+. Cu2+/ Cu. Al3+.27 Cho các cặp oxi hoá. Ag+. Cu2+. Fe2+. tăng 1. Cu. Cu(NO3)2. D. Ag+/Ag. C. B. Ag+. dung dịch có màu xanh. (1) và (2). Ag. Ag+ và các kim loại : Fe. Ag+/Ag. (1). 2+ + C. xuất hiện Cu màu đỏ. Cho vào ống nghiệm (1) một miếng nhỏ Na. Câu 5. Fe3+. Fe3+. Fe3+. Fe2+. Fe. C. Ion Cu2+ bị khử thành Cu trong thí nghiệm A.51g. Ag+. Kim loại Cu khử được các ion trong các cặp oxi hoá trên là A. Câu 5. sau đó kết tủa tan. 64 . Cu. Câu 5. B. Al3+. ống nghiệm (2) một đinh Fe đã làm sạch. Ag+. Fe3+. D. Ag .khử : Al3+/Al. Câu 5. C.26 Cho các cặp oxi hoá. Cl-. Cu2+/Cu. Tách Ag ra khỏi hỗn hợp với khối lượng không đổi người ta dùng dung dịch A. Fe2+. D. Fe2+/ Fe. Fe . Ag+/Ag. Cu2+. Fe3+. Fe2+/ Fe. D. Kim loại khử được ion Fe3+ thành Fe là A.. D. D. Fe2+/ Fe. Cu2+/ Cu. FeO. Ag+.khử xếp theo chiều tính oxi hoá của ion kim loại tăng. Fe2+. Fe3+/ Fe2+.25 Trong một dung dịch A có chứa đồng thời các cation sau : K+. giảm 1. ta thu được chất rắn là A. Al3+.21 Chọn một dãy chất tính oxi hoá tăng A. Câu 5. có khí thoát ra. D. xuất hiện Cu màu đỏ. B. giảm 0. Fe3O4.khử : Al3+/Al. Fe2+. Fe3+/Fe2+. B. Fe(OH)3. AgNO3. D. Al3+. C. Trong dung dịch A chỉ chứa một loại anion là A.Ag+/Ag. Cu2+. C. Ag+. (2). Chọn một dãy điện hoá gồm các cặp oxi hoá. Câu 5. C. Câu 5. Câu 5. B. Cu2+.24 Có một hỗn hợp gồm: Fe. Khi phản ứng kết thúc khối lượng lá Zn A. có khí thoát ra. B. Cu2+/Cu. C.51g.30 Có 2 ống nghiệm đựng dung dịch CuSO4.29 Thả Na vào dung dịch CuSO4 quan sát thấy hiện tượng A. B. xuất hiện kết tủa xanh. Cu2+/Cu. B. Fe2+.43g. D. sau đó kết tủa không tan. Ba2+. C. Ag. Fe2+/ Fe. Cu.1M. Fe3+/ Fe2+. FeCl2. Al. Fe2+.

điện phân CaCl2 nóng chảy. Câu 5. Ag. C.7%. 26. Cu. Cl2 ở anot.12g bột Fe và 0. 0. Cl2 ở catot. 9000C. B. 2. Sau khi thu được 336ml H2 (đktc) thì thấy khối lượng lá kim loại giảm 1. C.74g. dung dịch H2SO4 loãng. Câu 5. B.53%. D. điện phân CaSO4 nóng chảy. 3. Câu 5. Câu 5.12 g/ml). người ta thu được A.31 Cho 1.68%.15g.04M. Cl2 ở anot.12M. C. Mg.32 Nhúng một que sắt nặng 5g vào 50ml dung dịch CuSO 4 15% (D = 1.24g bột Mg vào một bình chứa sẵn 250ml dung dịch CuSO4. D.15g. 65 .6%. Giá trị của m là A. B. điện phân Ca(NO3)2 nóng chảy. 56%. D. MgO cần dùng 7g khí CO. 9. D. B. 0. 9000C. 0. Na ở anot. D. FeO. D.87%.154g.7%. 54%. 9000C. 52%. 3.39 Điện phân (điện cực trơ) dung dịch muối sunfat của một kim loại hoá trị II với cường độ dòng điện 3A. 2. dung dịch HCl.34 Để khử hoàn toàn 30g hỗn hợp gồm CuO. 9000C.36 Từ dung dịch CuSO4 để điều chế Cu. D.1M. 4. Fe. Fe. Nồng độ C% của dung dịch CuSO4 còn lại là A.40 Hoà tan m g Ba vào nước thu được 1 lít dung dịch có pH = 12. 0. Số gam chất rắn thu được sau phản ứng là A. C. dung dịch HCl. có màng ngăn 2 điện cực. Câu 5. 53%.685g. Fe 2O3 Fe3O4. D. Al. 24. Fe. B. điện phân dung dịch CaCl2.37 Điện phân NaCl nóng chảy với điện cực trơ. 23. người ta dùng A. 9.38 Một loại quặng sắt chứa 80% Fe2O3 và 10% SiO2. Thành phần % theo khối lượng của Fe và Si trong quặng này lần lượt là A. B. 8. C. C. B.06M. sau 1930 giây thấy khối lượng catot tăng 1. Câu 5.7%. Câu 5. Na. NaOH. dung dịch HNO3.7%. Ba. B. B. Na ở catot.35 Cho sơ đồ : CaCO3 → CaO → CaCl2 → Ca.33 Ngâm một lá kim loại có khối lượng 50g trong dung dịch HCl. Tên kim loại là A. B.Câu 5. C. Nồng độ mol/lít của dung dịch CuSO4 trước phản ứng là A. Fe. C. Câu 5. D. Hg. Cu. Ni. 3. D. C. 8. 25. Kim loại đó là A. 4. 0.92 gam. Khi que sắt đã được mạ kín thì có khối lượng là 5. H2 ở catot. Câu 5. NaClO. C.88g. Sau phản ứng khối lượng kim loại có trong bình là 1. Điều kiện phản ứng và hoá chất thích hợp cho sơ đồ trên lần lượt là A.9%.

Ba. 27.50 Có dung dịch HCl 0. Chất rắn sau phản ứng tan trong dung dịch HCl dư tạo 13.42 Điện phân nóng chảy muối clorua của kim loại M.72 lít. Al. Câu 5. C. Fe.43 Điện phân dung dịch NaOH với điện cực trơ. Fe. người ta thu được sản phẩm là A. D. Cho dd MgCl2 tác dụng dd Na2CO3. Cu. Thể tích khí NO (đktc) thu được là A. Điện phân dung dịch MgCl2. người ta lọc lấy dung dịch có pH = 2.14g. Nếu chỉ dùng thêm dung dịch H2SO4 loãng thì có thể nhận biết A.5g khí H2.25g.41 Điện phân muối clorua nóng chảy của kim loại M thu được 12g kim loại và 0.12 lít khí (đktc) ở anot. Ba. C. 4. C. 1. Na. Fe. NaOH.75g. D. Số gam Cu điều chế được từ các thí nghiệm trên là A. C.2 gam kim loại và 6.44 lít khí (đktc).1M. B. Al. Ca. B. Cu. NaCl. D. B.24 lít. 27. Ba. Mg.6g.2g.8g. phản ứng xong thấy khối lượng đinh Fe tăng thêm 1. Câu 5. Fe. 66 . D. 12.49 Cho 19. Câu 5. C. Câu 5.7g. 3. Mg. 2+ Câu 5. Mg. D.3 mol khí.25g. Khối lượng sắt đã tham gia phản ứng là A. Cl2. Khi cô cạn dung dịch thu được số gam muối khan là A. 0. Kim loại M là A. Mg. B.Câu 5. Mg.2g kim loại M (hoá trị không đổi) tác dụng với 0. B. Al. Cu. B. 28. C. 2. NaCl. D.15 mol O 2. Ba. Câu 5. Al. Rót 250ml dung dịch này vào cốc đựng mạt sắt. Ba. Sau một thời gian. 28. NaClO. B. Ca. D. Al.63g. C.48 lít. 2g. B. C. Điện phân MgCl2 nóng chảy.26g. 9. 6. 0.2g. Câu 5. Mg. 0. sau đó thêm 500ml dung dịch HCl 2M. KCl. không có màng ngăn 2 điện cực.2g Cu vào 500 ml dung dịch NaNO3 1M.72 lít khí (đktc).47 Cho 16. B. MgCl2. 3. M là A. C. Câu 5. D. Al.46 Hoà tan hoàn toàn 10g hỗn hợp Al và Mg trong dung dịch HCl thu được 0. Ở catot thu được 7. Ngâm một đinh Fe trong dung dịch còn lại sau điện phân. D. C. B.36 lít.75g. Thả Na vào dung dịch MgCl2. Muối clorua đó là A. D.45 Sau một thời gian điện phân dung dịch CuCl2 thu được 1.48 Có 5 mẫu kim loại: Mg. Câu 5. CaCl2.44 Ion Mg bị khử trong trường hợp A.

Dung dịch H2SO4 loãng. 0. BeSO4. 0. 4. Ag. 0. CaSO4. Dung dịch HNO3.96 lít khí H 2 và m g một chất rắn. Nồng độ mol/l của dung dịch CuSO4 đã pha chế là A.51 Cho 0.464M. Tên kim loại đó là A. 2. B. n CO2 > n Ca(OH)2 . Dung dịch CuSO4.84 và 10. Để phản ứng hết với dung dịch này cần 20ml dung dịch BaCl2 0. magie. CaO + CO2 → CaCO3.59 Dùng một thuốc thử phân biệt Fe2O3 và Fe3O4. B. Câu 5. C.55g muối khan. C.52 và 8. C. Câu 5.5H2O trong nước được 500ml dung dịch.75M.42 và 11. dung dịch HCl. C.27g. 0. n CO2 < n Ca(OH)2 . D. lượng kết tủa thu được lớn nhất là A. 0.4g.54g.92. Số g mỗi muối trong hỗn hợp là A. D. 5. D. BaSO4.232M.0g một kim loại hoá trị II trong dung dịch HCl. Mg. Cu. MgSO4. D. Câu 5. Câu 5. 3. CO2 + Ca(OH)2 → CaCO3 + H2O. Cu. Câu 5. Hai kim loại X. n CO2 = 2 n Ca(OH)2 . Câu 5. B.11 mol khí CO2 đi qua dung dịch NaOH sinh ra 11. Câu 5. Cho X vào một lượng nước dư. n CO2 = n Ca(OH)2 . B. thuốc thử đó là A.54 Một hỗn hợp X gồm Na và Al được trộn theo tỉ lệ mol 1: 2. C. Công thức của muối sunfat là A.58 Cho các chất: CaCO3.68 và 9. Ca(HCO3)2 → CaCO3 + CO2 + H2O.57 Hoà tan 58g muối CuSO4. Số phương trình phản ứng hoá học (dạng phân tử) xảy ra khi cho các chất tác dụng với nhau từng đôi một là A. Câu 5.7g. 0.56 Hoà tan 2. D. B. C.60 Cho phương trình phản ứng : a X + b Y(NO3)a → a X(NO3)b + b Y Biết dung dịch X(NO3)b có màu xanh. B.725M. B. Ag. 1. Giá trị của m là A. 2. sau khi kết thúc phản ứng thu được 8.02.3625M. Fe.8g muối sunfat của một kim loại nhóm IIA trong nước rồi pha loãng cho đủ 50ml dung dịch.6.55 Hoà tan 1. 1.44g hỗn hợp 2 muối. bari. C.76. 67 . 0. dung dịch NaOH. 0. kẽm. Dung dịch HCl.53 Hiện tượng tạo thành các thạch nhũ trong các hang động được giải thích bằng phản ứng A. B. canxi. Na2CO3 + Ca(OH)2 → CaCO3 + 2 NaOH. Y lần lượt là A. D. C. D. sau đó cô cạn dung dịch thu được 5. dung dịch NaHCO3. Fe. D. C. D.Câu 5. Câu 5.2.52 Cho dòng khí CO2 liên tục đi qua cốc đựng dung dịch Ca(OH)2. B. Cu. C. D. B.

65. MnO4. MgSO4. B. thu được dung dịch Y và một phần sắt không tan. D. Cu.61 Cho a g kim loại M tác dụng vừa đủ với V lít dung dịch HCl 2M thu được (a + 21. Câu 5. Fe(NO3)2. 10. Fe2(SO4)3. d là A. khối lượng thanh M tăng 0. C. Ag. Nguyên tử khối của M là A. MgSO4. Câu 5. Ca. Biết rằng toàn bộ Cu sinh ra đều bám hết vào thanh M. Câu 5.Câu 5. b mol Cu2+. Chất tan có trong dung dịch Y là A. dung dịch KMnO4 bị mất màu là do A. D. Tên của M là A. không bị khử không bị oxi hoá. bị khử. C.70 m g phoi sắt để ngoài không khí lâu ngày bị gỉ tạo thành hỗn hợp A có khối lượng 12g gồm 4 chất rắn. B.4M đến khi dung dịch hết màu xanh. vừa bị khử vừa bị oxi hoá.80g. 2a + 2b = c + d. FeSO4. Zn.tạo thành phức với Fe2+. FeSO4.64 Khi phản ứng với Fe2+ trong môi trường axit dư. Câu 5. B. 3. 24.6 lít. 1. C.bị oxi hoá.08g. Câu 5.2 lít. C.63 Khuấy một thanh kim loại M hoá trị 2 trong 200ml dung dịch Cu(NO3)2 0. Ba. D. MgSO4.65 Có các kim loại Cu.08g. D. 0. Mg.1 mol khí duy nhất NO (đktc). Vai trò của ion NO3. 0. MnO4.68 Trong một cốc nước chứa a mol Al3+. B. C. Fe và các dung dịch muối Cu(NO3)2. D. C. 4. bị oxi hoá. Biểu thức liên hệ giữa a. 56.10.3) g muối MCln. B. c mol Cl-. Ag. 3a + 2b = c + 2d. V có giá trị là A. 2a + 3b = 2c + d. C. II – BÀI TẬP NÂNG CAO Câu 5. MnO4. C. Giá trị m là A. Biết hiệu suất phản ứng điện phân là 80%.3 lít.64g. Số phương trình phản ứng hoá học xảy ra khi cho kim loại và muối tác dụng với nhau là A.bị khử thành Mn2+. 0. 9.64 mol khí Cl2 ở anot.4 lít.62 Điện phân nóng chảy 76g muối MCl2 thu được 0. 2. c. B. Câu 5. D. Fe2(SO4)3. B. 3a + 2b = c + d. Câu 5. B. AgNO3. Cho A tác dụng hết với dung dịch HNO3 loãng. Cu. 68 . C.67 Cho hỗn hợp X gồm Mg và Fe vào dung dịch axit H 2SO4 đặc nóng đến khi các phản ứng xảy ra hoàn toàn. Fe.8g. dư thu được 0. D. D. 27. D.66 Một kim loại dùng để loại bỏ tạp chất Fe2(SO4)3 trong dung dịch FeSO4 là A. D. 9. B. C. Câu 5. b. d mol SO42-.không màu trong môi trường axit. 0. MgSO4.là A.69 Cho Cu vào hỗn hợp gồm NaNO3 và H2SO4 loãng. B. MnO4.

B. được 1. Câu 5.5g. nóng thu được 5. Al tác dụng hết với dung dịch HCl dư thu được 5. C. 35g. Câu 5. D.36 lít. Thành phần % về khối lượng Mg trong hỗn hợp X là A. 69 . B. sau một thời gian thu được m g hỗn hợp X gồm các oxit và sắt dư. 26g.87g hỗn hợp X gồm Mg và Al vào 250ml dung dịch Y chứa axit HCl 1M và H2SO4 0. Mg và Ca. 37. Hoà tan hết hỗn hợp X bằng H2SO4 đặc. D.336 lít. Vậy 2 kim loại đó là A. Câu 5.75 Hỗn hợp X gồm 2 kim loại X1. Cô cạn dung dịch thì số gam muối khan thu được là A. B. 18.77 Cho 10. Cô cạn dung dịch thì số gam muối khan là A.Phần 1: hoà tan hết trong dung dịch chứa HCl và H2SO4 loãng thu được 3.79 Cho 22g hỗn hợp muối cacbonat của kim loại IA và IIA tác dụng với dung dịch HCl dư thu được 0. 29g.2g sắt để ngoài không khí bị gỉ thành 13.48 lít.224 lít.78 Cho 11g hỗn hợp nhiều kim loại trước hiđro tác dụng với dung dịch H2SO4 loãng. C. Đem Cu cho tan hết trong dung dịch HNO3 loãng dư. C. 0. 25. 3.2g.95g. Zn. Cô cạn dung dịch thì số gam muối khan thu được là A. D. Ca và Sr. 25.6 lít. Câu 5. Câu 5.6 lít khí (đktc). Hoà tan hết X bằng dung dịch HNO3 thấy có 0. 3. B. B.87g. 3.24 lít.336 lít. D. Câu 5.2.01%. 0.72 Oxi hoá m g sắt ngoài không khí. Câu 5. 39. . 1.12 lít NO duy nhất (đktc). thu được Cu.5M được dung dịch Z và 4. C. Nếu cho X tác dụng hết với dung dịch HNO3 loãng. 2.53g.4 mol khí CO2. Câu 5.8g.52g. 5. D. 20g. dư thu được 6. D.3 mol khí (đktc).0. Be và Mg. C. D.025 mol khí NO thoát ra.8g hỗn hợp 2 muối cacbonat của 2 kim loại thuộc nhóm II ở 2 chu kì kế tiếp nhau khi tác dụng hết với dung dịch HCl thu được 0. Cho X tan hết trong dung dịch CuSO 4 dư.Câu 5.6 lít SO2 (đktc).36 lít H2 (đktc). B. 4. D. 0.36 lít. B. 2. B.72 lít khí (đktc). 0. 27. B. D. 2. C. 2. 0. 35.224 lít. Sr và Ba.73 Nung nóng 16. Giá trị của V là A. 22g. 27g.2g hỗn hợp 3 kim loại Mg. dư thì thể tích N2 (đktc) là A.3g. Giá trị m là A.7g. X2 có hoá trị không đổi. C.74 Hỗn hợp X gồm 2 kim loại đều có hoá trị không đổi. C. D. C.98g.21 %.80 Cho 3. Cho A tác dụng hết với dung dịch HNO3 loãng.368 lít H 2 (đktc). không tác dụng với nước và đứng trước Cu.6g chất rắn A. 3. 24g.71 11. Giá trị m là A.242 lít. dư thu được V lít NO (đktc) duy nhất.8g bột sắt ngoài không khí. C. 26%. Chia X thành phần bằng nhau: . V có giá trị là A.252g.63 lít. 28g.24 lít. 3.76 Cho 36. B. được 3g hỗn hợp rắn gồm 4 chất.25g. Câu 5.Phần 2: hoà tan hết trong dung dịch HNO3 loãng thu được V lít khí NO (đktc). 36%.

Câu 5.81 Hoà tan hoàn toàn 2,81g hỗn hợp gồm Fe2O3, Al2O3, MgO, ZnO trong 500ml dung dịch axit H2SO4 0,2M (vừa đủ). Cô cạn dung dịch sau phản ứng, muối sunfat khan thu được có khối lượng là A. 6,81g. B. 10,81g. C. 5,81g. D. 4,81g. Câu 5.82 Cho 1,935g hỗn hợp gồm 2 kim loại Mg và Al tác dụng với 125ml dung dịch gồm HCl 1M và H2SO4 loãng 0,28M, thu được dung dịch X và 2,184 lít H 2 (đktc). Cô cạn dung dịch, thu được số gam muối là A. 9,7325g. B. 9,3725g. C. 9,7532g. D. 9,2357g. Câu 5.83 Cho 10g hỗn hợp gồm Al và một kim loại M (hoá trị x) tác dụng với 100ml dung dịch gồm H2SO4 aM và HCl 3aM, thu được 5,6 lít H2 (đktc), dung dịch X và 1,7g chất rắn. Khối lượng muối thu được là A. 2,85g. B. 2,855g. C. 28,55g. D. 28,5g. Câu 5.84 Cho 7,2g Mg tác dụng hết với dung dịch HNO 3 loãng, dư thu được 6,72 lít khí Y và dung dịch Z. Làm bay hơi Z thu được 47,4g chất rắn khan. Công thức phân tử của khí Y là A. N2O. B. NO. C. N2. D. NO2. Câu 5.85 Đốt nóng một hỗn hợp X gồm Al và Fe3O4 trong điều kiện không có không khí được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: Phần 1: tác dụng với dung dịch NaOH dư thu được 3,36 lít H2 (đktc). Phần 2 : tác dụng với dung dịch HCl dư thu được 13,44 lít H 2 (đktc). Thành phần % về khối lượng của Al trong hỗn hợp X là (hiệu suất phản ứng 100%) A. 27,95%. B. 2,795%. C. 72,05%. D. 7,205%. Câu 5.86 Cho hỗn hợp A gồm bột Al và Fe3O4. Nung nóng A ở nhiệt độ cao trong môi trường không có không khí để phản ứng xảy ra hoàn toàn thu được hỗn hợp B. Nghiền nhỏ B rồi chia làm 2 phần: - Phần 1 (ít) tác dụng với dung dịch NaOH dư thu được 1,176 lít H2 (đktc). Tách riêng chất không tan đem hoà tan trong dung dịch HCl dư thu được 1,008 lít khí (đktc) - Phần 2 (nhiều) tác dụng với dung dịch HCl dư thu được 6,552 lít khí (đktc).Khối lượng hỗn hợp A là A. 22,02g. B. 8,1g. C. 13,92g. D. 3,465g. Câu 5.87 Một hỗn hợp gồm Na, Ba có tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí B. Thể tích dung dịch HCl 0,1 M để trung hoà

1 dung dịch A là 10

A. 0,4 lít. B. 0,2 lít. C. 0,6 lít. D. 6 lít. Câu 5.88 Cho m gam hỗn hợp X gồm K và Al tác dụng với nước dư thu được 0,25 mol khí. Nếu cho m gam X tác dụng với Ba(OH)2 dư thu được 0,4 mol khí (các phản ứng đều xảy ra hoàn toàn). m có giá trị là A. 12,8g. B. 16g. C. 18g. D. 10,95g.

70

Câu 5.89 Dùng CO khử m g Fe2O3 ở nhiệt độ cao được 0,4 mol CO2 và hỗn hợp rắn X (gồm 4 chất). Hoà tan hết X cần 0,9 lít dung dịch HCl 1M thấy có 0,25 mol khí thoát ra. Giá trị m là A. 32g. B. 40g. C. 80g. D. 3,2g. Câu 5.90 Dùng CO khử m g Fe2O3 ở nhiệt độ cao thu được 1,1 gam CO2 và chất rắn X gồm 3 oxit. X phản ứng vừa đủ với 0,25 lít dung dịch H2SO4 loãng 0,5M. Giá trị m là A. 8,0g. B. 4,0g. C. 1,6g. D. 3,2g. Câu 5.91 Cho 0,1 mol CO (đktc) từ từ đi qua ống sứ nung nóng đựng 4 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Hỗn hợp khí thu được sau phản ứng có tỉ khối hơi so với H2 bằng 20. Công thức của oxit sắt và thành phần % CO 2 theo thể tích trong hỗn hợp khí sau phản ứng là A. FeO ; 75% B. Fe2O3 ; 75% C. Fe2O3 ; 65% D. Fe3O4 ; 75% Câu 5.92 Một dung dịch có chứa 2 cation là Fe2+ (0,1 mol); Al3+ (0,2 mol) và 2 anion Cl- (x mol), SO42- (y mol). Khi cô cạn dung dịch thu được 46,9 gam chất rắn khan. x và y có giá trị lần lượt là A. 0,02 và 0,03. B. 0,03 và 0,02. C. 0,2 và 0,3. D. 0,3 và 0,2. Câu 5.93 Thêm V lít dung dịch Na2CO3 1M vào một dung dịch có chứa đồng thời các ion − − sau: Ba2+; Ca2+; Mg2+; 0,2 mol Cl ; 0,3 mol NO3 . Để tạo lượng kết tủa lớn nhất thì giá trị của V là B. 0,25 lít. A. 2,5 lít. C. 0,5 lít. D. 5 lít. Câu 5.94 Hoà tan 16,2g Al trong dung dịch HNO3 loãng, dư thu được hỗn hợp khí gồm NO và N2 có tỉ khối hơi so với H2 là 14,4. Thể tích (tính theo lít) của NO, N2 lần lượt là A. 2,24 và 3,36. B. 0,224 và 0,336. C. 22,4 và 33,6. D. 2,24 và 4,48. Câu 5.95 Cho 13,5g nhôm tác dụng vừa đủ với dung dịch HNO 3 0,86M thu được hỗn hợp khí gồm NO và N2O có tỉ khối hơi đối với H 2 bằng 19,2. Thể tích dung dịch HNO3 cần dùng là A. 2,2 lít. B. 0,22 lít. C. 0,46 lít. D. 4,65 lít. Câu 5.96 Hoà tan một hợp kim Ba-Na với tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí. Thêm m g NaOH vào

1 dung dịch A ta được dung dịch B. Cho dung dịch B tác 10

dụng với 100ml dung dịch Al2(SO4)3 0,2M được kết tủa C. Giá trị m để được kết tủa C lớn nhất, nhỏ nhất lần lượt là A. 2,4g và 4g. B. 4g và 2,4g. C. 4,8g và 6,4g. D. 6,4g và 4,8g. Câu 5.97 Rót 150ml dung dịch NaOH 7M vào 50ml dung dịch Al 2(SO4)3 2M. Khối lượng chất dư sau thí nghiệm là A. 10g. B. 14g. C. 12g. D. 16g.

71

Câu 5.98 Dung dịch chứa 16,8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3, thêm vào 13,68g Al2(SO4)3 thu được kết tủa và dung dịch A. Đun nóng kết tủa đến khối lượng không đổi được chất rắn B. Khối lượng chất rắn B là A. 2,12g. B. 21,2g. C. 42,2g. D. 4,22g. Câu 5.99 Cho 18,9g muối Na2SO3 tác dụng hết với dung dịch HCl thu được khí A (đktc). Dẫn khí A vào dung dịch Ba(OH)2 dư. Sau khi hấp thụ, khối lượng dung dịch sẽ A. tăng 22,95g. B. giảm 22,95g. C. tăng 20,25g. D. giảm 20,25g. Câu 5.100 Đốt cháy hoàn toàn 0,336 lít C3H8 (đktc) bằng lượng oxi vừa đủ. Thu được toàn bộ sản phẩm cháy cho vào 35 ml dung dịch Ca(OH) 2 1M. Sau khi hấp thụ, khối lượng dung dịch A. tăng 0,56g. B. giảm 0,56g. C. tăng 5,6g. D. giảm 5,6g. Câu 5.101 m g hỗn hợp Mg, Al tác dụng với 250ml dung dịch X chứa hỗn hợp HCl 1M và H2SO4 0,5M sinh ra 5,32 lít H2 (đktc) và dung dịch Y (coi Vdung dịch không đổi). dung dịch có pH là A. 1. B. 7. C. 2. D. 6. Câu 5.102 Trộn 100ml dung dịch gồm Ba(OH)2 0,1M và NaOH 0,1M với 400ml dung dịch gồm H2SO4 0,0375M và HCl 0,0125M thu được dung dịch X. pH của dung dịch X là A. 2. B. 7. C. 6. D. 1.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG V
5.1 A 5.11 A 5.21 A 5.31 A 5.41 A 5.51 A 5.61 C 5.71 A 5.81 B 5.91 B 5.101 A 5.2 A 5.12 A 5.22 B 5.32 D 5.42 B 5.52 A 5.62 A 5.72 A 5.82 A 5.92 C 5.102 A 5.3 C 5.13 A 5.23 A 5.33 A 5.43 B 5.53 B 5.63 B 5.73 C 5.83 C 5.93 A 5.4 D 5.14 A 5.24 C 5.34 D 5.44 B 5.54 C 5.64 A 5.74 A 5.84 D 5.94 A 5.5 D 5.15 D 5.25 B 5.35 D 5.45 A 5.55 B 5.65 C 5.75 D 5.85 A 5.95 A 5.6 A 5.16 C 5.26 D 5.36 C 5.46 A 5.56 A 5.66 A 5.76 C 5.86 A 5.96 A 5.7 B 5.17 A 5.27 A 5.37 A 5.47 B 5.57 A 5.67 C 5.77 B 5.87 C 5.97 A 5.8 A 5.18 B 5.28 B 5.38 A 5.48 D 5.58 D 5.68 B 5.78 B 5.88 D 5.98 D 5.9 B 5.19 C 5.29 B 5.39 B 5.49 C 5.59 C 5.69 A 5.79 D 5.89 A 5.99 B 5.10 D 5.20 A 5.30 B 5.40 A 5.50 D 5.60 B 5.70 B 5.80 A 5.90 A 5.100 A

72

. KIM LOẠI KIỀM THỔ VÀ NHÔM A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. IIA: ns1. tác dụng với axit.+ H+ → H2O + CO2 HCO3. Ca.+ H2O t0 Ca(HCO3)2  CaCO3 + H2O + CO2 → . SO2. Kim loại kiềm thổ (IIA): Be.CaCO3 bị nhiệt phân. ns2 4. P2O5 hay axit H2S. bazơ mạnh. Mg. dung dịch axit. H3PO4 … vào dung dịch bazơ. Cấu hình electron ở lớp ngoài cùng của IA. Tất cả các kim loại ở hai nhóm này đều tác dụng với phi kim.Na2CO3 dễ tan trong nước. Sơ lược về muối cacbonat và hiđrocacbonat . H2O (trừ Be).KNO3. kém bền với nhiệt HCO3. 6. Fr 2. Số oxi hoá: trong các hợp chất IA. IIA: sử dụng phương pháp điện phân nóng chảy n ñpnc MXn  M + X2 (X = halogen). muối. Tính khử: IA. và tăng theo chiều Z tăng : M → Mn+ + ne (n = 1. Điều chế IA. 2). Ca(NO3)2 bị phân huỷ ở t > 330 C thành muối nitrit và oxi 1 t0 KNO3  KNO2 + O2 → 2 t0 Ca(NO3)2  Ca(NO2)2 + O2 → 73 . có màng ngăn hai điện cực. Ba. tan trong axit mạnh.NaOH.+ OH. oxit axit. hay dung dịch muối khác. Ra 3.→ CO32. và tan cả trong nước có hoà tan CO2 t0 CaCO3  CaO + CO2 →  → CaCO3 + H2O + CO2 ← Ca(HCO3)2  0 0 . ñpdd 2NaCl + 2H2O  2NaOH + H2 + Cl2 → (nếu không có màng ngăn : 2NaOH + Cl2 → NaCl + NaClO + H2O) 9. Na. Ca(HCO3)2 lưỡng tính. KIM LOẠI KIỀM. Tính chất của một số hiđroxit . mang gần như đầy đủ tính chất chung của muối như tác dụng với dung dịch axit mạnh. để xác định muối sinh ra. Rb. Cs. Kim loại kiềm (IA): Li.CHƯƠNG VI. . → 2 ñpnc 4MOH  4M + O2 + 2H2O → 7. 5. Điều chế bazơ tan: sử dụng phương pháp điện phân dung dịch muối tương ứng với điện cực trơ.NaHCO3. ta nên dùng công thức phân tử của các muối để xác định tỉ lệ giữa số mol nguyên tử kim loại với số mol nguyên tử phi kim trong oxit axit (axit) 8. IIA đều có tính khử (IIA khử yếu hơn IA). IIA có số oxi hoá +1. Ca(OH)2 có đầy đủ tính chất của một dung dịch bazơ như làm quỳ tím hoá xanh. +2. Sr.Khi cho CO2.

. . . 2Al + 6H2SO4 đặc  Al2(SO4)3 + 3SO2 + 6H2O → 14. Mg + O2  MgO → 2 3 t0 3.Nhôm có tính khử mạnh (Al → Al3+ + 3e) nhưng kém kim loại nhóm IA. K + Cl2  KCl → 2 t0 5. tham gia phản ứng nhiệt nhôm. IIA. Ca + Cl2  CaCl2 → 3 t0 6.Vật bằng nhôm bền trong không khí.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1 t0 1. Al + 3HCl → AlCl3 + H2 2 10. Al + 4HNO3 đặc  Al(NO3)3 + NO + 2H2O → 12.Cách làm mềm nước cứng tạm thời: đun.Nước cứng là nước chứa nhiều ion Ca2+. 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O t0 13. . chu kì 3. Na + HCl → NaCl + H2 2 8. .Al2O3.Cách làm mềm nước cứng vĩnh cửu dùng Na2CO3 hoặc Na3PO4. MgCl2. Nước cứng . . Nhôm .Nhôm bị phá huỷ trong kiềm. . Nước cứng vĩnh cửu chứa muối clorua hay sunfat của Ca2+ hay Mg2+ (CaCl2. 2Na + O2  Na2O → 2 1 t0 2. CaSO4.Điện phân Al2O3 nóng chảy (không thể điện phân nóng chảy AlCl3) để điều chế Al kim loại. H2O vì trên bề mặt nhôm được phủ kín một lớp Al2O3 bảo vệ. Al(OH)3 lưỡng tính. MgSO4).Vị trí Al trong bảng tuần hoàn: ô 13. Mg2+. Nước cứng tạm thời chứa muối Ca(HCO3)2 hay Mg(HCO3)2. . nhóm IIIA. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O t0 11. dd Na2CO3. Mg + 2HCl → MgCl2 + H2 3 9. Al + Cl2  AlCl3 → 2 1 7. 11.Nguyên tắc làm mềm nước cứng là làm giảm nồng độ các ion Ca2+. dùng bazơ tan. Mg2+ trong nước cứng. Ca + 2H2O → Ca(OH)2 + H2 16. 2Al + O2  Al2O3 → 2 1 t0 4.10. 2K + 2H2O → 2KOH + H2 15. B . 2Al + 6H2O → 2Al(OH)3 + 3H2 74 .

Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2↓ 32. 2KNO3 + 3C + S  N2 + 3CO2 + K2S → t0 44. 2KNO3  2KNO2 + O2 → t0 43. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. NaHCO3 + HCl → NaCl + CO2↑ + H2O 37. 2Al2O3  4Al + 3O2 → → 25. CaCO3  CaO + CO2 → t0 42. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. 2Mg(NO3)2  2MgO + 4NO2 + O2 → 46. 2NaOH  2Na + O2 + H2O → 2 ñpnc 23. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 ñpnc 21. 2Al + Fe2O3  Al2O3 + 2Fe → 20.17. NaHCO3 + NaOH → Na2CO3 + H2O 38. 2NaOH + CO2 → Na2CO3 + H2O 29. 2NaCl  2Na + Cl2 → 1 ñpnc 22. 2NaCl + 2H2O  2NaOH + H2 + Cl2 coù ng ngaê maø n 26. Na2CO3 + 2HCl → 2NaCl + H2O + CO2↑ 39. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. CaCO3 + 2HCl → CaCl2 + H2O + CO2↑  → 40. NaOH + HCl → NaCl + H2O 31. 2NaHCO3  Na2CO3 + CO2↑ + H2O → t0 34. Mg2+ + HPO42. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 t0 33. Ca(OH)2 + CO2 → CaCO3 + H2O 30. Al(OH)3 + NaOH → Na[Al(OH)4] 0 ñpdd 75 . Mg(HCO3)2  MgCO3 + CO2↑ + H2O → 36. NaOH + CO2 → NaHCO3 27. Ca(HCO3)2  CaCO3 + CO2↑ + H2O → t0 35. CaCO3 + H2O + CO2 ← Ca(HCO3)2  t 41.+ NH3 → MgNH4PO4 ↓ (màu trắng) 50. Mg + CuSO4 → MgSO4 + Cu t0 19. Ca(NO3)2  Ca(NO2)2 + O2 → t0 45. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. MgCl2  Mg + Cl2 → ñpnc 24. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49.

K+. D. 16%. Khối lượng kiềm là A. LiCl.5 Cho 200g CaCO3 tác dụng hoàn toàn với dung dịch H2SO4 loãng để lấy khí CO2 sục vào dung dịch chứa 60g NaOH. 50g. 68%. Kim loại kiềm có tính khử mạnh. B. + C. 12.Cu+. D. NaHSO4 . 12. Câu 6.45%. 168g. 48g. 2Al(OH)3  Al2O3 + 3H2O → C.9 Dung dịch muối có pH > 7 là A. Thành phần % theo khối lượng của Na2CO3 và NaHCO3 lần lượt là A. D. B.7 Nung 100g hỗn hợp gồm Na2CO3 và NaHCO3 cho đến khi khối lượng của hỗn hợp không đổi được 69g chất rắn.2 gam nước là A. M+ là cation: A.57%. D. D. B.119g. B. Công thức phân tử của muối kim loại kiềm là A. 4.8g. 126g. Na .1 Cation M+ có cấu hình electron ở lớp ngoài cùng là 3s23p6. 25.12 lít H2 (đktc) và dung dịch kiềm. D.4g. Na2CO3. Câu 6. B. Độ cứng cao.6 Cho 197g BaCO3 tác dụng hoàn toàn với dung dịch HCl để lấy khí CO2 sục vào dung dịch chứa 84g KOH.1g hỗn hợp 2 kim loại kiềm ở hai chu kì kế tiếp nhau trong bảng tuần hoàn tác dụng hết với nước thu được 1. D.4 Điện phân muối clorua kim loại kiềm nóng chảy thu được 0. Câu 6. C. 76 . D. NH4Cl.72%. C.9g. 32% . Có nhiệt độ nóng chảy thấp nhất trong tất cả kim loại.8g. B. C. B. C. Có số oxi hoá +1 trong các hợp chất. Câu 6. 11. Câu 6.6g. Khối lượng muối thu được là A.12 gam kim loại ở catot. 16% . NaCl. Khối lượng muối natri thu được là A. 84% . 84%. 68% .79%. KCl. KCl.BÀI TẬP TRẮC NGHIỆM I. C.BÀI TẬP CƠ BẢN Câu 6. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl t0 55. C. 24g. C. B. Ag+. D. C. B. Câu 6. RbCl. Câu 6. 32%. 2.8 gam kali kim loại vào 36.54. 12.3 Nồng độ phần trăm của dung dịch tạo thành khi hoà tan 7. 16. 25.04 mol khí ở anot và 3.2 Tính chất không phải của kim loại kiềm là A.8 Cho 3. Câu 6.69g.

Ca.85% và 59. BaSO4 . C.8g CaO tác dụng với một lượng nước dư thu được dung dịch X.5g.36. B.2 và 4.11 Cho 2. BaCO3 . B. Câu 6.85%.25g muối clorua của một kim loại hoá trị II và một lượng muối nitrat của kim loại đó có số mol bằng số mol muối clorua thì thấy khác nhau 7. Kim loại đó là A. Sục 1.15 Hoà tan 8. Câu 6. Câu 6. B.84g hỗn hợp CaCO3 và MgCO3 tác dụng hết với dung dịch HCl thu được 0. C. Be.36 và 4.17 Có 5 chất bột trắng là: NaCl. Ba. Cho dung dịch CaCl2 tác dụng với dung dịch AgNO3. D. Câu 6.55g.2g hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2.016 lít CO2 (đktc). D. B. Be.48 và 3.19 Trường hợp ion canxi bị khử thành Ca là A.Câu 6. 2. Ca. B. Câu 6.03 mol khí CO2.05g. Điện phân dung dịch CaCl2 với điện cực trơ. 3. Chỉ dùng nước và khí CO2 phân biệt được số chất là A. 40. Thành phần % theo khối lượng của CaCO3 và MgCO3 trong hỗn hợp lần lượt là A. C.4%.18 Kim loại thuộc nhóm IIA không tác dụng với nước ngay cả ở nhiệt độ cao là A. C. Mg. Ca. 4. Mg. Câu 6. D. 3. 4. Mg. D. Kim loại đó là A. 4.1 gam muối clorua. D. Câu 6. có màng ngăn. Ba.14 Cho 4. 6. D. 7. 70.15%.4% và 29. B.12 Hoà tan hoàn toàn 1. Dung dịch thu được có pH A. Be. C.44g kim loại hoá trị II trong 150ml dung dịch H2SO4 0. 77 . C. B.0 gam kim loại nhóm IIA tác dụng hết với dung dịch HCl tạo ra 11.48.16 Cho 2. 4.5M.10 Cho a mol NO2 hấp thụ hoàn toàn vào dung dịch chứa a mol NaOH. C. C. 5. khối lượng kết tủa thu được là A. Be. Ca. pH < 7. B. C. 4 và 4. pH = 7. pH = 5. Mg. C.15% và 40. Câu 6. Na2CO3 . Ba. Ba.95g. D.6%.6% và 70. pH > 7. B. 59.25. D. B. Điện phân CaCl2 nóng chảy. Câu 6. Na2SO4 . D.68 lít khí CO2 (đktc) vào dung dịch X.5g. 2. Để trung hoà axit dư phải dùng hết 30ml dung dịch NaOH 1M. Kim loại đó là A. 29. Số gam CaCO3 và MgCO3 lần lượt là A.13 Khi lấy 14.2.

Câu 6. C. NaNO3. 0. 92%. 100%. 0.05g. C. Dung dịch Na3PO4. 12. 0.2 lít khí CO2 (0oC. Câu 6.02 mol Cl– . B. toàn phần. B. B. nước mềm.D.02 mol Cl– ta được nước cứng A.4g Ca(OH)2 . Nước cứng vĩnh cửu. D. C. Điện phân dung dịch AlCl3 với điện cực trơ có màng ngăn. D. 0.02 mol Ca2+. Ca(OH)2. Câu 6. B. C. Tính cứng toàn phần. Nước cứng tạm thời.26 Đun sôi nước chứa 0. Na2CO3. Tính cứng tạm thời. Câu 6. D.2% (theo thể tích) đi qua dung dịch chứa 7. B. 50%. Dùng H2 khử Al2O3 ở nhiệt độ cao. HCl.65g.8 atm). 0. C.01 mol Na+. Điện phân Al2O3 nóng chảy. tạm thời. C.01 mol Na+. D. Câu 6.05 mol HCO3–. Na2CO3 + Ca(OH)2 CaCO3 + 2NaOH. C. Câu 6. 78 . Tính cứng vĩnh cửu.25g. 4. Câu 6. D. D. C. D. Na2CO3 + Ca(HCO3)2 CaCO3 + 2NaHCO3. Thành phần % theo khối lượng của CaCO3.29 Ion Al bị khử trong trường hợp A. Zeolít.23 Một loại nước có chứa nhiều muối Ca(HCO3)2 thuộc loại A. B.20 Phân biệt dung dịch Ca(HCO3)2 với dung dịch CaCl2 bằng A. Nước khoáng. 40%.22 Cho 10 lít hỗn hợp khí (đktc) gồm CO và CO2 trong đó CO2 chiếm 39. 14. Thả Na vào dung dịch Al2(SO4)3. Tính mềm. 0. vĩnh cửu. Na2CO3 + CaCl2 CaCO3 + 2NaCl.02 mol Ca2+.27 Một phương trình phản ứng hoá học giải thích việc dùng dung dịch Na2CO3 làm mềm nước cứng vĩnh cửu là A. B. Cho dung dịch Ca(OH)2 tác dụng với dung dịch HCl. 0.MgCO3 trong quặng là A. Na2CO3. B. Dung dịch HCl. Câu 6.5g. 3+ Câu 6. D. Na2CO3 + 2HCl 2NaCl + H2O + CO2.24 Dung dịch làm mềm nước cứng tạm thời và vĩnh cửu là A. C.25 Trong một bình nước có chứa 0. B.05 mol HCO3–. D. Dung dịch NaCl. D. C.01 mol Mg2+. Số g chất kết tủa sau phản ứng là A. 0. 0. 2.28 Trong phương pháp trao đổi ion để làm mềm nước cứng người ta dùng A.21 Khi nung 40g quặng đôlômit thu được 11. Nước trong bình có A.01 mol Mg2+. Na3PO4. Dung dịch Na2CO3. Nước cứng toàn phần. B. Ca(OH)2. Câu 6.

dẫn điện. D. Al(OH)3 + 3HCl AlCl3 + 3H2O. Câu 6. Nhôm là kim loại lưỡng tính. chu kì 3. NaHCO3. B. ô 13. D.36 Cho dần từng giọt dung dịch NaOH (1). AlCl3 + 3NaOH Al(OH)3 + 3NaCl. chu kì 3.30 Phương trình phản ứng hoá học chứng minh Al(OH)3 có tính axit là A. Lúc đ ầu đều có kết tủa keo trắng. Al2O3. B. HCl.32 Chọn câu không đúng A. B. ô 13. ô 13. ZnSO4. Nhôm là kim loại nhẹ. H2SO4 đặc nóng. D. dung dịch NH3 (2) lần lượt đến dư vào ống đựng dung dịch AlCl3 thấy A. D. ở (1) kết tủa tan. B. C. X. C. ở (2) kết tủa không tan.33 Trong những chất sau. NaOH dư. AlCl3 + 3H2O + 3NH3 Al(OH)3 + 3NH4Cl. B. nhóm IA. Ba(OH)2. C. H2SO4 loãng. Ba(OH)2. (2) lần lượt là A. B. 3 D. B. sau đó kết tủa tan ra. Ba(OH)2. t0. nhóm IIIB. HCl. đpnc. NaOH dư. Z. C. ở (1) kết tủa không tan. H2SO4 loãng. ô 13. nhóm IIIA. Câu 6. 2Al(OH)3 Al2O3 + 3H2O. Ba(OH)2. dẫn nhiệt tốt. C. HCl. ở (2) kết tủa tan. Lúc đầu đều có kết tủa keo trắng. H2SO4 đặc nguội. chất không có tính lưỡng tính là A. Câu 6. Lúc đầu đều có kết tủa keo trắng. t0. Y. đpnc. Vị trí M trong bảng tuần hoàn là A. NaAlO2 + H2O + HCl Al(OH)3 + NaCl. Nhôm có tính khử mạnh chỉ sau kim loại kiềm và kiềm thổ.35 Để làm kết tủa hoàn toàn Al(OH)3 người ta thực hiện phản ứng A.Câu 6. chu kì 3. Al(OH)3 .31 Cation M có cấu hình electron ở lớp ngoài cùng là 2s22p6. HCl. Câu 6. Câu 6. D. đpnc. Al(OH)3 + NaOH Na[Al(OH)4]. nhóm IB. 2 3+ Câu 6. 2Al(OH)3 2Al + 3H2O + O2. C. đpnc. C. chu kì 3. D. NaOH. E (dung dịch) và (1). t0. 79 .34 Cho sơ đồ : +X +Y +Z → Al → Al2(SO4)3 → Al(OH)3  Ba [ Al(OH) 4 ] 2 Al(OH)3 Al2O3 Al. NaOH đủ. Lúc đầu đều có kết tủa keo trắng. t0. Nhôm bị phá hủy trong môi trường kiềm. sau đó kết tủa không tan ra. Al2O3 + 3H2O 2Al(OH)3.

C. Lúc đầu đều có kết tủa keo trắng.35M. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa rồi tan ra.75M. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. ở (2) kết tủa tan.39 Cho từ từ đến dư dung dịch NaOH lần lượt vào các dung dịch đựng Na+ (1). C. B. 70%. 60%. rồi kết tủa không tan. 13. Kết thúc phản ứng thu được số gam chất rắn là A. CO 2 (2) lần lượt vào ống đựng dung dịch Na[Al(OH)4] thấy A. 13. ở (1) kết tủa không tan. (2) là NaOH. 10. 4.42 Cho 100ml dung dịch AlCl3 1M tác dụng với 200ml dung dịch NaOH. C. D. Câu 6. Câu 6.43 Hoà tan 5. (2) là NaOH. Lúc đầu đều có kết tủa keo trắng. C. Al3+ (2). D. Mg2+ (3) ta quan sát thấy A. ở (1) không hiện tượng.41 Có 4 mẫu bột kim loại là Na.44 Điện phân Al2O3 nóng chảy với dòng điện cường độ 9.75M và 0. B.35M. Lúc đầu đều có kết tủa keo trắng. ở (2) và (3) xuất hiện kết tủa trắng rồi tan. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. D.Câu 6. C. 2. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa. Câu 6. 90%. B.75M. D. D. Câu 6. 15. 2. 3. MgSO4. (2) là NaOH. ở (1) không hiện tượng. không tan. Không dùng thêm chất khác. B. 80 . C.65A trong thời gian 3000 giây thu được 2.4g bột Al vào 150ml dung dịch hỗn hợp chứa Fe(NO3)3 1M và Cu(NO3)2 1M.16g Al. ở (1) không hiện tượng. nhận ra (1) là AlCl3 . ở (1) không hiện tượng. ở (2) xuất hiện kết tủa trắng rồi tan.55g.8. ở (2) kết tủa không tan. D. Al. ở (3) xuất hiện kết tủa trắng. 2.75M và 0. sau đó kết tủa tan ra. 80%. Câu 6. rồi không tan. B. kết tủa trắng tăng dần. Al2O3. nhận ra (1) là AlCl3 .38 Phèn chua có công thức là A. K2SO4. Câu 6. D.Al2(SO4)3. không tan. Na3AlF6. ở (1) kết tủa tan.95. 1. nhận ra (1) là AlCl3 . Hiệu suất điện phân là A. C. ở (2) xuất hiện kết tủa trắng. người ta phân biệt chúng bằng cách A.75M và 0. kết tủa trắng tăng dần rồi tan.35M và 0. Kết tủa tạo thành được làm khô và nung đến khi khối lượng không đổi cân nặng 2. Chỉ dùng thêm nước làm thuốc thử thì số kim loại có thể phân biệt được là A.37 Cho dần từng giọt dung dịch HCl (1) .24H2O. 0. Fe.2. sau đó kết tủa không tan ra. nhận ra (1) là AlCl3 . C.24H2O. B. Lúc đầu đều có kết tủa keo trắng.Al2(SO4)3. B. D. 0. Câu 6. (2) là NaOH. Mg.2. B.nH2O. Nồng độ mol/l của dung dịch NaOH ban đầu là A. ở (3) xuất hiện kết tủa trắng không tan.40 Có 2 lọ không ghi nhãn đựng dung dịch AlCl 3 (1) và dung dịch NaOH (2).

C. Dung dịch Na2CO3. B. Al và Fe bằng dung dịch HCl.6 lít khí. MgO.51 Cho 2. 12. B. (Các phản ứng đều xảy ra hoàn toàn. B. C. 9. D. D.Câu 6. m có giá trị là A. Al (điều kiện phản ứng coi như có đủ) có thể điều chế được A. Cô cạn dung dịch X được m g chất rắn. B. Giá trị của V là A.96 lít khí.2g. Dung dịch NaOH. AlCl3. C. Câu 6.32 gam nhôm kim loại bằng dung dịch HNO3 loãng.46 Chỉ dùng các chất ban đầu là NaCl. B. D. 4.50 Hoà tan hết 3.34g.22g hỗn hợp kim loại gồm K. m nhận giá trị bằng A.52 Cho 3. Al. 14. H2O.6g.22g muối khan. m g X tác dụng với nước dư được 5. 12.45 Một thuốc thử phân biệt 3 chất rắn Mg. CuO. 11. 5. Dung dịch Na2CO3.10.95g.4800 lít. C.07g. AlCl3 . Mặt khác. Na và Ba vào nước được 500ml dung dịch X có pH = 13.136 lít khí (đktc) và m g muối clorua. C.10g.53 Hỗn hợp X gồm K và Al. Câu 6. là A. C. B. các thể tích khí đo ở đktc). Al(OH)3.49 Hoà tan hết 10g hỗn hợp muối cacbonat của kim loại IA và IIA bằng dung dịch HCl dư. D. D.24 lít khí (đktc). Al2O3 . Công thức của oxit là A.20g. 13. Câu 6. m có giá trị là A. Al(OH)3. Al2O3 D.45g. Sau đó cô cạn dung dịch thu được x gam muối khan. Câu 6. C.02g. ZnO. Mg. D. thu được 3. 4.44g. Ca. 18g.80g. 3.8g. 11.54 Hoà tan 4. C. Câu 6.4048 lít. 2. 16g. x có giá trị là A.06g oxit của kim loại M (có hoá trị n) tan trong HNO3 dư thì thu được 5.48 Một hoá chất để phân biệt các dung dịch riêng biệt NaCl. Na. H2SO4 đặc nguội. D. dư thu được V lít khí NO (đktc) và dung dịch X. C.52 gam muối.15. Dung dịch HCl. 3. AlCl3 là A. B. Câu 6. C. 12. H2O. D. dung dịch NaOH. Câu 6.5088 lít. 3. m g X tác dụng với dung dịch Ba(OH)2 dư thu được 8. D.00g. B. NaOH. B. 81 . Câu 6. dung dịch HCl. Câu 6. Cô cạn dung dịch X thu được 35. HCl đặc.6000 lít. amoniac.05g.5g hỗn hợp kim loại gồm Mg. CaCl2 . BaO. thu được 2.47 Một hoá chất để phân biệt Al. 3. Al2O3 đựng trong các lọ riêng biệt là dung dịch A. B. H2O.

90%. C. 102kg. 82 . Ca. 6.84g muối sunfat. C.102kg.04g hỗn hợp Fe và Cu tác dụng với dung dịch HNO 3 loãng thu được 0. 3. nếu đem tác dụng với dung dịch HCl dư thu được 26.1800kg Câu 6. 69. 210ml. B.Câu 6. Câu 6. % Fe theo khối lượng là A. B. Câu 6.58 Hợp kim Al-Mg tác dụng vừa đủ với dung dịch HCl thu được 8. D.88 lít H2(đktc).48 lít.62 3. D. 54g. Câu 6.57 Cho 9g hợp kim Al tác dụng với dung dịch NaOH đặc.60 31.6%.1020kg. D. D. 0. 180kg D. 8. dư thu được 10.8%.96 lít.08 lít H2 (đktc). Câu 6. và khí thoát ra ở anot chỉ là CO2) có giá trị lần lượt bằng A. 4. B. % Al tính theo khối lượng là A. Biết đã dùng dư 10ml thì thể tích dung dịch NaOH 4M đã lấy ban đầu là A.4g. 10200kg . Fe. 27g.72 lít.24 lít. 2.9g. 20ml. C. 18kg C.55 Khối lượng K2O cần lấy để hoà tan vào 70. 2.4g. Cũng lượng hợp kim trên tác dụng vừa đủ với dung dịch NaOH thu được 6. Kim loại là A.46%. 5. D.2%. 3. 63. Hỗn hợp sau phản ứng nhiệt nhôm nếu đem tác dụng với NaOH dư thu được 6.92%. C.72 lít H2(đktc). B.2 mol Al vào nước dư thì thể tích khí thoát ra (đktc) là A.72 lít H2 (đktc). % Al trong hợp kim là A. Câu 6. 9%. B.68%.96 lít H2 (đktc). D.7g. 6.896 lít NO (đktc). 4.32%. 6. 34.56 Cho hỗn hợp 0. nóng. C. 9.52g một kim loại tan hết trong dung dịch H 2SO4 loãng thu được 6.63 2. Câu 6.4g. B. 21ml. Câu 6. B.6g nước để thu được dung dịch có nồng độ 14% là A. Al.8atm).59 Khối lượng Al2O3 và khối lượng cacbon bị tiêu hao cần để sản xuất được 0. 4.2%. 180kg B.61 Hỗn hợp Al và Fe3O4 đem nung không có không khí.8 lít H2 (00C. D. D.3%. C. 200ml.1 mol Ba và 0. B. 8. 7. 36.2g hỗn hợp Al và Al2O3 tác dụng với dung dịch NaOH dư thu được 16. C.8g. C. K. Khối lượng Al trong hỗn hợp ban đầu là A.54 tấn Al bằng phương pháp điện phân nóng chảy Al2O3 với anot bằng cacbon (coi như hiệu suất điện phân bằng 100%. 73%.

anot là nơi xảy ra A.65 Cho Fe tác dụng với dung dịch H2SO4 loãng.55g.12g. Tên lá kim loại là A. a có giá trị là A.255g. D.36g. 42. D. 625. sự điện phân dung dịch muối. Al B.sự oxi hoá chất khử. 8.69 50g một lá kim loại tan hết trong dung dịch HCl thu được 336ml H 2(đktc) và thấy khối lượng lá kim loại giảm 1.5g.67 Khi khử hoàn toàn a g hỗn hợp gồm Fe và Fe 2O3 ở nhiệt độ cao thu đựơc 11.96 lít H2 (đktc). sự oxi hoá chất khử B. C.0136g.8g so với ban đầu. B. sự điện phân dung dịch muối. Giá trị a là A.71 Trong pin điện hoá. C.8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3. Thể tích H2 (đktc) là A.22g. catot là nơi xảy ra A. electron. 21. 11g. B. D. Câu 6. Nếu cho a g hỗn hợp trên tác dụng với dung dịch HCl dư thì được 8. Thêm H2SO4 vào 20ml dung dịch trên thấy làm mất màu 30ml dung dịch KMnO 4 0. sự khử chất oxi hoá.68 Cho dung dịch chứa 16.68g Al2(SO4)3 nữa thì thu được kết tủa X.6255g.7H2O.70 Suất điện động chuẩn E0 (pin) tính bằng A. nguyên tử Cu. Giá trị a là A. B.72 Trong pin điện hoá. Fe C.6 gam FeSO4. nguyên tử Zn. D.73 Trong cầu muối của pin điện hoá Zn – Cu xảy ra sự di chuyển các A.2g. 5. C.96 lít. C.1M. 6. thu được chất rắn Y. Còn nếu cho a g hỗn hợp trên tác dụng với dung dịch CuSO4 dư thì được chất rắn có khối lượng tăng thêm 0. 3.36 lít. C. sự điện li dung dịch muối. Câu 6.2g. D. E0 (pin) = E0 (anot) − E0 (catot).5g. D.BÀI TẬP NÂNG CAO Câu 6. D. ion. 1.136g. C.6g O2 (đktc). 0. Câu 6. Nhiệt phân hoàn toàn X. B.5g. Mg D. E0 (pin) = E0 (catot) + E0 (anot).68%. E0 (pin) = E0 (anot) + E0 (catot). E0 (pin) = E0 (catot) – E0 (anot). dung dịch thu được cho bay hơi H2O được 55. 16. C. Khối lượng chất rắn Y là A.2g Fe. 13. 4. C. Câu 6. 83 . B. Câu 6. tiếp tục thêm vào dung dịch sau phản ứng 13. 4.6g. sự khử chất oxi hoá. 0.48 lít. D. 6.22g. 0.Câu 6. B. 2. D.7H2O tác dụng với H2O thu được 300ml dung dịch.66 Cho a g FeSO4. Câu 6.64 Cho a g hỗn hợp gồm Al và Fe tác dụng với dung dịch NaOH dư thu được 1 thể tích H2 bằng thể tích của 9. Na II. C. B. 62. B. Câu 6.72 lít. sự điện li dung dịch muối. Câu 6.

Công thức hoá học của muối cacbonat là A. D.6%. B. D.42g Al2(SO4)3 tác dụng với 250ml dung dịch NaOH aM.55g cacnalít tác dụng với dung dịch KOH dư. B.12M hoặc 0. Câu 6.10H2O.76 Biết E pin (Zn – Cu) = 1.zH2O.6H2O.79 Cho 3.04M hoặc 0. 20. 0. − 0.2MgCl2. 2Ag+ + Fe → Fe2+ + 2Ag B.44V. D.08M. 7.10V và E0(Cu2+/Cu) = +0.26%.1.32g.1M. Fe3+ + 3Ag → Fe + 3Ag3+ Câu 6. Nồng độ mol/lít của dung dịch NaOH đã dùng là A.77 Hoà tan 2. C. B. thu được 0.0. B.MgCl2.80 Điện phân dung dịch NaOH với cường độ không đổi là 10A trong 268 giờ.khử Ag+/Ag và Fe2+/Fe là A.8%. C. –1. C.79V.66V. D. C.34V. 0.44V. 2KCl.Câu 6. lọc lấy kết tủa đem nung đến khối lượng không đổi thì được chất rắn có khối lượng giảm 0. Câu 6. 2.6H2O.MgCl2. 1. 77%.36g so với trước khi nung.56M. C.74 Phản ứng xảy ra trong pin điện hoá được cấu tạo bởi cặp oxi hoá. Biết khi nung nóng 11. D. Công thức hoá học của cacnalit là A. thu được một chất khí và dung dịch X. B. C. Nồng độ % của dung dịch NaOH trước điện phân là A.81 Cho 5g Na có lẫn Na2O và tạp chất trơ tác dụng với H2O thu được dung dịch X và 1. Na2CO3. 0. Na2CO3.xH2O trong 250cm3 nước cất. 24%.09V.94V. B. 12. Fe + 3Ag3+ → Fe3+ + 3Ag D.78 Cho công thức hoá học của muối cacnalít là xKCl.7H2O. Câu 6.yMgCl2. Mặt khác khi cho 5.2M hoặc 2.6g muối sunfat trung hoà khan. D.1g cacnalít thì khối lượng giảm 4. 0. KCl. 2. ZnCO3. Câu 6. Dung dịch X trung hoà vừa đủ 200ml dung dịch HCl 1M. B. MgCO3. KCl. Câu 6.H2O.5cm3 dung dịch HCl 0.875 lít khí Y (đktc).76V. + 1.28M.6H2O.4%. Cô cạn X thu được 7. Công thức hoá học của muối ngậm nước là A. B.82 Cho 5. thế điện cực chuẩn (E0) của cặp oxi hoá – khử Zn2+/Zn là A. 2KCl.8g muối cacbonat của một kim loại hoá trị II hoà tan trong dung dịch H2SO4 loãng vừa đủ.5g muối Na2CO3.6H2O. Biết 25cm3 dung dịch này tác dụng vừa đủ với 17.2%.78g chất kết tủa. Thành phần % theo khối lượng của tạp chất trơ là A. Na2CO3. 84 . D.8M. Sau điện phân còn lại 100g dung dịch 24%. 0. CaCO3. Na2CO3. Fe2+ + 2Ag → 2Ag+ + Fe C. + 0. FeCO3.5H2O.75 Suất điện động chuẩn của pin điện hoá Sn −Ag là A. C.76V.2MgCl2. Câu 6. D. C.7%.24M hoặc 0. 0 Câu 6. 1.

6 B.1s22s22p63s23p1.6g hỗn hợp chất rắn. D. HNO3 Câu 6. B.2g so với ban đầu.76g hỗn hợp 2 kim loại và dung dịch Y. 7. 58. 1s22s22p63s23p3. Thêm từ từ dung dịch HCl 1M vào X. D. 0. B.2 Câu 6. Nếu cho 23.84 Cho 21g hỗn hợp 2 kim loại K và Al hoà tan hoàn toàn trong nước được dung dịch X. n. Thành phần % theo khối lượng của Al trong X là A. 6. B. Dẫn từ từ toàn bộ Y vào ống chứa bột CuO dư.95g. 1 B.1s22s22p63s23p2. Chấm dứt phản ứng thu được dung dịch X. . B. B. . Khối lượng Zn trong hỗn hợp là A.675 mol SO2. C. 0. nóng. nung nóng thấy khối lượng chất rắn trong ống giảm 7.8. 2 C. 4 Câu 6.4g X gồm Al.89 Cho 5. NO và còn dư Fe. lúc đầu không thấy kết tủa. 3 D. đến khi kết tủa hoàn toàn thì cần 400ml dung dịch HCl. đun nóng thu được 1. 35.4. C. R có hoá trị II. e) là 40. Số gam K là A. cấu hình electron của R là A.12.32g kết tủa.4g X tác dụng với dung dịch H2SO4 loãng dư thu được khí Y. Dung dịch X chứa chất tan A.88 Cho dung dịch X chứa các ion Mg2+. Tổng khối lượng các ion trong dung dịch X là A.6g. C.85 Cho 23.8.87 Khuấy đều một lượng bột Fe và Fe3O4 vào dung dịch HNO3 loãng. Câu 6.22g. Fe(NO3)3. Câu 6. C.89%.56g. D.96g chất rắn và hỗn hợp khí X. D. Cl-.06 mol khí.2g.Fe(NO3)3 và HNO3 D. 85 .4 C.Thí nghiệm 2: X tác dụng với dung dịch BaCl2 dư thu được 9. Fe(NO3)2.97%. 5.Câu 6. Hấp thụ hoàn toàn X vào nước được 300ml dung dịch Y.58g Cu(NO3)2 trong bình kín.86 Hỗn hợp X gồm a mol Al và 0. Fe(NO3)2 và Fe(NO3)3 C. 1s22s22p63s2. C. SO42-. Fe. 5. 10. pH của dung dịch Y là A. Giá trị của a là A. dư thu được 0. 23.32g. Cu tác dụng với dung dịch H 2SO4 đặc.15g hỗn hợp X gồm Zn và Cu vào 140ml dung dịch AgNO3 1M. 1.3 D.Fe(NO3)2. 1.6.08%. Sau khi phản ứng xong được 15.4.03%.16g kết tủa và 0. Câu 6.4 mol O2 thu được 64. NH4+. Câu 6. 2. B.3 mol Mg phản ứng hết với hỗn hợp Y (vừa đủ) gồm b mol Cl2 và 0. 3.Thí nghiệm 1: X tác dụng với dung dịch NaOH dư. 0. 41. 0. 15. D.90 Nguyên tố R có tổng số hạt (p.4g.11g. sau một thời gian thu được 4.83 Nung 6.

97 Thứ tự pH theo chiều tăng dần các dung dịch có cùng nồng độ mol của NH 3. 0.275M. Câu 6. B. Ba(OH)2.56g chất kết tủa.98 Sau một thời gian điện phân 200ml dung dịch CuSO4 với điện cực trơ.12 hoặc 0.35g hai kim loại kiềm thuộc 2 chu kì liên tiếp vào 500ml dung dịch HCl được dung dịch Y và 2. B.5M D.2M. D.Câu 6. B. Al và Fe. D.804A đến khi bọt khí bắt đầu thoát ra ở cực âm thì mất 2 giờ. X và Y lần lượt là A. B. khi đó khối lượng cực âm tăng thêm 3. O. NH3. X và Y lần lượt là A. B. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 43 hạt.02M. Câu 6. 0. 0. D.90.44g. B. Be. 1s22s22p2.91 Nguyên tử của nguyên tố X có tổng số electron trong các phân lớp p là 7. NaOH. 1M. NaOH. Fe và Cu.18M.8 lít khí H2 (đktc). D. 1s22s22p63s23p3. Câu 6. NaOH.[KCldư] = 0.12 hoặc 0.96 Cho x mol CO2 hấp thụ hoàn toàn vào 200ml dung dịch hỗn hợp gồm KOH 1M và Ba(OH)2 0.5M. Z = 1).75M. [ KOH] = 0. Ba. 3M Câu 6. Câu 6.9M. Ca. NaCl.100 Điện phân 100ml một dung dịch có hoà tan 13. Giá trị của x là A. 3.[ KOH] = 0. n.1M.94 Cho ion HXO3-. FeCl3. Nồng độ mol/l của dung dịch CuSO4 trước điện phân là A. B. NH3. B.[KCldư] = 0. Câu 6. cần dùng 100ml dung dịch H2S 0.62g Al trong 280ml dung dịch HNO3 1M thu được dung dịch X và khí NO (sản phẩm khử duy nhất). Mg. Ba(OH)2.đều có cấu hình electron ở phân lớp ngoài cùng là 2p 6. B. 0. Ba(OH)2.12 C.9M. C. O.5g CuCl2 và 14. Z = 8). 86 . MgCl2. D. C. C. O (A = 16. Mặt khác cho 7. e) trong 2 nguyên tử kim loại X và Y là 142.95 Tổng số hạt (p.75M thu được 23. 0. [ KOH] = 0. 0. D. 2 2 6 2 4 C.[ KOH] = 0. Câu 6. O. Ba(OH)2 là A.88 D. 0.1A. Mg và Fe. NaOH. Để kết tủa hết ion Cu2+ còn lại trong dung dịch sau điện phân. 1.9g KCl có màng ngăn và địên cực trơ mất 2 giờ. Vậy X có cấu hình electron là A.99 Điện phân 200ml dung dịch có chứa 2 muối là Cu(NO3)2 và AgNO3 với cường độ dòng điện là 0. Nồng độ mol/l của dung dịch CuSO4 ban đầu là A.15M C.38. NH3.9M. nguyên tử của nguyên tố Y có tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện của X là 8. Nồng độ mol các chất có trong dung dịch sau điện phân đã được pha loãng cho đủ 200ml là A.9M. Câu 6.64g kết tủa. NH3. Biết H (A = 1.52M.1M. trong đó tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện là 42 hạt. cường độ dòng điện là 5. 0. Khi trộn dung dịch X vào dung dịch Y tạo thành 1. 1s 2s 2p 3s 3p . Công thức hoá học của hợp chất tạo bởi X và Y là A. D. O.3M B. Số hạt mang điện của nguyên tử Y nhiều hơn X là 12 hạt. Ca và Fe. AlCl3. Ba(OH)2.35M.93 Hoà tan hoàn toàn 1. C. C. D. 0.92 Cation X2+ và anion Y2. khối lượng dung dịch giảm 8g. Nồng độ mol/l của dung dịch HCl là A. Câu 6. 0. NaOH. C. C. Tổng các hạt trong ion đó là 123. 1s22s22p63s23p63d64s2. 0. 0.

14g vào dung dịch H 2SO4 loãng dư.83 6. D. B. C.46 6.53 6. Nhúng lá (1) vào dung dịch CuCl2.36 6.44g.103 6.4 A 6. Kết quả về khối lượng: lá (1) tăng 1. lá (2) tăng 8.95 6.91 6.2 D 6. lá (2) vào dung dịch CdCl2 đến khi thấy số mol CuCl2 và CdCl2 trong hai dung dịch giảm như nhau thì nhấc ra.5 A 6.16 6.97 6.6% so với ban đầu.84 6. Kim loại thu được đem hoà tan trong dung dịch HCl thu được 1.15 6. thấy đã dùng hết 40ml dung dịch KMnO4.26 6.105 A A A A A 87 .56 6.24 6. C. 1.68g.73 6.41 6.77 6.17 6.78 6. Mg.8 B 6.23 6.48 6.92 6.93 6. 90%.21 6.31 6.29 6.96g.2%.65 6.42 6.8g.102 M là kim loại hoá trị II.71 6.49 6.63 6.6 A 6. ZnO. Câu 6.52 6.20 A B C C A A D A B A 6. Lấy 2 lá kim loại M có khối lượng bằng nhau.14 6.12 6. Cu. C. Fe.99 6.74 6. 1.40 A D C B A C C A A C 6. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VI 6. Câu 6.86 6.59 6.105 4.34 6.103 Cho một cây đinh thép nặng 1. M là A. D.55 6. 16. Kết quả về khối lượng : lá (1) tăng 19%.102 6.1 D 6.32 6.39 6. CuO.101 M là kim loại hoá trị II. Zn.104 6. thu được chất rắn và dung dịch X. Zn .35 6.27 6. 49.72 6. Fe2O3 .51 6. Fe3O4. D. Nhỏ từ từ dung dịch KMnO4 0. B. D.90 C A A A A A A B B B 6. Khối lượng Fe trong hỗn hợp là A. D.Câu 6. B.54 6. 1.19 6.79 6. Câu 6.80 A B A A C A A A B A 6. Cu. lá (2) vào dung dịch Cu(NO 3)2 đến khi thấy số mol Pb(NO3)2 và Cu(NO3)2 trong hai dung dịch giảm như nhau thì nhấc ra.85 6. Cũng lượng hỗn hợp trên ngâm trong dung dịch CuSO4 dư thì khối lượng chất rắn thu được là 4. M là A.75 6.6g.13 6.98 6.82 6. 88%.18 6.101 6.38 6.96 6.3 A 6.7 B 6.4% so với ban đầu.67 6.2 %.50 D A B C B B A A B A 6.1%. Lấy 2 lá kim loại M có khối lượng bằng nhau.8g một oxit của kim loại trong dãy điện hoá ở nhiệt độ cao. 98.44 6.76 6.81 6. lá (2) giảm 9.94 6.25 6. B.68 6.016 lít khí H2 (đktc).92g Fe. Công thức hoá học của oxit kim loại là A.58 6.104 Khử 4.57 6.28 6. Nhúng lá (1) vào dung dịch Pb(NO3)2.10 D A 6.60 C B A D D D A B C D 6. B.87 6. %Fe trong đinh thép là A.47 6. C.72g hỗn hợp bột các chất Fe.45 6.61 6.64 6.88 6.1M vào X đến khi dung dịch X bắt đầu có màu hồng.89 6.100 A C A C A A A B B A 6.30 A C C C C B A A B C 6. Mg.37 6. FeO.62 6.70 A A D A B C D D B A 6.11 6. cần 2. Fe 2O3 tác dụng với CO dư ở nhiệt độ cao thu được 3. Câu 6.22 6.69 6.344 lít H2 (đktc).43 6. Cd.33 6.9 6.66 6. C.

Tính khử. Cu : [Ar]3d104s1. E Fe3+ /Fe2+ = 0. tính axit. E Cu 2+ /Cu = 0. Số oxi hoá +3 . CROM − SẮT − ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.Tính oxi hoá. Số oxi hoá +3 Số oxi hoá +6 . .Oxit và hiđroxit có lưỡng tính.44V. t0 2 Nước CrCl3 (r) + Cl +Zn 2 +(O +H O) 2 2 H2CrO47 H2Cr2O Cr HCl H2SO4(l) Cr (dd) Axit Cr(OH)2 +2 Cr +3 +Br (dd) +SO2. 3. E Fe2+ /Fe = -0. 0 0 0 0 .Tính khử. .Oxit và hiđroxit có tính .Cấu hình electron nguyên tử Cr : [Ar]3d54s1. 2.Tính oxi hoá.Tính khử và tính oxi hoá. . .Oxit và hiđroxit có tính bazơ.2 KI Cr +6 (dd) Kiềm Axit Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 . Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 .Oxit và hiđroxit có tính bazơ.CHƯƠNG VII.34V. Sơ đồ minh hoạ tính chất hoá học của crom + O .77V. Sơ đồ minh hoạ tính chất hoá học đồng + + 88 . . Fe : [Ar]3d64s2.74V. 4.Thế điện cực chuẩn E Cr3+ /Cr = -0. Crom − Sắt − Đồng .Oxit và hiđroxit có tính bazơ. t0 2 Cr2O3 (r) + NH 3 CrO3 + bột Al + Cl .

t 0 CuO (đen) 3 Cu2O (đỏ) Chất khử CO. Pb Số oxi hoá Eo(V) Tính khử Ag +1. Fe + H2SO4 loãng  → FeSO4 + H2. 89 . Sơ lược về các kim loại Ag. → 4. t Không khi ẩm Khí Clo khô t0 CuCO3.13 Yếu B . +4 Pb2+/Pb -0. → 7. H2SO4 đ dd FeCl3. (+2) Ag+/Ag +0. Fe + 2HCl  → FeCl2 + H2.Oxit và hiđroxit có tính bazơ. Fe + 6HNO3 đặc  → Fe(NO3)3 + 3NO2 + 3H2O.5H2O Cu(NO3)2.08 Rất yếu Ni +2. → 0 t 3. Zn. 8.Bình Au Zn +2 Zn2+/Zn -0. t0 6. 10000C Cu 0 Không khí. NH .[Cu(NH3)4]2+ NH3 Cu(OH)2 OH - H + HCl + O2.14 Yếu Pb +2. Au. Fe + 4HNO3 loãng  → Fe(NO3)3 + NO + 2H2O. AgNO3 Cu2+ (dd) H + Kết tinh CuSO4.5 -0. → t0 2. 5.26 Rất yếu T. 5. 3Fe + 2O2  Fe3O4. . +1. Sn. 2Fe + 6H2SO4 đặc  Fe2(SO4)3 + 3SO2 + 6H2O.Tính oxi hoá. Fe + S  FeS. HNO3. +4 Sn2+/Sn -0.3H2O Không khí. 2Fe + 3Cl2  2FeCl3. Ni.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) t0 1.76 Mạnh Sn +2. +3 (+3) Au3+/Au Ni2+/Ni +1.Cu(OH)2 (r) CuCl2 (r) Số oxi hoá +2 .

28. 43. 10. t0 2Fe(OH)3  Fe2O3 + 3H2O. Fe2O3 + 6HCl  → 2FeCl3 + 3H2O. 31.. t0 FeO + CO  Fe + CO2. 26. FeCl3 + 3NaOH  → Fe(OH)3 + 3NaCl. 2FeCl3 + Cu  → 2FeCl2 + CuCl2. 2FeS2 + 14H2SO4  → Fe2(SO4)3 + 15SO2 + 14H2O. Fe + 3AgNO3 (dư)  → Fe(NO3)3 + . 34. 16. 36. Fe + 2AgNO3  → Fe(NO3)2 + 2Ag. <5700 C 3Fe + 4H2O → Fe3O4 + 4H2. Fe(OH)2 + H2SO4  → FeSO4 + 2H2O. 0 t 3Fe2O3 + CO  2Fe3O4 + CO2. → t0 2Cr + 3S  Cr2S3.. 15... 18. → 2Fe(OH)3 + 3H2SO4  → Fe2(SO4)3 + 6H2O.. 22. Fe2O3 + 3H2SO4  → Fe2(SO4)3 + 3H2O. 32. 20. 4Fe(OH)2 + O2 + 2H2O  → 4Fe(OH)3. 2FeCl3 + Fe  → 3FeCl2. 2FeCl3 + 2KI  → 2FeCl2 + 2KCl + I2. 12. → 0 t 2FeO + 4H2SO4 đặc  Fe2(SO4)3 + SO2 + 4H2O. 35. 44. Fe (dư) + H2SO4 (đặc)  → FeSO4 + . → t0 Fe2O3 + CO  2FeO + CO2.. 90 Fe (dư) + HNO3  → Fe(NO3)2 + . 24. 10FeSO4 + 2KMnO4 + 8H2SO4  → 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. 33. FeO + 2HCl  → FeCl2 + H2O. 40. Fe + CuSO4  → FeSO4 + Cu. t0 3FeO + 10HNO3 đặc  3Fe(NO3)3 + NO + 5H2O. 30. 27. t0 4FeS2 + 11O2  2Fe2O3 + 8SO2. 21. 25.. 19. >5700 C Fe + H2O → FeO + H2. → Fe2O3 + 3H2SO4 loãng  → Fe2(SO4)3 + 3H2O.. 29. 41. 17. Fe(OH)3 + 3HCl  → FeCl3 + 3H2O. 11.9. → 0 t Fe2O3 + 3CO  2Fe + 3CO2. → t0 4Cr + 3O2  2Cr2O3. → FeO + H2SO4 loãng  → FeSO4 + H2O. 39.. 14. → .. 37. → 0 t 2Cr + 3Cl2  2CrCl3. 38.. 23. → Fe(OH)2 + 2HCl  → FeCl2 + 2H2O. 2FeCl2 + Cl2  → 2FeCl3. FeCl2 + 2NaOH  → Fe(OH)2 + 2NaCl. 13. 42.

77. CrCl2 + 2NaOH  → Cr(OH)2 + 2NaCl. → Cr(OH)2 + 2HCl  → CrCl2 + 2H2O. 63. 49. → 91 . 48. 58. → CrO + 2HCl  → CrCl2 + H2O. 2NaCrO2 + 3Br2 + 8NaOH  → 2Na2CrO4 + 6NaBr +4H2O 2Na2Cr2O7 + 3C  → 2Na2CO3 + CO2 + 2Cr2O3. 0 t Cu + Cl2  CuCl2. → 2CrO3 + 2NH3  → Cr2O3 + N2 + 3H2O. 54. 64. → K2Cr2O7 + 6FeSO4 + 7H2SO4  → 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. 66. 2CrCl3 + 3Cl2 + 16NaOH  → 2Na2CrO4 + 12NaCl + 8H2O. → 2Na2CrO4 + H2SO4  → Na2Cr2O7 + Na2SO4 + H2O. 76. 2Cr2O3 + 8NaOH + 3O2  → 4Na2CrO4 + 4H2O. 47. 0 t Cr2O3 + 2Al  2Cr + Al2O3. 2Cr + 3SnCl2  → 2CrCl3 + 3Sn. 72. 55. 60. → t0 2Cu + O2  2CuO. 53. 65. 62. 67. 61. 2CrO3 + H2O  → H2Cr2O7. 78. 52. K2Cr2O7 + 3H2S + 4H2SO4  → Cr2(SO4)3 +3S + K2SO4 + 7H2O.45. 80. 71. → t0 2Na2Cr2O7  2Na2O + 2Cr2O3 + 3O2. Na2Cr2O7 + 14HCl  → 2CrCl3 + 2NaCl +3Cl2+ 7H2O. K2Cr2O7+6KI+7H2SO4  Cr2(SO4)3+4K2SO4+3I2+7H2O. K2Cr2O7 + 3K2SO3 + 4H2SO4  → Cr2(SO4)3 + 4K2SO4 + 4H2O. → CrO3 + H2O  → H2CrO4. 79. Na2Cr2O7 + S  → Na2SO4 + Cr2O3. → >1000 C 2CrO + O2  2Cr2O3. 4CrCl2 + O2 + 4HCl  → 4CrCl3 + 2H2O. 59. 73. Cr(OH)3 + 3HCl  → CrCl3 + 3H2O. o t 2Cr(OH)3  Cr2O3 + 3H2O. 0 t (NH4)2Cr2O7  Cr2O3 + N2 + 4H2O. Cr2O3 + 3H2SO4  → Cr2(SO4)3 + 3H2O. 75. Cr + H2SO4  → CrSO4 + H2. 2CrCl3 + Zn  → ZnCl2 + 2CrCl2. CrCl3 + 3NaOH  → Cr(OH)3 + 3NaCl. 50. 57. to 4Cr(OH)2 + O2 + 2H2O  4Cr(OH)3. 69. Cr(OH)3 + NaOH  → Na[Cr(OH)4] (hay NaCrO2). 4200 C 4CrO3  2Cr2O3 + 3O2. 2CrCl2 + Cl2  → 2CrCl3. 68. 70. Cr + 2HCl  → CrCl2 + H2. 46. 56. 51. 74.

0 t CuO + H2  Cu + H2O. 86. 109. 87. → 0 . → t0 Zn + O2  2ZnO. → Cu + 2H2SO4 đặc  → CuSO4 + SO2 + 2H2O. 110.81. → t0 Zn + Cl2  ZnCl2. 96. Cu + 2FeCl3  → CuCl2 + 2FeCl2. CuO + H2SO4  → CuSO4 + H2O. 89. → ñieä phaâ dung dò n n ch 2Cu(NO3)2 + 2H2O  2Cu + 4HNO3 + O2. 101. Cu(OH)2 + 2HCl  → CuCl2 + 2H2O. 92 t Cu + S  CuS. 3Cu + 8NaNO3 + 4H2SO4  → 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. 93. 3Cu + 8HNO3 loãng  → 3Cu(NO3)2 + 2NO + 4H2O.Cu(OH)2  2CuO + CO2 + H2O. 0 t Cu(OH)2  CuO + H2O. → t0 3CuO + 2NH3  N2 + 3Cu + 3H2O. → 0 t 2Pb + O2  2PbO. → 3Pb + 8HNO3 loãng  → 3Pb(NO3)2 + 2NO + 4H2O. 82. → ñieä phaâ dung dò n n ch CuCl2  Cu + Cl2. CuS + 4H2SO4 đặc  → CuSO4 + 4SO2 + 4H2O. Cu(OH)2 + H2SO4  → CuSO4 + 2H2O. 104. Sn + 2HCl  → SnCl2 + H2. 113. → t0 Pb + S  PbS. 98. 107. 90. → Cu(OH)2 + 4NH3  → [Cu(NH3)4]2+ + 2OH-. → 0 t CuCO3. 95. 83. 2Cu + 4HCl + O2  → 2CuCl2 + 2H2O. → Cu2O + H2SO4 loãng  → CuSO4 + Cu + H2O. → CuS + 2AgNO3  → 2AgS + Cu(NO3)2. 0 t 2Cu(NO3)2  2CuO + 2NO2 + 3O2. 111. t0 Sn + O2  SnO2. → t0 CuO + Cu  Cu2O. 114. → 0 t Ni + Cl2  NiCl2. 92. → 0 t Zn + S  ZnS. 102. 88. Cu + 4HNO3 đặc  → Cu(NO3)2 + 2NO2 + 2H2O. 94. 97. 103. 108. 91. 85. 105. 115. CuO + 2HCl  → CuCl2 + H2O. 116. 84. 112. Cu + 2AgNO3  → Cu(NO3)2 + 2Ag. 106. → ñieä phaâ dung dò n n ch 2CuSO4 + 2H2O  2Cu + 2H2SO4 + O2. → t0 CuO + CO  Cu + CO2. 5000 C 2Ni + O2  2NiO. 99. 100.

BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 7. [Ar]3d7. [Ar]3d10. Fe.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư. Phản ứng tự oxi hoá. ZnO. B. 119. [Ar]3d . 2Ag + 2H2S + O2  → 2Ag2S + 2H2O. D. Hg.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ? A. +6.4 Các số oxi hoá đặc trưng của crom là ? A.117. Phản ứng trên thuộc loại phản ứng nào sau đây ? A. Ag. Ag2O + H2O2  → 2Ag + H2O + O2. 123. [Ar]3d6. D. C . → ñieä phaâ dung dò n n ch 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2. 9 C.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ? A. 118. +3. 2Ag + O3  → Ag2O + O2. B. B. C. Zn(HCO3)2. Câu 7. t0 2AgNO3  2Ag + 2NO2 + O2. Zn(OH)2. Cấu hình electron của ion Cu2+ là A. Phản ứng oxi hoá. CaSO4. [Ar]3d8. Phản ứng oxi hoá. Pirit sắt. B. 4 C. D. Na. ZnSO4. C. Mg. B.khử phức tạp.khử. +4. D. Ba. D.khử nội phân tử. Câu 7. +6. C. +4. Cr2O3. C. Manhetit. D. B. 121. Câu 7.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ? 93 . 120. D. MnSO4. B. Câu 7. Câu 7. O2. [Ar]3d3. Hematit.7 Hợp chất nào sau đây không có tính chất lưỡng tính ? A. C. D. +6. Đó là muối nào sau đây ? A. +1. [Ar]3d5. Xiđerit. Câu 7.5 Khi nung Na2Cr2O7 thu được Na2O.6. Ag. +3. B. Ag + 2HNO3(đặc)  → AgNO3 + NO2 + H2O. 124. MgSO4. Na. [Ar]3d . − 5Sn 2+ + 2 MnO4 + 16 H + → 5Sn4+ + 2 Mn2+ + 8 H2 O.khử. +2. C. +2. Ba. Na. Mg. Phản ứng phân huỷ không phải là oxi hoá. Câu 7. +4. 122.2 Cấu hình electron nào sau đây là của ion Fe3+ ? A. +2. ZnSO4. Mg. → Au +HNO3 + 3HCl  → AuCl3 + 2H2O + NO. +6. Câu 7.

Chất có phần trăm khối lượng sắt nhỏ nhất là………… Câu 7. CuSO4.15 Cho biết câu sai trong các câu sau : A. dung dịch AgNO3.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau : 94 . Câu 7.13 Có 2 lá sắt khối lượng bằng nhau. Câu 7. Al-Cu. Câu 7. Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan. C. Chất có % khối lượng đồng nhỏ nhất là……………. Dung dịch : NaOH. CuS(3). B. D. b. NO. Giảm đi. C đều đúng. Cu-Fe bằng phương pháp hoá học. D. Câu 7. Không xác định được. FeSO4(6).10 Phân biệt 3 mẫu hợp kim sau : Al-Fe. Câu 7. C. D. m1>m2. Câu 7. FeS2(5). Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy.. Cả A. C. HNO3 đặc nguội. Fe có khả năng tan trong dung dịch FeCl3. Lá 2 đốt trong khí clo dư thu được m2g muối. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép. D. Chất có phần trăm khối lượng sắt lớn nhất là………… b.5H2O(6). FeS(4). để bảo quản dung dịch muối sắt (II). Các chất có % khối lượng đồng bằng nhau là……………. B. B. Ag có khả năng tan trong dung dịch FeCl3. NH3. H2SO4 loãng.. CuSO4(5). dung dịch HCl. B. D. Kim loại Cr có thể cắt được thuỷ tinh. C. Fe2(SO4)3(7). c. Câu 7.14 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất : FeO(1). sắt kim loại. D. C. Không thay đổi. B. Hoá chất cần dùng là : A. B. Cu có khả năng tan trong dung dịch FeCl3.16 Trong phòng thí nghiệm. D. Crom là kim loại có tính khử mạnh hơn sắt. m2>m1.11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ? A. C. người ta thường cho vào đó : A. FeSO3(8). C. Chất có % khối lượng đồng lớn nhất là……………. Dung dịch : KOH. Mối liên hệ giữa m1 và m2 là A. a.12 Cho biết câu nào không đúng trong các câu sau: A. Fe2O3(2). dung dịch NaOH. dung dịch H2SO4. m1=m2. a. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2. NO2. Cu2S(4). Fe3O4(3).17 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất: CuO(1).. HCl.A. N2O. B. CrO là oxít bazơ. B. Tăng lên. Câu 7. Cu2O(2).

2. B. D. 8. CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả.68. D. Câu 7. Thể tích khí (ở đktc) là A. D.36g hỗn hợp gồm Fe3O4 và oxit của M. D.016 lít hiđro (đktc). Dung dịch thu được sau phản ứng gồm các chất A. [Ar]3d5.92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0. Fe3O4. Câu 7. 27.2857g. M (trong 5.52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi. Câu 7.999g.16. D. 1. Đốt cháy hết phần 2 trong oxi thu được 4.7H2O có khối lượng là 55.27 Hỗn hợp A gồm FeO. 1.3999g . Câu 7. 0. sấy khô. FeCl2.20 Cấu hình electron của Cr3+ là phương án nào ? A. Câu 7. Câu 7. B. Fe. FeCl2. Cu có thể tan trong dung dịch FeCl2.16. 10. [Ar]3d4. 27. 2. 0.26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO 4.16. 18.36. Zn. B.52g một kim loại tác dụng hết với H2SO4 loãng. 0. C. Ngâm lá kẽm vào dung dịch. Trong hỗn hợp A mỗi oxit đều có 0. CuSO4 có thể dùng làm khô khí NH3. C. FeCl3. 3 C. số gam của Fe.48 lít.23 Cho 1. 3.672 lít. D. HCl. D. FeCl3.100g. 0. [Ar]3d2. Kim loại đó là kim loại nào ? A.84g muối sunfat. chia làm 2 phần bằng nhau. 2.36. Câu 7. Cho AgNO3 vào dung dịch.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi.252g. sau một thời gian lấy đinh sắt ra. D. cân nặng 4. [Ar]3d .4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15.3584 lít.36 lít.A. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư. thu được 6. Câu 7. C. C. C. HCl. 54. Al. B. B.36. xăng.24 Lấy 5. B. Fe2O3. C.19. Chọn câu đúng trong các câu sau : A. D.16 lít. 3. Ngâm lá đồng vào dung dịch. Khối lượng của hỗn hợp A là bao nhiêu gam ? 95 . 3. Khối lượng sắt tham gia phản ứng là bao nhiêu ? A. Mg. Phần 1 tác dụng hết với dung dịch HCl thu được 2. B. Khối lượng mol của M.22 Cho 2.6g. 0.16M và H2SO4 0. B. 3. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ? A. FeCl3. 2. C. 0. FeCl2.25 Cho Fe tác dụng với dung dịch H2SO4 loãng. 7.33 lít.0896 lít. C. dung dịch thu được cho bay hơi được tinh thể FeSO4. Cu có thể tan trong dung dịch AlCl3.84.448 lít. Câu 7. Ngâm lá sắt vào dung dịch.52g hỗn hợp A) lần lượt là A.5 mol. HCl. B. 4.

Mg.33 Cho 7. 54.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H 2SO4 loãng thu được 560ml khí ở đktc. 2. Cr2O3 và 48g oxi. Hoà tan chất rắn X trên vào dung dịch HNO3 0. 88. 177 ml. M là kim loại nào ? A.8 lít. Câu 7.405g D. Giá trị của m là A. Cu. 50.36 lít.48 lít khí duy nhất NO (đktc). Na2Cr2O7 còn dư 0. Thể tích dung dịch AgNO3 32% (D=1.68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra. D. Câu 7. 21.1M. B. D. 1.8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171. Khối lượng muối sunfat khan thu được là A.8g đồng trong không khí thu được chất rắn X. C.5M thu được 448 ml khí NO (đktc).2. 0. C. 21. 3.84 lít.35 Đốt 12.5 ml. B.5 mol.08g.65. C. C. 10.12 lít. Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là A. Câu 7. Fe. Phản ứng này không thể xảy ra. 35.31 Một thanh đồng nặng 140.5M thu được 448 ml khí NO (đktc). Biết hiệu suất của quá trình 96%. Câu 7. 3. 15. Câu 7.04 lít.56. C. 20. CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0. C.56. C. Zn. ZnO. 177 lít. 464.52g. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư. Đáp số khác. Na2Cr2O7 còn dư 1 mol. B. 16g. B. Câu 7. dư thu được 4. D.5 lít. Khối lượng chất rắn X là A. B.4. Câu 7.2g kim loại M tác dụng với dung dịch HNO3 loãng. 25.9333 lít D. 22.2 g/ml) đã tác dụng với thanh đồng là A. C.24 lít.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O.65. 22. 88. D. 0. 116. Đáp số khác. C. Hoà tan chất rắn X trên vào dung dịch HNO3 0. 15. 0. D.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao. Vậy: A. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO 4 96 . B. Câu 7.405g hỗn hợp Fe2O3.69.8g đồng trong không khí thu được chất rắn X. B. 25. B. Khối lượng kết tủa thu được là bao nhiêu gam ? A.32 Cho 19. 30.36 Cho 1. D. C. B. B.A. C.2g. 0.34 Đốt 12. 232. Câu 7. Na2Cr2O7 đã hết. D. Câu 7.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ? A.

80%. 4. Giá trị của V là bao nhiêu ? A. Hiệu suất của phản ứng khử CuO là A. Câu 7. 1. 2.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X. B.41 Hỗn hợp X gồm Cu và Fe. C. Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38. Nguyên tố X là A. sắt. 3. trong đó Cu chiếm 43.4. 70%.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra. Fe2O3.36 lít. Có bao nhiêu gam Cu đã bám vào thanh sắt ? A.thì thu được một chất rắn. C. C.448 lít khí (đktc). Fe3O4. 80%. 75%. Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là A. 85%. Cu. 3.48 lít. C. Cho 14. D.24 lít. brom. Câu 7. Tên của kim loại đã dùng là A. n) là 82.8g. Câu 7. 1. Zn. cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1. 14g. 10. đem hoà tan vào dung dịch HCl thấy bay ra 0.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e. 11. C.2g. nếu sục thật 97 .4g. Các khí đo ở đktc. B.38 Khử 2.5g. 84%.4g. B. Câu 7. 15%.8g.72 lít (đktc). 12%. C.95%. 9. FeO.8g. B.40 Cho 100g hợp kim gồm có Fe. B. D. 4%. Al. 19.48 lít NO (đktc).5g. 4. 1. 2. 2. 32g. Fe. 4. Câu 7. 50g. 60g. Mặt khác. Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4. D.5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6. Câu 7. Câu 7.4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1. Thành phần phần trăm của Fe.8. 5%. D. Sau phản ứng thu được 1. C. D.12 lít.43 Nhúng thanh sắt vào dung dịch CuSO4. B. B. D. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22. B.76g chất rắn. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là A. D. Oxit sắt đó là ? A. 4%. C photpho. 2.05%. 83%. B.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X.2g.24% khối lượng. D.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32. C. sấy khô thấy khối lượng tăng 1.8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra. 60. crom. Không xác định được. Câu 7. 28g. D. 55. sau một thời gian lấy thanh sắt ra rửa sạch.6. Đáp số khác. 13%. Cr và Al trong hợp kim lần lượt là A.98 lít khí. 84%. Câu 7. p.8 lít khí.2.

C.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao. 5. 6. C. 3. 4.25g sắt clorua tác dụng với dung dịch AgNO 3 dư tạo ra 8.6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao. D. D. 5. D. Thành phần phần trăm cacbon trong mẫu thép là A. B. Câu 7. FeCl2. 16g.89g.2g Cu vào dung dịch HNO3 loãng. 69.08g. Câu 7. Thể tích hiđro đã dùng (170C và 725mmHg) là A. Câu 7. Không xác định được.48 lít. B. 6. B.42)g muối khan.53 Khử 9. 0. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là A. Đáp số khác.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư.36 lít.4g. C.92g. 3. 27g.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO. B. FeCl2.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH. 8.36 lít. Công thức của muối sắt đã dùng là A. sau đó làm bay hơi 98 .64g. B.584 lít.24 lít.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí. C.42%. m có giá trị là A.47 Một dung dịch có hoà tan 3. D.48 lít khí CO2 (đktc) thoát ra. Câu 7. Fe2O3. Những chất còn lại sau phản ứng. 0. Thể tích CO (đktc) đã dùng là A. 0. D.6g.61g kết tủa trắng. Cả FeCl2 và FeCl3. Công thức của muối sắt là A. 69. Không xác định được. thu được sắt và 2. Câu 7.12 lít. 2.4%.0053 lít. Đáp số khác. chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO 3.6g. Câu 7. 1. B. D. B. Câu 7. C.196 lít khí CO2 (0oC và 0. Câu 7.chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m 1 + 1. thấy có 0. 4. D. Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là A.48 lít.48 lít.24 lít. 4 lít.6492 g AgCl. B.88g nước. C.8 at) thoát ra. Thể tích CO (đktc) đã tham gia phản ứng là A. 6. thu được chất rắn có khối lượng 11. 46. Sau khi phản ứng kết thúc. D. FeCl3.84%. 0. nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26. 2. Câu 7.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO 3 tạo ra 2. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3.2g. D.72 lít hiđro (đktc). C. C.672 lít. B. 9g.72 lít. 22. FeCl3.54 Hoà tan hoàn toàn 19. 42g. 27g. 6. 3. Cả FeCl2 và FeCl3. 4. C.88 lít hiđro (đktc).72 lít. Fe3O4 thấy có 4. nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6.4 lít.

68%. 4. 32%.01. Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là A. C. 0. 40%. 8. thu được kết tủa Z. Số mol của Al. . Không đủ cơ sở để so sánh. 3 và 2. C. D. Fe và Ni. 32%. Mối liên hệ giữa V1 và V2 là A. 5. B. Fe và Sn. kim loại Mg. Lọc lấy kết tủa.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO 3 thấy thoát ra 0. V1=V2. 60%. D.72g.1 mol Fe2O3 và 0. Câu 7.84g. 0. kim loại Ag. D.58 Chia 4g hỗn hợp bột kim loại gồm nhôm. B. B. 3 và 3. 48. nhôm trong hợp kim lần lượt là A. B. D.4g. D. D. 40. thu được 560ml hiđro. Đáp số khác. II – BÀI TẬP NÂNG CAO Câu 7.63 Chỉ ra câu đúng trong các câu sau : 1. rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn. sắt và đồng thành 2 phần đều nhau.02. Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc). 0. kim loại Cu.61 Để khử ion Fe3+ trong dung dịch thành ion Fe2+ có thể dùng một lượng dư A. D. C. 0. V1>V2.Phần 1 : tác dụng với lượng dư dung dịch HCl.02. Câu 7. 3. thu được dung dịch Y. B. C. Khi nhúng các cặp kim loại trên vào dung dịch axit.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V 1 lít khí (đktc).448 lít khí không màu hoá nâu trong không khí (đo ở đktc). Cho NaOH vào Y.01. Đáp số khác. B. B.dung dịch và đun nóng. C. Thêm dung dịch kiềm vào muối đicromat.02. 3 và 8. 1.1 mol Fe3O4. Câu 7. Các khí đo ở đktc. C. 60%.57 Chất rắn X gồm 0. 64. 0.59 Cho sơ đồ phản ứng sau : Cu + HNO3  → muối + NO + nước. số cặp kim loại trong đó Fe bị phá huỷ trước là A.4g.Phần 2 : tác dụng với lượng dư dung dịch NaOH. 4.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb. muối này chuyển thành muối cromat. Phần trăm về khối lượng của đồng. 0. Fe trong 4g hỗn hợp lần lượt là: A. C. thu được 336ml hiđro. còn hợp chất Cr(VI) có tính oxi hoá mạnh. Hoà tan X bằng dung dịch HCl dư. Câu 7. . 2. Khối lượng muối khan thu được sau phản ứng là A. V1<V2. 40%.01. 2. Câu 7. 99 . 32. kim loại Ba. D. Giá trị của m là A. Câu 7. C. Hợp chất Cr(II) có tính khử đặc trưng. B. 3 và 6. 68%. Câu 7. thu được chất rắn có khối lượng là 0.

5. Cr(OH)3.66 Dung dịch X có màu đỏ cam. X4. 7. B. K2CrO4. Crom là kim loại có tính khử mạnh hơn sắt. (2) X1 + HNO3 → X4 + NO2 + H2O. D. Câu 7. B. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy. C. FeO. 2. Kim loại crom có thể cắt được thuỷ tinh. Na2Cr2O7. Công thức phân tử các chất A. Fe(OH) 2. 1. Câu 7. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ. 5. D. D. B. Câu 7. 6. Fe(NO3)3. K2Cr2O7. (4) X2 + NaOH → X5  NaCl. H2CrO4. 3. 3. -0. X6 lần lượt là X1 A B C D Cu Fe Fe Fe X2 CuCl FeCl2 FeCl3 Fe(NO3)3 X3 CuCl2 FeCl3 FeC2 FeCl3 X4 Cu(NO3)2 Fe(NO3)3 Fe(NO3)3 Fe(NO3)2 X5 CuOH Fe(OH)2 Fe(OH)2 Fe(OH)3 X6 Cu(OH)2 Fe(OH)3 Fe(OH)3 Fe(OH)2 Câu 7. (7) X5 + O2 + H2O → X6 Các chất X1. màu của dung dịch dần dần trở lại đỏ cam. 3. (3) X2 + Cl2 → X3. K2CrO4. K2Cr2O7. 7. Fe(NO3)2. Nếu thêm vào đó một lượng H 2SO4. CrO.68 Cho sơ đồ phản ứng : Cr + Sn2+  → Cr3+ + Sn (1) Cr + Cu2+  → Cr3+ + Cu (2) a. 8. 2. 100 .3. Fe3O4. X2. C. Na2CrO4. b. 2. màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. B. Fe2O3. Na2CrO4. Fe2(SO4)3. Na2Cr2O7. 1. 5. 8. Cr2O3. 8. Nếu cho thêm vào một lượng KOH. 5. A. X3.64 Cho từng chất Fe. Biết 0 ECr 3+ / Cr = −0. 3. 7. B và C lần lượt là : A. D. B. 6. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước. C. Dung dịch X chứa chất có công thức phân tử là A.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. + (5) X4 + NaOH → X6  + NaNO3. Các hợp chất CrO. Cr2O3.khử là A. Suất điện động chuẩn của pin điện hoá là A. 4. 1. 8.6 V. 2. C. 8. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo.88 V. 5. Câu 7. Cr(OH)2 đều có tính chất lưỡng tính. K2CrO4. Fe(OH)3. K2Cr2O7. 0. chất B tác dụng với axit chuyển thành chất C có màu da cam. 8. 7. X5. 6. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1). 3. 6. 4. D. hệ số của ion Cr3+ sẽ là A. Cr2O3. Cr(OH)2 tác dụng được với dung dịch HCl còn CrO 3 tác dụng được với dung dịch NaOH. Cr2O3. C. Các hợp chất Cr2O3. B. Số phản ứng thuộc loại oxi hoá. 5. 4. 74 V. Khi cân bằng 2 phản ứng trên. FeSO4.67 Cho các sơ đồ phản ứng : (1) X1 + HCl → X2 + H2. KCr2O4. FeCO3 lần lượt phản ứng với HNO3 đặc nóng.

Giảm 1.5 tấn. 0.8 tấn. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ? A. Suất điện động chuẩn của pin điện hoá là A. B.1g. 1.68g. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu : A.9g. D. D. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2). 0. 74g.432 M. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0.4 V. D. D. 0.08 V.0075 mol.464 M. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M.03M là A. 0. C. D. Sau phản ứng. Phần trăm theo khối lượng FeSO4 tinh khiết là A.4 V.272g. a. 2 tấn.5 tấn. 3. Tăng 22. Câu 7. 5. được 200 cm3 dung dịch. 0.03 M.69 Hoà tan 58g muối CuSO4. a. 2.2 tấn. C. -0. 1. B. D. được 500 ml dung dịch. c. 2. B.3265 tấn. 0.21g. Đáp số khác. B. Đáp số khác. 113. C. C.00375 mol. Đáp số khác. B.5H2O trong nước. D. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là A.8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87. C. Biết 0 ECr 3+ / Cr = −0. 0. 12. B. 0.725 M.7%. 11. -0.1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%) A. 21%. Tăng 1. 101 . 1. Câu 7.C. D.4 tấn.856g. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là A. B. a. Cho dần dần mạt sắt đến dư vào phương trình trên. 1.73. b. 74 V.71 Khối lượng quặng chứa 92. 0.856g.5%) là : A. B. 57%. B. 0. Câu 7. 90g. Đáp số khác. Đáp số khác.82 tấn.02625g. Biết 20 cm3 dung dịch này được axit hoá bằng H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0. Câu 7. C.6 V.9g.8 V. b. C.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước. sấy khô.72. b. -0. 0. 16. Đáp án khác. rửa nhẹ. D. Câu 7. đem cân thấy lá kẽm có khối lượng là A. 139. C. D. Nếu lấy quặng hematit trên đem luyện gang.28 tấn. B. 6 tấn.00075 mol. rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0. lấy lá kẽm ra khỏi dung dịch.88 V. D. c. C. C.

2g gồm Fe. 20. FeO và Fe2O3. 10. 1M. B. Câu 7.88g.8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+.5g.24 lít. sắt. C. Fe2O3. thu được 3g hỗn hợp chất rắn X. D. D. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2.27.2 mol FeS2 và 0. Giá trị của m là A. 10. 20. Giá trị m và nồng độ dung dịch HNO3 lần lượt là A. C. 8. 2. Giá trị của V (ở đktc) là A. 63.12 lít. thoát ra 0. khí CO 2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH) 2 thu được m2g kết tủa trắng. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư. D. 0.81. 1. 100ml.52. D. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư). C. 1.22g hỗn hợp X gồm Fe. C. PbO bằng khí CO ở nhiệt độ cao. 127. Hoà tan hoàn toàn 3. Câu 7. Sn. B. Cho 40g hỗn hợp vàng. Giá trị của m là A.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3. C.2M.685g. C. Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng. 10. Câu 7.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4.5M.24 lít khí NO duy nhất (đktc).768 lít. 12. 7.08g. Câu 7. Câu 7. 1: 3.685g D. bạc. C.32.62.5H2O cho m1 vào m2g dung dịch CuSO4 8%.36 lít.56 lít (đktc) NO (là sản phẩm khử duy nhất).5g. FeO. A.08g. 300ml.44g. Pb. 3. C. 2. 5. B. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. Lấy m1g X cho vào một ống sứ chịu nhiệt. Fe3O4) với số mol bằng nhau. Tỉ lệ là m2 A. khối lượng chất rắn thu được giảm 4. B. 9. 1: 4.04g. Kim loại X là A. 1: 6.72 lít khí (có màu nâu đỏ) duy nhất (đktc). 2. 20. 5. Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là A. Thể tích khí CO phản ứng (đktc) là A. 20. Cr. 200ml. 102 .4g chất rắn X. kẽm tác dụng với oxi dư nung nóng thu được 46.44g. B. CuO. 10. Cho 23. Fe3O4. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19. 10. Ni. Khử 16g hỗn hợp các oxit kim loại FeO.76.25.84 lít. B. Tính khối lượng m1.74.52. B. 10.7.344 lít hiđro (đktc) và dung dịch chứa m g muối. 400ml. 2.88g. Câu 7. 3.68 lít. thu được 1. 6. 56 lít.75.6M.22. Nung m g bột sắt trong oxi.77. D. 1: 5. B.72 lít. nung nóng rồi cho một luồng khí CO đi qua.8g. cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6.98.04g. Hoà tan hết hỗn hợp gồm 0. D. 10. Câu 7.3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất).78. B. đồng. m2. D. B. D. 2.80. Câu 7.

Al và Fe bằng dung dịch H 2SO4 loãng. 5. 1.24 lít. 0.15 mol.7g muối khan. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12. m nhận giá trị bằng A. C. 19.00g.05 mol.85g kết tủa.24 lít. thu được 3.48 lít.016 lít khí (đktc).2M. FeO. Công thức của sắt oxit là A. 1. B.76g kết tủa trắng.2g Cu vào 1 lít dung dịch gồm H2SO4 0. Beri Câu 7. D. 3. A. thu được 5g kết tủa. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0. D.12 lít.92 Hoà tan hết 1. D.05 và 0.075 mol. 0.Câu 7. m có giá trị là A. 18. 19.25g muối khan.2g B.08g.05 và 0. C.74g. 10. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15. Tính khối lượng m của X.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy). Fe2O3. V nhận giá trị bằng A. Câu 7.3g. A.02g.85g muối clorua khan. 11. Al) bằng oxi thu được (m +1.0g C.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại.688 lít. 1.025 mol.1M.2g. Fe2O3. A. 0. Chưa đủ dữ kiện để xác định.00g.136 lít khí (đktc) và m g muối sunfat. C.1M.62g chất rắn.224 lít. D.6g. Fe3O4.64g D.26g Câu 7. thu được V lít khí (đktc) và 3. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16. B. B.1M.91 Hoà tan hết 5.12 lít. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4. Fe3O4.56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2. Giá trị của m là A. Câu 7. D. 2. 4. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy). 3. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0. 6.84 Để mg phoi bào sắt (X) ngoài không khí. B.6)g oxit. 103 . C. 7.344 lít.16g. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3.36 lít. C. B.1g. HCl. Al. 5. thu được 9. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH) 2 0.72g hỗn hợp kim loại gồm Mg. 5. X là A.89 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt. 0. 0. HBr) thì thể tích H2 (đktc) thu được là A. C. Zn. Thể tích khí NO duy nhất thu được ở đktc là . D. B. 2.85 Cho 4.3g hỗn hợp kim loại gồm Mg. C.04g. C. C. 1. 4. 16. Canxi B. D. 4.448 lít. Mg. 2.86 Cho 19.36 lít khí SO2 duy nhất (đktc). Mặt khác. 0.5M và KNO3 0. Câu 7. 8.48 lít. 32. sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO.36 lít. Số mol khí CO2 thu được là A. Magie C. Câu 7.9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao. B. Câu 7. Câu 7. thu được 5g kết tủa. Zn và Fe bằng dung dịch HCl. 8. Bari D.83 Đốt cháy hết mg hỗn hợp A gồm (Zn. 15. Câu 7.18g.

1.1 mol. Câu 7.2 và y = 0.5 B 7.21g .20 C 7. B.97 Cho 1. B. 0.101 Oxi hoá hoàn toàn 0. 26g.75g hỗn hợp gồm 3 kim loại Fe. x = 0.93. Oxit khác.3 .102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian.8g.11 B 7. C.x mol.45g. Fe2O3. D.22 C 7. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VII 7. 5.2g. D. Không xác định được.16 B 7.03. Kim loại thu được đem hoà tan hết bằng dung dịch H 2SO4 loãng thấy tạo ra 1. b/6 c/1. Sục Y vào dung dịch nước vôi trong có dư. x = 0.16g. Giá trị của m là A. C. D. Hoà tan X bằng dung lịch HNO3 loãng.4256 lít.2g hỗn hợp CuO. 0.7 C 7. D.28 D 7. 1. dư.6g rắn X và hỗn hợp khí Y.30 C 7. Câu 7.94. thu được mg kết tủa Z. Giá trị m là A. 3. SO42. Cho 2. D. Câu 7. Kết quả khác.8 D 7. Câu 7.98. D. C.88g khí CO2. B. 3.21 D 7. Câu 7. Fe3O4.1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ? A. 24g. C.10 D 7.032g hỗn hợp các oxit (hỗn hợp X).8g bột sắt ngoài không khí. 7.448 lít khí NO duy nhất.4g.3 B 7. Al. 0.336 lít. Một dung dịch có chứa 2 cation là Fe2+ 0. D.84g Fe và 0. 22g. 5.29 A 7.96.525g.23 C 7. B.26 A 7. Câu 7. Fe2O3.1 B 7. m có giá trị là A.5g. B. 8g.8g một oxit của kim loại M thành kim loại cần 2.y mol. FeO.896 lít. Câu 7.02.72g.17 a/2.19 C 7. m có giá trị là A. C. C.18 D 7. B. 7.2 B 7. 5.25 C 7. 20g.2 mol và 2 anion Cl. FeO nung nóng. x = 0. C.100 Oxi hoá hoàn toàn 0. Tính a ? A.9g chất rắn khan. B.9 A 7.016 lít H2 (đktc). 6. CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0.6 C 7. C. B.344 lít H2. D. Cô cạn x thu được m g muối.2. A. người ta thu được 6. b/7 7. 0. B. x và y có giá trị là A. MgO.02 và y = 0. thu được 46.672 lít.03 và y = 0. 4.3g. Khi cô cạn dung dịch.0224 lít.12 khí (đktc) và dung dịch X. và sắt dư. C.792g hỗn hợp bột gồm Fe và Cu ta thu được 1.4 7.375g. Zn tan hết trong dung dịch HCl thì thu được 1.48g. Câu 7. B. 0. Câu 7.336 lít. sau một thời gian thu được 13.12 D 7. 0. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0.896 lít.27 A 7. 0. 0.15 B 7. x = 0.5 g. Al3+ 0.0336 lít.016g hỗn hợp các oxit sắt (hỗn hợp X).4 B 7. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5.81g hỗn hợp các oxit Fe3O4.2g.728g bột Fe ta thu được 1.3 và y = 0. 8. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0. D.95.Câu 7. Nung nóng 16. sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt. Khử hoàn toàn 4. Thể tích khí NO duy nhất bay ra (ở đktc) là A. 5 g. Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là A.14 C a/1.6 lít SO2 (đktc).99 Cho CO qua ống sứ chứa 15.13 7. D. 5.72g hỗn hợp gồm 4 chất rắn khác nhau. Tìm công thức của oxit. Chưa thể xác định.24 A 104 . 10 g. 1. C.

59 D 7.96 C 7.35 B 7.102 C 7.78 B 7.70.45 D 7.84 D 7.101 D 7.70.89 C 7.70.56 A 7.32 B 7.87 C 7.54 B 7.95 C 7.39 A 7.74 D 7.38 B 7.41 D 7.72.51 B 7.36 C 7.79 D 7.b B 7.a A 7.50 B 7.49 D 7.66 A 7.81 C 7.68.69.47 B 7.08(mol) → 3Cu 2+ + 2NO + H2 O. 0.34 A 7.68.42 B 7.40 A 7.71 B 7.a B 7.76 A 7.b C 7.86 C 7.94 C 0.98 B 7.c B 7.62 D 7.67 B 7.73 A 7.c B 7.63 A 7.43 D 7.80 A 7.b C 7.90 A 7.52 B 7.85 A 7.68.53 B 7.a B 7.03(mol) − 3Cu + 2NO3 + 8H 0.46 C 7.60 A 7.a A 7.016(mol) 0.88 B 7.100 D 7.44 B 7.48 B 7.31 B 7.93 C 7.92 B 7.65 B 7.b C 7.91 C 7.99 A + 7.33 C 7.7.57 A 7.64 D 7.83 B 7.55 C 7.61 B 7.58 A 7.77 C 7.82 A 7.75 A 7.69.016(mol) 105 .72.37 A 7.97 C 7.

t.CHƯƠNG VIII.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. 3NaNO2 + H2SO4 (l) → Na2SO4+NaNO3+2NO↑+H2O H2SO4 (l) + O2 KK to. vụn Cu Cô cạn. Nhận biết một số anion Tt Anion Thuốc thử Dấu hiệu 1 OH– Quỳ tím Hoá xanh SO32– HSO3– + 2 H CO32– HCO3– SiO32– 3 SO42– Ba2+ 4 S2– Cl– Ag+ Br– I– 5 PO43– 6 NO3 – Phương trình phản ứng SO32– + 2HCl → SO2 + H2O CO32– + 2HCl → 2Cl– + CO2 SO2 làm mất màu dung dịch KMnO4 CO2 làm vẩn đục dung dịch Ca(OH)2 trong SiO32– + 2HCl → H2SiO3 + 2Cl– Ba2+ + SO42– → BaSO4↓ 2Ag+ + S2– → Ag2S↓ ↑ SO2 ↑ CO2 Ag+ 7 ClO3– 8 NO2– H2SO4 loãng. ↓ keo trắng ↓ trắng ↓ đen ↓trắng vàng nhạt Ag+ + X– → AgX↓ vàng ↓ vàng (tan 3Ag+ + PO43– → Ag3PO4↓ trong HNO3) (↑) nâu NO2 3Cu+8H++2NO3–→2Cu2++2NO+4H2O dung dịch Cu2+ (2NO + O2 → 2NO2) xanh 106 . PHÂN BIỆT MỘT SỐ CHẤT VÔ CƠ & CHUẨN ĐỘ DUNG DỊCH A. không ↑ NO2 nâu NO  NO2↑ (nâu) → khí Dùng phân biệt NO2– và NO3– (vì NO3– không có phản ứng này). to O2↑ (que đóm t0 có MnO2 2KClO3  2KCl + 3O2↑ → bùng cháy) x.

Nhận biết một số cation Stt ion 1 2 3 4 Li Na+ K+ Ca2+ + Thuốc thử Dấu hiệu Đốt trên ngọn lửa vô sắc − Phương trình phản ứng (phương pháp vật lí) 5 Ba2+ 6 Ca2+ 7 Ba2+ 8 Mg2+ SO42 9 Cu2+ 10 Fe2+ − 2+ OH 2 Cu + 2OH → Cu(OH) ↓ (riêng với Fe3+ đặc +2 NH + 2H O Cu 2+  Cu(OH)2 ↓ → trưng nhất −2NH là dùng ion 2+ +4NH  [ Cu(NH 3 )4 ] → −2OH thioxianat SCN-. Ca2+ + SO42 → CaSO4↓ (it tan) − Ba2+ + SO42 → BaSO4↓ − Mg2+ + 2OH → Mg(OH)2↓ − 11 Fe3+ 12 NH4+ OH . tan ngay khi (OH–) dư dd H2S PbS ↓ đen − OH − 3  Cr 3+  Cr (OH )3 ↓   Cr ( OH )6 − → →     18 Pb 2+ (dd màu xanh) Pb + S → PbS↓ (màu đen) 2+ 2− 107 . − 3 4 + 2 3 - − Đỏ thẫm Vàng tươi Tím hồng Đỏ da cam Lục (hơi vàng) ↓ trắng ↓ trắng ↓ trắng ↓ xanh (nếu dùng dd NH3 thì tạo kết tủa xanh sau đó tan tạo ion phức màu xanh thẫm đặc trưng. làm xanh quỳ ẩm) Fe + 3SCN → Fe(SCN) ↓ đỏ máu − Fe3+ + 3OH → Fe(OH)3↓ đỏ nâu NH4+ + OH → NH3↑ + H2O +3OH Al3+  Al(OH)3 ↓ → + OH  [ Al(OH) 4 ] → - 3+ 3 − - 13 Al3+ − 14 Zn 2+ 15 Be2+ 16 Pb2+ 17 Cr 3+ OH từ từ đến dư − +2OH ↓ trắng tan Zn 2+  Zn(OH) 2 ↓ → ngay khi 2− + OH  [ Zn(OH) 4 ] → OH– dư + OH − Be2+  Be( OH )2 ↓  BeO 2 − → → 2 Pb2+ →Pb(OH)2↓ →PbO22 ↓ xanh. to − ↓ đỏ máu ↓ đỏ nâu NH3 ↑ khai.2. còn Fe2+ làm KK 2 + OH − mất màu Fe     Fe OH2 → ( ) ↓    Fe OH3 đỏ↓nâu →( ) dd thuốc ↓ trắng xanh − 2+ + 2+ 3+ MnO4 + 5Fe + 8H → Mn + 5Fe + tím khi có + + 4H2O mặt H ).

BaSO4. O3. CO2. 108 .1 Có 4 mẫu chất rắn màu trắng BaCO3. NaHCO3.5H2O t CuO + H2  Cu↓ + H2O → 0 SO3 + H2O → H2SO4 H2SO4 + BaCl2 → BaSO4 + 2HCl B . to Hoá đen CuO Trắng hoá xanh 13 H2 14 SO3 15 N2 CuSO4 khan CuO (đen) Hoá đỏ (Cu) to Dung dịch Kết tủa BaCl2 trắng BaSO4 (còn lại sau cùng) CuSO4 + 5H2O → CuSO4. B. nếu chỉ dùng H2O và một chất khí (không dùng nhiệt độ.3. điện phân) để phân biệt chúng thì chất khí phải chọn là A.BÀI TẬP TRẮC NGHIỆM Câu 8. Na2CO3. Nhận biết một số chất khí Stt Khí 1 Cl2 2 I2 3 SO2 4 H2S 5 HCl 6 NH3 7 NO 8 NO2 9 CO 10 CO2 11 O2 12 Hơi H2O Thuốc thử Dung dịch (KI + hồ tinh bột) Hồ tinh bột Dấu hiệu Phương trình phản ứng Không màu Cl2 + 2KI → 2KCl+ I2 + I2 → hoá xanh (Hồ tinh bột) → xanh Không màu → hoá xanh SO2 + Br2 + 2H2O → 2HBr + H2SO4 5SO2+2KMnO4+ 2H2O → 2H2SO4+2MnSO4+K2SO4 Pb2+ + H2S → PbS↓ + 2H+ Ag+ + Cl– → AgCl↓ NH3 + H2O→ NH4OH NH3 + HCl → NH4Cl 2NO + O2 → 2NO2 3NO2 + H2O → 2HNO3 + NO dd Br2 hay Mất màu dd KMnO4 dung dịch dd Pb(NO3)2 dd AgNO3 Quỳ tím ẩm HCl (đậm đặc) Không khí Quỳ tím ẩm dd PdCl2 (hay + CuO đen) Cho ↓ đen Cho ↓ trắng Hoá xanh Tạo khói trắng Hoá nâu Hoá đỏ Tạo ↓ Pd CO + PdCl2 + H2O → (hoá đỏ Cu) Pd↓ + 2HCl + CO2↑ CO2 + Ca(OH)2 → CaCO3↓ + H2O t 2Cu + O2  2CuO → 0 ddCa(OH)2 Vẩn đục Cu (đỏ).

kali hiđroxit. NaCl.3 Để loại bỏ Al ra khỏi hỗn hợp Al. BaCl2.5 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH.6 Có 5 dd đựng trong 5 lọ mất nhãn là FeCl3. B. dd HCl. H2SO4 đặc nguội. Dung dịch AgNO3 và dd phenolphthalein. C. C. B. dd BaCl2 và dd Br2.4 Để phân biệt 3 khí CO. D. NH4NO3. Na2CO3. Na2S. D. SO2. kali sunfit và nhôm sunfat (đều có nồng độ khoảng 0. NH3. Mg và Al 2O3. axit clo hiđric. C. H2SO4. C đều đúng.C. Câu 8. KCl. AlCl3. dd KOH. dd PdCl2 và dd Br2. C. Cu(OH)2. Zn(OH)2. không thể thực hiện được. Câu 8. Giấy quỳ tím và dd Ba(OH)2. dd BaCl2. C. B. Al. Dung dịch Ba(OH)2 và dd AgNO3. dd KOH Câu 8. thuốc thử được chọn là A. Fe3O4 và FeO người ta dùng A. Nếu chỉ được dùng một thuốc thử để nhận biết 5 chất lỏng trên. đồng sunfat khan. để nhận biết 4 chất lỏng trên. ta có thể dùng dd A. Cả A. NaOH. Dùng 2 hoá chất nào trong các cặp hoá chất sau đây để có thể phân biệt được các dd trên? A. nguội. Câu 8. KNO3. CO2 và H2O.8 Để làm khô khí amoniac người ta dùng hoá chất là A. bari clorua. D. B.10 Để thu được Al(OH)3 từ hỗn hợp bột Al(OH)3. quỳ tím. dd KMnO4 và dd Br2 C. axit sunfuric đặc. B. H2O D. D. AgNO3.2 Có 4 lọ hoá chất bị mất nhãn đựng riêng biệt 4 dung dịch không màu sau đây: NH4Cl. D. dd HNO3. D. B.9 Để nhận biết 3 dd natri sunfat. B. HCl. mỗi ống nghiệm chứa một trong các dd HCl. C. H2SO4 đặc nóng B. NaOH. Câu 8. C. chỉ cần dùng duy nhất một dd là A. B. HNO3 . ta có thể dùng A.1M). vôi sống. FeCl2. chỉ cần dùng một thuốc thử duy nhất là A. H2. SO2 ta có thể dùng thuốc thử là A. NaNO3. B. Quỳ tím. 109 . Câu 8. Câu 8. D. MgO. B. NaOH. C. dd HCl. D. Có thể sử dụng thuốc thử nào sau đây đề phân biệt các lọ dung dịch trên? A. dd H2SO4 đặc nguội. CO2. dd HNO3 đặc. Câu 8. D. P2O5. HCl. CuO. C. Câu 8. Câu 8. H2SO4 loãng. dd ammoniac.11 Có 4 ống nghiệm bị mất nhãn.7 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là NaAlO2. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. NaCl. BaCl2.

D. AgNO3. cả 4 dung dịch. B. NO3-. B. Fe. Câu 8. dd BaCl2. C. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Fe3+. CuSO4 khan. Ba. Cu để chứng minh sự có mặt của các ion trong X. B. Ag. Al2O3. Ag. chỉ một trong 4 dung dịch. H2SO4 loãng. D. C. dd FeCl2. D. Fe3+. Cả A.12 Để chứng tỏ sự có mặt của ion NO3. natri sunfat và thạch cao sống (CaSO4. Mg. C. CaO. người ta ngâm mẫu bạc này vào một lượng dư dd A. cả 3 dung dịch. Mg.18 Có 4 chất rắn riêng biệt gồm natri cacbonat. FeCl3 Câu 8. dd H2SO4. D.13 Để loại bỏ tạp chất Fe. Fe. C đều đúng Câu 8. HCl. dd HCl.D. Kết luận đúng là A. Dung dịch kiềm. Câu 8. Fe. D. Ag. C.ta nên dùng thuốc thử là A. Giấy quỳ tím và dd AgNO3. giấy quỳ B. Để phân biệt 2 kim loại Al và Ag cần phải dùng A. Cu và vài giọt dd H2SO4đặc. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Ba. B. dd NaOH.trong dd chứa các ion: NH4+. P2O5. Một học sinh dùng các hoá chất dd NaOH.16 Có 5 mẫu kim loại Ba. H2O. B.19 Dung dịch X có chứa các ion: NH4+. Br2 (Hơi) C. Câu 8. đá vôi. D.2H2O). tuỳ thuộc vào trật tự tiến hành các thí nghiệm.15 Cho các dd: AgNO3. dd AgNO3. NO3. Câu 8. B. HCl. X là A. CO2 B. C.17 Để làm khô khí H2S. Ba. Ca(OH)2. HNO3 đặc nguội.14 Có 3 lọ đựng 3 chất bột riêng biệt: Al. Có thể nhận biết 3 lọ trên bằng 1 thuốc thử duy nhất là A. Chỉ dùng thêm một hoá chất bên ngoài là dd H2SO4 loãng có thể nhận biết được tối đa bao nhiêu kim loại trong các dãy sau? A. B. Cl2 D. H2SO4 đặc nguội. Fe2+. chỉ 2 trong 4 dung dịch. vì Fe2+ và Fe3+ khi tác dụng với kiềm tạo kết tủa có màu sắc khác nhau. Câu 8. C. Al. Câu 8. Al. 110 . Mg. ta có thể dùng A. Ag. Chỉ dùng H2O và một khí X có thể phân biệt được cả 4 chất. dd NaOH. Cu có trong mẫu Ag và không làm thay đổi lượng Ag. Ba. Fe. C. Fe. Ag. đun nóng.

(4). D. (1). (1). D. (2) mẩu bông tẩm nước.23 Một học sinh đề nghị các cách để nhận ra lọ chứa khí NH3 lẫn trong các lọ riêng biệt chứa các khí N2.28 Chỉ dùng Na2CO3 có thể phân biệt được mỗi dd trong dãy dd nào sau đây? A. B. CaCl2. Câu 8. Các cách đúng là A. D. dd muối sắt(III) dư. dd muối Sắt(II) dư. B. Câu 8. (3). Câu 8. (3) nước cất có vài giọt quỳ tím. mỗi ống đựng 1 dd Na2CO3. Có thể dùng thuốc thử nào sau đây để nhận biết chúng? A. B. (3). giấy quỳ tím sau. (NH4)2SO4. Câu 8. NaOH. Câu 8. (1). chỉ (1). (2).26 Tách Ag ra khỏi hỗn hợp bột gồm Ag. Cu. NaNO3. 111 .21 Để nhận biết trong thành phần của khí nitơ có lẫn tạp chất hiđroclorua. C đều đúng. Fe(NO3)2. dd NaOH. AgNO3. D. C. C. dd AgNO3 dư. Fe với khối lượng Ag không đổi. Phương pháp đúng là A. HNO 3. B. B. (3). dd phenolphthalein. B.22 Thuốc thử duy nhất dùng để nhận biết NH4NO3. (4) mẩu Cu(OH)2. BaCl2. Học sinh đó không chứng minh được sự tồn tại của Fe 2+ và Fe3+ vì chúng đều tạo kết tủa với kiềm. Fe(NO3)3 và Cu(NO3)2 là A. C. chỉ dùng AgNO3. NaNO3. MgCl2. dd AlCl3. chỉ cần dùng một hoá chất là A. Hoá chất cần dùng và thứ tự thực hiện để nhận biết các chất đó là A. B. D. Mg(NO3)2. H2SO4 (loãng). dùng AgNO3 trước. Al(NO3)3. Ba(NO3)2. D. (1). (1). C. NaCl. Fe(NO3)3. (4). (1). BaCl2. Câu 8. Ba(OH)2. C. (2). FeCl2 thì chọn thuốc thử là A. (2). Na2CO3. HCl. Cl2. dd CuCl2 dư. dd HCl. NaAlO2.20 Có 4 ống nghiệm mất nhãn. O2. Câu 8. dùng giấy quỳ tím trước. C.D.25 Chỉ dùng một dd làm thuốc thử để nhận biết các dd muối sau: Al(NO3)3. MgCl2. KNO3. dd NH3. (1). MgCl2. NaCl. Al. Quỳ tím.24 Để thu được Al2O3 từ hỗn hợp bột Al2O3 và CuO mà khối lượng Al2O3 không thay đổi. MgSO4. D. (2). CO2 là: (1) dùng mẩu giấy quỳ tím ướt. (3). MgCl2. (3). Cả A. (3) mẩu bông tẩm dd HCl đặc. Câu 8. D. C đều được. (3). dd NH4Cl. B. (5). có thể dùng chất nào sau đây? A. (5). D. AgNO3 sau. Fe(NO3)3. C. B. (4).27 Có 3 lọ mất nhãn chứa 3 dd riêng biệt HCl. NaCl. Câu 8. B. C. (3). Ca(NO3)2. ta có thể dẫn khí qua: (1) dd bạc nitrat. (2) dd NaOH. NaOH. AlCl3. C. (5) mẩu AgCl. NH4NO3. (4) nước vôi trong. cả A.

dd Ba(OH)2. C. khí (2) làm mất màu của giấy.36 Chỉ dùng H2O có thể phân biệt được các chất trong dãy A. Na. NH4Cl.38 Để làm sạch quặng boxit thường có lẫn Fe2O3. CO2. X là muối CuSO4.35 Chỉ dùng một thuốc thử duy nhất nào sau đây để phân biệt hai khí SO2 và CO2? A. B. Mg.29 Để thu được Ag tinh khiết từ hỗn hợp bột Ag-Fe. Thuốc thử có thể dùng để nhận biết ba dd trên đơn giản nhất là A. O2. Ba(OH)2. dd Ba(OH)2. Na. dd H2SO4. C. dd AgNO3 vừa đủ. người ta dùng dư hoá chất nào sau đây? A. dd BaCl2. dd Ba(NO3)2 vừa đủ. K. X là muối Pb(NO3)2. AgNO3. Để xác định lọ đựng khí NH3 chỉ cần dùng thuốc thử duy nhất là A. Ca với axit H2SO4 đặc. giấy quỳ tím. AgNO3. FeCl3. Câu 8. Câu 8. NaOH. Câu 8. N2. (NH4)2SO4. B. C. C. dd NaOH đặc nóng và CO2. Ba. C. B. B đều đúng. Cl2. Câu 8. dd HClđặc. B. NH3. NH4NO3. C. KOH. nguội không thay đổi đáng kể nồng độ và không sinh nhiệt)? A. dd NaOH đặc nóng và HCl.33 Để loại được H2SO4 có lẫn trong dd HNO3. Kết luận sai là A. khí (2) là Cl2. C.30 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là (NH4)2SO4. kẽm sunfat. D. D. NH4Cl. Câu 8. khí (3) làm giấy có tẩm dd muối X hoá đen. để nhận biết 4 chất lỏng trên. 112 . dd H2SO4 loãng. dd NaOH loãng và CO2. khí còn lại là N2. dd NaOH. dd Ca(OH)2 . Na. kali sunfit. SiO2 dùng cho sản xuất Al người ta dùng chất nào trong số các chất sau đây là tốt nhất? A. khí (3) là Cl2. và giấy tẩm dd muối X người ta có thể phân biệt 4 lọ chứa khí riêng biệt O2. dd HCl. dd H2SO4 đặc nguội. HNO3 đặc nguội. D. D.34 Có 5 lọ đựng riêng biệt các khí sau: N2.B. khí (1) là O2. NH4NO3. dd Br2. H2O. H2S và Cl2 do có hiện tượng: khí (1) làm tàn lửa cháy bùng lên. D. Câu 8. dd NaOH.Câu 8. NH4Cl. X là muối CuSO4. NH4Cl. ta dùng A.32 Có ba dd kali clorua. dd NaOH loãng và dd HCl. C. quỳ tím ẩm. (NH4)2SO4. chỉ cần dùng dd A. Ba. dd Ca(OH)2 vừa đủ. D.37 Chỉ dùng duy nhất một dd nào sau đây để tách lấy riêng Al ra khỏi hỗn hợp Al. Câu 8. B. NH4NO3. Na.31 Chỉ có giấy màu ẩm. C. CuSO4. D. Câu 8. B. D. B. khí (1) là O2. B. C. lửa. B. D. BaCl2. K2SO4. D. Câu 8. cả A. K. Ca mà khối lượng Al không thay đổi (giả sử phản ứng của Mg. dd HCl.

20 D 8.1 B 8. nguội.27 D A 113 .30 A 8.23 C 8.15 A 8. Na2CO3. dd HCl. Câu 8. dd BaCl2.29 B 8. thuốc thử được chọn là A.14 8. NaNO3. cả A. dd H2SO4 và dd BaCl2. H2SO4 thì chọn A. chì clorua. axit sunfuric. natri hiđroxit.9 B 8. C đều đúng. Câu 8. B.41 Để nhận biết 4 dd: Na2SO4.19 C 8.26 C 8. dd NaOH. chỉ cần Fe kim loại.1M) bị mất nhãn.40 Đốt cháy Fe trong clo dư thu được chất X.28 D 8. dd HNO3 và dd Ba(OH)2. B. CuSO4. D. BaCl2. Mg và Al 2O3. chỉ cần dùng một chất duy nhất là A. dd HNO3 đặc. Al. D.5 D 8. C. ĐÁP ÁN 8. dd H2SO4 và dd AgNO3. Hãy chọn đáp án để nối thêm vào phần còn trống sao cho kết luận trên luôn đúng.4 A 8.10 A 8.2 B 8. H2SO4. nung sắt với lưu huỳnh thu được chất Y. C. và hỗn hợp NaNO3 và KHSO4. D.3 C 8. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên.39 Cho các dd: FeCl3. AgNO3. D.43 “Để phân biệt các dd riêng biệt gồm NaCl. dd HCl.18 D 8.44 Có các dd Al(NO3)3. NaOH và O2.7 A 8. C. FeCl2. không cần dùng bất kể hoá chất nào. Y có thể dùng hoá chất nào sau đây? A.8 A 8. D. B. K2CO3. quỳ tím. Số dd không hoà tan được đồng kim loại là A. quỳ tím Câu 8. A. BaCl2. NH3. BaCO3. B. B. Zn. H2SO4.17 8. HCl. dd CH3COOAg. C.25 B 8. 2.21 C 8. dd KOH. C. Thuốc thử để phân biệt các dd đó là A.6 C 8. chỉ cần dùng giấy quỳ tím. C.11 D 8. Để xác định thành phần cấu tạo và hoá trị các nguyên tố trong X. C.Câu 8. B. KOH ta có thể …”. H2O. 3.12 D 8.22 D 8. 4. D. B. Mg(NO3)2. Câu 8. Câu 8.16 B 8. Câu 8.24 C C 8. D. LiNO3 (đều có nồng độ khoảng 0. B.13 D 8. 1.45 Nếu chỉ dùng một thuốc thử duy nhất để phân biệt 3 dd NaOH.42 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. bari hiđroxit.

. Vấn đề vật liệu * Vấn đề về vật liệu đang đặt ra cho nhân loại là gì ? Cùng với sự phát triển của các ngành kinh tế và khoa học kĩ thuật.Sản xuất ra chất thay cho xăng từ nguồn nguyên liệu vô tận là không khí và nước. XÃ HỘI. .8. .43 A 8.Năng lượng điện hoá trong pin điện hoá hoặc acquy. sinh học mới ngày càng cao.38 D 8. * Hoá học đã góp phần giải quyết vấn đề về vật liệu như thế nào? . năng lượng thuỷ triều… .Vật liệu mới: 114 .37 A 8. .32 C 8.Các nguồn năng lượng.Điều chế khí metan trong lò biogaz. than đá.Khai thác và sử dụng năng lượng hoá thạch còn là một trong những nguyên nhân chủ yếu gây nên ô nhiễm môi trường và làm thay đổi khí hậu toàn cầu.Vật liệu có nguồn gốc vô cơ. MÔI TRƯỜNG A. năng lượng địa nhiệt.Năng lượng thuỷ điện. . năng lượng gió.Năng lượng được sản sinh ra trong các lò phản ứng hạt nhân được sử dụng cho mục đích hoà bình. HOÁ HỌC VÀ VẤN ĐỀ PHÁT TRIỂN KINH TẾ. nhu cầu của nhân loại về các vật liệu mới với những tính năng vật lí và hoá học. năng lượng mặt trời.31 B 8.33 A 8.36 A 8. . năng lượng nhân tạo thay thế. nhiên liệu hoá thạch như dầu mỏ.39 C 8.Vật liệu có nguồn gốc hữu cơ. dầu.40 B CHƯƠNG IX. Như : .44 B 8.Sản xuất khí than khô và khí than ướt từ than đá và nước.42 D 8. * Hoá học đã góp phần giải quyết vấn đề năng lượng và nhiên liệu như thế nào trong hiện tại và tương lai? Hoá học đã nghiên cứu góp phần sản xuất và sử dụng nguồn nhiên liệu.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. 2. Vấn đề năng lượng và nhiên liệu * Vấn đề về năng lượng và về nhiên liệu đang đặt ra cho nhân loại hiện nay là : .45 D 8. . khí tự nhiên… không phải là vô tận mà có giới hạn và ngày càng cạn kiệt.34 A 8.Điều chế etanol từ crackinh dầu mỏ để thay thế xăng.35 C 8. .41 B 8.

dung dịch để tiêm chích). Hoá học và vấn đề may mặc * Vấn đề may mặc đang đặt ra cho nhân loại hiện nay là : . hợp thời trang.Phòng chống những căn bệnh.Nghiên cứu ra các loại vacxin.Vật liệu nano (còn gọi là vật liệu nanomet) . chất ma tuý và cách phòng chống ma tuý (dưới dạng những viên thuốc tân dược. . thực phẩm đang đặt ra thách thức lớn cho nhân loại hiện nay . thực phẩm cho nhân loại như : nghiên cứu và sản xuất các chất hoá học có tác dụng bảo vệ.Tổng hợp hoá chất diệt nấm bệnh. 3. . nạn dịch của thế kỉ. 115 .Diện tích trồng trọt ngày càng bị thu hẹp. Hoá học và vấn đề sức khỏe con người * Dược phẩm . ..Thuốc bổ dưỡng cơ thể.Góp phần sản xuất ra tơ.Các vật liệu cơ bản để chế tạo các thiết bị chuyên dụng trong các nhà máy dệt và trong ngành dệt may.Vấn đề vi phạm vệ sinh an toàn thực phẩm. . vì vậy tơ sợi tự nhiên không thể đáp ứng đủ nhu cầu về số lượng cũng như chất lượng.Sản xuất các loại phân bón hoá học.Góp phần nghiên cứu thành phần hoá học của một số dược liệu tự nhiên. bột trắng dùng để hít. Hoá học và vấn đề thực phẩm * Vấn đề lương thực.Dân số thế giới ngày càng tăng. . . . 4. .Vật liệu compozit. . mà còn mặc đẹp.Vật liệu quang điện tử.Thuốc tránh thai. * Hoá học góp phần giải quyết vấn đề may mặc của nhân loại như : .… .Tổng hợp hoá chất có tác dụng diệt trừ cỏ dại. 4. động vật: . . * Chất gây nghiện. . phát triển thực vật.Sản xuất nhiều loại phẩm nhuộm.Sản xuất những hoá chất bảo quản lương thực và thực phẩm. . * Hoá học đã góp phần giải quyết vấn đề về lương thực.Nghiên cứu chế biến thức ăn tổng hợp. sợi hoá học có nhiều ưu điểm nổi bật.Nhu cầu của con người không chỉ mặc ấm. .Dân số thế giới gia tăng không ngừng. viên để uống.

không khí dựa trên cơ sở khoa học hoá học có kết hợp với khoa học vật lí và sinh học.… một số vi khuẩn gây bệnh. Than đá. Hoá học và vấn đề ô nhiễm môi trường Tác hại của ô nhiễm môi trường (không khí. B.… Thí dụ : hiện tượng thủng tầng ôzôn. Câu 9.Hoá học đã nghiên cứu ma tuý. rối loạn tuần hoàn. NH3. Thu khí metan từ khí bùn ao. gây thay đổi khí hậu toàn cầu.. chất có hại cho cây trồng vượt quá nồng độ được quy định. … * Ô nhiễm không khí Không khí bị ô nhiễm thường có chứa quá mức cho phép nồng độ các khí CO2. các chất hữu cơ tổng hợp. Lên men các chất thải hữu cơ như phân gia súc trong lò biogaz. Nhiên liệu nào sau đây thuộc loại nhiên liệu sạch đang được nghiên cứu sử dụng thay thế một số nhiên liệu khác gây ô nhiễm môi trường ? A. Xăng. Người ta đã sản xuất khí metan thay thế một phần cho nguồn nguyên liệu hoá thạch bằng cách nào sau đây ? A. đất. SO2.… * Ô nhiễm môi trường đất Đất bị ô nhiễm có chứa độc tố. Khí hiđro.… b) Xác định chất ô nhiễm bằng các thuốc thử. * Vai trò của hoá học trong việc xử lí chất ô nhiễm Xử lí ô nhiễm đất.Nghiện ma tuý sẽ dẫn đến rối loạn tâm. mưa axit. HCl. nước. . . chất độc hoá học. B. sử dụng chúng như là một loại thuốc chữa bệnh. Khí butan (gaz) D. các chất phóng xạ. hô hấp. các hoá chất vô cơ. màu sắc. bụi. làm diệt vong một số loại sinh vật. c) Bằng dụng cụ đo : nhiệt kế. CH4 và một số khí độc khác. các vi sinh vật gây bệnh.BÀI TẬP TRẮC NGHIỆM Câu 9. Tiêm chích ma tuý có thể gây trụy tim mạch dễ dẫn đến tử vong. các chất dinh dưỡng thực vật.… * Ô nhiễm nước Nước ô nhiễm thường có chứa các chất thải hữu cơ. sắc kí. nước) gây suy giảm sức khỏe của con người. thí dụ CO. 4. C.2.1. rối loạn chức năng thần kinh. máy đo pH. 116 . hiệu ứng nhà kính.Luôn nói không với ma tuý. * Nhận biết môi trường bị ô nhiễm a) Quan sát qua mùi. như rối loạn tiêu hoá. dầu. B. sinh lí.

Cho hơi nước đi qua than nóng đỏ trong lò. Năng lượng gió. Câu 9. H2. fomon. Panadol. C. Không khí chứa 78% N2. Dùng phân đạm. Nước thải từ các bệnh viện. khu vệ sinh chứa các khuẩn gây bệnh. Câu 9. dùng nước đá khô. Hg2+…Dùng chất nào sau đây để xử lí sơ bộ các chất thải trên ? A. Năng lượng thuỷ điện. 20% O2. Nước thải nhà máy có chứa nồng độ lớn các ion kim loại nặng như Pb2+. sắt…quá mức cho phép. D. C. B. Câu 9. 6% hỗn hợp CO2. Câu 9. Loại thuốc nào sau đây thuộc loại gây nghiện cho con người ? A. Amoxilin. Ni2+. Không khí chứa 78% N2. C. Hg2+. HNO3. Seđuxen. nước đá. NH3. B. Nước ruộng lúa chứa khoảng 1% thuốc trừ sâu và phân bón hoá học. H2. moocphin. H2O. Thuốc cảm Pamin. Vitamin C. Câu 9. Sau bài thực hành hoá học. Khí nào sau đây gây ra hiện tượng mưa axit ? A. SO2. glucozơ.3. D.6. H2O. Dùng fomon. B. Trường hợp nào sau đây được coi là không khí sạch ? A. 16% O2. B. Câu 9.9. chứa các ion : Cu2+. Nước từ các nhà máy nước hoặc nước giếng khoan không chứa các độc tố như asen. D. Penixilin. Pb2+. CH4. Một trong những hướng con người đã nghiên cứu để tạo ra nguồn năng lượng nhân tạo to lớn để sử dụng cho mục đích hoà bình. Câu 9. D. B. 2% hỗn hợp CO2. C. đó là : A. D. Giấm ăn.4. H2. Dùng nước đá hay ướp muối rồi sấy khô. B. Lên men ngũ cốc. nước đá. C. 18% O2. Zn2+. Etanol. HCl. Cd2+. Không khí chứa 78% N2. Cách bảo quản thực phẩm (thịt. Nước vôi dư. Năng lượng mặt trời. Không khí chứa 78% N2. H2O.8.C. Trường hợp nào sau đây được coi là nước không bị ô nhiễm ? A. C. D. D. C. trong một số chất thải dạng dung dịch. 4% hỗn hợp CO2.5. 21% O2. B. CH4 và bụi. Fe3+. cá…) bằng cách nào sau đây được coi là an toàn ? A. 117 . 1% hỗn hợp CO2. D.7. Năng lượng hạt nhân.

H2S. (Nên biết thêm : hàm lượng cho phép là 0.56 tấn.422 tấn.7 D 9. Than hoạt tính.4 tấn. Hãy tính lượng ngũ cốc chứa 65% tinh bột để sản xuất được 2. 3. A.422 tấn.30 tấn.14.0257 mg/l. A. Có thể điều chế thuốc diệt nấm 5% CuSO4 theo sơ đồ sau : CuS → CuO → CuSO 4 . 4.3 tấn ancol etylic. 0.12.0253 mg/l.0225 mg/l. 1. B. D. Câu 9. Trong công nghệ xử lí khí thải do quá trình hô hấp của các nhà du hành vũ trụ hay thuỷ thủ trong tàu ngầm người ta thường dùng hoá chất nào sau đây ? A. C. C. Có thể điều chế Ancol etylic bằng 2 cách sau : .0 tấn. NH3. nước Gia-ven. Không khí. B.0250 mg/l. 5. Tính khối lượng NaCl cần thiết để sản xuất 15 tấn NaOH. D.1 D 118 9.422 tấn. Nhiều loại sản phẩm hoá học được điều chế từ muối ăn trong nước biển như : HCl. 12. NaOH. tơ sợi tổng hợp. 0.5 C 9. CO2. D.0125 tấn. KClO3 rắn. Câu 9. B. B. người ta tiến hành như sau : Lấy 2 lít không khí rồi dẫn qua dung dịch Pb(NO 3)2 dư thì thu được 0. 15. 2. B.Câu 9. D. Na2O2 rắn. 0. B. Ancol etylic là sản phẩm trung gian từ đó sản xuất được cao su nhân tạo.2 tấn. Khí lò cao. C.6 A 9. C.3 tấn. 1. SO2. D. Câu 9.3 D 9. C. 27. . C. 8.13. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IX 9.10.2 A 9. Khí tự nhiên.55 tấn. A.4 C 9. Khí dầu mỏ. Câu 9. Tính hàm lượng khí đó trong không khí. Để đánh giá độ nhiễm bẩn không khí của một nhà máy. Hiệu suất của quá trình là 80%. Hãy cho biết hiện tượng đó chứng tỏ trong không khí đã có khí nào trong các khí sau đây ? A.2 tấn.Cho lên men các nguyên liệu chứa tinh bột. b.15.Cho khí etilen (lấy từ cracking dầu mỏ) hợp nước có xúc tác. Biết rằng hao hụt trong quá trình sản xuất là 25%. D. C. 0. A. Tính khối lượng dung dịch CuSO4 5% thu được từ 0. Câu 9.01 mg/l). D. Biết hiệu suất của quá trình là 80%. Na2CO3. Chất khí CO (cacbon monoxit) có trong thành phần loại khí nào sau đây ? A. 1. B.15 tấn nguyên liệu chứa 80% CuS.11.3585 mg chất kết tủa màu đen. NaOH rắn. coi hiệu suất phản ứng là 100%.8 A . 17. a.

9. C 9.12 D 9.15.a 9.9.14 C 9.b A C 119 .15.11 A 9.10 D 9.13 B 9.

You're Reading a Free Preview

Tải về
scribd
/*********** DO NOT ALTER ANYTHING BELOW THIS LINE ! ************/ var s_code=s.t();if(s_code)document.write(s_code)//-->