HÓA HỌC 12

• • • • • • • • • Chương 1: Este – Lipit Chương 2: Cacbohidrat Chương 3: Amin – Amino axit – Protein Chương 4: Polime – Vật liệu polime Chương 5: Đại cương về kim lọai Chương 6: Kim lọai kiềm – Kim lọai kiềm thổ - Nhôm Chương7: Sắt và một số kim lọai quan trọng Chương 8: Phân biệt một số chất vô cơ Chương 9: Hóa học và vấn đề phát triển kinh tế, xã hội và môi trường

TÀI LIỆU LƯU HÀNH NỘI BỘ

CHƯƠNG I. ESTE - LIPIT A- MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Khái niệm về dẫn xuất của axit cacboxylic - Dẫn xuất của axit cacboxylic là những sản phẩm tạo ra khi thay thế nhóm hiđroxyl -OH trong nhóm cacboxyl -COOH bằng nguyên tử hay nhóm nguyên tử khác: -COOH → -COZ (với Z: OR', NH2, OCOR, halogen, …) - Este là dẫn xuất của axit cacboxylic. Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR' thì được este. - Halogenua axit (quan trọng nhất là clorua axit RCOCl). Để tạo ra halogenua axit có thể dùng các tác nhân như PCl5 (photpho pentaclorua), PCl3 (photpho triclorua), COCl2 (photgen), SOCl2 (thionyl clorua), … RCOOH + PCl5 → RCOCl + POCl3 + HCl 3RCOOH + PCl3 → 3RCOCl + H3PO3 RCOOH + SOCl2 → RCOCl + SO2 + HCl RCOOH + COCl2 → RCOCl + CO2 + HCl - Anhiđrit axit, có 2 loại: đối xứng (dạng (RCO)2O hoặc (ArCO)2O; gọi tên bằng cách thay từ axit bằng anhiđrit (CH3CO)2O là anhiđrit axetic), và không cân đối (sinh ra từ hai axit monocacboxylic khác nhau như CH3CO-O-OCC6H5; gọi tên bằng từ anhiđrit cộng với tên của hai axit - anhiđrit axetic benzoic). Để tạo thành anhiđrit axit có thể sử dụng nhiều phương pháp khác nhau như dùng tác nhân hút nước P2O5 hay tác dụng của nhiệt, … 2. Công thức tổng quát của este a/ Trường hợp đơn giản: là este không chứa nhóm chức nào khác, ta có các công thức như sau :
- Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đơn chức R'OH: RCOOR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đơn chức R'OH: R(COOR')a. - Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đa chức R'(OH)b: (RCOO)bR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đa chức R'(OH)b: Rb(COO)abR'a. Trong đó, R và R' là gốc hiđrocacbon (no, không no hoặc thơm); trường hợp đặc biệt, R có thể là H (đó là este của axit fomic H-COOH).

b/ Trường hợp phức tạp: là trường hợp este còn chứa nhóm OH (hiđroxi este) hoặc este
còn chứa nhóm COOH (este - axit) hoặc các este vòng nội phân tử … Este trong trường hợp này sẽ phải xét cụ thể mà không thể có CTTQ chung được. Ví dụ với glixerol và axit axetic có thể có các hiđroxi este như HOC 3H5(OOCCH3)2 hoặc (HO)2C3H5OOCCH3; hoặc với axit oxalic và metanol có thể có este - axit là HOOC-COOCH3.

c/ Công thức tổng quát dạng phân tử của este không chứa nhóm chức khác Nên sử dụng CTTQ dạng C n H 2n + 2 −2∆ O2a (trong đó n là số cacbon trong phân tử este n ≥ 2, nguyên; ∆ là tổng số liên kết π và số vòng trong phân tử ∆ ≥ 1, 2

nguyên; a là số nhóm chức este a ≥ 1, nguyên), để viết phản ứng cháy hoặc thiết lập công thức theo phần trăm khối lượng của nguyên tố cụ thể. 3. Tính chất hoá học của este a/ Phản ứng thuỷ phân este Tính chất hoá học quan trọng nhất của este là phản ứng thuỷ phân. Sơ đồ thuỷ phân este (về cơ bản, chưa xét các trường hợp đặc biệt) là :

C

O

+H

OH

H +, t o

C O

H

+

OH

O O (este) (nước) (axit) (ancol) Thuỷ phân chính là quá trình nghịch của của phản ứng este hoá.
Phản ứng thuỷ phân có thể xảy ra trong môi trường axit hoặc môi trường bazơ. - Phản ứng thuỷ phân trong môi trường kiềm được gọi là phản ứng xà phòng hoá. Đặc điểm của phản ứng thuỷ phân este: - Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Sản phẩm của phản ứng trong điều kiện này luôn có axit cacboxylic. Để chuyển dịch cân bằng về phía tạo axit và ancol, ta dùng lượng dư nước.

- Phản ứng thuỷ phân este không những thuận nghịch mà còn rất chậm. Để tăng tốc độ phản ứng thuỷ phân ta đun nóng hỗn hợp phản ứng với với chất xúc tác axit (H2SO4, HCl…). - Phản ứng xà phòng hoá chỉ xảy ra một chiều, sản phẩm thu được luôn có muối của axit cacboxylic.

C O

+ OH-

to

C
(muối)

O-

+

OH

(este) (kiềm) O b/ Phản ứng của gốc hiđrocacbon

O (ancol, phenol, anđehit …)

Este không no (este của axit không no hoặc ancol không no) có khả năng tham gia phản ứng cộng và phản ứng trùng hợp – đây là tính chất do liên kết π quy định (tương tự như hiđrocacbon tương ứng). Một số phản ứng thuộc loại này có ứng dụng quan trọng là : - Phản ứng chuyển hoá dầu (chất béo lỏng) thành mỡ (chất béo rắn)
Ni, t , p (C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5 (Triolein) (Tristearin) - Phản ứng trùng hợp vinyl axetat thành poli(vinyl axetat)
0

nCH2

CH OCOCH3

xt, to, p

CH CH2 n OCOCH3

- Trùng hợp metyl metacrylat thành poli(metyl metacrylat) – thuỷ tinh hữu cơ plexiglas).

3

este: RCOOC(R)(OH)-R’ • Este + NaOH  1 sản phẩm duy nhất → hoặc “m RẮN = mESTE + mNaOH”.Phản ứng tráng gương của este của axit fomic– (xem lại anđehit). tuỳ thuộc vào việc nhóm – OH đính vào gốc hiđrocacbon có cấu tạo như thế nào mà sẽ có các phản ứng tiếp theo xảy ra để có sản phẩm cuối cùng hoàn toàn khác nhau. to. Phản ứng khử este bởi líti-nhôm hiđrua LiAlH4 thành ancol bậc I 1) LiAlH 4 → RCOOR'  RCH2OH + R'OH 2) H3O + (Chú ý: anhiđrit axit. • Este + NaOH  1 muối + 1 ancol + H2O → Este. p CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) CH3 metyl metacrylat .nCH2 CH COOCH3 xt. Không nhất thiết sản phẩm cuối cùng phải có ancol. halogenua axit cũng bị líti-nhôm hiđrua khử tương tự). Este vòng (được tạo bởi hiđroxi axit) CH 3 CH C O • Este + NaOH  Có MSP = MEste + MO → NaOH R C O O Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi 4 .axit : HOOC-R-COOR’ • Este + NaOH  2 muối + H2O → Este của phenol: C6H5OOC-R • Este + NaOH  1 muối + anđehit + H2O → Hiđroxi. 5.este: RCOOCH(OH)-R’ • Este + NaOH  1 muối + xeton + H2O → Hiđroxi. 4. Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : • Este + NaOH  1 muối + 1 anđehit → Este đơn chức có gốc ancol dạng công thức R-CH=CHThí dụ CH3COOCH=CH-CH3 • Este + NaOH  1 muối + 1 xeton → Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân. hoặc nữa là do cấu tạo bất thường của este gây nên. Một số phản ứng thuỷ phân đặc biệt của este Căn cứ vào sơ đồ phản ứng xà phòng hoá hay phản ứng thuỷ phân este ta có thể căn cứ vào sản phẩm tạo thành để suy đoán cấu tạo của este ban đầu.

Phản ứng xà phòng hoá xảy ra nhanh hơn phản ứng thuỷ phân trong môi trường axit và không thuận nghịch. Ví dụ: phản ứng tạo phenyl axetat (CH3CO)2O + C6H5OH  CH3COOC6H5 + CH3COOH → CH3COCl + C6H5OH  CH3COOC6H5 + HCl → c/ Phản ứng cộng vào hiđrocacbon không no của axit cacboxylic Ví dụ: phản ứng tạo vinyl axetat xt. t 0 CH3COOH + CH≡ CH  CH3COOCH=CH2 → d/ Phản ứng ankyl halogenua và muối bạc hay cacboxylat của kim loại kiềm RCOOAg + R'I → RCOOR' + AgI RCOONa + R′ I → RCOOR' + NaI 7. sáp.Chỉ số axit: là số mg KOH cần để trung hoà axit béo tự do có trong 1g chất béo. .Lipit là những hợp chất hữu cơ có trong tế bào sống. Lipit . 5 . sterit. .Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử C (thường từ 12C đến 24C) không phân nhánh.Phản ứng của ancol với anhiđrit axit hoặc clorua axit thì phản ứng xảy ra nhanh hơn và một chiều (không thuận nghịch như khi tác dụng với axit) (CH3CO)2O + C2H5OH  CH3COOC2H5 + CH3COOH → CH3COCl + C2H5OH  CH3COOC2H5 + HCl → b/ Phản ứng của phenol với anhiđrit axit hoặc clorua axit (phenol không tác dụng với axit cacboxylic) tạo este của phenol. H . Lipit bao gồm chất béo. t CH3 CH C O + NaOH CH3 CH C ONa O Chú ý các kết luận in nghiêng ngay dưới mỗi trường hợp trênO chỉ là một thí dụ OH đây o 6. anhiđrit axit. các em chỉ được vận dụng khi không có dấu hiệu cho phép xác định cụ thể số nhóm chức este trước đó. . Một số phương pháp điều chế este a/ Phản ứng của ancol với axit cacboxylic và dẫn xuất như clorua axit.Phản ứng của ancol với axit cacboxylic (xem axit). tạo ra este. .t  → RCOOH + R'OH ← RCOOR' + H2O  + 0 . Khi thuỷ phân chất béo thì thu được glixerol và axit béo. Muối natri (hoặc kali) của các axit béo chính là xà phòng. gọi chung là triglixerit.Khi đun nóng chất béo với dung dịch kiềm thì tạo ra glixerol và hỗn hợp muối của các axit béo. photpholipit.đơn giản nhất. …hầu hết chúng đều là các este phức tạp. Phản ứng của chất béo với chất kiềm được gọi là phản ứng xà phòng hoá.

CH3CH2COOH + Br2  CH3CHBrCOOH + HBr → 10. 3CH3COOH + PCl3 → 3CH3COCl + H3PO3 t0 7. RCOOC6H5 + 2NaOH  RCOONa + C6H5ONa + H2O → t0 3. RCOONa + HCl (dd loãng) → RCOOH + NaCl t0 16. Xà phòng và chất tẩy rửa tổng hợp B . C3H5(OOC R )3 + 3NaOH  3 R COONa + C3H5(OH)3 → H+ . R-CN + 2H2O → R-COOH + NH3↑ 1) O 2 → 14. H + 0 0 15.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP t 1.. t0  → 4.Chỉ số xà phòng hoá là tổng số mg KOH cần để xà phòng hoá glixerit và trung hoà axit béo tự do có trong 1g chất béo. t 0 8. CH3-CO-CH3 + HCN → (CH3)2C(OH)CN 11. C6H5-CH(CH3)2  C6H5OH + CH3COCH3 2) H 2 O. (CH3)2C(OH)CN + 2H2O → (CH3)2C(OH)COOH + NH3↑ 12. 2CH3COONa(r) + 4O2  Na2CO3 + 3CO2↑ + 3H2O → t0 17. CxHy(COOM)a + O2  M2CO3 + CO2 + H2O → (sơ đồ phản ứng đốt cháy muối cacboxylat). RCOOC(CH3)=CH2 + NaOH  RCOONa + CH3COCH3 → 6 . 8. . bR(COOH)a + aR'(OH)b ← Rb(COO)abR'a + abH2O  t 5. R-Cl + KCN → R-CN + KCl 13. CH3COONa(r) + NaOH(r)  CH4 + Na2CO3 → photpho. t0 18. (C17H35COO)3C3H5 + 3KOH  C17H35COOK + C3H5(OH)3 → 6. RCOOCH=CH2 + NaOH  RCOONa + CH3CHO → 0 t 2. 3CH3COOH + POCl3  3CH3COCl + H3PO4 → CaO. t 0 9.Chỉ số iot: là số gam iot có thể cộng hợp vào các liên kết bội có trong 100g chất béo.

B. D. c/ (1) cần đun nóng. Câu 1. (1). B. (4). B. Câu 1. b/ (1) tạo sản phẩm axit. (1) và (4). HOOC–CH = CH– COO–CH3 và CH3–OOC – CH = CH2. (3) Để điều chế este của phenol không dùng axit cacboxylic để thực hiện phản ứng với phenol. thu chất rắn Y. (4). Etyl fomiat. đơn chức. D. (1). còn (2) không cần đun nóng. c. Các nhận định đúng gồm A. (5). (5) isopropyl fomiat. a. (2) Không thể điều chế được vinyl axetat bằng cách đun sôi hỗn hợp ancol và axit có axit H2SO4 đặc làm xúc tác. c. (3).4 Hỗn hợp X gồm 2 este mạch hở E (C5H6O4) và F (C4H6O2). (3). (4) propyl fomiat. (4). sau đó cô cạn dung dịch. (3). sẽ tồn tại các este với tên gọi : (1) etyl axetat. còn (2) tạo sản phẩm muối. (1). (3).nghịch. a. (4) Hợp chất CH3COOC2H5 thuộc loại este. do đó làm tăng hiệu suất tạo este.C. (3) Este no. Câu 1.3 Xét các nhận định sau: (1) Trong phản ứng este hoá. (5). (3). D. D. mạch hở có công thức phân tử CnH2nO2 . C. axit sunfuric vừa làm xúc tác vừa có tác dụng hút nước. (2). (1). C. Vậy công thức cấu tạo của E và F là A. b. (3) metyl iso-propylonat. (1). (2). D. (2). (3). (2). Câu 1. a. (3). (2) metyl propionat. 4. và (4).. (2). Đun hỗn hợp X với dung dịch NaOH dư. (3). (1). 3. còn (2) chỉ một chiều. (5) Sản phẩm của phản ứng giữa axit và ancol là este. Câu 1. HOOC – CH = CH – COO – CH3 và CH2 = CH – COO – CH3. (4) Phản ứng este hoá là phản ứng thuận . 15. b.1 Khi đun hỗn hợp gồm etanol và axit axetic (có mặt H2SO4 đặc làm xúc tác). (4). c. (2) Este là hợp chất hữu cơ trong phân tử có nhóm – COO. Nhận xét đúng là A. (4). C. 7 .6 Ứng với công thức phân tử C4H8O2. HOOC – CH2 – COO – CH = CH2 và CH3 – COO – CH = CH2. b. (4). D. C. chỉ (4). (1). Các nhận định đúng là A. (4). Đietyl ete. Các tên gọi đúng ứng với este có thể có của công thức phân tử đã cho là A.2 Có các nhận định sau : (1) Este là sản phẩm của phản ứng giữa axit và ancol. Câu 1.5 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit benzoic là A. (5). (1). (5). 14. D. B. với n ≥ 2 .7 Phản ứng thuỷ phân của este trong môi trường axit (1) và môi trường bazơ (2) khác nhau ở các điểm : a/ (1) thuận nghịch. (5). Etyl axetic. C. C. có thể thu được este có tên là A. B. (2). Etyl axetat. (4). (4).BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 1. Nung Y với NaOH (có mặt CaO) thì được một chất khí là CH4. (5). HOOC – COO – CH2 – CH = CH2 và H – COO – CH2 – CH = CH2. B. (2). B. C. (3).

(3). D.9 Công thức tổng quát của este tạo bởi một axit cacboxylic no đơn chức và một ancol no đơn chức (cả axit và ancol đều mạch hở) là A. Câu 1. đơn chức chứa 50%C (về khối lượng) có tên gọi là A. B.10 Este của glixerol với axit cacboxylic (RCOOH) được một số học sinh viết như sau: (1) (RCOO)3C3H5. B.17 Chất X có công thức phân tử C4H8O2. 8 . D. (3). B. Câu 1. Công thức cấu tạo của X là A. (1). CnH2n+2O2. (4) (ROOC)2C3H5(OH). 12. C. C2H5COOCH3 C. Câu 1.10O6. (1). D. (4). CnH2n . HCOOC3H5. D. 18.8 Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là A. vinyl fomiat.13 Những phát biểu sau đây : (1) Chất béo không tan trong nước. (3) Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. B. CnH2n – 2O2. B. B. chỉ có (5). (1). D.14 Trong thành phần của một số loại sơn có trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. CnH2nO2. (1). Số lượng công thức cấu tạo của các trieste có thể có trong loại sơn nói trên là A.6O4. D. phản ứng đặc trưng cho mọi este là A. (3). Rb(COO)abR’a. chỉ có (1). C. nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. D. Các phát biểu đúng là A. Câu 1. phenyl fomiat. C. (2) phản ứng cộng. (4) phản ứng oxi hóa. RCOOR’. HCOOC3H7 B. metyl benzoat. (5). C.16 Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. C. B. CnH2n – 2O2. ba chức là A.Câu 1. Câu 1. CnH2n + 1COOCmH2m +1. B. C. C. 6. CnH2n -16O12. (4). etyl axetat. (2). Câu 1. 8. (2). (4). CnH2nO2. CnH2n .12 Trong số các phản ứng có thể có của este gồm: (1) phản ứng trùng hợp. vinyl axtetat. Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức C2H3O2Na. (4) Chất béo là este của glixerol và axit hữu cơ. (1).18O12. Câu 1. (3). Câu 1. (2). (4). (2). (2) Chất béo không tan trong nước. metyl axetat. X có tên gọi là A. (3) và (4). phenyl axetat. benzyl fomiat. B. C. D. (1). Câu 1.11 Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi. (3) (HO)2C3H5OOCR. (2) (RCOO)2C3H5(OH). (5) C3H5(COOR)3. C. D. Công thức đã viết đúng là A.15 Este mạch hở. CnH2n . (3) phản ứng thuỷ phân. (4). CH3COOC2H5 D. (2).

Câu 1. 2. 3.2. (1).25 Tên gọi của este (được tạo nên từ axit và ancol thích hợp) có công thức phân tử C4H6O2 là A.22 Đun nóng hỗn hợp gồm x mol axit axetic và y mol etylen glicol (xt H2SO4 đặc). x = 1.21 Số nguyên tử cacbon tối thiểu trong phân tử este (được tạo nên từ axit và ancol) no đa chức. 2. Câu 1. C. 3. D. 1. (1). Câu 1. 9 . (2). Câu 1.05.2. 3. C. D. (1) và (2). 2. C. 4. B.19 Trong số các este: (1) metyl axetat. 2. Ở nhiệt độ đó hằng số cân bằng Kc của phản ứng este hoá là A.20 Số nguyên tử cacbon tối thiểu trong phân tử este không no. 4. 2. x. B. 1. C. C. Metyl acrylat. chỉ có (3). 0. y = 0.23 Trong số các đồng phân mạch hở có công thức phân tử C2H4O2.25 mol ancol và 0. 2. chỉ có (1). 1.4. Vinyl axetat. Metyl propionat.90. mạch hở là A. C.24 Ứng với công thức phân tử C3H6O2. B. x = 1. 18. 1. Câu 1. C.00.75. C. 2. (1). (2) metyl acrylat. y = 0. Câu 1. số đồng phân có khả năng tác dụng với dung dịch NaOH. D.80. (3).05. (4). (2). Câu 1. 2. (4) vinyl fomiat. 5. (3) metyl metacrylat. C. (3) iso propyl fomiat. Câu 1. 1. D. D. (4) metyl benzoat.30 mol axit. (2) metyl axetat. 1. một học sinh gọi tên các đồng phân este có thể có gồm: (1) etyl fomiat. B. Các tên gọi đúng là A. natri kim loại.2 mol este tạo thành. Metyl metacrylat. 6. y = 1.26 Cho 2 mol CH3COOH thực hiện phản ứng este hoá với 3 mol C2H5OH. 1. B. 4. 2. D. 2.Câu 1.00.75 mol este (không tác dụng với Na). Khi đạt trạng thái cân bằng trong hỗn hợp có 1. x = 1. Tại thời điểm cân bằng thu được 0. 2. este mà polime của nó được dùng để sản xuất chất dẻo gồm A. B. D. 2.18 Khi đun hỗn hợp 2 axit R1COOH và R2COOH với glixerol (axit H2SO4 làm xúc tác) có thể thu được mấy trieste ? A. (3). C. 2. (4). y = 1. B. natri cacbonat. D. B. y có giá trị là A. 5. (4). (2) và (3). B. dung dịch AgNO3 trong amoniac lần lượt là A. mạch hở là A. 2. x = 1.20. 1. (3).

e. O). Glixerol khử nước hoàn toàn cho sản phẩm là acrolein. Câu 1.32 Thuỷ phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng. este đơn có 2 nối đôi. D. B. Y thuộc dãy đồng đẳng A. B. Câu 1. c. este đơn no. axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. C. este đơn. e. C. giấm và axit sunfuric đặc. Đốt cháy hoàn toàn m g T. a. C. thu được một muối và một ancol. b. HCOO –C(CH3) = CH2. C. thu được 2 sản phẩm hữu cơ X. no. Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. Câu 1. Cho X5 tác dụng với NaOH lại thu được X2. Thuỷ phân X bằng dung dịch NaOH dư. c/ Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. Chất béo là este của glixerol với các axit béo. Vậy X. b. Đun hồi lưu hỗn hợp etanol. HOOC–CH2–CH = CH–OOCH. d. d. Cô cạn X1 được chất rắn X2 và hỗn hợp hơi X3. B. Câu 1. thu 6. Cho X4 tráng gương được sản phẩm X5. Đun sôi hỗn hợp etanol.72 lít (đktc) CO2 và 5. D. Phản ứng xà phòng hoá là phản ứng thuỷ phân este trong môi trường kiềm. d/ Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. D. D. a.30 Cách nào sau đây có thể dùng để điều chế etyl axetat ? A. rượu trắng và axit sunfuric đặc. HCOO – CH = CH – CH3. C. d. D. B. đun nóng. C.33 Cho các câu sau : a/ Chất béo thuộc loại hợp chất este. Chưng cất X3 thu được chất X4. có 1 nối đôi. Câu 1. Y mạch hở (C.Câu 1. a. isopropyl fomiat. HOOC–COO–CH2–CH = CH2. H. Những câu đúng là đáp án nào sau đây ? A. số nguyên tử cacbon chẵn. Đun hồi lưu hỗn hợp axit axetic. B. nhưng đều tác dụng với dung dịch NaOH khi đun nóng. HOOC–CH2–COO–CH = CH2. Chất E là A. este đơn.29 Phát biểu nào sau đây sai ? A. Các axit béo có mạch cacbon không phân nhánh.27 Chất X tác dụng với NaOH cho dung dịch X1. D. e/ Chất béo lỏng là các triglixerit chứa gốc axit không no trong phân tử. B. CH2 = CH – CH2 – OCOH. b/ Các este không tan trong nước do chúng nhẹ hơn nước. có một nối ba.28 Hỗn hợp T gồm 2 chất X. etyl axetat. 10 . e. Công thức cấu tạo của X có thể là A. propyl fomiat. Y (chứa các nguyên tử C. metyl propionat. HOOC–CH = CH–OOC–CH3. axit axetic và axit sunfuric đặc.31 Chất hữu cơ X có công thức phân tử là C5H6O4. Đun hồi lưu hỗn hợp etanol. C. B. Vậy công thức cấu tạo của X là A. d. a.O) đơn chức đều không tác dụng được với Na. CH2 = CH – OCOCH3.H. Câu 1. D.4g H2O. c.

cần thực hiện số lượng phản ứng hoá học ít nhất là A. Axit tạo F là A.5 mol. 11 .6 mol. 3. CH3–CH2–COO–CH=CH2 và CH2=CH–COO–CH2–CH3.36 Đun nóng hỗn hợp X và Y có công thức C5H8O2 trong dung dịch NaOH. axit fomic. D. D. 3. để điều chế được ba polime gồm polistiren. C. Số miligam NaOH cần để trung hoà các axit tự do có trong 1 gam chất béo. D. C.4 mol. B. 2. phân CH 5 C O. B. Để phân biệt 3 este: anlyl axetat. C. 2. 44%. khi đốt cháy một thể tích ancol T cần 3 thể tích oxi (đo ở cùng điều CH2 CH2 O kiện). axit axetic.34 Chỉ số axit của chất béo là A. C. B. 0. a có giá trị là A. D. Công thức cấu tạo của X là A.40 Cho 0. C3H3O2Na và 2 sản phẩm khác. D. C. 7. (3) dd AgNO3/NH3. 50%. Số mol KOH cần để xà phòng hoá một gam chất béo.41 F là chất CH có 2 .37 Từ nguyên liệu đầu là eten và benzen (xúc tác và điều kiện phản ứng có đủ).6. D. 22%. B. 2. 0. axit valeric. Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng A. B. polibutađien và poli(butađienstiren). 1. F tác dụng với NaOH tạo ra một ancol T.39 Trong phòng thí nghiệm có các hoá chất được dùng làm thuốc thử gồm: (1) dd brom.Câu 1. 0. axit acrylic. D. 1. 0. CâuCH3COOCH2 hữu cơ CHcông thứcCH2 tử C2H8O2.35 Cho a mol chất béo (C17H35COO)3C3H5 tác dụng hết với NaOH thu được 46g glixerol. C. 51%. Công thức cấu tạo của X và Y là A. CH2 CH(CH3)COOCH3. B. cô cạn dung dịch sau phản ứng thu 21g muối khan. Số liên kết π có trong gốc hiđrocacbon của axit béo. (4) axit axetic. Số miligam KOH cần để trung hoà các axit tự do có trong 1 gam chất béo. B. CH3–CH(OH)–CH(OH)–CH=CH2 và CH2=CH–CH2–CH2–COOH. 1. D. (2) dd NaOH.15 mol este đơn chức X (C5H8O2) tác dụng vừa đủ với dung dịch NaOH. thu sản phẩm 2 muối C3H5O2Na. B. (5) cồn iot. C. 1. Câu 1. 3. 5. vinyl axetat và etyl fomiat cần phải dùng các thuốc thử là A. Câu 1. CH2 CH COOC2H5 . 5. Câu 1.3 mol. 8 Câu 1. CH2=CH–CH2–CH2 – COOH và CH3–CH2–CH=CH–COOH. O=HC–CH2–CH2–CH2–CH=O và O=HC–CH(OH)–CH2–CH=CH2. C. Câu 1. Câu 1.38 Cho 10 gam hỗn hợp X gồm etanol và etyl axetat tác dụng vừa đủ với 50g dung dịch natri hiđroxit 4%.

B. Câu 1. Etyl fomiat. D. B. HCOOCH3. .49 Đốt hoàn toàn 4. làm bay hơi 8. 0.48 lít CO2 (đktc) và 3.4g). CH3COOCH3.2g.44 Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6. C2H5COOCH3 (4. 0. 600 mmHg).22g). Câu 1. axit acrylic. Câu 1.52g H2O. HCOOC2H5 (1. D. Công thức cấu tạo mỗi este và số gam tương ứng là A. 0. Tên gọi của X là A. Biết E có phản ứng tráng gương với dung dịch AgNO3/NH3. đơn chức. (COOC2H5)2. B.6g Z thu được thể tích bằng thể tích của 3. C2H5COOCH3 (6. D. HCOO – C2H5.4g). 1.6g H2O.32 lít (ở 1270C.36 lít oxi (đktc) thu hỗn hợp CO 2 và H2O có tỉ lệ thể tích tương ứng 6 : 5.Câu 1.2g ancol đơn chức.68g một ancol Y duy nhất có tỉ khối so với oxi là 1. C.28g X cần 3. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối lượng bình tăng 6. CH3COOC2H5 (6.1 mol. C2H3COOC2H5.16g CO2 và 2.4g X với dung dịch NaOH (phản ứng hoàn toàn) thu được sản phẩm có 6. HCOO – CH2CH2CH3. CH3COOC2H5 (4. C.8g este đơn chức. C2H4(COOC2H5)2. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A.47 Làm bay hơi 7. D. D. B.43 Cho ancol X tác dụng với axit Y thu được este Z.8g muối. D. C. vinyl fomiat. B. CH3COOCH3 (1. Câu 1. axit metacrylic.48 Đốt cháy hoàn toàn 2. axit fomic. C. C2H5COOC2H5.42 Đốt cháy hoàn toàn m g hỗn hợp các este no. 0. HCOOC2H5. CH3COOC2H5. 10g. HCOOCH3. C. 12 B. D.2g một este E thu được 6. Khi thực hiện phản ứng xà phòng hoá 7. mạch hở. D. B. HCOOC2H5 (2.22g). C2H3COOC3H7. Biết MY > MX.46 Thuỷ phân hoàn toàn 8. Etyl propionat.2g. CH(COOCH3)3. 12g.4g một este X thu được một thể tích hơi bằng thể tích của 3.6g).48g). B. Công thức của X là A. C. D. B.6g một ancol Y. Propyl axetat.2g khí oxi ở cùng điều kiện nhiệt độ. C. Nếu đun X trong dung dịch H 2SO4 loãng thu được axit Y có dY / H 2 = 36 và ancol đơn chức Z. Câu 1. C.14g hỗn hợp 2 muối và 3. C. CH3COOCH3. metyl axetat.48g). 10g.4375. etyl fomiat. có thể tích 8.45 Đốt cháy 6g este E thu được 4. axit axetic.2g O2 ở cùng điều kiện nhiệt độ và áp suất.50 Đun nóng 0. CH3COOCH3 (2. X có công thức A. isopropyl fomiat.01mol.1 mol X với dung dịch NaOH (đủ).1 mol.6g). Vậy công thức cấu tạo của E là A. mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4. (COOC3H5)2. Câu 1. Câu 1. Etyl axetat. Công thức cấu tạo của E là A. Tên gọi của X là A.01 mol.4g muối của axit đa chức và 9. Tên gọi của Y là A. thu 13. áp suất. CH3COO – CH2CH2CH3. Câu 1.

CH3CH2COOCH3. 3. m lần lượt là A. C.4g hỗn hợp 2 este đơn chức X.82g . C3H5(COOCH3)3.0g.53 Cho 21. D. B.92g glixerol. 20. Để trung hoà 2. 8. HCOOCH3 66. 165. C17 H 35COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | B. HCOOC2H5 16. Câu 1. Câu 1. C. C.51 Xà phòng hoá hoàn toàn 0. C17 H 33COO C H | C15 H 31COOCH 2 D. CTCT.1M. C3H5(OOCH)3.82g . 18. 8.55 Trong chất béo luôn có một lượng axit béo tự do.8g chất béo cần 3ml dung dịch KOH 0. CH3COOCH3 19. Công thức cấu tạo thu gọn của X là A.2g ancol Y và 20. C. CH3CH2OOC-COOCH2CH3.2g . (HCOO)3C3H5. B.3 mol NaOH. Vậy chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa 89% tristearin là A.5M.18%. Số miligam KOH dùng để trung hoà lượng axit béo tự do trong một gam chất béo gọi là chỉ số axit của chất béo.57 Khi thuỷ phân (xúc tác axit) một este thu được glixerol và hỗn hợp các axit stearic và axit panmitic theo tỉ lệ mol tương ứng bằng 2 : 1.20%. Y cần 200ml dung dịch NaOH 1.6g muối và 0. Sau khi phản ứng hoàn toàn. Câu 1. B. 16. C15 H 31COO C H | C15 H 31COOCH 2 13 . B. D.2 mol HCl. 7. 8. D.67%.2g.56 Tổng số miligam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong một gam chất béo gọi là chỉ số xà phòng hoá của chất béo. (CH3COO)3C3H5.4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức). 155. 7. Câu 1. % khối lượng của X trong hỗn hợp ban đầu và giá trị m là A. 20.Câu 1. 6. Lượng NaOH dư được trung hoà hết bởi 0.1 mol một ancol Y. D. cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và m g một muối khan duy nhất Z. Câu 1. 15. Chỉ số axit của mẫu chất béo trên là A.02g natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa).5M thu được 24.08g. CH3–C(COOCH3)3. C15 H 31COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | C. C3H5(COOCH3)3. 6.52 Để xà phòng hoá hoàn toàn 19. Công thức của X là A. (C2H5COO)3C2H5. Câu 1.82g. Este có thể có công thức cấu tạo nào sau đây? C17 H 35COO C H 2 C17 H 35COO C H 2 | | A.4g. 7.8g chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0.6g. 6.1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0.2g .54 Khi thuỷ phân a g một este X thu được 0. thu 9. D. 8. D.08g. 175. 19.4g. 185. Giá trị của a. B. C. B. C.

(1). (4). D.58g hỗn hợp Y gồm muối của axit linoleic và axit oleic. Câu 1. metyl axetat. Câu 1. 10.61kg. 3. cần dùng 0. 175g. Tên X là A. D.787kg. C. C3H6O2.92g. (C17H35COO)3C3H5. Câu 1. (C17H33COO)3C3H5.Câu 1.58 Trong chất béo luôn có một lượng axit béo tự do.7g chất hữu cơ X cần dùng 3. Biết X tác dụng với KOH tạo ra 2 chất hữu cơ. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng lớn hơn khối lượng X đã phản ứng. (2).62 Thuỷ phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1. D. C. Câu 1. (C15H31COO)3C3H5. (2). 9.90g. (C15H29COO)3C3H5.82g.91g. 929. thu được 0.84kg. B. C. (4) (C17H31OCO)2C3H5COOC17H29. (3). 917kg. Chất béo đó là A. Những công thức đúng là A.64 Đun nóng 215g axit metacrylic với 100g metanol (với Hpứ = 60%). (1). 14 . D. 2. C. etyl axetat. C. và mg hỗn hợp muối Na. 3. (4). (4). D.60 Đun sôi a g một triglixerit X với dung dịch KOH cho đến khi phản ứng hoàn toàn. B.145kg chất béo.61 Khối lượng xà phòng thu được từ 1 tấn mỡ động vật (chứa 50% trioleoyl glixerol.63 Đốt cháy 3. 889. B. B. C. 8. 988kg. Câu 1. (3). C. Công thức cấu tạo có thể có của các trieste đó là : (1) (C 17H31COO)2C3H5OOCC17H29.24g muối của axit béo duy nhất. (1). 125g. C.092kg glixerol. 7. Khối lượng este metyl metacrylat thu được là A. Câu 1.84g glixerol và 18. B. Giá trị của a là A. (2).65 Một chất hữu cơ X có d X CO2 = 2 . Khi thuỷ phân hoàn toàn 2. 8.92g glixerol và 9. Khối lượng xà phòng 60% (về khối lượng) thu được là A. D. (3) (C17H31OOC)2C3H5OOCC17H29. D. 100g.3kg NaOH.92kg. C3H4O2. Vậy công thức phân tử của X là A. iso propyl fomiat. (2). C2H4O2. B.92 lít O2 (đktc) thu được CO2 và H2O có tỉ lệ mol 1:1. Câu 1. C4H8O2. 150g.59 Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. (2) C17H31COOC3H5(OOCC17H29)2. thu 0. 30% tripanmitoyl glixerol (panmitin) và 20% tristearoyl glixerol (stearin) về khối lượng) khi xà phòng hoá bằng natri hiđroxit. giả sử hiệu suất quá trình đạt 90% là A. B.2kg. metyl propionat. D. B.3kg.

72 Thuỷ phân este X (C4H6O2) trong môi trường axit ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. 7. Đốt cháy hỗn hợp X sẽ thu được nCO2 − nH 2O = 0. etyl fomiat. B. HCOO – CH2 – CH = CH2.66 Este X có d X / H 2 = 44 . Trong hỗn hợp X. Câu 1. mạch hở. Tên gọi của L là ancol anlylic. Công thức của este E là A. C.2 mol. 8.15 mol. CH2 = CH – OCO – CH3.2g muối natriaxetat.69 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit ađipic là A. isopropyl fomiat. Nếu đốt cháy cùng một lượng X1 hay X2 sẽ thu được cùng một thể tích CO2 (ở cùng nhiệt độ và áp suất).15 mol D. Cho một lượng X tác dụng hoàn 41 toàn với dung dịch NaOH vừa đủ. (CH3COO)3C3H5. C. 625 ).71 X là một este hữu cơ đơn chức.4g este E thuỷ phân trong dung dịch NaOH thì thu được 8. Nung một trong hai muối thu được với NaOH (vôi tôi – xút) sẽ tạo metan.21g hỗn hợp X gồm hai chất hữu cơ Y và Z cùng nhóm chức với dung dịch NaOH dư. cần dùng 12g NaOH. C.015 mol H2. B. II – BÀI TẬP NÂNG CAO Câu 1. D. C. (CH3COO)2C2H4. 0. H – COOC2H5 0.Câu 1. Câu 1. CH3(CH2)2COOCH3.492g muối khan (hao hụt 6%). C. 6. C17H35COO(CH2)16CH3. thu 20. Trong X chắc chắn có một este với công thức và số mol tương ứng là A. CH3 – COOC2H3 0. metyl propionat. C.67 Xà phòng hoá 22. Công thức cấu tạo của X là A. B. CH3COOCH3.2 mol. CH3 – CH = CH – OCOH. thu được hỗn hợp muối natri của hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và một chất lỏng L (tỉ khối hơi d L / CH 4 = 3. CH2 = CH – COO – CH3. Câu 1. H-COOCH3. B. etyl axetat. Tên gọi của X là A. C. X là A. Chất L 1 phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. X2. Nhận định nào sau đây là sai ? A.68 Đun nóng 3. 15 . B. B. CH3COOCH3. CH2=CH–COOCH3.70 Cho 7. 02 .2g hỗn hợp gồm 2 este đồng phân. D. H – COOC2H5 0. Câu 1. hai chất Y và Z có số mol bằng nhau. Câu 1. thu được muối có khối lượng bằng khối lượng 37 este ban đầu. D. D. D. D. Cho lượng 10 chất L phản ứng với Na được 0. Thuỷ phân X tạo nên 2 hợp chất hữu cơ X1. CH3 – COOCH3 0. B.

16 . HCOOCH=CH–CH3 và CH3COOCH=CH2. C. Y: C3H8O3. sau phản ứng thu được một muối và một anđehit. X: CH2O2.52g một este E của axit cacboxylic no đơn chức và ancol no đơn chức (cả hai đều mạch hở) phản ứng vừa hết với 40ml dung dịch NaOH 1M. glixerol. ancol propylic.74 Đun hợp chất X với H2O (xúc tác H+) được axit hữu cơ Y ( dY / N2 = 2. C2H5COOCH3.75 Xà phòng hoá một este no đơn chức E bằng một lượng vừa đủ dung dịch NaOH chỉ thu được một sản phẩm X duy nhất.76 3. HCOOCH=CH–CH3. D. CH3COOCH2CH3. Câu 1. B. X: C3H6O2. Tên gọi của X. HCOOCH2CH=CH2. C. Isopropyl fomiat. X: C2H4O2. B. ancol etanol. CH3− CH− 2 CH 2 2 O O − C=O. Câu 1. axit propionic. CH3COOCH=CH2. glixerol. C. CH3CH2CH2OH Câu 1. CH2− 2 CH C=O. Nung X với vôi tôi xút thu được ancol Y và muối vô cơ Z. Y: C3H8O3.Câu 1.32g CO2. Y. CTCT của este E và chất Y là (giả sử các phản ứng đều đạt 100%) A. ancol isopropylic. Biết Z là ancol đơn chức.57 ) và ancol Z. ancol anlylic. Biết oxi hoá X bằng CuO đun nóng được sản phẩm có phản ứng tráng gương. Y: C3H8O. CH3CH2OH. Công thức cấu tạo của E là A. Khi bị oxi hoá chất Y chuyển thành anđehit. Y lần lượt là A. axit axetic. D. Biết rằng một trong 2 chất (X hoặc Y) tạo thành este là đơn chức.1 mol este E (chứa một loại nhóm chức) cần dùng vừa đủ 100g dung dịch NaOH 12%. Xác định công thức phân tử và gọi tên X. A.92 lít O2 (đktc) và thu được VCO : V H O = 3 : 2 . thu được chất X và chất Y. Đốt cháy hoàn toàn Y thu được CO 2 và H2O có tỉ lệ thể tích 3 : 4. Cho hơi Z qua ống bột đựng Cu xúc tác đun nóng thì sinh ra chất T có khả năng tham gia phản ứng tráng gương. CTCT của este không thể là A. C.78 Cho 12.4g muối của axit hữu cơ X và 9. axit axetic. HCOOCH2CH2CH3.9g một este đơn chức (mạch hở) tác dụng vừa đủ với 150ml dung dịch KOH 1M. D. D. axit acrylic. axit valeric. CH3CH2OH. ancol benzylic.73 Một este X tạo bởi axit đơn chức và ancol đơn chức có tỉ khối với He bằng 17 22. Metyl propionat. Metyl axetat. axit fomic. Etyl axetat.77 Thuỷ phân hoàn toàn 0. Đốt cháy 0. B. Câu 1. Câu 1. C. thu được 20. X: C2H4O2. Để đốt cháy hoàn toàn 2. D. axit acrylic. axit metacrylic. B. CH3OCO− CH=CH2. Y: C3H8O3. C2H5− CH− C=O. CH3CH2OH. B. Tên X là A. HCOOCH(CH3)CH3.2g ancol Y. B. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng bằng lượng 22 este đã phản ứng.6g chất Y cho 1. CH2− O C. glixerol. D.8g X thì cần 3.

(CH2=C(CH3)–COO)3C3H5. C2H5OOC–C6H4–COOC2H5 D. 4. Thành phần % khối lượng của etyl axetat trong hỗn hợp là A. 47. B. Mặc khác để thuỷ phân 6. Câu 1.00g muối khan G. B. X khử được AgNO3 trong amoniac. C2H5O–C6H4–COOC2H5. Câu 1. 118.9035g X cần 54. Sau phản ứng phải dùng 25ml dd H2SO4 0.8g thì tên gọi của este là A.16%. Trong ancol = dung dịch ancol Y 94% (theo khối lượng) tỉ số mol n 14 . D. C2H5OOC–C3H4–COOC2H5. (CH2=CH–COO)3C3H5. C. D. 17 .6g hỗn hợp etyl axetat và etyl fomiat cần 25. vinyl pentanoat. (D = 1. 108. 52.83 Đun a gam este mạch không phân nhánh CnH2n+1COOC2H5 với 100ml dd KOH. C. Câu 1. C. Cho G tác dụng với axit vô cơ loãng thu được G 1 không phân nhánh. Câu 1. khối lượng muối natri thu được là A. B.85 Để thuỷ phân 0. 6.01 mol este của một ancol đa chức với một axit cacboxylic đơn chức cần dùng 1.5ml NaOH 0. phenyl fomiat. D.81 Khi thuỷ phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. Cho 10g E tác dụng với lượng NaOH vừa đủ. etyl axetat.Câu 1.10kg natri hiđroxit.05g muối. Tên gọi của este đó là A. C. CH3–C6H4–COOC2H5. Y lần lượt là A. 103. C. CTCT của este là A. 117. C. D. B. D.2g NaOH.52g CO2 và 1. 2.96ml NaOH 10%. 100 < M X < 200 .60g một este E đơn chức được 3. còn Y tác dụng với nước brom sinh ra kết tủa trắng. 50.6kg. 8.20%. benzyl fomiat.5M để trung hoà KOH còn dư.14%.152g H2O.445kg.08g/ml). Giả sử phản ứng xảy ra hoàn toàn. cô cạn dung dịch sau phản ứng thu được 14. etyl butyrat. (CH3COO)2C2H4. B.245kg.35g este đó cần 3g NaOH và thu được 7.18%. (H–COO)3C3H5. etyl propionat.89kg. 36. C. D.2M. Số lượng CTCT thoả mãn tính chất đã nêu của E là A.80 Để xà phòng hoá 100kg dầu ăn thuộc loại trioleoyl glixerol có chỉ số axit bằng 7 cần 14. B. Muốn trung hoà dung dịch chứa 0. Câu 1. B. Câu 1.84 Thuốc chống muỗi (DEP) thu được khi cho axit thơm (X) tác dụng với ancol Y. Biết rằng H 2O n 86 CTCT thu gọn của X. etyl valerat. Khi a = 5.79 Đốt cháy 1. anlyl butyrat. Mặt khác muốn trung hoà 20ml dd KOH ban đầu phải dùng 15ml dd H2SO4 nói trên.82 Muốn thuỷ phân 5.

Cho hỗn hợp muối đó tác dụng H2SO4 dư được hỗn hợp 3 axit X.22g hỗn hợp hai este là đồng phân X và Y. 286. Câu 1. Câu 1. B. để trung hoà NaOH dư phải dùng 10ml HCl 0. thu được 8.87 Để xà phòng hoá hoàn toàn 2. (CH3)2CH-COOC2H5 và (CH3)3COOCH3. 287. trong đó X và Y là đồng phân của nhau.9g hỗn hợp ancol trên tác dụng hết với Na thu được 0. 170kg và 80kg. Z lần lượt là A. Chỉ số iot của chất béo được tạo nên từ axit linoleic là A.2M. Khi cho 3. CH3COOC(CH3)3 và CH3CH2COOCH(CH3)2.18%. 65kg và 40kg. 18. Khi đốt cháy hoàn toàn hỗn hợp hai este đó thì thu được khí CO2 và hơi nước với tỉ lệ thể tích VH2O :VCO2 = 1:1 . 20.736. D. Tên gọi của hai este là A. D. thu được hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và hai ankanol.05. (CH3)2CHCOOH. CH3CH2CH2CH2COOH. vinyl axetat. B. etyl fomiat. Y) với dung dịch H2SO4 loãng.20%. (CH3)2CHCOOH. D. metyl acrylat.88 Đun nóng hỗn hợp hai chất đồng phân (X. cần dùng 90ml dung dịch HCl 0. D. 192. CH3CH2CH2COOH. 22. cần dùng 30ml dd NaOH 1M. HCOOC(CH3)3 và CH3COOCH(CH3)2. A. 1 để trung hoà dung dịch thu được.6g hỗn hợp muối. 2. 228. (CH3)3CCOOH.92 Một mẫu chất béo chứa gồm trilein và tripanmitin có chỉ số iot là 19. B. 215kg và 80kg. Đun 7. Câu 1. propyl fomiat. D. D. 90. C. 3. CH3CH2CH2CH2COOH. 20. Z là đồng đẳng kế tiếp của Y và có mạch cacbon không phân nhánh.86 Đun 20g lipit với dung dịch chứa 10g NaOH.3M. Câu 1. CH3(CH2)3COOH.920. (CH3)2CH-COOC2H5 và (CH3)2CHCH2COOCH3.868. Y. etyl axetat. 86. Z. Y. Số CTCT của E và CTCT của các axit X. Phần trăm về khối lượng của một trong hai glixerit phải là A. B.05 mol khí. 85. (CH3)3CCOOH. CH3(CH2)3COOH. metyl propionat. B. Hoà tan 1g hỗn hợp axit trên vào 50ml NaOH 0. Câu 1.5kg và 41kg. isopropyl fomiat. 190. 2.188.Câu 1. 18 . 3. 188. Phân tử 10 khối trung bình của các axit béo trong thành phần cấu tạo của lipit và chỉ số xà phòng hoá của lipit và lần lượt là A. mạch hở. 196. Biết hiệu suất quá trình este hoá và quá trình trùng hợp lần lượt là 60% và 80%. C. (CH3)2CHCOOH.9g A với NaOH cho tới phản ứng hoàn toàn. Y là A. Sau khi kết thúc phản ứng.5M.19%. C.89 E là este của glixerol với một số axit monocacboxylic no.1%. (CH3)2CHCOOH. 173. D.90 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu. metyl axetat. 191. C. 273. Biết rằng các gốc hiđrocacbon đều có độ phân nhánh cao nhất. C. CH3CH2CH2COOH. B. B.91 Số gam iot có thể cộng vào liên kết bội trong mạch cacbon của 100g chất béo được gọi là chỉ số iot của chất béo. Câu 1. C. C. CTCT của X.

cấu tạo bởi một nhóm cacbonyl ở vị trí C2 (là xeton) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]3COCH2OH. Cùng với dạng mạch hở fructozơ có thể tồn tại ở dạng mạch vòng 5 cạnh hoặc 6 cạnh H OH 2 H O OH H 5 2 1 O H O OH H 5 1 CH2OH 2 OH H 3 OH O OH H 5 HOCH2 3 1 OH 4 CH2OH H 6 HOCH2 3 OH H 4 CH2OH 6 4 CH2OH H 6 α -fructozơ fructozơ OH- β -fructozơ Trong môi trường bazơ. nên không có khả năng mở vòng. 19 . hai dạng vòng này chiếm ưu thế và luôn chuyển hoá lẫn nhau theo một cân bằng qua dạng mạch hở. do đó có thể mở vòng tạo thành nhóm anđehit (– CHO). Fructozơ là đồng phân của glucozơ. glucozơ tồn tại chủ yếu ở hai dạng α -glucozơ và β glucozơ (dạng mạch vòng). fructozơ có sự chuyển hoá thành glucozơ. CH2OH[CHOH]3-CO-CH2OH CH2OH[CHOH]4CHO b) Saccarozơ và mantozơ (C12H22O11) Saccarozơ là một đisaccarit. Đơn vị monosaccarit thứ hai có nhóm OH semiaxetal tự do.CHƯƠNG II. Trong dung dịch. CACBOHIĐRAT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Trong phân tử không còn nhóm OH semiaxetal.glucozơ nối với C2 của gốc β fructozơ qua nguyên tử O (C1 – O – C2). H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 1 OH H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 6 CH2OH 5 OH 3 H O H 2 OH H OH 1 O C 1 H H 4 OH α -glucozơ glucozơ β -glucozơ Glucozơ có đầy đủ các tính chất của rượu đa chức và anđehit đơn chức.glucozơ nối với C4 của gốc α .hoặc β . cấu tạo bởi C 1 của gốc α . Mantozơ là đồng phân của saccarozơ. cấu tạo bởi C1 của gốc α .glucozơ qua nguyên tử O (C1 – O – C4). cấu tạo bởi một nhóm cacbonyl ở C1 (là anđehit) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]4CHO. Trong thiên nhiên. Cấu trúc phân tử a) Glucozơ và fructozơ (C6H12O6) Glucozơ là monosaccarit.

Xenlulozơ là đồng phân của tinh bột. cấu tạo bởi các mắt xích β -glucozơ liên kết với nhau thành mạch kéo dài.c) Tinh bột và xenlulozơ (C6H10O5)n Tinh bột là polisaccarit. phân tử không có nhóm CHO và mỗi mắt xích còn 3 nhóm OH tự do. 20 . 2. (-) không có phản ứng. không yêu cầu viết sản phẩm. cấu tạo bởi các mắt xích α -glucozơ liên kết với nhau thành mạch xoắn lò xo. (*) phản ứng trong môi trường kiềm. nên công thức của xenlulozơ còn có thể viết [C6H7O2(OH)3]n. Tính chất hoá học Cacbohiđrat Glucozơ Tính chất T/c của anđehit + [Ag(NH3)2]OH T/c riêng của –OH hemiaxetal + CH3OH/HCl T/c của poliancol + Cu(OH)2 T/c của ancol (P/ư este hoá) + (CH3CO)2O Ag↓ + Ag↓ Fructozơ Saccarozơ Mantozơ Tinh bột Xenlulozơ Metyl glucozit - - Metyl glucozit - - dd màu xanh lam dd màu xanh lam dd màu xanh lam dd màu xanh lam - - + + + + + Xenlulozơ triaxetat Xenlulozơ trinitrat + + HNO3/H2SO4 P/ư thuỷ phân + H2O/H+ P/ư màu + I2 - + + + + - Glucozơ + Fructozơ Glucozơ Glucozơ Glucozơ - - - - màu xanh đặc trưng - (+) có phản ứng. phân tử không có nhóm CHO và các nhóm OH bị che lấp đi.

B .CaO.2H2O 16. → H 2SO4 loaõ g n 14. C6H12O6  2C2H5OH + 2CO2↑ → o Ni. (C6H10O5)n + nH2O  → hoaë men c Axit voâ loaõ g. CH 2 OH[CHOH]4 CHO + 2[Ag(NH 3) 2]OH  CH 2OH[CHOH] 4COONH 4 +2Ag ↓ + glucozơ amoni gluconat Men röôï u 5. CH2OH[CHOH]4CHO + H2  CH2OH[CHOH]4CH2OH → Sobit (Sobitol) t0 3. CH2OH[CHOH]4CHO + 2Cu(OH)2  CH2OH[CHOH]4COOH + Cu2O↓ + → +2H2O t → 3NH 3 + O H 2 4. CH2OH[CHOH]3COCH2OH ← CH2OH[CHOH]4CHO  12. C12H22O11 + H2O  C6H12O6(Glucozơ) + C6H12O6(Fructozơ) → → 15. C12H22O11. C12H22O11 + Ca(OH)2 + H2O  C12H22O11. CH2OH[CHOH]4COOH + Fe  tạo phức màu vàng xanh.t0 (pentaaxetyl glucozơ) + H2O 2. C6H12O6  2CH3–CHOH–COOH → Axit lactic (axit sữa chua) Men → 7. (C6H10O5)n + nH2O t0  → xt: H + (Glucozơ) nC6H12O6 (Xenlulozơ) (Glucozơ) Ca(OH)2 9.CH2OH[CHOH]4CHO+5CH3COOH ← CH3COOCH2[CHOOCCH3]4CHO  Xt. (C6H10O5)n + nH2O  nC6H12O6 Hoaë H+ c (Tinh bột) 8. t 0 cô n nC6H12O6 21 . 6H–CHO → C6H12O6 10.t0 Men lactic 6.CaO.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP  → 1.2H2O + CO2  C12H22O11 + CaCO3↓ 2H2O + → 17. 6 CH2OH H 4 OH 5 OH 3 H O H 2 OH H 1 OH H 6 CH2OH 5 OH 3 H OH − O H 2 OH H 1 + HOCH3 HCl 4 OH + H2O OCH3 metyl α -glucozit  → 11. CH2OH[CHOH]4CHO + Br2 + H2O  CH2OH[CHOH]4COOH + 2HBr → 3+ 13.

2.tinh bột 18. Câu 2. 22 . C.1 Tìm từ thích hợp để điền vào chỗ trống trong đoạn văn sau: Ở dạng mạch hở glucozơ và fructozơ đều có nhóm cacbonyl.2g. Cacbohiđrat là những hợp chất hữu cơ tạp chức và đa số chúng có công thức chung là Cn(H2O)m. B. mantozơ. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)n.3 Có mấy loại cacbohiđrat quan trọng? A. D. Câu 2.6g. [C6H7O2(OH)3]n + 3nHONO2  [C6H7O2(ONO2)3]n + 3nH2O → (HNO3) xenlulozơ trinitrat C. D. 2. ngược lại. 21. D. Trong môi trường bazơ. glucozơ.BÀI TẬP TRẮC NGHIỆM I. fructozơ có thể chuyển hoá thành … và … A.BÀI TẬP CƠ BẢN Câu 2. glucozơ.2 Cacbohiđrat là gì? A. C.2g. 1. 3 loại. glucozơ. nhưng trong phân tử glucozơ nhóm cacbonyl ở nguyên tử C số …. C.2g. C. 2. B. phản ứng với Na và với dung dịch AgNO3 trong amoniac. t 0 20. 43. 6nCO2 + 5nH2O Dieä luï p c  → a/ s maë trôø t i glucozơ (C6H10O5)n 0 Axit voâ loaõ g. B. ngược lại. 4 loại. 68. C. 2.5 Để tráng bạc một chiếc gương soi. 43. B. Câu 2. Cacbohiđrat là những hợp chất hữu cơ tạp chức. 68. 2 loại. D. Khối lượng bạc đã sinh ra bám vào mặt kính của gương và khối lượng AgNO 3 cần dùng lần lượt là (biết các phản ứng xảy ra hoàn toàn) A. Câu 2. 68. 1. 1. phản ứng với CuO và với dung dịch AgNO3 trong amoniac.0g.0g.0g. glucozơ. ngược lại. 43. phản ứng với NaOH và với dung dịch AgNO3 trong amoniac. 1 loại. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)m. 2.4 Những thí nghiệm nào chứng minh được cấu tạo phân tử của glucozơ? A. còn trong phân tử fructozơ nhóm cacbonyl ở nguyên tử C số…. D. t cô n 19. B.0g. phản ứng với Cu(OH)2 và với dung dịch AgNO3 trong amoniac. (C6H10O5)n + nH2O  nC6H12O6 → xenlulozơ glucozơ H 2SO4 ñ. người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac. 34.

anđehit axetic. D. Cu(OH)2/OH . Cả B. Iot làm hồ tinh bột hoá xanh. lòng trắng trứng và rượu etylic. saccarozơ và anđehit axetic có thể dùng chất nào trong các chất sau làm thuốc thử ? − A. D. dung dịch KMnO4. B. tinh bột và xenlulozơ ở dạng bột? A. glucozơ và axit axetic. dung dịch HNO3. B. Cho từng chất tác dụng với vôi sữa Ca(OH)2. C. Câu 2. Hoà tan từng chất vào nước.9 Để phân biệt các chất: Glucozơ. Glixerol tác dụng Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên ? A. Saccarozơ là một đisaccarit. còn lại hồ tinh bột. Câu 2. Tinh bột và xenlulozơ đều là polisaccarit. lòng trắng trứng tác dụng Cu(OH)2 cho màu xanh tím. Chỉ dùng một thuốc thử nào sau đây để phân biệt chúng. B. dung dịch HNO3 đặc. còn lại lòng trắng trứng. Khi thuỷ phân đến cùng saccarozơ. glixerol tác dụng với Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. NaOH. có thể chỉ dùng một thuốc thử nào sau đây? − A. Cho từng chất tác dụng với dung dịch iot. Na kim loại.7 Để phân biệt các dung dịch glucozơ. Câu 2. B. Iot làm hồ tinh bột hoá xanh. HNO3.8 Có bốn lọ mất nhãn chứa: Glixerol. KOH và axit axetic. glixerol.Câu 2. 23 . A. ancol etylic. Nước brom. C đều đúng. chỉ khác nhau về cấu tạo của gốc glucozơ. dung dịch CuSO4. C. D. B. C. Cu(OH)2/OH . tinh bột và xenlulozơ đều cho một loại monosaccarit. [Ag(NH3)2]OH. Câu 2. dung dịch AgNO3/NH3. D. C. Cho từng chất tác dụng với dung dịch HNO3/H2SO4.6 Phương án nào dưới đây có thể phân biệt được saccarozơ. A. C. B. còn lại glixerol. B. D.10 Chọn cách phân biệt các dung dịch sau đây: Lòng trắng trứng. C. dung dịch brom. C.12 Chọn câu phát biểu sai: A. hồ tinh bột. Câu 2. dung dịch HCl. Câu 2.11 Có 4 dung dịch loãng không màu gồm: Lòng trắng trứng. glixerol. Cu(OH)2 trong môi trường kiềm. khi đun nóng lòng trắng trứng đông tụ. AgNO3/NH3. glixerol. D. sau đó đun nóng và thử với dung dịch iot.

không màu.20 Nhóm gluxit đều có khả năng tham gia phản ứng tráng gương là A.D.74g. mantozơ. chỉ có glucozơ. Glucozơ. Chất đó là chất nào trong các chất sau ? A. xenlulozơ. tinh bột. fructozơ. Câu 2.16 Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol là 1:1. có vị ngọt là tính chất vật lí và trạng thái tự nhiên của nhóm chất nào sau đây? A. D. Khi thuỷ phân đến cùng. saccarozơ và tinh bột. sacacrozơ.4g. B.0g. D.14 Cho các chất glucozơ. phản ứng xảy ra hoàn toàn. B. fructozơ.5g. B. B. glucozơ và xenlulozơ. C.444kg. khối lượng ancol thu được là A. 0. biết hiệu suất lên men là 80%. fructozơ. saccarozơ.21 Cho glucozơ lên men tạo thành ancol. C. B.15 Để tráng bạc một số ruột phích. Câu 2.17 Khi thuỷ phân 1kg bột gạo có 80% tinh bột. mantozơ.19 Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. Mantozơ. 0. tinh bột và xenlulozơ đều cho glucozơ.690kg. fructozơ. Câu 2. C.8g. fructozơ.89kg. D. 91. Khối lượng AgNO3 cần dùng và khối lượng Ag tạo ra lần lượt là (giả thiết rằng. dễ tan trong nước. glucozơ và fructozơ. glucozơ và tinh bột. B. Câu 2. A.8g. sự chuyển hoá của fructozơ là không đáng kể và hiệu suất các phản ứng đều đạt 90%) A. 24 . thu được 50g kết tủa. hex-3-en. B. glucozơ. tinh bột. C. 88. C. glucozơ.555kg. D. 23. Câu 2. tinh bột. D. 0. D. 0. Câu 2.6g. D. Glucozơ. glucozơ và saccarozơ. xenlulozơ. fructozơ.99kg.80kg. C. 27. C. tất cả các chất đã cho. 102. Câu 2. D. vừa có tính chất của anđehit là A. glucozơ. D. 52. 0. xenlulozơ. không mùi. Saccarozơ.13 Cùng là chất rắn kết tinh. Chất vừa có tính chất của ancol đa chức. 0.8g. 91. C.74g. Câu 2.18 Tính khối lượng glucozơ tạo thành khi thuỷ phân 1kg mùn cưa có 50% xenlulozơ. 0. Câu 2. xenlulozơ. A. glucozơ. 0. fructozơ và saccarozơ.500kg. 52.5g. 28. Giả thiết hiệu suất phản ứng là 80%. 64. tinh bột. Glucozơ.90kg. Saccarozơ. C. người ta phải dùng 100g saccarozơ. thì khối lượng glucozơ thu được là bao nhiêu ? Giả thiết rằng.0g.0g. khí CO2 tạo thành được dẫn qua dung dịch nước vôi trong dư. axit axetic. B. 50. saccarozơ. Saccarozơ. Chất này có thể lên men rượu (ancol). Glucozơ. 18. B.

D.25 Biết CO2 chiếm 0.103 lít. Saccarozơ. Câu 2. Phân biệt glucozơ và saccarozơ bằng phản ứng tráng gương. Câu 2. C6H12O6 + Cu(OH)2  → kết tủa đỏ gạch n B. nhiệt độ.26 Glucozơ tác dụng được với tất cả chất trong nhóm chất nào sau đây? A. glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở. Phân biệt tinh bột và xenlulozơ bằng I2. 224. B. nhiệt độ. D. đun nóng. Cu(OH)2. Phân biệt mantozơ và saccarozơ bằng phản ứng tráng gương. 25 . C6H12O6  m e → C2H5OH + O2 Câu 2. H2/Ni . B. B.28 Chọn câu phát biểu đúng: A. nhiệt độ. tinh bột. Phân biệt glucozơ và fructozơ bằng phản ứng tráng gương. 112. C6H12O6 + CuO  → Dung dịch màu xanh n D. C.23 Nhóm gluxit khi thuỷ phân hoàn toàn đều chỉ tạo thành glucozơ là: A. CH3COOH/H2SO4 đặc. nhiệt độ.glucozit không thể chuyển sang dạng mạch hở. [Ag(NH3)2]OH. xenlulozơ. xenlulozơ. H2O/H+. H2/Ni. mantozơ. D. C. tinh bột. Câu 2. D. xenlulozơ. Glucozơ và fructozơ là đồng phân cấu tạo của nhau.27 Chọn câu phát biểu sai: A. H2/Ni .22 Chọn sơ đồ phản ứng đúng của glucozơ A. 448. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. C. Mantozơ. Tinh bột có cấu trúc phân tử mạch không phân nhánh. Metyl α .Câu 2. B.03% thể tích không khí. C6H12O6  m e → CH3–CH(OH)–COOH C. Cu(OH)2. C.103 lít.103 lít. C. B.103 lít. Saccarozơ. 336. thể tích không khí (đktc) cần cung cấp cho cây xanh quang hợp để tạo 162g tinh bột là A. Phân biệt saccarozơ và glixerol bằng Cu(OH)2. [Ag(NH3)2]OH. mantozơ. [Ag(NH3)2]OH. mantozơ. [Ag(NH3)2]OH. H2/Ni . Cu(OH)2. D.24 Phát biểu nào sau đây không đúng ? A. đun nóng. NaOH. Trong dung dịch. Câu 2. tinh bột. Na2CO3. Câu 2. B. Cu(OH)2. Saccarozơ.

[C6H7O2(OH)2]n. B.37 Một polisaccarit (C6H10O5)n có khối lượng phân tử là 162000u. quá trình oxi hoá. Câu 2. C. xenlulozơ. C. D. D. C. n có giá trị là A. Câu 2. Y lần lượt là A. B. (C6H10O5)n. men C.C. etanol. D. 56g. 1000. Câu 2. hiệu suất thuỷ phân tinh bột và lên men lactic tương ứng là 90% và 80%. Khối lượng tinh bột cần dùng là A. etanol. asmt → Câu 2. mantozơ. 1500.29 Phương trình: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. Câu 2. B. D. quá trình hô hấp.30 Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → sobit. Glucozơ + [Ag(NH3)2]OH. C. Glucozơ. là phản ứng Clorofin hoá học chính của quá trình nào sau đây? A. B. Câu 2. [C6H7O2(OH)3]n. Câu 2. (C6H12O6)n. saccarozơ.32 Để điều chế 45g axit lactic từ tinh bột và qua con đường lên men lactic. D. (C6H10O5)n.34 Thuốc thử phân biệt glucozơ với fructozơ là A. Câu 2. CxHyOz. C.25g. Tên gọi X. quá trình quang hợp.36 Công thức phân tử và công thức cấu tạo của xenlulozơ lần lượt là A. Glucozơ + H2/Ni . D. tinh bột. glucozơ. Câu 2. D. D. (C6H10O5)n. Glucozơ + Cu(OH)2. 900. Glucozơ. fructozơ thành những sản phẩm giống nhau là A. 56. B. [C6H7O2(OH)3]n. quá trình khử. etanol.39 Cacbohiđrat khi thuỷ phân tạo ra 2 phân tử monosaccarit là 26 .nH2O. mantozơ. fructozơ. Cn(H2O)m. B. B.35 Cacbohiđrat (gluxit) là những hợp chất hữu cơ tạp chức và có công thức chung là A.33 Phản ứng chuyển glucozơ. Glucozơ. tinh bột. Glucozơ. Phân biệt saccarozơ và glixerol bằng phản ứng thuỷ phân. D. D. 950. Câu 2. C. o C. 60g. t . to. H2. xenlulozơ. R(OH)x(CHO)y. B. dung dịch Br2. C. D. B. phản ứng với Cu(OH)2. Glucozơ → etanol. phản ứng với H2/Ni. Dung dịch mantozơ có tính khử và bị thuỷ phân thành glucozơ. [C6H7O2(OH)3]n. B.31 Phản ứng khử glucozơ là phản ứng nào sau đây ? A. Cu(OH)2. C. C. phản ứng với kim loại Na.38 Gluxit không thể thuỷ phân được nữa là A. [Ag(NH3)2]OH. phản ứng tráng gương. 50g. Câu 2.

B. xenlulozơ.4%. 0. khử glucozơ bằng H2/Ni. phản ứng lên men rượu etylic. amilopectin. amilozơ. C. D.41 Polisaccarit khi thuỷ phân đến cùng tạo ra nhiều monosaccarit là A. saccarozơ. B.47 Tinh bột trong gạo nếp chứa khoảng 98% là A. B. B. phản ứng khử Cu(OH)2.44 Để xác định trong nước tiểu của người bị bệnh tiểu đường có chứa một lượng nhỏ glucozơ. Mantozơ. D. D. D. đều hoà tan Cu(OH)2 ở nhiệt độ thường tạo dung dịch màu xanh đặc trưng. Xenlulozơ. [Ag(NH3)2]OH. Câu 2. Câu 2. đều lấy từ củ cải đường. C. C. lên men rượu etylic. tinh bột. 0. fructozơ. C. Saccarozơ. to. amilozơ. đều có trong biệt dược “huyết thanh ngọt”. B. amilozơ. 27 . Cu(OH)2. phản ứng cộng hiđro. Câu 2. amilopectin. Câu 2. Tinh bột.2%. glixerol. Saccarozơ. B. B. phản ứng tráng gương. dung dịch AgNO3 trong dung dịch NH3. phản ứng thuỷ phân. phản ứng tráng gương.40 Saccarozơ và glucozơ có đặc điểm giống nhau là A.1%. Câu 2. saccarozơ. Câu 2.42 Chất không phản ứng với glucozơ là A. glucozơ tác dụng với Cu(OH)2. Tinh bột.3%. có thể dùng 2 phản ứng hoá học là A. C. D. alanin. Câu 2. C. nồng độ của glucozơ có giá trị hầu như không đổi là A. D.46 Gluxit chuyển hoá thành glucozơ trong môi trường kiềm là A.48 Phản ứng chứng tỏ glucozơ có nhiều nhóm OH ở các nguyên tử cacbon liên tiếp nhau là phản ứng với A. B. mantozơ. C. oxi hoá glucozơ bằng [Ag(NH3)2]OH. phản ứng tráng gương. Cu(OH)2 ở nhiệt độ thường. Câu 2.43 Trong máu người. I2. Xenlulozơ. H2/Ni. 0. tinh bột. D. C. saccarozơ.45 Sobit (sobitol) là sản phẩm của phản ứng A.A. đều tham gia phản ứng tráng gương. D. phản ứng tráng gương. glucozơ. B. 0. B. C. xenlulozơ. Câu 2. D.

(8). AgNO3/NH3. C. (7). Khi bệnh nhân có lượng glucozơ trong máu < 0. tác dụng với Cu(OH)2 tạo dung dịch có màu xanh đặc trưng. Câu 2. (2). D. H2/Ni. D. (8) Cn(H2O)m. (7). Khi bệnh nhân có lượng glucozơ trong máu từ 0. A. vậy trong phân tử … ở … Tương tự như glucozơ. to.54 Phản ứng nào sau đây chứng tỏ glucozơ có dạng mạch vòng? A. B. (6). (3). (8).50 Phân tử glucozơ tác dụng với Cu(OH)2 cho …. Cu(OH)2. (6). Câu 2. bị oxi hoá bởi … trong môi trường bazơ. phản ứng với AgNO3/NH3. Cho hỗn hợp etilen và hơi nước qua tháp chứa H3PO4. B. Cacbohiđrat là những … và đa số chúng có công thức chung là … (1) dung dịch màu xanh lam. C. (2). Câu 2. (4). Câu 2. (2). (3). (3).1%. (3). Câu 2. (4). (1). (6). (7). phản ứng với Cu(OH)2. Lên men glucozơ. B.1%. (3) vị trí kề nhau. D.C. (5). 28 . (1). tác dụng với axit tạo sobitol. B. t . (8). Khi bệnh nhân có lượng glucozơ trong máu = 0.1% → 0. (5).49 Phản ứng chứng minh glucozơ có nhóm chức anđehit là A. (5) poliancol. B. D. (2) có nhiều nhóm OH. nóng. C. Câu 2.52 Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm ? A. (4). (8). Cho etilen tác dụng với dung dịch H2SO4 loãng. (1).1%. (4). tác dụng với axit tạo este có 5 gốc axit. B. Cu(OH)2 ở nhiệt độ cao. (2). D.53 Fructozơ không phản ứng với chất nào sau đây? A. (1). o C. phản ứng với CH3OH/HCl. (4) fructozơ. (6) phức bạc amoniac. Từ hay cụm từ thích hợp ở những chỗ trống trong các câu ở đoạn văn trên lần lượt là A. (5). phản ứng tráng gương. D. D. … cộng với hiđro cho …. (6). C. (7) hợp chất hữu cơ tạp chức. dung dịch brom. phản ứng lên men rượu etylic. Khi bệnh nhân có lượng glucozơ trong máu > 0.2%. phản ứng với H2/Ni. C. Thuỷ phân dẫn xuất etyl halogenua trong môi trường kiềm. (7). (5).51 Khi nào bệnh nhân được truyền trực tiếp dung dịch glucozơ (còn được gọi với biệt danh “huyết thanh ngọt”).

4g. (3). 14. C3H6O3.4g CO2 thì kèm theo 1. saccarozơ. 13. (4). (2). C3H6O3. Câu 2. lên men thành ancol etylic.55 Phản ứng tổng hợp glucozơ trong cây xanh cần được cung cấp năng lượng là 2813kJ cho mỗi mol glucozơ tạo thành.58 Cho 4 chất hữu cơ X. Tỉ lệ phân tử khối của X. 90. C2H4O2. (1). giá trị của a là A.65kg. D. D. Câu 2. D.26g. C6H12O6. nhưng chỉ 10% được sử dụng vào phản ứng tổng hợp glucozơ.II. CH2O. (2). Câu 2. 29 . (4) CH3COOH (H2SO4 đặc) A. Khối lượng dung dịch so với ban đầu giảm 3. CH2O. glucozơ. B.56 Cho 10kg glucozơ chứa 10% tạp chất. (3) [Ag(NH3)2]OH. 12.BÀI TẬP NÂNG CAO Câu 2. C6H12O6. 88. Z.26g. Câu 2. Z.56kg. CH2O. C.84kg. Y. T lần lượt là 6:1:3:2 và số nguyên tử cacbon trong mỗi chất không nhiều hơn 6. B. C2H4O2.32g.59 Saccarozơ đều tác dụng được với nhóm chất nào sau đây ? (1) H2/Ni. Công thức phân tử của X. (2). B. lượng glucozơ tổng hợp được bao nhiêu? A.57 Lên men a g glucozơ. B. C3H6O3. T. Với một ngày nắng (từ 6h00 – 17h00) diện tích lá xanh là 1m2. (2) Cu(OH)2. C.09J năng lượng mặt trời. Câu 2. C. C2H4O2. C. Khi oxi hoá hoàn toàn từng chất đều cho cùng kết quả: Cứ tạo ra 4. 88. D. (4). 15. CH2O. Khối lượng ancol etylic thu được bằng bao nhiêu? A. B. 4. B. ancol bị hao hụt 5%. cho toàn bộ lượng CO2 sinh ra hấp thụ vào dung dịch nước vôi trong tạo thành 10g kết tủa. mỗi cm2 lá xanh nhận được khoảng 2. C3H6O3. C6H12O6. C.32g. Biết hiệu suất của quá trình lên men là 90%. T lần lượt là A. to. C2H4O2. D.37kg. Z.8g H2O và cần một thể tích oxi vừa đúng bằng thể tích CO2 thu được. 6CO2 + 6H2O C6H12O6 + 6O2 Nếu trong một phút.60 Một cacbohiđrat (Z) có các phản ứng diễn ra theo sơ đồ chuyển hoá sau Cu(OH)2/NaOH to dung dịch xanh lam kết tủa đỏ gạch Z Vậy Z không thể là A. C6H12O6. 6. 4. (1). Trong quá trình chế biến. Y. 5. 90. Y.

C12H22O11 C6H12O6 CH3COOH CH3COOC2H5 CH3COONa B. Câu 2.28g CO2 và 1. Biết rằng.39 lít. Công thức của E. Q. 5031kg. D. B. D. C6H12O6. B. Giá trị m cần dùng là bao nhiêu ? A. 15. Xenlulozơ và tinh bột đều có phân tử khối rất lớn.0.01 mol một cacbohiđrat (X). X. X.65 Chọn câu đúng trong các câu sau: A. Nếu muốn điều chế một tấn ancol etylic.125:1.C. B. C đều sai.62 Cho m g tinh bột lên men để sản xuất ancol etylic. thu được 5. Y.70kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric 96% (D=1. A. B. 24. (C6H10O5)n. 14. C12H24O12. D.98g H2O. Câu 2. Z là hợp chất hữu cơ.0. C. C. nhưng phân tử khối của xenlulozơ lớn hơn nhiều so với tinh bột. Câu 2. (C6H10O5)n C6H12O6 CH3CHO CH3COOH CH3COOC2H5 C. Xenlulozơ có phân tử khối nhỏ hơn tinh bột. Xenlulozơ và tinh bột có phân tử khối gần bằng nhau. Câu 2. được đều chế từ xenlulozơ và axit nitric.64 Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh. mỗi mũi tên biểu thị một phản ứng hoá học).52 g/ml) cần dùng là bao nhiêu ? A. toàn bộ lượng CO2 sinh ra cho qua dung dịch Ca(OH)2 dư. B.61 Đốt cháy hoàn toàn 0. tỉ lệ khối lượng H và O trong X là 0.5. 950. Q.00 lít. Xenlulozơ và tinh bột có phân tử khối nhỏ. mantozơ. Z phù hợp với sơ đồ sau là Q X E CO2 C2H5OH Z Y E Q X Y Z A. 15. 949.2. D. C. Y.39 lít. 940. C12H22O11. D. 1000. B. Biết hiệu suất mỗi giai đoạn lên men là 80%. C. Câu 2.66 Để sản xuất ancol etylic người ta dùng nguyên liệu là mùn cưa và vỏ bào từ gỗ chứa 50% xenlulozơ.0g kết tủa. Câu 2.63 Cho sơ đồ chuyển đổi sau (E. 30 . thu được 750. (C6H10O5)n C6H12O6 CH3CHO CH3COONH4 CH3COOH D. fructozơ. Muốn điều chế 29. hiệu suất quá trình là 70% thì khối lượng nguyên liệu xấp xỉ A. 5000kg.39 lít. Công thức phân tử của X là A.

Muốn tạo ra 500g tinh bột thì cần bao nhiêu lít không khí (đktc) để cung cấp đủ lượng CO2 cho phản ứng quang hợp? Giả thiết hiệu suất quá trình là 100% A. D. (C6H10O5)n. 1218. C. Khối lượng ancol thu được là A.6g CH3COOH.25 lít. xenlulozơ điaxetat và 6. 389. C. C12H22O11.4104g X thu được thể tích khí đúng bằng thể tích 0. 398. 1382600 lít. 400kg. C. thu được 11. Câu 2. 77% và 23%. D. 76.72 Đốt cháy hoàn toàn 0.16%. đồng thời khối lượng dung dịch tăng 0. Câu 2. Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A.84% và 23.7 lít. D. Công thức phân tử của X là A. Đun nóng dung dịch A lại được 0. D. biết khối lượng riêng của ancol etylic là 0. C. 1246. tất cả đều sai. B.1g kết tủa nữa. 390kg.16%. C18H36O18. 1382666. C6H12O6. C.67 Chọn phát biểu sai: A. 31 . C. B.0855g một cacbohiđrat X.0552g hỗn hợp hơi ancol etylic và axit fomic đo trong cùng điều kiện.1g hỗn hợp X gồm xenlulozơ triaxetat. Câu 2.70 Pha loãng 389. D. to. hiệu suất của mỗi quá trình lên men là 85%. Tinh bột có phản ứng màu với iot do tinh bột có cấu tạo mạch ở dạng xoắn có lỗ rỗng. 1206.8kg.125 lít.68 Cho xenlulozơ phản ứng với anhiđrit axetic (xúc tác H2SO4 đặc). D. B. tất cả đều sai.25 lít. Có thể phân biệt glucozơ và saccarozơ bằng phản ứng với Cu(OH)2 /OH-. B.7 lít. 1402666.8 g/cm3. Biết khi làm bay hơi 0.1g kết tủa và dung dịch A. Câu 2. 70% và 30%.71 Khí cacbonic chiếm tỉ lệ 0. B.8kg ancol etylic thành ancol 40o.0815g.84% và 22.8kg. Câu 2. Câu 2.03% thể tích không khí. 6200kg. Thể tích dung dịch ancol thu được là A. Tinh bột và xenlulozơ không thể hiện tính khử vì trong phân tử không có nhóm chức anđehit (–CH=O).C. Có thể phân biệt mantozơ và đường nho bằng vị giác. D. 5100kg. 77. B. Sản phẩm được dẫn vào nước vôi trong thu được 0.69 Lên men 1 tấn tinh bột chứa 5% tạp chất trơ thành ancol etylic.

50 C 2.37 C 2.26 B 2.5 C 2.33 C 2.64 A 2.44 C 2.41 B 2.57 D 2. sẽ làm cho tính bazơ tăng lên.72 A 2.71 A 2.31 A 2.9 B 2.67 A 2.16 B 2.19 C 2.11 B 2.40 C 2.6 C 2.69 C 2..56 B 2.45 A 2. NH CH COOH n R amin α .1 A 2.3 C 2.53 C 2.10 D 2.60 B 2.18 B 2.70 C CHƯƠNG III.68 B 2.30 A 2.amino axit peptit 2.47 B 2.27 D 2.4 D 2.52 B 2. R CH COOH.66 A 2.12 C 2.61 C 2.38 D 2.17 D 2.48 B 2.39 C 2.7 A 2.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG II 2.49 D 2.42 D 2.63 B 2.21 A 2.43 A 2.23 C 2.15 A 2.34 C 2.32 B 2.25 B 2.65 D 2.59 B 2. Tính chất a) Tính chất của nhóm NH2 + Tính bazơ R NH2 + H2O [R NH3]+ + OH- Tác dụng với axit cho muối: R NH2 + HCl [R NH3]+Cl- Lưu ý: Mọi yếu tố làm tăng mật độ electron ở nguyên tử nitơ trong phân tử amin trung hoà nói chung đều làm tăng tính bazơ (trừ trường hợp chịu ảnh hưởng của hiệu ứng che chắn không gian và khả năng solvat hoá trong dung môi nước).2 B 2.24 D 2.62 B 2.  Những nhóm đẩy electron.29 B 2.28 C 2.51 B 2.8 C 2. AMIN – AMINO AXIT – PROTEIN A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.54 D 2.14 A 2. NH2 H2N CH CO 1 R .46 C 2. 32 .58 C 2.13 A 2..35 A 2.36 B 2.20 D 2.55 A 2. chẳng hạn các gốc ankyl có hiệu ứng +I. Cấu tạo phân tử: Các nhóm đặc trưng R NH2.22 B 2.

− Amin bậc 1 • Amin béo bậc 1 Tác dụng với axit nitrơ tạo ancol tương ứng và giải phóng khí nitơ (hiện tượng sủi bọt khí).hay ArN2Cl + NaNO2 + HCl  Thí dụ: C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O (1*)    (anilin) (phenylđiazoni clorua) Đun nóng dung dịch muối điazoni: +  t0 C 6 H N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl (2*) →  5   Lưu ý: Trong công thức phân tử không cần viết các phản ứng (1* và 2*). người ta có thể phân biệt được chúng. Ngược lại nhóm phenyl có hiệu ứng –C hút electron. sẽ làm tính bazơ yếu đi. 33 . HCl R NH2 + HONO R OH + N2 + H2O NaNO + HCl 2 Thí dụ: C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  • Amin thơm bậc 1 Tác dụng với axit nitrơ trong môi trường axit ở nhiệt độ thấp tạo muối điazoni. ta có thể viết: (CH3)2NH > CH3NH2 > NH3 > C6H5NH2 > (C6H5)2NH > (C6H5)3N. nên phải dùng hỗn hợp (NaNO2 + HCl). đồng thời trong phân tử xuất hiện hiệu ứng liên hợp p .  Về nguyên tắc. Thực tế HNO2 không bền. chỉ cần nêu hiện tượng. ngược lại càng có nhiều nhóm gây hiệu ứng –C tính bazơ sẽ càng giảm. do đó khả năng nhận proton của anilin giảm. làm giảm mật độ điện tích âm ở nguyên tử N. Vì vậy các amin mạch hở có tính bazơ mạnh hơn (dung dịch trong nước của chúng có thể làm xanh giấy quỳ) so với amin thơm (Anilin không làm xanh giấy quỳ). + Tác dụng với HNO2 Dựa vào khả năng phản ứng khác nhau đối với HNO 2 của các amin mỗi bậc.π theo chiều chuyển dịch electron hướng vào vòng benzen. đun nóng dung dịch muối điazoni sẽ tạo ra phenol và giải phóng nitơ. càng thay thế nhiều nguyên tử H trong phân tử NH3 bằng những nhóm có hiệu ứng đẩy electron +I tính bazơ càng tăng. Điều này được giải thích là: Amin thơm chứa vòng benzen hút electron. ArNH2 + HNO2 + HCl 0-5oC -2H2O ArN2+Cl. Vì vậy.

và ω .. + H2N 4 COOH + nH2O hay2enzim H SO CH2 Rn COOH + Phản ứng màu với Cu(OH)2 cho dung dịch màu xanh tím (dùng để nhận biết protein).amino axit tạo poliamit: NH [CH2]5 CO n + nH2O d) Protein có phản ứng của nhóm peptit CO-NH + Phản ứng thuỷ phân: H 2N CH 1 R H2 N nH2N [CH2]5 COOH to CO HN CH R1 CH CO HN CH R2 CH CO ..− Amin bậc 2 Các amin bậc 2 thuộc dãy thơm hay dãy béo đều dễ dàng phản ứng với HNO2 tạo thành nitrozamin (Nitroso) màu vàng: R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (Nitroso – màu vàng) − Amin bậc 3: Không phản ứng (không có hiện tượng gì). e) Anilin và nhiều protein có phản ứng thế dễ dàng nguyên tử H của vòng benzen NH2 NH2 Br Br (trắng) Br (dd) + 3Br2(dd) + 3HBr(dd) 34 . + Tác dụng với dẫn xuất halogen: R NH2 + CH3I R NHCH3 + HI b) Amino axit có tính chất của nhóm COOH Tính axit RCH(NH2)COOH + NaOH RCH(NH2)COONa + H2O Phản ứng este hoá: 2 4 RCH(NH2)COOH + R1OH RCH(NH2)COOR1 + H2O c) Amino axit có phản ứng giữa nhóm COOH và nhóm NH2 Tạo muối nội (ion lưỡng cực): H SO H3N+ CH COO- H2N CH COOH R R Phản ứng trùng ngưng của các ε .. NH CH R3 CH R2 COOH + H2N R3 COOH + H2N Rn COOH+ ..

C6H5NH2 + HCl  C6H5NH3Cl → phenylamoni clorua 8.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP NaNO + HCl 2 1. C6H5–NO2 + 6 [ H ]  → Cũng có thể viết: 16. R–NO2 + 6 [ H ]  R–NH2 + 2H2O → Fe + HCl C6H5–NH2 + 2H2O 15. C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O    +   3. C6H5NH2 + CH3COOH  CH3COONH3C6H5 → 10. C6H5NH2 + H2SO4  C6H5NH3HSO4 → 11. CH3NH3Cl + NaOH  CH3NH2 + NaCl + H2O → 9. NH2 Br Br (dd) + 3Br2(dd) Br Fe + HCl + 3HBr(dd) 14. P 17. 2C6H5NH2 + H2SO4  [C6H5NH3]2SO4 → 12. 3R – OH + NH3  (R)3N + 3H2O → C2H5OH → 20. C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  + NaNO + HCl  2 2. CH3 – NH2 + H2O ← CH3 – NH3+ + OH 6. R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (nitroso – màu vàng)  → 5. H2N + H2SO4 180oC H2N NH2 SO3H + H2O 13. 2R – OH + NH3  (R)2NH + 2H2O → Al 2O3. R – Cl + NH3  R – NH2 + HCl 1000C 21. R – OH + NH3  R–NH2 + H2O → Al 2O3. C 6 H 5 N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl →   t0 4. P 18. CH3NH2 + H–COOH  H–COONH3CH3 → metylamoni fomiat 7. P 19. R–NO2 + 6HCl + 3Fe  R–NH2 + 3FeCl2 + 2H2O → Al 2O3. R – NH2 + HCl  R – NH3Cl → 35 .B .

thêm vài giọt dung dịch H2SO4. B. phenylamin < etylamin < amoniac. R – Cl + NH3  R – NH3Cl 1000C 23.1 Sự sắp xếp theo trật tự tăng dần tính bazơ giữa etylamin. H2N–R–COOH + HONO  HO–R–COOH + N2↑ + H2O → 39. thêm vài giọt dung dịch Na2CO3 D. [H3N+–R–COOR’]Cl. B. p . Câu 3. p NH[CH2]5CO n + nH2O HN[CH2]6CO n + nH2O 40.+ NH3  H2N–R–COOR’ + NH4Cl → 35. C. H2NR(COOH)a + aNaOH  H2N(COONa)a + aH2O → 28. H2N–R–COOH + HCl  ClH3N–R–COOH → 36. H2N–R–COOH + R’–OH ←  H2N–R–COOR’ + H2O  HCl   → 33. phenylamin và amoniac đúng là A. C. R – NH3Cl + NaOH  R – NH2 + NaCl + H2O → C2H5OH → 24. D.BÀI TẬP TRẮC NGHIỆM I. 2R – Cl + NH3  (R)2NH + 2HCl 1000 C C2H5OH → 25. H2N–R–COOH + Na  H2N–R–COONa + H2 → 2 30. ClH3N–R–COOH + 2NaOH  H2N–R–COONa + NaCl + H2O → HCl 38.C2H5OH → 22. Đưa đầu đũa thuỷ tinh đã nhúng vào dung dịch HCl đậm đặc lên phía trên miệng lọ đựng dung dịch CH3NH2. 2(H2N)bR(COOH)a + aBa(OH)2  [(H2N)bR(COO)a]2Baa + 2aH2O → 1 29. to. 36 xt.+ H+ ← H3N+–R – COO  27.BÀI TẬP CƠ BẢN Câu 3. 2(H2N)bR(COOH)a + bH2SO4  [(H3N)bR(COOH)a]2(SO4)b → 37. 2(H2N)bR(COOH)a + aNa2O  2(H2N)b R(COONa)a + aH2O → HCl  → 32. phenylamin < amoniac < etylamin. 41. H2N–R–COOH + R’–OH + HCl ←  [H3N+–R–COOR’]Cl. etylamin < amoniac < phenylamin. to. CH3CH(Br)COOH + 3NH3  CH3CH(NH2)COONH4 + NH4Br → C. nH2N[CH2]5COOH nH2N[CH2]6COOH xt. nhận biết bằng mùi. amoniac < etylamin < phenylamin.2 Cách thuận lợi nhất để nhận biết lọ đựng dung dịch CH3NH2 là A. H2N–R–COOH ← H2N–R–COO.+ H2O  34. (H2N)b R (COOH)a + aNa  (H2N)bR(COONa)a + → a 2 H2 31. 3R – Cl + NH3  (R)3N + 3HCl 1000 C  →  → 26.

C. 4. 2. CH2(NH2)COOH. thì số mắt xích alanin trong phân tử A là bao nhiêu? A. chỉ cần dùng thuốc thử nào sau đây? A.5. 2.9 Thuốc thử nào dưới đây dùng để phân biệt các dung dịch glucozơ.2g CO2. AgNO3/NH3. hiđroxyl metylen khử oxi hoá cation anion D. CH(NH2)2COOH. amin cacbonyl oxi hoá Axit phân tử phân tử ion lưỡng B. B. N) và ancol metylic. 6. Câu 3. O. 189. 5. amino cacboxyl bazơ Axit phân tử cực C. D. etanol và lòng trắng trứng? A. Câu 3. xeton metyl axit lưỡng tính nguyên tử cation Câu 3. B. D. C. 192. CH3OH/HCl. D. C. 3.9g este A thu được 13. Amino axit thường tồn tại dưới dạng …(5)…cân bằng với dạng …(6)… (1) (2) (3) (4) (5) (6) A. 3. B. B. CH3CH2COOH và CH3[CH2]3NH2. Để nhận ra dung dịch của các hợp chất trên.8 Este A được điều chế từ amino axit B (chỉ chứa C.12 lít N2 (đktc).000. HCl. B. 190. CH(NH2)2COOCH3. CH(NH2)2COOH. 4.3 Số lượng đồng phân ứng với công thức phân tử C3H9N là A. NaOH.4 Số lượng đồng phân amin bậc 2 ứng với công thức phân tử C4H11N là A. 5. C. Câu 3. Tỉ khối hơi của A so với H2 là 44.Câu 3. H. 37 . B. D. CH2(NH2)COOCH3. quỳ tím. 191. 3. C.10 Khi thuỷ phân 500g protein A thu được 170g alanin.7 Có 3 chất hữu cơ gồm NH2CH2COOH. D. C. 5. D.3g H2O và 1. Cu(OH)2. CH(NH2)2COOCH3.6 Amino axit là một hợp chất hữu cơ tạp chức. trong phân tử của nó vừa có nhóm …(1)…vừa có nhóm …(2)…nên vừa có tính chất …(3)…vừa có tính chất … (4)…. glixerol. 4. Đốt cháy hoàn toàn 8. HNO3. Công thức cấu tạo thu gọn của A. B lần lượt là A. D. Câu 3. Câu 3. CH2(NH2)COOH. Câu 3. Nếu phân tử khối của A là 50. C. B.5 Số lượng đồng phân amin có chứa vòng benzen ứng với công thức phân tử C7H9N là A. 2. CH2(NH2)COOCH3. NaOH.

Câu 3.11 Chất nào sau đây không có phản ứng với dung dịch C2H5NH2 trong H2O? A. HCl. B. H2SO4. C. NaOH. D. quỳ tím. Câu 3.12 Glixin phản ứng được với tất cả các chất trong nhóm chất nào sau đây (điều kiện phản ứng xem như có đủ): A. Quỳ tím , HCl , NH3 , C2H5OH. B. NaOH, HCl, C2H5OH, CH2 COOH.
NH2

C. Phenoltalein , HCl , C2H5OH , Na. D. Na , NaOH , Br2 , C2H5OH. Câu 3.13 Tìm công thức cấu tạo của hợp chất hữu cơ X chứa 32% C; 6,667% H; 42,667% O; 18,666% N. Biết phân tử X có một nguyên tử N và X có khả năng tham gia phản ứng trùng ngưng. A. H2NCH2COOH. B. C2H5NO2. C. HCOONH3CH3. D. CH3COONH4. Câu 3.14 Hợp chất hữu cơ A có công thức phân tử là C3H7O2N, A tác dụng được với dung dịch NaOH, dung dịch HCl và làm mất màu dung dịch brom. Công thức cấu tạo đúng của A là A. CH3CH(NH2)COOH. B. CH2=CHCOONH4. C. HCOOCH2CH2NH2. D. H2NCH2CH2COOH. Câu 3.15 Cho các chất: etylen glicol (1), axit aminoaxetic (2), axit oxalic (3), axit acrylic (4). Những chất có thể tham gia phản ứng trùng ngưng là A. (1), (2), (3). B. (1), (2). C. Chỉ có (2). D. Cả bốn chất. Câu 3.16 Có các dung dịch chứa trong các lọ mất nhãn sau: Lòng trắng trứng, hồ tinh bột, glixerol. Thuốc thử có thể dùng để phân biệt các dung dịch trên là A. Cu(OH)2. B. I2. C. AgNO3. D. cả A, B đều đúng. Câu 3.17 Số đồng phân của hợp chất hữu cơ thơm có công thức phân tử C7H7NO2 là A. 7. B. 6. C. 5. D. 8. Câu 3.18 Số đồng phân của các chất có công thức phân tử C4H10O (1), C4H9Cl (2), C4H10 (3), C4H11N (4) theo chiều tăng dần là A. (3), (2), (1), (4). B. (4), (1), (2), (3). C. (2), (4), (1), (3). D. (4), (3), (2), (1). 38

Câu 3.19 Cho sơ đồ phản ứng: NaOH C9H17O4N (X)  C5H7O4NNa2 (Y) + 2C2H5OH. → Công thức cấu tạo thu gọn của X, Y lần lượt là A. C2H5OOCCH2CH(NH2)CH2COOC2H5, NaOOCCH2CH(NH2)CH2COONa. B. CH3OOCCH2CH(NH2)CH2COOC3H7, NaOOCCH2CH(NH2)CH2COONa. C. HOOCCH2CH(NH2)CH2COOC4H9, NaOOCCH2CH(NH2)CH2COONa. D. CH3OOCCH2CH(NH2)CH2COOCH(CH3)2, NaOOCCH2CH(NH2)CH2COONa. Câu 3.20 Chọn phát biểu đúng về hợp chất tạp chức: A. Hợp chất hữu cơ có từ hai loại nhóm chức trở lên. B. Hợp chất hữu cơ có từ hai nhóm chức trở lên. C. Hợp chất hữu cơ có nhiều nhóm chức. D. Hợp chất hữu cơ có hai nhóm chức. Câu 3.21 Trong sơ đồ sau, công thức cấu tạo thu gọn phù hợp của A, B, C, D, E lần lượt là
2 2 2 2 + NH 3 + dd NaOH → → → → Etan  A  B  C  D  E  → → 1:1 Cu 1:1 Mn2+ Glixin. A. C2H5Cl, C2H5OH , CH3CHO, CH3COOH , CH3COOCl. B. C2H5Cl, C2H5OH , CH3CHO, CH3COOH, CH2ClCOOH. C. C2H5Cl, C2H5OH , CH3 COCH3, CH3COOH, CH2ClCOOH. D. C2H5Cl, C2H5OH , CH3COOH, CH3COCH3, CH2ClCOOH. Câu 3.22 Cho 3 chất hữu cơ: NH2CH2COOH (1); CH3CH2CH2CH2NH2 (2); CH3CH2COOH (3). Nhiệt độ nóng chảy của chúng được xếp theo trình tự giảm dần là A. (2) < (3) < (1). B. (1) > (3) > (2). C. (3) < (2) < (1). D. (2) > (1) > (3). Câu 3.23 Hợp chất đa chức và hợp chất tạp chức giống nhau ở chỗ A. đều là hợp chất có nhiều nhóm chức. B. đều là hợp chất chứa các nhóm chức giống nhau. C. phân tử luôn có liên kết π. D. mạch cacbon trong phân tử có liên kết π . Câu 3.24 X là một axit α -monoamino monocacboxylic, có tỉ khối hơi so với không khí là 3,07. X là A. glixin. B. alanin. C. axit α - aminobutiric. D. axit glutamic.

+ Cl

+O

+O

+ Cl

39

Câu 3.25 Khi đun nóng chất béo với dung dịch kiềm “....”
A. luôn thu được glixerol và phản ứng xảy ra thuận nghịch. B. luôn thu được glixerol, phản ứng xảy ra nhanh hơn và một chiều. C. luôn thu được muối của axit béo và phản ứng xảy ra thuận nghịch. D. luôn thu được xà phòng, phản ứng xảy ra chậm hơn. Chọn một phương án trong số các phương án trên để điền vào chỗ trống trong câu sao cho đúng ý nghĩa hoá học.

Câu 3.26 Amino axit là
A. hợp chất hữu cơ đa chức, có chứa 2 nhóm chức COOH và NH2. B. hợp chất hữu cơ đa chức, có chứa 2 loại nhóm chức COOH và NH2. C. hợp chất hữu cơ tạp chức, có chứa 2 nhóm chức COOH và NH2. D. hợp chất hữu cơ tạp chức, có chứa 2 loại nhóm chức COOH và NH2.

Câu 3.27 Công thức tổng quát của amino axit là A. RCH(NH2)COOH. B. R(NH2)x(COOH)y. C. R(NH2)(COOH). D. RCH(NH3Cl)COOH. Câu 3.28 Chọn câu phát biểu sai: A. Amino axit là hợp chất hữu cơ tạp chức. B. Tính bazơ của C6H5NH2 yếu hơn NH3. C. Công thức tổng quát của amin no, mạch hở, đơn chức là CnH2n + 3N (n ≥ 1). D. Dung dịch của các amino axit đều làm quỳ tím chuyển sang màu đỏ. Câu 3.29 Hai phương trình phản ứng hoá học sau, chứng minh được nhận định rằng: H2NCH2COOH + NaOH → H2NCH2COONa + H2O. H2NCH2COOH + HCl → HOOCCH2NH3Cl. A. Glixin là một axit. B. Glixin là một bazơ. C. Glixin là một chất lưỡng tính. D. Glixin là một chất trung tính. Câu 3.30 Hợp chất hữu cơ X có công thức cấu tạo thu gọn: HOOCCH2CH2CH(NH2)COOH. Tên gọi của X là A. glixin. B. alanin. C. axit ađipic. D. axit glutamic. Câu 3.31 Cho sơ đồ chuyển hoá sau:
X
H2SO4 - Na2SO4

Y

C2H5OH, H2SO4, to - Na2SO4

CH3

CH

COO

C2H5

NH3HSO4
CH COONa, CH3 CH COOH.

Công thức cấu tạo phù hợp của X, Y lần lượt là
A. CH3 C. CH3 CH COONa, CH3 CH COOH. B. CH3 D. CH3 NH2 CH COONa, CH3 NH2 NH2 CH COOH. NH3HSO4 NH3HSO4 CH COOH, CH3 NH3HSO4 NH2 CH COOH. NH2

Câu 3.32 Phương trình phản ứng hoá học sau chứng minh được rằng: H2NCH2COOH + C2H5OH 40
H+, to

H2NCH2COOC2H5 + H2O.

Một số protein bị đông tụ khi đun nóng. Câu 3. NaOOC – CH2 – CH2 – CH(NH2) – COONa.35 Công thức cấu tạo thu gọn của axit 2 – amino – 3 – phenylpropanoic là A. C6H5 NH2 D. tất cả A. D. O . không xác định được. Câu 3. H . CH3 CH2 CH NH2 C6H5 COOH. protein bị thuỷ phân tạo ra các amino axit. Phân tử khối của một amin đơn chức luôn là số chẵn. D. C. có công thức cấu tạo thu gọn là A. CH2 CH COOH.A. HOOC – CH2 – CH2 – CH(NH2) – COOH. Amino axit tham gia phản ứng trùng ngưng. Câu 3. Hiđroclorua và amoniac. CH3COOK thì số lượng kết tủa thu được là A. B. C. C.34 Muối của axit glutamic dùng làm bột ngọt (còn gọi là mì chính). triphenylamin. CuSO4. axit glutamic. D.37 Để điều chế glixin theo sơ đồ: Axit axetic → axit cloaxetic → glixin.33 Điều khẳng định nào sau đây là sai ? A. Zn(NO3)2.225. C. B. D. B. B. 41 . D. điphenylamin. Câu 3. alanin. D. C. Protein có trong mọi bộ phận của cơ thể động vật là hợp chất hữu cơ đa chức. B. CH3 CH2 CH C6H5 NH2 COOH. CH2 CH COOH. Amin đơn chức đều chứa một số lẻ nguyên tử H trong phân tử. Glixin có nhóm COOH.38 Tính bazơ của amin nào trong số các amin sau đây là yếu nhất ? A. Glixin có nhóm NH2. glixin. HOOC – CH2 – CH2 – CH(NH2) – COONH4. H nối với O của axit linh động hơn ancol. B.39 Sản phẩm của phản ứng este hoá giữa amino axit X và metanol thu được este có tỉ khối hơi so với propin bằng 2. Ở nhiệt độ thường dưới tác dụng của men. B. B. Clo và amoniac. C. N. Tên gọi của X là A. NH2 C6H5 C.36 Chọn câu phát biểu sai: A. H nối với O của ancol linh động hơn axit. 0. C đều sai. 1. D.40 Cho dung dịch metylamin đến dư vào các dung dịch sau: FeCl3. B. anilin. Amino axit có tính lưỡng tính. Câu 3. Câu 3. Các protein đều chứa các nguyên tố C . Câu 3. B. Axit clohiđric và muối amoni. C. NaOOC – CH2 – CH2 – CH(NH2) – COOH. Câu 3. Clo và amin. Cần dùng thêm các chất phản ứng nào sau đây (không kể xúc tác): A.

C. H2N[CH2]4 CHO. không làm mất màu dung dịch Br2.52g X tác dụng vừa đủ với 200ml dung dịch HCl thu được 2. Tính bazơ của các amin đều mạnh hơn NH3. C. Metylamin có tính bazơ mạnh hơn anilin. 3. D. Câu 3. 0. D. B. B. Công thức phân tử của hai amin là A. Sự đông tụ của protit. cacbon. khi tác dụng với dung dịch NaOH chỉ thu được sản phẩm hữu cơ duy nhất.45 Hỗn hợp (X) gồm hai amin đơn chức. B.47 Hợp chất hữu cơ (X) có công thức phân tử CxHyNO có khối lượng phân tử bằng 113u. Câu 3. CH2 CH2 NH O C. 0.96g muối.46 Cho 3. D. Tổng số mol hai amin và nồng độ mol/l của dung dịch HCl là A. C. Câu 3. D. C. Công thức tổng quát của amin no. CH3COOAg. Có phản ứng hoá học của NaCl với chất có trong nước lọc khi xay (giã) cua. 0. D. B. B. C3H9N và C4H11N. số mol hai amin bằng nhau.1M. (CH3COO)2Pb. D. CH3 CH2 CH2 CH2 C NH2. Các amin đều kết hợp với proton. thì số lượng kết tủa thu được là A. đimetylamin. đietylmetylamin tác dụng vừa đủ với 50ml dung dịch HCl 1M.04 mol và 0. kết quả khác. không đủ dữ kiện để tính. C. 2.43 Khi nấu canh cua. metylamin.42 Cho dung dịch metylamin đến dư vào các dung dịch sau: (CH3COO)2Cu.C. Tất cả các nguyên nhân nêu ở A.2M. kết quả khác.18g. Câu 3. riêu cua nổi lên được giải thích là do: A. D. C = O. C. B. Fe + dung dịch HCl. kết quả khác.06 mol và 0. Các chất bẩn trong cua chưa được làm sạch hết.44 Điều chế anilin bằng cách khử nitrobenzen thì dùng chất khử nào sau đây ? A. Câu 3. Câu 3. B. 20. Câu 3. X còn có khả năng tham gia phản ứng trùng hợp. C.123g. 21.41 Cho 15g hỗn hợp các amin gồm anilin. C3H9N và C2H7N. Biết trong hỗn hợp. D. 2.48 Hãy chỉ ra câu sai trong các câu sau: A.04g hỗn hợp Y gồm hai amin đơn chức. 16. D. Khối lượng sản phẩm thu được có giá trị là A.825g. khí H2. Công thức cấu tạo của X là CH2 CH2 CH2 A. B. 1. CH5N và C2H7N. X có đặc điểm cấu tạo và các tính chất sau: phân tử có mạch cacbon không phân nhánh. 42 . 3. Ngoài ra.98g muối. B. 0. NH3. Câu 3. Cho 1.3M. no. C. (CH3COO)2Mg. mạch hở tác dụng vừa đủ với dung dịch HCl thu được 5. mạch hở là CnH2n+2+kNk.02 mol và 0.

C2H5NH2 và C4H9NH2. C2H7N. hơi H2O và 336 cm3 khí N2 (đktc).6g khí cacbonic. 12. B. 43 . CH3-CH2-CH2-NH2. C3H7NH2 và C4H9NH2. Đốt cháy hoàn toàn 3. B. C4H9N. CH3 Câu 3.51 Đốt cháy hoàn toàn m g một amin A bằng lượng không khí vừa đủ. C3H9N.49 Đốt cháy hoàn toàn hỗn hợp hai amin no. kết quả khác. D. đimetylamin. B lần lượt là NH2 NH2 A. 8. C5H11N.44 lít khí nitơ. C2H7N.50 Có hai amin bậc một gồm A (đồng đẳng của anilin) và B (đồng đẳng của metylamin). etylamin hoặc đimetylamin. thu được 2. 7.4 lít N2 (các V đo ở đktc). C. C5H13N. Công thức phân tử của hai amin lần lượt là A. C4H9-NH2. C. 9. 9. Câu 3.Câu 3. C3H9N và C4H11N. A và C đúng. etylamin.54 Dung dịch X chứa HCl và H2SO4 có pH = 2. CH3-C6H4-NH2 . B. D. C4H11N. C4H11N. D. C4H11N. Giả thiết không khí chỉ gồm nitơ và oxi. C2H7N. etylamin. người ta thu được 10. B. B. là đồng đẳng liên tiếp. Khi đốt cháy amin B thấy VCO2 : VH2O = 2 : 3 . CH3-CH-NH2. Công thức cấu tạo của A. Câu 3. II.24 lít khí CO2 (đktc) và 3. C3H9N. CH3N. Để trung hoà hoàn toàn 0. C5H13N.6g hơi nước và 69. C.53 Cho 20g hỗn hợp gồm 3 amin no.125g H2O. D.4 lít khí CO2 và 1.59g hỗn hợp 2 amin no. Giá trị m và tên gọi của amin là A.BÀI TẬP NÂNG CAO Câu 3. C. cô cạn dung dịch thu được 31.21g amin A sinh ra khí CO 2. thu được 17. đơn chức. C. bậc I (có số nguyên tử C nhỏ hơn hoặc bằng 4) phải dùng một lít dung dịch X. Câu 3. CH3 . CH3NH2 và C4H9NH2. đơn chức. Nếu 3 amin trên được trộn theo tỉ lệ số mol 1:10:5 và thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là A. C3H9N. CH3-C6H4-NH2 . CH3 . CH3-CH2-CH2-NH2.6g H2O. tác dụng vừa đủ với dung dịch HCl. C3H9N. CH5N và C2H7N. 8. C. C3H7N.52 Khi đốt cháy hoàn toàn một amin đơn chất X. D. D.68g hỗn hợp muối. B. Công thức phân tử của 2 amin là A. X có công thức phân tử là A. Biết rằng tên của A có tiếp đầu ngữ “para”. đơn chức là đồng đẳng liên tiếp của nhau. trong đó nitơ chiếm 80% thể tích (các V đo ở đktc). C2H7N và C3H9N.

Công thức cấu tạo của A là A. A và B đều sai. D.4 ≤ X < 1.55 Khi đốt cháy mỗi đồng đẳng của ankylamin. Mặt khác. D. 0. Câu 3. A tác dụng với kiềm tạo thành NH3.. Biết X là amin bậc I. Vì có nhóm …(6)… và nhóm …(7)… trong phân tử. A và B đều đúng. B. C. C4H9NO2. H2NC3H6COOH.5. 0.75 < X ≤ 1. C4H9NO2. B.58 Một hợp chất hữu cơ A mạch thẳng có công thức phân tử là C3H10O2N2. thì tỉ lệ thể tích X = VCO2 : VH2O biến đổi như thế nào theo số lượng nguyên tử cacbon tăng dần trong phân tử ? A. B.8 ≤ X < 2. công thức cấu tạo thu gọn có thể có của X là A. nguyên tử hiđro khi thay thế amino cacboxyl D. C đều đúng. D. A tác dụng với dung dịch axit tạo thành muối amin bậc I. Câu 3. H2NC3H6COOH. Câu 3. C. D. B. C3H5COONH4. amino nguyên tử hiđro luỡng tính luỡng tính luỡng tính C. khi thay thế khi thay thế khi thay thế nguy ên tử hiđr o (2) nguyên tử hiđro cacboxyl (3) một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon (4) luỡng tính tạp chức tạp chức tạp chức (5) đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino (6) tạp chức (7) cacboxyl (8) amino (9) trùng ngưng trùng ngưng trùng ngưng trùng ngưng B. Công thức cấu tạo thu gọn của A. 0. H2NC3H6COOH.2. Câu 3. 0.08g CO2.59 Những từ hay cụm từ thích hợp với những chỗ trống ở các câu trong đoạn văn sau là Amin là những hợp chất hữu cơ được tạo thành …(1)…một hay nhiều …(2)… trong phân tử amoniac bởi …(3)…. H2NC3H6COOH.4 ≤ X < 1. C có cùng công thức phân tử C 4H9O2N. C3H5COONH4. Biết A tác dụng với cả HCl và Na2O. C. CH3CH(NH2)COONH4.1 mol X cần 600ml dung dịch HCl 0.99g H2O và 336ml N2 (đktc). B” tác dụng với NaOH tạo ra B’. 0. B tác dụng với H mới sinh tạo ra B’.. C3H5COONH4. B. cả A. C4H9NO2. H2NCH2C6H3(NH2)2.Câu 3. B. amino cacboxyl 44 .5M. C4H9NO2. H2NCH2CH2COONH4.56 Đốt cháy hoàn toàn một amin thơm X thu được 3. B’ tác dụng với HCl tạo ra B”.57 Các chất A. C tác dụng với NaOH tạo ra muối và NH 3. C lần lượt là A. Để trung hoà 0. amino axit biểu hiện tính chất …(8)…và tính chất đặc biệt là phản ứng …(9)… (1) A. Amino axit là loại hợp chất hữu cơ . CH3NHC6H3(NH2)2. CH3C6H2(NH2)3. C3H5COONH4. C.(4)…mà phân tử chứa …(5)….

Công thức cấu tạo thu gọn của X là A. CH3CH(NH2)CH2COOH. CH3COONH4 hoặc HCOONH3CH3. B. 45 . Mặt khác.3oC. X là hợp chất nào sau đây? A. B.5 mol N2. cả A. Biết A có cấu tạo mạch không phân nhánh và nhóm amino ở vị trí α .60 Amino axit X chứa một nhóm chức amin bậc I trong phân tử. ngoài ra còn tác dụng được với nước brom. mạch hở.18%. H2NCH2COOH. X vừa tác dụng được với dung dịch HCl vừa tác dụng được với dung dịch NaOH. cả A. C đều sai. B. B. cả A. 3 mol CO2 và 0. Biết rằng. H2NCH2COOH.63 Hợp chất hữu cơ X có phân tử khối nhỏ hơn phân tử khối của benzen. D. Câu 3. H2NCH2COOH. Câu 3.928 lít khí CO2 (đo ở 27. D. đốt cháy a g hỗn hợp hai amino axit trên và cho sản phẩm cháy qua dung dịch NaOH dư. Cho tỉ lệ phân tử khối của chúng là 1. thu được VCO2 : VH 2O = 6 : 7 . 1 chức amino tác dụng với 40. CH3CH(NH2)COOH.8g.65g muối khan.35g muối.7g chất X. H2N[CH2]3COOH. Khi đốt cháy 1 mol X thu được hơi nước. H2NCH(NH2)[CH2]2COOH. tất cả đều sai. CH3NH[CH2]2COOH. cần 140ml dung dịch KOH 3M. H. H2N[CH2]3COOH. D.05g A khi tác dụng với một lượng NaOH dư. nitơ chiếm 18. CH2=C(NH2)-COOH. Công thức cấu tạo thu gọn có thể có của X là A.64 Cho a g hỗn hợp hai amino axit A. B đều no.15g dung dịch HCl 20% được dung dịch A. H2N[CH2]4COOH. C2H5COONH4 hoặc HCOONH3CH3. H2NCH2CH2COOH. CH3NH[CH2]3COOH. kết quả khác. khi đốt cháy thu được khí nitơ ở dạng đơn chất. chứa 1 chức axit.Câu 3. H2N-CH=CH-COOH. C đều sai. Đốt cháy hoàn toàn một lượng X thu được CO2 và N2 theo tỉ lệ thể tích 4:1. N trong đó hiđro chiếm 9.37. O. Câu 3. chỉ chứa nguyên tố C. H2N[CH2]3COOH.09%. H2NCH2COOH. Để tác dụng hết với các chất trong dung dịch A.62 Hợp chất X chứa các nguyên tố C. B. C. D. C. Công thức cấu tạo thu gọn của hai amino axit lần lượt là A. N và có phân tử khối là 89. C. HOOCCH(NH2)COOH. Đốt cháy 7. HOOCCH2CH(NH2)COOH. 1atm).61 Khi đốt cháy hoàn toàn đồng đẳng X của axit aminoaxetic. thu được 4. B đều đúng. D. Câu 3. Biết rằng. Biết 0. B. H2NCH2CH2COOH. Biết X tác dụng với dung dịch NaOH và dung dịch HCl. C. H2N[CH2]4COOH. Công thức cấu tạo thu gọn của A là A.1 mol A phản ứng vừa hết với 100ml dung dịch HCl 1M tạo ra 18. CH3NHCH2COOH. B. Câu 3. O. C. thì thấy khối lượng bình này tăng thêm 32. B. H. H2NCH2COOH. CH2=CH-COONH4. X là hợp chất nào sau đây? A. H2NCH(NH2)COOH. 22. không phân nhánh .65 A là một amino axit trong phân tử ngoài các nhóm cacboxyl và amino không có nhóm chức nào khác. Mặt khác. tạo ra 28.

H. Câu 3. Hai chất (X) và (Y) có cùng số mol. B và C đều đúng. D. B. CH3CH2CH(NH2)COOH. . hiđro. (5) metylamin. (4). CH4ON2. CH3CH(NH2)2. CH3CH2NH2. (3). thu được 18. (3) cacbon. D.69 Câu khẳng định nào sau đây luôn đúng: A. B. B.1g X tác dụng với dung dịch HCl dư. khi lọc dung dịch thu được 4. X có công thức cấu tạo nào sau đây? A.Các protein đều chứa các nguyên tố … . (4) p-nitrotoluen. C3H8O2N2.73 Hợp chất X chứa các nguyên tố C. (4).67 Chọn phát biểu sai: A. CH3CH(NH2)COOH. (2) anilin. C. Công thức phân tử của X là A. C. (1).68 Hãy điền những từ hoặc cụm từ thích hợp vào các chỗ trống ở các câu sau . (1). C3H8ON2.82g (Y). thu toàn bộ sản phẩm qua bình chứa nước vôi trong dư. (2). C.Protein có trong … . CH3NHCH2COOH. N với tỉ lệ khối lượng tương ứng là 3:1:4:7.448 lít (đktc) một khí không bị hấp thụ.Ở nhiệt độ thường dưới tác dụng của men. C đều đúng. Câu 3. (2). oxi. (2). B. (3). D. Đốt cháy hoàn toàn lượng (X) và (Y) trên. nitơ. O. kết quả khác. Biết phân tử X có 2 nguyên tử nitơ. H2NCH2CH2NH2. CH3CH2CH(NH2)COOH. Câu 3.66 X là một α -amino axit no chỉ chứa một nhóm –NH2 và một nhóm –COOH. D. H2NCH2CH2COOH. Câu 3.Một số protein bị … khi đun nóng hoặc khi cho thêm một số hoá chất.2g và còn lại 0. thấy khối lượng bình đựng nước vôi trong tăng 3.C. Cho 15. D. Trình tự tính bazơ tăng dần theo chiều từ trái sang phải là A. Câu 3. B. H2NCH2CH2COOH. HOOCCH2CH2CH(NH2)COOH. (2). C. Câu 3. B.72 Amino axit (Y) có công thức dạng NCxHy(COOH)m. (1) < (2) < (4) < (3) < (5) < (6).71 Đốt cháy hoàn toàn 0. D. (1) < (4) < (3) < (2) < (5) < (6).344 lít (đktc).70 Cho các chất: (1) amoniac. Câu 3. Mọi amin đơn chức đều chứa một số lẻ số nguyên tử H trong phân tử. B. C. D. (4) đông tụ Những từ hoặc cụm từ thích hợp theo trình tự từ trên xuống là A. (1). D. (2) < (1) < (3) < (4) < (5) < (6).02 mol một amin bậc I (X) với lượng oxi vừa đủ. Amin luôn luôn phản ứng với H+. Các amino axit đều tan trong nước. B. NC4H8(COOH)2. B. (4). (4) < (3) < (2) < (1) < (5) < (6). N(CH2COOH)3. (2) bị thuỷ phân.0g kết tủa. (1). C. D. (1) mọi bộ phận của cơ thể. 46 .75g muối của X. (3) p-nitroanilin. kết quả khác. (4). Phân tử khối của một amin đơn chức luôn là số chẵn. (3). (6) đimetylamin. C. Phân tử khối của một amino axit (gồm một chức amino và một chức cacboxyl) luôn luôn là số lẻ. Công thức cấu tạo của X là A. Dung dịch amino axit không làm giấy quỳ đổi màu. Lấy một lượng axit aminoaxetic (X) và 3. (3). Công thức cấu tạo thu gọn của (Y) là A. protein … tạo ra các amino axit. thể tích khí oxi cần dùng để đốt cháy hết (Y) nhiều hơn để đốt cháy hết (X) là 1. Thuỷ phân protein bằng axit khi đun nóng sẽ cho một hỗn hợp các amino axit. C. Câu 3.

ta phân biệt polime trùng hợp và polime trùng ngưng.53 A 3.19 A 3.34 B 3.Số mắt xích (n) trong phân tử polime được gọi là hệ số polime hoá hay độ polime hoá.58 C 3.13 A 3.48 B 3.n n.39 B 3.49 A 3.68 B 3.22 B 3. polime tổng hợp. .8 C 3.M = M.69 D 3. POLIME A. Khái niệm về polime Polime là các hợp chất có phân tử khối rất lớn do nhiều đơn vị nhỏ gọi là mắt xích liên kết với nhau tạo nên.29 C 3.1 C 3.62 C 3.31 C 3.63 B 3.43 C 3.…) n Monome → Polime n Monome → Polime+ nH2O Polime trùng hợp Polime trùng ngưng n.61 A 3.66 D 3.33 A 3.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG III 3.51 D 3.73 A 3.35 B 3.2 D 3.24 B 3.3 C 3.59 C 3.16 A 3.72 C 3.60 A 3.38 C 3. đồng thời giải phóng những phân tử nhỏ (như H2O.7 D 3.12 B 3.23 A 3.21 B 3.71 D 3.25 B 3.n + n. ta phân biệt polime thiên nhiên.67 D 3.44 D 3.64 D 3.45 A 5.15 A 3.65 C 3.18 Có liên kết đôi hoặc vòng Có hai nhóm chức có khả không bền năng phản ứng trở lên Trùng ngưng Định nghĩa Quá trình Sản phẩm Khối luợng Điều kiện của monome 47 .46 A 3. .14 B 3.4 B 3.M = M’.41 A 3.56 D 3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. polime nhân tạo (bán tổng hợp).10 C 3.42 C 3.18 A 3.47 A 3.55 C 3.40 B 3.54 D 3.37 D 3.5 D 3.9 C 3.27 B 3. .20 A 3.28 D 3.17 A 3.30 D 3.32 D 3.Theo phản ứng polime hoá.11 C 3.36 A 3.70 C CHƯƠNG IV.57 D 3.52 C 3.Theo nguồn gốc.26 D 3. Phản ứng Trùng hợp Mục so sánh Là quá trình kết hợp nhiều phân tử nhỏ giống nhau hoặc tương tự nhau (monome) thành phân tử lớn (polime) Là quá trình kết hợp nhiều phân tử nhỏ thành phân tử lớn (polime).6 B 3.50 B 3.

Phân tử polime có thể tồn tại ở dạng mạch không phân nhánh.Cao su: vật liệu có tính đàn hồi. 4.Phản ứng giữ nguyên mạch polime: Phản ứng cộng vào liên kết đôi hoặc thay thế các nhóm chức ngoại mạch.Chất dẻo: vật liệu polime có tính dẻo. một số polime có tính đàn hồi.Phản ứng khâu mạch polime: Phản ứng tạo cầu nối giữa các mạch (cầu -S-S.hay -CH2-) thành polime mạng không gian hoặc phản ứng kéo dài thêm mạch polime. Nhựa a) Nhựa PE nCH2 CH2 xt. Khái niệm về các vật liệu polime o . có thể kéo thành sợi. hữu cơ khác. Tính chất a) Tính chất vật lí Hầu hết polime là chất rắn. Thí dụ: t CH2 CH n + nCH3COONa CH CH2 n + nNaOH OCOCH3 OH . Đa số polime có tính dẻo. .dễ bị thuỷ phân khi có mặt axit hay bazơ. không bay hơi.2. to.Phân tử polime có thể có cấu tạo điều hoà (nếu các mắt xích nối với nhau theo một trật tự xác định) và không điều hoà (nếu các mắt xích nối với nhau không theo một trật tự nào cả). . . dài và mảnh. Cấu trúc . bền. p CH2 etilen CH2 n polietilen(PE) b) Nhựa PVC nCH2 CH Cl vinyl clorua xt.Keo dán hữu cơ: vật liệu polime có khả năng kết nối chắc chắn hai mảnh vật liệu khác. Polime có nhóm chức trong mạch như –CO-NH. . một số có tính dai. -COOCH2. 3.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. B .Phản ứng cắt mạch polime: Polime bị giải trùng ở nhiệt độ thích hợp. dạng mạch phân nhánh và dạng mạch không gian.Vật liệu compozit: vật liệu tổ hợp gồm polime làm nhựa nền và các vật liệu vô cơ. một số tan trong các dung môi hữu cơ. không có nhiệt nóng chảy xác định. . b) Tính chất hoá học: có 3 loại phản ứng . p CH2 CH n Cl poli(vinyl clorua) (PVC) c) Nhựa PS 48 .Tơ: vật liệu polime hình sợi. . to.

t + o CH2 n + nH2O − Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ.fomanđehit) (PPF) có 3 dạng: nhựa novolac.plexiglas) nCH2 CH COOCH3 xt. nhựa rezol. 49 . p CH CH2 n OCOCH3 Thuỷ phân PVA trong môi trường kiềm: CH CH2 n + nNaOH OCOCH3 to CH2 CH n + nCH3COONa OH CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) e) Nhựa PMM (thuỷ tinh hữu cơ . nhựa rezit. p CH CH2 C6H5 n d) Nhựa PVA nCH2 CH OCOCH3 xt. p CH3 metyl metacrylat f) Nhựa PPF Poli(phenol . OH .nCH C6H5 CH2 xt.. to. to. OH OH n + nHCHO H . CH2 CH2 CH2OH CH2 CH2 OH .... − Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. to. − Nhựa novolac: Nếu dư phenol và xúc tác axit.

. . xt CH2 CH C Cl CH2 n f) Cao su flopren nCH2 C F xt. t nCH2=CH− CH=CH2  → 0 ( CH 2 CH = CH CH 2 )n buta-1. p.. p. to..3-dien (isopren) c) Cao su buna – S nCH2 CH CH CH2 + nCH C6 H 5 nCH2 xt. p CH2 C F CH CH2 n 3.. xt CH2 CH CH CH2 CH CN CH2 n e) Cao su clopren nCH2 CH C CH2 Cl CH CH2 to.. 2. . . H2 C .. p C CH CH2 n CH3 poliisopren (cao su isopren) CH2 o CH2 t . xt CH2 CH CH CH2 CH C6 H 5 CH2 n d) Cao su buna – N nCH2 CH CH CH2 + nCH CN o CH2 t . p..CH2 OH OH CH2 OH CH2 OH CH2 CH2 OH CH2 CH2 OH CH2 CH2 CH2 .. Tơ a) Tơ capron (nilon – 6) 50 . to... Cao su a) Cao su buna Na.3-đien (butađien) b) Cao su isopren polibutađien (cao su buna) C CH CH2 CH3 2-metylbuta-1.. H2C ..

Len.6) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH xt. Câu 4. 6 → 4 → 2 → 5 → 3 → 1.nH2N[CH2]5COOH n CH2 CH2 CH2 CH2 xt. to. p NH[CH2]5CO n b) Tơ enang (nilon – 7) nH2N[CH2]6COOH c) Tơ nilon – 6.6 có công thức là A. Câu 4. B.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 4. 3 → → 2 → 4 → 5 → 1. p CH2 C=O NH xt. p NH[CH2]5CO n + nH2O xt. 2 → 6 → 3 → 4 → 5 → 1. len. tơ tằm. to.3 Không nên ủi (là) quá nóng quần áo bằng nilon.CO . vì: A. tơ tằm. C. Len. tơ nilon có các nhóm (. tơ nilon dễ cháy.NH -) trong phân tử kém bền với nhiệt. C. Len. NH[CH2]5CO n . C. Hãy sắp xếp các chất theo đúng thứ tự xảy ra trong quá trình điều chế A. D. 51 . axetilen (6). p n 2 n + HCl 2 Cl Cl e) Tơ dacron (lapsan) nHOOC C6H4 COOH + nHO CH2 CH2 axit terephtalic etylen glicol CO OH C6H4 CO O CH2 CH2 O n + 2nH2O poli(etylen terephtalat) (lapsan) C. tơ tằm. B. D. to. NH[CH2]6NHCO[CH2]4CO n . đivinyl (5). NHCH(CH3)CO n . D. NH[CH2]6CO n . tơ nilon mềm mại. p CH2 CH CH CH Cl xt.2 Tơ nilon – 6. to. Len. p HN[CH2]6CO n + nH2O NH[CH2]6NHCO[CH2]4CO n + 2nH2O d) Tơ clorin CH2 CH CH2 Cl CH Cl n 2 + n 2 Cl2 xt. to. 6 B. tơ tằm. to. rượu etylic (4). 4 → 6 → 3 → 2 → 5 → 1.1 Hợp chất đầu và các hợp chất trung gian trong quá trình điều chế ra cao su buna (1) là: etilen (2). metan (3). tơ nilon kém bền với nhiệt. tơ tằm.

Câu 4. B. Z trong sơ đồ trên lần lượt là A. butađien. Phản ứng trùng hợp. vinylaxetilen. Phản ứng đồng trùng hợp. Axetilen. Y . (1).10 Tên của polime có công thức sau là OH CH2 n A. (1). CH2 C(COOCH3) CH3 n D. Câu 4. PbS.5 Khi H2SO4 đậm đặc rơi vào quần áo bằng vải sợi bông. butađien. D. chỗ vải đó bị đen lại do có sản phẩm tạo thành là A. nhựa phenol-fomanđehit. C. (3). B. Axetilen. Câu 4. D.6 Cho sơ đồ sau: CH4 → X → Y → Z → cao su buna. H2S. S. C. Câu 4. butađien. Tất cả đều sai. tơ axetat. Etilen. Câu 4.4 Những phân tử nào sau đây có thể tham gia phản ứng trùng hợp ? CH2=CH2(1). polistiren. nhựa bakelít.7 Cao su buna – S có công thức là A.8 Cao su buna . B. D. vinylaxetilen.11 Tơ enang thuộc loại A. D. nhựa dẻo. Câu 4. n .Câu 4. C.9 Thuỷ tinh plexiglas là polime nào sau đây? A. Polimetyl acrylat (PMA). (1). etanol. B. B. (2). CH2=CH–Cl(3). butađien. B. (4). (3). Polivinyl axetat (PVA). Câu 4. Polimetyl metacrylat (PMM). C. D. CH2 C. etanol. Phản ứng trùng ngưng. Tên gọi của X . B. C. (3). (3). tơ polieste. Anđehit axetic. Phản ứng đồng trùng ngưng. cacbon. tơ poliamit. D. (2). tơ tằm. C. CH3–CH3(4) A. CH CH CH2 CH CH2 C6H5 . Câu 4. B.S được điều chế bằng : A. CH ≡ CH(2). CH2 CH CH CH2 n .12 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – S? 52 . (2). C. CH CH2 C6H5 n . D.

nCH2 B.6 người ta dùng axit nào để trùng ngưng với hexametylen điamin ? A. m CH3 CH2 + mCH C6H5 to. p. p. nCH2 C. xt CH2 CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . p. nCH2 B. nCH2 C. . p. p. CH3 CH2 + mCH C6H5 o CH2 t . xt CH2 CH2 to. CH C CH2 n . xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. xt to. xt Câu 4. D.17 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – N? 53 .14 Phản ứng nào sau đây tạo ra sản phẩm là cao su cloropren? A. Câu 4. nCH2 CH CH CH CH CH C Cl C CH CH2 CH2 CH2 to. C. axit ađipic.A. m CH3 CH2 + mCH C6H5 o CH2 t . xt to.CH3 CH2 C CH B. CH2 CH2 n n . xt to. xt CH2 CH2 CH2 CH CH CH2 n . .13 Phản ứng nào sau đây tạo ra sản phẩm là cao su isopren? A. CH3 Câu 4. nCH2 C. p. p.CH2 CH3 CH CH CH2 . CH2 CH2 n n . xt to. nCH2 D. p. Công thức cấu tạo thu gọn của X là . nCH2 CH CH CH CH CH C Cl C CH CH2 to. p. D. CH C CH2 n CH3 CH2 CH CH CH2 n CH C6H5 CH2 . xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. C. axit stearic. nCH2 CH CH CH CH CH C Cl C CH CH2 to. nCH2 B.6. axit oxalic. axit axetic. B. . X tham gia phản ứng trùng hợp được một loại cao su. A. p. p. p. xt CH2 CH2 to. xt CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . nCH2 D.15 Hiđro hoá hợp chất hữu cơ X được isopentan. nCH2 D.16 Để điều chế nilon .CH3 C C CH2 .CH2 C CH CH2 . m . Cl .

axit metacrylic. CH C6H5 CH2 . B. axit metacrylic. B. nhựa PVC.26 Một polime Y có cấu tạo mạch như sau: 54 . A. Câu 4. trùng hợp axit acrylic. nCH2 B.21 Tơ enang được điều chế bằng cách A.22 Nhựa PS được điều chế từ monome nào sau đây? A. p. C. Câu 4. D. –NH– trong phân tử. Câu 4.CH2 C CH CH2. axit metacrylic.25 Tơ poliamit là những polime tổng hợp có chứa nhiều nhóm A. B.CH2 CH3 CH CH2 CH2 CH3.CH2 CH CH2 OH. xt CH3 n n . xt CH2 CH2 CH C CH C Cl CH2 CH2 to. thuỷ tinh hữu cơ. Câu 4. .19 Sản phẩm của phản ứng trùng hợp metyl metacrylat được gọi là A. B. D. p. trùng ngưng alanin. C. Câu 4. nCH2 CH D. caprolactam.24 Từ monome nào sau đây có thể điều chế được poli(vinyl ancol) ? A. –CO–NH– trong phân tử. Câu 4. xt CH2 CH CH2 CH o CH2 + mCH CH2 t . caprolactam. C. chất dẻo. Câu 4. nCH2 CH CH CH2 + nCH CN CH o CH2 t . m C. metyl metacrylat. p. axit caproic. D. C.20 Tơ capron được điều chế từ monome nào sau đây ? A. p. Câu 4. stiren. D.18 Tên của monome tạo ra polime có công thức CH3 C CH2 n COOH là A.CH2 CH OCOCH3. xt C6H5 n Câu 4. D. phenol. axit acrylic. –CO– trong phân tử. phenol.CH3 CH3 CH2 C CH. B.CH2 CH COOCH3. B. D. –CH(CN)– trong phân tử. C. metyl acrylat. C. B. D. CH3 C C CH2. nCH2 CH CH C CH2 CH3 C Cl CH2 to. CH CH CH2 CH2 CH CN CH2 n .CH2 CH COOC2H5. trùng ngưng HOOC-(CH2)4-COOH. trùng ngưng H2N-(CH2)6-COOH. C.A. nhựa bakelít.23 Chất có khả năng trùng hợp thành cao su là B. C. D.

30 Chọn câu phát biểu sai: A. Câu 4. A.… − 2− 2− 2− 2− 2− 2− 2− 2− … CH CH CH CH CH CH CH CH Công thức một mắt xích của polime Y là A. C. C6H5CH=CH2. Câu 4. Câu 4. − 2− CH .27 Tiến hành clo hoá poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. B.B. còn tinh bột và xenlulozơ là loại polime tổng hợp. Công thức cấu tạo thu gọn của X. 3. Hầu hết các polime không tan trong nước và các dung môi thông thường. Vậy. D.18% clo theo khối lượng. Các vật liệu polime thường là chất rắn không bay hơi. − 2− 2− 2− CH CH CH . NHCH(CH3)CO n . trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo ? B. C. − 2− 2− 2− 2− CH CH CH CH . Câu 4. D. Tỉ lệ số mắt xích (butađien : stiren) trong loại polime trên là A. NH[CH2]6NHCO[CH2]4CO n . thu được polime X. B. B. Cứ 2. 2. Câu 4. 1. Polietilen và poli(vinyl clorua) là loại polime thiên nhiên. D.29 Tiến hành phản ứng đồng trùng hợp giữa stiren và buta – 1. C6H5CH2CHO. 1 : 3. p − H 2O X  Y  polime.31 Cho sơ đồ phản ứng sau: → xt . B. C.6 có phân tử khối (M = 2500) là 55 . C6H5CH=CH2. C.3 – đien (butađien).28 Tơ capron (nilon – 6) có công thức là NH[CH2]5CO n . 1 : 1. C. Polime là những chất có phân tử khối rất lớn do nhiều mắt xích liên kết với nhau. CH3-C6H4CH2OH . 2 : 3. D. A. C. C6H5CH(CH3)OH. t o . 1 : 2.834 gam X phản ứng vừa hết với 1. C6H5COCH3. D. C6H5CH2CH2OH. 4. D. NH[CH2]6CO n .32 Hệ số trùng hợp (số mắt xích) của tơ nilon – 6. → X có công thức phân tử C8H10O không tác dụng với NaOH. Y lần lượt là: A. Trong X có chứa 66.731 gam Br2. C6H5CH2CH2OH. − 2− 2− CH CH . II – BÀI TẬP NÂNG CAO Câu 4.

xenlulozơ. Câu 4. (9). x 3 = . PVC. 11. (2). H2O. C. ancol etylic. natri phenolat (7). (4). 4576 m3. amilozơ. amilopectin. (7). (7). D. các chất đầu và chất trung gian trong quá trình điều chế là: metan (2). etilen (4). 7225 m3.69% CO2 về thể tích. = . Biết CH4 chiếm 95% thể tích khí thiên nhiên.35 Cho các polime : PE. phenyl clorua (10). Câu 4. (4). PVC. B. C. amilozơ. nhựa PVC (6). cao su lưu hoá. amilozơ. y 2 D. axeton. PE.38 Cho các chất sau: butan (1). (2). etin (2). amilopectin. PE. (9). PVC. benzyl clorua (6). 56 . (5). B. C. cao su buna.A. D. amilozơ . benzen (3). (8). y 5 Câu 4. PE. thu được hỗn hợp khí và hơi (CO2. D. 12. B. (3).3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y. B. (2). (5). (1) → (4) → (5) → (6). C. PVC.cao su buna. D. (4). 13.37 Đồng trùng hợp đimetyl buta–1. PVC. Đốt cháy hoàn toàn một lượng polime này. Câu 4. (6). (2).33 Điều chế nhựa phenol-fomanđehit (1). D. (1). poli(vinyl ancol). B. thu được một loại polime. (8). axetilen (8). B. = . Câu 4. C. 10. y 3 y 3 C. N2) trong đó có 57. D. 6235 m3. B. amilopectin. xenlulozơ. (6). cao su buna . (1). (1) → (3) → (2) → (5) → (6). vậy để điều chế một tấn  0% PVC thì số m3 khí thiên nhiên (đktc) cần là A. (3). metan (3). (7). vinyl clorua (5). C. (5).  5%  5 Câu 4. Chọn các chất thích hợp cho sơ đồ đó là A. (1). (3). (6). cả A và B. Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 x 2 A. cao su buna. cao su lưu hoá. xenlulozơ. PE. anđehit fomic (4).34 Đun nóng poli (vinyl axetat) với kiềm ở điều kiện thích hợp ta thu được sản phẩm trong đó có A. (10). Polime có dạng cấu trúc mạch không phân nhánh là A. (5). x 3 = . phenol (5). (1). 5883 m3. (3). Hãy cho biết sơ đồ chuyển hoá nào sau đây có thể dùng để điều chế poli(vinyl clorua) ? A.36 Chất dẻo PVC được điều chế theo sơ đồ sau: CH 4  H = 1 → A  H = 9%→ B  H = 9 → PVC. etilen (9). xenlulozơ. ancol vinylic. (1) → (2) → (4) → (5) → (6).

B. mẫu lụa sản xuất từ tơ thiên nhiên cho mùi khét. C. còn da nhân tạo thì bóng. HO-CH2-CH2-OH. HOOC-C6H4-COOH. lụa sản xuất từ tơ thiên nhiên dễ may hơn lụa sản xuất từ tơ nhân tạo. cả A. Câu 4. len). C đều đúng. p + n Cl2 A. B. So sánh độ mềm mại của chúng. chỉ phản ứng (1). B. p HN[CH2]6CO xt.Câu 4. NH[CH2]6NHCO[CH2]4CO n + 2nH2O . anđehit axetic. mẫu da thật cho mùi khét.43 Để phân biệt lụa sản xuất từ tơ nhân tạo (tơ visco. Đốt hai mẫu da. D. So sánh độ bóng của lụa. D. Câu 4. tơ thiên nhiên (tơ tằm. p n + nH2O .39 Khi cho hai chất X và Y trùng ngưng tạo ra polime Z có công thức O CH2 CH2 O C C6H4 C n O O . Dùng dao cắt ngang hai mẫu da. HO-CH2-COOH. n CH2 CH CH CH n + 2HCl .40 Có thể phân biệt các đồ dùng làm bằng da thật và da nhân tạo (PVC) bằng cách nào sau đây? A. ancol etylic. tơ xenlulozơ axetat) và tơ thiên nhiên (tơ tằm. len) người ta dùng cách nào sau đây? A. C. Cl Cl Cl 2 (2) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH (3) CH2 CH CH2 CH Cl Cl n 2 2 xt. to. So sánh khả năng thấm nước của chúng. B. Công thức của X. chỉ phản ứng (3). hai phản ứng (2) và (3). to.41 Đun nóng vinyl axetat với kiềm ở điều kiện thích hợp. C. Y lần lượt là A. Dùng kim may (máy may) may thử vài đường chỉ trên lụa. 57 . mềm mại hơn tơ nhân tạo. D. lụa sản xuất từ tơ thiên nhiên có độ bóng cao hơn lụa sản xuất từ tơ nhân tạo. còn mẫu lụa sản xuất từ tơ nhân tạo không cho mùi khét. B. HOOC-CH2CH2-COOH. So sánh độ mềm mại của chúng. HO-C6H4-COOH. ta thu được sản phẩm trong đó có: A. to. nhẵn Câu 4.42 Xét các phản ứng sau đây. HO-C6H4-OH. da thật mềm mại hơn da nhân tạo. ancol vinylic. khét. Đốt hai mẫu lụa. hai phản ứng (1) và (2). da thật dễ thấm nước hơn. B. phản ứng nào thuộc loại phản ứng trùng ngưng ? (1) nH2N[CH2]6COOH xt. da thật ở vết cắt bị xơ. C. axeton. còn da nhân tạo không cho mùi D. Câu 4. C. D.

A.37 A 4. C.36 A 4. Câu 4.31 C 4.25 A 4.44 Polime X (chứa C. C.22 D 4. tơ polieste. C.48 Cho các polime sau đây: (1) tơ tằm.9 A 4.45 Tơ lapsan thuộc loại A. (7).34 C 4.27 B 4.14 B 4.39 A 4.17 C 4.32 B 4.23 A 4. (6).47 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu ? Biết hiệu suất quá trình este hoá và trùng hợp lần lượt là 60% và 80%.33B 4.48 B 4. (1). (2). (7) tơ axetat. (2).42 C 4. Loại tơ có nguồn gốc xenlulozơ là A. C.21 C 4. B.40 C CHƯƠNG V. Vậy.6 C 4. – CHCl – CHCl – .26 D 4. 215kg và 80kg. (4) tơ enang.4 D 4. số thứ tự nhóm A (số electron ngoài cùng). B. (2) sợi bông. số thứ tự nhóm B (số electron ngoài cùng + số electron kề ngoài cùng chưa bão hoà).7 C 4. (3) sợi đay. (6). protein.38 D 4.8 B 4.19 D 4.1 A 4. B. CH3COOCH = CH2. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IV 4.47 A 4. (7).000. C. (2). (5) tơ visco. D. Câu 4. poli(vinyl clorua).30 D 4.28 A 4.6. tinh bột. Vị trí của kim loại: ô nguyên tố (Z).5 A 4. tơ visco. tơ poliamit. B. 2.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.44 A 4. CH2 = CH – COOCH3.24 B 4. Câu 4. B.13 C 4.20 B 4.16 D 4.49 B 4. (3). B. (6) nilon – 6.2 C 4.11 B 4. H.12 D 4. D. 175kg và 70kg.29 B 4. (5). 3 electron ở lớp ngoài cùng.45 C 4. (5). chu kì (số lớp electron).10 A 4.46 Polime ( CH 2 CH(OH) ) n là sản phẩm của phản ứng trùng hợp sau đó thuỷ phân trong môi trường kiềm của monome nào sau đây ? A. 65kg và 40kg. 58 . – CH = CCl – . (6). Câu 4. Cl) có hệ số trùng hợp là 560 và phân tử khối là 35.35 D 4. D. – CH2 – CHCl – . Công thức một mắt xích của X là A. polime trên thuộc loại nào trong số các polime sau ? A. 171kg và 82kg. C.18 C 4. (3). D. Câu 4. ĐẠI CƯƠNG VỀ KIM LOẠI A. D. 2. CH2 = CHCOOCH2CH = CH2.49 Khi đốt cháy một loại polime chỉ thu được khí CO 2 và hơi H2O với tỉ lệ n CO2 : n H2O = 1:1 . tơ axetat.15 C 4. D. – CCl = CCl – .Câu 4. polietilen.43 C 4.41 C 4.46 B 4. Cấu tạo của kim loại: thường có 1.3 B 4. C2H5COOCH2CH = CH2.

Al. hợp chất khử chứa nguyên tố có số oxi hoá thấp lên cao và nó bị khử xuống mức oxi hoá thấp hơn. 3Cu + 8HNO3 → 3Cu(NO3)2 + 2NO + 4H2O . . IIA (trừ Be. 59 . Na + 2H2O → 2NaOH + H2 . Tính chất hoá học chung: tính khử : M  M n+ + ne → . nhưng cứng hơn kim loại nguyên chất. 8. 9. H2SO4 đặc oxi hoá kim loại (trừ Pt. H2SO4 đặc Dung dịch HNO3. 4. trong đó kim loại bị oxi hoá do tác dụng của dung dịch chất điện li và tạo nên dòng electron chuyển dời từ cực âm đến cực dương.khử.Tác dụng với axit HCl.Chú ý rằng. . Cấu tạo của đơn chất kim loại: mạng tinh thể gồm có các ion dương dao động liên tục ở các nút mạng và các electron tự do chuyển động hỗn loạn giữa các ion dương. Mg) khử H2O ở t0 thường thành H2. Fe + Cu2+ → Fe2+ + Cu . Liên kết kim loại: lực hút tĩnh điện giữa các electron tự do và các ion dương kim loại.Tác dụng với H2O IA.3 điều kiện cần và đủ để kim loại bị ăn mòn điện hoá : các điện cực khác chất. muốn B được bảo vệ thì A phải có tính khử mạnh hơn B. 5. . Cr thụ động trong dd HNO3 đặc nguội. dẫn điện và dẫn nhiệt kém hơn kim loại nguyên chất.Tác dụng với dd muối Kim loại mạnh (trừ Ba. dẫn nhiệt. K. các điện cực cùng tiếp xúc với 1 dung dịch chất điện li.Tác dụng với dd HNO3. H2SO4 đặc nguội. . Au).3. Ca.khử. Nhớ thứ tự các cặp oxi hoá khử sau : Cu2+/Cu Fe3+/Fe2+ Ag+/Ag 2 Fe3+ + Cu → Cu2+ + 2Fe2+ Fe3+ không oxi hoá Ag. Sự ăn mòn kim loại: là sự oxi hoá kim loại do tác dụng của các chất trong môi trường xung quanh : M → Mn+ + ne . 6.Ăn mòn hoá học là quá trình oxi hoá . Tính chất vật lí chung của kim loại: tính dẻo. Hợp kim có t0 nóng chảy thấp hơn.Fe.Dãy điện hoá kim loại cho phép dự đoán chiều phản ứng giữa 2 cặp oxi hoá khử : chất oxi hoá mạnh nhất sẽ oxi hoá chất khử mạnh nhất sinh ra chất oxi hoá yếu hơn và chất khử yếu hơn. H2SO4 loãng : M + n H+ → Mn+ + Kim loại sau H không khử được H+ thành H2. dẫn điện. ánh kim do các electron tự do gây ra. với cặp kim loại A─B. trong đó các electron của kim loại được chuyển trực tiếp đến các chất trong môi trường. các điện cực tiếp xúc với nhau.Tác dụng với phi kim : xM + M+ y O2 → MxOy 2 n Cl2 → MCln 2 n H2 2 . phi kim. Hợp kim: là vật liệu kim loại có chứa một kim loại cơ bản và một số kim loại khác hay với một vài hợp kim.Ăn mòn điện hoá là quá trình oxi hoá . Na) khử ion của kim loại yếu hơn trong dd muối thành kim loại tự do. .

IIA. b) It = ne. ne là số mol electron trao đổi trong quá trình điện phân. n là hoá trị (hoặc số mol electrron trao đổi tính cho 1 mol chất thoát ra ở điện cực. Al) và oxit của kim loại cần điều chế (sau Al). * Phương pháp điện phân nóng chảy để điều chế kim loại IA.It n 96500 Trong đó I là cường độ dòng điện tính bằng Ampe. t là thời gian điện phân tính bằng giây. Nguyên tắc điều chế kim loại: là sự khử ion kim loại : Mn+ + ne → M .10. A là nguyên tử khối (hoặc phân tử khối). CO. Ca. C. Al. K. 60 . Công thức của định luật Farađay a) m = A 1 . t là thời gian điện phân tính bằng giây. . 11.96500 Trong đó I là cường độ dòng điện tính bằng Ampe. m là lượng chất thoát ra ở điện cực theo gam. * Phương pháp điện phân dung dịch để điều chế kim loại sau Al.Các phương pháp điều chế kim loại : * Phương pháp thuỷ luyện cần có dung dịch muối của kim loại cần điều chế (sau Al) và kim loại có tính khử mạnh hơn (trừ Ba. Na) * Phương pháp nhiệt luyện cần có 1 trong 4 chất khử (H2.

2NaCl  2 Na + Cl2 → 1 ñpnc 19. Fe + 3AgNO3. 3Fe3O4 + 8Al  4Al2O3 + 9Fe → 3 ñpnc 17. Fe + 4HNO3  Fe(NO3)3 + NO + 2H2O → >570 C 6. Na + H2O  NaOH + H2 → 2 8. Al2O3  2Al + O2 → 2 ñpnc 18. dư  Fe(NO3)3 + 3Ag → t 14. Fe + S  → t0 3. MgCl2  Mg + Cl2 → ñpdd 23. H2 + PbO  H2O + Pb → t0 15. CuSO4 + H2O  Cu + → 26. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 61 .MỘT SỐ PHẢN ỨNG THƯỜNG GẶP t 1. 3Fe + 2O2  → 4. 2AgNO3 + H2O  2Ag + O2 + 2HNO3 → 2 ñpdd 24. CuCl2  Cu + Cl2 → 0 1 O2 + H2SO4 2 1 ñpdd 25. 2Fe + 3Cl2  → 0 t 2. Fe + 2AgNO3  Fe(NO3)2 + 2Ag → 13. Fe + 2HCl  → 0 2FeCl3 FeS Fe3O4 FeCl2 + H2 5. Fe2O3 + 3CO  2Fe + 3CO2 → t0 16. Fe + H2O → FeO + H2 1 7. Ba + 2H2O  Ba(OH)2 + H2 → 0 9. 2NaOH  2Na + O2 + H2O → 2 ñpnc 20. Fe2(SO4)3 + Cu  CuSO4 + 2FeSO4 → 12. 2FeCl3 + Fe  3FeCl2 → 11.B. Fe + CuSO4  FeSO4 + Cu → 10.

K+. các ion dương kim loại và các electron tự do. D. Ba.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 5. B. chu kì 4. ô 26. ion âm phi kim và ion dương kim loại. Phần trăm khối lượng của Al trong hợp kim là A. Dãy gồm các nguyên tử và ion có cấu hình electron trên là A. B. chu kì 4. nhóm IIB. ô 26. C. + Câu 5. Số g muối tạo ra là A. chu kì 3. Câu 5. K. nhóm VIIIA. C. Câu 5. ô 18. C. nhóm IIA. B.5M. Mg. Cl.7 Hoà tan hoàn toàn 15. Câu 5.6 Hoà tan 1. K+. chu kì 4. 82%. nhóm VIIIB. Ca2+. cứ 10 mol Al thì có 1 mol Ni.4g hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 0.Ni. 35. 81%. C. D. nhóm VIIIB. B. liên kết sinh ra bởi lực hút tĩnh điện giữa các ion dương và các electron tự do. các nguyên tử kim loại. D. ô 18. D. Nguyên tử M là A. chu kì 4. C. Ca2+. C. D.C . các electron tự do. D. liên kết giữa các nguyên tử bằng các cặp electron dùng chung. Cl-. C.44g một kim loại hoá trị II trong 150ml dung dịch H 2SO40. 63. ô 26. B. Ar. F. Be.5 Cation M có cấu hình electron ở phân lớp ngoài cùng là 2p6. Muốn trung hoà axit dư trong dung dịch thu được phải dùng hết 30ml dung dịch NaOH 1M. chu kì 3.4 Cho cấu hình electron: 1s22s22p63s23p6. B. D. Cl.2 Ion M có cấu hình electron ở lớp ngoài cùng là 3s 23p6.6g khí H2 bay ra. Ar. Ar.7. nhóm IIB. ô 20.1 Vị trí của nguyên tử M (Z = 26) trong bảng hệ thống tuần hoàn là A. chu kì 4.9 Trong hợp kim Al. B. C. Na. ô 26. Kim loại đó là A. D. liên kết sinh ra bởi lực hút tĩnh điện giữa nguyên tử H tích điện dương và nguyên tử O tích điện âm. Câu 5. B. ô 20. 2+ Câu 5.7. 53. 84%. F. B.8 Liên kết kim loại là A. Câu 5. nhóm VIIIA. Cl. C. Ca. 62 . liên kết sinh ra bởi lực hút tĩnh điện giữa ion dương và các ion âm.3 Trong mạng tinh thể kim loại có A. Vị trí M trong bảng hệ thống tuần hoàn là A.7.7. 83%. D. Ar. nhóm IIA. 36. Câu 5. chu kì 4.

33g hợp kim Fe. Ag+. Cu2+. Zn. B. C. D. D. D. C. 72. B. Pb là ngâm hỗn hợp trong dung dịch X dư.Câu 5. C. thu được 0. X (Fe). ánh kim. ánh kim. Hg(NO3)2. M là A. C. B. Công thức hoá học của hợp kim là A. Cu2+. ánh kim. Lá sắt bị ăn mòn kiểu điện hoá.Zn trong dung dịch HCl đến phản ứng hoàn toàn thu được 0. C. Câu 5. C. Pb(NO3)2. 63 . AgNO3. Tính mềm. Thành phần %Ag trong hợp kim là A. Sn(NO3)2. 63%. X ( Ag. B. Câu 5. Tính dẻo. Tính cứng.1%. C.398g kết tủa. Câu 5. Ag+.Fe khử Cu2+ thành Cu. Al3+. Thành phần % của Fe là A.15 Một phương pháp hoá học làm sạch một loại thuỷ ngân có lẫn Zn. Sn. dẫn điện.1%. Cu3Al2. ZnCl2. X.1%. D. Cu. D. D. NaCl. Câu 5. Pb(NO3)2. tính cứng hơn kim loại nguyên chất.11 Hoà tan 0. D. C. Ag. Cu2+. 75. Y ( Cu2+.896 lít H2 (đktc).12 Tính chất vật lí chung của kim loại là A. Y (Cu2+).Fe tan trong dung dịch HCl tạo khí H2. Câu 5.14 Một hợp kim Cu-Al chứa 12. dẫn nhiệt. 61%. D. 62%. Phản ứng xong.13 Hợp kim có A. D.16 Ngâm một lá kẽm nhỏ trong một dung dịch có chứa 2. Cd. Câu 5. dẫn điện. Pb2+. CuSO4. Y lần lượt là A. dẫn nhiệt.3% Al. Ag+. Na+. 60%. C.17 Để bảo vệ vỏ tàu đi biển phần ngâm dưới nước người ta nối nó với A. C. nhiệt độ nóng chảy cao hơn kim loại nguyên chất. B. dẫn nhiệt.18 Cho lá sắt vào dung dịch HCl loãng có một lượng nhỏ CuSO4 thấy H2 thoát ra càng lúc càng nhanh do A. dẫn nhiệt. Zn(NO3)2. Y ( Cu2+.24g ion M 2+. dẫn nhiệt cao hơn kim loại nguyên chất. Câu 5. Fe2+).94g. D. Ni khử được các ion kim loại A. dẫn điện. Ni. CuAl. Ag+. X có thể là A. Lá sắt bị ăn mòn kiểu hoá học. AlCl3. dẫn điện. B. Cu. Nhiệt độ nóng chảy cao.10 Ngâm 2. Fe. Câu 5. B. Câu 5. Cu). B.19 Ngâm một lá Ni lần lượt trong những dung dịch muối sau : MgSO4. Cu3Al. X ( Ag). tính dẫn điện. tính dẻo hơn kim loại nguyên chất. Y (Cu2+). Fe2+). Mg2+. 74. Câu 5. 73. Sn.5g hợp kim của Ag vào dung dịch HNO3.20 Cho bột Cu đến dư vào dung dịch hỗn hợp gồm Fe(NO3)3 và AgNO3 thu được chất rắn X và dung dịch Y. ánh kim. C. B. B. CuAl3. D. Thêm dung dịch HCl vào dung dịch trên. khối lượng lá kẽm tăng thêm 0. X ( Ag). Cu2+. B.1%.

Fe3+/ Fe2+. C. Fe. tăng 1.khử : Al3+/Al. B. C. Fe2O3. sau đó kết tủa tan. Câu 5. (2). D. Fe2+/ Fe. không bị khử. Fe3O4. Câu 5.khử xếp theo chiều tính oxi hoá của ion kim loại tăng. ống nghiệm (2) một đinh Fe đã làm sạch. 64 . Cl-. Al3+. xuất hiện kết tủa xanh. D. Ag+/Ag. D. NO3-. Fe2+. Fe2+. Trong dung dịch A chỉ chứa một loại anion là A. D. có khí thoát ra. Cu2+. Fe3+.29 Thả Na vào dung dịch CuSO4 quan sát thấy hiện tượng A. FeCl3. dung dịch mất màu xanh. Al3+. Fe2+/ Fe. B. Fe2+. FeO. Fe3+. Fe2+/ Fe. D. Fe3+/ Fe2+. Fe2+. (1). Cu. B. Cu. Cu. B. B. Fe3+. Fe2+/ Fe.22 Ngâm một lá Zn trong 200ml dung dịch AgNO3 0. Cu2+/ Cu. giảm 1.khử : Al3+/Al. C.30 Có 2 ống nghiệm đựng dung dịch CuSO4. Ag+. Ag. ta thu được chất rắn là A. Fe3+. C. Fe3+. tăng 0. Ag+/Ag. Ag . Cu2+/Cu. Fe3+/ Fe2+. Fe3+/ Fe2+. Cu(NO3)2.26 Cho các cặp oxi hoá. Ion Cu2+ bị khử thành Cu trong thí nghiệm A. 2+ + C. D. Fe . Khi phản ứng kết thúc khối lượng lá Zn A. B.. Ag+. Ag+/Ag.Câu 5.24 Có một hỗn hợp gồm: Fe.43g. Al3+. Fe2+. xuất hiện Cu màu đỏ. Fe3+. Cho vào ống nghiệm (1) một miếng nhỏ Na. Câu 5. AgNO3. B. (1) và (2). Cu. Fe3+/ Fe2+. Fe3+.28 Khi nung Fe(OH)2 trong không khí ẩm đến khối lượng không đổi. Ag+. C. Kim loại khử được ion Fe3+ thành Fe là A.25 Trong một dung dịch A có chứa đồng thời các cation sau : K+. B. Al3+. B. SO42-. Ag+. có khí thoát ra. Ag+. Câu 5. xuất hiện kết tủa xanh.51g. Fe2+/ Fe. Cu2+.27 Cho các cặp oxi hoá. 2+ Câu 5. Cu2+/ Cu. tính khử của kim loại giảm A. Câu 5. D. xuất hiện Cu màu đỏ. Tách Ag ra khỏi hỗn hợp với khối lượng không đổi người ta dùng dung dịch A. Al3+. D. Cu2+. C. Chọn một dãy điện hoá gồm các cặp oxi hoá. Ag+ và các kim loại : Fe. Fe(OH)3. Ag+/ Ag. Al. dung dịch có màu xanh. Ag. C. D. Cu2+/Cu. Cu2+. Câu 5. giảm 0. Fe2+/ Fe. D. Fe2+. Cu2+/Cu. Cu2+.21 Chọn một dãy chất tính oxi hoá tăng A. Ag+/Ag. B. CO32-.Ag+/Ag. Fe3+/Fe2+. C. Ba2+. Câu 5. FeCl2.1M. Câu 5. Ag+. Kim loại Cu khử được các ion trong các cặp oxi hoá trên là A. sau đó kết tủa không tan. Fe2+. Cu2+/ Cu.23 Cho các ion : Fe .43g. C.51g.

D. điện phân dung dịch CaCl2. 9. 3.15g. Cl2 ở anot. D. D. 53%.6%. Hg. 9000C. có màng ngăn 2 điện cực. Giá trị của m là A. Fe. 24.7%. B.12g bột Fe và 0. Fe. người ta dùng A. D.154g.12M. 2.Câu 5.685g. D. Câu 5. dung dịch HCl. D. D. Tên kim loại là A. Cl2 ở anot.32 Nhúng một que sắt nặng 5g vào 50ml dung dịch CuSO 4 15% (D = 1. 26.9%. 9000C. 4.24g bột Mg vào một bình chứa sẵn 250ml dung dịch CuSO4. 8. sau 1930 giây thấy khối lượng catot tăng 1. 8. Thành phần % theo khối lượng của Fe và Si trong quặng này lần lượt là A. điện phân Ca(NO3)2 nóng chảy. Câu 5. dung dịch HCl.92 gam. dung dịch H2SO4 loãng. NaClO. Sau khi thu được 336ml H2 (đktc) thì thấy khối lượng lá kim loại giảm 1.87%. MgO cần dùng 7g khí CO.7%. D. C. Na. C.38 Một loại quặng sắt chứa 80% Fe2O3 và 10% SiO2. B. 56%.68%. B. Na ở anot. Al.1M. C. Mg. Câu 5. B. người ta thu được A. Câu 5. Ag. Na ở catot.88g. Nồng độ C% của dung dịch CuSO4 còn lại là A. Fe 2O3 Fe3O4.33 Ngâm một lá kim loại có khối lượng 50g trong dung dịch HCl.37 Điện phân NaCl nóng chảy với điện cực trơ. 0. C. Khi que sắt đã được mạ kín thì có khối lượng là 5. FeO. 52%. 0. H2 ở catot. 9. dung dịch HNO3. NaOH. 4.04M. D. C. 0. C. Cu. Sau phản ứng khối lượng kim loại có trong bình là 1. C. B. Câu 5. B. Điều kiện phản ứng và hoá chất thích hợp cho sơ đồ trên lần lượt là A. Ni.53%. C. Ba. Câu 5. 3. điện phân CaCl2 nóng chảy. 65 .40 Hoà tan m g Ba vào nước thu được 1 lít dung dịch có pH = 12. 0. B.36 Từ dung dịch CuSO4 để điều chế Cu.06M. B.7%. B. Nồng độ mol/lít của dung dịch CuSO4 trước phản ứng là A. Fe.39 Điện phân (điện cực trơ) dung dịch muối sunfat của một kim loại hoá trị II với cường độ dòng điện 3A. Kim loại đó là A. Câu 5.34 Để khử hoàn toàn 30g hỗn hợp gồm CuO. 9000C. C. 23.12 g/ml).7%. Số gam chất rắn thu được sau phản ứng là A. 25.15g. 3. điện phân CaSO4 nóng chảy.31 Cho 1. Cl2 ở catot.35 Cho sơ đồ : CaCO3 → CaO → CaCl2 → Ca. D. B. Câu 5. Cu. C.74g. Câu 5. 2. 9000C. 0. Fe. 54%.

50 Có dung dịch HCl 0.2g Cu vào 500 ml dung dịch NaNO3 1M. 2. C. Cu. D.3 mol khí.15 mol O 2. 28. M là A. D. Ba. phản ứng xong thấy khối lượng đinh Fe tăng thêm 1.2g kim loại M (hoá trị không đổi) tác dụng với 0. Khối lượng sắt đã tham gia phản ứng là A. 27. 0. Ngâm một đinh Fe trong dung dịch còn lại sau điện phân. Fe.75g. Câu 5.44 Ion Mg bị khử trong trường hợp A. B. Muối clorua đó là A. 3.75g. Thả Na vào dung dịch MgCl2.14g. Khi cô cạn dung dịch thu được số gam muối khan là A. Câu 5. KCl. Kim loại M là A. 1.1M. NaCl.7g. Ba. B. 12. C. C. B. Sau một thời gian. C. D. B. D. Na. CaCl2. 9. NaOH. Mg. Al.2g. người ta thu được sản phẩm là A. D.48 Có 5 mẫu kim loại: Mg. Al. Ca. Câu 5. Cho dd MgCl2 tác dụng dd Na2CO3.41 Điện phân muối clorua nóng chảy của kim loại M thu được 12g kim loại và 0. Al. Câu 5. C. D. Điện phân dung dịch MgCl2. B. Số gam Cu điều chế được từ các thí nghiệm trên là A.5g khí H2. B. Nếu chỉ dùng thêm dung dịch H2SO4 loãng thì có thể nhận biết A.25g.24 lít. Al. 28. C. C. D. Ba. Mg.36 lít. 0. Mg.47 Cho 16. Ở catot thu được 7.12 lít khí (đktc) ở anot. B. Mg.2 gam kim loại và 6. Cl2. Câu 5. người ta lọc lấy dung dịch có pH = 2. 66 .43 Điện phân dung dịch NaOH với điện cực trơ.48 lít. D. 6. MgCl2. Fe. Fe. Mg.49 Cho 19. NaClO. 3. không có màng ngăn 2 điện cực. NaCl. Câu 5.Câu 5. C. Chất rắn sau phản ứng tan trong dung dịch HCl dư tạo 13. Fe. 4. B.63g.42 Điện phân nóng chảy muối clorua của kim loại M.8g.45 Sau một thời gian điện phân dung dịch CuCl2 thu được 1.2g. Mg. C.72 lít. B. Al. 2+ Câu 5. D. Cu. D. Câu 5. Câu 5.6g.46 Hoà tan hoàn toàn 10g hỗn hợp Al và Mg trong dung dịch HCl thu được 0.25g. Cu. 0. 27. Ca. sau đó thêm 500ml dung dịch HCl 2M.72 lít khí (đktc). Rót 250ml dung dịch này vào cốc đựng mạt sắt. Al. Thể tích khí NO (đktc) thu được là A.26g. B. 2g. Ba. C. Điện phân MgCl2 nóng chảy.44 lít khí (đktc). Ba.

Ag. Ag. 0. B. C.51 Cho 0. Dung dịch HCl. D. thuốc thử đó là A. n CO2 = n Ca(OH)2 . B. D. Dung dịch HNO3.725M.2.Câu 5. D. Câu 5. kẽm. magie. n CO2 > n Ca(OH)2 . Công thức của muối sunfat là A.76. B. Để phản ứng hết với dung dịch này cần 20ml dung dịch BaCl2 0. Cho X vào một lượng nước dư. 5.52 Cho dòng khí CO2 liên tục đi qua cốc đựng dung dịch Ca(OH)2. C.54 Một hỗn hợp X gồm Na và Al được trộn theo tỉ lệ mol 1: 2. 0. Cu.55g muối khan. B. D.44g hỗn hợp 2 muối. MgSO4. Fe. C.75M.57 Hoà tan 58g muối CuSO4. Câu 5. n CO2 = 2 n Ca(OH)2 . Hai kim loại X. dung dịch HCl. Na2CO3 + Ca(OH)2 → CaCO3 + 2 NaOH.60 Cho phương trình phản ứng : a X + b Y(NO3)a → a X(NO3)b + b Y Biết dung dịch X(NO3)b có màu xanh. B. Câu 5. C. 67 . 1. D.02.96 lít khí H 2 và m g một chất rắn. Cu. bari. C. Fe.11 mol khí CO2 đi qua dung dịch NaOH sinh ra 11. B. Số g mỗi muối trong hỗn hợp là A. lượng kết tủa thu được lớn nhất là A. B. D.59 Dùng một thuốc thử phân biệt Fe2O3 và Fe3O4. dung dịch NaOH. Câu 5. B.92. Dung dịch H2SO4 loãng. Nồng độ mol/l của dung dịch CuSO4 đã pha chế là A. C.5H2O trong nước được 500ml dung dịch.4g.54g. C. 0.58 Cho các chất: CaCO3. D. Câu 5. D. CaO + CO2 → CaCO3.42 và 11.84 và 10.53 Hiện tượng tạo thành các thạch nhũ trong các hang động được giải thích bằng phản ứng A.3625M. 3. 0.68 và 9. B. Cu. 0. dung dịch NaHCO3.0g một kim loại hoá trị II trong dung dịch HCl.52 và 8. Giá trị của m là A. C. 4. BaSO4.464M.8g muối sunfat của một kim loại nhóm IIA trong nước rồi pha loãng cho đủ 50ml dung dịch. Câu 5. 2. C. Câu 5. Câu 5. Tên kim loại đó là A. 1.7g. 0. sau khi kết thúc phản ứng thu được 8. 0. D. Dung dịch CuSO4. CaSO4.6. canxi. 2. Mg. Y lần lượt là A.232M.56 Hoà tan 2. Số phương trình phản ứng hoá học (dạng phân tử) xảy ra khi cho các chất tác dụng với nhau từng đôi một là A. n CO2 < n Ca(OH)2 . B. C. 0. BeSO4. Câu 5.55 Hoà tan 1. D.27g. sau đó cô cạn dung dịch thu được 5. Ca(HCO3)2 → CaCO3 + CO2 + H2O. CO2 + Ca(OH)2 → CaCO3 + H2O.

D. C.61 Cho a g kim loại M tác dụng vừa đủ với V lít dung dịch HCl 2M thu được (a + 21.8g.6 lít. C.tạo thành phức với Fe2+. MnO4. Câu 5.66 Một kim loại dùng để loại bỏ tạp chất Fe2(SO4)3 trong dung dịch FeSO4 là A. 2a + 2b = c + d.08g. Câu 5. MgSO4. 2. Vai trò của ion NO3.80g. Biết rằng toàn bộ Cu sinh ra đều bám hết vào thanh M. B.62 Điện phân nóng chảy 76g muối MCl2 thu được 0. thu được dung dịch Y và một phần sắt không tan. C. D. Câu 5. 3a + 2b = c + 2d. MgSO4. C. C. D. D. 24. b. B. 4. FeSO4.64 Khi phản ứng với Fe2+ trong môi trường axit dư. khối lượng thanh M tăng 0. Zn.3 lít. Cu. không bị khử không bị oxi hoá. Câu 5.bị oxi hoá.không màu trong môi trường axit. Ag. C. 1. Fe(NO3)2. 3. Fe2(SO4)3.64 mol khí Cl2 ở anot. 27. Câu 5. V có giá trị là A.10. Tên của M là A. 68 . B. MgSO4. Cu. Biết hiệu suất phản ứng điện phân là 80%. B. Fe. 0.4 lít. B. D.67 Cho hỗn hợp X gồm Mg và Fe vào dung dịch axit H 2SO4 đặc nóng đến khi các phản ứng xảy ra hoàn toàn. B.3) g muối MCln. Ag. Nguyên tử khối của M là A. 0. bị khử. FeSO4. AgNO3. Mg. c. 65.là A. Số phương trình phản ứng hoá học xảy ra khi cho kim loại và muối tác dụng với nhau là A. B. bị oxi hoá.4M đến khi dung dịch hết màu xanh. 0.68 Trong một cốc nước chứa a mol Al3+. D.2 lít. 0. Giá trị m là A. Fe2(SO4)3. 9. Câu 5.1 mol khí duy nhất NO (đktc). C.65 Có các kim loại Cu. MgSO4. 3a + 2b = c + d. Ca. 56. 9. C. 10. Câu 5. D.70 m g phoi sắt để ngoài không khí lâu ngày bị gỉ tạo thành hỗn hợp A có khối lượng 12g gồm 4 chất rắn. D. 2a + 3b = 2c + d. Ba. D. Fe và các dung dịch muối Cu(NO3)2. Chất tan có trong dung dịch Y là A. B. vừa bị khử vừa bị oxi hoá. Câu 5. B. MnO4. Cho A tác dụng hết với dung dịch HNO3 loãng. MnO4. dư thu được 0. dung dịch KMnO4 bị mất màu là do A. II – BÀI TẬP NÂNG CAO Câu 5. B. Biểu thức liên hệ giữa a. MnO4. C. c mol Cl-.08g.Câu 5. d là A. d mol SO42-.bị khử thành Mn2+. D. C. b mol Cu2+.69 Cho Cu vào hỗn hợp gồm NaNO3 và H2SO4 loãng.63 Khuấy một thanh kim loại M hoá trị 2 trong 200ml dung dịch Cu(NO3)2 0.64g.

dư thì thể tích N2 (đktc) là A. D. Al tác dụng hết với dung dịch HCl dư thu được 5. 0. được 3g hỗn hợp rắn gồm 4 chất.224 lít. 4. Câu 5. . 0.21 %. 39. 3.Câu 5. 2. C. Vậy 2 kim loại đó là A. B. 27g.79 Cho 22g hỗn hợp muối cacbonat của kim loại IA và IIA tác dụng với dung dịch HCl dư thu được 0. dư thu được V lít NO (đktc) duy nhất. C. Câu 5. 3.2g sắt để ngoài không khí bị gỉ thành 13. 22g. C. D. 25. Cô cạn dung dịch thì số gam muối khan thu được là A.8g bột sắt ngoài không khí.Phần 2: hoà tan hết trong dung dịch HNO3 loãng thu được V lít khí NO (đktc). 5. D.0. C. Cô cạn dung dịch thì số gam muối khan thu được là A. 36%. sau một thời gian thu được m g hỗn hợp X gồm các oxit và sắt dư. 37. B.336 lít.80 Cho 3. 24g. B.72 Oxi hoá m g sắt ngoài không khí. C. Zn. Câu 5. C. nóng thu được 5.242 lít. 69 . Hoà tan hết X bằng dung dịch HNO3 thấy có 0. 29g. D. X2 có hoá trị không đổi.12 lít NO duy nhất (đktc).72 lít khí (đktc).8g. B.2g. 3.224 lít. 35g.2.95g. 2. B.75 Hỗn hợp X gồm 2 kim loại X1. Cho A tác dụng hết với dung dịch HNO3 loãng.252g. Cho X tan hết trong dung dịch CuSO 4 dư.76 Cho 36.336 lít.5M được dung dịch Z và 4. 3.8g hỗn hợp 2 muối cacbonat của 2 kim loại thuộc nhóm II ở 2 chu kì kế tiếp nhau khi tác dụng hết với dung dịch HCl thu được 0. Câu 5. Ca và Sr. 2. Thành phần % về khối lượng Mg trong hỗn hợp X là A.36 lít.52g.87g hỗn hợp X gồm Mg và Al vào 250ml dung dịch Y chứa axit HCl 1M và H2SO4 0. C.2g hỗn hợp 3 kim loại Mg.36 lít. Chia X thành phần bằng nhau: . C.6 lít khí (đktc). được 1. B. C. D. B. 26g.4 mol khí CO2. Cô cạn dung dịch thì số gam muối khan là A. V có giá trị là A.368 lít H 2 (đktc). Câu 5. 2. D.3g. Câu 5.98g.24 lít. B.71 11. Hoà tan hết hỗn hợp X bằng H2SO4 đặc.36 lít H2 (đktc). C.6 lít. 20g.6 lít SO2 (đktc). 0.73 Nung nóng 16. 1. Giá trị m là A. Giá trị của V là A.7g. D. B. Mg và Ca. thu được Cu.53g. dư thu được 6. 28g. Câu 5. Sr và Ba.48 lít. 0.63 lít.6g chất rắn A.25g.025 mol khí NO thoát ra. 26%. Be và Mg. 18. Câu 5. 27. Câu 5.24 lít. 0.87g. D. 35.01%. 3.5g. Nếu cho X tác dụng hết với dung dịch HNO3 loãng.3 mol khí (đktc).78 Cho 11g hỗn hợp nhiều kim loại trước hiđro tác dụng với dung dịch H2SO4 loãng. B. D. 25.Phần 1: hoà tan hết trong dung dịch chứa HCl và H2SO4 loãng thu được 3.74 Hỗn hợp X gồm 2 kim loại đều có hoá trị không đổi. Giá trị m là A. D. không tác dụng với nước và đứng trước Cu.77 Cho 10. Đem Cu cho tan hết trong dung dịch HNO3 loãng dư.

Câu 5.81 Hoà tan hoàn toàn 2,81g hỗn hợp gồm Fe2O3, Al2O3, MgO, ZnO trong 500ml dung dịch axit H2SO4 0,2M (vừa đủ). Cô cạn dung dịch sau phản ứng, muối sunfat khan thu được có khối lượng là A. 6,81g. B. 10,81g. C. 5,81g. D. 4,81g. Câu 5.82 Cho 1,935g hỗn hợp gồm 2 kim loại Mg và Al tác dụng với 125ml dung dịch gồm HCl 1M và H2SO4 loãng 0,28M, thu được dung dịch X và 2,184 lít H 2 (đktc). Cô cạn dung dịch, thu được số gam muối là A. 9,7325g. B. 9,3725g. C. 9,7532g. D. 9,2357g. Câu 5.83 Cho 10g hỗn hợp gồm Al và một kim loại M (hoá trị x) tác dụng với 100ml dung dịch gồm H2SO4 aM và HCl 3aM, thu được 5,6 lít H2 (đktc), dung dịch X và 1,7g chất rắn. Khối lượng muối thu được là A. 2,85g. B. 2,855g. C. 28,55g. D. 28,5g. Câu 5.84 Cho 7,2g Mg tác dụng hết với dung dịch HNO 3 loãng, dư thu được 6,72 lít khí Y và dung dịch Z. Làm bay hơi Z thu được 47,4g chất rắn khan. Công thức phân tử của khí Y là A. N2O. B. NO. C. N2. D. NO2. Câu 5.85 Đốt nóng một hỗn hợp X gồm Al và Fe3O4 trong điều kiện không có không khí được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: Phần 1: tác dụng với dung dịch NaOH dư thu được 3,36 lít H2 (đktc). Phần 2 : tác dụng với dung dịch HCl dư thu được 13,44 lít H 2 (đktc). Thành phần % về khối lượng của Al trong hỗn hợp X là (hiệu suất phản ứng 100%) A. 27,95%. B. 2,795%. C. 72,05%. D. 7,205%. Câu 5.86 Cho hỗn hợp A gồm bột Al và Fe3O4. Nung nóng A ở nhiệt độ cao trong môi trường không có không khí để phản ứng xảy ra hoàn toàn thu được hỗn hợp B. Nghiền nhỏ B rồi chia làm 2 phần: - Phần 1 (ít) tác dụng với dung dịch NaOH dư thu được 1,176 lít H2 (đktc). Tách riêng chất không tan đem hoà tan trong dung dịch HCl dư thu được 1,008 lít khí (đktc) - Phần 2 (nhiều) tác dụng với dung dịch HCl dư thu được 6,552 lít khí (đktc).Khối lượng hỗn hợp A là A. 22,02g. B. 8,1g. C. 13,92g. D. 3,465g. Câu 5.87 Một hỗn hợp gồm Na, Ba có tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí B. Thể tích dung dịch HCl 0,1 M để trung hoà

1 dung dịch A là 10

A. 0,4 lít. B. 0,2 lít. C. 0,6 lít. D. 6 lít. Câu 5.88 Cho m gam hỗn hợp X gồm K và Al tác dụng với nước dư thu được 0,25 mol khí. Nếu cho m gam X tác dụng với Ba(OH)2 dư thu được 0,4 mol khí (các phản ứng đều xảy ra hoàn toàn). m có giá trị là A. 12,8g. B. 16g. C. 18g. D. 10,95g.

70

Câu 5.89 Dùng CO khử m g Fe2O3 ở nhiệt độ cao được 0,4 mol CO2 và hỗn hợp rắn X (gồm 4 chất). Hoà tan hết X cần 0,9 lít dung dịch HCl 1M thấy có 0,25 mol khí thoát ra. Giá trị m là A. 32g. B. 40g. C. 80g. D. 3,2g. Câu 5.90 Dùng CO khử m g Fe2O3 ở nhiệt độ cao thu được 1,1 gam CO2 và chất rắn X gồm 3 oxit. X phản ứng vừa đủ với 0,25 lít dung dịch H2SO4 loãng 0,5M. Giá trị m là A. 8,0g. B. 4,0g. C. 1,6g. D. 3,2g. Câu 5.91 Cho 0,1 mol CO (đktc) từ từ đi qua ống sứ nung nóng đựng 4 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Hỗn hợp khí thu được sau phản ứng có tỉ khối hơi so với H2 bằng 20. Công thức của oxit sắt và thành phần % CO 2 theo thể tích trong hỗn hợp khí sau phản ứng là A. FeO ; 75% B. Fe2O3 ; 75% C. Fe2O3 ; 65% D. Fe3O4 ; 75% Câu 5.92 Một dung dịch có chứa 2 cation là Fe2+ (0,1 mol); Al3+ (0,2 mol) và 2 anion Cl- (x mol), SO42- (y mol). Khi cô cạn dung dịch thu được 46,9 gam chất rắn khan. x và y có giá trị lần lượt là A. 0,02 và 0,03. B. 0,03 và 0,02. C. 0,2 và 0,3. D. 0,3 và 0,2. Câu 5.93 Thêm V lít dung dịch Na2CO3 1M vào một dung dịch có chứa đồng thời các ion − − sau: Ba2+; Ca2+; Mg2+; 0,2 mol Cl ; 0,3 mol NO3 . Để tạo lượng kết tủa lớn nhất thì giá trị của V là B. 0,25 lít. A. 2,5 lít. C. 0,5 lít. D. 5 lít. Câu 5.94 Hoà tan 16,2g Al trong dung dịch HNO3 loãng, dư thu được hỗn hợp khí gồm NO và N2 có tỉ khối hơi so với H2 là 14,4. Thể tích (tính theo lít) của NO, N2 lần lượt là A. 2,24 và 3,36. B. 0,224 và 0,336. C. 22,4 và 33,6. D. 2,24 và 4,48. Câu 5.95 Cho 13,5g nhôm tác dụng vừa đủ với dung dịch HNO 3 0,86M thu được hỗn hợp khí gồm NO và N2O có tỉ khối hơi đối với H 2 bằng 19,2. Thể tích dung dịch HNO3 cần dùng là A. 2,2 lít. B. 0,22 lít. C. 0,46 lít. D. 4,65 lít. Câu 5.96 Hoà tan một hợp kim Ba-Na với tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí. Thêm m g NaOH vào

1 dung dịch A ta được dung dịch B. Cho dung dịch B tác 10

dụng với 100ml dung dịch Al2(SO4)3 0,2M được kết tủa C. Giá trị m để được kết tủa C lớn nhất, nhỏ nhất lần lượt là A. 2,4g và 4g. B. 4g và 2,4g. C. 4,8g và 6,4g. D. 6,4g và 4,8g. Câu 5.97 Rót 150ml dung dịch NaOH 7M vào 50ml dung dịch Al 2(SO4)3 2M. Khối lượng chất dư sau thí nghiệm là A. 10g. B. 14g. C. 12g. D. 16g.

71

Câu 5.98 Dung dịch chứa 16,8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3, thêm vào 13,68g Al2(SO4)3 thu được kết tủa và dung dịch A. Đun nóng kết tủa đến khối lượng không đổi được chất rắn B. Khối lượng chất rắn B là A. 2,12g. B. 21,2g. C. 42,2g. D. 4,22g. Câu 5.99 Cho 18,9g muối Na2SO3 tác dụng hết với dung dịch HCl thu được khí A (đktc). Dẫn khí A vào dung dịch Ba(OH)2 dư. Sau khi hấp thụ, khối lượng dung dịch sẽ A. tăng 22,95g. B. giảm 22,95g. C. tăng 20,25g. D. giảm 20,25g. Câu 5.100 Đốt cháy hoàn toàn 0,336 lít C3H8 (đktc) bằng lượng oxi vừa đủ. Thu được toàn bộ sản phẩm cháy cho vào 35 ml dung dịch Ca(OH) 2 1M. Sau khi hấp thụ, khối lượng dung dịch A. tăng 0,56g. B. giảm 0,56g. C. tăng 5,6g. D. giảm 5,6g. Câu 5.101 m g hỗn hợp Mg, Al tác dụng với 250ml dung dịch X chứa hỗn hợp HCl 1M và H2SO4 0,5M sinh ra 5,32 lít H2 (đktc) và dung dịch Y (coi Vdung dịch không đổi). dung dịch có pH là A. 1. B. 7. C. 2. D. 6. Câu 5.102 Trộn 100ml dung dịch gồm Ba(OH)2 0,1M và NaOH 0,1M với 400ml dung dịch gồm H2SO4 0,0375M và HCl 0,0125M thu được dung dịch X. pH của dung dịch X là A. 2. B. 7. C. 6. D. 1.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG V
5.1 A 5.11 A 5.21 A 5.31 A 5.41 A 5.51 A 5.61 C 5.71 A 5.81 B 5.91 B 5.101 A 5.2 A 5.12 A 5.22 B 5.32 D 5.42 B 5.52 A 5.62 A 5.72 A 5.82 A 5.92 C 5.102 A 5.3 C 5.13 A 5.23 A 5.33 A 5.43 B 5.53 B 5.63 B 5.73 C 5.83 C 5.93 A 5.4 D 5.14 A 5.24 C 5.34 D 5.44 B 5.54 C 5.64 A 5.74 A 5.84 D 5.94 A 5.5 D 5.15 D 5.25 B 5.35 D 5.45 A 5.55 B 5.65 C 5.75 D 5.85 A 5.95 A 5.6 A 5.16 C 5.26 D 5.36 C 5.46 A 5.56 A 5.66 A 5.76 C 5.86 A 5.96 A 5.7 B 5.17 A 5.27 A 5.37 A 5.47 B 5.57 A 5.67 C 5.77 B 5.87 C 5.97 A 5.8 A 5.18 B 5.28 B 5.38 A 5.48 D 5.58 D 5.68 B 5.78 B 5.88 D 5.98 D 5.9 B 5.19 C 5.29 B 5.39 B 5.49 C 5.59 C 5.69 A 5.79 D 5.89 A 5.99 B 5.10 D 5.20 A 5.30 B 5.40 A 5.50 D 5.60 B 5.70 B 5.80 A 5.90 A 5.100 A

72

Rb.CaCO3 bị nhiệt phân.Na2CO3 dễ tan trong nước. hay dung dịch muối khác. và tan cả trong nước có hoà tan CO2 t0 CaCO3  CaO + CO2 →  → CaCO3 + H2O + CO2 ← Ca(HCO3)2  0 0 . ñpdd 2NaCl + 2H2O  2NaOH + H2 + Cl2 → (nếu không có màng ngăn : 2NaOH + Cl2 → NaCl + NaClO + H2O) 9. và tăng theo chiều Z tăng : M → Mn+ + ne (n = 1. Ba.+ H2O t0 Ca(HCO3)2  CaCO3 + H2O + CO2 → . IIA: ns1. Số oxi hoá: trong các hợp chất IA. ns2 4. . Ca(NO3)2 bị phân huỷ ở t > 330 C thành muối nitrit và oxi 1 t0 KNO3  KNO2 + O2 → 2 t0 Ca(NO3)2  Ca(NO2)2 + O2 → 73 . tan trong axit mạnh. ta nên dùng công thức phân tử của các muối để xác định tỉ lệ giữa số mol nguyên tử kim loại với số mol nguyên tử phi kim trong oxit axit (axit) 8. Cấu hình electron ở lớp ngoài cùng của IA. Điều chế bazơ tan: sử dụng phương pháp điện phân dung dịch muối tương ứng với điện cực trơ. Kim loại kiềm thổ (IIA): Be.+ H+ → H2O + CO2 HCO3. tác dụng với axit. có màng ngăn hai điện cực. Sr.→ CO32. Ca(HCO3)2 lưỡng tính. kém bền với nhiệt HCO3. H3PO4 … vào dung dịch bazơ.KNO3. Kim loại kiềm (IA): Li. IIA đều có tính khử (IIA khử yếu hơn IA). để xác định muối sinh ra. Tính chất của một số hiđroxit . 2). H2O (trừ Be).NaOH.+ OH. Ca(OH)2 có đầy đủ tính chất của một dung dịch bazơ như làm quỳ tím hoá xanh. P2O5 hay axit H2S. Sơ lược về muối cacbonat và hiđrocacbonat . mang gần như đầy đủ tính chất chung của muối như tác dụng với dung dịch axit mạnh. Na. Điều chế IA. Ca. KIM LOẠI KIỀM THỔ VÀ NHÔM A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. SO2. oxit axit.NaHCO3. Ra 3. bazơ mạnh. Tất cả các kim loại ở hai nhóm này đều tác dụng với phi kim. 6. dung dịch axit. muối. . → 2 ñpnc 4MOH  4M + O2 + 2H2O → 7. Fr 2. KIM LOẠI KIỀM.CHƯƠNG VI. Mg. 5.Khi cho CO2. Tính khử: IA. IIA có số oxi hoá +1. IIA: sử dụng phương pháp điện phân nóng chảy n ñpnc MXn  M + X2 (X = halogen). Cs. +2.

. Mg + O2  MgO → 2 3 t0 3.Cách làm mềm nước cứng tạm thời: đun. . dd Na2CO3. . K + Cl2  KCl → 2 t0 5. 11. Mg + 2HCl → MgCl2 + H2 3 9. Nước cứng tạm thời chứa muối Ca(HCO3)2 hay Mg(HCO3)2. 2Al + 6H2O → 2Al(OH)3 + 3H2 74 .Al2O3. IIA.10. Al + Cl2  AlCl3 → 2 1 7. .Nước cứng là nước chứa nhiều ion Ca2+.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1 t0 1. 2K + 2H2O → 2KOH + H2 15.Vật bằng nhôm bền trong không khí. Na + HCl → NaCl + H2 2 8. . CaSO4. 2Al + O2  Al2O3 → 2 1 t0 4.Nhôm có tính khử mạnh (Al → Al3+ + 3e) nhưng kém kim loại nhóm IA. Nhôm . B . MgCl2. 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O t0 13. nhóm IIIA. Ca + Cl2  CaCl2 → 3 t0 6. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O t0 11.Nhôm bị phá huỷ trong kiềm. Al + 3HCl → AlCl3 + H2 2 10. chu kì 3. tham gia phản ứng nhiệt nhôm. dùng bazơ tan.Cách làm mềm nước cứng vĩnh cửu dùng Na2CO3 hoặc Na3PO4. Mg2+. . MgSO4).Nguyên tắc làm mềm nước cứng là làm giảm nồng độ các ion Ca2+. .Điện phân Al2O3 nóng chảy (không thể điện phân nóng chảy AlCl3) để điều chế Al kim loại. . Nước cứng vĩnh cửu chứa muối clorua hay sunfat của Ca2+ hay Mg2+ (CaCl2. Al(OH)3 lưỡng tính. H2O vì trên bề mặt nhôm được phủ kín một lớp Al2O3 bảo vệ. Nước cứng . Al + 4HNO3 đặc  Al(NO3)3 + NO + 2H2O → 12. Ca + 2H2O → Ca(OH)2 + H2 16.Vị trí Al trong bảng tuần hoàn: ô 13. Mg2+ trong nước cứng. 2Al + 6H2SO4 đặc  Al2(SO4)3 + 3SO2 + 6H2O → 14. 2Na + O2  Na2O → 2 1 t0 2.

2NaOH + CO2 → Na2CO3 + H2O 29. 2Al2O3  4Al + 3O2 → → 25. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. NaHCO3 + NaOH → Na2CO3 + H2O 38. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 t0 33. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. 2NaCl  2Na + Cl2 → 1 ñpnc 22. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 ñpnc 21. Mg2+ + HPO42. MgCl2  Mg + Cl2 → ñpnc 24. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. Al(OH)3 + NaOH → Na[Al(OH)4] 0 ñpdd 75 . Mg + CuSO4 → MgSO4 + Cu t0 19.17. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. 2NaHCO3  Na2CO3 + CO2↑ + H2O → t0 34. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2↓ 32. 2Al + Fe2O3  Al2O3 + 2Fe → 20.+ NH3 → MgNH4PO4 ↓ (màu trắng) 50. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. 2KNO3 + 3C + S  N2 + 3CO2 + K2S → t0 44. Ca(OH)2 + CO2 → CaCO3 + H2O 30. Na2CO3 + 2HCl → 2NaCl + H2O + CO2↑ 39. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. CaCO3  CaO + CO2 → t0 42. 2NaOH  2Na + O2 + H2O → 2 ñpnc 23. NaOH + CO2 → NaHCO3 27. Ca(NO3)2  Ca(NO2)2 + O2 → t0 45. 2NaCl + 2H2O  2NaOH + H2 + Cl2 coù ng ngaê maø n 26. NaHCO3 + HCl → NaCl + CO2↑ + H2O 37. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. Mg(HCO3)2  MgCO3 + CO2↑ + H2O → 36. Ca(HCO3)2  CaCO3 + CO2↑ + H2O → t0 35. CaCO3 + H2O + CO2 ← Ca(HCO3)2  t 41. 2KNO3  2KNO2 + O2 → t0 43. NaOH + HCl → NaCl + H2O 31. 2Mg(NO3)2  2MgO + 4NO2 + O2 → 46. CaCO3 + 2HCl → CaCl2 + H2O + CO2↑  → 40.

2 Tính chất không phải của kim loại kiềm là A.45%. Câu 6. Công thức phân tử của muối kim loại kiềm là A.04 mol khí ở anot và 3. Khối lượng kiềm là A. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl t0 55. D. C. D. 16% .4g. 84%. 76 . B.8g. KCl. C. C. Khối lượng muối thu được là A. C. Câu 6.BÀI TẬP TRẮC NGHIỆM I. M+ là cation: A. 12. B. C. B.79%. D. + C. 84% . Ag+.54.12 lít H2 (đktc) và dung dịch kiềm. D. D. 68% . D. Khối lượng muối natri thu được là A. NH4Cl. Có số oxi hoá +1 trong các hợp chất. D.9 Dung dịch muối có pH > 7 là A. Câu 6.5 Cho 200g CaCO3 tác dụng hoàn toàn với dung dịch H2SO4 loãng để lấy khí CO2 sục vào dung dịch chứa 60g NaOH. Kim loại kiềm có tính khử mạnh.4 Điện phân muối clorua kim loại kiềm nóng chảy thu được 0. 2. 25. Na .7 Nung 100g hỗn hợp gồm Na2CO3 và NaHCO3 cho đến khi khối lượng của hỗn hợp không đổi được 69g chất rắn. B. 4.69g. 11. 12.1 Cation M+ có cấu hình electron ở lớp ngoài cùng là 3s23p6.57%. 12. KCl. 48g.6g. Câu 6. C. NaCl.Cu+. Thành phần % theo khối lượng của Na2CO3 và NaHCO3 lần lượt là A. Câu 6. Có nhiệt độ nóng chảy thấp nhất trong tất cả kim loại. 16%. D. B.8 Cho 3. B. Na2CO3. 24g. NaHSO4 . Câu 6. C. B. D. 168g. B.2 gam nước là A. 50g.BÀI TẬP CƠ BẢN Câu 6.1g hỗn hợp 2 kim loại kiềm ở hai chu kì kế tiếp nhau trong bảng tuần hoàn tác dụng hết với nước thu được 1. B.3 Nồng độ phần trăm của dung dịch tạo thành khi hoà tan 7. 68%. Câu 6.9g. 32%.119g. RbCl. K+. 126g. Độ cứng cao. LiCl.8 gam kali kim loại vào 36.72%.6 Cho 197g BaCO3 tác dụng hoàn toàn với dung dịch HCl để lấy khí CO2 sục vào dung dịch chứa 84g KOH.12 gam kim loại ở catot. 32% . Câu 6. C. 16.8g. 2Al(OH)3  Al2O3 + 3H2O → C. 25.

B.12 Hoà tan hoàn toàn 1. Kim loại đó là A. B. C. pH < 7.2. Chỉ dùng nước và khí CO2 phân biệt được số chất là A.016 lít CO2 (đktc).2g hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2.11 Cho 2.6%.95g.10 Cho a mol NO2 hấp thụ hoàn toàn vào dung dịch chứa a mol NaOH.6% và 70.68 lít khí CO2 (đktc) vào dung dịch X. B. D.85%. B. D. 40. Mg. 2. 4.15% và 40. B. Ba. Câu 6. Be.Câu 6.14 Cho 4.0 gam kim loại nhóm IIA tác dụng hết với dung dịch HCl tạo ra 11.19 Trường hợp ion canxi bị khử thành Ca là A. Câu 6. C. Be. Điện phân dung dịch CaCl2 với điện cực trơ. C. C. C.25g muối clorua của một kim loại hoá trị II và một lượng muối nitrat của kim loại đó có số mol bằng số mol muối clorua thì thấy khác nhau 7. 7.55g. 4. 59.5g. BaSO4 .44g kim loại hoá trị II trong 150ml dung dịch H2SO4 0.4% và 29. Ca. pH > 7.36.1 gam muối clorua. 5.48. B.15%. D.36 và 4.05g.4%.2 và 4. Ca. D. Ba. 29. Mg.15 Hoà tan 8. 4. khối lượng kết tủa thu được là A. Be. Mg. Sục 1. Be. Ba. C. 3. Cho dung dịch CaCl2 tác dụng với dung dịch AgNO3.48 và 3.16 Cho 2. D. Câu 6. B. Ca.84g hỗn hợp CaCO3 và MgCO3 tác dụng hết với dung dịch HCl thu được 0. pH = 5.18 Kim loại thuộc nhóm IIA không tác dụng với nước ngay cả ở nhiệt độ cao là A.25. có màng ngăn. Câu 6. Câu 6. Na2CO3 . Na2SO4 . 6. Thành phần % theo khối lượng của CaCO3 và MgCO3 trong hỗn hợp lần lượt là A. B. C. Dung dịch thu được có pH A. 70.5M. D.85% và 59. B. D. Kim loại đó là A. 4. Câu 6. C. B. Số gam CaCO3 và MgCO3 lần lượt là A. pH = 7. Câu 6.17 Có 5 chất bột trắng là: NaCl.13 Khi lấy 14. Ba. 77 . 4 và 4. C. 3. Kim loại đó là A. D. Câu 6. Ca.8g CaO tác dụng với một lượng nước dư thu được dung dịch X. 2. Điện phân CaCl2 nóng chảy. Mg. BaCO3 . D. Câu 6.5g. Để trung hoà axit dư phải dùng hết 30ml dung dịch NaOH 1M.03 mol khí CO2. C.

B. C. C.65g. Na3PO4. 100%. HCl. Điện phân dung dịch AlCl3 với điện cực trơ có màng ngăn. D. Na2CO3 + Ca(HCO3)2 CaCO3 + 2NaHCO3. Nước cứng toàn phần. Zeolít. Na2CO3 + Ca(OH)2 CaCO3 + 2NaOH. 0. C. 0. 40%. C.05 mol HCO3–. Dung dịch NaCl.8 atm). 78 . 0. B. Tính cứng toàn phần. toàn phần.MgCO3 trong quặng là A. C. 12. Tính cứng tạm thời. vĩnh cửu. nước mềm. B. 0. Nước trong bình có A. D.27 Một phương trình phản ứng hoá học giải thích việc dùng dung dịch Na2CO3 làm mềm nước cứng vĩnh cửu là A.25g. B. B. B.20 Phân biệt dung dịch Ca(HCO3)2 với dung dịch CaCl2 bằng A. Thành phần % theo khối lượng của CaCO3.01 mol Na+. 2.25 Trong một bình nước có chứa 0.05g. Tính cứng vĩnh cửu.4g Ca(OH)2 . C. Tính mềm. 0. NaNO3. Dung dịch Na2CO3.24 Dung dịch làm mềm nước cứng tạm thời và vĩnh cửu là A. 4.D. 0. Thả Na vào dung dịch Al2(SO4)3. C. C. B. Câu 6. D.01 mol Na+.02 mol Ca2+. Câu 6.02 mol Cl– . B. 0. 0.21 Khi nung 40g quặng đôlômit thu được 11. Câu 6. B.29 Ion Al bị khử trong trường hợp A. Dùng H2 khử Al2O3 ở nhiệt độ cao. Câu 6.22 Cho 10 lít hỗn hợp khí (đktc) gồm CO và CO2 trong đó CO2 chiếm 39. Dung dịch Na3PO4. Na2CO3. C. Câu 6. Điện phân Al2O3 nóng chảy. Na2CO3. Ca(OH)2. Na2CO3 + 2HCl 2NaCl + H2O + CO2. D. Cho dung dịch Ca(OH)2 tác dụng với dung dịch HCl.2 lít khí CO2 (0oC. Số g chất kết tủa sau phản ứng là A.28 Trong phương pháp trao đổi ion để làm mềm nước cứng người ta dùng A.23 Một loại nước có chứa nhiều muối Ca(HCO3)2 thuộc loại A.01 mol Mg2+. D. 3+ Câu 6. Câu 6.2% (theo thể tích) đi qua dung dịch chứa 7.01 mol Mg2+. B. Dung dịch HCl. Nước khoáng. Nước cứng tạm thời. D. D. 0. 50%. Câu 6. D. D.02 mol Cl– ta được nước cứng A. Câu 6.02 mol Ca2+.05 mol HCO3–.26 Đun sôi nước chứa 0. 92%. tạm thời.5g. Nước cứng vĩnh cửu. Câu 6. Ca(OH)2. Na2CO3 + CaCl2 CaCO3 + 2NaCl. C. 14. D.

HCl. ở (2) kết tủa không tan. Al(OH)3 . H2SO4 loãng. C. nhóm IIIB. D. 79 . Ba(OH)2. AlCl3 + 3H2O + 3NH3 Al(OH)3 + 3NH4Cl. HCl. Al2O3 + 3H2O 2Al(OH)3. đpnc. ở (2) kết tủa tan. sau đó kết tủa tan ra. Lúc đầu đều có kết tủa keo trắng. H2SO4 đặc nguội. đpnc. Lúc đầu đều có kết tủa keo trắng. NaHCO3. nhóm IA. Câu 6. 2 3+ Câu 6.32 Chọn câu không đúng A. ZnSO4. NaOH dư. Al2O3. D. D.36 Cho dần từng giọt dung dịch NaOH (1). Nhôm bị phá hủy trong môi trường kiềm.Câu 6. B. 2Al(OH)3 2Al + 3H2O + O2. C. B. t0. Ba(OH)2. chu kì 3. ô 13. NaOH. Nhôm là kim loại nhẹ. NaOH dư. dung dịch NH3 (2) lần lượt đến dư vào ống đựng dung dịch AlCl3 thấy A. Câu 6. nhóm IIIA. đpnc. H2SO4 đặc nóng. t0. D. AlCl3 + 3NaOH Al(OH)3 + 3NaCl. Câu 6. ở (1) kết tủa tan. E (dung dịch) và (1). chất không có tính lưỡng tính là A. Al(OH)3 + NaOH Na[Al(OH)4].35 Để làm kết tủa hoàn toàn Al(OH)3 người ta thực hiện phản ứng A. dẫn điện. 2Al(OH)3 Al2O3 + 3H2O. Vị trí M trong bảng tuần hoàn là A. Câu 6. Lúc đầu đều có kết tủa keo trắng. C. t0.33 Trong những chất sau. ô 13.30 Phương trình phản ứng hoá học chứng minh Al(OH)3 có tính axit là A. chu kì 3. Lúc đ ầu đều có kết tủa keo trắng. B. C. H2SO4 loãng. B. C. Z. (2) lần lượt là A. dẫn nhiệt tốt. X. Y. Al(OH)3 + 3HCl AlCl3 + 3H2O. D. C. 3 D. B. B. NaOH đủ. HCl. Nhôm là kim loại lưỡng tính. NaAlO2 + H2O + HCl Al(OH)3 + NaCl. đpnc. nhóm IB.34 Cho sơ đồ : +X +Y +Z → Al → Al2(SO4)3 → Al(OH)3  Ba [ Al(OH) 4 ] 2 Al(OH)3 Al2O3 Al. Câu 6. C. chu kì 3. ô 13. HCl. D. chu kì 3. ô 13. B.31 Cation M có cấu hình electron ở lớp ngoài cùng là 2s22p6. t0. sau đó kết tủa không tan ra. Ba(OH)2. Ba(OH)2. ở (1) kết tủa không tan. Nhôm có tính khử mạnh chỉ sau kim loại kiềm và kiềm thổ.

95. Al2O3.24H2O.Al2(SO4)3. 1. nhận ra (1) là AlCl3 .39 Cho từ từ đến dư dung dịch NaOH lần lượt vào các dung dịch đựng Na+ (1). không tan. 10. (2) là NaOH.37 Cho dần từng giọt dung dịch HCl (1) . Lúc đầu đều có kết tủa keo trắng. kết tủa trắng tăng dần. Câu 6. C. 80 .40 Có 2 lọ không ghi nhãn đựng dung dịch AlCl 3 (1) và dung dịch NaOH (2).75M. D.8. Câu 6. (2) là NaOH. C. D. 80%. 2.38 Phèn chua có công thức là A. Câu 6. Không dùng thêm chất khác. 90%. Nồng độ mol/l của dung dịch NaOH ban đầu là A. 2. không tan.35M và 0. C.Al2(SO4)3. rồi kết tủa không tan.24H2O. C.75M và 0. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. MgSO4. 60%.55g. ở (1) không hiện tượng. ở (1) không hiện tượng. B. ở (2) kết tủa tan. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. rồi không tan. ở (3) xuất hiện kết tủa trắng không tan. sau đó kết tủa không tan ra. B.Câu 6.65A trong thời gian 3000 giây thu được 2. nhận ra (1) là AlCl3 . B. CO 2 (2) lần lượt vào ống đựng dung dịch Na[Al(OH)4] thấy A. 0. D. Câu 6. 13. ở (2) xuất hiện kết tủa trắng rồi tan.75M và 0. B. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa. D.nH2O. D. ở (1) kết tủa không tan. ở (1) kết tủa tan.2. Lúc đầu đều có kết tủa keo trắng. ở (3) xuất hiện kết tủa trắng.41 Có 4 mẫu bột kim loại là Na. Al.2. Chỉ dùng thêm nước làm thuốc thử thì số kim loại có thể phân biệt được là A.75M.4g bột Al vào 150ml dung dịch hỗn hợp chứa Fe(NO3)3 1M và Cu(NO3)2 1M.43 Hoà tan 5. Mg. ở (1) không hiện tượng. Lúc đầu đều có kết tủa keo trắng.44 Điện phân Al2O3 nóng chảy với dòng điện cường độ 9. Fe. 70%. ở (2) xuất hiện kết tủa trắng. Câu 6. Kết thúc phản ứng thu được số gam chất rắn là A. Lúc đầu đều có kết tủa keo trắng. Mg2+ (3) ta quan sát thấy A. D. nhận ra (1) là AlCl3 . 4. C. C.75M và 0. ở (1) không hiện tượng. 3.42 Cho 100ml dung dịch AlCl3 1M tác dụng với 200ml dung dịch NaOH. (2) là NaOH. D. K2SO4. (2) là NaOH. ở (2) kết tủa không tan. Câu 6. nhận ra (1) là AlCl3 . kết tủa trắng tăng dần rồi tan. Hiệu suất điện phân là A. Al3+ (2). Kết tủa tạo thành được làm khô và nung đến khi khối lượng không đổi cân nặng 2. C.16g Al. B. B. Na3AlF6. D. Câu 6. B. người ta phân biệt chúng bằng cách A. B. sau đó kết tủa tan ra. C. 15. 0. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa rồi tan ra.35M.35M. 2. ở (2) và (3) xuất hiện kết tủa trắng rồi tan. 13.

C. m g X tác dụng với dung dịch Ba(OH)2 dư thu được 8. Câu 6.48 Một hoá chất để phân biệt các dung dịch riêng biệt NaCl.53 Hỗn hợp X gồm K và Al.22g muối khan. 5. Dung dịch NaOH. Giá trị của V là A. Al2O3 đựng trong các lọ riêng biệt là dung dịch A.45g. B. Mg. C.06g oxit của kim loại M (có hoá trị n) tan trong HNO3 dư thì thu được 5. B. D. 81 . Câu 6. 14.6 lít khí. C. D. AlCl3 là A. HCl đặc. D. Câu 6. 9. 11. Cô cạn dung dịch X được m g chất rắn. C.00g. Công thức của oxit là A. Al (điều kiện phản ứng coi như có đủ) có thể điều chế được A.6g. H2O. AlCl3 . Al(OH)3.95g.22g hỗn hợp kim loại gồm K.96 lít khí.24 lít khí (đktc). Al.44g.52 gam muối. 3. Ca.34g.07g. D. 13. D. B.05g.2g. H2O. Câu 6. 2. m có giá trị là A.02g. (Các phản ứng đều xảy ra hoàn toàn. thu được 3. CaCl2 . 16g. 11. H2SO4 đặc nguội.32 gam nhôm kim loại bằng dung dịch HNO3 loãng. Al và Fe bằng dung dịch HCl. B. m g X tác dụng với nước dư được 5. D. 3.5g hỗn hợp kim loại gồm Mg.52 Cho 3. AlCl3. 4. dung dịch HCl. CuO.4048 lít. thu được 2.8g. Na. các thể tích khí đo ở đktc). m nhận giá trị bằng A.46 Chỉ dùng các chất ban đầu là NaCl. 4. Câu 6. C. là A. B.47 Một hoá chất để phân biệt Al.10.54 Hoà tan 4. Al2O3 D.51 Cho 2. dư thu được V lít khí NO (đktc) và dung dịch X. 12. D. amoniac.10g. C.15. C. Mặt khác.Câu 6.49 Hoà tan hết 10g hỗn hợp muối cacbonat của kim loại IA và IIA bằng dung dịch HCl dư. MgO. B. m có giá trị là A.50 Hoà tan hết 3. C. ZnO. D.4800 lít.45 Một thuốc thử phân biệt 3 chất rắn Mg.136 lít khí (đktc) và m g muối clorua. 12. Na và Ba vào nước được 500ml dung dịch X có pH = 13.20g.80g. B. Dung dịch Na2CO3. BaO. Al2O3 . C. Cô cạn dung dịch X thu được 35. Dung dịch HCl. Câu 6. 18g. C. Sau đó cô cạn dung dịch thu được x gam muối khan. Câu 6. dung dịch NaOH. 3. B.5088 lít. H2O. Câu 6. Al(OH)3. NaOH. 12.6000 lít. B. Dung dịch Na2CO3. 3. B. x có giá trị là A. Câu 6. D.

2%.68%. 4.46%.24 lít. 180kg D. 102kg. dư thu được 10.3%. Câu 6.88 lít H2(đktc).62 3. % Al trong hợp kim là A. 3. 21ml. Câu 6. 6. 8. B. 73%. 82 . Khối lượng Al trong hỗn hợp ban đầu là A.Câu 6.7g.96 lít H2 (đktc). Câu 6. Fe. 3. C.58 Hợp kim Al-Mg tác dụng vừa đủ với dung dịch HCl thu được 8. 210ml.8 lít H2 (00C. 0. D. Kim loại là A.9g.54 tấn Al bằng phương pháp điện phân nóng chảy Al2O3 với anot bằng cacbon (coi như hiệu suất điện phân bằng 100%. và khí thoát ra ở anot chỉ là CO2) có giá trị lần lượt bằng A. D.72 lít H2(đktc).102kg. 18kg C.72 lít H2 (đktc). D. B. 34. C. K. Câu 6. C.59 Khối lượng Al2O3 và khối lượng cacbon bị tiêu hao cần để sản xuất được 0.04g hỗn hợp Fe và Cu tác dụng với dung dịch HNO 3 loãng thu được 0.2 mol Al vào nước dư thì thể tích khí thoát ra (đktc) là A.1020kg. 63.92%. Câu 6. D. 6. 54g.2g hỗn hợp Al và Al2O3 tác dụng với dung dịch NaOH dư thu được 16. D. Cũng lượng hợp kim trên tác dụng vừa đủ với dung dịch NaOH thu được 6. 2. 4. 10200kg .8g. 6. B. C. C.08 lít H2 (đktc). Câu 6. C. C.63 2. B.48 lít. Hỗn hợp sau phản ứng nhiệt nhôm nếu đem tác dụng với NaOH dư thu được 6.56 Cho hỗn hợp 0. nếu đem tác dụng với dung dịch HCl dư thu được 26.4g.1 mol Ba và 0. D.8%. 200ml. 36.2%. Ca. 90%. 5. 27g.32%. B.6g nước để thu được dung dịch có nồng độ 14% là A. B.61 Hỗn hợp Al và Fe3O4 đem nung không có không khí.6%. Biết đã dùng dư 10ml thì thể tích dung dịch NaOH 4M đã lấy ban đầu là A. 2.1800kg Câu 6.60 31.57 Cho 9g hợp kim Al tác dụng với dung dịch NaOH đặc. 4.84g muối sunfat.52g một kim loại tan hết trong dung dịch H 2SO4 loãng thu được 6.96 lít. B.4g. 9. Al. 20ml. 7. nóng. C. 9%.8atm). 69. Câu 6. % Al tính theo khối lượng là A. B. 8. 180kg B. D. D.4g.72 lít. % Fe theo khối lượng là A.55 Khối lượng K2O cần lấy để hoà tan vào 70.896 lít NO (đktc).

5g.73 Trong cầu muối của pin điện hoá Zn – Cu xảy ra sự di chuyển các A. D.7H2O. catot là nơi xảy ra A. Câu 6. Tên lá kim loại là A. a có giá trị là A.8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3.6g. 11g. Fe C. B.6255g. 83 .22g. 16.136g.67 Khi khử hoàn toàn a g hỗn hợp gồm Fe và Fe 2O3 ở nhiệt độ cao thu đựơc 11. sự điện phân dung dịch muối. Câu 6. dung dịch thu được cho bay hơi H2O được 55. sự điện li dung dịch muối.2g. sự khử chất oxi hoá. 62.7H2O tác dụng với H2O thu được 300ml dung dịch. B. C. C. C. sự khử chất oxi hoá. 6. B. B. 5. Câu 6.68g Al2(SO4)3 nữa thì thu được kết tủa X. ion. Câu 6. Câu 6. sự điện li dung dịch muối. Thể tích H2 (đktc) là A. nguyên tử Zn.68%. E0 (pin) = E0 (anot) + E0 (catot). E0 (pin) = E0 (catot) – E0 (anot). E0 (pin) = E0 (catot) + E0 (anot). 4.2g. D. B.66 Cho a g FeSO4. C. D. 21. Còn nếu cho a g hỗn hợp trên tác dụng với dung dịch CuSO4 dư thì được chất rắn có khối lượng tăng thêm 0. 6.72 lít.12g. 42. Al B. 4. D. Mg D.8g so với ban đầu. E0 (pin) = E0 (anot) − E0 (catot). D. Giá trị a là A.1M.55g. B.2g Fe.0136g.36g. 8.96 lít H2 (đktc). D. Câu 6.5g.22g. Nếu cho a g hỗn hợp trên tác dụng với dung dịch HCl dư thì được 8. Thêm H2SO4 vào 20ml dung dịch trên thấy làm mất màu 30ml dung dịch KMnO 4 0. B. C. 3. 0.6g O2 (đktc). Nhiệt phân hoàn toàn X. 2. 1.5g. Câu 6. Na II.65 Cho Fe tác dụng với dung dịch H2SO4 loãng.96 lít. C.255g. B. D.69 50g một lá kim loại tan hết trong dung dịch HCl thu được 336ml H 2(đktc) và thấy khối lượng lá kim loại giảm 1.70 Suất điện động chuẩn E0 (pin) tính bằng A.71 Trong pin điện hoá.BÀI TẬP NÂNG CAO Câu 6. electron. sự oxi hoá chất khử B. 0. D.72 Trong pin điện hoá.sự oxi hoá chất khử.36 lít. tiếp tục thêm vào dung dịch sau phản ứng 13. C. D. C. 13. Câu 6.64 Cho a g hỗn hợp gồm Al và Fe tác dụng với dung dịch NaOH dư thu được 1 thể tích H2 bằng thể tích của 9. nguyên tử Cu.6 gam FeSO4.48 lít. C. anot là nơi xảy ra A.68 Cho dung dịch chứa 16. thu được chất rắn Y. Khối lượng chất rắn Y là A. 625. sự điện phân dung dịch muối. Giá trị a là A. 0.Câu 6.

Công thức hoá học của cacnalit là A. B. Biết khi nung nóng 11.6g muối sunfat trung hoà khan.76 Biết E pin (Zn – Cu) = 1.7H2O.6H2O. D.8g muối cacbonat của một kim loại hoá trị II hoà tan trong dung dịch H2SO4 loãng vừa đủ.1.875 lít khí Y (đktc). Na2CO3.6%.7%. B. − 0. D. 0 Câu 6.6H2O.08M.5H2O.6H2O. D. Fe3+ + 3Ag → Fe + 3Ag3+ Câu 6.44V.2M hoặc 2.79 Cho 3. 0. C. KCl.75 Suất điện động chuẩn của pin điện hoá Sn −Ag là A. Sau điện phân còn lại 100g dung dịch 24%.56M. Công thức hoá học của muối cacbonat là A. Mặt khác khi cho 5. B.32g. 2.94V. Na2CO3.55g cacnalít tác dụng với dung dịch KOH dư.1g cacnalít thì khối lượng giảm 4. B. 0. Nồng độ mol/lít của dung dịch NaOH đã dùng là A.8M.4%.10V và E0(Cu2+/Cu) = +0.xH2O trong 250cm3 nước cất.66V. ZnCO3.81 Cho 5g Na có lẫn Na2O và tạp chất trơ tác dụng với H2O thu được dung dịch X và 1. D.1M.2MgCl2. 2Ag+ + Fe → Fe2+ + 2Ag B. C. Câu 6.khử Ag+/Ag và Fe2+/Fe là A. D.5cm3 dung dịch HCl 0. 1. D.77 Hoà tan 2.10H2O. Câu 6. C.09V.MgCl2. Cô cạn X thu được 7. 2KCl.26%.74 Phản ứng xảy ra trong pin điện hoá được cấu tạo bởi cặp oxi hoá.78g chất kết tủa. C. 24%.5g muối Na2CO3. 84 . 12. Câu 6.42g Al2(SO4)3 tác dụng với 250ml dung dịch NaOH aM. 1.zH2O. Na2CO3. Dung dịch X trung hoà vừa đủ 200ml dung dịch HCl 1M. MgCO3.76V.28M. 2KCl. 7. B. Công thức hoá học của muối ngậm nước là A.Câu 6. thu được 0.82 Cho 5. lọc lấy kết tủa đem nung đến khối lượng không đổi thì được chất rắn có khối lượng giảm 0. Thành phần % theo khối lượng của tạp chất trơ là A. Biết 25cm3 dung dịch này tác dụng vừa đủ với 17. Câu 6. CaCO3. thu được một chất khí và dung dịch X. Fe + 3Ag3+ → Fe3+ + 3Ag D.12M hoặc 0. + 1. Fe2+ + 2Ag → 2Ag+ + Fe C. Nồng độ % của dung dịch NaOH trước điện phân là A. –1. 20.04M hoặc 0.36g so với trước khi nung. KCl. D.78 Cho công thức hoá học của muối cacnalít là xKCl. C. Câu 6.H2O. B.8%. FeCO3. thế điện cực chuẩn (E0) của cặp oxi hoá – khử Zn2+/Zn là A. 77%.80 Điện phân dung dịch NaOH với cường độ không đổi là 10A trong 268 giờ. 0. 0.yMgCl2. C. D.44V.34V.6H2O.2%. B. Na2CO3.76V.24M hoặc 0. 2. C.79V.MgCl2. + 0.2MgCl2.0. 0. C. Câu 6. B.

3.08%. Tổng khối lượng các ion trong dung dịch X là A. Khối lượng Zn trong hỗn hợp là A. Fe(NO3)2. C.03%. Sau khi phản ứng xong được 15.4g. Fe. 4 Câu 6.89%.8.84 Cho 21g hỗn hợp 2 kim loại K và Al hoà tan hoàn toàn trong nước được dung dịch X. 5.675 mol SO2.15g hỗn hợp X gồm Zn và Cu vào 140ml dung dịch AgNO3 1M. 0.90 Nguyên tố R có tổng số hạt (p.83 Nung 6. 2 C. Thêm từ từ dung dịch HCl 1M vào X. Câu 6. D. dư thu được 0.58g Cu(NO3)2 trong bình kín.2g so với ban đầu.96g chất rắn và hỗn hợp khí X. 5.56g. 41.4. . 2. cấu hình electron của R là A. 15. pH của dung dịch Y là A. đun nóng thu được 1.1s22s22p63s23p2. nung nóng thấy khối lượng chất rắn trong ống giảm 7.76g hỗn hợp 2 kim loại và dung dịch Y.89 Cho 5. sau một thời gian thu được 4.85 Cho 23. C. lúc đầu không thấy kết tủa. Dung dịch X chứa chất tan A.6g. Cl-.3 D. B.8. B.22g. Số gam K là A.Fe(NO3)3 và HNO3 D. Hấp thụ hoàn toàn X vào nước được 300ml dung dịch Y.32g.86 Hỗn hợp X gồm a mol Al và 0.11g.12. Dẫn từ từ toàn bộ Y vào ống chứa bột CuO dư. D.32g kết tủa.1s22s22p63s23p1.4.6g hỗn hợp chất rắn. đến khi kết tủa hoàn toàn thì cần 400ml dung dịch HCl. SO42-. 1 B. NH4+.2 Câu 6. B. nóng. D. 23.Thí nghiệm 1: X tác dụng với dung dịch NaOH dư. 10. 1. HNO3 Câu 6.95g. 0.Fe(NO3)2. 1s22s22p63s23p3. . 7.4 mol O2 thu được 64. 0. B. 58.6 B. Fe(NO3)3.4g X tác dụng với dung dịch H2SO4 loãng dư thu được khí Y. B.88 Cho dung dịch X chứa các ion Mg2+. NO và còn dư Fe.Thí nghiệm 2: X tác dụng với dung dịch BaCl2 dư thu được 9.6.87 Khuấy đều một lượng bột Fe và Fe3O4 vào dung dịch HNO3 loãng.06 mol khí. n. 0. Nếu cho 23.4 C.2g. 6. R có hoá trị II.4g X gồm Al.3 mol Mg phản ứng hết với hỗn hợp Y (vừa đủ) gồm b mol Cl2 và 0. e) là 40. 1. Câu 6. C. Câu 6.Câu 6. 85 . Fe(NO3)2 và Fe(NO3)3 C. Chấm dứt phản ứng thu được dung dịch X. Thành phần % theo khối lượng của Al trong X là A. Cu tác dụng với dung dịch H 2SO4 đặc. 35. Câu 6.97%. B. Giá trị của a là A. C.16g kết tủa và 0. D. D. 1s22s22p63s2. C. 3 D.

9M.35M. C. C. B. 0. 0. Câu 6. 0. Biết H (A = 1. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 43 hạt. D. Khi trộn dung dịch X vào dung dịch Y tạo thành 1. MgCl2. Công thức hoá học của hợp chất tạo bởi X và Y là A. O. 1s22s22p63s23p3.95 Tổng số hạt (p.44g. 1M. khi đó khối lượng cực âm tăng thêm 3.9g KCl có màng ngăn và địên cực trơ mất 2 giờ. Câu 6.1M. Nồng độ mol/l của dung dịch CuSO4 ban đầu là A.8 lít khí H2 (đktc). Mg và Fe.98 Sau một thời gian điện phân 200ml dung dịch CuSO4 với điện cực trơ. cần dùng 100ml dung dịch H2S 0. Tổng các hạt trong ion đó là 123. NH3.75M. D. NaOH. 0.92 Cation X2+ và anion Y2.[ KOH] = 0. B.56g chất kết tủa.12 hoặc 0. AlCl3. Câu 6. Ba(OH)2.93 Hoà tan hoàn toàn 1. FeCl3.12 C.5g CuCl2 và 14. 3M Câu 6.804A đến khi bọt khí bắt đầu thoát ra ở cực âm thì mất 2 giờ.5M D. Nồng độ mol/l của dung dịch CuSO4 trước điện phân là A.94 Cho ion HXO3-.[ KOH] = 0. NaOH. D. Nồng độ mol/l của dung dịch HCl là A. NaCl. Câu 6.3M B.64g kết tủa.88 D. B. Nồng độ mol các chất có trong dung dịch sau điện phân đã được pha loãng cho đủ 200ml là A. Câu 6. nguyên tử của nguyên tố Y có tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện của X là 8. Ba(OH)2.9M. Z = 8). O. C.99 Điện phân 200ml dung dịch có chứa 2 muối là Cu(NO3)2 và AgNO3 với cường độ dòng điện là 0. Mặt khác cho 7. O (A = 16. 1s22s22p2.9M.15M C. Mg. 1s22s22p63s23p63d64s2. Ca và Fe. NaOH. O. 1. Ba(OH)2 là A. e) trong 2 nguyên tử kim loại X và Y là 142. 2 2 6 2 4 C. C.35g hai kim loại kiềm thuộc 2 chu kì liên tiếp vào 500ml dung dịch HCl được dung dịch Y và 2.100 Điện phân 100ml một dung dịch có hoà tan 13. 0. O.đều có cấu hình electron ở phân lớp ngoài cùng là 2p 6. 0. 0. B. NH3. X và Y lần lượt là A. B. D. D. D. B. trong đó tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện là 42 hạt.[KCldư] = 0.91 Nguyên tử của nguyên tố X có tổng số electron trong các phân lớp p là 7.9M.90.Câu 6. 0. B. Ba. 86 .[KCldư] = 0. Ca.52M. D. 0. n. B. 0. NH3. NH3.12 hoặc 0. X và Y lần lượt là A. C. Câu 6.1A.02M. Z = 1). Để kết tủa hết ion Cu2+ còn lại trong dung dịch sau điện phân. Ba(OH)2. Al và Fe.38. Be. Câu 6. 0. Fe và Cu. Số hạt mang điện của nguyên tử Y nhiều hơn X là 12 hạt. khối lượng dung dịch giảm 8g. [ KOH] = 0. 1s 2s 2p 3s 3p .62g Al trong 280ml dung dịch HNO3 1M thu được dung dịch X và khí NO (sản phẩm khử duy nhất).2M.96 Cho x mol CO2 hấp thụ hoàn toàn vào 200ml dung dịch hỗn hợp gồm KOH 1M và Ba(OH)2 0. cường độ dòng điện là 5. NaOH. B.1M. [ KOH] = 0. Vậy X có cấu hình electron là A. D. C. Giá trị của x là A.97 Thứ tự pH theo chiều tăng dần các dung dịch có cùng nồng độ mol của NH 3.275M.75M thu được 23. 0. Câu 6. Ba(OH)2.5M. C.18M. NaOH. 3.

57 6.81 6.8g một oxit của kim loại trong dãy điện hoá ở nhiệt độ cao.14g vào dung dịch H 2SO4 loãng dư.91 6.104 Khử 4.58 6. Fe2O3 .45 6. 16. Câu 6. %Fe trong đinh thép là A.17 6. Zn .9 6. Mg. lá (2) giảm 9. cần 2. 1. 98. Cd.102 6.35 6.70 A A D A B C D D B A 6.74 6. Lấy 2 lá kim loại M có khối lượng bằng nhau. ZnO. Fe.102 M là kim loại hoá trị II.96 6.29 6. Nhỏ từ từ dung dịch KMnO4 0.3 A 6. B.53 6.4 A 6. C.95 6.82 6.6% so với ban đầu.11 6. M là A.72g hỗn hợp bột các chất Fe.52 6.92g Fe.62 6.47 6. Kim loại thu được đem hoà tan trong dung dịch HCl thu được 1.83 6.42 6.103 Cho một cây đinh thép nặng 1. C.56 6. 1. lá (2) vào dung dịch Cu(NO 3)2 đến khi thấy số mol Pb(NO3)2 và Cu(NO3)2 trong hai dung dịch giảm như nhau thì nhấc ra.1%.105 A A A A A 87 . C.6g.5 A 6.6 A 6.94 6.10 D A 6.36 6.41 6.96g. C.72 6. D. 49. Kết quả về khối lượng: lá (1) tăng 1.2 %.1 D 6.18 6.46 6. D. 88%.39 6. 90%.22 6.76 6.90 C A A A A A A B B B 6. B.38 6. Mg.92 6.26 6.63 6.28 6. Nhúng lá (1) vào dung dịch CuCl2. Khối lượng Fe trong hỗn hợp là A.80 A B A A C A A A B A 6.8 B 6.89 6.79 6.21 6. FeO.32 6.99 6.20 A B C C A A D A B A 6.67 6.87 6. Công thức hoá học của oxit kim loại là A.2 D 6.27 6.78 6. thấy đã dùng hết 40ml dung dịch KMnO4. B.30 A C C C C B A A B C 6.8g.44g. Cũng lượng hỗn hợp trên ngâm trong dung dịch CuSO4 dư thì khối lượng chất rắn thu được là 4. D.71 6. Câu 6. lá (2) vào dung dịch CdCl2 đến khi thấy số mol CuCl2 và CdCl2 trong hai dung dịch giảm như nhau thì nhấc ra.Câu 6.50 D A B C B B A A B A 6.68g.12 6. Lấy 2 lá kim loại M có khối lượng bằng nhau.31 6.016 lít khí H2 (đktc). Zn.13 6.97 6.100 A C A C A A A B B A 6. Cu. Fe 2O3 tác dụng với CO dư ở nhiệt độ cao thu được 3.49 6.33 6. B.59 6.60 C B A D D D A B C D 6. C.105 4. Kết quả về khối lượng : lá (1) tăng 19%.98 6.69 6. Câu 6.103 6.68 6.14 6.55 6.44 6.84 6. lá (2) tăng 8. D.23 6. Nhúng lá (1) vào dung dịch Pb(NO3)2.75 6.73 6.85 6.15 6.25 6.1M vào X đến khi dung dịch X bắt đầu có màu hồng.48 6. CuO.61 6.4% so với ban đầu. Câu 6.19 6. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VI 6.344 lít H2 (đktc).37 6.7 B 6.101 M là kim loại hoá trị II. D. Fe3O4.88 6. M là A.77 6.101 6.54 6.16 6.64 6. Cu.51 6.24 6.93 6.40 A D C B A C C A A C 6.66 6.43 6. B. thu được chất rắn và dung dịch X.65 6.104 6.2%.86 6. 1.34 6.

. t0 2 Cr2O3 (r) + NH 3 CrO3 + bột Al + Cl .Oxit và hiđroxit có lưỡng tính. Sơ đồ minh hoạ tính chất hoá học của crom + O . Số oxi hoá +3 Số oxi hoá +6 .Tính khử. CROM − SẮT − ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. 4. .44V.2 KI Cr +6 (dd) Kiềm Axit Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 . .Tính oxi hoá.Oxit và hiđroxit có tính .Oxit và hiđroxit có tính bazơ.Thế điện cực chuẩn E Cr3+ /Cr = -0.Oxit và hiđroxit có tính bazơ. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 .34V.CHƯƠNG VII. Cu : [Ar]3d104s1. E Cu 2+ /Cu = 0.Tính khử. E Fe2+ /Fe = -0. Sơ đồ minh hoạ tính chất hoá học đồng + + 88 . t0 2 Nước CrCl3 (r) + Cl +Zn 2 +(O +H O) 2 2 H2CrO47 H2Cr2O Cr HCl H2SO4(l) Cr (dd) Axit Cr(OH)2 +2 Cr +3 +Br (dd) +SO2. E Fe3+ /Fe2+ = 0. 3. Số oxi hoá +3 .Oxit và hiđroxit có tính bazơ.74V. 2.Cấu hình electron nguyên tử Cr : [Ar]3d54s1.77V. . .Tính khử và tính oxi hoá. Crom − Sắt − Đồng . 0 0 0 0 . Fe : [Ar]3d64s2. tính axit.Tính oxi hoá.

+4 Pb2+/Pb -0. Fe + 2HCl  → FeCl2 + H2.76 Mạnh Sn +2. → 0 t 3.Oxit và hiđroxit có tính bazơ. AgNO3 Cu2+ (dd) H + Kết tinh CuSO4. +3 (+3) Au3+/Au Ni2+/Ni +1.3H2O Không khí. Fe + S  FeS. NH . 2Fe + 3Cl2  2FeCl3. +1. t0 6. H2SO4 đ dd FeCl3.[Cu(NH3)4]2+ NH3 Cu(OH)2 OH - H + HCl + O2. 5. 5. 3Fe + 2O2  Fe3O4.Bình Au Zn +2 Zn2+/Zn -0. Zn.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) t0 1.08 Rất yếu Ni +2. (+2) Ag+/Ag +0. → 4. 8. Sn. Au. t Không khi ẩm Khí Clo khô t0 CuCO3.5 -0.Cu(OH)2 (r) CuCl2 (r) Số oxi hoá +2 . 2Fe + 6H2SO4 đặc  Fe2(SO4)3 + 3SO2 + 6H2O.14 Yếu Pb +2. 89 . Pb Số oxi hoá Eo(V) Tính khử Ag +1.5H2O Cu(NO3)2. +4 Sn2+/Sn -0. 10000C Cu 0 Không khí. → t0 2.13 Yếu B . Sơ lược về các kim loại Ag. t 0 CuO (đen) 3 Cu2O (đỏ) Chất khử CO. → 7.Tính oxi hoá. . HNO3.26 Rất yếu T. Fe + 6HNO3 đặc  → Fe(NO3)3 + 3NO2 + 3H2O. Fe + 4HNO3 loãng  → Fe(NO3)3 + NO + 2H2O. Ni. Fe + H2SO4 loãng  → FeSO4 + H2.

12. 30. 32. → 0 t 2FeO + 4H2SO4 đặc  Fe2(SO4)3 + SO2 + 4H2O. → Fe(OH)2 + 2HCl  → FeCl2 + 2H2O. 2FeCl3 + 2KI  → 2FeCl2 + 2KCl + I2.. 37. 13. 43. 35. → 0 t Fe2O3 + 3CO  2Fe + 3CO2. 22. 41. Fe + CuSO4  → FeSO4 + Cu.. <5700 C 3Fe + 4H2O → Fe3O4 + 4H2. 28. → t0 Fe2O3 + CO  2FeO + CO2. 10FeSO4 + 2KMnO4 + 8H2SO4  → 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. 33. 36. 15. 31. 42. → t0 2Cr + 3S  Cr2S3. 17. 2FeCl3 + Cu  → 2FeCl2 + CuCl2. t0 2Fe(OH)3  Fe2O3 + 3H2O. 26. 39. FeCl3 + 3NaOH  → Fe(OH)3 + 3NaCl. 18. 14... 2FeCl2 + Cl2  → 2FeCl3. 20. 27. 25. 11.. FeO + 2HCl  → FeCl2 + H2O. 19. 4Fe(OH)2 + O2 + 2H2O  → 4Fe(OH)3. 23. Fe + 3AgNO3 (dư)  → Fe(NO3)3 + . → 2Fe(OH)3 + 3H2SO4  → Fe2(SO4)3 + 6H2O. 38. 24. >5700 C Fe + H2O → FeO + H2. Fe (dư) + H2SO4 (đặc)  → FeSO4 + . t0 3FeO + 10HNO3 đặc  3Fe(NO3)3 + NO + 5H2O. 40... t0 4FeS2 + 11O2  2Fe2O3 + 8SO2. → . 16. Fe(OH)2 + H2SO4  → FeSO4 + 2H2O. 0 t 3Fe2O3 + CO  2Fe3O4 + CO2. 21. FeCl2 + 2NaOH  → Fe(OH)2 + 2NaCl. → t0 4Cr + 3O2  2Cr2O3. 2FeS2 + 14H2SO4  → Fe2(SO4)3 + 15SO2 + 14H2O.. → FeO + H2SO4 loãng  → FeSO4 + H2O.. 29. Fe2O3 + 3H2SO4  → Fe2(SO4)3 + 3H2O. t0 FeO + CO  Fe + CO2. Fe + 2AgNO3  → Fe(NO3)2 + 2Ag. → 0 t 2Cr + 3Cl2  2CrCl3. 44. Fe(OH)3 + 3HCl  → FeCl3 + 3H2O.. 34.9.. → Fe2O3 + 3H2SO4 loãng  → Fe2(SO4)3 + 3H2O. 90 Fe (dư) + HNO3  → Fe(NO3)2 + . Fe2O3 + 6HCl  → 2FeCl3 + 3H2O. 10. 2FeCl3 + Fe  → 3FeCl2.

→ Cr(OH)2 + 2HCl  → CrCl2 + 2H2O. 68. 67. 59. Cr2O3 + 3H2SO4  → Cr2(SO4)3 + 3H2O. 52. CrCl3 + 3NaOH  → Cr(OH)3 + 3NaCl. K2Cr2O7+6KI+7H2SO4  Cr2(SO4)3+4K2SO4+3I2+7H2O. 71. 80. Na2Cr2O7 + S  → Na2SO4 + Cr2O3. 70. o t 2Cr(OH)3  Cr2O3 + 3H2O. 4200 C 4CrO3  2Cr2O3 + 3O2. 2CrCl2 + Cl2  → 2CrCl3. Cr + 2HCl  → CrCl2 + H2. → >1000 C 2CrO + O2  2Cr2O3. 63. 72. 0 t Cr2O3 + 2Al  2Cr + Al2O3. 2CrO3 + H2O  → H2Cr2O7. 76. 0 t Cu + Cl2  CuCl2. 2CrCl3 + 3Cl2 + 16NaOH  → 2Na2CrO4 + 12NaCl + 8H2O. 47. K2Cr2O7 + 3K2SO3 + 4H2SO4  → Cr2(SO4)3 + 4K2SO4 + 4H2O. 69. 2Cr2O3 + 8NaOH + 3O2  → 4Na2CrO4 + 4H2O. 61. 57. 46. Cr(OH)3 + NaOH  → Na[Cr(OH)4] (hay NaCrO2). 0 t (NH4)2Cr2O7  Cr2O3 + N2 + 4H2O. → K2Cr2O7 + 6FeSO4 + 7H2SO4  → 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. 49. → 2Na2CrO4 + H2SO4  → Na2Cr2O7 + Na2SO4 + H2O. 73. → CrO3 + H2O  → H2CrO4. → 91 . → 2CrO3 + 2NH3  → Cr2O3 + N2 + 3H2O. 55. → t0 2Cu + O2  2CuO. 66. 50. 65. 58. Cr(OH)3 + 3HCl  → CrCl3 + 3H2O. 75. 77. to 4Cr(OH)2 + O2 + 2H2O  4Cr(OH)3. 4CrCl2 + O2 + 4HCl  → 4CrCl3 + 2H2O. 64. Na2Cr2O7 + 14HCl  → 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 79. 54. Cr + H2SO4  → CrSO4 + H2. 62. 56. 2NaCrO2 + 3Br2 + 8NaOH  → 2Na2CrO4 + 6NaBr +4H2O 2Na2Cr2O7 + 3C  → 2Na2CO3 + CO2 + 2Cr2O3. 74. 2CrCl3 + Zn  → ZnCl2 + 2CrCl2. K2Cr2O7 + 3H2S + 4H2SO4  → Cr2(SO4)3 +3S + K2SO4 + 7H2O. → t0 2Na2Cr2O7  2Na2O + 2Cr2O3 + 3O2.45. 60. 78. 53. 51. 2Cr + 3SnCl2  → 2CrCl3 + 3Sn. CrCl2 + 2NaOH  → Cr(OH)2 + 2NaCl. 48. → CrO + 2HCl  → CrCl2 + H2O.

111. → 0 . 99. → ñieä phaâ dung dò n n ch 2CuSO4 + 2H2O  2Cu + 2H2SO4 + O2. 113. → 3Pb + 8HNO3 loãng  → 3Pb(NO3)2 + 2NO + 4H2O. t0 Sn + O2  SnO2. 102. Cu(OH)2 + 2HCl  → CuCl2 + 2H2O. → 0 t CuCO3. Sn + 2HCl  → SnCl2 + H2. 115. 92 t Cu + S  CuS. CuO + H2SO4  → CuSO4 + H2O. 3Cu + 8NaNO3 + 4H2SO4  → 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. → t0 3CuO + 2NH3  N2 + 3Cu + 3H2O. 95. 96. 5000 C 2Ni + O2  2NiO. → t0 CuO + CO  Cu + CO2. Cu(OH)2 + H2SO4  → CuSO4 + 2H2O.81. → t0 CuO + Cu  Cu2O. → 0 t Ni + Cl2  NiCl2. 86. → CuS + 2AgNO3  → 2AgS + Cu(NO3)2. Cu + 2FeCl3  → CuCl2 + 2FeCl2. 90. 82. → t0 Zn + Cl2  ZnCl2. 0 t CuO + H2  Cu + H2O. 83. → Cu(OH)2 + 4NH3  → [Cu(NH3)4]2+ + 2OH-. 108. 87. 101. → Cu2O + H2SO4 loãng  → CuSO4 + Cu + H2O. Cu + 2AgNO3  → Cu(NO3)2 + 2Ag. → 0 t 2Pb + O2  2PbO. 94. 93. 114. 100. 0 t 2Cu(NO3)2  2CuO + 2NO2 + 3O2. 0 t Cu(OH)2  CuO + H2O. 116. 92. 3Cu + 8HNO3 loãng  → 3Cu(NO3)2 + 2NO + 4H2O. 103. 109. → ñieä phaâ dung dò n n ch 2Cu(NO3)2 + 2H2O  2Cu + 4HNO3 + O2.Cu(OH)2  2CuO + CO2 + H2O. 110. 2Cu + 4HCl + O2  → 2CuCl2 + 2H2O. CuS + 4H2SO4 đặc  → CuSO4 + 4SO2 + 4H2O. CuO + 2HCl  → CuCl2 + H2O. → Cu + 2H2SO4 đặc  → CuSO4 + SO2 + 2H2O. 97. 88. → t0 Zn + O2  2ZnO. → ñieä phaâ dung dò n n ch CuCl2  Cu + Cl2. 89. 84. 104. 98. Cu + 4HNO3 đặc  → Cu(NO3)2 + 2NO2 + 2H2O. → 0 t Zn + S  ZnS. 105. 106. 91. 85. 107. 112. → t0 Pb + S  PbS.

D.6. Ba. +2.4 Các số oxi hoá đặc trưng của crom là ? A. CaSO4. D. C.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 7.khử phức tạp.khử nội phân tử. Xiđerit. 123. 2Ag + O3  → Ag2O + O2. ZnSO4. Zn(HCO3)2. 124. Mg. C . +6.khử. [Ar]3d7. Phản ứng oxi hoá. 9 C. C. 119. C. Phản ứng phân huỷ không phải là oxi hoá. +6. [Ar]3d5. +6. Fe.5 Khi nung Na2Cr2O7 thu được Na2O. [Ar]3d . Cấu hình electron của ion Cu2+ là A.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ? A.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư. 122. D. Ag2O + H2O2  → 2Ag + H2O + O2. Đó là muối nào sau đây ? A. B. B. → ñieä phaâ dung dò n n ch 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2. Câu 7. [Ar]3d6. t0 2AgNO3  2Ag + 2NO2 + O2. Ba. +2. O2. D.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ? 93 . Câu 7. B. Phản ứng tự oxi hoá. Câu 7. MnSO4. D. C. +4. Pirit sắt. [Ar]3d3. Manhetit. +6. +3. [Ar]3d . +4. +3. Mg. D. Na. 121. C. Câu 7. 4 C. Câu 7. Ag. Ag + 2HNO3(đặc)  → AgNO3 + NO2 + H2O. → Au +HNO3 + 3HCl  → AuCl3 + 2H2O + NO.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ? A. D. Hematit. B. Na.7 Hợp chất nào sau đây không có tính chất lưỡng tính ? A.2 Cấu hình electron nào sau đây là của ion Fe3+ ? A. [Ar]3d8. +4. Zn(OH)2. Na. +2.khử. B. 118.117. Phản ứng trên thuộc loại phản ứng nào sau đây ? A. MgSO4. ZnSO4. Phản ứng oxi hoá. Câu 7. Câu 7. +1. 2Ag + 2H2S + O2  → 2Ag2S + 2H2O. C. B. B. [Ar]3d10. Câu 7. Cr2O3. B. ZnO. 120. − 5Sn 2+ + 2 MnO4 + 16 H + → 5Sn4+ + 2 Mn2+ + 8 H2 O. Ag. D. Mg. Hg.

C. Mối liên hệ giữa m1 và m2 là A. D. sắt kim loại. Các chất có % khối lượng đồng bằng nhau là…………….17 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất: CuO(1). CrO là oxít bazơ. CuSO4(5). để bảo quản dung dịch muối sắt (II). Chất có % khối lượng đồng nhỏ nhất là……………. người ta thường cho vào đó : A. c. Câu 7. NO2. Câu 7. Fe có khả năng tan trong dung dịch FeCl3.5H2O(6). Câu 7. FeS(4). N2O. Hoá chất cần dùng là : A. Cu có khả năng tan trong dung dịch FeCl3. D. HNO3 đặc nguội. C. Cu-Fe bằng phương pháp hoá học. Tăng lên.11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ? A. FeS2(5). D.10 Phân biệt 3 mẫu hợp kim sau : Al-Fe. B. Lá 2 đốt trong khí clo dư thu được m2g muối. NO. m1=m2. m2>m1. m1>m2. D. FeSO4(6).. a. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2.16 Trong phòng thí nghiệm. dung dịch HCl. Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy. D. Không thay đổi. CuSO4.. C. Dung dịch : NaOH. C. b. D. C. Dung dịch : KOH. B. B. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép. Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau : 94 . dung dịch AgNO3. Fe2O3(2). B. Crom là kim loại có tính khử mạnh hơn sắt. Không xác định được. Cu2O(2). Câu 7. H2SO4 loãng. Chất có % khối lượng đồng lớn nhất là……………. Chất có phần trăm khối lượng sắt nhỏ nhất là………… Câu 7. D. Câu 7. B. C. CuS(3).15 Cho biết câu sai trong các câu sau : A. C.A. Câu 7. Chất có phần trăm khối lượng sắt lớn nhất là………… b. dung dịch NaOH.. Giảm đi. NH3. B.13 Có 2 lá sắt khối lượng bằng nhau.14 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất : FeO(1). HCl. Fe3O4(3). Cả A. B. Ag có khả năng tan trong dung dịch FeCl3. a. Câu 7. Cu2S(4). Câu 7. dung dịch H2SO4. B.12 Cho biết câu nào không đúng trong các câu sau: A. Kim loại Cr có thể cắt được thuỷ tinh. FeSO3(8). Al-Cu. Fe2(SO4)3(7). C đều đúng.

3. HCl. C. 2. 10. 2. Ngâm lá sắt vào dung dịch. 1. CuSO4 có thể dùng làm khô khí NH3.3584 lít. 0. 8. Câu 7. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ? A.672 lít. Chọn câu đúng trong các câu sau : A.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi. D.52g hỗn hợp A) lần lượt là A. B. Ngâm lá kẽm vào dung dịch. 0. C. C. Mg.48 lít. Fe2O3.36 lít. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư.5 mol. Câu 7. 54. 0.A. B. [Ar]3d2. 3.52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi. FeCl3.22 Cho 2. [Ar]3d4. Phần 1 tác dụng hết với dung dịch HCl thu được 2.84g muối sunfat. xăng.6g. B. Đốt cháy hết phần 2 trong oxi thu được 4. số gam của Fe.36. C.100g. Trong hỗn hợp A mỗi oxit đều có 0.20 Cấu hình electron của Cr3+ là phương án nào ? A. Dung dịch thu được sau phản ứng gồm các chất A. Al.25 Cho Fe tác dụng với dung dịch H2SO4 loãng.448 lít.84. [Ar]3d5.19. FeCl2. 0.36. Khối lượng sắt tham gia phản ứng là bao nhiêu ? A. D.2857g.26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO 4. 2. sấy khô. D. chia làm 2 phần bằng nhau.16 lít. HCl. D. dung dịch thu được cho bay hơi được tinh thể FeSO4.16. cân nặng 4. C. Khối lượng của hỗn hợp A là bao nhiêu gam ? 95 .252g.16. Câu 7. Câu 7. Khối lượng mol của M. Zn. [Ar]3d . CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả. C. C. FeCl2.23 Cho 1. C. 0. M (trong 5.999g. FeCl3. thu được 6. Ngâm lá đồng vào dung dịch. 18. Câu 7. 4. D. Câu 7.16.7H2O có khối lượng là 55. Fe3O4. Cu có thể tan trong dung dịch AlCl3. 27. D.0896 lít. 3.3999g .16M và H2SO4 0. B. B. Cu có thể tan trong dung dịch FeCl2. Kim loại đó là kim loại nào ? A.68.33 lít. Cho AgNO3 vào dung dịch. 27. 3.36g hỗn hợp gồm Fe3O4 và oxit của M.52g một kim loại tác dụng hết với H2SO4 loãng.27 Hỗn hợp A gồm FeO. 1. FeCl2. D. B. D. HCl. B. Câu 7. B. FeCl3.36.016 lít hiđro (đktc). Fe.4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15. Thể tích khí (ở đktc) là A. sau một thời gian lấy đinh sắt ra. 2. Câu 7. B. D.24 Lấy 5. 7. 0. Câu 7. 3 C.92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0.

5 lít.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%. 464. D. 0. Đáp số khác. Câu 7.68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra. Khối lượng muối sunfat khan thu được là A. B.8g đồng trong không khí thu được chất rắn X. Giá trị của m là A. 0.56.2 g/ml) đã tác dụng với thanh đồng là A.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H 2SO4 loãng thu được 560ml khí ở đktc. 0. 25. D. D. 10. Na2Cr2O7 đã hết.65. B. 25. C.34 Đốt 12. 22. Câu 7. 50.2. Khối lượng chất rắn X là A. C. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO 4 96 .2g kim loại M tác dụng với dung dịch HNO3 loãng. Thể tích dung dịch AgNO3 32% (D=1.24 lít. Đáp số khác. 177 lít. D. Câu 7.32 Cho 19. Câu 7. 30. 20. D. Câu 7.35 Đốt 12. D. 15.12 lít. ZnO.9333 lít D.69. Na2Cr2O7 còn dư 0. Biết hiệu suất của quá trình 96%.52g. 0.8g đồng trong không khí thu được chất rắn X. Hoà tan chất rắn X trên vào dung dịch HNO3 0.405g D. Câu 7. Fe.5M thu được 448 ml khí NO (đktc). 177 ml. B. 88. 21. C. C. B. Na2Cr2O7 còn dư 1 mol. Mg.5M thu được 448 ml khí NO (đktc). 35. B.8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171.56. 2. CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0. 3. C. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư. Khối lượng kết tủa thu được là bao nhiêu gam ? A. 3.36 Cho 1. 16g. Zn. 88. B. Cr2O3 và 48g oxi. Phản ứng này không thể xảy ra.5 mol. B. C. 54.08g.84 lít. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ? A.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O.8 lít.A. 1. B. 15.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao. Câu 7. C. C.36 lít. Hoà tan chất rắn X trên vào dung dịch HNO3 0.31 Một thanh đồng nặng 140. Vậy: A. C. D. Câu 7. dư thu được 4. 22.65. C.405g hỗn hợp Fe2O3. Cu. 21.48 lít khí duy nhất NO (đktc). Câu 7.5 ml. B. Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là A. 232. Câu 7.1M. 116.2g. B. M là kim loại nào ? A.33 Cho 7.4.04 lít. C.

Câu 7. B. Cr và Al trong hợp kim lần lượt là A. Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4. B. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là A. Đáp số khác.5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6.4g.8g. Thành phần phần trăm của Fe. Không xác định được. Cu. 70%. 11.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X. D. C. Câu 7. B. B.98 lít khí.2g. Sau phản ứng thu được 1. 60g. D. 3. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22. n) là 82. 85%. B. nếu sục thật 97 . 55. 15%.43 Nhúng thanh sắt vào dung dịch CuSO4. B. 80%.24% khối lượng. D. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4. Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là A. cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1. 80%.8 lít khí. 2. p. Tên của kim loại đã dùng là A.5g. Fe2O3. 2.72 lít (đktc). B.5g.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra. crom.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e. Câu 7. Câu 7. 4. 3. Câu 7. D. 10. 14g. 1.8g.40 Cho 100g hợp kim gồm có Fe.36 lít.41 Hỗn hợp X gồm Cu và Fe.2g. Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38. 1. C photpho. 83%.8g. C. 5%. đem hoà tan vào dung dịch HCl thấy bay ra 0. 1. Hiệu suất của phản ứng khử CuO là A.thì thu được một chất rắn.4. 4%. Giá trị của V là bao nhiêu ? A. Fe3O4.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32. Câu 7. Cho 14. 2.38 Khử 2. B.95%. D. 4. D.6. sắt. 84%.448 lít khí (đktc). trong đó Cu chiếm 43.76g chất rắn. 75%. Câu 7. FeO. D. 19. B. Oxit sắt đó là ? A. 28g. Fe. Câu 7. 4%.4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1. C. 2. brom. C.2. 32g.8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra. C. Các khí đo ở đktc. C.8. 50g. 60. 84%. sau một thời gian lấy thanh sắt ra rửa sạch.24 lít. Zn. Al. 13%. Nguyên tố X là A. 9. Mặt khác. Câu 7. sấy khô thấy khối lượng tăng 1.05%.48 lít. 4.48 lít NO (đktc). C.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X. C. D.12 lít. D. Có bao nhiêu gam Cu đã bám vào thanh sắt ? A. 12%.4g.

4%.48 lít khí CO2 (đktc) thoát ra. Sau khi phản ứng kết thúc. 4. Câu 7. 6.53 Khử 9. C. B.61g kết tủa trắng. C.24 lít.24 lít. nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6. Đáp số khác.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH. sau đó làm bay hơi 98 .4 lít. FeCl2. B. 6.42%. Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là A. C. B. B.8 at) thoát ra.0053 lít. Không xác định được.36 lít.48 lít. 42g.2g Cu vào dung dịch HNO3 loãng. thu được chất rắn có khối lượng 11.72 lít. Cả FeCl2 và FeCl3. Câu 7. D. thu được sắt và 2.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là A. Công thức của muối sắt là A.47 Một dung dịch có hoà tan 3. 0. 5. 5. Đáp số khác. B.6492 g AgCl. Thể tích CO (đktc) đã dùng là A. 4 lít. C. 27g. 8.89g.48 lít.72 lít.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư. 0. FeCl3. D. m có giá trị là A. Cả FeCl2 và FeCl3. D. Câu 7. B. 1. 3. B. C. 27g. Câu 7.12 lít. 6.196 lít khí CO2 (0oC và 0. 2. Câu 7. 3. 0.672 lít. thấy có 0. 46.chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m 1 + 1. 22. 0. Câu 7. B. D. C. FeCl2. D.88g nước. 69.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO. Những chất còn lại sau phản ứng.42)g muối khan. nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26. Fe2O3. 4.2g. C. 6. D. FeCl3.88 lít hiđro (đktc). 69. Fe3O4 thấy có 4.25g sắt clorua tác dụng với dung dịch AgNO 3 dư tạo ra 8. C. D. 4. chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO 3. Công thức của muối sắt đã dùng là A.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí.84%. Thể tích hiđro đã dùng (170C và 725mmHg) là A. 9g. Thể tích CO (đktc) đã tham gia phản ứng là A.6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO 3 tạo ra 2. Không xác định được. B.4g. Thành phần phần trăm cacbon trong mẫu thép là A.36 lít. 2.584 lít.48 lít. D. 3.08g. Câu 7.6g.54 Hoà tan hoàn toàn 19. Câu 7.6g.64g.92g. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3. Câu 7.72 lít hiđro (đktc). C. 16g. D.

C. Hoà tan X bằng dung dịch HCl dư. Các khí đo ở đktc. rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn.61 Để khử ion Fe3+ trong dung dịch thành ion Fe2+ có thể dùng một lượng dư A.02. C. B.59 Cho sơ đồ phản ứng sau : Cu + HNO3  → muối + NO + nước.4g. 8. Câu 7. Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc). 99 . B. V1>V2. D. Fe và Sn. Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là A. nhôm trong hợp kim lần lượt là A. 3 và 2.1 mol Fe2O3 và 0. 48. 2. II – BÀI TẬP NÂNG CAO Câu 7.448 lít khí không màu hoá nâu trong không khí (đo ở đktc). C. 60%. 0. thu được chất rắn có khối lượng là 0. D. 68%. Câu 7. 0. 3 và 3. Câu 7. Câu 7. D. B.4g. Câu 7. Phần trăm về khối lượng của đồng. D.1 mol Fe3O4. thu được dung dịch Y. D. kim loại Mg. 3. 40. D. B. sắt và đồng thành 2 phần đều nhau. 4. B. C. còn hợp chất Cr(VI) có tính oxi hoá mạnh.dung dịch và đun nóng.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO 3 thấy thoát ra 0. . kim loại Cu. 4. Hợp chất Cr(II) có tính khử đặc trưng. Câu 7. Câu 7.58 Chia 4g hỗn hợp bột kim loại gồm nhôm. 0.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb.02.63 Chỉ ra câu đúng trong các câu sau : 1. V1<V2. Thêm dung dịch kiềm vào muối đicromat. Đáp số khác. 40%. 40%. D.01. D. Giá trị của m là A. Fe và Ni. 60%. số cặp kim loại trong đó Fe bị phá huỷ trước là A. Mối liên hệ giữa V1 và V2 là A. Đáp số khác. Fe trong 4g hỗn hợp lần lượt là: A. Không đủ cơ sở để so sánh. 0. C.Phần 2 : tác dụng với lượng dư dung dịch NaOH.02.Phần 1 : tác dụng với lượng dư dung dịch HCl.01. Khi nhúng các cặp kim loại trên vào dung dịch axit. Lọc lấy kết tủa. Khối lượng muối khan thu được sau phản ứng là A. kim loại Ba. C. thu được 560ml hiđro. 0. 3 và 8. C. 32. . thu được kết tủa Z. kim loại Ag.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V 1 lít khí (đktc). B.01. 68%. 32%.72g. muối này chuyển thành muối cromat. 1.57 Chất rắn X gồm 0. Số mol của Al. Cho NaOH vào Y. 64. thu được 336ml hiđro. B. 5.84g. 2. V1=V2. B. 3 và 6. 32%. 0. C.

5. 2. Công thức phân tử các chất A. 2. D.3. (4) X2 + NaOH → X5  NaCl. 8. 5. D. B. -0. K2Cr2O7. CrO. (2) X1 + HNO3 → X4 + NO2 + H2O. 5. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ. C. 2. màu của dung dịch dần dần trở lại đỏ cam. 74 V. 8. A. Nếu cho thêm vào một lượng KOH. Cr2O3. Fe3O4. C. K2CrO4. 8. 1. X2. Câu 7. Fe2O3. Na2CrO4. 7. 7. 7. X4. Nếu thêm vào đó một lượng H 2SO4. 3. (3) X2 + Cl2 → X3. 1. Biết 0 ECr 3+ / Cr = −0. Fe(NO3)2. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy. Na2Cr2O7. Suất điện động chuẩn của pin điện hoá là A.64 Cho từng chất Fe. Cr2O3. B và C lần lượt là : A. D. 0. B. C. hệ số của ion Cr3+ sẽ là A. 8. 7.68 Cho sơ đồ phản ứng : Cr + Sn2+  → Cr3+ + Sn (1) Cr + Cu2+  → Cr3+ + Cu (2) a.66 Dung dịch X có màu đỏ cam. 3. FeCO3 lần lượt phản ứng với HNO3 đặc nóng. B. C. X3. 3. B. 100 . 3. Cr2O3. 3. 5. 4. Kim loại crom có thể cắt được thuỷ tinh. Cr(OH)2 đều có tính chất lưỡng tính. K2CrO4. + (5) X4 + NaOH → X6  + NaNO3. 8. Câu 7. KCr2O4. chất B tác dụng với axit chuyển thành chất C có màu da cam. 6. D. H2CrO4. 6. Khi cân bằng 2 phản ứng trên. Các hợp chất CrO. Cr(OH)2 tác dụng được với dung dịch HCl còn CrO 3 tác dụng được với dung dịch NaOH. B. Fe(NO3)3. K2CrO4.khử là A. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước. 6. Crom là kim loại có tính khử mạnh hơn sắt. Cr2O3. 4. X5. 2. 6. 4.6 V. Fe(OH)3. Dung dịch X chứa chất có công thức phân tử là A. Fe2(SO4)3. Câu 7. Số phản ứng thuộc loại oxi hoá.67 Cho các sơ đồ phản ứng : (1) X1 + HCl → X2 + H2. (7) X5 + O2 + H2O → X6 Các chất X1. Na2Cr2O7. 5. K2Cr2O7. 8. X6 lần lượt là X1 A B C D Cu Fe Fe Fe X2 CuCl FeCl2 FeCl3 Fe(NO3)3 X3 CuCl2 FeCl3 FeC2 FeCl3 X4 Cu(NO3)2 Fe(NO3)3 Fe(NO3)3 Fe(NO3)2 X5 CuOH Fe(OH)2 Fe(OH)2 Fe(OH)3 X6 Cu(OH)2 Fe(OH)3 Fe(OH)3 Fe(OH)2 Câu 7.88 V. 1. Câu 7. 5. Các hợp chất Cr2O3.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. Na2CrO4. b. Cr(OH)3. Fe(OH) 2. D. C. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1). K2Cr2O7. B. màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. FeO. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo. FeSO4.

72. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M. 113. -0.03M là A. Nếu lấy quặng hematit trên đem luyện gang.82 tấn.9g. sấy khô. đem cân thấy lá kẽm có khối lượng là A.4 V. 0. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là A.00375 mol. Giảm 1. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0.6 V. 0. C.69 Hoà tan 58g muối CuSO4.0075 mol. 0. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ? A. 6 tấn.272g. Câu 7. Suất điện động chuẩn của pin điện hoá là A. B.08 V. D. a.856g. C. Đáp số khác. D. C. 0. c. B.725 M.3265 tấn. Tăng 22.C.5 tấn. 16. 57%. Phần trăm theo khối lượng FeSO4 tinh khiết là A. b.2 tấn. 101 .1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%) A. D.856g. 0. Sau phản ứng. B. Biết 20 cm3 dung dịch này được axit hoá bằng H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0. 1. C. D. D. 1.8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87. 1.73. 0. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2). 0.5%) là : A.88 V. được 200 cm3 dung dịch. 2 tấn. 2. Câu 7.03 M. C. C. -0.464 M.8 tấn. C. Câu 7.7%.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước. B. D. Đáp án khác. 0. 12.432 M.8 V.68g.00075 mol. rửa nhẹ. 3. B. Câu 7. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu : A. b. Tăng 1. B. 74 V. 139. 2.4 tấn. C. 90g. Câu 7. Đáp số khác. Biết 0 ECr 3+ / Cr = −0. B. D. Đáp số khác. B. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là A. được 500 ml dung dịch. b. 0. a. rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0. D.1g. Đáp số khác. Cho dần dần mạt sắt đến dư vào phương trình trên. 5. Đáp số khác. 21%. a.21g. D.02625g. -0.71 Khối lượng quặng chứa 92. 0. 74g.5H2O trong nước. 0. lấy lá kẽm ra khỏi dung dịch.28 tấn. 1.9g. C. B. D. B. C.4 V. c.5 tấn. D. 11.

12.84 lít. A. Giá trị m và nồng độ dung dịch HNO3 lần lượt là A.2M. B. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. Tính khối lượng m1. 10. FeO và Fe2O3. m2. B.62. Câu 7.72 lít khí (có màu nâu đỏ) duy nhất (đktc). Giá trị của m là A.7. Câu 7.74. 56 lít. Cho 23.08g.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3. Câu 7. B.8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+. 20.80.6M. 200ml.22g hỗn hợp X gồm Fe.5g.22.2g gồm Fe. 10.75. 2.5g. C. 9. khí CO 2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH) 2 thu được m2g kết tủa trắng.98. sắt. 1: 3. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư).76.88g. Ni.68 lít.04g. 127.52. C. Lấy m1g X cho vào một ống sứ chịu nhiệt. C. D. B. D. 2.24 lít khí NO duy nhất (đktc). Pb.36 lít. Fe2O3. Nung m g bột sắt trong oxi. 6. 10.56 lít (đktc) NO (là sản phẩm khử duy nhất). 5. 1: 6.2 mol FeS2 và 0.81. 10. thu được 1. 63.768 lít.3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất).344 lít hiđro (đktc) và dung dịch chứa m g muối. 1.88g. Câu 7. Tỉ lệ là m2 A. Fe3O4.12 lít. 3. 1M. Hoà tan hoàn toàn 3. 20. D. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19. 1.04g. B.78. D. B. FeO. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư.5M. bạc. nung nóng rồi cho một luồng khí CO đi qua. B. B. Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng. 2. CuO.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4. PbO bằng khí CO ở nhiệt độ cao. đồng. B. thu được 3g hỗn hợp chất rắn X.44g. 10. Thể tích khí CO phản ứng (đktc) là A. Khử 16g hỗn hợp các oxit kim loại FeO. Giá trị của V (ở đktc) là A.77.27. Cho 40g hỗn hợp vàng. 8.685g D. thoát ra 0. 5. Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là A.52. Fe3O4) với số mol bằng nhau. 0. 20. D. Cr. Câu 7. D. 10. C.5H2O cho m1 vào m2g dung dịch CuSO4 8%. kẽm tác dụng với oxi dư nung nóng thu được 46. 1: 4. 1: 5.24 lít.08g.32. Hoà tan hết hỗn hợp gồm 0. 400ml.25. Kim loại X là A.685g. C. Câu 7.72 lít.4g chất rắn X. cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6.44g. C. D. khối lượng chất rắn thu được giảm 4. 2. 3. Câu 7. 7. Giá trị của m là A. B. 2. 102 . 300ml. C. C. 10.8g. Câu 7. Sn. 100ml. D. 20. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2.

Mg. Bari D. thu được 5g kết tủa.04g. C. 19. A. Fe2O3. 5. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3.344 lít. 5. 16. A. X là A. FeO. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH) 2 0.1g. C. thu được 3.00g. Câu 7. C.18g.136 lít khí (đktc) và m g muối sunfat.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy).36 lít khí SO2 duy nhất (đktc).1M. Câu 7.05 và 0. D.2g B. 1. B.16g. 0. Giá trị của m là A.85g kết tủa.12 lít. 6.24 lít. C. Zn.56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2. Câu 7. 0. Zn và Fe bằng dung dịch HCl. C. 1. m nhận giá trị bằng A. Câu 7.6g.74g.3g hỗn hợp kim loại gồm Mg. 0. Fe3O4. 19. 0. 32. B. 1.0g C. thu được V lít khí (đktc) và 3. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4. Số mol khí CO2 thu được là A. Công thức của sắt oxit là A.91 Hoà tan hết 5. D.48 lít. A.1M.62g chất rắn. 3.64g D. 2.Câu 7. 8. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16. D. B. 11.7g muối khan. 103 . 4. C.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy). 10.075 mol. 8. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7.025 mol.76g kết tủa trắng. Tính khối lượng m của X. Al.5M và KNO3 0.85 Cho 4.36 lít. 4.1M. B.224 lít. 2.72g hỗn hợp kim loại gồm Mg. Câu 7.00g. D. D. 15.05 và 0. Beri Câu 7.2g Cu vào 1 lít dung dịch gồm H2SO4 0.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại. HCl. Al) bằng oxi thu được (m +1.448 lít. 18. C. Al và Fe bằng dung dịch H 2SO4 loãng.92 Hoà tan hết 1. Fe2O3. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15. B. 5. Chưa đủ dữ kiện để xác định. 0.84 Để mg phoi bào sắt (X) ngoài không khí. sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO. B. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12. 0. D. Magie C. HBr) thì thể tích H2 (đktc) thu được là A. V nhận giá trị bằng A. D.86 Cho 19.9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao. m có giá trị là A.85g muối clorua khan.05 mol.15 mol. 7.89 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt.36 lít.3g.688 lít.26g Câu 7.2M. Câu 7.2g. 4.48 lít.02g.6)g oxit. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0.83 Đốt cháy hết mg hỗn hợp A gồm (Zn. 2. B. Thể tích khí NO duy nhất thu được ở đktc là . 3. Canxi B. Mặt khác. thu được 9. thu được 5g kết tủa.08g. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0.25g muối khan. C.12 lít. 1.24 lít. Fe3O4.016 lít khí (đktc). C. Câu 7.

4256 lít. B. B. 5.18 D 7.94.23 C 7. x = 0. 0.1 mol.03 và y = 0. 1. Câu 7.032g hỗn hợp các oxit (hỗn hợp X). 4. 22g.3g.19 C 7.0336 lít. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VII 7. Câu 7. B. Chưa thể xác định.2 mol và 2 anion Cl. Khử hoàn toàn 4.5g.896 lít. Cho 2. b/6 c/1. Câu 7.2g. D. B. Câu 7. 20g.3 và y = 0.12 khí (đktc) và dung dịch X. Tính a ? A.102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian. thu được 46. MgO.48g.27 A 7.6 lít SO2 (đktc).96.99 Cho CO qua ống sứ chứa 15. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0. Thể tích khí NO duy nhất bay ra (ở đktc) là A.14 C a/1.21 D 7.26 A 7. C.y mol.45g.10 D 7. x = 0. Câu 7. SO42. Không xác định được.016 lít H2 (đktc).5 B 7.896 lít. 7.7 C 7.4 B 7. D.98. Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là A.97 Cho 1. 10 g. 0. B. C. C.24 A 104 .2g hỗn hợp CuO. 5.0224 lít.20 C 7. Hoà tan X bằng dung lịch HNO3 loãng.6g rắn X và hỗn hợp khí Y.4 7. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5.2g. 0. Al3+ 0.728g bột Fe ta thu được 1.16g. Giá trị m là A.13 7. Câu 7.22 C 7. Câu 7.x mol.15 B 7. sau một thời gian thu được 13.30 C 7.84g Fe và 0. Al. Tìm công thức của oxit. D.016g hỗn hợp các oxit sắt (hỗn hợp X). Oxit khác.4g.Câu 7.344 lít H2.8 D 7.03. 5. FeO. C. 8g.81g hỗn hợp các oxit Fe3O4.88g khí CO2. Fe2O3.336 lít.6 C 7.02 và y = 0.17 a/2.100 Oxi hoá hoàn toàn 0. Zn tan hết trong dung dịch HCl thì thu được 1.525g. 1. x và y có giá trị là A.2 và y = 0.11 B 7. Một dung dịch có chứa 2 cation là Fe2+ 0. D. Cô cạn x thu được m g muối. 5. C.672 lít. B. D. Sục Y vào dung dịch nước vôi trong có dư. 24g. FeO nung nóng.792g hỗn hợp bột gồm Fe và Cu ta thu được 1.16 B 7. CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0. 7. 6. Câu 7. người ta thu được 6.448 lít khí NO duy nhất. dư. D.9 A 7. Fe2O3. 0. và sắt dư.2 B 7.12 D 7. thu được mg kết tủa Z. D. Nung nóng 16.8g.8g một oxit của kim loại M thành kim loại cần 2. C.3 . C.3 B 7. b/7 7. m có giá trị là A.8g bột sắt ngoài không khí. Kim loại thu được đem hoà tan hết bằng dung dịch H 2SO4 loãng thấy tạo ra 1. 3.25 C 7. Khi cô cạn dung dịch. sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt. Giá trị của m là A.75g hỗn hợp gồm 3 kim loại Fe.336 lít. Kết quả khác.29 A 7. D. B. x = 0.5 g. C. D.28 D 7.72g.2.101 Oxi hoá hoàn toàn 0.1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ? A.02.72g hỗn hợp gồm 4 chất rắn khác nhau. Câu 7. 5 g.1 B 7. Fe3O4. 0. 3. 0. 26g. 1. 0.95. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0.93. m có giá trị là A. B. x = 0. D. A.21g .375g. B. C. 0. 8.9g chất rắn khan. C. B.

46 C 7.83 B 7.a A 7.63 A 7.96 C 7.79 D 7.88 B 7.90 A 7.97 C 7. 0.89 C 7.41 D 7.59 D 7.48 B 7.78 B 7.56 A 7.35 B 7.85 A 7.99 A + 7.82 A 7.81 C 7.42 B 7.c B 7.53 B 7.91 C 7.76 A 7.102 C 7.68.016(mol) 105 .36 C 7.60 A 7.95 C 7.61 B 7.58 A 7.b B 7.80 A 7.49 D 7.92 B 7.03(mol) − 3Cu + 2NO3 + 8H 0.72.75 A 7.64 D 7.100 D 7.32 B 7.a A 7.57 A 7.87 C 7.50 B 7.34 A 7.38 B 7.68.67 B 7.37 A 7.73 A 7.52 B 7.94 C 0.40 A 7.51 B 7.93 C 7.7.39 A 7.65 B 7.70.33 C 7.71 B 7.98 B 7.45 D 7.69.08(mol) → 3Cu 2+ + 2NO + H2 O.70.b C 7.016(mol) 0.44 B 7.47 B 7.74 D 7.101 D 7.a B 7.c B 7.70.66 A 7.a B 7.43 D 7.77 C 7.b C 7.68.55 C 7.69.54 B 7.86 C 7.72.62 D 7.84 D 7.b C 7.31 B 7.

Nhận biết một số anion Tt Anion Thuốc thử Dấu hiệu 1 OH– Quỳ tím Hoá xanh SO32– HSO3– + 2 H CO32– HCO3– SiO32– 3 SO42– Ba2+ 4 S2– Cl– Ag+ Br– I– 5 PO43– 6 NO3 – Phương trình phản ứng SO32– + 2HCl → SO2 + H2O CO32– + 2HCl → 2Cl– + CO2 SO2 làm mất màu dung dịch KMnO4 CO2 làm vẩn đục dung dịch Ca(OH)2 trong SiO32– + 2HCl → H2SiO3 + 2Cl– Ba2+ + SO42– → BaSO4↓ 2Ag+ + S2– → Ag2S↓ ↑ SO2 ↑ CO2 Ag+ 7 ClO3– 8 NO2– H2SO4 loãng. vụn Cu Cô cạn. 3NaNO2 + H2SO4 (l) → Na2SO4+NaNO3+2NO↑+H2O H2SO4 (l) + O2 KK to.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. to O2↑ (que đóm t0 có MnO2 2KClO3  2KCl + 3O2↑ → bùng cháy) x. ↓ keo trắng ↓ trắng ↓ đen ↓trắng vàng nhạt Ag+ + X– → AgX↓ vàng ↓ vàng (tan 3Ag+ + PO43– → Ag3PO4↓ trong HNO3) (↑) nâu NO2 3Cu+8H++2NO3–→2Cu2++2NO+4H2O dung dịch Cu2+ (2NO + O2 → 2NO2) xanh 106 .CHƯƠNG VIII. PHÂN BIỆT MỘT SỐ CHẤT VÔ CƠ & CHUẨN ĐỘ DUNG DỊCH A.t. không ↑ NO2 nâu NO  NO2↑ (nâu) → khí Dùng phân biệt NO2– và NO3– (vì NO3– không có phản ứng này).

to − ↓ đỏ máu ↓ đỏ nâu NH3 ↑ khai. tan ngay khi (OH–) dư dd H2S PbS ↓ đen − OH − 3  Cr 3+  Cr (OH )3 ↓   Cr ( OH )6 − → →     18 Pb 2+ (dd màu xanh) Pb + S → PbS↓ (màu đen) 2+ 2− 107 . Nhận biết một số cation Stt ion 1 2 3 4 Li Na+ K+ Ca2+ + Thuốc thử Dấu hiệu Đốt trên ngọn lửa vô sắc − Phương trình phản ứng (phương pháp vật lí) 5 Ba2+ 6 Ca2+ 7 Ba2+ 8 Mg2+ SO42 9 Cu2+ 10 Fe2+ − 2+ OH 2 Cu + 2OH → Cu(OH) ↓ (riêng với Fe3+ đặc +2 NH + 2H O Cu 2+  Cu(OH)2 ↓ → trưng nhất −2NH là dùng ion 2+ +4NH  [ Cu(NH 3 )4 ] → −2OH thioxianat SCN-. làm xanh quỳ ẩm) Fe + 3SCN → Fe(SCN) ↓ đỏ máu − Fe3+ + 3OH → Fe(OH)3↓ đỏ nâu NH4+ + OH → NH3↑ + H2O +3OH Al3+  Al(OH)3 ↓ → + OH  [ Al(OH) 4 ] → - 3+ 3 − - 13 Al3+ − 14 Zn 2+ 15 Be2+ 16 Pb2+ 17 Cr 3+ OH từ từ đến dư − +2OH ↓ trắng tan Zn 2+  Zn(OH) 2 ↓ → ngay khi 2− + OH  [ Zn(OH) 4 ] → OH– dư + OH − Be2+  Be( OH )2 ↓  BeO 2 − → → 2 Pb2+ →Pb(OH)2↓ →PbO22 ↓ xanh. còn Fe2+ làm KK 2 + OH − mất màu Fe     Fe OH2 → ( ) ↓    Fe OH3 đỏ↓nâu →( ) dd thuốc ↓ trắng xanh − 2+ + 2+ 3+ MnO4 + 5Fe + 8H → Mn + 5Fe + tím khi có + + 4H2O mặt H ).2. Ca2+ + SO42 → CaSO4↓ (it tan) − Ba2+ + SO42 → BaSO4↓ − Mg2+ + 2OH → Mg(OH)2↓ − 11 Fe3+ 12 NH4+ OH . − 3 4 + 2 3 - − Đỏ thẫm Vàng tươi Tím hồng Đỏ da cam Lục (hơi vàng) ↓ trắng ↓ trắng ↓ trắng ↓ xanh (nếu dùng dd NH3 thì tạo kết tủa xanh sau đó tan tạo ion phức màu xanh thẫm đặc trưng.

108 . điện phân) để phân biệt chúng thì chất khí phải chọn là A. NaHCO3. Na2CO3.3. Nhận biết một số chất khí Stt Khí 1 Cl2 2 I2 3 SO2 4 H2S 5 HCl 6 NH3 7 NO 8 NO2 9 CO 10 CO2 11 O2 12 Hơi H2O Thuốc thử Dung dịch (KI + hồ tinh bột) Hồ tinh bột Dấu hiệu Phương trình phản ứng Không màu Cl2 + 2KI → 2KCl+ I2 + I2 → hoá xanh (Hồ tinh bột) → xanh Không màu → hoá xanh SO2 + Br2 + 2H2O → 2HBr + H2SO4 5SO2+2KMnO4+ 2H2O → 2H2SO4+2MnSO4+K2SO4 Pb2+ + H2S → PbS↓ + 2H+ Ag+ + Cl– → AgCl↓ NH3 + H2O→ NH4OH NH3 + HCl → NH4Cl 2NO + O2 → 2NO2 3NO2 + H2O → 2HNO3 + NO dd Br2 hay Mất màu dd KMnO4 dung dịch dd Pb(NO3)2 dd AgNO3 Quỳ tím ẩm HCl (đậm đặc) Không khí Quỳ tím ẩm dd PdCl2 (hay + CuO đen) Cho ↓ đen Cho ↓ trắng Hoá xanh Tạo khói trắng Hoá nâu Hoá đỏ Tạo ↓ Pd CO + PdCl2 + H2O → (hoá đỏ Cu) Pd↓ + 2HCl + CO2↑ CO2 + Ca(OH)2 → CaCO3↓ + H2O t 2Cu + O2  2CuO → 0 ddCa(OH)2 Vẩn đục Cu (đỏ). to Hoá đen CuO Trắng hoá xanh 13 H2 14 SO3 15 N2 CuSO4 khan CuO (đen) Hoá đỏ (Cu) to Dung dịch Kết tủa BaCl2 trắng BaSO4 (còn lại sau cùng) CuSO4 + 5H2O → CuSO4. O3. BaSO4. B. nếu chỉ dùng H2O và một chất khí (không dùng nhiệt độ.1 Có 4 mẫu chất rắn màu trắng BaCO3.5H2O t CuO + H2  Cu↓ + H2O → 0 SO3 + H2O → H2SO4 H2SO4 + BaCl2 → BaSO4 + 2HCl B .BÀI TẬP TRẮC NGHIỆM Câu 8. CO2.

dd HNO3 đặc.10 Để thu được Al(OH)3 từ hỗn hợp bột Al(OH)3. CO2. SO2 ta có thể dùng thuốc thử là A. quỳ tím. chỉ cần dùng duy nhất một dd là A. dd ammoniac. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. C. D. ta có thể dùng dd A.7 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là NaAlO2. B. C. Câu 8. dd H2SO4 đặc nguội. H2. D. D. D. Câu 8. Có thể sử dụng thuốc thử nào sau đây đề phân biệt các lọ dung dịch trên? A. Cả A. Mg và Al 2O3. HNO3 . Cu(OH)2. H2O D. Câu 8. đồng sunfat khan. axit clo hiđric. NaCl. Dùng 2 hoá chất nào trong các cặp hoá chất sau đây để có thể phân biệt được các dd trên? A. C. C.5 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH.11 Có 4 ống nghiệm bị mất nhãn.C. Al. B. KCl. H2SO4 loãng. C đều đúng. dd BaCl2 và dd Br2. NH3. dd HNO3.6 Có 5 dd đựng trong 5 lọ mất nhãn là FeCl3. H2SO4. D. Câu 8. bari clorua. Na2CO3. H2SO4 đặc nguội. D. B.1M). NaOH. NaNO3. B. C. thuốc thử được chọn là A. để nhận biết 4 chất lỏng trên. AgNO3. D. CO2 và H2O. HCl. dd PdCl2 và dd Br2. nguội. Câu 8. dd HCl. B. NH4NO3. Câu 8. NaOH. Dung dịch Ba(OH)2 và dd AgNO3. Dung dịch AgNO3 và dd phenolphthalein. kali hiđroxit. Fe3O4 và FeO người ta dùng A. Câu 8. B. Giấy quỳ tím và dd Ba(OH)2.3 Để loại bỏ Al ra khỏi hỗn hợp Al. SO2. D. B. C. FeCl2. B. Quỳ tím. dd HCl. Câu 8. NaOH. AlCl3. axit sunfuric đặc. C. Zn(OH)2. không thể thực hiện được. KNO3. B. ta có thể dùng A. BaCl2. mỗi ống nghiệm chứa một trong các dd HCl. H2SO4 đặc nóng B.9 Để nhận biết 3 dd natri sunfat. chỉ cần dùng một thuốc thử duy nhất là A. vôi sống. dd KOH Câu 8. dd KOH. Na2S. dd BaCl2. NaCl.8 Để làm khô khí amoniac người ta dùng hoá chất là A. BaCl2. D. C. dd KMnO4 và dd Br2 C. Nếu chỉ được dùng một thuốc thử để nhận biết 5 chất lỏng trên. MgO.4 Để phân biệt 3 khí CO. CuO. P2O5. HCl.2 Có 4 lọ hoá chất bị mất nhãn đựng riêng biệt 4 dung dịch không màu sau đây: NH4Cl. 109 . kali sunfit và nhôm sunfat (đều có nồng độ khoảng 0. B. C. Câu 8.

HNO3 đặc nguội.2H2O). Cả A. Fe.16 Có 5 mẫu kim loại Ba. C đều đúng Câu 8. Ag. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. dd H2SO4. Br2 (Hơi) C. C. Để phân biệt 2 kim loại Al và Ag cần phải dùng A. Mg. Ba. B. C. Ag. Câu 8. Dung dịch kiềm. Ag. B. Một học sinh dùng các hoá chất dd NaOH. dd BaCl2. C. CaO. đá vôi. NO3-. Al. Mg. Chỉ dùng H2O và một khí X có thể phân biệt được cả 4 chất. P2O5. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Chỉ dùng thêm một hoá chất bên ngoài là dd H2SO4 loãng có thể nhận biết được tối đa bao nhiêu kim loại trong các dãy sau? A. Cu và vài giọt dd H2SO4đặc. Câu 8. Cu có trong mẫu Ag và không làm thay đổi lượng Ag. H2SO4 đặc nguội. B. chỉ 2 trong 4 dung dịch. HCl. B. C. FeCl3 Câu 8. CO2 B. Cu để chứng minh sự có mặt của các ion trong X. Al2O3. giấy quỳ B.18 Có 4 chất rắn riêng biệt gồm natri cacbonat. Câu 8. D. Ca(OH)2. Fe. 110 . người ta ngâm mẫu bạc này vào một lượng dư dd A. vì Fe2+ và Fe3+ khi tác dụng với kiềm tạo kết tủa có màu sắc khác nhau. C. D. dd AgNO3.12 Để chứng tỏ sự có mặt của ion NO3. chỉ một trong 4 dung dịch. HCl.19 Dung dịch X có chứa các ion: NH4+. Cl2 D. B. H2O. Kết luận đúng là A. đun nóng.D. Fe3+. Có thể nhận biết 3 lọ trên bằng 1 thuốc thử duy nhất là A. dd HCl. Fe. C. Fe. D. Ba. cả 4 dung dịch. dd NaOH. CuSO4 khan. tuỳ thuộc vào trật tự tiến hành các thí nghiệm. dd NaOH. C. Ag. cả 3 dung dịch. Mg. Câu 8.14 Có 3 lọ đựng 3 chất bột riêng biệt: Al.ta nên dùng thuốc thử là A. B. AgNO3. ta có thể dùng A. Ag. D. NO3. D.15 Cho các dd: AgNO3. Fe2+. natri sunfat và thạch cao sống (CaSO4.17 Để làm khô khí H2S. B. Fe3+. Al. D. Fe. Câu 8. dd FeCl2.trong dd chứa các ion: NH4+.13 Để loại bỏ tạp chất Fe. Câu 8. Giấy quỳ tím và dd AgNO3. Ba. H2SO4 loãng. Ba. X là A.

C. (3) nước cất có vài giọt quỳ tím. Al. Câu 8. cả A. Mg(NO3)2. D. (2). Các cách đúng là A. Fe(NO3)2. dd HCl. O2. B.23 Một học sinh đề nghị các cách để nhận ra lọ chứa khí NH3 lẫn trong các lọ riêng biệt chứa các khí N2. Fe(NO3)3. D. AgNO3. B.26 Tách Ag ra khỏi hỗn hợp bột gồm Ag. B. AlCl3. chỉ dùng AgNO3. KNO3. (1). B. C đều được. Fe(NO3)3 và Cu(NO3)2 là A. B. (3). dd NaOH. NaOH. NaNO3. (4) nước vôi trong. C. Na2CO3. (3).21 Để nhận biết trong thành phần của khí nitơ có lẫn tạp chất hiđroclorua. (4). (1). C. BaCl2. CO2 là: (1) dùng mẩu giấy quỳ tím ướt. dd AlCl3. Câu 8. D. ta có thể dẫn khí qua: (1) dd bạc nitrat. BaCl2. B. D. Fe(NO3)3. Ba(OH)2. (5). C. (5) mẩu AgCl. dd AgNO3 dư. chỉ (1).20 Có 4 ống nghiệm mất nhãn. chỉ cần dùng một hoá chất là A. Câu 8. Cl2. (5). (2). MgCl2. (1). (2) dd NaOH. (3) mẩu bông tẩm dd HCl đặc. D. C. giấy quỳ tím sau. dd muối Sắt(II) dư.D.22 Thuốc thử duy nhất dùng để nhận biết NH4NO3. Hoá chất cần dùng và thứ tự thực hiện để nhận biết các chất đó là A. Phương pháp đúng là A. (2). Al(NO3)3. AgNO3 sau. NaCl. (4). (3). D. Câu 8. 111 . (3). B. Có thể dùng thuốc thử nào sau đây để nhận biết chúng? A. dd NH3. H2SO4 (loãng). B. D. NaCl. Quỳ tím. dùng AgNO3 trước. có thể dùng chất nào sau đây? A. (2) mẩu bông tẩm nước. FeCl2 thì chọn thuốc thử là A. D.25 Chỉ dùng một dd làm thuốc thử để nhận biết các dd muối sau: Al(NO3)3. (1). dd NH4Cl. (NH4)2SO4. (3). (4). Ba(NO3)2. NH4NO3. Câu 8. (3). NaOH. Học sinh đó không chứng minh được sự tồn tại của Fe 2+ và Fe3+ vì chúng đều tạo kết tủa với kiềm. mỗi ống đựng 1 dd Na2CO3. (1). (3). MgCl2. HCl. Câu 8. D. CaCl2. (1). NaNO3. Câu 8. Cu. (2). C. NaCl. B. Cả A.27 Có 3 lọ mất nhãn chứa 3 dd riêng biệt HCl. NaAlO2. Ca(NO3)2. MgSO4. dùng giấy quỳ tím trước.24 Để thu được Al2O3 từ hỗn hợp bột Al2O3 và CuO mà khối lượng Al2O3 không thay đổi. Câu 8. B. dd muối sắt(III) dư. C. dd CuCl2 dư. MgCl2. (4) mẩu Cu(OH)2.28 Chỉ dùng Na2CO3 có thể phân biệt được mỗi dd trong dãy dd nào sau đây? A. C đều đúng. C. HNO 3. MgCl2. (1). C. Fe với khối lượng Ag không đổi. Câu 8. dd phenolphthalein.

dd Ba(NO3)2 vừa đủ. B. NH4Cl. dd HCl. và giấy tẩm dd muối X người ta có thể phân biệt 4 lọ chứa khí riêng biệt O2. B. BaCl2.37 Chỉ dùng duy nhất một dd nào sau đây để tách lấy riêng Al ra khỏi hỗn hợp Al. khí (3) là Cl2. dd Br2. B.Câu 8. O2. C. Câu 8. NH4Cl. NH3. Ba(OH)2. Ba. NH4Cl. X là muối CuSO4. dd NaOH. NaOH. Kết luận sai là A. dd HClđặc. D. dd BaCl2. Câu 8. ta dùng A. khí (3) làm giấy có tẩm dd muối X hoá đen.34 Có 5 lọ đựng riêng biệt các khí sau: N2. khí (2) là Cl2. X là muối CuSO4. Để xác định lọ đựng khí NH3 chỉ cần dùng thuốc thử duy nhất là A. dd Ba(OH)2.30 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là (NH4)2SO4. FeCl3.33 Để loại được H2SO4 có lẫn trong dd HNO3. Câu 8. NH4NO3.36 Chỉ dùng H2O có thể phân biệt được các chất trong dãy A. Na. (NH4)2SO4. NH4NO3. giấy quỳ tím. khí còn lại là N2. D. Ca với axit H2SO4 đặc. B. dd NaOH đặc nóng và HCl. kali sunfit. Câu 8. dd Ca(OH)2 . C. Câu 8. khí (2) làm mất màu của giấy. CuSO4.38 Để làm sạch quặng boxit thường có lẫn Fe2O3. dd NaOH đặc nóng và CO2. Thuốc thử có thể dùng để nhận biết ba dd trên đơn giản nhất là A. K. dd NaOH. dd AgNO3 vừa đủ. (NH4)2SO4. C. K. SiO2 dùng cho sản xuất Al người ta dùng chất nào trong số các chất sau đây là tốt nhất? A. dd Ba(OH)2. AgNO3. C. X là muối Pb(NO3)2. N2. D. CO2. C. Mg. Na. C.31 Chỉ có giấy màu ẩm. dd NaOH loãng và dd HCl.35 Chỉ dùng một thuốc thử duy nhất nào sau đây để phân biệt hai khí SO2 và CO2? A. nguội không thay đổi đáng kể nồng độ và không sinh nhiệt)? A. khí (1) là O2. D. C. C. B. AgNO3. B. dd H2SO4. B. D. người ta dùng dư hoá chất nào sau đây? A. Câu 8. B. Câu 8. H2O. để nhận biết 4 chất lỏng trên. HNO3 đặc nguội. chỉ cần dùng dd A. D. NH4Cl. B. Na. lửa.B. Na. NH4NO3. D. D. dd H2SO4 loãng. dd HCl. 112 . H2S và Cl2 do có hiện tượng: khí (1) làm tàn lửa cháy bùng lên. khí (1) là O2. Câu 8. K2SO4. Cl2. dd H2SO4 đặc nguội. Ca mà khối lượng Al không thay đổi (giả sử phản ứng của Mg. cả A. KOH. Câu 8. Ba.29 Để thu được Ag tinh khiết từ hỗn hợp bột Ag-Fe. C.32 Có ba dd kali clorua. dd Ca(OH)2 vừa đủ. B đều đúng. D. kẽm sunfat. quỳ tím ẩm. C. dd NaOH loãng và CO2. D.

BaCl2. D. Na2CO3. D. AgNO3. quỳ tím.14 8.17 8. dd CH3COOAg. C.25 B 8. C.Câu 8.26 C 8. dd KOH. nguội.16 B 8. B.21 C 8. axit sunfuric. chỉ cần dùng một chất duy nhất là A. B.7 A 8.43 “Để phân biệt các dd riêng biệt gồm NaCl.22 D 8. C đều đúng.44 Có các dd Al(NO3)3. dd HNO3 và dd Ba(OH)2.2 B 8.11 D 8. H2SO4.20 D 8.29 B 8. dd HCl.9 B 8. KOH ta có thể …”. Câu 8.30 A 8. Thuốc thử để phân biệt các dd đó là A. H2SO4 thì chọn A. Số dd không hoà tan được đồng kim loại là A.3 C 8. HCl. không cần dùng bất kể hoá chất nào. B. K2CO3. Y có thể dùng hoá chất nào sau đây? A. chì clorua. B. dd BaCl2. dd HNO3 đặc. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. LiNO3 (đều có nồng độ khoảng 0.41 Để nhận biết 4 dd: Na2SO4.13 D 8.18 D 8.23 C 8. C.4 A 8. 1. NH3. Mg và Al 2O3.10 A 8. D.1M) bị mất nhãn. Hãy chọn đáp án để nối thêm vào phần còn trống sao cho kết luận trên luôn đúng. Câu 8. D.15 A 8. cả A. FeCl2. A.28 D 8. CuSO4. NaOH và O2.40 Đốt cháy Fe trong clo dư thu được chất X. BaCO3. D. H2SO4.1 B 8. chỉ cần dùng giấy quỳ tím. dd NaOH. dd HCl. D. Zn.27 D A 113 . thuốc thử được chọn là A. natri hiđroxit.39 Cho các dd: FeCl3. H2O. Mg(NO3)2.5 D 8.24 C C 8. C. B. 4. chỉ cần Fe kim loại. Câu 8. quỳ tím Câu 8.8 A 8. B. 2. C. 3.6 C 8.12 D 8. ĐÁP ÁN 8. D. B. B. Câu 8.45 Nếu chỉ dùng một thuốc thử duy nhất để phân biệt 3 dd NaOH. nung sắt với lưu huỳnh thu được chất Y. dd H2SO4 và dd AgNO3. Để xác định thành phần cấu tạo và hoá trị các nguyên tố trong X. C. Câu 8. bari hiđroxit.19 C 8.42 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. NaNO3. C. BaCl2. Al. dd H2SO4 và dd BaCl2. và hỗn hợp NaNO3 và KHSO4.

45 D 8.Sản xuất ra chất thay cho xăng từ nguồn nguyên liệu vô tận là không khí và nước.Vật liệu mới: 114 .43 A 8. .Khai thác và sử dụng năng lượng hoá thạch còn là một trong những nguyên nhân chủ yếu gây nên ô nhiễm môi trường và làm thay đổi khí hậu toàn cầu. sinh học mới ngày càng cao. năng lượng thuỷ triều… . . 2.Sản xuất khí than khô và khí than ướt từ than đá và nước.Năng lượng điện hoá trong pin điện hoá hoặc acquy. * Hoá học đã góp phần giải quyết vấn đề năng lượng và nhiên liệu như thế nào trong hiện tại và tương lai? Hoá học đã nghiên cứu góp phần sản xuất và sử dụng nguồn nhiên liệu. MÔI TRƯỜNG A.41 B 8.Vật liệu có nguồn gốc vô cơ.42 D 8.37 A 8. khí tự nhiên… không phải là vô tận mà có giới hạn và ngày càng cạn kiệt.Các nguồn năng lượng.38 D 8. . năng lượng gió.44 B 8. nhu cầu của nhân loại về các vật liệu mới với những tính năng vật lí và hoá học. năng lượng địa nhiệt. . năng lượng mặt trời.Điều chế etanol từ crackinh dầu mỏ để thay thế xăng.Điều chế khí metan trong lò biogaz. .32 C 8.Vật liệu có nguồn gốc hữu cơ. Vấn đề vật liệu * Vấn đề về vật liệu đang đặt ra cho nhân loại là gì ? Cùng với sự phát triển của các ngành kinh tế và khoa học kĩ thuật. nhiên liệu hoá thạch như dầu mỏ. than đá.8.33 A 8. . .Năng lượng thuỷ điện.Năng lượng được sản sinh ra trong các lò phản ứng hạt nhân được sử dụng cho mục đích hoà bình. * Hoá học đã góp phần giải quyết vấn đề về vật liệu như thế nào? . .35 C 8. XÃ HỘI. năng lượng nhân tạo thay thế.31 B 8. Như : .34 A 8.39 C 8.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.40 B CHƯƠNG IX. Vấn đề năng lượng và nhiên liệu * Vấn đề về năng lượng và về nhiên liệu đang đặt ra cho nhân loại hiện nay là : . dầu. HOÁ HỌC VÀ VẤN ĐỀ PHÁT TRIỂN KINH TẾ.36 A 8.

.Nghiên cứu ra các loại vacxin. 4.Góp phần nghiên cứu thành phần hoá học của một số dược liệu tự nhiên.Nhu cầu của con người không chỉ mặc ấm. chất ma tuý và cách phòng chống ma tuý (dưới dạng những viên thuốc tân dược. .Thuốc bổ dưỡng cơ thể. phát triển thực vật. vì vậy tơ sợi tự nhiên không thể đáp ứng đủ nhu cầu về số lượng cũng như chất lượng. hợp thời trang. bột trắng dùng để hít. . Hoá học và vấn đề may mặc * Vấn đề may mặc đang đặt ra cho nhân loại hiện nay là : . Hoá học và vấn đề sức khỏe con người * Dược phẩm .Phòng chống những căn bệnh. viên để uống. mà còn mặc đẹp.Vật liệu nano (còn gọi là vật liệu nanomet) .Góp phần sản xuất ra tơ. * Chất gây nghiện. 115 ..Sản xuất nhiều loại phẩm nhuộm. .Sản xuất các loại phân bón hoá học.Vật liệu compozit.Vấn đề vi phạm vệ sinh an toàn thực phẩm.Vật liệu quang điện tử. 4.Tổng hợp hoá chất có tác dụng diệt trừ cỏ dại. . thực phẩm đang đặt ra thách thức lớn cho nhân loại hiện nay .Nghiên cứu chế biến thức ăn tổng hợp.Tổng hợp hoá chất diệt nấm bệnh.… . .Dân số thế giới ngày càng tăng.Dân số thế giới gia tăng không ngừng.Diện tích trồng trọt ngày càng bị thu hẹp.Thuốc tránh thai. động vật: . . * Hoá học đã góp phần giải quyết vấn đề về lương thực. . nạn dịch của thế kỉ. Hoá học và vấn đề thực phẩm * Vấn đề lương thực. 3.Các vật liệu cơ bản để chế tạo các thiết bị chuyên dụng trong các nhà máy dệt và trong ngành dệt may. thực phẩm cho nhân loại như : nghiên cứu và sản xuất các chất hoá học có tác dụng bảo vệ. . . . sợi hoá học có nhiều ưu điểm nổi bật.Sản xuất những hoá chất bảo quản lương thực và thực phẩm. . * Hoá học góp phần giải quyết vấn đề may mặc của nhân loại như : . dung dịch để tiêm chích). .

nước) gây suy giảm sức khỏe của con người..… Thí dụ : hiện tượng thủng tầng ôzôn. sinh lí. Tiêm chích ma tuý có thể gây trụy tim mạch dễ dẫn đến tử vong. đất. làm diệt vong một số loại sinh vật. B. 4. dầu. Nhiên liệu nào sau đây thuộc loại nhiên liệu sạch đang được nghiên cứu sử dụng thay thế một số nhiên liệu khác gây ô nhiễm môi trường ? A. nước.… * Ô nhiễm môi trường đất Đất bị ô nhiễm có chứa độc tố. hô hấp. các chất phóng xạ. HCl. không khí dựa trên cơ sở khoa học hoá học có kết hợp với khoa học vật lí và sinh học. * Vai trò của hoá học trong việc xử lí chất ô nhiễm Xử lí ô nhiễm đất. các chất dinh dưỡng thực vật.… * Ô nhiễm nước Nước ô nhiễm thường có chứa các chất thải hữu cơ. Câu 9.1. chất có hại cho cây trồng vượt quá nồng độ được quy định. màu sắc. C. máy đo pH. Người ta đã sản xuất khí metan thay thế một phần cho nguồn nguyên liệu hoá thạch bằng cách nào sau đây ? A. NH3. Hoá học và vấn đề ô nhiễm môi trường Tác hại của ô nhiễm môi trường (không khí. rối loạn tuần hoàn. rối loạn chức năng thần kinh. Lên men các chất thải hữu cơ như phân gia súc trong lò biogaz. Than đá. SO2.BÀI TẬP TRẮC NGHIỆM Câu 9. CH4 và một số khí độc khác. hiệu ứng nhà kính. Xăng. * Nhận biết môi trường bị ô nhiễm a) Quan sát qua mùi. B. Khí hiđro. các vi sinh vật gây bệnh.Nghiện ma tuý sẽ dẫn đến rối loạn tâm.… b) Xác định chất ô nhiễm bằng các thuốc thử. c) Bằng dụng cụ đo : nhiệt kế. chất độc hoá học. các hoá chất vô cơ. B. mưa axit. … * Ô nhiễm không khí Không khí bị ô nhiễm thường có chứa quá mức cho phép nồng độ các khí CO2.2. gây thay đổi khí hậu toàn cầu. . . Thu khí metan từ khí bùn ao. như rối loạn tiêu hoá.… một số vi khuẩn gây bệnh. thí dụ CO. bụi.Luôn nói không với ma tuý. các chất hữu cơ tổng hợp. 116 . Khí butan (gaz) D. sử dụng chúng như là một loại thuốc chữa bệnh. sắc kí.Hoá học đã nghiên cứu ma tuý.

Nước vôi dư. Câu 9. chứa các ion : Cu2+. Hg2+…Dùng chất nào sau đây để xử lí sơ bộ các chất thải trên ? A. D. Câu 9. Câu 9. khu vệ sinh chứa các khuẩn gây bệnh. Nước ruộng lúa chứa khoảng 1% thuốc trừ sâu và phân bón hoá học. 16% O2. Trường hợp nào sau đây được coi là nước không bị ô nhiễm ? A. Năng lượng mặt trời. C. C. Etanol. Penixilin. D. D. Giấm ăn. Năng lượng hạt nhân. Pb2+. SO2. 117 .8. Amoxilin. sắt…quá mức cho phép. Trường hợp nào sau đây được coi là không khí sạch ? A. H2. HCl. Câu 9.9. D. moocphin. Năng lượng gió. fomon. H2. B. Một trong những hướng con người đã nghiên cứu để tạo ra nguồn năng lượng nhân tạo to lớn để sử dụng cho mục đích hoà bình.3. cá…) bằng cách nào sau đây được coi là an toàn ? A. Hg2+. đó là : A. H2. D. Không khí chứa 78% N2. C. 2% hỗn hợp CO2. CH4. Lên men ngũ cốc. H2O. B. Dùng nước đá hay ướp muối rồi sấy khô. Vitamin C. B. NH3. 4% hỗn hợp CO2. 21% O2. Dùng fomon. Khí nào sau đây gây ra hiện tượng mưa axit ? A. Câu 9. Nước thải nhà máy có chứa nồng độ lớn các ion kim loại nặng như Pb2+. Seđuxen. Fe3+. nước đá.5. 1% hỗn hợp CO2. Zn2+. C.7. 18% O2. Nước từ các nhà máy nước hoặc nước giếng khoan không chứa các độc tố như asen. C.4. HNO3. Cách bảo quản thực phẩm (thịt. 20% O2. nước đá. CH4 và bụi. Nước thải từ các bệnh viện. B. Không khí chứa 78% N2. B.C. B. 6% hỗn hợp CO2. glucozơ. Panadol. B. H2O. D. Năng lượng thuỷ điện. Không khí chứa 78% N2. trong một số chất thải dạng dung dịch. D. C. Câu 9. Loại thuốc nào sau đây thuộc loại gây nghiện cho con người ? A. Thuốc cảm Pamin. H2O. Cd2+.6. Không khí chứa 78% N2. Ni2+. Sau bài thực hành hoá học. Dùng phân đạm. D. dùng nước đá khô. C. Cho hơi nước đi qua than nóng đỏ trong lò. Câu 9.

SO2. A.422 tấn. C.3585 mg chất kết tủa màu đen.3 D 9. A. Câu 9. Tính khối lượng dung dịch CuSO4 5% thu được từ 0. 1.15 tấn nguyên liệu chứa 80% CuS. Tính khối lượng NaCl cần thiết để sản xuất 15 tấn NaOH. Có thể điều chế Ancol etylic bằng 2 cách sau : . 2. KClO3 rắn. coi hiệu suất phản ứng là 100%. B.56 tấn. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IX 9. D. người ta tiến hành như sau : Lấy 2 lít không khí rồi dẫn qua dung dịch Pb(NO 3)2 dư thì thu được 0. a. D. Câu 9. A. 17. Na2O2 rắn. C. Tính hàm lượng khí đó trong không khí. Khí dầu mỏ. B.14. 0.01 mg/l).0250 mg/l. (Nên biết thêm : hàm lượng cho phép là 0.0253 mg/l.Cho lên men các nguyên liệu chứa tinh bột.0125 tấn. NaOH.11. Trong công nghệ xử lí khí thải do quá trình hô hấp của các nhà du hành vũ trụ hay thuỷ thủ trong tàu ngầm người ta thường dùng hoá chất nào sau đây ? A. Than hoạt tính.2 A 9.0225 mg/l. C. B. 15.10. nước Gia-ven. 3.3 tấn. 8.2 tấn. NH3.4 C 9. 12.4 tấn.3 tấn ancol etylic. 5.2 tấn.0257 mg/l. 0. D. C. B. Khí tự nhiên. tơ sợi tổng hợp. C. Không khí. H2S. Ancol etylic là sản phẩm trung gian từ đó sản xuất được cao su nhân tạo.8 A . 1.1 D 118 9. NaOH rắn. Câu 9. D.7 D 9.Câu 9. CO2. Biết hiệu suất của quá trình là 80%. 0. 1. A. C.Cho khí etilen (lấy từ cracking dầu mỏ) hợp nước có xúc tác.12.5 C 9. Biết rằng hao hụt trong quá trình sản xuất là 25%. 27. Khí lò cao.422 tấn. b. 4. Chất khí CO (cacbon monoxit) có trong thành phần loại khí nào sau đây ? A.422 tấn. 0. Câu 9. Hiệu suất của quá trình là 80%. Nhiều loại sản phẩm hoá học được điều chế từ muối ăn trong nước biển như : HCl. Hãy cho biết hiện tượng đó chứng tỏ trong không khí đã có khí nào trong các khí sau đây ? A. D. B.15.13. B.6 A 9. C.0 tấn.30 tấn. B. Câu 9. Để đánh giá độ nhiễm bẩn không khí của một nhà máy. Na2CO3. . D. Hãy tính lượng ngũ cốc chứa 65% tinh bột để sản xuất được 2.55 tấn. Có thể điều chế thuốc diệt nấm 5% CuSO4 theo sơ đồ sau : CuS → CuO → CuSO 4 . D.

10 D 9.15.15.11 A 9.14 C 9.b A C 119 .13 B 9.12 D 9.a 9. C 9.9.9.

Sign up to vote on this title
UsefulNot useful