HÓA HỌC 12

• • • • • • • • • Chương 1: Este – Lipit Chương 2: Cacbohidrat Chương 3: Amin – Amino axit – Protein Chương 4: Polime – Vật liệu polime Chương 5: Đại cương về kim lọai Chương 6: Kim lọai kiềm – Kim lọai kiềm thổ - Nhôm Chương7: Sắt và một số kim lọai quan trọng Chương 8: Phân biệt một số chất vô cơ Chương 9: Hóa học và vấn đề phát triển kinh tế, xã hội và môi trường

TÀI LIỆU LƯU HÀNH NỘI BỘ

CHƯƠNG I. ESTE - LIPIT A- MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Khái niệm về dẫn xuất của axit cacboxylic - Dẫn xuất của axit cacboxylic là những sản phẩm tạo ra khi thay thế nhóm hiđroxyl -OH trong nhóm cacboxyl -COOH bằng nguyên tử hay nhóm nguyên tử khác: -COOH → -COZ (với Z: OR', NH2, OCOR, halogen, …) - Este là dẫn xuất của axit cacboxylic. Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR' thì được este. - Halogenua axit (quan trọng nhất là clorua axit RCOCl). Để tạo ra halogenua axit có thể dùng các tác nhân như PCl5 (photpho pentaclorua), PCl3 (photpho triclorua), COCl2 (photgen), SOCl2 (thionyl clorua), … RCOOH + PCl5 → RCOCl + POCl3 + HCl 3RCOOH + PCl3 → 3RCOCl + H3PO3 RCOOH + SOCl2 → RCOCl + SO2 + HCl RCOOH + COCl2 → RCOCl + CO2 + HCl - Anhiđrit axit, có 2 loại: đối xứng (dạng (RCO)2O hoặc (ArCO)2O; gọi tên bằng cách thay từ axit bằng anhiđrit (CH3CO)2O là anhiđrit axetic), và không cân đối (sinh ra từ hai axit monocacboxylic khác nhau như CH3CO-O-OCC6H5; gọi tên bằng từ anhiđrit cộng với tên của hai axit - anhiđrit axetic benzoic). Để tạo thành anhiđrit axit có thể sử dụng nhiều phương pháp khác nhau như dùng tác nhân hút nước P2O5 hay tác dụng của nhiệt, … 2. Công thức tổng quát của este a/ Trường hợp đơn giản: là este không chứa nhóm chức nào khác, ta có các công thức như sau :
- Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đơn chức R'OH: RCOOR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đơn chức R'OH: R(COOR')a. - Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đa chức R'(OH)b: (RCOO)bR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đa chức R'(OH)b: Rb(COO)abR'a. Trong đó, R và R' là gốc hiđrocacbon (no, không no hoặc thơm); trường hợp đặc biệt, R có thể là H (đó là este của axit fomic H-COOH).

b/ Trường hợp phức tạp: là trường hợp este còn chứa nhóm OH (hiđroxi este) hoặc este
còn chứa nhóm COOH (este - axit) hoặc các este vòng nội phân tử … Este trong trường hợp này sẽ phải xét cụ thể mà không thể có CTTQ chung được. Ví dụ với glixerol và axit axetic có thể có các hiđroxi este như HOC 3H5(OOCCH3)2 hoặc (HO)2C3H5OOCCH3; hoặc với axit oxalic và metanol có thể có este - axit là HOOC-COOCH3.

c/ Công thức tổng quát dạng phân tử của este không chứa nhóm chức khác Nên sử dụng CTTQ dạng C n H 2n + 2 −2∆ O2a (trong đó n là số cacbon trong phân tử este n ≥ 2, nguyên; ∆ là tổng số liên kết π và số vòng trong phân tử ∆ ≥ 1, 2

nguyên; a là số nhóm chức este a ≥ 1, nguyên), để viết phản ứng cháy hoặc thiết lập công thức theo phần trăm khối lượng của nguyên tố cụ thể. 3. Tính chất hoá học của este a/ Phản ứng thuỷ phân este Tính chất hoá học quan trọng nhất của este là phản ứng thuỷ phân. Sơ đồ thuỷ phân este (về cơ bản, chưa xét các trường hợp đặc biệt) là :

C

O

+H

OH

H +, t o

C O

H

+

OH

O O (este) (nước) (axit) (ancol) Thuỷ phân chính là quá trình nghịch của của phản ứng este hoá.
Phản ứng thuỷ phân có thể xảy ra trong môi trường axit hoặc môi trường bazơ. - Phản ứng thuỷ phân trong môi trường kiềm được gọi là phản ứng xà phòng hoá. Đặc điểm của phản ứng thuỷ phân este: - Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Sản phẩm của phản ứng trong điều kiện này luôn có axit cacboxylic. Để chuyển dịch cân bằng về phía tạo axit và ancol, ta dùng lượng dư nước.

- Phản ứng thuỷ phân este không những thuận nghịch mà còn rất chậm. Để tăng tốc độ phản ứng thuỷ phân ta đun nóng hỗn hợp phản ứng với với chất xúc tác axit (H2SO4, HCl…). - Phản ứng xà phòng hoá chỉ xảy ra một chiều, sản phẩm thu được luôn có muối của axit cacboxylic.

C O

+ OH-

to

C
(muối)

O-

+

OH

(este) (kiềm) O b/ Phản ứng của gốc hiđrocacbon

O (ancol, phenol, anđehit …)

Este không no (este của axit không no hoặc ancol không no) có khả năng tham gia phản ứng cộng và phản ứng trùng hợp – đây là tính chất do liên kết π quy định (tương tự như hiđrocacbon tương ứng). Một số phản ứng thuộc loại này có ứng dụng quan trọng là : - Phản ứng chuyển hoá dầu (chất béo lỏng) thành mỡ (chất béo rắn)
Ni, t , p (C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5 (Triolein) (Tristearin) - Phản ứng trùng hợp vinyl axetat thành poli(vinyl axetat)
0

nCH2

CH OCOCH3

xt, to, p

CH CH2 n OCOCH3

- Trùng hợp metyl metacrylat thành poli(metyl metacrylat) – thuỷ tinh hữu cơ plexiglas).

3

halogenua axit cũng bị líti-nhôm hiđrua khử tương tự). hoặc nữa là do cấu tạo bất thường của este gây nên.Phản ứng tráng gương của este của axit fomic– (xem lại anđehit).este: RCOOC(R)(OH)-R’ • Este + NaOH  1 sản phẩm duy nhất → hoặc “m RẮN = mESTE + mNaOH”. p CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) CH3 metyl metacrylat . 4. 5. Phản ứng khử este bởi líti-nhôm hiđrua LiAlH4 thành ancol bậc I 1) LiAlH 4 → RCOOR'  RCH2OH + R'OH 2) H3O + (Chú ý: anhiđrit axit. Một số phản ứng thuỷ phân đặc biệt của este Căn cứ vào sơ đồ phản ứng xà phòng hoá hay phản ứng thuỷ phân este ta có thể căn cứ vào sản phẩm tạo thành để suy đoán cấu tạo của este ban đầu. Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : • Este + NaOH  1 muối + 1 anđehit → Este đơn chức có gốc ancol dạng công thức R-CH=CHThí dụ CH3COOCH=CH-CH3 • Este + NaOH  1 muối + 1 xeton → Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân. • Este + NaOH  1 muối + 1 ancol + H2O → Este. to. Este vòng (được tạo bởi hiđroxi axit) CH 3 CH C O • Este + NaOH  Có MSP = MEste + MO → NaOH R C O O Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi 4 . tuỳ thuộc vào việc nhóm – OH đính vào gốc hiđrocacbon có cấu tạo như thế nào mà sẽ có các phản ứng tiếp theo xảy ra để có sản phẩm cuối cùng hoàn toàn khác nhau. Không nhất thiết sản phẩm cuối cùng phải có ancol.axit : HOOC-R-COOR’ • Este + NaOH  2 muối + H2O → Este của phenol: C6H5OOC-R • Este + NaOH  1 muối + anđehit + H2O → Hiđroxi.nCH2 CH COOCH3 xt.este: RCOOCH(OH)-R’ • Este + NaOH  1 muối + xeton + H2O → Hiđroxi.

anhiđrit axit. Phản ứng của chất béo với chất kiềm được gọi là phản ứng xà phòng hoá. t CH3 CH C O + NaOH CH3 CH C ONa O Chú ý các kết luận in nghiêng ngay dưới mỗi trường hợp trênO chỉ là một thí dụ OH đây o 6. …hầu hết chúng đều là các este phức tạp.Lipit là những hợp chất hữu cơ có trong tế bào sống. sáp.Phản ứng của ancol với axit cacboxylic (xem axit). Một số phương pháp điều chế este a/ Phản ứng của ancol với axit cacboxylic và dẫn xuất như clorua axit. photpholipit.t  → RCOOH + R'OH ← RCOOR' + H2O  + 0 . 5 .Phản ứng của ancol với anhiđrit axit hoặc clorua axit thì phản ứng xảy ra nhanh hơn và một chiều (không thuận nghịch như khi tác dụng với axit) (CH3CO)2O + C2H5OH  CH3COOC2H5 + CH3COOH → CH3COCl + C2H5OH  CH3COOC2H5 + HCl → b/ Phản ứng của phenol với anhiđrit axit hoặc clorua axit (phenol không tác dụng với axit cacboxylic) tạo este của phenol. t 0 CH3COOH + CH≡ CH  CH3COOCH=CH2 → d/ Phản ứng ankyl halogenua và muối bạc hay cacboxylat của kim loại kiềm RCOOAg + R'I → RCOOR' + AgI RCOONa + R′ I → RCOOR' + NaI 7. . tạo ra este.đơn giản nhất.Khi đun nóng chất béo với dung dịch kiềm thì tạo ra glixerol và hỗn hợp muối của các axit béo. H . Muối natri (hoặc kali) của các axit béo chính là xà phòng. . Khi thuỷ phân chất béo thì thu được glixerol và axit béo. Lipit . Phản ứng xà phòng hoá xảy ra nhanh hơn phản ứng thuỷ phân trong môi trường axit và không thuận nghịch.Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử C (thường từ 12C đến 24C) không phân nhánh. .Chỉ số axit: là số mg KOH cần để trung hoà axit béo tự do có trong 1g chất béo. gọi chung là triglixerit. sterit. các em chỉ được vận dụng khi không có dấu hiệu cho phép xác định cụ thể số nhóm chức este trước đó. . Lipit bao gồm chất béo. Ví dụ: phản ứng tạo phenyl axetat (CH3CO)2O + C6H5OH  CH3COOC6H5 + CH3COOH → CH3COCl + C6H5OH  CH3COOC6H5 + HCl → c/ Phản ứng cộng vào hiđrocacbon không no của axit cacboxylic Ví dụ: phản ứng tạo vinyl axetat xt.

RCOOC(CH3)=CH2 + NaOH  RCOONa + CH3COCH3 → 6 . t0 18. H + 0 0 15. CxHy(COOM)a + O2  M2CO3 + CO2 + H2O → (sơ đồ phản ứng đốt cháy muối cacboxylat). 3CH3COOH + POCl3  3CH3COCl + H3PO4 → CaO. CH3CH2COOH + Br2  CH3CHBrCOOH + HBr → 10. CH3COONa(r) + NaOH(r)  CH4 + Na2CO3 → photpho. 2CH3COONa(r) + 4O2  Na2CO3 + 3CO2↑ + 3H2O → t0 17. RCOOCH=CH2 + NaOH  RCOONa + CH3CHO → 0 t 2. RCOONa + HCl (dd loãng) → RCOOH + NaCl t0 16. CH3-CO-CH3 + HCN → (CH3)2C(OH)CN 11. .Chỉ số xà phòng hoá là tổng số mg KOH cần để xà phòng hoá glixerit và trung hoà axit béo tự do có trong 1g chất béo. Xà phòng và chất tẩy rửa tổng hợp B .. t0  → 4. C6H5-CH(CH3)2  C6H5OH + CH3COCH3 2) H 2 O.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP t 1. (CH3)2C(OH)CN + 2H2O → (CH3)2C(OH)COOH + NH3↑ 12. 8. bR(COOH)a + aR'(OH)b ← Rb(COO)abR'a + abH2O  t 5.Chỉ số iot: là số gam iot có thể cộng hợp vào các liên kết bội có trong 100g chất béo. t 0 8. R-Cl + KCN → R-CN + KCl 13. C3H5(OOC R )3 + 3NaOH  3 R COONa + C3H5(OH)3 → H+ . t 0 9. 3CH3COOH + PCl3 → 3CH3COCl + H3PO3 t0 7. R-CN + 2H2O → R-COOH + NH3↑ 1) O 2 → 14. (C17H35COO)3C3H5 + 3KOH  C17H35COOK + C3H5(OH)3 → 6. RCOOC6H5 + 2NaOH  RCOONa + C6H5ONa + H2O → t0 3.

D. (4). (3). (2). (4). (2). (3). (1). HOOC–CH = CH– COO–CH3 và CH3–OOC – CH = CH2. (3). (2) Không thể điều chế được vinyl axetat bằng cách đun sôi hỗn hợp ancol và axit có axit H2SO4 đặc làm xúc tác. (3). C. C. (1). (5) isopropyl fomiat. Nung Y với NaOH (có mặt CaO) thì được một chất khí là CH4. (1). Câu 1. Câu 1. Đietyl ete. (5). (5) Sản phẩm của phản ứng giữa axit và ancol là este. a. (2). D. B. (4). (1). a. axit sunfuric vừa làm xúc tác vừa có tác dụng hút nước. (3). (5). 14. (2) metyl propionat. 3. (4). (5). do đó làm tăng hiệu suất tạo este. (2). D. C. Câu 1. (4). Các nhận định đúng là A. chỉ (4).nghịch. Câu 1. (4). (4) Hợp chất CH3COOC2H5 thuộc loại este. HOOC – CH = CH – COO – CH3 và CH2 = CH – COO – CH3.2 Có các nhận định sau : (1) Este là sản phẩm của phản ứng giữa axit và ancol. (4). C. (1). (2). Etyl axetic. (2). D. c. (5)..4 Hỗn hợp X gồm 2 este mạch hở E (C5H6O4) và F (C4H6O2). c. Nhận xét đúng là A.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 1. a. B. C. (4). (4). (1). (5). b.6 Ứng với công thức phân tử C4H8O2. sẽ tồn tại các este với tên gọi : (1) etyl axetat. (1). B. Etyl fomiat. còn (2) không cần đun nóng. D. B. B. b. (2). (4) Phản ứng este hoá là phản ứng thuận . B. C. sau đó cô cạn dung dịch. với n ≥ 2 . Câu 1. (3). (2) Este là hợp chất hữu cơ trong phân tử có nhóm – COO. đơn chức. Vậy công thức cấu tạo của E và F là A. c/ (1) cần đun nóng.C. HOOC – COO – CH2 – CH = CH2 và H – COO – CH2 – CH = CH2.3 Xét các nhận định sau: (1) Trong phản ứng este hoá. (3) metyl iso-propylonat. b/ (1) tạo sản phẩm axit. HOOC – CH2 – COO – CH = CH2 và CH3 – COO – CH = CH2. Đun hỗn hợp X với dung dịch NaOH dư. Câu 1. c. còn (2) chỉ một chiều. có thể thu được este có tên là A. Các tên gọi đúng ứng với este có thể có của công thức phân tử đã cho là A. (1) và (4). 15. còn (2) tạo sản phẩm muối. (1). thu chất rắn Y. Các nhận định đúng gồm A. (3). (3) Este no. D. (4) propyl fomiat. (5). 7 . 4.5 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit benzoic là A. D.1 Khi đun hỗn hợp gồm etanol và axit axetic (có mặt H2SO4 đặc làm xúc tác). B.7 Phản ứng thuỷ phân của este trong môi trường axit (1) và môi trường bazơ (2) khác nhau ở các điểm : a/ (1) thuận nghịch. mạch hở có công thức phân tử CnH2nO2 . (3) Để điều chế este của phenol không dùng axit cacboxylic để thực hiện phản ứng với phenol. (3). b. (3). C. và (4). Etyl axetat.

C. (4). X có tên gọi là A. D. Câu 1. (3). metyl axetat. D. CnH2n . D. (1). HCOOC3H7 B. B. (3). B. (2). vinyl fomiat. D. (2) Chất béo không tan trong nước. etyl axetat. phenyl fomiat. (1). (3) (HO)2C3H5OOCR.8 Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là A. (1). (1). nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. Các phát biểu đúng là A.16 Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. C. (4) (ROOC)2C3H5(OH). 18. Câu 1. Câu 1. (4). CnH2nO2. (3). C. Câu 1.11 Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi. (2).14 Trong thành phần của một số loại sơn có trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. B. B. (3). B. (5) C3H5(COOR)3. D. C2H5COOCH3 C. (4). Câu 1. (2) (RCOO)2C3H5(OH).15 Este mạch hở. (2). benzyl fomiat. HCOOC3H5. Công thức đã viết đúng là A. C. Câu 1.10O6. CnH2n+2O2. (3) phản ứng thuỷ phân.18O12. C. CnH2nO2. chỉ có (1). (4). (1). C. Rb(COO)abR’a. B. D. D. CnH2n – 2O2. (4). Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức C2H3O2Na. Câu 1. 6.13 Những phát biểu sau đây : (1) Chất béo không tan trong nước. CnH2n . phản ứng đặc trưng cho mọi este là A. (3) Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. CnH2n – 2O2. B.17 Chất X có công thức phân tử C4H8O2. C. B. Câu 1. (2). 12. 8 . CH3COOC2H5 D. B. C. ba chức là A. (1). (4) phản ứng oxi hóa. 8.9 Công thức tổng quát của este tạo bởi một axit cacboxylic no đơn chức và một ancol no đơn chức (cả axit và ancol đều mạch hở) là A. CnH2n + 1COOCmH2m +1. đơn chức chứa 50%C (về khối lượng) có tên gọi là A. Câu 1. (4) Chất béo là este của glixerol và axit hữu cơ. RCOOR’. (3) và (4). (5).10 Este của glixerol với axit cacboxylic (RCOOH) được một số học sinh viết như sau: (1) (RCOO)3C3H5. C. vinyl axtetat. Công thức cấu tạo của X là A.Câu 1. chỉ có (5). (2) phản ứng cộng. (2).6O4. CnH2n . CnH2n -16O12.12 Trong số các phản ứng có thể có của este gồm: (1) phản ứng trùng hợp. D. metyl benzoat. phenyl axetat. Số lượng công thức cấu tạo của các trieste có thể có trong loại sơn nói trên là A. D.

Metyl metacrylat. 2. dung dịch AgNO3 trong amoniac lần lượt là A. y = 1. mạch hở là A. Câu 1. B. 2. (4). y = 0.00. D. (1). 3. chỉ có (1). C. C. (4) vinyl fomiat. Câu 1. (2) metyl axetat. (3). B. y có giá trị là A. (2) metyl acrylat. B.75 mol este (không tác dụng với Na). D. Metyl acrylat.18 Khi đun hỗn hợp 2 axit R1COOH và R2COOH với glixerol (axit H2SO4 làm xúc tác) có thể thu được mấy trieste ? A. Tại thời điểm cân bằng thu được 0. B.05.30 mol axit. Câu 1. D. chỉ có (3). este mà polime của nó được dùng để sản xuất chất dẻo gồm A.20 Số nguyên tử cacbon tối thiểu trong phân tử este không no.2. C. D. 2. 3. 2. B. (4).25 Tên gọi của este (được tạo nên từ axit và ancol thích hợp) có công thức phân tử C4H6O2 là A. 2. (4) metyl benzoat. 2. (2).Câu 1. D. D. y = 0. (1). Câu 1.05. 1. natri kim loại. C. (4). Câu 1.22 Đun nóng hỗn hợp gồm x mol axit axetic và y mol etylen glicol (xt H2SO4 đặc).24 Ứng với công thức phân tử C3H6O2. C. số đồng phân có khả năng tác dụng với dung dịch NaOH. (3). 1. Metyl propionat. 4.25 mol ancol và 0. một học sinh gọi tên các đồng phân este có thể có gồm: (1) etyl fomiat. 5. 4. C. 2. x. (2) và (3). x = 1. 1.20. 5. 3. Khi đạt trạng thái cân bằng trong hỗn hợp có 1. 6. (1) và (2). 2. (3) metyl metacrylat. natri cacbonat. 1. Câu 1. 2. Câu 1.2. (2). D. Vinyl axetat. B. Ở nhiệt độ đó hằng số cân bằng Kc của phản ứng este hoá là A. 2. C. 1. 0. (1). C.19 Trong số các este: (1) metyl axetat. 2. 2. x = 1.21 Số nguyên tử cacbon tối thiểu trong phân tử este (được tạo nên từ axit và ancol) no đa chức. 9 .2 mol este tạo thành.90.80. Câu 1.4. B. B. C. (3).00. D.75. 2. Các tên gọi đúng là A.26 Cho 2 mol CH3COOH thực hiện phản ứng este hoá với 3 mol C2H5OH.23 Trong số các đồng phân mạch hở có công thức phân tử C2H4O2. 1. 1. 1. (3) iso propyl fomiat. x = 1. 4. B. x = 1. mạch hở là A. 18. y = 1. 2. C.

72 lít (đktc) CO2 và 5. D.32 Thuỷ phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng. axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. Đun hồi lưu hỗn hợp etanol. thu được 2 sản phẩm hữu cơ X.Câu 1. C. Glixerol khử nước hoàn toàn cho sản phẩm là acrolein.27 Chất X tác dụng với NaOH cho dung dịch X1. Công thức cấu tạo của X có thể là A.30 Cách nào sau đây có thể dùng để điều chế etyl axetat ? A. a.H.4g H2O. D. Cho X4 tráng gương được sản phẩm X5. d. 10 . HOOC–CH = CH–OOC–CH3. Câu 1. B. c/ Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. e. Câu 1. B.28 Hỗn hợp T gồm 2 chất X. D. b. C. a. b.31 Chất hữu cơ X có công thức phân tử là C5H6O4. D. Các axit béo có mạch cacbon không phân nhánh. thu được một muối và một ancol. CH2 = CH – OCOCH3. CH2 = CH – CH2 – OCOH. B. B. rượu trắng và axit sunfuric đặc. có 1 nối đôi. có một nối ba. C. Câu 1. este đơn. b/ Các este không tan trong nước do chúng nhẹ hơn nước. e. e/ Chất béo lỏng là các triglixerit chứa gốc axit không no trong phân tử. Chất béo là este của glixerol với các axit béo. Vậy công thức cấu tạo của X là A. C.33 Cho các câu sau : a/ Chất béo thuộc loại hợp chất este. D. B. Vậy X. C. este đơn no. D. O).O) đơn chức đều không tác dụng được với Na. Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. Cô cạn X1 được chất rắn X2 và hỗn hợp hơi X3. a. propyl fomiat. HOOC–CH2–COO–CH = CH2. Những câu đúng là đáp án nào sau đây ? A.29 Phát biểu nào sau đây sai ? A. Đun hồi lưu hỗn hợp axit axetic. H. B. c. đun nóng. Đun sôi hỗn hợp etanol. e. thu 6. axit axetic và axit sunfuric đặc. a. d. HOOC–COO–CH2–CH = CH2. c. HOOC–CH2–CH = CH–OOCH. metyl propionat. Chưng cất X3 thu được chất X4. no. B. D. Y thuộc dãy đồng đẳng A. Câu 1. giấm và axit sunfuric đặc. Câu 1. Chất E là A. isopropyl fomiat. d. Cho X5 tác dụng với NaOH lại thu được X2. Y mạch hở (C. Đun hồi lưu hỗn hợp etanol. Phản ứng xà phòng hoá là phản ứng thuỷ phân este trong môi trường kiềm. số nguyên tử cacbon chẵn. d. C. etyl axetat. Câu 1. C. HCOO – CH = CH – CH3. Thuỷ phân X bằng dung dịch NaOH dư. Y (chứa các nguyên tử C. HCOO –C(CH3) = CH2. d/ Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. este đơn có 2 nối đôi. este đơn. nhưng đều tác dụng với dung dịch NaOH khi đun nóng. Đốt cháy hoàn toàn m g T.

C. (5) cồn iot. 1. Câu 1.39 Trong phòng thí nghiệm có các hoá chất được dùng làm thuốc thử gồm: (1) dd brom. 3. cần thực hiện số lượng phản ứng hoá học ít nhất là A. 0. D. 1. axit acrylic. 1. để điều chế được ba polime gồm polistiren.Câu 1. Câu 1. CH3–CH2–COO–CH=CH2 và CH2=CH–COO–CH2–CH3. 2. cô cạn dung dịch sau phản ứng thu 21g muối khan. 11 . axit valeric. 2. D.6 mol. 8 Câu 1. axit axetic. C. B. D. 22%. Axit tạo F là A. 5. CH3–CH(OH)–CH(OH)–CH=CH2 và CH2=CH–CH2–CH2–COOH. Để phân biệt 3 este: anlyl axetat.38 Cho 10 gam hỗn hợp X gồm etanol và etyl axetat tác dụng vừa đủ với 50g dung dịch natri hiđroxit 4%. Số liên kết π có trong gốc hiđrocacbon của axit béo. Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng A. 3. CH2 CH(CH3)COOCH3. (4) axit axetic. B. Công thức cấu tạo của X là A. C. thu sản phẩm 2 muối C3H5O2Na.4 mol. C. C.40 Cho 0. C. 3.5 mol. O=HC–CH2–CH2–CH2–CH=O và O=HC–CH(OH)–CH2–CH=CH2. C. Số miligam NaOH cần để trung hoà các axit tự do có trong 1 gam chất béo.41 F là chất CH có 2 . 2. C3H3O2Na và 2 sản phẩm khác. B. D. (2) dd NaOH. 50%. CH2=CH–CH2–CH2 – COOH và CH3–CH2–CH=CH–COOH. Số miligam KOH cần để trung hoà các axit tự do có trong 1 gam chất béo. Câu 1. 51%. 0.35 Cho a mol chất béo (C17H35COO)3C3H5 tác dụng hết với NaOH thu được 46g glixerol. (3) dd AgNO3/NH3. D. B. B. D. D. a có giá trị là A. 5. 44%. Công thức cấu tạo của X và Y là A.34 Chỉ số axit của chất béo là A. 7.3 mol. B. Số mol KOH cần để xà phòng hoá một gam chất béo. khi đốt cháy một thể tích ancol T cần 3 thể tích oxi (đo ở cùng điều CH2 CH2 O kiện). axit fomic. C. CâuCH3COOCH2 hữu cơ CHcông thứcCH2 tử C2H8O2. F tác dụng với NaOH tạo ra một ancol T.36 Đun nóng hỗn hợp X và Y có công thức C5H8O2 trong dung dịch NaOH. B. D. 0. 1. Câu 1. 0.6. polibutađien và poli(butađienstiren). CH2 CH COOC2H5 .37 Từ nguyên liệu đầu là eten và benzen (xúc tác và điều kiện phản ứng có đủ). Câu 1. phân CH 5 C O.15 mol este đơn chức X (C5H8O2) tác dụng vừa đủ với dung dịch NaOH. vinyl axetat và etyl fomiat cần phải dùng các thuốc thử là A. B.

6g).8g muối.45 Đốt cháy 6g este E thu được 4. Câu 1. C2H3COOC2H5.32 lít (ở 1270C. Vậy công thức cấu tạo của E là A. C2H5COOCH3 (4. D. vinyl fomiat. 0. D. D. HCOOC2H5.4g). 10g. HCOO – CH2CH2CH3. Câu 1. Công thức cấu tạo của E là A. D. D.6g Z thu được thể tích bằng thể tích của 3. B. B. C. C2H3COOC3H7. D. CH3COOCH3. Tên gọi của Y là A. 0. .Câu 1. axit acrylic. 12 B. B. CH(COOCH3)3. C2H5COOC2H5. (COOC3H5)2.14g hỗn hợp 2 muối và 3.48g). 1.4375. CH3COO – CH2CH2CH3. CH3COOC2H5 (6. (COOC2H5)2. C. HCOOCH3. thu 13. CH3COOCH3. Công thức cấu tạo mỗi este và số gam tương ứng là A.42 Đốt cháy hoàn toàn m g hỗn hợp các este no. B. Câu 1.6g H2O.50 Đun nóng 0. axit axetic.48g).1 mol X với dung dịch NaOH (đủ). X có công thức A.47 Làm bay hơi 7. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối lượng bình tăng 6. Câu 1. mạch hở. CH3COOCH3 (2. D.49 Đốt hoàn toàn 4. Câu 1. Nếu đun X trong dung dịch H 2SO4 loãng thu được axit Y có dY / H 2 = 36 và ancol đơn chức Z. Propyl axetat.1 mol. 12g. C2H4(COOC2H5)2. 600 mmHg).4g một este X thu được một thể tích hơi bằng thể tích của 3. Khi thực hiện phản ứng xà phòng hoá 7. B. etyl fomiat. có thể tích 8.4g muối của axit đa chức và 9. Câu 1. HCOOC2H5 (1.36 lít oxi (đktc) thu hỗn hợp CO 2 và H2O có tỉ lệ thể tích tương ứng 6 : 5.44 Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6.6g). HCOOCH3. C.48 lít CO2 (đktc) và 3. C.16g CO2 và 2. C.4g X với dung dịch NaOH (phản ứng hoàn toàn) thu được sản phẩm có 6.8g este đơn chức. Tên gọi của X là A. 10g.01 mol. Công thức của X là A. 0.48 Đốt cháy hoàn toàn 2. axit fomic.2g O2 ở cùng điều kiện nhiệt độ và áp suất.2g. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A. HCOOC2H5 (2.01mol. D. Etyl propionat.6g một ancol Y. mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4. 0. Câu 1. Biết E có phản ứng tráng gương với dung dịch AgNO3/NH3.28g X cần 3. isopropyl fomiat.46 Thuỷ phân hoàn toàn 8. D. Etyl axetat. CH3COOC2H5. C. Câu 1.22g).2g một este E thu được 6. Tên gọi của X là A.43 Cho ancol X tác dụng với axit Y thu được este Z.2g khí oxi ở cùng điều kiện nhiệt độ. Biết MY > MX. C.2g. C2H5COOCH3 (6. làm bay hơi 8. B. C. axit metacrylic. B.2g ancol đơn chức. metyl axetat. CH3COOCH3 (1. đơn chức. B. HCOO – C2H5.1 mol.52g H2O.22g). áp suất. Etyl fomiat. C. CH3COOC2H5 (4.4g).68g một ancol Y duy nhất có tỉ khối so với oxi là 1.

6g muối và 0.92g glixerol. 7. 185.2g. C15 H 31COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | C.3 mol NaOH. 6. (C2H5COO)3C2H5. C. B. C3H5(COOCH3)3. Lượng NaOH dư được trung hoà hết bởi 0.6g. CH3–C(COOCH3)3. 6.8g chất béo cần 3ml dung dịch KOH 0. B.54 Khi thuỷ phân a g một este X thu được 0. 18.1 mol một ancol Y. Câu 1. 19.2g ancol Y và 20. Công thức của X là A. C17 H 35COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | B.18%. C. Sau khi phản ứng hoàn toàn.1M.4g. B. 6.5M thu được 24. 16. % khối lượng của X trong hỗn hợp ban đầu và giá trị m là A.2g .56 Tổng số miligam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong một gam chất béo gọi là chỉ số xà phòng hoá của chất béo. D. 7. D.82g . Este có thể có công thức cấu tạo nào sau đây? C17 H 35COO C H 2 C17 H 35COO C H 2 | | A. C. CH3CH2OOC-COOCH2CH3. thu 9. C.1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0. Câu 1.4g. D. C3H5(OOCH)3. C. Câu 1.51 Xà phòng hoá hoàn toàn 0. Giá trị của a. 20. 175. 7.8g chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0. 8.02g natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa).20%. Công thức cấu tạo thu gọn của X là A. 8.4g hỗn hợp 2 este đơn chức X.53 Cho 21. 155.0g.52 Để xà phòng hoá hoàn toàn 19. Y cần 200ml dung dịch NaOH 1.82g. 8.Câu 1. Câu 1. Câu 1. CH3COOCH3 19. 8. D. C15 H 31COO C H | C15 H 31COOCH 2 13 .82g . C. 165. B. (CH3COO)3C3H5.67%.55 Trong chất béo luôn có một lượng axit béo tự do.57 Khi thuỷ phân (xúc tác axit) một este thu được glixerol và hỗn hợp các axit stearic và axit panmitic theo tỉ lệ mol tương ứng bằng 2 : 1. 3.4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức). C17 H 33COO C H | C15 H 31COOCH 2 D. 20. Câu 1. Vậy chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa 89% tristearin là A. CTCT. HCOOCH3 66. 15. D. D.08g. Để trung hoà 2. (HCOO)3C3H5. HCOOC2H5 16. B. B.08g. Số miligam KOH dùng để trung hoà lượng axit béo tự do trong một gam chất béo gọi là chỉ số axit của chất béo. m lần lượt là A.2g .2 mol HCl. CH3CH2COOCH3. Chỉ số axit của mẫu chất béo trên là A. cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và m g một muối khan duy nhất Z.5M. C3H5(COOCH3)3.

Câu 1. D.92kg. 8. Câu 1.092kg glixerol. C.58 Trong chất béo luôn có một lượng axit béo tự do. metyl axetat. (C17H35COO)3C3H5.3kg NaOH.92g glixerol và 9. C. B. B. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng lớn hơn khối lượng X đã phản ứng. 150g.92g. (3).64 Đun nóng 215g axit metacrylic với 100g metanol (với Hpứ = 60%). D. Vậy công thức phân tử của X là A.Câu 1. 929. 3. Chất béo đó là A.90g. 14 . 3. Câu 1.63 Đốt cháy 3.787kg. Khối lượng xà phòng 60% (về khối lượng) thu được là A. (2). B. (C15H31COO)3C3H5. 917kg. D. (3). 175g. 988kg. C. C. Câu 1. D. 7.62 Thuỷ phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1. 8. 30% tripanmitoyl glixerol (panmitin) và 20% tristearoyl glixerol (stearin) về khối lượng) khi xà phòng hoá bằng natri hiđroxit. etyl axetat. (4). và mg hỗn hợp muối Na. C. Câu 1.2kg. D. Khi thuỷ phân hoàn toàn 2. giả sử hiệu suất quá trình đạt 90% là A. Câu 1. (4). iso propyl fomiat. Giá trị của a là A. thu được 0. D. (C17H33COO)3C3H5.61kg.82g. (3) (C17H31OOC)2C3H5OOCC17H29. Công thức cấu tạo có thể có của các trieste đó là : (1) (C 17H31COO)2C3H5OOCC17H29. B. D. Câu 1. (1). metyl propionat.84kg. 889. C.92 lít O2 (đktc) thu được CO2 và H2O có tỉ lệ mol 1:1. Biết X tác dụng với KOH tạo ra 2 chất hữu cơ.145kg chất béo. 10.65 Một chất hữu cơ X có d X CO2 = 2 .61 Khối lượng xà phòng thu được từ 1 tấn mỡ động vật (chứa 50% trioleoyl glixerol.60 Đun sôi a g một triglixerit X với dung dịch KOH cho đến khi phản ứng hoàn toàn. 125g. Tên X là A. (1). C3H4O2. (4). D. (C15H29COO)3C3H5. B.84g glixerol và 18. cần dùng 0. (4) (C17H31OCO)2C3H5COOC17H29. C4H8O2.24g muối của axit béo duy nhất. C. Khối lượng este metyl metacrylat thu được là A. (2). (2). C3H6O2. B. C2H4O2. (1). 2.91g. B. C. 9. Những công thức đúng là A.59 Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. thu 0. (2) C17H31COOC3H5(OOCC17H29)2. B.58g hỗn hợp Y gồm muối của axit linoleic và axit oleic. (2).7g chất hữu cơ X cần dùng 3.3kg. 100g.

cần dùng 12g NaOH. Câu 1. B. Trong hỗn hợp X. CH2=CH–COOCH3. thu được muối có khối lượng bằng khối lượng 37 este ban đầu.67 Xà phòng hoá 22. CH3 – COOC2H3 0. Trong X chắc chắn có một este với công thức và số mol tương ứng là A.68 Đun nóng 3. Nhận định nào sau đây là sai ? A. isopropyl fomiat. CH2 = CH – OCO – CH3.492g muối khan (hao hụt 6%). CH3 – CH = CH – OCOH. 8.2g muối natriaxetat. B.2g hỗn hợp gồm 2 este đồng phân. H – COOC2H5 0. (CH3COO)2C2H4. 15 . D.015 mol H2. D.15 mol. B. 02 . metyl propionat. D. thu được hỗn hợp muối natri của hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và một chất lỏng L (tỉ khối hơi d L / CH 4 = 3.21g hỗn hợp X gồm hai chất hữu cơ Y và Z cùng nhóm chức với dung dịch NaOH dư. etyl axetat. X2. hai chất Y và Z có số mol bằng nhau. 625 ). D.70 Cho 7. C. Tên gọi của X là A. X là A. Đốt cháy hỗn hợp X sẽ thu được nCO2 − nH 2O = 0. Câu 1. Câu 1. 6. Công thức cấu tạo của X là A.2 mol.71 X là một este hữu cơ đơn chức. D.Câu 1. CH3COOCH3. Công thức của este E là A. D. C. Nếu đốt cháy cùng một lượng X1 hay X2 sẽ thu được cùng một thể tích CO2 (ở cùng nhiệt độ và áp suất). Nung một trong hai muối thu được với NaOH (vôi tôi – xút) sẽ tạo metan. CH2 = CH – COO – CH3. 0. C. HCOO – CH2 – CH = CH2.66 Este X có d X / H 2 = 44 . B.72 Thuỷ phân este X (C4H6O2) trong môi trường axit ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. C. mạch hở. B. thu 20.4g este E thuỷ phân trong dung dịch NaOH thì thu được 8. Chất L 1 phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. Cho lượng 10 chất L phản ứng với Na được 0. C. II – BÀI TẬP NÂNG CAO Câu 1. 7.15 mol D.2 mol. C. B. Câu 1. (CH3COO)3C3H5. B. H-COOCH3. Cho một lượng X tác dụng hoàn 41 toàn với dung dịch NaOH vừa đủ. CH3(CH2)2COOCH3. etyl fomiat. Tên gọi của L là ancol anlylic. H – COOC2H5 0. Câu 1. CH3 – COOCH3 0. Thuỷ phân X tạo nên 2 hợp chất hữu cơ X1.69 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit ađipic là A. C. C17H35COO(CH2)16CH3. CH3COOCH3.

HCOOCH(CH3)CH3. Khi bị oxi hoá chất Y chuyển thành anđehit. C. 16 . axit fomic. Câu 1. Cho hơi Z qua ống bột đựng Cu xúc tác đun nóng thì sinh ra chất T có khả năng tham gia phản ứng tráng gương. HCOOCH=CH–CH3 và CH3COOCH=CH2. D. B. CH3OCO− CH=CH2. CH3CH2CH2OH Câu 1.32g CO2. Nung X với vôi tôi xút thu được ancol Y và muối vô cơ Z. Tên gọi của X.76 3. B. glixerol. Isopropyl fomiat. thu được 20. B. axit axetic. sau phản ứng thu được một muối và một anđehit. Câu 1. Đốt cháy hoàn toàn Y thu được CO 2 và H2O có tỉ lệ thể tích 3 : 4. glixerol.52g một este E của axit cacboxylic no đơn chức và ancol no đơn chức (cả hai đều mạch hở) phản ứng vừa hết với 40ml dung dịch NaOH 1M. D. axit metacrylic. C2H5− CH− C=O. ancol anlylic. Y: C3H8O3. C.74 Đun hợp chất X với H2O (xúc tác H+) được axit hữu cơ Y ( dY / N2 = 2. axit acrylic. A. Biết oxi hoá X bằng CuO đun nóng được sản phẩm có phản ứng tráng gương. B.Câu 1. Y: C3H8O3. Metyl propionat. axit valeric. axit axetic.73 Một este X tạo bởi axit đơn chức và ancol đơn chức có tỉ khối với He bằng 17 22. X: C2H4O2. X: C2H4O2. X: CH2O2.6g chất Y cho 1. C.92 lít O2 (đktc) và thu được VCO : V H O = 3 : 2 .9g một este đơn chức (mạch hở) tác dụng vừa đủ với 150ml dung dịch KOH 1M. C. Câu 1. Y: C3H8O3. Tên X là A. CH3CH2OH. CH3COOCH=CH2. HCOOCH2CH2CH3. D.4g muối của axit hữu cơ X và 9. B. CH2− 2 CH C=O. Etyl axetat. B. D. D. CH2− O C. Biết Z là ancol đơn chức. thu được chất X và chất Y.57 ) và ancol Z. X: C3H6O2.2g ancol Y. CTCT của este E và chất Y là (giả sử các phản ứng đều đạt 100%) A. HCOOCH2CH=CH2. Y lần lượt là A. D. axit acrylic. ancol etanol. Y: C3H8O. ancol propylic. Y. C.78 Cho 12. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng bằng lượng 22 este đã phản ứng. Biết rằng một trong 2 chất (X hoặc Y) tạo thành este là đơn chức. HCOOCH=CH–CH3. Xác định công thức phân tử và gọi tên X. C2H5COOCH3.8g X thì cần 3.77 Thuỷ phân hoàn toàn 0. Công thức cấu tạo của E là A. Để đốt cháy hoàn toàn 2. glixerol. ancol isopropylic.75 Xà phòng hoá một este no đơn chức E bằng một lượng vừa đủ dung dịch NaOH chỉ thu được một sản phẩm X duy nhất. axit propionic. Đốt cháy 0. ancol benzylic. CH3− CH− 2 CH 2 2 O O − C=O. CTCT của este không thể là A. CH3CH2OH. CH3CH2OH. Câu 1.1 mol este E (chứa một loại nhóm chức) cần dùng vừa đủ 100g dung dịch NaOH 12%. CH3COOCH2CH3. Metyl axetat.

etyl axetat.Câu 1.8g thì tên gọi của este là A.96ml NaOH 10%.5ml NaOH 0. C2H5OOC–C3H4–COOC2H5. 108.6g hỗn hợp etyl axetat và etyl fomiat cần 25. 6. cô cạn dung dịch sau phản ứng thu được 14. D.81 Khi thuỷ phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. Giả sử phản ứng xảy ra hoàn toàn. 36. B. C. Mặt khác muốn trung hoà 20ml dd KOH ban đầu phải dùng 15ml dd H2SO4 nói trên.83 Đun a gam este mạch không phân nhánh CnH2n+1COOC2H5 với 100ml dd KOH. Câu 1. etyl valerat. 47. Khi a = 5.35g este đó cần 3g NaOH và thu được 7. 50. D. phenyl fomiat. C2H5O–C6H4–COOC2H5. Câu 1.445kg. còn Y tác dụng với nước brom sinh ra kết tủa trắng. 17 . Cho G tác dụng với axit vô cơ loãng thu được G 1 không phân nhánh. Câu 1. 118. Trong ancol = dung dịch ancol Y 94% (theo khối lượng) tỉ số mol n 14 . 4.14%.05g muối. 117.82 Muốn thuỷ phân 5. Câu 1.9035g X cần 54. (CH2=CH–COO)3C3H5.18%.01 mol este của một ancol đa chức với một axit cacboxylic đơn chức cần dùng 1. etyl butyrat.89kg. C.16%.00g muối khan G.60g một este E đơn chức được 3. benzyl fomiat. Cho 10g E tác dụng với lượng NaOH vừa đủ. C2H5OOC–C6H4–COOC2H5 D. (D = 1.2g NaOH. Biết rằng H 2O n 86 CTCT thu gọn của X. vinyl pentanoat. (CH2=C(CH3)–COO)3C3H5.52g CO2 và 1. C. anlyl butyrat.79 Đốt cháy 1.85 Để thuỷ phân 0. B. Muốn trung hoà dung dịch chứa 0. Y lần lượt là A.84 Thuốc chống muỗi (DEP) thu được khi cho axit thơm (X) tác dụng với ancol Y. Sau phản ứng phải dùng 25ml dd H2SO4 0. Câu 1. CH3–C6H4–COOC2H5. Mặc khác để thuỷ phân 6.10kg natri hiđroxit. D. Tên gọi của este đó là A. khối lượng muối natri thu được là A. B.20%.152g H2O. (CH3COO)2C2H4. (H–COO)3C3H5. D. 103.6kg.2M. D. Số lượng CTCT thoả mãn tính chất đã nêu của E là A. C.80 Để xà phòng hoá 100kg dầu ăn thuộc loại trioleoyl glixerol có chỉ số axit bằng 7 cần 14. B.08g/ml). 2. C. B.5M để trung hoà KOH còn dư. 8. Thành phần % khối lượng của etyl axetat trong hỗn hợp là A. D. Câu 1. etyl propionat. B. CTCT của este là A. B. 100 < M X < 200 . C. C. 52.245kg. X khử được AgNO3 trong amoniac.

trong đó X và Y là đồng phân của nhau. etyl axetat. D. Z là đồng đẳng kế tiếp của Y và có mạch cacbon không phân nhánh. Chỉ số iot của chất béo được tạo nên từ axit linoleic là A. 188. 228. để trung hoà NaOH dư phải dùng 10ml HCl 0. 22. 90. C. CH3(CH2)3COOH. 20. D. Y. 2. 173.188. thu được hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và hai ankanol. 85. 190.20%. etyl fomiat. B. D. mạch hở.05 mol khí. D. D.1%. (CH3)2CH-COOC2H5 và (CH3)2CHCH2COOCH3. Y là A. C. 3. 273. B.6g hỗn hợp muối.920. Hoà tan 1g hỗn hợp axit trên vào 50ml NaOH 0.5M. isopropyl fomiat.90 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu. metyl axetat. 20.91 Số gam iot có thể cộng vào liên kết bội trong mạch cacbon của 100g chất béo được gọi là chỉ số iot của chất béo. B. (CH3)2CHCOOH. C. D. CH3CH2CH2CH2COOH. Y) với dung dịch H2SO4 loãng. CTCT của X.2M. Sau khi kết thúc phản ứng. Z lần lượt là A. 170kg và 80kg.22g hỗn hợp hai este là đồng phân X và Y.5kg và 41kg. Khi đốt cháy hoàn toàn hỗn hợp hai este đó thì thu được khí CO2 và hơi nước với tỉ lệ thể tích VH2O :VCO2 = 1:1 . CH3CH2CH2CH2COOH. Biết hiệu suất quá trình este hoá và quá trình trùng hợp lần lượt là 60% và 80%. 286.92 Một mẫu chất béo chứa gồm trilein và tripanmitin có chỉ số iot là 19. Câu 1.89 E là este của glixerol với một số axit monocacboxylic no. Cho hỗn hợp muối đó tác dụng H2SO4 dư được hỗn hợp 3 axit X. Câu 1. metyl acrylat. B. Câu 1. Y. vinyl axetat.05. C.87 Để xà phòng hoá hoàn toàn 2.3M. HCOOC(CH3)3 và CH3COOCH(CH3)2. 2. Z. (CH3)2CHCOOH. B. 3.88 Đun nóng hỗn hợp hai chất đồng phân (X. 196.9g hỗn hợp ancol trên tác dụng hết với Na thu được 0.736. C. CH3(CH2)3COOH. (CH3)3CCOOH. CH3COOC(CH3)3 và CH3CH2COOCH(CH3)2. (CH3)2CHCOOH. Phân tử 10 khối trung bình của các axit béo trong thành phần cấu tạo của lipit và chỉ số xà phòng hoá của lipit và lần lượt là A. metyl propionat.86 Đun 20g lipit với dung dịch chứa 10g NaOH. Khi cho 3.18%. (CH3)3CCOOH. CH3CH2CH2COOH. CH3CH2CH2COOH. 215kg và 80kg. Đun 7. Biết rằng các gốc hiđrocacbon đều có độ phân nhánh cao nhất. (CH3)2CH-COOC2H5 và (CH3)3COOCH3. 1 để trung hoà dung dịch thu được.9g A với NaOH cho tới phản ứng hoàn toàn. Câu 1. 192. propyl fomiat. 191. C. cần dùng 30ml dd NaOH 1M. B. C. Câu 1. thu được 8. cần dùng 90ml dung dịch HCl 0. (CH3)2CHCOOH.Câu 1.19%. Tên gọi của hai este là A. 18. 65kg và 40kg. 287. A. Phần trăm về khối lượng của một trong hai glixerit phải là A.868. Số CTCT của E và CTCT của các axit X. 18 . D. 86. B. Câu 1.

cấu tạo bởi một nhóm cacbonyl ở vị trí C2 (là xeton) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]3COCH2OH. hai dạng vòng này chiếm ưu thế và luôn chuyển hoá lẫn nhau theo một cân bằng qua dạng mạch hở. do đó có thể mở vòng tạo thành nhóm anđehit (– CHO). H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 1 OH H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 6 CH2OH 5 OH 3 H O H 2 OH H OH 1 O C 1 H H 4 OH α -glucozơ glucozơ β -glucozơ Glucozơ có đầy đủ các tính chất của rượu đa chức và anđehit đơn chức. cấu tạo bởi C1 của gốc α . Fructozơ là đồng phân của glucozơ. cấu tạo bởi C 1 của gốc α .hoặc β . 19 .glucozơ qua nguyên tử O (C1 – O – C4). Cùng với dạng mạch hở fructozơ có thể tồn tại ở dạng mạch vòng 5 cạnh hoặc 6 cạnh H OH 2 H O OH H 5 2 1 O H O OH H 5 1 CH2OH 2 OH H 3 OH O OH H 5 HOCH2 3 1 OH 4 CH2OH H 6 HOCH2 3 OH H 4 CH2OH 6 4 CH2OH H 6 α -fructozơ fructozơ OH- β -fructozơ Trong môi trường bazơ. cấu tạo bởi một nhóm cacbonyl ở C1 (là anđehit) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]4CHO. CH2OH[CHOH]3-CO-CH2OH CH2OH[CHOH]4CHO b) Saccarozơ và mantozơ (C12H22O11) Saccarozơ là một đisaccarit. CACBOHIĐRAT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. nên không có khả năng mở vòng. Đơn vị monosaccarit thứ hai có nhóm OH semiaxetal tự do. Mantozơ là đồng phân của saccarozơ.glucozơ nối với C2 của gốc β fructozơ qua nguyên tử O (C1 – O – C2). glucozơ tồn tại chủ yếu ở hai dạng α -glucozơ và β glucozơ (dạng mạch vòng).CHƯƠNG II. fructozơ có sự chuyển hoá thành glucozơ. Trong thiên nhiên. Trong phân tử không còn nhóm OH semiaxetal. Trong dung dịch. Cấu trúc phân tử a) Glucozơ và fructozơ (C6H12O6) Glucozơ là monosaccarit.glucozơ nối với C4 của gốc α .

cấu tạo bởi các mắt xích α -glucozơ liên kết với nhau thành mạch xoắn lò xo.c) Tinh bột và xenlulozơ (C6H10O5)n Tinh bột là polisaccarit. nên công thức của xenlulozơ còn có thể viết [C6H7O2(OH)3]n. (-) không có phản ứng. Xenlulozơ là đồng phân của tinh bột. 2. không yêu cầu viết sản phẩm. phân tử không có nhóm CHO và các nhóm OH bị che lấp đi. cấu tạo bởi các mắt xích β -glucozơ liên kết với nhau thành mạch kéo dài. phân tử không có nhóm CHO và mỗi mắt xích còn 3 nhóm OH tự do. 20 . Tính chất hoá học Cacbohiđrat Glucozơ Tính chất T/c của anđehit + [Ag(NH3)2]OH T/c riêng của –OH hemiaxetal + CH3OH/HCl T/c của poliancol + Cu(OH)2 T/c của ancol (P/ư este hoá) + (CH3CO)2O Ag↓ + Ag↓ Fructozơ Saccarozơ Mantozơ Tinh bột Xenlulozơ Metyl glucozit - - Metyl glucozit - - dd màu xanh lam dd màu xanh lam dd màu xanh lam dd màu xanh lam - - + + + + + Xenlulozơ triaxetat Xenlulozơ trinitrat + + HNO3/H2SO4 P/ư thuỷ phân + H2O/H+ P/ư màu + I2 - + + + + - Glucozơ + Fructozơ Glucozơ Glucozơ Glucozơ - - - - màu xanh đặc trưng - (+) có phản ứng. (*) phản ứng trong môi trường kiềm.

6 CH2OH H 4 OH 5 OH 3 H O H 2 OH H 1 OH H 6 CH2OH 5 OH 3 H OH − O H 2 OH H 1 + HOCH3 HCl 4 OH + H2O OCH3 metyl α -glucozit  → 11. CH2OH[CHOH]3COCH2OH ← CH2OH[CHOH]4CHO  12.CaO.CaO.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP  → 1. → H 2SO4 loaõ g n 14. CH2OH[CHOH]4CHO + 2Cu(OH)2  CH2OH[CHOH]4COOH + Cu2O↓ + → +2H2O t → 3NH 3 + O H 2 4.2H2O 16. (C6H10O5)n + nH2O  nC6H12O6 Hoaë H+ c (Tinh bột) 8. C12H22O11 + H2O  C6H12O6(Glucozơ) + C6H12O6(Fructozơ) → → 15. CH2OH[CHOH]4CHO + Br2 + H2O  CH2OH[CHOH]4COOH + 2HBr → 3+ 13.CH2OH[CHOH]4CHO+5CH3COOH ← CH3COOCH2[CHOOCCH3]4CHO  Xt. (C6H10O5)n + nH2O  → hoaë men c Axit voâ loaõ g. CH 2 OH[CHOH]4 CHO + 2[Ag(NH 3) 2]OH  CH 2OH[CHOH] 4COONH 4 +2Ag ↓ + glucozơ amoni gluconat Men röôï u 5.t0 Men lactic 6. CH2OH[CHOH]4COOH + Fe  tạo phức màu vàng xanh.t0 (pentaaxetyl glucozơ) + H2O 2. t 0 cô n nC6H12O6 21 . C6H12O6  2C2H5OH + 2CO2↑ → o Ni. C12H22O11 + Ca(OH)2 + H2O  C12H22O11. (C6H10O5)n + nH2O t0  → xt: H + (Glucozơ) nC6H12O6 (Xenlulozơ) (Glucozơ) Ca(OH)2 9. CH2OH[CHOH]4CHO + H2  CH2OH[CHOH]4CH2OH → Sobit (Sobitol) t0 3. C6H12O6  2CH3–CHOH–COOH → Axit lactic (axit sữa chua) Men → 7.2H2O + CO2  C12H22O11 + CaCO3↓ 2H2O + → 17. C12H22O11.B . 6H–CHO → C6H12O6 10.

1.2g. còn trong phân tử fructozơ nhóm cacbonyl ở nguyên tử C số…. B. 1. 2. 34. Cacbohiđrat là những hợp chất hữu cơ tạp chức và đa số chúng có công thức chung là Cn(H2O)m. người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac.4 Những thí nghiệm nào chứng minh được cấu tạo phân tử của glucozơ? A. nhưng trong phân tử glucozơ nhóm cacbonyl ở nguyên tử C số …. Câu 2. 6nCO2 + 5nH2O Dieä luï p c  → a/ s maë trôø t i glucozơ (C6H10O5)n 0 Axit voâ loaõ g. glucozơ. D.BÀI TẬP TRẮC NGHIỆM I.2 Cacbohiđrat là gì? A. D. 68. D. 1. ngược lại. glucozơ. glucozơ. C. 2 loại.tinh bột 18. C. glucozơ. 4 loại. 2.3 Có mấy loại cacbohiđrat quan trọng? A. Câu 2. fructozơ có thể chuyển hoá thành … và … A. Cacbohiđrat là những hợp chất hữu cơ tạp chức. 2. B. 3 loại. 2. phản ứng với Na và với dung dịch AgNO3 trong amoniac. Câu 2. [C6H7O2(OH)3]n + 3nHONO2  [C6H7O2(ONO2)3]n + 3nH2O → (HNO3) xenlulozơ trinitrat C.BÀI TẬP CƠ BẢN Câu 2. t cô n 19. Câu 2.6g. 2. 1 loại. 68. phản ứng với Cu(OH)2 và với dung dịch AgNO3 trong amoniac.0g. mantozơ. 21. Trong môi trường bazơ. Khối lượng bạc đã sinh ra bám vào mặt kính của gương và khối lượng AgNO 3 cần dùng lần lượt là (biết các phản ứng xảy ra hoàn toàn) A.5 Để tráng bạc một chiếc gương soi. C. phản ứng với CuO và với dung dịch AgNO3 trong amoniac.0g. D. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)m. 43.2g. 43. C. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)n. ngược lại. phản ứng với NaOH và với dung dịch AgNO3 trong amoniac. B. D. 68. 43.0g. t 0 20. C. (C6H10O5)n + nH2O  nC6H12O6 → xenlulozơ glucozơ H 2SO4 ñ. B.2g.0g.1 Tìm từ thích hợp để điền vào chỗ trống trong đoạn văn sau: Ở dạng mạch hở glucozơ và fructozơ đều có nhóm cacbonyl. B. ngược lại. 22 .

Câu 2. B. glixerol tác dụng với Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. lòng trắng trứng và rượu etylic. Chỉ dùng một thuốc thử nào sau đây để phân biệt chúng.10 Chọn cách phân biệt các dung dịch sau đây: Lòng trắng trứng. dung dịch CuSO4. còn lại hồ tinh bột. B. tinh bột và xenlulozơ ở dạng bột? A. C.11 Có 4 dung dịch loãng không màu gồm: Lòng trắng trứng.9 Để phân biệt các chất: Glucozơ. Câu 2. Câu 2. C. Glixerol tác dụng Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng.7 Để phân biệt các dung dịch glucozơ. có thể chỉ dùng một thuốc thử nào sau đây? − A. dung dịch KMnO4. khi đun nóng lòng trắng trứng đông tụ. glixerol. dung dịch AgNO3/NH3. Câu 2. tinh bột và xenlulozơ đều cho một loại monosaccarit. Câu 2.8 Có bốn lọ mất nhãn chứa: Glixerol.12 Chọn câu phát biểu sai: A. C. Khi thuỷ phân đến cùng saccarozơ. A. lòng trắng trứng tác dụng Cu(OH)2 cho màu xanh tím. Iot làm hồ tinh bột hoá xanh. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên ? A. dung dịch HCl. dung dịch HNO3. D. Nước brom. Câu 2. Cho từng chất tác dụng với vôi sữa Ca(OH)2. 23 . glixerol. ancol etylic. Cu(OH)2/OH . Cho từng chất tác dụng với dung dịch HNO3/H2SO4. chỉ khác nhau về cấu tạo của gốc glucozơ. sau đó đun nóng và thử với dung dịch iot. D. Hoà tan từng chất vào nước. B. saccarozơ và anđehit axetic có thể dùng chất nào trong các chất sau làm thuốc thử ? − A. còn lại glixerol. D. A. glixerol. dung dịch HNO3 đặc. D. Cu(OH)2/OH . [Ag(NH3)2]OH. C đều đúng. B. Cu(OH)2 trong môi trường kiềm. Na kim loại. glucozơ và axit axetic. D.Câu 2. C. Iot làm hồ tinh bột hoá xanh. dung dịch brom. B. Cả B. hồ tinh bột. C. còn lại lòng trắng trứng. KOH và axit axetic. B. AgNO3/NH3. anđehit axetic. NaOH. C.6 Phương án nào dưới đây có thể phân biệt được saccarozơ. Saccarozơ là một đisaccarit. D. C. Tinh bột và xenlulozơ đều là polisaccarit. B. HNO3. Cho từng chất tác dụng với dung dịch iot.

Khi thuỷ phân đến cùng. C. 52. Saccarozơ. 50. B. B. C. 0. glucozơ. Câu 2.8g.D. 27.5g. C. tinh bột. khối lượng ancol thu được là A. glucozơ. tất cả các chất đã cho.8g. tinh bột. fructozơ.17 Khi thuỷ phân 1kg bột gạo có 80% tinh bột. fructozơ. glucozơ và xenlulozơ.555kg. tinh bột. fructozơ.690kg. Câu 2. glucozơ. Khối lượng AgNO3 cần dùng và khối lượng Ag tạo ra lần lượt là (giả thiết rằng. hex-3-en. Glucozơ. không mùi. 88.5g. xenlulozơ. Câu 2. xenlulozơ. 0.21 Cho glucozơ lên men tạo thành ancol. C.99kg. fructozơ. 18. D. glucozơ. fructozơ. C. 102. glucozơ và saccarozơ. xenlulozơ. D. 0. tinh bột và xenlulozơ đều cho glucozơ. B. C. Chất này có thể lên men rượu (ancol).4g. A. C.500kg. 23. Saccarozơ.0g. tinh bột.18 Tính khối lượng glucozơ tạo thành khi thuỷ phân 1kg mùn cưa có 50% xenlulozơ. B. Câu 2. C. 0. 24 . C.74g. B. 28.19 Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. Saccarozơ. Câu 2. xenlulozơ. B. D. saccarozơ. 0. axit axetic. A. B. sự chuyển hoá của fructozơ là không đáng kể và hiệu suất các phản ứng đều đạt 90%) A.13 Cùng là chất rắn kết tinh. 91. thu được 50g kết tủa. fructozơ và saccarozơ.14 Cho các chất glucozơ.20 Nhóm gluxit đều có khả năng tham gia phản ứng tráng gương là A. glucozơ và tinh bột. B. 0. Glucozơ. thì khối lượng glucozơ thu được là bao nhiêu ? Giả thiết rằng. 64. 0. Glucozơ. vừa có tính chất của anđehit là A.8g. có vị ngọt là tính chất vật lí và trạng thái tự nhiên của nhóm chất nào sau đây? A. Chất vừa có tính chất của ancol đa chức.6g. fructozơ.74g. mantozơ. người ta phải dùng 100g saccarozơ. Câu 2.0g. dễ tan trong nước. mantozơ. khí CO2 tạo thành được dẫn qua dung dịch nước vôi trong dư.90kg. 52. D. Câu 2.444kg. glucozơ và fructozơ. D.0g. 0. Chất đó là chất nào trong các chất sau ? A. Giả thiết hiệu suất phản ứng là 80%. Mantozơ. 91. D. sacacrozơ. phản ứng xảy ra hoàn toàn. không màu. D.80kg.15 Để tráng bạc một số ruột phích. Câu 2. B. Câu 2. chỉ có glucozơ.89kg. saccarozơ. D.16 Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol là 1:1. biết hiệu suất lên men là 80%. Glucozơ. saccarozơ và tinh bột. D.

103 lít. mantozơ. [Ag(NH3)2]OH. C6H12O6 + Cu(OH)2  → kết tủa đỏ gạch n B.25 Biết CO2 chiếm 0. thể tích không khí (đktc) cần cung cấp cho cây xanh quang hợp để tạo 162g tinh bột là A. D. xenlulozơ. C. Phân biệt tinh bột và xenlulozơ bằng I2. Câu 2. xenlulozơ. Na2CO3. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. NaOH. 112. C. tinh bột. Phân biệt saccarozơ và glixerol bằng Cu(OH)2. B. nhiệt độ. Tinh bột có cấu trúc phân tử mạch không phân nhánh.03% thể tích không khí. nhiệt độ. đun nóng.24 Phát biểu nào sau đây không đúng ? A. H2/Ni . Saccarozơ. Câu 2. xenlulozơ. C. CH3COOH/H2SO4 đặc. Phân biệt mantozơ và saccarozơ bằng phản ứng tráng gương.23 Nhóm gluxit khi thuỷ phân hoàn toàn đều chỉ tạo thành glucozơ là: A. mantozơ. B. C. Câu 2. Cu(OH)2. đun nóng. Metyl α . D. Câu 2.Câu 2. C. B. [Ag(NH3)2]OH. H2/Ni . 224. Saccarozơ.103 lít. C6H12O6  m e → CH3–CH(OH)–COOH C. C6H12O6 + CuO  → Dung dịch màu xanh n D. Cu(OH)2. Glucozơ và fructozơ là đồng phân cấu tạo của nhau.103 lít. [Ag(NH3)2]OH. B. Cu(OH)2. Mantozơ. H2O/H+. Câu 2.22 Chọn sơ đồ phản ứng đúng của glucozơ A. nhiệt độ. mantozơ. B. H2/Ni. D. D. glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở. Phân biệt glucozơ và saccarozơ bằng phản ứng tráng gương. [Ag(NH3)2]OH. 448.28 Chọn câu phát biểu đúng: A.glucozit không thể chuyển sang dạng mạch hở. B. Phân biệt glucozơ và fructozơ bằng phản ứng tráng gương. tinh bột. Cu(OH)2. Saccarozơ. nhiệt độ. 25 .103 lít. tinh bột.26 Glucozơ tác dụng được với tất cả chất trong nhóm chất nào sau đây? A.27 Chọn câu phát biểu sai: A. H2/Ni . C6H12O6  m e → C2H5OH + O2 Câu 2. 336. Trong dung dịch. D.

[C6H7O2(OH)3]n. tinh bột.35 Cacbohiđrat (gluxit) là những hợp chất hữu cơ tạp chức và có công thức chung là A. Câu 2.25g. Câu 2. [C6H7O2(OH)3]n. Phân biệt saccarozơ và glixerol bằng phản ứng thuỷ phân. phản ứng với Cu(OH)2.32 Để điều chế 45g axit lactic từ tinh bột và qua con đường lên men lactic. [C6H7O2(OH)3]n. D. mantozơ. xenlulozơ. (C6H10O5)n. Cu(OH)2. D. etanol. Dung dịch mantozơ có tính khử và bị thuỷ phân thành glucozơ. 50g. H2. Khối lượng tinh bột cần dùng là A. B.34 Thuốc thử phân biệt glucozơ với fructozơ là A. C. Glucozơ. B. Cn(H2O)m. 900. n có giá trị là A. mantozơ.39 Cacbohiđrat khi thuỷ phân tạo ra 2 phân tử monosaccarit là 26 . B. tinh bột. B. D. C. Câu 2.C.36 Công thức phân tử và công thức cấu tạo của xenlulozơ lần lượt là A. D. to.29 Phương trình: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. Câu 2. Glucozơ. C.31 Phản ứng khử glucozơ là phản ứng nào sau đây ? A. [C6H7O2(OH)2]n. phản ứng với kim loại Na. Câu 2. Glucozơ. phản ứng tráng gương. CxHyOz. D. 60g. C. C. 56g. B. hiệu suất thuỷ phân tinh bột và lên men lactic tương ứng là 90% và 80%. fructozơ thành những sản phẩm giống nhau là A. Glucozơ + [Ag(NH3)2]OH. 950. Tên gọi X. Câu 2. men C. Y lần lượt là A. B. D. D. B. saccarozơ. etanol. xenlulozơ. B. Câu 2. C. B.38 Gluxit không thể thuỷ phân được nữa là A. 1500. D. C. Glucozơ. B.nH2O. quá trình quang hợp. Glucozơ → etanol. Glucozơ + H2/Ni . phản ứng với H2/Ni. quá trình hô hấp. 1000.37 Một polisaccarit (C6H10O5)n có khối lượng phân tử là 162000u.30 Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → sobit. Câu 2. etanol. o C. 56. (C6H10O5)n. dung dịch Br2. quá trình oxi hoá. Câu 2. t . là phản ứng Clorofin hoá học chính của quá trình nào sau đây? A. C. Glucozơ + Cu(OH)2.33 Phản ứng chuyển glucozơ. (C6H10O5)n. D. C. [Ag(NH3)2]OH. R(OH)x(CHO)y. asmt → Câu 2. D. fructozơ. glucozơ. (C6H12O6)n. Câu 2. D. quá trình khử.

B. lên men rượu etylic. oxi hoá glucozơ bằng [Ag(NH3)2]OH.46 Gluxit chuyển hoá thành glucozơ trong môi trường kiềm là A.3%. có thể dùng 2 phản ứng hoá học là A. D. Xenlulozơ. phản ứng thuỷ phân. B. B. C. Câu 2. dung dịch AgNO3 trong dung dịch NH3. B. Mantozơ.47 Tinh bột trong gạo nếp chứa khoảng 98% là A. 27 . B. Saccarozơ. 0. phản ứng tráng gương. I2. C. C. alanin. glucozơ tác dụng với Cu(OH)2. Tinh bột.40 Saccarozơ và glucozơ có đặc điểm giống nhau là A. Cu(OH)2. Xenlulozơ. to. B. Câu 2. fructozơ. amilozơ. B. 0. tinh bột. phản ứng tráng gương. B. saccarozơ. [Ag(NH3)2]OH. xenlulozơ. C. glucozơ. Câu 2. D. D. amilozơ. đều lấy từ củ cải đường. amilozơ. Câu 2. xenlulozơ. Cu(OH)2 ở nhiệt độ thường. Saccarozơ.A. C. phản ứng lên men rượu etylic. đều tham gia phản ứng tráng gương. B.43 Trong máu người.2%.41 Polisaccarit khi thuỷ phân đến cùng tạo ra nhiều monosaccarit là A. B. phản ứng khử Cu(OH)2. đều có trong biệt dược “huyết thanh ngọt”.1%. phản ứng tráng gương. saccarozơ. D. Câu 2. C. mantozơ. Câu 2. Tinh bột. amilopectin.45 Sobit (sobitol) là sản phẩm của phản ứng A. đều hoà tan Cu(OH)2 ở nhiệt độ thường tạo dung dịch màu xanh đặc trưng. D. C. H2/Ni. Câu 2. saccarozơ. C.44 Để xác định trong nước tiểu của người bị bệnh tiểu đường có chứa một lượng nhỏ glucozơ. tinh bột.48 Phản ứng chứng tỏ glucozơ có nhiều nhóm OH ở các nguyên tử cacbon liên tiếp nhau là phản ứng với A. D. khử glucozơ bằng H2/Ni. D. 0.42 Chất không phản ứng với glucozơ là A.4%. Câu 2. Câu 2. phản ứng cộng hiđro. phản ứng tráng gương. nồng độ của glucozơ có giá trị hầu như không đổi là A. glixerol. 0. C. D. amilopectin. D.

Câu 2. (6). dung dịch brom. (4).1% → 0. (3). (1). (3) vị trí kề nhau. H2/Ni. (6). bị oxi hoá bởi … trong môi trường bazơ. (1).52 Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm ? A. (3). (4). Thuỷ phân dẫn xuất etyl halogenua trong môi trường kiềm. D. phản ứng với AgNO3/NH3. (5). (8). Câu 2. to. phản ứng tráng gương.53 Fructozơ không phản ứng với chất nào sau đây? A. (2). nóng. t . (6) phức bạc amoniac. B.2%. phản ứng lên men rượu etylic. (6). Cho hỗn hợp etilen và hơi nước qua tháp chứa H3PO4. D. (7) hợp chất hữu cơ tạp chức. (3).54 Phản ứng nào sau đây chứng tỏ glucozơ có dạng mạch vòng? A.51 Khi nào bệnh nhân được truyền trực tiếp dung dịch glucozơ (còn được gọi với biệt danh “huyết thanh ngọt”). (3). (2). (7). Khi bệnh nhân có lượng glucozơ trong máu = 0. C. C. (8). … cộng với hiđro cho …. (8). C. (2). (6). Khi bệnh nhân có lượng glucozơ trong máu < 0. (1). (5). (4). (2) có nhiều nhóm OH. Câu 2. Lên men glucozơ.1%. B. tác dụng với axit tạo este có 5 gốc axit. Cacbohiđrat là những … và đa số chúng có công thức chung là … (1) dung dịch màu xanh lam. D. B. D. (5). 28 . (1). Cho etilen tác dụng với dung dịch H2SO4 loãng. (4) fructozơ. Cu(OH)2 ở nhiệt độ cao. D. (5). vậy trong phân tử … ở … Tương tự như glucozơ. phản ứng với Cu(OH)2. (7). Câu 2.C. A.49 Phản ứng chứng minh glucozơ có nhóm chức anđehit là A. Từ hay cụm từ thích hợp ở những chỗ trống trong các câu ở đoạn văn trên lần lượt là A. B. C. Khi bệnh nhân có lượng glucozơ trong máu từ 0. o C. Câu 2. (8) Cn(H2O)m. Cu(OH)2. Câu 2. D.1%. B. tác dụng với axit tạo sobitol. tác dụng với Cu(OH)2 tạo dung dịch có màu xanh đặc trưng. (5) poliancol. (7). C. phản ứng với CH3OH/HCl. (2).50 Phân tử glucozơ tác dụng với Cu(OH)2 cho …. phản ứng với H2/Ni. (8). (4). Khi bệnh nhân có lượng glucozơ trong máu > 0. D. AgNO3/NH3. B. (7).1%.

5. Tỉ lệ phân tử khối của X.58 Cho 4 chất hữu cơ X. C. T lần lượt là 6:1:3:2 và số nguyên tử cacbon trong mỗi chất không nhiều hơn 6. (4). B. (2). (1). lượng glucozơ tổng hợp được bao nhiêu? A. 14. CH2O. Y. CH2O. Câu 2. 12.8g H2O và cần một thể tích oxi vừa đúng bằng thể tích CO2 thu được. Với một ngày nắng (từ 6h00 – 17h00) diện tích lá xanh là 1m2. C2H4O2. C2H4O2. Y. C2H4O2. D. (1). C3H6O3.84kg. C. 4. 88. saccarozơ. D.26g. T lần lượt là A. (4). lên men thành ancol etylic. 90. B.57 Lên men a g glucozơ. giá trị của a là A.09J năng lượng mặt trời. C3H6O3. Khối lượng dung dịch so với ban đầu giảm 3.59 Saccarozơ đều tác dụng được với nhóm chất nào sau đây ? (1) H2/Ni. C6H12O6. nhưng chỉ 10% được sử dụng vào phản ứng tổng hợp glucozơ.56kg. C3H6O3.60 Một cacbohiđrat (Z) có các phản ứng diễn ra theo sơ đồ chuyển hoá sau Cu(OH)2/NaOH to dung dịch xanh lam kết tủa đỏ gạch Z Vậy Z không thể là A. (3).4g. 4. C3H6O3. C6H12O6. 90. Khi oxi hoá hoàn toàn từng chất đều cho cùng kết quả: Cứ tạo ra 4. Y.26g. CH2O. 6. 88. Câu 2. glucozơ. mỗi cm2 lá xanh nhận được khoảng 2.4g CO2 thì kèm theo 1. D. Z.37kg.BÀI TẬP NÂNG CAO Câu 2. B.II. Z. 13. D. Công thức phân tử của X. CH2O. C6H12O6. to. (2).32g. Câu 2. (2). Câu 2.56 Cho 10kg glucozơ chứa 10% tạp chất. B. Khối lượng ancol etylic thu được bằng bao nhiêu? A. Câu 2. T.32g. C2H4O2. 29 . C. (2) Cu(OH)2.65kg. (4) CH3COOH (H2SO4 đặc) A. C. (3) [Ag(NH3)2]OH. ancol bị hao hụt 5%. D. 6CO2 + 6H2O C6H12O6 + 6O2 Nếu trong một phút.55 Phản ứng tổng hợp glucozơ trong cây xanh cần được cung cấp năng lượng là 2813kJ cho mỗi mol glucozơ tạo thành. cho toàn bộ lượng CO2 sinh ra hấp thụ vào dung dịch nước vôi trong tạo thành 10g kết tủa. C6H12O6. Biết hiệu suất của quá trình lên men là 90%. Z. Trong quá trình chế biến. B. C. B. 15.

15.28g CO2 và 1. Biết hiệu suất mỗi giai đoạn lên men là 80%. Giá trị m cần dùng là bao nhiêu ? A. 30 . C đều sai. Câu 2. 950. Công thức phân tử của X là A. C12H24O12.39 lít. thu được 5. 15. toàn bộ lượng CO2 sinh ra cho qua dung dịch Ca(OH)2 dư. hiệu suất quá trình là 70% thì khối lượng nguyên liệu xấp xỉ A.39 lít.61 Đốt cháy hoàn toàn 0. D. (C6H10O5)n C6H12O6 CH3CHO CH3COONH4 CH3COOH D. Nếu muốn điều chế một tấn ancol etylic. Q. C12H22O11 C6H12O6 CH3COOH CH3COOC2H5 CH3COONa B. B.66 Để sản xuất ancol etylic người ta dùng nguyên liệu là mùn cưa và vỏ bào từ gỗ chứa 50% xenlulozơ. Y. B. mantozơ. C. C. Câu 2. C6H12O6. X. D. mỗi mũi tên biểu thị một phản ứng hoá học). thu được 750.63 Cho sơ đồ chuyển đổi sau (E. Q. Câu 2. B.39 lít.00 lít. Câu 2. D. B.64 Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh. fructozơ. D. Z là hợp chất hữu cơ. A. 14. Xenlulozơ và tinh bột có phân tử khối gần bằng nhau. Biết rằng. Câu 2.0. C. Muốn điều chế 29. 24. 5031kg. tỉ lệ khối lượng H và O trong X là 0.65 Chọn câu đúng trong các câu sau: A.5. C. Y. B. Công thức của E. X. được đều chế từ xenlulozơ và axit nitric.98g H2O. 940.70kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric 96% (D=1. (C6H10O5)n.0. D.01 mol một cacbohiđrat (X).52 g/ml) cần dùng là bao nhiêu ? A.125:1.2. Z phù hợp với sơ đồ sau là Q X E CO2 C2H5OH Z Y E Q X Y Z A.C.0g kết tủa. 5000kg. 949. 1000. Xenlulozơ có phân tử khối nhỏ hơn tinh bột. C12H22O11. Xenlulozơ và tinh bột đều có phân tử khối rất lớn. Xenlulozơ và tinh bột có phân tử khối nhỏ. Câu 2. (C6H10O5)n C6H12O6 CH3CHO CH3COOH CH3COOC2H5 C.62 Cho m g tinh bột lên men để sản xuất ancol etylic. nhưng phân tử khối của xenlulozơ lớn hơn nhiều so với tinh bột. B.

25 lít.6g CH3COOH. Sản phẩm được dẫn vào nước vôi trong thu được 0. 77. Công thức phân tử của X là A. Có thể phân biệt mantozơ và đường nho bằng vị giác. Có thể phân biệt glucozơ và saccarozơ bằng phản ứng với Cu(OH)2 /OH-. Câu 2.72 Đốt cháy hoàn toàn 0. 389. C. thu được 11.70 Pha loãng 389. đồng thời khối lượng dung dịch tăng 0.125 lít. 1218. C12H22O11. D.67 Chọn phát biểu sai: A.7 lít. 31 . 398. D. B. tất cả đều sai. Câu 2.8 g/cm3.25 lít.03% thể tích không khí. C. B. Đun nóng dung dịch A lại được 0. Câu 2.1g kết tủa và dung dịch A. 1206. C18H36O18. 1246. Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A. biết khối lượng riêng của ancol etylic là 0. Biết khi làm bay hơi 0. 400kg. Khối lượng ancol thu được là A. 1382666.8kg.C. 6200kg.8kg ancol etylic thành ancol 40o.0815g.1g kết tủa nữa.8kg. B. C.7 lít. C. D. Thể tích dung dịch ancol thu được là A. hiệu suất của mỗi quá trình lên men là 85%. D. Câu 2. to. Muốn tạo ra 500g tinh bột thì cần bao nhiêu lít không khí (đktc) để cung cấp đủ lượng CO2 cho phản ứng quang hợp? Giả thiết hiệu suất quá trình là 100% A. Câu 2.71 Khí cacbonic chiếm tỉ lệ 0. 1382600 lít. B. Câu 2.1g hỗn hợp X gồm xenlulozơ triaxetat. C6H12O6. B.16%.84% và 23.0552g hỗn hợp hơi ancol etylic và axit fomic đo trong cùng điều kiện. 77% và 23%. 390kg. 5100kg. B.4104g X thu được thể tích khí đúng bằng thể tích 0. Tinh bột có phản ứng màu với iot do tinh bột có cấu tạo mạch ở dạng xoắn có lỗ rỗng. 70% và 30%. D. Tinh bột và xenlulozơ không thể hiện tính khử vì trong phân tử không có nhóm chức anđehit (–CH=O). (C6H10O5)n. 1402666.84% và 22.0855g một cacbohiđrat X. tất cả đều sai.68 Cho xenlulozơ phản ứng với anhiđrit axetic (xúc tác H2SO4 đặc).69 Lên men 1 tấn tinh bột chứa 5% tạp chất trơ thành ancol etylic. xenlulozơ điaxetat và 6.16%. D. 76. D. C. C.

41 B 2.59 B 2.9 B 2.1 A 2.69 C 2.14 A 2. Tính chất a) Tính chất của nhóm NH2 + Tính bazơ R NH2 + H2O [R NH3]+ + OH- Tác dụng với axit cho muối: R NH2 + HCl [R NH3]+Cl- Lưu ý: Mọi yếu tố làm tăng mật độ electron ở nguyên tử nitơ trong phân tử amin trung hoà nói chung đều làm tăng tính bazơ (trừ trường hợp chịu ảnh hưởng của hiệu ứng che chắn không gian và khả năng solvat hoá trong dung môi nước).11 B 2.42 D 2.25 B 2.29 B 2.21 A 2.19 C 2.52 B 2.64 A 2. Cấu tạo phân tử: Các nhóm đặc trưng R NH2.13 A 2.18 B 2.38 D 2.36 B 2.24 D 2.27 D 2. AMIN – AMINO AXIT – PROTEIN A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.33 C 2.32 B 2.63 B 2.66 A 2.71 A 2.23 C 2.12 C 2.57 D 2.46 C 2.55 A 2.51 B 2.70 C CHƯƠNG III..15 A 2.54 D 2.49 D 2.65 D 2.43 A 2.53 C 2.20 D 2. 32 .45 A 2.62 B 2.60 B 2.58 C 2.10 D 2.35 A 2.50 C 2.68 B 2..8 C 2.3 C 2.22 B 2. NH2 H2N CH CO 1 R .44 C 2.39 C 2.48 B 2. chẳng hạn các gốc ankyl có hiệu ứng +I.2 B 2. sẽ làm cho tính bazơ tăng lên. NH CH COOH n R amin α .61 C 2.26 B 2.4 D 2.6 C 2.7 A 2.31 A 2.30 A 2.40 C 2.47 B 2.56 B 2. R CH COOH.amino axit peptit 2.17 D 2.16 B 2.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG II 2.67 A 2.28 C 2.37 C 2.34 C 2.5 C 2.72 A 2.  Những nhóm đẩy electron.

 Ngược lại nhóm phenyl có hiệu ứng –C hút electron. Vì vậy các amin mạch hở có tính bazơ mạnh hơn (dung dịch trong nước của chúng có thể làm xanh giấy quỳ) so với amin thơm (Anilin không làm xanh giấy quỳ). làm giảm mật độ điện tích âm ở nguyên tử N. sẽ làm tính bazơ yếu đi. ArNH2 + HNO2 + HCl 0-5oC -2H2O ArN2+Cl. người ta có thể phân biệt được chúng. 33 .π theo chiều chuyển dịch electron hướng vào vòng benzen. do đó khả năng nhận proton của anilin giảm. Thực tế HNO2 không bền. đun nóng dung dịch muối điazoni sẽ tạo ra phenol và giải phóng nitơ. HCl R NH2 + HONO R OH + N2 + H2O NaNO + HCl 2 Thí dụ: C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  • Amin thơm bậc 1 Tác dụng với axit nitrơ trong môi trường axit ở nhiệt độ thấp tạo muối điazoni. ta có thể viết: (CH3)2NH > CH3NH2 > NH3 > C6H5NH2 > (C6H5)2NH > (C6H5)3N. càng thay thế nhiều nguyên tử H trong phân tử NH3 bằng những nhóm có hiệu ứng đẩy electron +I tính bazơ càng tăng.  Về nguyên tắc. Vì vậy. + Tác dụng với HNO2 Dựa vào khả năng phản ứng khác nhau đối với HNO 2 của các amin mỗi bậc. đồng thời trong phân tử xuất hiện hiệu ứng liên hợp p .hay ArN2Cl + NaNO2 + HCl  Thí dụ: C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O (1*)    (anilin) (phenylđiazoni clorua) Đun nóng dung dịch muối điazoni: +  t0 C 6 H N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl (2*) →  5   Lưu ý: Trong công thức phân tử không cần viết các phản ứng (1* và 2*). Điều này được giải thích là: Amin thơm chứa vòng benzen hút electron. chỉ cần nêu hiện tượng. ngược lại càng có nhiều nhóm gây hiệu ứng –C tính bazơ sẽ càng giảm. nên phải dùng hỗn hợp (NaNO2 + HCl). − Amin bậc 1 • Amin béo bậc 1 Tác dụng với axit nitrơ tạo ancol tương ứng và giải phóng khí nitơ (hiện tượng sủi bọt khí).

.amino axit tạo poliamit: NH [CH2]5 CO n + nH2O d) Protein có phản ứng của nhóm peptit CO-NH + Phản ứng thuỷ phân: H 2N CH 1 R H2 N nH2N [CH2]5 COOH to CO HN CH R1 CH CO HN CH R2 CH CO . + H2N 4 COOH + nH2O hay2enzim H SO CH2 Rn COOH + Phản ứng màu với Cu(OH)2 cho dung dịch màu xanh tím (dùng để nhận biết protein)..− Amin bậc 2 Các amin bậc 2 thuộc dãy thơm hay dãy béo đều dễ dàng phản ứng với HNO2 tạo thành nitrozamin (Nitroso) màu vàng: R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (Nitroso – màu vàng) − Amin bậc 3: Không phản ứng (không có hiện tượng gì). + Tác dụng với dẫn xuất halogen: R NH2 + CH3I R NHCH3 + HI b) Amino axit có tính chất của nhóm COOH Tính axit RCH(NH2)COOH + NaOH RCH(NH2)COONa + H2O Phản ứng este hoá: 2 4 RCH(NH2)COOH + R1OH RCH(NH2)COOR1 + H2O c) Amino axit có phản ứng giữa nhóm COOH và nhóm NH2 Tạo muối nội (ion lưỡng cực): H SO H3N+ CH COO- H2N CH COOH R R Phản ứng trùng ngưng của các ε .và ω ... NH CH R3 CH R2 COOH + H2N R3 COOH + H2N Rn COOH+ . e) Anilin và nhiều protein có phản ứng thế dễ dàng nguyên tử H của vòng benzen NH2 NH2 Br Br (trắng) Br (dd) + 3Br2(dd) + 3HBr(dd) 34 .

R–NO2 + 6HCl + 3Fe  R–NH2 + 3FeCl2 + 2H2O → Al 2O3. 2R – OH + NH3  (R)2NH + 2H2O → Al 2O3. CH3NH2 + H–COOH  H–COONH3CH3 → metylamoni fomiat 7. R – OH + NH3  R–NH2 + H2O → Al 2O3. P 17. 3R – OH + NH3  (R)3N + 3H2O → C2H5OH → 20. CH3NH3Cl + NaOH  CH3NH2 + NaCl + H2O → 9.B . C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  + NaNO + HCl  2 2. R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (nitroso – màu vàng)  → 5. C 6 H 5 N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl →   t0 4. C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O    +   3. C6H5NH2 + CH3COOH  CH3COONH3C6H5 → 10. R – Cl + NH3  R – NH2 + HCl 1000C 21. C6H5–NO2 + 6 [ H ]  → Cũng có thể viết: 16. P 19. C6H5NH2 + HCl  C6H5NH3Cl → phenylamoni clorua 8. R–NO2 + 6 [ H ]  R–NH2 + 2H2O → Fe + HCl C6H5–NH2 + 2H2O 15.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP NaNO + HCl 2 1. P 18. 2C6H5NH2 + H2SO4  [C6H5NH3]2SO4 → 12. CH3 – NH2 + H2O ← CH3 – NH3+ + OH 6. R – NH2 + HCl  R – NH3Cl → 35 . H2N + H2SO4 180oC H2N NH2 SO3H + H2O 13. NH2 Br Br (dd) + 3Br2(dd) Br Fe + HCl + 3HBr(dd) 14. C6H5NH2 + H2SO4  C6H5NH3HSO4 → 11.

to.BÀI TẬP TRẮC NGHIỆM I.+ H+ ← H3N+–R – COO  27. thêm vài giọt dung dịch H2SO4. C. thêm vài giọt dung dịch Na2CO3 D.BÀI TẬP CƠ BẢN Câu 3. D. H2NR(COOH)a + aNaOH  H2N(COONa)a + aH2O → 28. H2N–R–COOH + HONO  HO–R–COOH + N2↑ + H2O → 39. nhận biết bằng mùi. phenylamin và amoniac đúng là A. 2R – Cl + NH3  (R)2NH + 2HCl 1000 C C2H5OH → 25. 2(H2N)bR(COOH)a + bH2SO4  [(H3N)bR(COOH)a]2(SO4)b → 37. 3R – Cl + NH3  (R)3N + 3HCl 1000 C  →  → 26. R – Cl + NH3  R – NH3Cl 1000C 23.+ NH3  H2N–R–COOR’ + NH4Cl → 35. (H2N)b R (COOH)a + aNa  (H2N)bR(COONa)a + → a 2 H2 31. p . H2N–R–COOH + R’–OH + HCl ←  [H3N+–R–COOR’]Cl.1 Sự sắp xếp theo trật tự tăng dần tính bazơ giữa etylamin.2 Cách thuận lợi nhất để nhận biết lọ đựng dung dịch CH3NH2 là A. 2(H2N)bR(COOH)a + aNa2O  2(H2N)b R(COONa)a + aH2O → HCl  → 32. ClH3N–R–COOH + 2NaOH  H2N–R–COONa + NaCl + H2O → HCl 38. CH3CH(Br)COOH + 3NH3  CH3CH(NH2)COONH4 + NH4Br → C. H2N–R–COOH ← H2N–R–COO. etylamin < amoniac < phenylamin. B. 41. R – NH3Cl + NaOH  R – NH2 + NaCl + H2O → C2H5OH → 24. p NH[CH2]5CO n + nH2O HN[CH2]6CO n + nH2O 40. H2N–R–COOH + HCl  ClH3N–R–COOH → 36. C.+ H2O  34. to. Câu 3. H2N–R–COOH + R’–OH ←  H2N–R–COOR’ + H2O  HCl   → 33. 36 xt. phenylamin < etylamin < amoniac. B. amoniac < etylamin < phenylamin.C2H5OH → 22. nH2N[CH2]5COOH nH2N[CH2]6COOH xt. [H3N+–R–COOR’]Cl. phenylamin < amoniac < etylamin. H2N–R–COOH + Na  H2N–R–COONa + H2 → 2 30. Đưa đầu đũa thuỷ tinh đã nhúng vào dung dịch HCl đậm đặc lên phía trên miệng lọ đựng dung dịch CH3NH2. 2(H2N)bR(COOH)a + aBa(OH)2  [(H2N)bR(COO)a]2Baa + 2aH2O → 1 29.

D. quỳ tím.2g CO2. Công thức cấu tạo thu gọn của A. trong phân tử của nó vừa có nhóm …(1)…vừa có nhóm …(2)…nên vừa có tính chất …(3)…vừa có tính chất … (4)….9 Thuốc thử nào dưới đây dùng để phân biệt các dung dịch glucozơ.5. 37 . B.3 Số lượng đồng phân ứng với công thức phân tử C3H9N là A. 3. 4. B.10 Khi thuỷ phân 500g protein A thu được 170g alanin. Câu 3. Câu 3. 189. Để nhận ra dung dịch của các hợp chất trên.4 Số lượng đồng phân amin bậc 2 ứng với công thức phân tử C4H11N là A. 2. D. C. N) và ancol metylic. NaOH. CH3CH2COOH và CH3[CH2]3NH2. 2. hiđroxyl metylen khử oxi hoá cation anion D.8 Este A được điều chế từ amino axit B (chỉ chứa C. 190. B. 3. Nếu phân tử khối của A là 50. HNO3. NaOH.9g este A thu được 13.5 Số lượng đồng phân amin có chứa vòng benzen ứng với công thức phân tử C7H9N là A. Câu 3. 2. C.6 Amino axit là một hợp chất hữu cơ tạp chức. CH2(NH2)COOCH3. CH2(NH2)COOH. 5. CH3OH/HCl.12 lít N2 (đktc). Câu 3. 191. B lần lượt là A. 3. Cu(OH)2. glixerol. B.Câu 3. AgNO3/NH3. C. amin cacbonyl oxi hoá Axit phân tử phân tử ion lưỡng B. H. 4. C. D. etanol và lòng trắng trứng? A. D. B. amino cacboxyl bazơ Axit phân tử cực C. Câu 3. CH(NH2)2COOCH3.3g H2O và 1. B. thì số mắt xích alanin trong phân tử A là bao nhiêu? A. CH(NH2)2COOCH3. Amino axit thường tồn tại dưới dạng …(5)…cân bằng với dạng …(6)… (1) (2) (3) (4) (5) (6) A. 4. 5. D. D. 6. Câu 3. 192. D. C. CH(NH2)2COOH. chỉ cần dùng thuốc thử nào sau đây? A. CH2(NH2)COOCH3. C.000. CH(NH2)2COOH. 5. xeton metyl axit lưỡng tính nguyên tử cation Câu 3.7 Có 3 chất hữu cơ gồm NH2CH2COOH. HCl. Đốt cháy hoàn toàn 8. B. Tỉ khối hơi của A so với H2 là 44. C. CH2(NH2)COOH. O.

Câu 3.11 Chất nào sau đây không có phản ứng với dung dịch C2H5NH2 trong H2O? A. HCl. B. H2SO4. C. NaOH. D. quỳ tím. Câu 3.12 Glixin phản ứng được với tất cả các chất trong nhóm chất nào sau đây (điều kiện phản ứng xem như có đủ): A. Quỳ tím , HCl , NH3 , C2H5OH. B. NaOH, HCl, C2H5OH, CH2 COOH.
NH2

C. Phenoltalein , HCl , C2H5OH , Na. D. Na , NaOH , Br2 , C2H5OH. Câu 3.13 Tìm công thức cấu tạo của hợp chất hữu cơ X chứa 32% C; 6,667% H; 42,667% O; 18,666% N. Biết phân tử X có một nguyên tử N và X có khả năng tham gia phản ứng trùng ngưng. A. H2NCH2COOH. B. C2H5NO2. C. HCOONH3CH3. D. CH3COONH4. Câu 3.14 Hợp chất hữu cơ A có công thức phân tử là C3H7O2N, A tác dụng được với dung dịch NaOH, dung dịch HCl và làm mất màu dung dịch brom. Công thức cấu tạo đúng của A là A. CH3CH(NH2)COOH. B. CH2=CHCOONH4. C. HCOOCH2CH2NH2. D. H2NCH2CH2COOH. Câu 3.15 Cho các chất: etylen glicol (1), axit aminoaxetic (2), axit oxalic (3), axit acrylic (4). Những chất có thể tham gia phản ứng trùng ngưng là A. (1), (2), (3). B. (1), (2). C. Chỉ có (2). D. Cả bốn chất. Câu 3.16 Có các dung dịch chứa trong các lọ mất nhãn sau: Lòng trắng trứng, hồ tinh bột, glixerol. Thuốc thử có thể dùng để phân biệt các dung dịch trên là A. Cu(OH)2. B. I2. C. AgNO3. D. cả A, B đều đúng. Câu 3.17 Số đồng phân của hợp chất hữu cơ thơm có công thức phân tử C7H7NO2 là A. 7. B. 6. C. 5. D. 8. Câu 3.18 Số đồng phân của các chất có công thức phân tử C4H10O (1), C4H9Cl (2), C4H10 (3), C4H11N (4) theo chiều tăng dần là A. (3), (2), (1), (4). B. (4), (1), (2), (3). C. (2), (4), (1), (3). D. (4), (3), (2), (1). 38

Câu 3.19 Cho sơ đồ phản ứng: NaOH C9H17O4N (X)  C5H7O4NNa2 (Y) + 2C2H5OH. → Công thức cấu tạo thu gọn của X, Y lần lượt là A. C2H5OOCCH2CH(NH2)CH2COOC2H5, NaOOCCH2CH(NH2)CH2COONa. B. CH3OOCCH2CH(NH2)CH2COOC3H7, NaOOCCH2CH(NH2)CH2COONa. C. HOOCCH2CH(NH2)CH2COOC4H9, NaOOCCH2CH(NH2)CH2COONa. D. CH3OOCCH2CH(NH2)CH2COOCH(CH3)2, NaOOCCH2CH(NH2)CH2COONa. Câu 3.20 Chọn phát biểu đúng về hợp chất tạp chức: A. Hợp chất hữu cơ có từ hai loại nhóm chức trở lên. B. Hợp chất hữu cơ có từ hai nhóm chức trở lên. C. Hợp chất hữu cơ có nhiều nhóm chức. D. Hợp chất hữu cơ có hai nhóm chức. Câu 3.21 Trong sơ đồ sau, công thức cấu tạo thu gọn phù hợp của A, B, C, D, E lần lượt là
2 2 2 2 + NH 3 + dd NaOH → → → → Etan  A  B  C  D  E  → → 1:1 Cu 1:1 Mn2+ Glixin. A. C2H5Cl, C2H5OH , CH3CHO, CH3COOH , CH3COOCl. B. C2H5Cl, C2H5OH , CH3CHO, CH3COOH, CH2ClCOOH. C. C2H5Cl, C2H5OH , CH3 COCH3, CH3COOH, CH2ClCOOH. D. C2H5Cl, C2H5OH , CH3COOH, CH3COCH3, CH2ClCOOH. Câu 3.22 Cho 3 chất hữu cơ: NH2CH2COOH (1); CH3CH2CH2CH2NH2 (2); CH3CH2COOH (3). Nhiệt độ nóng chảy của chúng được xếp theo trình tự giảm dần là A. (2) < (3) < (1). B. (1) > (3) > (2). C. (3) < (2) < (1). D. (2) > (1) > (3). Câu 3.23 Hợp chất đa chức và hợp chất tạp chức giống nhau ở chỗ A. đều là hợp chất có nhiều nhóm chức. B. đều là hợp chất chứa các nhóm chức giống nhau. C. phân tử luôn có liên kết π. D. mạch cacbon trong phân tử có liên kết π . Câu 3.24 X là một axit α -monoamino monocacboxylic, có tỉ khối hơi so với không khí là 3,07. X là A. glixin. B. alanin. C. axit α - aminobutiric. D. axit glutamic.

+ Cl

+O

+O

+ Cl

39

Câu 3.25 Khi đun nóng chất béo với dung dịch kiềm “....”
A. luôn thu được glixerol và phản ứng xảy ra thuận nghịch. B. luôn thu được glixerol, phản ứng xảy ra nhanh hơn và một chiều. C. luôn thu được muối của axit béo và phản ứng xảy ra thuận nghịch. D. luôn thu được xà phòng, phản ứng xảy ra chậm hơn. Chọn một phương án trong số các phương án trên để điền vào chỗ trống trong câu sao cho đúng ý nghĩa hoá học.

Câu 3.26 Amino axit là
A. hợp chất hữu cơ đa chức, có chứa 2 nhóm chức COOH và NH2. B. hợp chất hữu cơ đa chức, có chứa 2 loại nhóm chức COOH và NH2. C. hợp chất hữu cơ tạp chức, có chứa 2 nhóm chức COOH và NH2. D. hợp chất hữu cơ tạp chức, có chứa 2 loại nhóm chức COOH và NH2.

Câu 3.27 Công thức tổng quát của amino axit là A. RCH(NH2)COOH. B. R(NH2)x(COOH)y. C. R(NH2)(COOH). D. RCH(NH3Cl)COOH. Câu 3.28 Chọn câu phát biểu sai: A. Amino axit là hợp chất hữu cơ tạp chức. B. Tính bazơ của C6H5NH2 yếu hơn NH3. C. Công thức tổng quát của amin no, mạch hở, đơn chức là CnH2n + 3N (n ≥ 1). D. Dung dịch của các amino axit đều làm quỳ tím chuyển sang màu đỏ. Câu 3.29 Hai phương trình phản ứng hoá học sau, chứng minh được nhận định rằng: H2NCH2COOH + NaOH → H2NCH2COONa + H2O. H2NCH2COOH + HCl → HOOCCH2NH3Cl. A. Glixin là một axit. B. Glixin là một bazơ. C. Glixin là một chất lưỡng tính. D. Glixin là một chất trung tính. Câu 3.30 Hợp chất hữu cơ X có công thức cấu tạo thu gọn: HOOCCH2CH2CH(NH2)COOH. Tên gọi của X là A. glixin. B. alanin. C. axit ađipic. D. axit glutamic. Câu 3.31 Cho sơ đồ chuyển hoá sau:
X
H2SO4 - Na2SO4

Y

C2H5OH, H2SO4, to - Na2SO4

CH3

CH

COO

C2H5

NH3HSO4
CH COONa, CH3 CH COOH.

Công thức cấu tạo phù hợp của X, Y lần lượt là
A. CH3 C. CH3 CH COONa, CH3 CH COOH. B. CH3 D. CH3 NH2 CH COONa, CH3 NH2 NH2 CH COOH. NH3HSO4 NH3HSO4 CH COOH, CH3 NH3HSO4 NH2 CH COOH. NH2

Câu 3.32 Phương trình phản ứng hoá học sau chứng minh được rằng: H2NCH2COOH + C2H5OH 40
H+, to

H2NCH2COOC2H5 + H2O.

HOOC – CH2 – CH2 – CH(NH2) – COONH4. có công thức cấu tạo thu gọn là A.39 Sản phẩm của phản ứng este hoá giữa amino axit X và metanol thu được este có tỉ khối hơi so với propin bằng 2. CH3 CH2 CH C6H5 NH2 COOH. CH3 CH2 CH NH2 C6H5 COOH. Câu 3.34 Muối của axit glutamic dùng làm bột ngọt (còn gọi là mì chính). B. C đều sai. C. D. B.A. B. HOOC – CH2 – CH2 – CH(NH2) – COOH. Glixin có nhóm COOH. Câu 3. C. C6H5 NH2 D. D. CuSO4. B. axit glutamic. Amino axit có tính lưỡng tính. Zn(NO3)2. Câu 3. triphenylamin. tất cả A. C. Câu 3. Câu 3. B. Glixin có nhóm NH2. không xác định được. Các protein đều chứa các nguyên tố C . N. 1. D. Amin đơn chức đều chứa một số lẻ nguyên tử H trong phân tử. Câu 3. Ở nhiệt độ thường dưới tác dụng của men.36 Chọn câu phát biểu sai: A. 0. B.38 Tính bazơ của amin nào trong số các amin sau đây là yếu nhất ? A.33 Điều khẳng định nào sau đây là sai ? A.40 Cho dung dịch metylamin đến dư vào các dung dịch sau: FeCl3. CH3COOK thì số lượng kết tủa thu được là A. Amino axit tham gia phản ứng trùng ngưng. 41 . Câu 3. B.37 Để điều chế glixin theo sơ đồ: Axit axetic → axit cloaxetic → glixin. Clo và amin. D. glixin. H nối với O của axit linh động hơn ancol. Tên gọi của X là A. B. C. Cần dùng thêm các chất phản ứng nào sau đây (không kể xúc tác): A. Clo và amoniac. D. Một số protein bị đông tụ khi đun nóng. D.225. alanin. Câu 3. C. O . Hiđroclorua và amoniac. NH2 C6H5 C. CH2 CH COOH. H . C. anilin. Phân tử khối của một amin đơn chức luôn là số chẵn. B. H nối với O của ancol linh động hơn axit. B. D. C. protein bị thuỷ phân tạo ra các amino axit.35 Công thức cấu tạo thu gọn của axit 2 – amino – 3 – phenylpropanoic là A. điphenylamin. NaOOC – CH2 – CH2 – CH(NH2) – COOH. NaOOC – CH2 – CH2 – CH(NH2) – COONa. CH2 CH COOH. Axit clohiđric và muối amoni. Protein có trong mọi bộ phận của cơ thể động vật là hợp chất hữu cơ đa chức.

B.04 mol và 0. B. D. D. Khối lượng sản phẩm thu được có giá trị là A. X có đặc điểm cấu tạo và các tính chất sau: phân tử có mạch cacbon không phân nhánh. Câu 3. (CH3COO)2Pb. kết quả khác.C.48 Hãy chỉ ra câu sai trong các câu sau: A. thì số lượng kết tủa thu được là A. không làm mất màu dung dịch Br2. Công thức cấu tạo của X là CH2 CH2 CH2 A. riêu cua nổi lên được giải thích là do: A. Công thức phân tử của hai amin là A.825g. D. NH3. 3. no.41 Cho 15g hỗn hợp các amin gồm anilin. B. C. B. 1. 2. C.43 Khi nấu canh cua. kết quả khác. Câu 3. D. đietylmetylamin tác dụng vừa đủ với 50ml dung dịch HCl 1M. Tổng số mol hai amin và nồng độ mol/l của dung dịch HCl là A. Câu 3. (CH3COO)2Mg. mạch hở là CnH2n+2+kNk.98g muối. Tất cả các nguyên nhân nêu ở A. đimetylamin. CH2 CH2 NH O C. 42 .2M. X còn có khả năng tham gia phản ứng trùng hợp. B. Sự đông tụ của protit. Tính bazơ của các amin đều mạnh hơn NH3. số mol hai amin bằng nhau. Biết trong hỗn hợp. 0. B. 21. C = O. Fe + dung dịch HCl.42 Cho dung dịch metylamin đến dư vào các dung dịch sau: (CH3COO)2Cu. 16.18g.47 Hợp chất hữu cơ (X) có công thức phân tử CxHyNO có khối lượng phân tử bằng 113u. B.96g muối. D. C. Các chất bẩn trong cua chưa được làm sạch hết. Câu 3. B. Câu 3.02 mol và 0.44 Điều chế anilin bằng cách khử nitrobenzen thì dùng chất khử nào sau đây ? A. C. kết quả khác. C3H9N và C2H7N. 0. H2N[CH2]4 CHO. 2. không đủ dữ kiện để tính. 3. Câu 3.46 Cho 3. D. khi tác dụng với dung dịch NaOH chỉ thu được sản phẩm hữu cơ duy nhất.52g X tác dụng vừa đủ với 200ml dung dịch HCl thu được 2. C3H9N và C4H11N. CH5N và C2H7N. Ngoài ra. D. 0. khí H2.1M. CH3 CH2 CH2 CH2 C NH2. B. Cho 1. Câu 3. D. C. metylamin.06 mol và 0. D. mạch hở tác dụng vừa đủ với dung dịch HCl thu được 5.45 Hỗn hợp (X) gồm hai amin đơn chức. C. Metylamin có tính bazơ mạnh hơn anilin. 0. C. cacbon. C. Công thức tổng quát của amin no. CH3COOAg. Câu 3. 20.04g hỗn hợp Y gồm hai amin đơn chức. Có phản ứng hoá học của NaCl với chất có trong nước lọc khi xay (giã) cua.123g. Các amin đều kết hợp với proton.3M.

C4H9-NH2. A và C đúng. Biết rằng tên của A có tiếp đầu ngữ “para”. B. CH3NH2 và C4H9NH2. D. C3H9N và C4H11N. C4H11N. Câu 3. C3H9N. đơn chức. C. CH3-CH2-CH2-NH2. 9. D.53 Cho 20g hỗn hợp gồm 3 amin no. C3H9N. đơn chức. B. Câu 3. Để trung hoà hoàn toàn 0. D. C5H13N.6g H2O. C2H7N. Công thức phân tử của 2 amin là A. 43 . kết quả khác. đơn chức là đồng đẳng liên tiếp của nhau. etylamin.51 Đốt cháy hoàn toàn m g một amin A bằng lượng không khí vừa đủ. C4H11N. CH3-C6H4-NH2 .BÀI TẬP NÂNG CAO Câu 3. cô cạn dung dịch thu được 31. C. Câu 3. thu được 17. tác dụng vừa đủ với dung dịch HCl.49 Đốt cháy hoàn toàn hỗn hợp hai amin no. đimetylamin.21g amin A sinh ra khí CO 2. C3H7N.6g hơi nước và 69. C5H11N. C4H11N. CH3-CH-NH2. Khi đốt cháy amin B thấy VCO2 : VH2O = 2 : 3 . B lần lượt là NH2 NH2 A.54 Dung dịch X chứa HCl và H2SO4 có pH = 2. X có công thức phân tử là A.59g hỗn hợp 2 amin no. Công thức phân tử của hai amin lần lượt là A. C3H9N.50 Có hai amin bậc một gồm A (đồng đẳng của anilin) và B (đồng đẳng của metylamin). C. C2H7N. D. B. Đốt cháy hoàn toàn 3. thu được 2. 7. là đồng đẳng liên tiếp. CH3N. C. CH5N và C2H7N.44 lít khí nitơ. D. CH3 Câu 3. etylamin. Giá trị m và tên gọi của amin là A. C. B. 9. C4H9N.52 Khi đốt cháy hoàn toàn một amin đơn chất X.Câu 3. CH3-C6H4-NH2 . B. C2H7N. trong đó nitơ chiếm 80% thể tích (các V đo ở đktc). người ta thu được 10. 12. C3H7NH2 và C4H9NH2. II. bậc I (có số nguyên tử C nhỏ hơn hoặc bằng 4) phải dùng một lít dung dịch X.125g H2O. 8. 8. CH3 . C3H9N. C5H13N. B. hơi H2O và 336 cm3 khí N2 (đktc). C2H7N và C3H9N. etylamin hoặc đimetylamin.24 lít khí CO2 (đktc) và 3. CH3-CH2-CH2-NH2.4 lít khí CO2 và 1. D. C2H5NH2 và C4H9NH2. Giả thiết không khí chỉ gồm nitơ và oxi. Nếu 3 amin trên được trộn theo tỉ lệ số mol 1:10:5 và thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là A.68g hỗn hợp muối. Công thức cấu tạo của A. CH3 .6g khí cacbonic. C.4 lít N2 (các V đo ở đktc).

8 ≤ X < 2. amino cacboxyl 44 . Công thức cấu tạo của A là A. D. C. thì tỉ lệ thể tích X = VCO2 : VH2O biến đổi như thế nào theo số lượng nguyên tử cacbon tăng dần trong phân tử ? A. CH3NHC6H3(NH2)2. Biết A tác dụng với cả HCl và Na2O. H2NC3H6COOH. Vì có nhóm …(6)… và nhóm …(7)… trong phân tử.5. B” tác dụng với NaOH tạo ra B’. A và B đều đúng. D. C có cùng công thức phân tử C 4H9O2N. C tác dụng với NaOH tạo ra muối và NH 3.75 < X ≤ 1. Để trung hoà 0. C. 0. D. C.1 mol X cần 600ml dung dịch HCl 0. C đều đúng. Câu 3. 0. C3H5COONH4. D.5M.. B. C3H5COONH4. B.56 Đốt cháy hoàn toàn một amin thơm X thu được 3.57 Các chất A.Câu 3. C4H9NO2. B. CH3C6H2(NH2)3. B. Câu 3. Biết X là amin bậc I. amino axit biểu hiện tính chất …(8)…và tính chất đặc biệt là phản ứng …(9)… (1) A. A tác dụng với dung dịch axit tạo thành muối amin bậc I. C3H5COONH4. H2NC3H6COOH. C4H9NO2. C4H9NO2. Mặt khác. Câu 3.08g CO2. 0.(4)…mà phân tử chứa …(5)…. 0. C3H5COONH4. Amino axit là loại hợp chất hữu cơ . C lần lượt là A. H2NC3H6COOH. C4H9NO2. A tác dụng với kiềm tạo thành NH3..4 ≤ X < 1. 0. khi thay thế khi thay thế khi thay thế nguy ên tử hiđr o (2) nguyên tử hiđro cacboxyl (3) một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon (4) luỡng tính tạp chức tạp chức tạp chức (5) đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino (6) tạp chức (7) cacboxyl (8) amino (9) trùng ngưng trùng ngưng trùng ngưng trùng ngưng B. H2NCH2C6H3(NH2)2.59 Những từ hay cụm từ thích hợp với những chỗ trống ở các câu trong đoạn văn sau là Amin là những hợp chất hữu cơ được tạo thành …(1)…một hay nhiều …(2)… trong phân tử amoniac bởi …(3)…. B’ tác dụng với HCl tạo ra B”. B. C.2. B.55 Khi đốt cháy mỗi đồng đẳng của ankylamin.99g H2O và 336ml N2 (đktc).4 ≤ X < 1. H2NCH2CH2COONH4. H2NC3H6COOH. Công thức cấu tạo thu gọn của A.58 Một hợp chất hữu cơ A mạch thẳng có công thức phân tử là C3H10O2N2. B tác dụng với H mới sinh tạo ra B’. nguyên tử hiđro khi thay thế amino cacboxyl D. Câu 3. amino nguyên tử hiđro luỡng tính luỡng tính luỡng tính C. CH3CH(NH2)COONH4. A và B đều sai. công thức cấu tạo thu gọn có thể có của X là A. cả A.

B. X là hợp chất nào sau đây? A. H2N[CH2]4COOH. 1atm). CH3NH[CH2]2COOH. Biết 0. Câu 3. chứa 1 chức axit. D. H. C đều sai.Câu 3.62 Hợp chất X chứa các nguyên tố C. mạch hở. cả A. HOOCCH(NH2)COOH. B.37. N và có phân tử khối là 89. C. chỉ chứa nguyên tố C. cả A.7g chất X. D. tạo ra 28. B đều đúng. đốt cháy a g hỗn hợp hai amino axit trên và cho sản phẩm cháy qua dung dịch NaOH dư. nitơ chiếm 18.928 lít khí CO2 (đo ở 27. Để tác dụng hết với các chất trong dung dịch A. Đốt cháy hoàn toàn một lượng X thu được CO2 và N2 theo tỉ lệ thể tích 4:1. Cho tỉ lệ phân tử khối của chúng là 1. CH2=C(NH2)-COOH. Mặt khác. D. B đều no. H2NCH2COOH.35g muối. CH3COONH4 hoặc HCOONH3CH3. X vừa tác dụng được với dung dịch HCl vừa tác dụng được với dung dịch NaOH. Công thức cấu tạo thu gọn của hai amino axit lần lượt là A. C2H5COONH4 hoặc HCOONH3CH3. Đốt cháy 7.1 mol A phản ứng vừa hết với 100ml dung dịch HCl 1M tạo ra 18.05g A khi tác dụng với một lượng NaOH dư. H2N-CH=CH-COOH. H2N[CH2]3COOH. Biết X tác dụng với dung dịch NaOH và dung dịch HCl.3oC. B. Biết rằng. H2NCH2COOH.60 Amino axit X chứa một nhóm chức amin bậc I trong phân tử. C.64 Cho a g hỗn hợp hai amino axit A.63 Hợp chất hữu cơ X có phân tử khối nhỏ hơn phân tử khối của benzen. H2NCH2CH2COOH. Biết rằng. Câu 3.18%. Khi đốt cháy 1 mol X thu được hơi nước. Công thức cấu tạo thu gọn của X là A. H2N[CH2]3COOH. Câu 3. C. H2NCH(NH2)COOH. B. Câu 3.15g dung dịch HCl 20% được dung dịch A. C đều sai. CH3NHCH2COOH. HOOCCH2CH(NH2)COOH. H2NCH2COOH. H2N[CH2]4COOH. 45 . 1 chức amino tác dụng với 40. thu được VCO2 : VH 2O = 6 : 7 . D.65 A là một amino axit trong phân tử ngoài các nhóm cacboxyl và amino không có nhóm chức nào khác. cần 140ml dung dịch KOH 3M. Biết A có cấu tạo mạch không phân nhánh và nhóm amino ở vị trí α . CH3CH(NH2)COOH. thu được 4. H2NCH(NH2)[CH2]2COOH. X là hợp chất nào sau đây? A. cả A. H2NCH2CH2COOH. tất cả đều sai. H2NCH2COOH. O. D.61 Khi đốt cháy hoàn toàn đồng đẳng X của axit aminoaxetic. N trong đó hiđro chiếm 9. H. H2NCH2COOH. B. không phân nhánh .5 mol N2. C. thì thấy khối lượng bình này tăng thêm 32. Mặt khác. kết quả khác. B. CH3CH(NH2)CH2COOH.65g muối khan. Công thức cấu tạo thu gọn có thể có của X là A. CH3NH[CH2]3COOH. O.09%. khi đốt cháy thu được khí nitơ ở dạng đơn chất. ngoài ra còn tác dụng được với nước brom. Câu 3. 22. B. Công thức cấu tạo thu gọn của A là A. H2N[CH2]3COOH. 3 mol CO2 và 0. CH2=CH-COONH4. C.8g. B.

(3). CH3NHCH2COOH. (4). C. protein … tạo ra các amino axit.0g kết tủa. Thuỷ phân protein bằng axit khi đun nóng sẽ cho một hỗn hợp các amino axit. NC4H8(COOH)2. (4). (3) cacbon. Dung dịch amino axit không làm giấy quỳ đổi màu. B. (2). Câu 3.448 lít (đktc) một khí không bị hấp thụ.Các protein đều chứa các nguyên tố … . (1). Câu 3. (4). Biết phân tử X có 2 nguyên tử nitơ. CH3CH(NH2)2. (3) p-nitroanilin. Các amino axit đều tan trong nước. C. B. Câu 3.C. B. C. B. CH3CH2NH2. D.69 Câu khẳng định nào sau đây luôn đúng: A. (3). (2).68 Hãy điền những từ hoặc cụm từ thích hợp vào các chỗ trống ở các câu sau .71 Đốt cháy hoàn toàn 0.73 Hợp chất X chứa các nguyên tố C. 46 . B. C. Câu 3. O. (2) bị thuỷ phân. H2NCH2CH2COOH. khi lọc dung dịch thu được 4. Công thức cấu tạo của X là A. thu được 18.2g và còn lại 0. oxi. D. (2). C.Protein có trong … . Phân tử khối của một amino axit (gồm một chức amino và một chức cacboxyl) luôn luôn là số lẻ. CH3CH2CH(NH2)COOH. C. (2). CH3CH(NH2)COOH. H2NCH2CH2NH2. (1) < (4) < (3) < (2) < (5) < (6). CH4ON2. C. D.70 Cho các chất: (1) amoniac. Câu 3.67 Chọn phát biểu sai: A. Cho 15. B và C đều đúng. C. Công thức phân tử của X là A. Trình tự tính bazơ tăng dần theo chiều từ trái sang phải là A. Câu 3. (5) metylamin. D. Đốt cháy hoàn toàn lượng (X) và (Y) trên. B. B. Hai chất (X) và (Y) có cùng số mol. hiđro. Phân tử khối của một amin đơn chức luôn là số chẵn. X có công thức cấu tạo nào sau đây? A. (4) đông tụ Những từ hoặc cụm từ thích hợp theo trình tự từ trên xuống là A.75g muối của X. (1) mọi bộ phận của cơ thể.82g (Y). kết quả khác. H. Amin luôn luôn phản ứng với H+. D. Mọi amin đơn chức đều chứa một số lẻ số nguyên tử H trong phân tử. B. HOOCCH2CH2CH(NH2)COOH. N(CH2COOH)3. B. Công thức cấu tạo thu gọn của (Y) là A. D. N với tỉ lệ khối lượng tương ứng là 3:1:4:7. (3).66 X là một α -amino axit no chỉ chứa một nhóm –NH2 và một nhóm –COOH. C3H8ON2. (2) < (1) < (3) < (4) < (5) < (6). (6) đimetylamin. thấy khối lượng bình đựng nước vôi trong tăng 3. kết quả khác. D. (1) < (2) < (4) < (3) < (5) < (6). D. thể tích khí oxi cần dùng để đốt cháy hết (Y) nhiều hơn để đốt cháy hết (X) là 1. (1).72 Amino axit (Y) có công thức dạng NCxHy(COOH)m. . Câu 3. C đều đúng. (2) anilin. (4) < (3) < (2) < (1) < (5) < (6).02 mol một amin bậc I (X) với lượng oxi vừa đủ.Ở nhiệt độ thường dưới tác dụng của men.344 lít (đktc). thu toàn bộ sản phẩm qua bình chứa nước vôi trong dư. H2NCH2CH2COOH. C3H8O2N2. (1). Câu 3. (1). CH3CH2CH(NH2)COOH. (3). D.Một số protein bị … khi đun nóng hoặc khi cho thêm một số hoá chất. (4).1g X tác dụng với dung dịch HCl dư. Lấy một lượng axit aminoaxetic (X) và 3. nitơ. (4) p-nitrotoluen.

34 B 3.M = M.21 B 3.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG III 3.1 C 3.46 A 3.45 A 5.71 D 3.M = M’.26 D 3.65 C 3.58 C 3.36 A 3.7 D 3.13 A 3.43 C 3.42 C 3.70 C CHƯƠNG IV.72 C 3.Theo phản ứng polime hoá.47 A 3.29 C 3.63 B 3. đồng thời giải phóng những phân tử nhỏ (như H2O.28 D 3. .55 C 3.…) n Monome → Polime n Monome → Polime+ nH2O Polime trùng hợp Polime trùng ngưng n.10 C 3.53 A 3.73 A 3. .61 A 3.30 D 3.69 D 3.17 A 3. polime tổng hợp.49 A 3.16 A 3. polime nhân tạo (bán tổng hợp).57 D 3.68 B 3.60 A 3.15 A 3.31 C 3.20 A 3.8 C 3.18 Có liên kết đôi hoặc vòng Có hai nhóm chức có khả không bền năng phản ứng trở lên Trùng ngưng Định nghĩa Quá trình Sản phẩm Khối luợng Điều kiện của monome 47 .25 B 3.62 C 3.19 A 3.38 C 3.3 C 3.18 A 3.5 D 3.54 D 3.Số mắt xích (n) trong phân tử polime được gọi là hệ số polime hoá hay độ polime hoá.23 A 3.n + n.11 C 3.37 D 3. Phản ứng Trùng hợp Mục so sánh Là quá trình kết hợp nhiều phân tử nhỏ giống nhau hoặc tương tự nhau (monome) thành phân tử lớn (polime) Là quá trình kết hợp nhiều phân tử nhỏ thành phân tử lớn (polime).24 B 3.27 B 3.41 A 3.66 D 3.59 C 3. ta phân biệt polime trùng hợp và polime trùng ngưng.12 B 3.52 C 3.22 B 3.n n. ta phân biệt polime thiên nhiên.6 B 3. Khái niệm về polime Polime là các hợp chất có phân tử khối rất lớn do nhiều đơn vị nhỏ gọi là mắt xích liên kết với nhau tạo nên.35 B 3.14 B 3.32 D 3.67 D 3.64 D 3. POLIME A.51 D 3.2 D 3.56 D 3.33 A 3.40 B 3.Theo nguồn gốc.48 B 3.44 D 3. .4 B 3.9 C 3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.39 B 3.50 B 3.

. Polime có nhóm chức trong mạch như –CO-NH. Khái niệm về các vật liệu polime o . có thể kéo thành sợi. to. một số tan trong các dung môi hữu cơ.Tơ: vật liệu polime hình sợi. 4. B .Cao su: vật liệu có tính đàn hồi. .Chất dẻo: vật liệu polime có tính dẻo. hữu cơ khác.Keo dán hữu cơ: vật liệu polime có khả năng kết nối chắc chắn hai mảnh vật liệu khác. một số có tính dai. không bay hơi. Nhựa a) Nhựa PE nCH2 CH2 xt. dài và mảnh. 3.2. . bền.Phản ứng giữ nguyên mạch polime: Phản ứng cộng vào liên kết đôi hoặc thay thế các nhóm chức ngoại mạch. to. Thí dụ: t CH2 CH n + nCH3COONa CH CH2 n + nNaOH OCOCH3 OH . -COOCH2. Cấu trúc .Phản ứng khâu mạch polime: Phản ứng tạo cầu nối giữa các mạch (cầu -S-S. p CH2 etilen CH2 n polietilen(PE) b) Nhựa PVC nCH2 CH Cl vinyl clorua xt. một số polime có tính đàn hồi.dễ bị thuỷ phân khi có mặt axit hay bazơ.Vật liệu compozit: vật liệu tổ hợp gồm polime làm nhựa nền và các vật liệu vô cơ.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. dạng mạch phân nhánh và dạng mạch không gian. . Tính chất a) Tính chất vật lí Hầu hết polime là chất rắn.Phản ứng cắt mạch polime: Polime bị giải trùng ở nhiệt độ thích hợp. b) Tính chất hoá học: có 3 loại phản ứng . Đa số polime có tính dẻo.Phân tử polime có thể tồn tại ở dạng mạch không phân nhánh.Phân tử polime có thể có cấu tạo điều hoà (nếu các mắt xích nối với nhau theo một trật tự xác định) và không điều hoà (nếu các mắt xích nối với nhau không theo một trật tự nào cả). không có nhiệt nóng chảy xác định. p CH2 CH n Cl poli(vinyl clorua) (PVC) c) Nhựa PS 48 . .hay -CH2-) thành polime mạng không gian hoặc phản ứng kéo dài thêm mạch polime. .

. p CH CH2 n OCOCH3 Thuỷ phân PVA trong môi trường kiềm: CH CH2 n + nNaOH OCOCH3 to CH2 CH n + nCH3COONa OH CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) e) Nhựa PMM (thuỷ tinh hữu cơ . to. OH OH n + nHCHO H .nCH C6H5 CH2 xt. to. p CH CH2 C6H5 n d) Nhựa PVA nCH2 CH OCOCH3 xt... nhựa rezit. to. − Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. p CH3 metyl metacrylat f) Nhựa PPF Poli(phenol .t + o CH2 n + nH2O − Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. 49 . nhựa rezol.fomanđehit) (PPF) có 3 dạng: nhựa novolac..plexiglas) nCH2 CH COOCH3 xt. CH2 CH2 CH2OH CH2 CH2 OH . OH . − Nhựa novolac: Nếu dư phenol và xúc tác axit.

t nCH2=CH− CH=CH2  → 0 ( CH 2 CH = CH CH 2 )n buta-1. xt CH2 CH CH CH2 CH CN CH2 n e) Cao su clopren nCH2 CH C CH2 Cl CH CH2 to. H2 C .CH2 OH OH CH2 OH CH2 OH CH2 CH2 OH CH2 CH2 OH CH2 CH2 CH2 .3-đien (butađien) b) Cao su isopren polibutađien (cao su buna) C CH CH2 CH3 2-metylbuta-1.. xt CH2 CH CH CH2 CH C6 H 5 CH2 n d) Cao su buna – N nCH2 CH CH CH2 + nCH CN o CH2 t ... p CH2 C F CH CH2 n 3.... .. H2C .. to. p. to. . xt CH2 CH C Cl CH2 n f) Cao su flopren nCH2 C F xt.. p. ..3-dien (isopren) c) Cao su buna – S nCH2 CH CH CH2 + nCH C6 H 5 nCH2 xt.. p.. 2. Cao su a) Cao su buna Na. Tơ a) Tơ capron (nilon – 6) 50 . p C CH CH2 n CH3 poliisopren (cao su isopren) CH2 o CH2 t .

to. NH[CH2]6NHCO[CH2]4CO n .CO . to. 51 . p n 2 n + HCl 2 Cl Cl e) Tơ dacron (lapsan) nHOOC C6H4 COOH + nHO CH2 CH2 axit terephtalic etylen glicol CO OH C6H4 CO O CH2 CH2 O n + 2nH2O poli(etylen terephtalat) (lapsan) C. Len. Câu 4. C. NH[CH2]5CO n . axetilen (6). tơ tằm. D. p CH2 C=O NH xt. tơ tằm. to. to. 6 → 4 → 2 → 5 → 3 → 1. len. p NH[CH2]5CO n + nH2O xt. NHCH(CH3)CO n . vì: A. tơ tằm. Hãy sắp xếp các chất theo đúng thứ tự xảy ra trong quá trình điều chế A.1 Hợp chất đầu và các hợp chất trung gian trong quá trình điều chế ra cao su buna (1) là: etilen (2). p NH[CH2]5CO n b) Tơ enang (nilon – 7) nH2N[CH2]6COOH c) Tơ nilon – 6.nH2N[CH2]5COOH n CH2 CH2 CH2 CH2 xt. tơ nilon có các nhóm (. tơ nilon dễ cháy. tơ tằm. to.3 Không nên ủi (là) quá nóng quần áo bằng nilon. Len. p HN[CH2]6CO n + nH2O NH[CH2]6NHCO[CH2]4CO n + 2nH2O d) Tơ clorin CH2 CH CH2 Cl CH Cl n 2 + n 2 Cl2 xt. C.6 có công thức là A. đivinyl (5). p CH2 CH CH CH Cl xt. D. 2 → 6 → 3 → 4 → 5 → 1. Len. tơ nilon kém bền với nhiệt. B. B. metan (3). 4 → 6 → 3 → 2 → 5 → 1. 3 → → 2 → 4 → 5 → 1. C.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 4. rượu etylic (4). NH[CH2]6CO n . to. tơ tằm.NH -) trong phân tử kém bền với nhiệt. Câu 4. 6 B. tơ nilon mềm mại.6) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH xt. D. Len.2 Tơ nilon – 6.

PbS. D. C.S được điều chế bằng : A. butađien. B. C.9 Thuỷ tinh plexiglas là polime nào sau đây? A. etanol. Axetilen. (2). chỗ vải đó bị đen lại do có sản phẩm tạo thành là A.7 Cao su buna – S có công thức là A. Câu 4. Câu 4.12 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – S? 52 .6 Cho sơ đồ sau: CH4 → X → Y → Z → cao su buna. Tất cả đều sai. CH ≡ CH(2).11 Tơ enang thuộc loại A. B. Phản ứng trùng hợp. tơ axetat. Câu 4. CH3–CH3(4) A. Phản ứng trùng ngưng. D. Etilen.8 Cao su buna . (4). CH2 C. cacbon. Z trong sơ đồ trên lần lượt là A. CH2 CH CH CH2 n . B. vinylaxetilen. C. C. (2). CH CH CH2 CH CH2 C6H5 . (2). (3).Câu 4. CH2=CH–Cl(3). B. nhựa bakelít. tơ tằm. Câu 4. C. D. Câu 4. D. etanol. (1). vinylaxetilen. Câu 4. Polimetyl metacrylat (PMM). D. Polivinyl axetat (PVA). (1). tơ polieste. (3). C.10 Tên của polime có công thức sau là OH CH2 n A. tơ poliamit. n . Tên gọi của X . Phản ứng đồng trùng hợp. H2S. polistiren. nhựa dẻo. (1). B. Phản ứng đồng trùng ngưng. Anđehit axetic. B. S. butađien. nhựa phenol-fomanđehit. Câu 4. Axetilen. B. butađien. butađien. Câu 4. CH2 C(COOCH3) CH3 n D. D. B. C. CH CH2 C6H5 n .5 Khi H2SO4 đậm đặc rơi vào quần áo bằng vải sợi bông. (3). Y . Polimetyl acrylat (PMA). (3). D.4 Những phân tử nào sau đây có thể tham gia phản ứng trùng hợp ? CH2=CH2(1).

xt CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . CH2 CH2 n n . m CH3 CH2 + mCH C6H5 o CH2 t . nCH2 CH CH CH CH CH C Cl C CH CH2 CH2 CH2 to. axit stearic.6.14 Phản ứng nào sau đây tạo ra sản phẩm là cao su cloropren? A. A. p. D. p. axit ađipic. Cl . xt Câu 4. xt CH2 CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . CH C CH2 n . p. p. p. . nCH2 D. nCH2 CH CH CH CH CH C Cl C CH CH2 to.CH3 C C CH2 . xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. axit axetic. xt CH2 CH2 to. CH C CH2 n CH3 CH2 CH CH CH2 n CH C6H5 CH2 .15 Hiđro hoá hợp chất hữu cơ X được isopentan. CH3 CH2 + mCH C6H5 o CH2 t . axit oxalic. Công thức cấu tạo thu gọn của X là . p. B.CH2 C CH CH2 . nCH2 D. p.A. p. . xt to. . xt CH2 CH2 CH2 CH CH CH2 n .CH3 CH2 C CH B. p. C. xt to. nCH2 B. nCH2 B. p. xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4.13 Phản ứng nào sau đây tạo ra sản phẩm là cao su isopren? A.CH2 CH3 CH CH CH2 . D. nCH2 C. CH2 CH2 n n . xt to. p. xt CH2 CH2 to. X tham gia phản ứng trùng hợp được một loại cao su. nCH2 B. m . Câu 4. nCH2 CH CH CH CH CH C Cl C CH CH2 to. nCH2 C.16 Để điều chế nilon . xt to.17 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – N? 53 . C. m CH3 CH2 + mCH C6H5 to. nCH2 C. p.6 người ta dùng axit nào để trùng ngưng với hexametylen điamin ? A. nCH2 D. CH3 Câu 4.

nCH2 CH CH CH2 + nCH CN CH o CH2 t . Câu 4. B. C.A.23 Chất có khả năng trùng hợp thành cao su là B. chất dẻo. axit metacrylic.24 Từ monome nào sau đây có thể điều chế được poli(vinyl ancol) ? A. B. D. Câu 4. B. trùng ngưng HOOC-(CH2)4-COOH. C. p. axit metacrylic. nhựa PVC. thuỷ tinh hữu cơ.CH2 CH3 CH CH2 CH2 CH3.CH2 CH CH2 OH. trùng ngưng alanin. Câu 4. CH C6H5 CH2 .CH2 CH COOC2H5. xt CH2 CH CH2 CH o CH2 + mCH CH2 t . A. B.19 Sản phẩm của phản ứng trùng hợp metyl metacrylat được gọi là A. nCH2 CH D. B. CH3 C C CH2.CH2 CH OCOCH3. C. CH CH CH2 CH2 CH CN CH2 n . xt C6H5 n Câu 4. –CO– trong phân tử.25 Tơ poliamit là những polime tổng hợp có chứa nhiều nhóm A. –CO–NH– trong phân tử.18 Tên của monome tạo ra polime có công thức CH3 C CH2 n COOH là A.20 Tơ capron được điều chế từ monome nào sau đây ? A. nhựa bakelít. C. Câu 4. C. metyl acrylat. D. nCH2 B. xt CH3 n n . D. phenol. axit acrylic.21 Tơ enang được điều chế bằng cách A. D. xt CH2 CH2 CH C CH C Cl CH2 CH2 to. nCH2 CH CH C CH2 CH3 C Cl CH2 to. phenol. stiren. –CH(CN)– trong phân tử. metyl metacrylat.22 Nhựa PS được điều chế từ monome nào sau đây? A. Câu 4. D. B. Câu 4. B. D. C.CH2 C CH CH2. C. caprolactam. trùng ngưng H2N-(CH2)6-COOH. D. –NH– trong phân tử. p. Câu 4. . m C. axit metacrylic. p.26 Một polime Y có cấu tạo mạch như sau: 54 . Câu 4. trùng hợp axit acrylic. C. p. axit caproic. D.CH3 CH3 CH2 C CH.CH2 CH COOCH3. caprolactam.

Polime là những chất có phân tử khối rất lớn do nhiều mắt xích liên kết với nhau. D. 2 : 3. Công thức cấu tạo thu gọn của X. C6H5CH(CH3)OH. − 2− 2− 2− CH CH CH . NH[CH2]6NHCO[CH2]4CO n . Câu 4.28 Tơ capron (nilon – 6) có công thức là NH[CH2]5CO n . C6H5CH2CH2OH.3 – đien (butađien). D. − 2− CH . 1 : 3. NHCH(CH3)CO n . C6H5CH=CH2.6 có phân tử khối (M = 2500) là 55 . C. 1 : 2. − 2− 2− CH CH .731 gam Br2. NH[CH2]6CO n . Câu 4. Polietilen và poli(vinyl clorua) là loại polime thiên nhiên. thu được polime X. D. B. C. A. p − H 2O X  Y  polime. D. C.… − 2− 2− 2− 2− 2− 2− 2− 2− … CH CH CH CH CH CH CH CH Công thức một mắt xích của polime Y là A. C. C6H5CH2CH2OH. C6H5CH2CHO. Vậy.B. Tỉ lệ số mắt xích (butađien : stiren) trong loại polime trên là A.30 Chọn câu phát biểu sai: A.31 Cho sơ đồ phản ứng sau: → xt .834 gam X phản ứng vừa hết với 1. D. C. Cứ 2. C6H5CH=CH2. 2.27 Tiến hành clo hoá poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. Câu 4.32 Hệ số trùng hợp (số mắt xích) của tơ nilon – 6. B. B. B. Trong X có chứa 66.29 Tiến hành phản ứng đồng trùng hợp giữa stiren và buta – 1. Câu 4. 3. trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo ? B. C6H5COCH3. t o . → X có công thức phân tử C8H10O không tác dụng với NaOH. − 2− 2− 2− 2− CH CH CH CH . D. Y lần lượt là: A. 1. II – BÀI TẬP NÂNG CAO Câu 4. 4. A. 1 : 1. CH3-C6H4CH2OH . C.18% clo theo khối lượng. Câu 4. còn tinh bột và xenlulozơ là loại polime tổng hợp. Các vật liệu polime thường là chất rắn không bay hơi. Hầu hết các polime không tan trong nước và các dung môi thông thường.

C. benzyl clorua (6).cao su buna. (6). C. anđehit fomic (4). ancol vinylic.34 Đun nóng poli (vinyl axetat) với kiềm ở điều kiện thích hợp ta thu được sản phẩm trong đó có A. PVC. D. amilopectin. (5). (1) → (2) → (4) → (5) → (6). cả A và B. etilen (4). (1). (8). 10. C. cao su buna. C. (9). Câu 4.69% CO2 về thể tích. amilozơ. D. 6235 m3. (3). PE. y 3 y 3 C. cao su lưu hoá. amilozơ. C. (1). ancol etylic. (7). Hãy cho biết sơ đồ chuyển hoá nào sau đây có thể dùng để điều chế poli(vinyl clorua) ? A. = . etin (2).36 Chất dẻo PVC được điều chế theo sơ đồ sau: CH 4  H = 1 → A  H = 9%→ B  H = 9 → PVC. Chọn các chất thích hợp cho sơ đồ đó là A. các chất đầu và chất trung gian trong quá trình điều chế là: metan (2). (2). xenlulozơ. D.  5%  5 Câu 4. xenlulozơ. amilopectin. vinyl clorua (5). 4576 m3. Câu 4. (1) → (4) → (5) → (6). (7). amilopectin. xenlulozơ. B. xenlulozơ. (3). phenyl clorua (10). D. PVC. 11. (2). metan (3). benzen (3). (7). B. (6). B. PE. (9). cao su buna . x 3 = . (8). x 3 = . = . C. H2O. B. 56 . PE. etilen (9). B. (3). 7225 m3. (10). nhựa PVC (6). thu được hỗn hợp khí và hơi (CO2. poli(vinyl ancol). (5). phenol (5). PE.35 Cho các polime : PE. vậy để điều chế một tấn  0% PVC thì số m3 khí thiên nhiên (đktc) cần là A. natri phenolat (7). (1) → (3) → (2) → (5) → (6). y 2 D.37 Đồng trùng hợp đimetyl buta–1. D. cao su buna. (3). N2) trong đó có 57. PVC. Câu 4.38 Cho các chất sau: butan (1). axetilen (8). axeton. (5). B. Polime có dạng cấu trúc mạch không phân nhánh là A. amilozơ. (4). y 5 Câu 4. (6).3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y. Đốt cháy hoàn toàn một lượng polime này. (4). thu được một loại polime. PVC. (2). (1).A. cao su lưu hoá. Biết CH4 chiếm 95% thể tích khí thiên nhiên. Câu 4. 5883 m3. PVC. 12. (2). D. Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 x 2 A. (4). B. (5). (1). 13. amilozơ .33 Điều chế nhựa phenol-fomanđehit (1).

C. So sánh khả năng thấm nước của chúng.41 Đun nóng vinyl axetat với kiềm ở điều kiện thích hợp. ancol etylic. C. mềm mại hơn tơ nhân tạo. C đều đúng. p HN[CH2]6CO xt. chỉ phản ứng (3). Đốt hai mẫu da. HO-C6H4-OH. B. B. So sánh độ mềm mại của chúng. Câu 4. hai phản ứng (1) và (2). lụa sản xuất từ tơ thiên nhiên có độ bóng cao hơn lụa sản xuất từ tơ nhân tạo. Công thức của X. cả A. C. da thật mềm mại hơn da nhân tạo.Câu 4. to. còn da nhân tạo không cho mùi D. D. HO-C6H4-COOH. ancol vinylic. B. So sánh độ mềm mại của chúng. Đốt hai mẫu lụa. tơ xenlulozơ axetat) và tơ thiên nhiên (tơ tằm. Dùng dao cắt ngang hai mẫu da. còn da nhân tạo thì bóng.43 Để phân biệt lụa sản xuất từ tơ nhân tạo (tơ visco. da thật ở vết cắt bị xơ. B. khét. còn mẫu lụa sản xuất từ tơ nhân tạo không cho mùi khét. to. So sánh độ bóng của lụa. B.39 Khi cho hai chất X và Y trùng ngưng tạo ra polime Z có công thức O CH2 CH2 O C C6H4 C n O O . n CH2 CH CH CH n + 2HCl . p + n Cl2 A. HOOC-CH2CH2-COOH. NH[CH2]6NHCO[CH2]4CO n + 2nH2O . p n + nH2O . Cl Cl Cl 2 (2) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH (3) CH2 CH CH2 CH Cl Cl n 2 2 xt. phản ứng nào thuộc loại phản ứng trùng ngưng ? (1) nH2N[CH2]6COOH xt. HOOC-C6H4-COOH. chỉ phản ứng (1). to.40 Có thể phân biệt các đồ dùng làm bằng da thật và da nhân tạo (PVC) bằng cách nào sau đây? A. D.42 Xét các phản ứng sau đây. mẫu da thật cho mùi khét. axeton. mẫu lụa sản xuất từ tơ thiên nhiên cho mùi khét. B. da thật dễ thấm nước hơn. nhẵn Câu 4. C. len). D. lụa sản xuất từ tơ thiên nhiên dễ may hơn lụa sản xuất từ tơ nhân tạo. Câu 4. Câu 4. tơ thiên nhiên (tơ tằm. D. anđehit axetic. C. len) người ta dùng cách nào sau đây? A. HO-CH2-COOH. 57 . ta thu được sản phẩm trong đó có: A. HO-CH2-CH2-OH. Dùng kim may (máy may) may thử vài đường chỉ trên lụa. Y lần lượt là A. hai phản ứng (2) và (3).

Câu 4.19 D 4. B. B. C. polime trên thuộc loại nào trong số các polime sau ? A. (1). (6) nilon – 6.6. 171kg và 82kg. số thứ tự nhóm A (số electron ngoài cùng).48 Cho các polime sau đây: (1) tơ tằm.39 A 4.3 B 4. (2). D. C.10 A 4. tinh bột.1 A 4. Câu 4.46 B 4.15 C 4. (2). D. 215kg và 80kg.13 C 4. 2. C.12 D 4.33B 4. CH2 = CH – COOCH3. – CCl = CCl – .23 A 4. C2H5COOCH2CH = CH2. (4) tơ enang.47 A 4.49 B 4. Câu 4.45 Tơ lapsan thuộc loại A. tơ visco.6 C 4. (6). tơ poliamit.000. (6). 3 electron ở lớp ngoài cùng. tơ polieste. tơ axetat. (7) tơ axetat.8 B 4. CH2 = CHCOOCH2CH = CH2. Cl) có hệ số trùng hợp là 560 và phân tử khối là 35.38 D 4. D. (3) sợi đay. B. Vị trí của kim loại: ô nguyên tố (Z). Cấu tạo của kim loại: thường có 1. (2). Loại tơ có nguồn gốc xenlulozơ là A.22 D 4. (2) sợi bông.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.40 C CHƯƠNG V. – CH2 – CHCl – . C. chu kì (số lớp electron). số thứ tự nhóm B (số electron ngoài cùng + số electron kề ngoài cùng chưa bão hoà). (5) tơ visco.28 A 4.17 C 4.47 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu ? Biết hiệu suất quá trình este hoá và trùng hợp lần lượt là 60% và 80%. ĐẠI CƯƠNG VỀ KIM LOẠI A. – CHCl – CHCl – .44 Polime X (chứa C. B.4 D 4.20 B 4. 175kg và 70kg.7 C 4. (7).11 B 4.34 C 4. (5).18 C 4.42 C 4. Câu 4.30 D 4.16 D 4.49 Khi đốt cháy một loại polime chỉ thu được khí CO 2 và hơi H2O với tỉ lệ n CO2 : n H2O = 1:1 .45 C 4.48 B 4.25 A 4. Câu 4. Câu 4.32 B 4. Vậy. (5). C. D. 58 . polietilen.5 A 4. (6).31 C 4.36 A 4. (7).2 C 4.43 C 4.37 A 4.21 C 4. 2. 65kg và 40kg.24 B 4. H.44 A 4. B.26 D 4.9 A 4. Công thức một mắt xích của X là A. CH3COOCH = CH2.27 B 4.35 D 4. D.29 B 4.46 Polime ( CH 2 CH(OH) ) n là sản phẩm của phản ứng trùng hợp sau đó thuỷ phân trong môi trường kiềm của monome nào sau đây ? A. protein. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IV 4.41 C 4.14 B 4. C. poli(vinyl clorua). D. (3). A. B. (3). – CH = CCl – .

khử.Fe. H2SO4 đặc oxi hoá kim loại (trừ Pt. . K. hợp chất khử chứa nguyên tố có số oxi hoá thấp lên cao và nó bị khử xuống mức oxi hoá thấp hơn. phi kim. .Tác dụng với dd HNO3. Fe + Cu2+ → Fe2+ + Cu . 4. . Cr thụ động trong dd HNO3 đặc nguội. Na) khử ion của kim loại yếu hơn trong dd muối thành kim loại tự do. Nhớ thứ tự các cặp oxi hoá khử sau : Cu2+/Cu Fe3+/Fe2+ Ag+/Ag 2 Fe3+ + Cu → Cu2+ + 2Fe2+ Fe3+ không oxi hoá Ag. Na + 2H2O → 2NaOH + H2 . Sự ăn mòn kim loại: là sự oxi hoá kim loại do tác dụng của các chất trong môi trường xung quanh : M → Mn+ + ne . Hợp kim có t0 nóng chảy thấp hơn. Ca. với cặp kim loại A─B. dẫn điện. trong đó kim loại bị oxi hoá do tác dụng của dung dịch chất điện li và tạo nên dòng electron chuyển dời từ cực âm đến cực dương. 3Cu + 8HNO3 → 3Cu(NO3)2 + 2NO + 4H2O . H2SO4 đặc Dung dịch HNO3. . Au).3.Ăn mòn hoá học là quá trình oxi hoá . Mg) khử H2O ở t0 thường thành H2. các điện cực cùng tiếp xúc với 1 dung dịch chất điện li.Chú ý rằng.Dãy điện hoá kim loại cho phép dự đoán chiều phản ứng giữa 2 cặp oxi hoá khử : chất oxi hoá mạnh nhất sẽ oxi hoá chất khử mạnh nhất sinh ra chất oxi hoá yếu hơn và chất khử yếu hơn. Al. dẫn nhiệt. . 8. 9. 59 . Cấu tạo của đơn chất kim loại: mạng tinh thể gồm có các ion dương dao động liên tục ở các nút mạng và các electron tự do chuyển động hỗn loạn giữa các ion dương. dẫn điện và dẫn nhiệt kém hơn kim loại nguyên chất.Tác dụng với phi kim : xM + M+ y O2 → MxOy 2 n Cl2 → MCln 2 n H2 2 .Tác dụng với dd muối Kim loại mạnh (trừ Ba.3 điều kiện cần và đủ để kim loại bị ăn mòn điện hoá : các điện cực khác chất. 5. nhưng cứng hơn kim loại nguyên chất. Tính chất vật lí chung của kim loại: tính dẻo. trong đó các electron của kim loại được chuyển trực tiếp đến các chất trong môi trường. 6.Tác dụng với axit HCl. Hợp kim: là vật liệu kim loại có chứa một kim loại cơ bản và một số kim loại khác hay với một vài hợp kim. H2SO4 loãng : M + n H+ → Mn+ + Kim loại sau H không khử được H+ thành H2. Liên kết kim loại: lực hút tĩnh điện giữa các electron tự do và các ion dương kim loại. Tính chất hoá học chung: tính khử : M  M n+ + ne → .khử. H2SO4 đặc nguội. muốn B được bảo vệ thì A phải có tính khử mạnh hơn B. ánh kim do các electron tự do gây ra.Tác dụng với H2O IA. IIA (trừ Be. các điện cực tiếp xúc với nhau.Ăn mòn điện hoá là quá trình oxi hoá .

Na) * Phương pháp nhiệt luyện cần có 1 trong 4 chất khử (H2. C. K. 11. * Phương pháp điện phân nóng chảy để điều chế kim loại IA. b) It = ne. t là thời gian điện phân tính bằng giây. n là hoá trị (hoặc số mol electrron trao đổi tính cho 1 mol chất thoát ra ở điện cực.Các phương pháp điều chế kim loại : * Phương pháp thuỷ luyện cần có dung dịch muối của kim loại cần điều chế (sau Al) và kim loại có tính khử mạnh hơn (trừ Ba. m là lượng chất thoát ra ở điện cực theo gam. Al. A là nguyên tử khối (hoặc phân tử khối).10. * Phương pháp điện phân dung dịch để điều chế kim loại sau Al.It n 96500 Trong đó I là cường độ dòng điện tính bằng Ampe. CO. 60 . Nguyên tắc điều chế kim loại: là sự khử ion kim loại : Mn+ + ne → M .96500 Trong đó I là cường độ dòng điện tính bằng Ampe. ne là số mol electron trao đổi trong quá trình điện phân. Ca. t là thời gian điện phân tính bằng giây. . Al) và oxit của kim loại cần điều chế (sau Al). Công thức của định luật Farađay a) m = A 1 . IIA.

B. Fe + 2AgNO3  Fe(NO3)2 + 2Ag → 13. 3Fe3O4 + 8Al  4Al2O3 + 9Fe → 3 ñpnc 17. H2 + PbO  H2O + Pb → t0 15. CuCl2  Cu + Cl2 → 0 1 O2 + H2SO4 2 1 ñpdd 25. CuSO4 + H2O  Cu + → 26. dư  Fe(NO3)3 + 3Ag → t 14. Fe + H2O → FeO + H2 1 7. Na + H2O  NaOH + H2 → 2 8. 2NaOH  2Na + O2 + H2O → 2 ñpnc 20. MgCl2  Mg + Cl2 → ñpdd 23. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 61 . Fe + CuSO4  FeSO4 + Cu → 10. 2FeCl3 + Fe  3FeCl2 → 11. Fe2(SO4)3 + Cu  CuSO4 + 2FeSO4 → 12. 2AgNO3 + H2O  2Ag + O2 + 2HNO3 → 2 ñpdd 24. 2Fe + 3Cl2  → 0 t 2. Al2O3  2Al + O2 → 2 ñpnc 18. Fe + S  → t0 3. Fe + 4HNO3  Fe(NO3)3 + NO + 2H2O → >570 C 6. 2NaCl  2 Na + Cl2 → 1 ñpnc 19. 3Fe + 2O2  → 4.MỘT SỐ PHẢN ỨNG THƯỜNG GẶP t 1. Fe + 3AgNO3. Fe2O3 + 3CO  2Fe + 3CO2 → t0 16. Fe + 2HCl  → 0 2FeCl3 FeS Fe3O4 FeCl2 + H2 5. Ba + 2H2O  Ba(OH)2 + H2 → 0 9.

liên kết giữa các nguyên tử bằng các cặp electron dùng chung. F.6 Hoà tan 1. Câu 5. Vị trí M trong bảng hệ thống tuần hoàn là A. D. Muốn trung hoà axit dư trong dung dịch thu được phải dùng hết 30ml dung dịch NaOH 1M.8 Liên kết kim loại là A. 62 . Câu 5. chu kì 4. ô 18. D. các ion dương kim loại và các electron tự do. nhóm IIA.Ni. chu kì 4. cứ 10 mol Al thì có 1 mol Ni. Cl.C . 81%. nhóm IIB. ô 26.6g khí H2 bay ra.2 Ion M có cấu hình electron ở lớp ngoài cùng là 3s 23p6. nhóm VIIIB. chu kì 4. 53. D. nhóm VIIIA. Cl. 2+ Câu 5. C. B. K. C. 84%. C. C. 36. Be. D. B. ô 20. Cl-. F.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 5. các nguyên tử kim loại. Mg. Phần trăm khối lượng của Al trong hợp kim là A. ô 26. D. B. Ar. Ba. chu kì 4. liên kết sinh ra bởi lực hút tĩnh điện giữa các ion dương và các electron tự do. B.7. ô 26. chu kì 4. Câu 5. 63. Ar. D. các electron tự do. C. + Câu 5. D. B. 82%. ô 26. liên kết sinh ra bởi lực hút tĩnh điện giữa nguyên tử H tích điện dương và nguyên tử O tích điện âm. Kim loại đó là A. ion âm phi kim và ion dương kim loại.1 Vị trí của nguyên tử M (Z = 26) trong bảng hệ thống tuần hoàn là A.7. D. Ca2+. Câu 5. Nguyên tử M là A.7 Hoà tan hoàn toàn 15. D.5 Cation M có cấu hình electron ở phân lớp ngoài cùng là 2p6. nhóm VIIIB. C.4 Cho cấu hình electron: 1s22s22p63s23p6. Ar. Dãy gồm các nguyên tử và ion có cấu hình electron trên là A. chu kì 3. Ar. C. B.7. Câu 5.7. ô 20. B. liên kết sinh ra bởi lực hút tĩnh điện giữa ion dương và các ion âm. Cl.9 Trong hợp kim Al. 35.5M. nhóm IIA. chu kì 3.4g hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 0. Câu 5.3 Trong mạng tinh thể kim loại có A. Ca. ô 18. nhóm VIIIA. 83%. chu kì 4. B. C. Ca2+. K+. Số g muối tạo ra là A. C. nhóm IIB.44g một kim loại hoá trị II trong 150ml dung dịch H 2SO40. K+. B. Na.

Zn. Câu 5. Cd. X ( Ag). Câu 5. D. C. CuAl. Câu 5. AlCl3. Thêm dung dịch HCl vào dung dịch trên. 73.18 Cho lá sắt vào dung dịch HCl loãng có một lượng nhỏ CuSO4 thấy H2 thoát ra càng lúc càng nhanh do A. AgNO3. Cu2+.20 Cho bột Cu đến dư vào dung dịch hỗn hợp gồm Fe(NO3)3 và AgNO3 thu được chất rắn X và dung dịch Y. D. C. Hg(NO3)2. Ag+. Ag+. dẫn nhiệt. B. nhiệt độ nóng chảy cao hơn kim loại nguyên chất.10 Ngâm 2. Thành phần %Ag trong hợp kim là A. dẫn nhiệt. Công thức hoá học của hợp kim là A. C. B. khối lượng lá kẽm tăng thêm 0. Mg2+. Y lần lượt là A. D. Ni khử được các ion kim loại A. ánh kim. Câu 5. dẫn nhiệt. NaCl. C. Phản ứng xong. B. Ag+. tính cứng hơn kim loại nguyên chất. ánh kim. D.5g hợp kim của Ag vào dung dịch HNO3. 60%. CuSO4. D. Tính dẻo.1%. Y (Cu2+).12 Tính chất vật lí chung của kim loại là A.33g hợp kim Fe. Sn. C. M là A. Cu2+. Cu2+. X có thể là A. X. tính dẫn điện.24g ion M 2+. Câu 5. D. Fe2+).Câu 5. Ag. Sn. Cu2+. ánh kim. ánh kim. C. Fe. 61%. Nhiệt độ nóng chảy cao. D.3% Al.19 Ngâm một lá Ni lần lượt trong những dung dịch muối sau : MgSO4.15 Một phương pháp hoá học làm sạch một loại thuỷ ngân có lẫn Zn. D. Na+. dẫn nhiệt. 62%. B. Ni.1%. B. Cu3Al2. B. Pb2+. Câu 5. B.Zn trong dung dịch HCl đến phản ứng hoàn toàn thu được 0. CuAl3. C. 63%.11 Hoà tan 0. Y (Cu2+). 75. Cu3Al. B. dẫn điện. dẫn nhiệt cao hơn kim loại nguyên chất. Tính cứng. Ag+. B. Cu.17 Để bảo vệ vỏ tàu đi biển phần ngâm dưới nước người ta nối nó với A. Y ( Cu2+. Pb là ngâm hỗn hợp trong dung dịch X dư. B. Tính mềm. Al3+. C.13 Hợp kim có A. C. Cu). B. tính dẻo hơn kim loại nguyên chất. C. Y ( Cu2+. dẫn điện.896 lít H2 (đktc). Câu 5. dẫn điện. ZnCl2. 74. X ( Ag.398g kết tủa.1%.16 Ngâm một lá kẽm nhỏ trong một dung dịch có chứa 2. Sn(NO3)2. thu được 0. D. 72. D. C. dẫn điện. Pb(NO3)2. Câu 5. Pb(NO3)2. Lá sắt bị ăn mòn kiểu hoá học. Câu 5. X ( Ag). X (Fe).Fe tan trong dung dịch HCl tạo khí H2. Thành phần % của Fe là A. Lá sắt bị ăn mòn kiểu điện hoá. Fe2+). 63 .1%.Fe khử Cu2+ thành Cu. D. Cu. Zn(NO3)2. Câu 5.94g.14 Một hợp kim Cu-Al chứa 12.

Fe2+.khử : Al3+/Al. Ag. Ag+/Ag. D.27 Cho các cặp oxi hoá. Fe3+/ Fe2+. (1) và (2). B. Fe(OH)3. Ag+. Cu2+. Ag. Fe. Fe3+/ Fe2+.. FeO. tăng 1.23 Cho các ion : Fe . Ag+. Trong dung dịch A chỉ chứa một loại anion là A. AgNO3. Fe3+/ Fe2+. Al. Ag+. Fe3+. D. Fe3+. giảm 1. B. Ag+/Ag. Cu2+/Cu.24 Có một hỗn hợp gồm: Fe. B. Fe3+/Fe2+. SO42-. có khí thoát ra.Câu 5. Cu2+/Cu. D. Ag+/Ag. Al3+. Câu 5. Khi phản ứng kết thúc khối lượng lá Zn A. Fe2+/ Fe. Ag+ và các kim loại : Fe. 2+ + C.21 Chọn một dãy chất tính oxi hoá tăng A. B. C. Cu. 64 . FeCl2. D.26 Cho các cặp oxi hoá. dung dịch mất màu xanh. Fe3+/ Fe2+. Cu2+/ Cu. Fe3+/ Fe2+. C. D. D. Fe . (1).1M. Al3+. Ag+/Ag. Tách Ag ra khỏi hỗn hợp với khối lượng không đổi người ta dùng dung dịch A. Fe2+/ Fe.43g. Al3+. Fe2+. B. Cu2+. Cu2+/ Cu. Cu. Fe3+.51g. Ion Cu2+ bị khử thành Cu trong thí nghiệm A.28 Khi nung Fe(OH)2 trong không khí ẩm đến khối lượng không đổi.khử : Al3+/Al. 2+ Câu 5. xuất hiện Cu màu đỏ. sau đó kết tủa tan. (2). Fe2+/ Fe. tăng 0. D. xuất hiện Cu màu đỏ. Chọn một dãy điện hoá gồm các cặp oxi hoá. C. C. Fe3+. Câu 5. Fe3+. có khí thoát ra. B. C. Fe2+/ Fe. dung dịch có màu xanh. Ag+/ Ag. D. B. Kim loại khử được ion Fe3+ thành Fe là A. Fe3+. NO3-. FeCl3. Fe2+/ Fe. D. Fe2+. giảm 0. Câu 5. Fe2+. ống nghiệm (2) một đinh Fe đã làm sạch. Ba2+. Fe2O3. Cu. Câu 5. Fe2+. D. Fe2+. Câu 5. không bị khử. Fe2+.Ag+/Ag. C. ta thu được chất rắn là A. Fe2+/ Fe.khử xếp theo chiều tính oxi hoá của ion kim loại tăng.29 Thả Na vào dung dịch CuSO4 quan sát thấy hiện tượng A.30 Có 2 ống nghiệm đựng dung dịch CuSO4. sau đó kết tủa không tan. C. B.22 Ngâm một lá Zn trong 200ml dung dịch AgNO3 0. Cu2+. Ag+. Cho vào ống nghiệm (1) một miếng nhỏ Na. Cl-. Câu 5. Ag . tính khử của kim loại giảm A.25 Trong một dung dịch A có chứa đồng thời các cation sau : K+. C. C. B. Cu. Cu2+/Cu. Ag+. B. Fe3+. CO32-. Al3+.51g. Ag+. Al3+. Kim loại Cu khử được các ion trong các cặp oxi hoá trên là A. xuất hiện kết tủa xanh. xuất hiện kết tủa xanh. Cu(NO3)2. Cu2+/ Cu. Câu 5. Fe3O4. Cu2+. Cu2+. Câu 5.43g.

điện phân Ca(NO3)2 nóng chảy. C. D. Ba. Fe 2O3 Fe3O4.92 gam. Cl2 ở anot. C. Câu 5.35 Cho sơ đồ : CaCO3 → CaO → CaCl2 → Ca. Câu 5. 0. Cl2 ở anot. điện phân CaSO4 nóng chảy. có màng ngăn 2 điện cực. Fe. 65 . C.12M. người ta thu được A. Câu 5. dung dịch HCl.6%. Na ở anot. 52%. B. MgO cần dùng 7g khí CO. D.9%.24g bột Mg vào một bình chứa sẵn 250ml dung dịch CuSO4. C. 9000C.7%. 54%. B. điện phân CaCl2 nóng chảy. 9. 0. Tên kim loại là A. 9000C. C.7%. Na. 2. Số gam chất rắn thu được sau phản ứng là A. 25.87%. B. dung dịch HCl.38 Một loại quặng sắt chứa 80% Fe2O3 và 10% SiO2. 8. Mg. FeO. B.34 Để khử hoàn toàn 30g hỗn hợp gồm CuO. 53%. 3. Câu 5. 56%. B. Giá trị của m là A. B. D. dung dịch H2SO4 loãng. B. 4. 8.37 Điện phân NaCl nóng chảy với điện cực trơ. sau 1930 giây thấy khối lượng catot tăng 1. Nồng độ mol/lít của dung dịch CuSO4 trước phản ứng là A. B.7%.685g.39 Điện phân (điện cực trơ) dung dịch muối sunfat của một kim loại hoá trị II với cường độ dòng điện 3A. điện phân dung dịch CaCl2. Điều kiện phản ứng và hoá chất thích hợp cho sơ đồ trên lần lượt là A.68%. Hg. 2. Câu 5.7%. Sau khi thu được 336ml H2 (đktc) thì thấy khối lượng lá kim loại giảm 1.53%. H2 ở catot. dung dịch HNO3.Câu 5.74g.36 Từ dung dịch CuSO4 để điều chế Cu. 23. C. C. Cu.40 Hoà tan m g Ba vào nước thu được 1 lít dung dịch có pH = 12. Ag. 4.1M. 0. Câu 5.33 Ngâm một lá kim loại có khối lượng 50g trong dung dịch HCl.32 Nhúng một que sắt nặng 5g vào 50ml dung dịch CuSO 4 15% (D = 1.04M. NaClO.154g.31 Cho 1. Cl2 ở catot. C.15g. B.15g. Cu. D. Câu 5. Fe. Na ở catot. 0.88g. 3. D. Ni. 9000C. Câu 5.06M. Fe. Fe. C. Nồng độ C% của dung dịch CuSO4 còn lại là A. 0. 24.12 g/ml). 9. D. D. 9000C. D. người ta dùng A. 26. B. Thành phần % theo khối lượng của Fe và Si trong quặng này lần lượt là A. 3. Câu 5. NaOH. D. C. Khi que sắt đã được mạ kín thì có khối lượng là 5. Kim loại đó là A. D. Al. Sau phản ứng khối lượng kim loại có trong bình là 1.12g bột Fe và 0.

Rót 250ml dung dịch này vào cốc đựng mạt sắt. Kim loại M là A.41 Điện phân muối clorua nóng chảy của kim loại M thu được 12g kim loại và 0.7g. 3. Mg.12 lít khí (đktc) ở anot. Al. Fe. Sau một thời gian.49 Cho 19. Ba. Fe. Ngâm một đinh Fe trong dung dịch còn lại sau điện phân. sau đó thêm 500ml dung dịch HCl 2M.6g. D. 0. 2. D. Ba.48 Có 5 mẫu kim loại: Mg.24 lít. D. NaCl. CaCl2. Chất rắn sau phản ứng tan trong dung dịch HCl dư tạo 13. 0. Câu 5. Mg. Khi cô cạn dung dịch thu được số gam muối khan là A. 27.47 Cho 16. C. 28. Fe.36 lít.15 mol O 2. người ta thu được sản phẩm là A. NaCl. C.2g. 66 . phản ứng xong thấy khối lượng đinh Fe tăng thêm 1. B. Câu 5. Mg.25g. Câu 5.45 Sau một thời gian điện phân dung dịch CuCl2 thu được 1. 9. B. C. Al.Câu 5.5g khí H2. B. B. C. Al. 12. B. Điện phân MgCl2 nóng chảy. Ba. Khối lượng sắt đã tham gia phản ứng là A. B.1M. Al. Câu 5. Cl2. Na. B. Câu 5.14g.72 lít khí (đktc).26g. Nếu chỉ dùng thêm dung dịch H2SO4 loãng thì có thể nhận biết A. Mg. B. Số gam Cu điều chế được từ các thí nghiệm trên là A. C.2g Cu vào 500 ml dung dịch NaNO3 1M.42 Điện phân nóng chảy muối clorua của kim loại M.8g. Cho dd MgCl2 tác dụng dd Na2CO3. D. Cu.46 Hoà tan hoàn toàn 10g hỗn hợp Al và Mg trong dung dịch HCl thu được 0.75g.44 Ion Mg bị khử trong trường hợp A.2g.44 lít khí (đktc). Cu. 3. 6.43 Điện phân dung dịch NaOH với điện cực trơ.63g. Thả Na vào dung dịch MgCl2. Câu 5. C. C. D. 4. KCl. 1. Ba.72 lít. D. MgCl2. Ba. 2+ Câu 5. Al. D. không có màng ngăn 2 điện cực. Mg. Câu 5. C. NaOH. 0. 28. Ở catot thu được 7. 2g. Al. người ta lọc lấy dung dịch có pH = 2. Mg. Ca.75g. Fe.2g kim loại M (hoá trị không đổi) tác dụng với 0. B. D. Ca.3 mol khí.2 gam kim loại và 6. Muối clorua đó là A. Thể tích khí NO (đktc) thu được là A. 27. B. D.48 lít. D. Câu 5. C. Điện phân dung dịch MgCl2. Cu. M là A. C.50 Có dung dịch HCl 0. NaClO.25g.

27g. B.7g. C. Ca(HCO3)2 → CaCO3 + CO2 + H2O. 0. Câu 5. C. B.42 và 11. CaO + CO2 → CaCO3. C. C. Câu 5. Số phương trình phản ứng hoá học (dạng phân tử) xảy ra khi cho các chất tác dụng với nhau từng đôi một là A. BaSO4. D. Hai kim loại X.57 Hoà tan 58g muối CuSO4.54 Một hỗn hợp X gồm Na và Al được trộn theo tỉ lệ mol 1: 2. magie. Ag.3625M.55 Hoà tan 1.84 và 10. 2. B. Cho X vào một lượng nước dư.44g hỗn hợp 2 muối.75M. Nồng độ mol/l của dung dịch CuSO4 đã pha chế là A. Cu.464M. D. D.2.58 Cho các chất: CaCO3. BeSO4. 0. Fe.54g. n CO2 = 2 n Ca(OH)2 .0g một kim loại hoá trị II trong dung dịch HCl.92. C. D. sau đó cô cạn dung dịch thu được 5.232M. sau khi kết thúc phản ứng thu được 8.6. Na2CO3 + Ca(OH)2 → CaCO3 + 2 NaOH.60 Cho phương trình phản ứng : a X + b Y(NO3)a → a X(NO3)b + b Y Biết dung dịch X(NO3)b có màu xanh.56 Hoà tan 2. 0. B.68 và 9. Câu 5. D.96 lít khí H 2 và m g một chất rắn. 0.Câu 5. 0. Câu 5. 0.76. CaSO4. B. Câu 5. Ag. Câu 5. 5. D. C. Giá trị của m là A. dung dịch HCl. Dung dịch CuSO4. 2. Số g mỗi muối trong hỗn hợp là A.59 Dùng một thuốc thử phân biệt Fe2O3 và Fe3O4.55g muối khan. Dung dịch H2SO4 loãng.52 Cho dòng khí CO2 liên tục đi qua cốc đựng dung dịch Ca(OH)2.11 mol khí CO2 đi qua dung dịch NaOH sinh ra 11. 1. B. Y lần lượt là A. D. bari. Fe. C.8g muối sunfat của một kim loại nhóm IIA trong nước rồi pha loãng cho đủ 50ml dung dịch. Tên kim loại đó là A. Câu 5. Công thức của muối sunfat là A. n CO2 > n Ca(OH)2 . n CO2 = n Ca(OH)2 . D.4g.02. Dung dịch HCl. Cu. Câu 5. CO2 + Ca(OH)2 → CaCO3 + H2O. B. n CO2 < n Ca(OH)2 . B. Cu. 0. B. 67 .5H2O trong nước được 500ml dung dịch. kẽm. dung dịch NaHCO3. 0. Câu 5. Để phản ứng hết với dung dịch này cần 20ml dung dịch BaCl2 0. D. C. dung dịch NaOH.53 Hiện tượng tạo thành các thạch nhũ trong các hang động được giải thích bằng phản ứng A. canxi. 1.725M. B. C.52 và 8. thuốc thử đó là A. 3.51 Cho 0. Dung dịch HNO3. MgSO4. 4. C. D. lượng kết tủa thu được lớn nhất là A. Mg.

27. 2a + 2b = c + d. MgSO4. Biết hiệu suất phản ứng điện phân là 80%. C. B.bị oxi hoá. Ca. FeSO4. 3a + 2b = c + 2d. Nguyên tử khối của M là A.8g.4M đến khi dung dịch hết màu xanh.64 Khi phản ứng với Fe2+ trong môi trường axit dư. B.tạo thành phức với Fe2+. B. MnO4.08g. 9. D. 4. c mol Cl-. thu được dung dịch Y và một phần sắt không tan. C.66 Một kim loại dùng để loại bỏ tạp chất Fe2(SO4)3 trong dung dịch FeSO4 là A. B. II – BÀI TẬP NÂNG CAO Câu 5. C. D.65 Có các kim loại Cu.62 Điện phân nóng chảy 76g muối MCl2 thu được 0. c. C. 68 . Câu 5. Cu.3) g muối MCln. B. Fe2(SO4)3. bị khử. 0. AgNO3. 3. Câu 5. D. Tên của M là A. Cho A tác dụng hết với dung dịch HNO3 loãng.2 lít. MgSO4. MnO4. D. Câu 5.4 lít. D. D. D. Ag. C. B. C. B. khối lượng thanh M tăng 0.1 mol khí duy nhất NO (đktc). 3a + 2b = c + d. 2. 10. Fe và các dung dịch muối Cu(NO3)2. Ba.68 Trong một cốc nước chứa a mol Al3+. Câu 5.63 Khuấy một thanh kim loại M hoá trị 2 trong 200ml dung dịch Cu(NO3)2 0. bị oxi hoá. D. Chất tan có trong dung dịch Y là A. d là A.10. dư thu được 0. C.64 mol khí Cl2 ở anot. Câu 5. C.là A. 2a + 3b = 2c + d. B. Cu. MgSO4. d mol SO42-. MgSO4. C.69 Cho Cu vào hỗn hợp gồm NaNO3 và H2SO4 loãng. b. Fe.61 Cho a g kim loại M tác dụng vừa đủ với V lít dung dịch HCl 2M thu được (a + 21. Số phương trình phản ứng hoá học xảy ra khi cho kim loại và muối tác dụng với nhau là A. Fe2(SO4)3. 0. 65. 0. B. D. Giá trị m là A. vừa bị khử vừa bị oxi hoá. dung dịch KMnO4 bị mất màu là do A.08g.80g. Mg.70 m g phoi sắt để ngoài không khí lâu ngày bị gỉ tạo thành hỗn hợp A có khối lượng 12g gồm 4 chất rắn. FeSO4.6 lít. Vai trò của ion NO3.67 Cho hỗn hợp X gồm Mg và Fe vào dung dịch axit H 2SO4 đặc nóng đến khi các phản ứng xảy ra hoàn toàn.3 lít.64g. Biểu thức liên hệ giữa a. 9. 1. Fe(NO3)2. B. MnO4. b mol Cu2+. D. V có giá trị là A. Ag. 24. Câu 5. Câu 5. 56. Biết rằng toàn bộ Cu sinh ra đều bám hết vào thanh M.bị khử thành Mn2+. Câu 5. không bị khử không bị oxi hoá. Zn. MnO4.không màu trong môi trường axit. C. 0.Câu 5.

3. 24g. 18. B.368 lít H 2 (đktc).7g. Câu 5. thu được Cu. Cô cạn dung dịch thì số gam muối khan thu được là A. 36%. C. B.52g.0.78 Cho 11g hỗn hợp nhiều kim loại trước hiđro tác dụng với dung dịch H2SO4 loãng. C. 28g.5g. 2. dư thu được V lít NO (đktc) duy nhất. Be và Mg. 3.01%.Phần 1: hoà tan hết trong dung dịch chứa HCl và H2SO4 loãng thu được 3.48 lít. V có giá trị là A. X2 có hoá trị không đổi. 25.80 Cho 3.5M được dung dịch Z và 4.252g. Câu 5. Cô cạn dung dịch thì số gam muối khan là A. 27g. 0.8g hỗn hợp 2 muối cacbonat của 2 kim loại thuộc nhóm II ở 2 chu kì kế tiếp nhau khi tác dụng hết với dung dịch HCl thu được 0.025 mol khí NO thoát ra.71 11.53g.95g. Chia X thành phần bằng nhau: . B. D. D.98g.87g. Câu 5. C. Đem Cu cho tan hết trong dung dịch HNO3 loãng dư. Câu 5.6 lít khí (đktc). D.8g. C. 37. Zn. Nếu cho X tác dụng hết với dung dịch HNO3 loãng. B.76 Cho 36. không tác dụng với nước và đứng trước Cu. Giá trị m là A.224 lít. 0.8g bột sắt ngoài không khí.21 %.75 Hỗn hợp X gồm 2 kim loại X1. B. B. C. 2.12 lít NO duy nhất (đktc). sau một thời gian thu được m g hỗn hợp X gồm các oxit và sắt dư.36 lít. Câu 5. D. D. Cô cạn dung dịch thì số gam muối khan thu được là A. 26g. .2. 2. Câu 5. Thành phần % về khối lượng Mg trong hỗn hợp X là A. 69 . Câu 5.6 lít SO2 (đktc). dư thu được 6. Hoà tan hết hỗn hợp X bằng H2SO4 đặc. Sr và Ba.36 lít H2 (đktc). Hoà tan hết X bằng dung dịch HNO3 thấy có 0. 0. được 3g hỗn hợp rắn gồm 4 chất. Mg và Ca. C. 39. D. B. Câu 5. Câu 5.79 Cho 22g hỗn hợp muối cacbonat của kim loại IA và IIA tác dụng với dung dịch HCl dư thu được 0. 22g. 3. dư thì thể tích N2 (đktc) là A. C.6 lít.2g hỗn hợp 3 kim loại Mg.87g hỗn hợp X gồm Mg và Al vào 250ml dung dịch Y chứa axit HCl 1M và H2SO4 0. 20g. 27. 0. C.336 lít. 2. B. 4. 35g.77 Cho 10. 5.3 mol khí (đktc). B. Ca và Sr.72 Oxi hoá m g sắt ngoài không khí. Giá trị m là A. C. D.24 lít. D.72 lít khí (đktc). 26%. Al tác dụng hết với dung dịch HCl dư thu được 5. 29g.Câu 5. C. Cho A tác dụng hết với dung dịch HNO3 loãng.24 lít. nóng thu được 5. Cho X tan hết trong dung dịch CuSO 4 dư. được 1. 0. 3.36 lít. 35.73 Nung nóng 16.Phần 2: hoà tan hết trong dung dịch HNO3 loãng thu được V lít khí NO (đktc).6g chất rắn A.74 Hỗn hợp X gồm 2 kim loại đều có hoá trị không đổi.63 lít.336 lít. Giá trị của V là A. 3.4 mol khí CO2. 25.224 lít. 1. D.242 lít. D.2g.25g. B. Vậy 2 kim loại đó là A.2g sắt để ngoài không khí bị gỉ thành 13.3g.

Câu 5.81 Hoà tan hoàn toàn 2,81g hỗn hợp gồm Fe2O3, Al2O3, MgO, ZnO trong 500ml dung dịch axit H2SO4 0,2M (vừa đủ). Cô cạn dung dịch sau phản ứng, muối sunfat khan thu được có khối lượng là A. 6,81g. B. 10,81g. C. 5,81g. D. 4,81g. Câu 5.82 Cho 1,935g hỗn hợp gồm 2 kim loại Mg và Al tác dụng với 125ml dung dịch gồm HCl 1M và H2SO4 loãng 0,28M, thu được dung dịch X và 2,184 lít H 2 (đktc). Cô cạn dung dịch, thu được số gam muối là A. 9,7325g. B. 9,3725g. C. 9,7532g. D. 9,2357g. Câu 5.83 Cho 10g hỗn hợp gồm Al và một kim loại M (hoá trị x) tác dụng với 100ml dung dịch gồm H2SO4 aM và HCl 3aM, thu được 5,6 lít H2 (đktc), dung dịch X và 1,7g chất rắn. Khối lượng muối thu được là A. 2,85g. B. 2,855g. C. 28,55g. D. 28,5g. Câu 5.84 Cho 7,2g Mg tác dụng hết với dung dịch HNO 3 loãng, dư thu được 6,72 lít khí Y và dung dịch Z. Làm bay hơi Z thu được 47,4g chất rắn khan. Công thức phân tử của khí Y là A. N2O. B. NO. C. N2. D. NO2. Câu 5.85 Đốt nóng một hỗn hợp X gồm Al và Fe3O4 trong điều kiện không có không khí được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: Phần 1: tác dụng với dung dịch NaOH dư thu được 3,36 lít H2 (đktc). Phần 2 : tác dụng với dung dịch HCl dư thu được 13,44 lít H 2 (đktc). Thành phần % về khối lượng của Al trong hỗn hợp X là (hiệu suất phản ứng 100%) A. 27,95%. B. 2,795%. C. 72,05%. D. 7,205%. Câu 5.86 Cho hỗn hợp A gồm bột Al và Fe3O4. Nung nóng A ở nhiệt độ cao trong môi trường không có không khí để phản ứng xảy ra hoàn toàn thu được hỗn hợp B. Nghiền nhỏ B rồi chia làm 2 phần: - Phần 1 (ít) tác dụng với dung dịch NaOH dư thu được 1,176 lít H2 (đktc). Tách riêng chất không tan đem hoà tan trong dung dịch HCl dư thu được 1,008 lít khí (đktc) - Phần 2 (nhiều) tác dụng với dung dịch HCl dư thu được 6,552 lít khí (đktc).Khối lượng hỗn hợp A là A. 22,02g. B. 8,1g. C. 13,92g. D. 3,465g. Câu 5.87 Một hỗn hợp gồm Na, Ba có tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí B. Thể tích dung dịch HCl 0,1 M để trung hoà

1 dung dịch A là 10

A. 0,4 lít. B. 0,2 lít. C. 0,6 lít. D. 6 lít. Câu 5.88 Cho m gam hỗn hợp X gồm K và Al tác dụng với nước dư thu được 0,25 mol khí. Nếu cho m gam X tác dụng với Ba(OH)2 dư thu được 0,4 mol khí (các phản ứng đều xảy ra hoàn toàn). m có giá trị là A. 12,8g. B. 16g. C. 18g. D. 10,95g.

70

Câu 5.89 Dùng CO khử m g Fe2O3 ở nhiệt độ cao được 0,4 mol CO2 và hỗn hợp rắn X (gồm 4 chất). Hoà tan hết X cần 0,9 lít dung dịch HCl 1M thấy có 0,25 mol khí thoát ra. Giá trị m là A. 32g. B. 40g. C. 80g. D. 3,2g. Câu 5.90 Dùng CO khử m g Fe2O3 ở nhiệt độ cao thu được 1,1 gam CO2 và chất rắn X gồm 3 oxit. X phản ứng vừa đủ với 0,25 lít dung dịch H2SO4 loãng 0,5M. Giá trị m là A. 8,0g. B. 4,0g. C. 1,6g. D. 3,2g. Câu 5.91 Cho 0,1 mol CO (đktc) từ từ đi qua ống sứ nung nóng đựng 4 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Hỗn hợp khí thu được sau phản ứng có tỉ khối hơi so với H2 bằng 20. Công thức của oxit sắt và thành phần % CO 2 theo thể tích trong hỗn hợp khí sau phản ứng là A. FeO ; 75% B. Fe2O3 ; 75% C. Fe2O3 ; 65% D. Fe3O4 ; 75% Câu 5.92 Một dung dịch có chứa 2 cation là Fe2+ (0,1 mol); Al3+ (0,2 mol) và 2 anion Cl- (x mol), SO42- (y mol). Khi cô cạn dung dịch thu được 46,9 gam chất rắn khan. x và y có giá trị lần lượt là A. 0,02 và 0,03. B. 0,03 và 0,02. C. 0,2 và 0,3. D. 0,3 và 0,2. Câu 5.93 Thêm V lít dung dịch Na2CO3 1M vào một dung dịch có chứa đồng thời các ion − − sau: Ba2+; Ca2+; Mg2+; 0,2 mol Cl ; 0,3 mol NO3 . Để tạo lượng kết tủa lớn nhất thì giá trị của V là B. 0,25 lít. A. 2,5 lít. C. 0,5 lít. D. 5 lít. Câu 5.94 Hoà tan 16,2g Al trong dung dịch HNO3 loãng, dư thu được hỗn hợp khí gồm NO và N2 có tỉ khối hơi so với H2 là 14,4. Thể tích (tính theo lít) của NO, N2 lần lượt là A. 2,24 và 3,36. B. 0,224 và 0,336. C. 22,4 và 33,6. D. 2,24 và 4,48. Câu 5.95 Cho 13,5g nhôm tác dụng vừa đủ với dung dịch HNO 3 0,86M thu được hỗn hợp khí gồm NO và N2O có tỉ khối hơi đối với H 2 bằng 19,2. Thể tích dung dịch HNO3 cần dùng là A. 2,2 lít. B. 0,22 lít. C. 0,46 lít. D. 4,65 lít. Câu 5.96 Hoà tan một hợp kim Ba-Na với tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí. Thêm m g NaOH vào

1 dung dịch A ta được dung dịch B. Cho dung dịch B tác 10

dụng với 100ml dung dịch Al2(SO4)3 0,2M được kết tủa C. Giá trị m để được kết tủa C lớn nhất, nhỏ nhất lần lượt là A. 2,4g và 4g. B. 4g và 2,4g. C. 4,8g và 6,4g. D. 6,4g và 4,8g. Câu 5.97 Rót 150ml dung dịch NaOH 7M vào 50ml dung dịch Al 2(SO4)3 2M. Khối lượng chất dư sau thí nghiệm là A. 10g. B. 14g. C. 12g. D. 16g.

71

Câu 5.98 Dung dịch chứa 16,8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3, thêm vào 13,68g Al2(SO4)3 thu được kết tủa và dung dịch A. Đun nóng kết tủa đến khối lượng không đổi được chất rắn B. Khối lượng chất rắn B là A. 2,12g. B. 21,2g. C. 42,2g. D. 4,22g. Câu 5.99 Cho 18,9g muối Na2SO3 tác dụng hết với dung dịch HCl thu được khí A (đktc). Dẫn khí A vào dung dịch Ba(OH)2 dư. Sau khi hấp thụ, khối lượng dung dịch sẽ A. tăng 22,95g. B. giảm 22,95g. C. tăng 20,25g. D. giảm 20,25g. Câu 5.100 Đốt cháy hoàn toàn 0,336 lít C3H8 (đktc) bằng lượng oxi vừa đủ. Thu được toàn bộ sản phẩm cháy cho vào 35 ml dung dịch Ca(OH) 2 1M. Sau khi hấp thụ, khối lượng dung dịch A. tăng 0,56g. B. giảm 0,56g. C. tăng 5,6g. D. giảm 5,6g. Câu 5.101 m g hỗn hợp Mg, Al tác dụng với 250ml dung dịch X chứa hỗn hợp HCl 1M và H2SO4 0,5M sinh ra 5,32 lít H2 (đktc) và dung dịch Y (coi Vdung dịch không đổi). dung dịch có pH là A. 1. B. 7. C. 2. D. 6. Câu 5.102 Trộn 100ml dung dịch gồm Ba(OH)2 0,1M và NaOH 0,1M với 400ml dung dịch gồm H2SO4 0,0375M và HCl 0,0125M thu được dung dịch X. pH của dung dịch X là A. 2. B. 7. C. 6. D. 1.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG V
5.1 A 5.11 A 5.21 A 5.31 A 5.41 A 5.51 A 5.61 C 5.71 A 5.81 B 5.91 B 5.101 A 5.2 A 5.12 A 5.22 B 5.32 D 5.42 B 5.52 A 5.62 A 5.72 A 5.82 A 5.92 C 5.102 A 5.3 C 5.13 A 5.23 A 5.33 A 5.43 B 5.53 B 5.63 B 5.73 C 5.83 C 5.93 A 5.4 D 5.14 A 5.24 C 5.34 D 5.44 B 5.54 C 5.64 A 5.74 A 5.84 D 5.94 A 5.5 D 5.15 D 5.25 B 5.35 D 5.45 A 5.55 B 5.65 C 5.75 D 5.85 A 5.95 A 5.6 A 5.16 C 5.26 D 5.36 C 5.46 A 5.56 A 5.66 A 5.76 C 5.86 A 5.96 A 5.7 B 5.17 A 5.27 A 5.37 A 5.47 B 5.57 A 5.67 C 5.77 B 5.87 C 5.97 A 5.8 A 5.18 B 5.28 B 5.38 A 5.48 D 5.58 D 5.68 B 5.78 B 5.88 D 5.98 D 5.9 B 5.19 C 5.29 B 5.39 B 5.49 C 5.59 C 5.69 A 5.79 D 5.89 A 5.99 B 5.10 D 5.20 A 5.30 B 5.40 A 5.50 D 5.60 B 5.70 B 5.80 A 5.90 A 5.100 A

72

+ H+ → H2O + CO2 HCO3.KNO3. Tính khử: IA. có màng ngăn hai điện cực. Ca(HCO3)2 lưỡng tính. kém bền với nhiệt HCO3.Na2CO3 dễ tan trong nước. và tăng theo chiều Z tăng : M → Mn+ + ne (n = 1. Cs. 2). KIM LOẠI KIỀM THỔ VÀ NHÔM A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.NaOH. dung dịch axit. Fr 2.CHƯƠNG VI. tan trong axit mạnh. Kim loại kiềm thổ (IIA): Be.+ OH. Tất cả các kim loại ở hai nhóm này đều tác dụng với phi kim. oxit axit. IIA: sử dụng phương pháp điện phân nóng chảy n ñpnc MXn  M + X2 (X = halogen). Ca(OH)2 có đầy đủ tính chất của một dung dịch bazơ như làm quỳ tím hoá xanh. KIM LOẠI KIỀM. IIA có số oxi hoá +1. Điều chế IA. Tính chất của một số hiđroxit . ns2 4. . IIA: ns1. Cấu hình electron ở lớp ngoài cùng của IA. tác dụng với axit.+ H2O t0 Ca(HCO3)2  CaCO3 + H2O + CO2 → .Khi cho CO2. Số oxi hoá: trong các hợp chất IA. hay dung dịch muối khác. Kim loại kiềm (IA): Li. để xác định muối sinh ra. Ra 3.→ CO32. ñpdd 2NaCl + 2H2O  2NaOH + H2 + Cl2 → (nếu không có màng ngăn : 2NaOH + Cl2 → NaCl + NaClO + H2O) 9. IIA đều có tính khử (IIA khử yếu hơn IA). P2O5 hay axit H2S. 6. Ba.NaHCO3.CaCO3 bị nhiệt phân. Sơ lược về muối cacbonat và hiđrocacbonat . H2O (trừ Be). Điều chế bazơ tan: sử dụng phương pháp điện phân dung dịch muối tương ứng với điện cực trơ. +2. Rb. muối. Ca(NO3)2 bị phân huỷ ở t > 330 C thành muối nitrit và oxi 1 t0 KNO3  KNO2 + O2 → 2 t0 Ca(NO3)2  Ca(NO2)2 + O2 → 73 . Na. SO2. bazơ mạnh. và tan cả trong nước có hoà tan CO2 t0 CaCO3  CaO + CO2 →  → CaCO3 + H2O + CO2 ← Ca(HCO3)2  0 0 . ta nên dùng công thức phân tử của các muối để xác định tỉ lệ giữa số mol nguyên tử kim loại với số mol nguyên tử phi kim trong oxit axit (axit) 8. → 2 ñpnc 4MOH  4M + O2 + 2H2O → 7. mang gần như đầy đủ tính chất chung của muối như tác dụng với dung dịch axit mạnh. Sr. Ca. H3PO4 … vào dung dịch bazơ. Mg. 5. .

Mg + 2HCl → MgCl2 + H2 3 9. chu kì 3.Nước cứng là nước chứa nhiều ion Ca2+. CaSO4.Điện phân Al2O3 nóng chảy (không thể điện phân nóng chảy AlCl3) để điều chế Al kim loại. 2Al + 6H2SO4 đặc  Al2(SO4)3 + 3SO2 + 6H2O → 14. Nước cứng tạm thời chứa muối Ca(HCO3)2 hay Mg(HCO3)2. Ca + Cl2  CaCl2 → 3 t0 6. Nước cứng . 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O t0 13. 2K + 2H2O → 2KOH + H2 15. .MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1 t0 1. Al + 4HNO3 đặc  Al(NO3)3 + NO + 2H2O → 12. 2Na + O2  Na2O → 2 1 t0 2.Vị trí Al trong bảng tuần hoàn: ô 13.Nguyên tắc làm mềm nước cứng là làm giảm nồng độ các ion Ca2+. . dùng bazơ tan. Mg + O2  MgO → 2 3 t0 3. 2Al + O2  Al2O3 → 2 1 t0 4. IIA. Al + Cl2  AlCl3 → 2 1 7. Nước cứng vĩnh cửu chứa muối clorua hay sunfat của Ca2+ hay Mg2+ (CaCl2. B . nhóm IIIA. . K + Cl2  KCl → 2 t0 5.Cách làm mềm nước cứng vĩnh cửu dùng Na2CO3 hoặc Na3PO4. Mg2+. 2Al + 6H2O → 2Al(OH)3 + 3H2 74 . 11. . MgSO4). .Nhôm có tính khử mạnh (Al → Al3+ + 3e) nhưng kém kim loại nhóm IA. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O t0 11.Cách làm mềm nước cứng tạm thời: đun. . Al(OH)3 lưỡng tính. Ca + 2H2O → Ca(OH)2 + H2 16. . MgCl2. Nhôm .Vật bằng nhôm bền trong không khí.Al2O3. dd Na2CO3.10. tham gia phản ứng nhiệt nhôm.Nhôm bị phá huỷ trong kiềm. Al + 3HCl → AlCl3 + H2 2 10. Na + HCl → NaCl + H2 2 8. H2O vì trên bề mặt nhôm được phủ kín một lớp Al2O3 bảo vệ. Mg2+ trong nước cứng. .

2KNO3 + 3C + S  N2 + 3CO2 + K2S → t0 44. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. 2NaHCO3  Na2CO3 + CO2↑ + H2O → t0 34. Al(OH)3 + NaOH → Na[Al(OH)4] 0 ñpdd 75 . CaCO3 + H2O + CO2 ← Ca(HCO3)2  t 41. Ca(HCO3)2  CaCO3 + CO2↑ + H2O → t0 35. Mg2+ + HPO42. Ca(OH)2 + CO2 → CaCO3 + H2O 30.17. 2NaOH  2Na + O2 + H2O → 2 ñpnc 23. 2Al + Fe2O3  Al2O3 + 2Fe → 20. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. 2Mg(NO3)2  2MgO + 4NO2 + O2 → 46. NaOH + CO2 → NaHCO3 27. NaHCO3 + HCl → NaCl + CO2↑ + H2O 37. NaHCO3 + NaOH → Na2CO3 + H2O 38. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. Mg(HCO3)2  MgCO3 + CO2↑ + H2O → 36. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2↓ 32.+ NH3 → MgNH4PO4 ↓ (màu trắng) 50. 2NaOH + CO2 → Na2CO3 + H2O 29. MgCl2  Mg + Cl2 → ñpnc 24. CaCO3 + 2HCl → CaCl2 + H2O + CO2↑  → 40. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. Ca(NO3)2  Ca(NO2)2 + O2 → t0 45. 2NaCl  2Na + Cl2 → 1 ñpnc 22. 2KNO3  2KNO2 + O2 → t0 43. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. CaCO3  CaO + CO2 → t0 42. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 ñpnc 21. Mg + CuSO4 → MgSO4 + Cu t0 19. 2Al2O3  4Al + 3O2 → → 25. 2NaCl + 2H2O  2NaOH + H2 + Cl2 coù ng ngaê maø n 26. Na2CO3 + 2HCl → 2NaCl + H2O + CO2↑ 39. NaOH + HCl → NaCl + H2O 31. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 t0 33.

B.1 Cation M+ có cấu hình electron ở lớp ngoài cùng là 3s23p6. 76 . D. 25. Câu 6.45%. + C. Câu 6.9 Dung dịch muối có pH > 7 là A. D. B. 126g.8g. Thành phần % theo khối lượng của Na2CO3 và NaHCO3 lần lượt là A. NH4Cl. C. Na .12 gam kim loại ở catot. D. 32% .1g hỗn hợp 2 kim loại kiềm ở hai chu kì kế tiếp nhau trong bảng tuần hoàn tác dụng hết với nước thu được 1. 16% . 11. 16%. LiCl. 2.2 Tính chất không phải của kim loại kiềm là A. C. D.8g. 12. KCl. Câu 6. B. Câu 6. B. NaCl. 84% . C.4g. Câu 6.57%. 68%.8 gam kali kim loại vào 36. B. Na2CO3. 25. KCl. K+. D.3 Nồng độ phần trăm của dung dịch tạo thành khi hoà tan 7. B.2 gam nước là A. Kim loại kiềm có tính khử mạnh. 12. D. C. 12. C.Cu+. Ag+. Có nhiệt độ nóng chảy thấp nhất trong tất cả kim loại. 32%.04 mol khí ở anot và 3. Công thức phân tử của muối kim loại kiềm là A. D. Khối lượng kiềm là A. B. 2Al(OH)3  Al2O3 + 3H2O → C. 48g. RbCl. D. D. 84%.8 Cho 3.72%. C.54.119g. NaHSO4 . B.12 lít H2 (đktc) và dung dịch kiềm.BÀI TẬP TRẮC NGHIỆM I.6g. Độ cứng cao. 4. M+ là cation: A. 16.9g. C. Có số oxi hoá +1 trong các hợp chất. 24g. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl t0 55. B. 68% .6 Cho 197g BaCO3 tác dụng hoàn toàn với dung dịch HCl để lấy khí CO2 sục vào dung dịch chứa 84g KOH.5 Cho 200g CaCO3 tác dụng hoàn toàn với dung dịch H2SO4 loãng để lấy khí CO2 sục vào dung dịch chứa 60g NaOH.BÀI TẬP CƠ BẢN Câu 6. Khối lượng muối natri thu được là A.4 Điện phân muối clorua kim loại kiềm nóng chảy thu được 0.79%. Câu 6.7 Nung 100g hỗn hợp gồm Na2CO3 và NaHCO3 cho đến khi khối lượng của hỗn hợp không đổi được 69g chất rắn. Câu 6. 50g. 168g.69g. C. Câu 6. Khối lượng muối thu được là A.

44g kim loại hoá trị II trong 150ml dung dịch H2SO4 0. Điện phân CaCl2 nóng chảy. Kim loại đó là A. Câu 6.36 và 4. Ca. Ca.4% và 29. 4 và 4.6% và 70. BaCO3 . Thành phần % theo khối lượng của CaCO3 và MgCO3 trong hỗn hợp lần lượt là A. B. Ba. Câu 6.15% và 40.95g. Để trung hoà axit dư phải dùng hết 30ml dung dịch NaOH 1M.16 Cho 2. D. Na2SO4 .12 Hoà tan hoàn toàn 1. 4.11 Cho 2. B. pH > 7.15%. Số gam CaCO3 và MgCO3 lần lượt là A. Câu 6. D. B.2. Câu 6.48.48 và 3.25g muối clorua của một kim loại hoá trị II và một lượng muối nitrat của kim loại đó có số mol bằng số mol muối clorua thì thấy khác nhau 7. Ba. B. C. 5. có màng ngăn. pH = 7. Chỉ dùng nước và khí CO2 phân biệt được số chất là A.1 gam muối clorua. 6. C. Câu 6. pH = 5. B.85%. C. 4. D. Kim loại đó là A. C.0 gam kim loại nhóm IIA tác dụng hết với dung dịch HCl tạo ra 11. 77 . D. 4.15 Hoà tan 8.19 Trường hợp ion canxi bị khử thành Ca là A.5g. Be. B. Cho dung dịch CaCl2 tác dụng với dung dịch AgNO3.5g. pH < 7. Be.016 lít CO2 (đktc). D.05g. Sục 1. C. 40. Mg. 7. Mg. 3. Ca. C.36.13 Khi lấy 14.2 và 4.10 Cho a mol NO2 hấp thụ hoàn toàn vào dung dịch chứa a mol NaOH. 29. Mg. Câu 6. Kim loại đó là A. Ca.8g CaO tác dụng với một lượng nước dư thu được dung dịch X. D. C. D.55g.5M.4%. C. B.84g hỗn hợp CaCO3 và MgCO3 tác dụng hết với dung dịch HCl thu được 0.03 mol khí CO2. Be.2g hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2. Ba. Dung dịch thu được có pH A. Câu 6. Mg. 4. Câu 6. 3. Be. B. 70. 59. Câu 6. 2. C.6%.14 Cho 4.68 lít khí CO2 (đktc) vào dung dịch X. D. BaSO4 . C.Câu 6.25. D. B.18 Kim loại thuộc nhóm IIA không tác dụng với nước ngay cả ở nhiệt độ cao là A.17 Có 5 chất bột trắng là: NaCl. khối lượng kết tủa thu được là A. 2.85% và 59. Ba. Na2CO3 . Điện phân dung dịch CaCl2 với điện cực trơ. B.

0.05 mol HCO3–.01 mol Na+. Câu 6. B. Na3PO4. C. tạm thời. Câu 6.28 Trong phương pháp trao đổi ion để làm mềm nước cứng người ta dùng A. 0. Nước cứng vĩnh cửu.02 mol Ca2+. Na2CO3 + 2HCl 2NaCl + H2O + CO2. 0.4g Ca(OH)2 . B. C.20 Phân biệt dung dịch Ca(HCO3)2 với dung dịch CaCl2 bằng A. D. B. Na2CO3 + CaCl2 CaCO3 + 2NaCl.24 Dung dịch làm mềm nước cứng tạm thời và vĩnh cửu là A. D.02 mol Cl– . Điện phân dung dịch AlCl3 với điện cực trơ có màng ngăn.22 Cho 10 lít hỗn hợp khí (đktc) gồm CO và CO2 trong đó CO2 chiếm 39.MgCO3 trong quặng là A. Tính cứng tạm thời. Dung dịch HCl. C.21 Khi nung 40g quặng đôlômit thu được 11. HCl.05 mol HCO3–. Dung dịch Na2CO3. B. C. B. Nước trong bình có A. Dùng H2 khử Al2O3 ở nhiệt độ cao. 100%. D.01 mol Na+. Tính cứng toàn phần. 2. Số g chất kết tủa sau phản ứng là A. 0. B. D. 0.2 lít khí CO2 (0oC. Tính mềm. B.27 Một phương trình phản ứng hoá học giải thích việc dùng dung dịch Na2CO3 làm mềm nước cứng vĩnh cửu là A.25 Trong một bình nước có chứa 0. B. C. Dung dịch Na3PO4. 50%. 12.65g. Tính cứng vĩnh cửu.26 Đun sôi nước chứa 0. Câu 6.29 Ion Al bị khử trong trường hợp A. Thả Na vào dung dịch Al2(SO4)3. C. Câu 6. Ca(OH)2. C. Nước cứng toàn phần. Nước cứng tạm thời. D.23 Một loại nước có chứa nhiều muối Ca(HCO3)2 thuộc loại A. Cho dung dịch Ca(OH)2 tác dụng với dung dịch HCl. 92%. D. 14. D.5g. 0. Dung dịch NaCl.8 atm).05g. 0. Zeolít. Na2CO3 + Ca(OH)2 CaCO3 + 2NaOH. D. D. NaNO3. Nước khoáng. D. Câu 6. 4.02 mol Cl– ta được nước cứng A. toàn phần. Ca(OH)2. 78 .2% (theo thể tích) đi qua dung dịch chứa 7. Câu 6.01 mol Mg2+. vĩnh cửu. B. 0. nước mềm. Thành phần % theo khối lượng của CaCO3. 0. Na2CO3. Na2CO3. Điện phân Al2O3 nóng chảy. Câu 6. Câu 6. C. Na2CO3 + Ca(HCO3)2 CaCO3 + 2NaHCO3. Câu 6.02 mol Ca2+.25g. 40%. C. C.01 mol Mg2+. 3+ Câu 6. B.D.

đpnc. Câu 6. Nhôm có tính khử mạnh chỉ sau kim loại kiềm và kiềm thổ. đpnc. nhóm IA. Ba(OH)2. ở (1) kết tủa không tan. C. NaHCO3. C. Al2O3. nhóm IIIA. Ba(OH)2. H2SO4 loãng. HCl. sau đó kết tủa tan ra. B. Lúc đầu đều có kết tủa keo trắng. ô 13. Ba(OH)2. dẫn nhiệt tốt. ở (2) kết tủa không tan. Al2O3 + 3H2O 2Al(OH)3. D. Z. Vị trí M trong bảng tuần hoàn là A. 2 3+ Câu 6. ở (1) kết tủa tan. t0. Câu 6. 2Al(OH)3 Al2O3 + 3H2O. B. Ba(OH)2. C. 2Al(OH)3 2Al + 3H2O + O2. H2SO4 đặc nóng. Al(OH)3 . t0.30 Phương trình phản ứng hoá học chứng minh Al(OH)3 có tính axit là A. C. NaOH dư.31 Cation M có cấu hình electron ở lớp ngoài cùng là 2s22p6. 79 . NaOH đủ. ở (2) kết tủa tan. đpnc. Lúc đầu đều có kết tủa keo trắng. C. HCl. ô 13. D. Nhôm là kim loại nhẹ. C. Al(OH)3 + 3HCl AlCl3 + 3H2O. B. AlCl3 + 3NaOH Al(OH)3 + 3NaCl.Câu 6. B. ô 13.35 Để làm kết tủa hoàn toàn Al(OH)3 người ta thực hiện phản ứng A. chu kì 3. chu kì 3.34 Cho sơ đồ : +X +Y +Z → Al → Al2(SO4)3 → Al(OH)3  Ba [ Al(OH) 4 ] 2 Al(OH)3 Al2O3 Al. chu kì 3. D. Nhôm bị phá hủy trong môi trường kiềm. Y. D. ZnSO4.36 Cho dần từng giọt dung dịch NaOH (1). Lúc đầu đều có kết tủa keo trắng. H2SO4 đặc nguội. C. NaOH dư. HCl. NaAlO2 + H2O + HCl Al(OH)3 + NaCl. H2SO4 loãng.32 Chọn câu không đúng A. t0. AlCl3 + 3H2O + 3NH3 Al(OH)3 + 3NH4Cl. Lúc đ ầu đều có kết tủa keo trắng. dung dịch NH3 (2) lần lượt đến dư vào ống đựng dung dịch AlCl3 thấy A. dẫn điện. nhóm IIIB. E (dung dịch) và (1). Câu 6. B. X. (2) lần lượt là A. Câu 6. ô 13. đpnc. B. Al(OH)3 + NaOH Na[Al(OH)4]. chu kì 3. NaOH. sau đó kết tủa không tan ra. Nhôm là kim loại lưỡng tính. B. D. D. Câu 6. HCl. t0. nhóm IB. 3 D. chất không có tính lưỡng tính là A.33 Trong những chất sau.

D. ở (2) xuất hiện kết tủa trắng rồi tan.44 Điện phân Al2O3 nóng chảy với dòng điện cường độ 9. B. kết tủa trắng tăng dần rồi tan. 3. sau đó kết tủa không tan ra.16g Al. C. Lúc đầu đều có kết tủa keo trắng. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa. D. 1.37 Cho dần từng giọt dung dịch HCl (1) .Al2(SO4)3. D.75M và 0. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. D. ở (1) kết tủa tan. 90%. D. 80%. (2) là NaOH.8. Câu 6. ở (1) không hiện tượng. Câu 6. ở (1) kết tủa không tan. D. Mg2+ (3) ta quan sát thấy A. sau đó kết tủa tan ra. rồi kết tủa không tan. Na3AlF6.75M và 0.95. Hiệu suất điện phân là A. ở (3) xuất hiện kết tủa trắng không tan.38 Phèn chua có công thức là A.65A trong thời gian 3000 giây thu được 2. Nồng độ mol/l của dung dịch NaOH ban đầu là A. 0. 70%.2. Kết tủa tạo thành được làm khô và nung đến khi khối lượng không đổi cân nặng 2. B.41 Có 4 mẫu bột kim loại là Na. nhận ra (1) là AlCl3 . B. ở (1) không hiện tượng.75M. nhận ra (1) là AlCl3 .43 Hoà tan 5. Câu 6. 10.2. (2) là NaOH.42 Cho 100ml dung dịch AlCl3 1M tác dụng với 200ml dung dịch NaOH. 13.75M và 0. B. 4. ở (3) xuất hiện kết tủa trắng. Câu 6. Lúc đầu đều có kết tủa keo trắng. 15. không tan. ở (2) xuất hiện kết tủa trắng. (2) là NaOH. ở (1) không hiện tượng. C.75M. K2SO4. C.40 Có 2 lọ không ghi nhãn đựng dung dịch AlCl 3 (1) và dung dịch NaOH (2). Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. C. Câu 6.35M. Al2O3. Al3+ (2). Lúc đầu đều có kết tủa keo trắng. ở (1) không hiện tượng. B. không tan. Al. 2. 13. rồi không tan. D.4g bột Al vào 150ml dung dịch hỗn hợp chứa Fe(NO3)3 1M và Cu(NO3)2 1M. Kết thúc phản ứng thu được số gam chất rắn là A. ở (2) kết tủa không tan.39 Cho từ từ đến dư dung dịch NaOH lần lượt vào các dung dịch đựng Na+ (1). MgSO4. C. 80 . Mg. ở (2) và (3) xuất hiện kết tủa trắng rồi tan. C. 2.35M. nhận ra (1) là AlCl3 . người ta phân biệt chúng bằng cách A. Không dùng thêm chất khác. Chỉ dùng thêm nước làm thuốc thử thì số kim loại có thể phân biệt được là A. B. Câu 6.Al2(SO4)3. 0. ở (2) kết tủa tan.35M và 0. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa rồi tan ra. (2) là NaOH. C. C. D. kết tủa trắng tăng dần. B. Fe.24H2O. nhận ra (1) là AlCl3 .nH2O. B.Câu 6. Lúc đầu đều có kết tủa keo trắng.24H2O. CO 2 (2) lần lượt vào ống đựng dung dịch Na[Al(OH)4] thấy A. 60%.55g. 2. Câu 6.

ZnO.06g oxit của kim loại M (có hoá trị n) tan trong HNO3 dư thì thu được 5. H2SO4 đặc nguội. Al2O3 đựng trong các lọ riêng biệt là dung dịch A.45 Một thuốc thử phân biệt 3 chất rắn Mg. 3.5088 lít. 81 . H2O. 12. C. C. Câu 6.22g hỗn hợp kim loại gồm K. C. B.54 Hoà tan 4. 5. AlCl3 . D.80g.5g hỗn hợp kim loại gồm Mg. B. B. m nhận giá trị bằng A.10g. 3. Câu 6. Giá trị của V là A. 18g. Ca.05g. Dung dịch Na2CO3.8g. Al.15. H2O. D. B. Dung dịch NaOH. C. B. Mg. C. dư thu được V lít khí NO (đktc) và dung dịch X.10. CaCl2 . 4. m g X tác dụng với nước dư được 5. Sau đó cô cạn dung dịch thu được x gam muối khan. Al(OH)3.32 gam nhôm kim loại bằng dung dịch HNO3 loãng. D. Cô cạn dung dịch X thu được 35. 3.34g. 11. D.95g.20g.6g. C. m có giá trị là A.52 Cho 3.53 Hỗn hợp X gồm K và Al. 11. Câu 6. Al(OH)3. B. HCl đặc.45g.52 gam muối. 14. 9.00g.07g. D. B. NaOH. m g X tác dụng với dung dịch Ba(OH)2 dư thu được 8.50 Hoà tan hết 3.4800 lít. 13. (Các phản ứng đều xảy ra hoàn toàn. Al2O3 . 12. B. m có giá trị là A.46 Chỉ dùng các chất ban đầu là NaCl. CuO.02g. Công thức của oxit là A.22g muối khan.48 Một hoá chất để phân biệt các dung dịch riêng biệt NaCl. thu được 2. amoniac. dung dịch NaOH. AlCl3 là A. Na. Dung dịch Na2CO3. C. 2. D. C. các thể tích khí đo ở đktc). C.47 Một hoá chất để phân biệt Al. là A.2g. 12. Mặt khác.96 lít khí. Câu 6. BaO. 16g. dung dịch HCl. B. Al2O3 D. D. Dung dịch HCl. thu được 3. Câu 6.44g. Al và Fe bằng dung dịch HCl.24 lít khí (đktc). 4.Câu 6.51 Cho 2. Câu 6.4048 lít.136 lít khí (đktc) và m g muối clorua. D. Cô cạn dung dịch X được m g chất rắn.6000 lít. C. B. Câu 6. H2O. AlCl3. Al (điều kiện phản ứng coi như có đủ) có thể điều chế được A. Câu 6. 3. Na và Ba vào nước được 500ml dung dịch X có pH = 13. D. x có giá trị là A. Câu 6.49 Hoà tan hết 10g hỗn hợp muối cacbonat của kim loại IA và IIA bằng dung dịch HCl dư.6 lít khí. MgO.

Câu 6.52g một kim loại tan hết trong dung dịch H 2SO4 loãng thu được 6. 90%. D. 6. B. Ca. B.2 mol Al vào nước dư thì thể tích khí thoát ra (đktc) là A. C. 18kg C.72 lít H2 (đktc). Câu 6.4g.1800kg Câu 6. 4.24 lít.96 lít. và khí thoát ra ở anot chỉ là CO2) có giá trị lần lượt bằng A. B. Cũng lượng hợp kim trên tác dụng vừa đủ với dung dịch NaOH thu được 6.68%. 102kg. 8.2%. Khối lượng Al trong hỗn hợp ban đầu là A. Câu 6. C.8 lít H2 (00C. 4. D. 180kg B. B. 2. % Al tính theo khối lượng là A.1 mol Ba và 0. 36. D. 3.1020kg. D. 54g. 73%. 10200kg . 6. C.72 lít.56 Cho hỗn hợp 0.96 lít H2 (đktc). Câu 6.8atm). 0. Hỗn hợp sau phản ứng nhiệt nhôm nếu đem tác dụng với NaOH dư thu được 6.04g hỗn hợp Fe và Cu tác dụng với dung dịch HNO 3 loãng thu được 0. nóng. 9%. B. Câu 6. B. C.4g.72 lít H2(đktc). D.48 lít. 180kg D.63 2. 20ml. B. 34.6g nước để thu được dung dịch có nồng độ 14% là A. C. Biết đã dùng dư 10ml thì thể tích dung dịch NaOH 4M đã lấy ban đầu là A. 4.08 lít H2 (đktc). Fe. C.57 Cho 9g hợp kim Al tác dụng với dung dịch NaOH đặc.9g.62 3. dư thu được 10. C.55 Khối lượng K2O cần lấy để hoà tan vào 70.3%.61 Hỗn hợp Al và Fe3O4 đem nung không có không khí. nếu đem tác dụng với dung dịch HCl dư thu được 26.6%. 3. 200ml. Kim loại là A. 5. Câu 6. Al.4g.2%. 2.102kg. 8. 27g.Câu 6.84g muối sunfat.8g.59 Khối lượng Al2O3 và khối lượng cacbon bị tiêu hao cần để sản xuất được 0.60 31. % Al trong hợp kim là A. 210ml.7g. 7.92%. B. C. D.2g hỗn hợp Al và Al2O3 tác dụng với dung dịch NaOH dư thu được 16. 9. 63. 21ml. D.54 tấn Al bằng phương pháp điện phân nóng chảy Al2O3 với anot bằng cacbon (coi như hiệu suất điện phân bằng 100%. 82 . K.32%.8%. Câu 6.46%. 69.58 Hợp kim Al-Mg tác dụng vừa đủ với dung dịch HCl thu được 8.896 lít NO (đktc). 6.88 lít H2(đktc). % Fe theo khối lượng là A. D.

71 Trong pin điện hoá.68 Cho dung dịch chứa 16. nguyên tử Cu. D. D. 625. Câu 6. tiếp tục thêm vào dung dịch sau phản ứng 13.72 lít. Na II. C.68%. 83 .0136g. sự khử chất oxi hoá. E0 (pin) = E0 (anot) − E0 (catot).96 lít H2 (đktc). 5. C.6g O2 (đktc).8g so với ban đầu. C. D. Câu 6. Câu 6. sự điện li dung dịch muối. 62. 0. Mg D. a có giá trị là A. 11g. Tên lá kim loại là A. B.12g. Khối lượng chất rắn Y là A. D. B. E0 (pin) = E0 (catot) + E0 (anot). D. B.sự oxi hoá chất khử. D. B. C. thu được chất rắn Y. 4.7H2O. C. Còn nếu cho a g hỗn hợp trên tác dụng với dung dịch CuSO4 dư thì được chất rắn có khối lượng tăng thêm 0. C.68g Al2(SO4)3 nữa thì thu được kết tủa X. 0. sự khử chất oxi hoá. C. Câu 6.2g. C. E0 (pin) = E0 (catot) – E0 (anot). sự điện phân dung dịch muối. electron. Thêm H2SO4 vào 20ml dung dịch trên thấy làm mất màu 30ml dung dịch KMnO 4 0.5g.70 Suất điện động chuẩn E0 (pin) tính bằng A.7H2O tác dụng với H2O thu được 300ml dung dịch. 21. Câu 6. anot là nơi xảy ra A. ion.69 50g một lá kim loại tan hết trong dung dịch HCl thu được 336ml H 2(đktc) và thấy khối lượng lá kim loại giảm 1.5g.66 Cho a g FeSO4. B. Thể tích H2 (đktc) là A. 3.65 Cho Fe tác dụng với dung dịch H2SO4 loãng. 1. sự oxi hoá chất khử B. 6. B.36 lít.72 Trong pin điện hoá. Câu 6. Câu 6. C. Giá trị a là A. 16. 2.6255g. Fe C.22g. D. dung dịch thu được cho bay hơi H2O được 55. D. Câu 6. E0 (pin) = E0 (anot) + E0 (catot).64 Cho a g hỗn hợp gồm Al và Fe tác dụng với dung dịch NaOH dư thu được 1 thể tích H2 bằng thể tích của 9. B. D. sự điện phân dung dịch muối. Nhiệt phân hoàn toàn X. Giá trị a là A. 6.8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3.1M. 8.36g.55g. B.22g.6 gam FeSO4.2g Fe.255g.2g.96 lít.136g.BÀI TẬP NÂNG CAO Câu 6. Al B. catot là nơi xảy ra A. 13.6g.Câu 6. 4. 42.67 Khi khử hoàn toàn a g hỗn hợp gồm Fe và Fe 2O3 ở nhiệt độ cao thu đựơc 11. Nếu cho a g hỗn hợp trên tác dụng với dung dịch HCl dư thì được 8.48 lít. 0. nguyên tử Zn. sự điện li dung dịch muối.5g.73 Trong cầu muối của pin điện hoá Zn – Cu xảy ra sự di chuyển các A.

78 Cho công thức hoá học của muối cacnalít là xKCl. 0 Câu 6.55g cacnalít tác dụng với dung dịch KOH dư.7%. Nồng độ % của dung dịch NaOH trước điện phân là A. C.76 Biết E pin (Zn – Cu) = 1.44V.79 Cho 3. B. 0.zH2O.xH2O trong 250cm3 nước cất. 2Ag+ + Fe → Fe2+ + 2Ag B.8g muối cacbonat của một kim loại hoá trị II hoà tan trong dung dịch H2SO4 loãng vừa đủ.77 Hoà tan 2. 0.8M. B.42g Al2(SO4)3 tác dụng với 250ml dung dịch NaOH aM. 0. B. thế điện cực chuẩn (E0) của cặp oxi hoá – khử Zn2+/Zn là A. 12.24M hoặc 0.32g. Fe3+ + 3Ag → Fe + 3Ag3+ Câu 6. C.khử Ag+/Ag và Fe2+/Fe là A. Cô cạn X thu được 7.76V. Câu 6.75 Suất điện động chuẩn của pin điện hoá Sn −Ag là A. B. 0. C.2MgCl2.H2O. 1. Câu 6. B.44V.1g cacnalít thì khối lượng giảm 4. Na2CO3.8%. KCl. D. C. D.MgCl2.6H2O. Công thức hoá học của muối ngậm nước là A. Biết 25cm3 dung dịch này tác dụng vừa đủ với 17.2M hoặc 2. D. 7. D.6%. + 1.5H2O. thu được 0.yMgCl2.94V.4%.2%.81 Cho 5g Na có lẫn Na2O và tạp chất trơ tác dụng với H2O thu được dung dịch X và 1.76V.2MgCl2.5g muối Na2CO3.09V. Sau điện phân còn lại 100g dung dịch 24%.08M. B.0. Na2CO3.28M. CaCO3. Câu 6. Câu 6. Na2CO3.5cm3 dung dịch HCl 0. lọc lấy kết tủa đem nung đến khối lượng không đổi thì được chất rắn có khối lượng giảm 0. 0. Dung dịch X trung hoà vừa đủ 200ml dung dịch HCl 1M. Biết khi nung nóng 11. Fe2+ + 2Ag → 2Ag+ + Fe C. 77%. Câu 6. − 0.66V. Câu 6. D. B. 2.36g so với trước khi nung.26%. Mặt khác khi cho 5.Câu 6. C. D. C.04M hoặc 0. ZnCO3. D.6H2O.82 Cho 5. 2KCl.7H2O.34V. C. MgCO3. C.6g muối sunfat trung hoà khan.10H2O. Thành phần % theo khối lượng của tạp chất trơ là A.6H2O.74 Phản ứng xảy ra trong pin điện hoá được cấu tạo bởi cặp oxi hoá. 1. Na2CO3. 2. –1. D. Fe + 3Ag3+ → Fe3+ + 3Ag D. Công thức hoá học của cacnalit là A. 24%.56M. 20.78g chất kết tủa.80 Điện phân dung dịch NaOH với cường độ không đổi là 10A trong 268 giờ.10V và E0(Cu2+/Cu) = +0.79V.1. 84 .6H2O. thu được một chất khí và dung dịch X.875 lít khí Y (đktc). KCl. 2KCl.12M hoặc 0. B. Nồng độ mol/lít của dung dịch NaOH đã dùng là A.MgCl2. Công thức hoá học của muối cacbonat là A. FeCO3. + 0.1M.

Khối lượng Zn trong hỗn hợp là A. C. lúc đầu không thấy kết tủa. Dung dịch X chứa chất tan A. dư thu được 0.4g.95g.1s22s22p63s23p2.6. 85 .4.4g X gồm Al. D. 1. 41. Tổng khối lượng các ion trong dung dịch X là A. 1s22s22p63s2. Fe(NO3)2. Fe. B. Câu 6. Câu 6. B. 0.15g hỗn hợp X gồm Zn và Cu vào 140ml dung dịch AgNO3 1M. B.1s22s22p63s23p1.Fe(NO3)3 và HNO3 D. 10. NH4+. 58.Câu 6.6g.84 Cho 21g hỗn hợp 2 kim loại K và Al hoà tan hoàn toàn trong nước được dung dịch X.4 C. Số gam K là A.32g kết tủa.8. Fe(NO3)2 và Fe(NO3)3 C. .4. Chấm dứt phản ứng thu được dung dịch X.83 Nung 6.97%.12.Fe(NO3)2.88 Cho dung dịch X chứa các ion Mg2+. B. R có hoá trị II. 2 C. NO và còn dư Fe.96g chất rắn và hỗn hợp khí X. 7.89 Cho 5.56g. Cl-. Câu 6. đến khi kết tủa hoàn toàn thì cần 400ml dung dịch HCl.03%. C. Giá trị của a là A. D. 3 D. Thêm từ từ dung dịch HCl 1M vào X. 1.Thí nghiệm 2: X tác dụng với dung dịch BaCl2 dư thu được 9. C. Dẫn từ từ toàn bộ Y vào ống chứa bột CuO dư. Hấp thụ hoàn toàn X vào nước được 300ml dung dịch Y. 0. 0.90 Nguyên tố R có tổng số hạt (p.2g.6g hỗn hợp chất rắn. 0. 4 Câu 6. e) là 40.32g.87 Khuấy đều một lượng bột Fe và Fe3O4 vào dung dịch HNO3 loãng. 2. D. Sau khi phản ứng xong được 15.Thí nghiệm 1: X tác dụng với dung dịch NaOH dư.85 Cho 23.58g Cu(NO3)2 trong bình kín. HNO3 Câu 6.06 mol khí. nóng. Fe(NO3)3.08%. 6.675 mol SO2. cấu hình electron của R là A.4g X tác dụng với dung dịch H2SO4 loãng dư thu được khí Y. C. B.2 Câu 6. Cu tác dụng với dung dịch H 2SO4 đặc.4 mol O2 thu được 64. 5.16g kết tủa và 0. B. 5. Câu 6.3 mol Mg phản ứng hết với hỗn hợp Y (vừa đủ) gồm b mol Cl2 và 0. sau một thời gian thu được 4.3 D.86 Hỗn hợp X gồm a mol Al và 0. D. 3.8.89%. SO42-. 15. . 23. nung nóng thấy khối lượng chất rắn trong ống giảm 7. 1 B. Nếu cho 23.2g so với ban đầu. pH của dung dịch Y là A. n. Thành phần % theo khối lượng của Al trong X là A.11g.6 B. đun nóng thu được 1.76g hỗn hợp 2 kim loại và dung dịch Y. 1s22s22p63s23p3. 35. C.22g. D.

NH3.96 Cho x mol CO2 hấp thụ hoàn toàn vào 200ml dung dịch hỗn hợp gồm KOH 1M và Ba(OH)2 0.92 Cation X2+ và anion Y2. NaOH. B. O.97 Thứ tự pH theo chiều tăng dần các dung dịch có cùng nồng độ mol của NH 3. 1s22s22p2. Ba(OH)2.5g CuCl2 và 14.75M thu được 23. e) trong 2 nguyên tử kim loại X và Y là 142.9g KCl có màng ngăn và địên cực trơ mất 2 giờ. 1M.1A.9M. khi đó khối lượng cực âm tăng thêm 3. Al và Fe.12 C. C. Giá trị của x là A.75M. B. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 43 hạt.100 Điện phân 100ml một dung dịch có hoà tan 13. NaOH. cần dùng 100ml dung dịch H2S 0. 0. X và Y lần lượt là A. 0. D. Ba(OH)2. Ba(OH)2.9M. Câu 6. NH3. D.2M. Nồng độ mol/l của dung dịch HCl là A. 0. Z = 8).64g kết tủa. O. cường độ dòng điện là 5. 1s22s22p63s23p3. B. 0.5M D. [ KOH] = 0. 2 2 6 2 4 C.99 Điện phân 200ml dung dịch có chứa 2 muối là Cu(NO3)2 và AgNO3 với cường độ dòng điện là 0. D. Ca và Fe. NaOH. B. NaOH. n. O (A = 16. D. X và Y lần lượt là A. O.[KCldư] = 0. NH3.62g Al trong 280ml dung dịch HNO3 1M thu được dung dịch X và khí NO (sản phẩm khử duy nhất).Câu 6.35g hai kim loại kiềm thuộc 2 chu kì liên tiếp vào 500ml dung dịch HCl được dung dịch Y và 2.3M B. Vậy X có cấu hình electron là A. nguyên tử của nguyên tố Y có tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện của X là 8.35M.95 Tổng số hạt (p.8 lít khí H2 (đktc).93 Hoà tan hoàn toàn 1. FeCl3. Câu 6.12 hoặc 0.804A đến khi bọt khí bắt đầu thoát ra ở cực âm thì mất 2 giờ. 86 . Be. Câu 6. NaOH.[KCldư] = 0. Mg và Fe. Biết H (A = 1. B. 0. 1s22s22p63s23p63d64s2. O. Ba. NH3. [ KOH] = 0. 3M Câu 6.94 Cho ion HXO3-.90.18M. Câu 6. C.9M. Nồng độ mol/l của dung dịch CuSO4 ban đầu là A.56g chất kết tủa. 0. Z = 1). 0. Ba(OH)2 là A. NaCl. 0.91 Nguyên tử của nguyên tố X có tổng số electron trong các phân lớp p là 7. D.88 D.98 Sau một thời gian điện phân 200ml dung dịch CuSO4 với điện cực trơ. Câu 6.đều có cấu hình electron ở phân lớp ngoài cùng là 2p 6. trong đó tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện là 42 hạt. 0. B. Ca. AlCl3. Công thức hoá học của hợp chất tạo bởi X và Y là A. Khi trộn dung dịch X vào dung dịch Y tạo thành 1.5M. Nồng độ mol/l của dung dịch CuSO4 trước điện phân là A.52M. Ba(OH)2. MgCl2. 0. 0. 1.1M. D.[ KOH] = 0.1M. Số hạt mang điện của nguyên tử Y nhiều hơn X là 12 hạt. C. Tổng các hạt trong ion đó là 123. 3. C. B. B.12 hoặc 0. B. Mặt khác cho 7. khối lượng dung dịch giảm 8g.9M. Câu 6. Câu 6. Mg. Nồng độ mol các chất có trong dung dịch sau điện phân đã được pha loãng cho đủ 200ml là A. Câu 6. C. 0.15M C. Để kết tủa hết ion Cu2+ còn lại trong dung dịch sau điện phân. C. D.44g. Fe và Cu. D. 1s 2s 2p 3s 3p . C.02M.[ KOH] = 0.275M.38.

39 6.43 6.82 6. ZnO.97 6. D.8g.98 6. Nhỏ từ từ dung dịch KMnO4 0.23 6.104 Khử 4.38 6. Kết quả về khối lượng: lá (1) tăng 1. 88%.80 A B A A C A A A B A 6.29 6.57 6.37 6.33 6.016 lít khí H2 (đktc). 1.59 6. B.24 6. Khối lượng Fe trong hỗn hợp là A. Câu 6. Fe 2O3 tác dụng với CO dư ở nhiệt độ cao thu được 3. D.61 6. lá (2) tăng 8.44 6. Nhúng lá (1) vào dung dịch CuCl2. Kết quả về khối lượng : lá (1) tăng 19%.78 6.74 6.42 6.5 A 6.95 6.34 6.94 6.103 Cho một cây đinh thép nặng 1.84 6.46 6.49 6.99 6.52 6.103 6. thu được chất rắn và dung dịch X.45 6.77 6.25 6. Công thức hoá học của oxit kim loại là A.20 A B C C A A D A B A 6.21 6.56 6.8g một oxit của kim loại trong dãy điện hoá ở nhiệt độ cao.68g. cần 2. C. Fe3O4. B. lá (2) vào dung dịch CdCl2 đến khi thấy số mol CuCl2 và CdCl2 trong hai dung dịch giảm như nhau thì nhấc ra. B.76 6.50 D A B C B B A A B A 6.48 6.18 6.1M vào X đến khi dung dịch X bắt đầu có màu hồng.19 6. FeO. Lấy 2 lá kim loại M có khối lượng bằng nhau.75 6.1 D 6. C.104 6.60 C B A D D D A B C D 6. CuO.72 6.41 6.6g. B.93 6.Câu 6. Mg. Cũng lượng hỗn hợp trên ngâm trong dung dịch CuSO4 dư thì khối lượng chất rắn thu được là 4.47 6.55 6.65 6.83 6.71 6. Fe.89 6. Zn. Câu 6.58 6.102 M là kim loại hoá trị II.14 6.27 6. Nhúng lá (1) vào dung dịch Pb(NO3)2.53 6. Câu 6.63 6. C. thấy đã dùng hết 40ml dung dịch KMnO4.26 6. Kim loại thu được đem hoà tan trong dung dịch HCl thu được 1.2 %.51 6. B.16 6.14g vào dung dịch H 2SO4 loãng dư.69 6.4% so với ban đầu.105 A A A A A 87 . ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VI 6.10 D A 6.92g Fe.68 6. Cu.73 6. 90%. Cu. Mg.66 6.344 lít H2 (đktc). 49.100 A C A C A A A B B A 6.79 6.44g.101 M là kim loại hoá trị II.81 6.2 D 6.2%.92 6.91 6. 16.96 6.101 6.86 6.54 6.6% so với ban đầu.102 6.85 6.96g.4 A 6.11 6.8 B 6. C.1%.30 A C C C C B A A B C 6. Lấy 2 lá kim loại M có khối lượng bằng nhau.87 6.88 6. D.36 6. D.15 6.13 6. 1. lá (2) vào dung dịch Cu(NO 3)2 đến khi thấy số mol Pb(NO3)2 và Cu(NO3)2 trong hai dung dịch giảm như nhau thì nhấc ra.70 A A D A B C D D B A 6. C.9 6.17 6.22 6.64 6.72g hỗn hợp bột các chất Fe. D.35 6. 98. M là A. Cd.12 6.7 B 6.62 6. %Fe trong đinh thép là A. Zn .105 4. Fe2O3 .40 A D C B A C C A A C 6.3 A 6.90 C A A A A A A B B B 6.32 6.28 6.31 6.67 6.6 A 6. Câu 6. 1. M là A. lá (2) giảm 9.

Oxit và hiđroxit có lưỡng tính. 0 0 0 0 .Thế điện cực chuẩn E Cr3+ /Cr = -0. E Fe2+ /Fe = -0. 2. Sơ đồ minh hoạ tính chất hoá học của crom + O . Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 . Số oxi hoá +3 Số oxi hoá +6 . t0 2 Nước CrCl3 (r) + Cl +Zn 2 +(O +H O) 2 2 H2CrO47 H2Cr2O Cr HCl H2SO4(l) Cr (dd) Axit Cr(OH)2 +2 Cr +3 +Br (dd) +SO2. . CROM − SẮT − ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Số oxi hoá +3 .44V.Cấu hình electron nguyên tử Cr : [Ar]3d54s1.Oxit và hiđroxit có tính bazơ.Tính oxi hoá.34V. 4. Fe : [Ar]3d64s2. . .CHƯƠNG VII.77V.2 KI Cr +6 (dd) Kiềm Axit Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 . .Tính khử và tính oxi hoá. . tính axit.Oxit và hiđroxit có tính bazơ. Cu : [Ar]3d104s1.Oxit và hiđroxit có tính .Tính khử.Oxit và hiđroxit có tính bazơ.74V.Tính oxi hoá. E Fe3+ /Fe2+ = 0.Tính khử. E Cu 2+ /Cu = 0. t0 2 Cr2O3 (r) + NH 3 CrO3 + bột Al + Cl . 3. Sơ đồ minh hoạ tính chất hoá học đồng + + 88 . Crom − Sắt − Đồng .

Fe + S  FeS. 5.Tính oxi hoá. Sơ lược về các kim loại Ag. Au. 5. → 7. 2Fe + 6H2SO4 đặc  Fe2(SO4)3 + 3SO2 + 6H2O. Fe + H2SO4 loãng  → FeSO4 + H2.Bình Au Zn +2 Zn2+/Zn -0. 2Fe + 3Cl2  2FeCl3. HNO3. → 0 t 3. +3 (+3) Au3+/Au Ni2+/Ni +1. +4 Pb2+/Pb -0. AgNO3 Cu2+ (dd) H + Kết tinh CuSO4.5H2O Cu(NO3)2. → 4. 3Fe + 2O2  Fe3O4. t Không khi ẩm Khí Clo khô t0 CuCO3.5 -0. H2SO4 đ dd FeCl3.Oxit và hiđroxit có tính bazơ. Sn.76 Mạnh Sn +2.13 Yếu B . NH .08 Rất yếu Ni +2. +1. Fe + 6HNO3 đặc  → Fe(NO3)3 + 3NO2 + 3H2O. 8. 89 . Pb Số oxi hoá Eo(V) Tính khử Ag +1.[Cu(NH3)4]2+ NH3 Cu(OH)2 OH - H + HCl + O2. t 0 CuO (đen) 3 Cu2O (đỏ) Chất khử CO.3H2O Không khí. . t0 6. (+2) Ag+/Ag +0.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) t0 1. +4 Sn2+/Sn -0. Fe + 2HCl  → FeCl2 + H2. → t0 2.14 Yếu Pb +2.26 Rất yếu T. 10000C Cu 0 Không khí. Ni. Zn.Cu(OH)2 (r) CuCl2 (r) Số oxi hoá +2 . Fe + 4HNO3 loãng  → Fe(NO3)3 + NO + 2H2O.

2FeCl3 + Fe  → 3FeCl2. → 0 t 2FeO + 4H2SO4 đặc  Fe2(SO4)3 + SO2 + 4H2O. t0 FeO + CO  Fe + CO2. 10. t0 2Fe(OH)3  Fe2O3 + 3H2O. 32. → t0 4Cr + 3O2  2Cr2O3. 31.. 90 Fe (dư) + HNO3  → Fe(NO3)2 + . 33. → . 12. 30. FeO + 2HCl  → FeCl2 + H2O. 38. FeCl3 + 3NaOH  → Fe(OH)3 + 3NaCl. 19.. 26.. 15.. 17. 2FeS2 + 14H2SO4  → Fe2(SO4)3 + 15SO2 + 14H2O. 10FeSO4 + 2KMnO4 + 8H2SO4  → 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. → t0 2Cr + 3S  Cr2S3. 29. 4Fe(OH)2 + O2 + 2H2O  → 4Fe(OH)3. Fe2O3 + 6HCl  → 2FeCl3 + 3H2O. 41. 28.. → Fe(OH)2 + 2HCl  → FeCl2 + 2H2O. 35. 21. Fe + 2AgNO3  → Fe(NO3)2 + 2Ag. 22.. 20. Fe + CuSO4  → FeSO4 + Cu. 2FeCl2 + Cl2  → 2FeCl3. 23. 39. → t0 Fe2O3 + CO  2FeO + CO2. >5700 C Fe + H2O → FeO + H2. t0 4FeS2 + 11O2  2Fe2O3 + 8SO2. 44.. → 0 t Fe2O3 + 3CO  2Fe + 3CO2. 43. 11. 34. 13. 0 t 3Fe2O3 + CO  2Fe3O4 + CO2. 37. Fe (dư) + H2SO4 (đặc)  → FeSO4 + . 14. 36. 16. <5700 C 3Fe + 4H2O → Fe3O4 + 4H2. 27. 2FeCl3 + Cu  → 2FeCl2 + CuCl2. → Fe2O3 + 3H2SO4 loãng  → Fe2(SO4)3 + 3H2O. 25. Fe(OH)2 + H2SO4  → FeSO4 + 2H2O. Fe2O3 + 3H2SO4  → Fe2(SO4)3 + 3H2O.9. 24... 2FeCl3 + 2KI  → 2FeCl2 + 2KCl + I2. Fe + 3AgNO3 (dư)  → Fe(NO3)3 + . t0 3FeO + 10HNO3 đặc  3Fe(NO3)3 + NO + 5H2O. → 2Fe(OH)3 + 3H2SO4  → Fe2(SO4)3 + 6H2O. → FeO + H2SO4 loãng  → FeSO4 + H2O. 40. → 0 t 2Cr + 3Cl2  2CrCl3. Fe(OH)3 + 3HCl  → FeCl3 + 3H2O. 42. 18.. FeCl2 + 2NaOH  → Fe(OH)2 + 2NaCl..

→ t0 2Na2Cr2O7  2Na2O + 2Cr2O3 + 3O2. Cr2O3 + 3H2SO4  → Cr2(SO4)3 + 3H2O.45. 62. CrCl2 + 2NaOH  → Cr(OH)2 + 2NaCl. 2CrCl3 + 3Cl2 + 16NaOH  → 2Na2CrO4 + 12NaCl + 8H2O. 68. 76. 78. 69. Cr(OH)3 + 3HCl  → CrCl3 + 3H2O. 73. 0 t (NH4)2Cr2O7  Cr2O3 + N2 + 4H2O. → >1000 C 2CrO + O2  2Cr2O3. K2Cr2O7+6KI+7H2SO4  Cr2(SO4)3+4K2SO4+3I2+7H2O. Cr + H2SO4  → CrSO4 + H2. 57. CrCl3 + 3NaOH  → Cr(OH)3 + 3NaCl. → 2CrO3 + 2NH3  → Cr2O3 + N2 + 3H2O. 75. 54. → 91 . 64. Cr + 2HCl  → CrCl2 + H2. → K2Cr2O7 + 6FeSO4 + 7H2SO4  → 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. Cr(OH)3 + NaOH  → Na[Cr(OH)4] (hay NaCrO2). 79. 2Cr + 3SnCl2  → 2CrCl3 + 3Sn. 53. 4CrCl2 + O2 + 4HCl  → 4CrCl3 + 2H2O. 2CrCl2 + Cl2  → 2CrCl3. 2CrO3 + H2O  → H2Cr2O7. 61. Na2Cr2O7 + S  → Na2SO4 + Cr2O3. 60. 2NaCrO2 + 3Br2 + 8NaOH  → 2Na2CrO4 + 6NaBr +4H2O 2Na2Cr2O7 + 3C  → 2Na2CO3 + CO2 + 2Cr2O3. 2Cr2O3 + 8NaOH + 3O2  → 4Na2CrO4 + 4H2O. 48. K2Cr2O7 + 3K2SO3 + 4H2SO4  → Cr2(SO4)3 + 4K2SO4 + 4H2O. 47. 50. 71. 56. K2Cr2O7 + 3H2S + 4H2SO4  → Cr2(SO4)3 +3S + K2SO4 + 7H2O. 67. → Cr(OH)2 + 2HCl  → CrCl2 + 2H2O. 74. 77. Na2Cr2O7 + 14HCl  → 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 0 t Cu + Cl2  CuCl2. 51. 55. 2CrCl3 + Zn  → ZnCl2 + 2CrCl2. 49. → CrO3 + H2O  → H2CrO4. 66. 65. 0 t Cr2O3 + 2Al  2Cr + Al2O3. 4200 C 4CrO3  2Cr2O3 + 3O2. 59. 72. 80. 52. 58. to 4Cr(OH)2 + O2 + 2H2O  4Cr(OH)3. → t0 2Cu + O2  2CuO. 63. 70. → CrO + 2HCl  → CrCl2 + H2O. → 2Na2CrO4 + H2SO4  → Na2Cr2O7 + Na2SO4 + H2O. o t 2Cr(OH)3  Cr2O3 + 3H2O. 46.

3Cu + 8HNO3 loãng  → 3Cu(NO3)2 + 2NO + 4H2O. CuO + H2SO4  → CuSO4 + H2O. 111. 83. → 0 t Ni + Cl2  NiCl2. 96. 3Cu + 8NaNO3 + 4H2SO4  → 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. → t0 CuO + Cu  Cu2O. 85. 89. 97. Cu(OH)2 + 2HCl  → CuCl2 + 2H2O. → Cu2O + H2SO4 loãng  → CuSO4 + Cu + H2O. t0 Sn + O2  SnO2. 104. → ñieä phaâ dung dò n n ch 2Cu(NO3)2 + 2H2O  2Cu + 4HNO3 + O2. 99. CuS + 4H2SO4 đặc  → CuSO4 + 4SO2 + 4H2O. → CuS + 2AgNO3  → 2AgS + Cu(NO3)2. → t0 Zn + Cl2  ZnCl2. 0 t Cu(OH)2  CuO + H2O. → 0 . 82. 91. 101. → ñieä phaâ dung dò n n ch CuCl2  Cu + Cl2. 112. 114. 86. → Cu + 2H2SO4 đặc  → CuSO4 + SO2 + 2H2O. 106. CuO + 2HCl  → CuCl2 + H2O.81. 109. 2Cu + 4HCl + O2  → 2CuCl2 + 2H2O. → 0 t CuCO3. Cu(OH)2 + H2SO4  → CuSO4 + 2H2O. 110. 0 t 2Cu(NO3)2  2CuO + 2NO2 + 3O2. 84. 88. → t0 Zn + O2  2ZnO. 90. 0 t CuO + H2  Cu + H2O. → t0 3CuO + 2NH3  N2 + 3Cu + 3H2O. 107. 92. → ñieä phaâ dung dò n n ch 2CuSO4 + 2H2O  2Cu + 2H2SO4 + O2. 105. 103. → t0 Pb + S  PbS. → 3Pb + 8HNO3 loãng  → 3Pb(NO3)2 + 2NO + 4H2O. Sn + 2HCl  → SnCl2 + H2. → 0 t 2Pb + O2  2PbO. 116. Cu + 2AgNO3  → Cu(NO3)2 + 2Ag.Cu(OH)2  2CuO + CO2 + H2O. 108. Cu + 4HNO3 đặc  → Cu(NO3)2 + 2NO2 + 2H2O. 102. 113. 93. Cu + 2FeCl3  → CuCl2 + 2FeCl2. 87. 5000 C 2Ni + O2  2NiO. 115. 98. → Cu(OH)2 + 4NH3  → [Cu(NH3)4]2+ + 2OH-. 95. 94. 92 t Cu + S  CuS. → 0 t Zn + S  ZnS. → t0 CuO + CO  Cu + CO2. 100.

D. − 5Sn 2+ + 2 MnO4 + 16 H + → 5Sn4+ + 2 Mn2+ + 8 H2 O. Ag. B.khử phức tạp. 123. B. Phản ứng phân huỷ không phải là oxi hoá. C. Hg. B. O2. Đó là muối nào sau đây ? A.117. Cr2O3. 9 C. +6. +6. +2.khử. Cấu hình electron của ion Cu2+ là A.5 Khi nung Na2Cr2O7 thu được Na2O. Xiđerit. +3. [Ar]3d8. +1.khử. [Ar]3d7. [Ar]3d . Câu 7. Ba. Manhetit. +6. MgSO4. Mg. [Ar]3d3. [Ar]3d .khử nội phân tử. Zn(OH)2. 4 C. C. Câu 7. Ag + 2HNO3(đặc)  → AgNO3 + NO2 + H2O. C. D. 120. ZnO. D. Câu 7. Câu 7. 121. 124. D. Mg. 118. B. D. B. Phản ứng oxi hoá. +2.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 7. B. +4. [Ar]3d5. Na. D.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ? A. Ba. Fe. Ag. Câu 7. D. +2. [Ar]3d10. Phản ứng trên thuộc loại phản ứng nào sau đây ? A. Câu 7. Câu 7. Na. CaSO4. Ag2O + H2O2  → 2Ag + H2O + O2. 2Ag + O3  → Ag2O + O2. 119. B.2 Cấu hình electron nào sau đây là của ion Fe3+ ? A. C. ZnSO4. t0 2AgNO3  2Ag + 2NO2 + O2. B. Câu 7. Phản ứng tự oxi hoá. Hematit. [Ar]3d6.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ? 93 . C. D. Pirit sắt. Na.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư. C. → Au +HNO3 + 3HCl  → AuCl3 + 2H2O + NO. → ñieä phaâ dung dò n n ch 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2. 2Ag + 2H2S + O2  → 2Ag2S + 2H2O.6.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ? A. +6. Zn(HCO3)2. MnSO4.4 Các số oxi hoá đặc trưng của crom là ? A. C . +4. +4. Mg. 122. Phản ứng oxi hoá. +3. ZnSO4.7 Hợp chất nào sau đây không có tính chất lưỡng tính ? A.

H2SO4 loãng. C đều đúng. Không thay đổi. Chất có phần trăm khối lượng sắt nhỏ nhất là………… Câu 7. dung dịch H2SO4.12 Cho biết câu nào không đúng trong các câu sau: A. Crom là kim loại có tính khử mạnh hơn sắt. Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan.. Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy. FeS2(5).. Al-Cu. Tăng lên. D. Cu có khả năng tan trong dung dịch FeCl3. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2. Mối liên hệ giữa m1 và m2 là A. b. NO2. C. C. Chất có phần trăm khối lượng sắt lớn nhất là………… b. dung dịch AgNO3.15 Cho biết câu sai trong các câu sau : A.13 Có 2 lá sắt khối lượng bằng nhau. người ta thường cho vào đó : A.10 Phân biệt 3 mẫu hợp kim sau : Al-Fe. B. Cu2S(4). B. B. C. B.5H2O(6). Dung dịch : KOH. D. Cu-Fe bằng phương pháp hoá học. Lá 2 đốt trong khí clo dư thu được m2g muối. B. Không xác định được. B. a.17 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất: CuO(1). HCl. NH3.. C. Chất có % khối lượng đồng lớn nhất là……………. Hoá chất cần dùng là : A. Câu 7. Câu 7. Câu 7. sắt kim loại.A. Fe có khả năng tan trong dung dịch FeCl3. D. FeS(4). Câu 7. Câu 7. để bảo quản dung dịch muối sắt (II).11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ? A. Dung dịch : NaOH. B. CuSO4(5). CuS(3). N2O. NO. Fe2O3(2). D. m1>m2. C. Fe3O4(3).16 Trong phòng thí nghiệm. Fe2(SO4)3(7). dung dịch HCl.14 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất : FeO(1). Câu 7. Cả A. FeSO4(6). HNO3 đặc nguội. c. CrO là oxít bazơ. Các chất có % khối lượng đồng bằng nhau là……………. D. B. Giảm đi. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép. a. C. D. Chất có % khối lượng đồng nhỏ nhất là……………. Câu 7. m1=m2. FeSO3(8). Ag có khả năng tan trong dung dịch FeCl3. Câu 7. D. Cu2O(2). m2>m1. Kim loại Cr có thể cắt được thuỷ tinh. dung dịch NaOH.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau : 94 . CuSO4. C.

B.16.36 lít. 0. 54. B. Câu 7. D. Câu 7. 3. FeCl2. 10. 0. Fe. Cu có thể tan trong dung dịch AlCl3. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư. D. 3 C.68. Câu 7. 2. 1.36.6g. Câu 7. Trong hỗn hợp A mỗi oxit đều có 0. Câu 7.A. HCl.672 lít. D. Ngâm lá kẽm vào dung dịch. Cho AgNO3 vào dung dịch.0896 lít. C.52g một kim loại tác dụng hết với H2SO4 loãng.27 Hỗn hợp A gồm FeO.19.3584 lít. sau một thời gian lấy đinh sắt ra. 4. 3. 0. Fe3O4. Thể tích khí (ở đktc) là A.84g muối sunfat. C. Cu có thể tan trong dung dịch FeCl2. D. CuSO4 có thể dùng làm khô khí NH3.36.22 Cho 2.16. C. chia làm 2 phần bằng nhau. 0.448 lít. B. 0.999g. 3. xăng.92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0. HCl.7H2O có khối lượng là 55. FeCl3. 0. Khối lượng sắt tham gia phản ứng là bao nhiêu ? A. 1.84. M (trong 5. Khối lượng của hỗn hợp A là bao nhiêu gam ? 95 . C. HCl. FeCl3. Đốt cháy hết phần 2 trong oxi thu được 4.16 lít.36.3999g .20 Cấu hình electron của Cr3+ là phương án nào ? A. dung dịch thu được cho bay hơi được tinh thể FeSO4. C. số gam của Fe. [Ar]3d2. B.016 lít hiđro (đktc). Zn.52g hỗn hợp A) lần lượt là A. FeCl2. Kim loại đó là kim loại nào ? A. B. C.4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15. D. [Ar]3d .48 lít.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi. [Ar]3d5.2857g. Chọn câu đúng trong các câu sau : A. Khối lượng mol của M. Câu 7.252g. 8. Ngâm lá đồng vào dung dịch. Dung dịch thu được sau phản ứng gồm các chất A. B. Câu 7. Câu 7. 27.100g. C. Al. 18. C.23 Cho 1.16. FeCl2. 7. D.16M và H2SO4 0. 2. D.5 mol.24 Lấy 5. 2.26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO 4.33 lít. 2. B. Fe2O3. Ngâm lá sắt vào dung dịch. Mg. sấy khô. FeCl3.25 Cho Fe tác dụng với dung dịch H2SO4 loãng. thu được 6. 27.36g hỗn hợp gồm Fe3O4 và oxit của M. Câu 7. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ? A. CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả. Phần 1 tác dụng hết với dung dịch HCl thu được 2. cân nặng 4. D. 3.52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi. [Ar]3d4. D. B. B.

Na2Cr2O7 còn dư 0. 88. B. 3. C. 54. Câu 7. ZnO. C. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO 4 96 . Cu. 35. D. Đáp số khác. Na2Cr2O7 còn dư 1 mol. Câu 7.1M. 21.36 Cho 1. Hoà tan chất rắn X trên vào dung dịch HNO3 0. 50.31 Một thanh đồng nặng 140. D. C.5M thu được 448 ml khí NO (đktc).2 g/ml) đã tác dụng với thanh đồng là A. C. Câu 7. C. B.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%.32 Cho 19.52g. Giá trị của m là A. 25. 25. B. Câu 7. 10.8 lít. 232. 22.2g kim loại M tác dụng với dung dịch HNO3 loãng. Cr2O3 và 48g oxi.69.48 lít khí duy nhất NO (đktc).65. Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là A.405g hỗn hợp Fe2O3.8g đồng trong không khí thu được chất rắn X. Khối lượng muối sunfat khan thu được là A. 0.2. M là kim loại nào ? A. 30. Na2Cr2O7 đã hết. Hoà tan chất rắn X trên vào dung dịch HNO3 0. D. 464. D. 177 lít. Phản ứng này không thể xảy ra.56. C. Khối lượng kết tủa thu được là bao nhiêu gam ? A.24 lít. B.08g. Vậy: A.04 lít. B. Zn. B. C. 88. C.34 Đốt 12.35 Đốt 12.5M thu được 448 ml khí NO (đktc). B. 22. C. 21. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư. Đáp số khác.12 lít. C.405g D. D. dư thu được 4. 20. 0. Thể tích dung dịch AgNO3 32% (D=1. Câu 7.36 lít. Câu 7.68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra.4. 1. 3. D. 116. 16g. CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0. Câu 7. Khối lượng chất rắn X là A.8g đồng trong không khí thu được chất rắn X. 177 ml. B. B. B.A. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ? A.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O.33 Cho 7. 0.8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171. Câu 7. C.65.84 lít. 0. Fe.56.9333 lít D. 15. 2.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H 2SO4 loãng thu được 560ml khí ở đktc.5 ml.5 mol. Mg.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao.5 lít.2g. Câu 7. Biết hiệu suất của quá trình 96%. D. Câu 7. 15.

48 lít NO (đktc). sắt. 15%. 11. Fe. Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38. Có bao nhiêu gam Cu đã bám vào thanh sắt ? A.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra.448 lít khí (đktc).41 Hỗn hợp X gồm Cu và Fe. C. sau một thời gian lấy thanh sắt ra rửa sạch.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e. Mặt khác. FeO. C.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32.36 lít. 28g. 85%.72 lít (đktc).38 Khử 2. Câu 7.2. B. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là A. C. 70%. 1. cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1.8g. D. Nguyên tố X là A.24 lít. C. 4. 3. 9. sấy khô thấy khối lượng tăng 1. B.4g.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X. 60g.76g chất rắn. Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là A. Câu 7. D. 14g. 2. 60. 5%. D. Zn. D.24% khối lượng. D.4g. D. Giá trị của V là bao nhiêu ? A. 4%. C.12 lít. B.8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra.48 lít. Cu.8g. Câu 7. Sau phản ứng thu được 1. 75%. 12%.5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6. 2. brom. 19.2g. Các khí đo ở đktc. nếu sục thật 97 . trong đó Cu chiếm 43. 84%. 10.5g. B.5g. Fe2O3. Thành phần phần trăm của Fe. Câu 7.8. 83%. 3.6. 80%. crom. Al. Hiệu suất của phản ứng khử CuO là A. 55. Câu 7. D. B. Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4.8 lít khí. Cr và Al trong hợp kim lần lượt là A. Câu 7. Không xác định được. 4%.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X. 50g. C. Câu 7.2g. 4. 2. 2.05%. Cho 14.95%. B. 32g. p.40 Cho 100g hợp kim gồm có Fe.4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1.43 Nhúng thanh sắt vào dung dịch CuSO4. 84%. 4.8g. Tên của kim loại đã dùng là A. 1. B. 80%. Câu 7. D. D. 13%.thì thu được một chất rắn. n) là 82. C. Fe3O4. C. đem hoà tan vào dung dịch HCl thấy bay ra 0.4. Đáp số khác. B. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22. B. Câu 7. 1. C photpho.98 lít khí. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4. Oxit sắt đó là ? A.

12 lít.53 Khử 9.6g. C. Câu 7.42%.36 lít. B. FeCl2.54 Hoà tan hoàn toàn 19.72 lít. 4.88g nước. 4. Thể tích hiđro đã dùng (170C và 725mmHg) là A. D. B. Không xác định được. B. 0.72 lít. C. B. 0.48 lít. D. C. 3.4g. B.25g sắt clorua tác dụng với dung dịch AgNO 3 dư tạo ra 8.672 lít.8 at) thoát ra. C. Fe3O4 thấy có 4.36 lít. B.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí.64g. chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO 3. Câu 7. Câu 7. 5. 3. FeCl3. C. Câu 7. 69.4%. Thể tích CO (đktc) đã dùng là A. FeCl2. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là A. Câu 7. FeCl3.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư. Cả FeCl2 và FeCl3.89g.4 lít. 4.2g. Công thức của muối sắt đã dùng là A.48 lít. 2.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO 3 tạo ra 2. Công thức của muối sắt là A. nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6. 0. 9g. D. 16g. D.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH. C. 3.6492 g AgCl. Thành phần phần trăm cacbon trong mẫu thép là A. Câu 7. D. B. nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26. C.24 lít. D. 6.61g kết tủa trắng. Câu 7.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao. 69. Cả FeCl2 và FeCl3.48 lít khí CO2 (đktc) thoát ra.47 Một dung dịch có hoà tan 3. Câu 7.24 lít. B. 5. Sau khi phản ứng kết thúc. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3. Fe2O3.196 lít khí CO2 (0oC và 0. 2. B. Không xác định được.6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao. thấy có 0. 27g. 46. thu được sắt và 2.84%. 22. 6. C.88 lít hiđro (đktc).584 lít. 6. Đáp số khác. C. Đáp số khác. 27g.0053 lít.92g. Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là A. Thể tích CO (đktc) đã tham gia phản ứng là A. thu được chất rắn có khối lượng 11. D. 1. 4 lít. 8.chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m 1 + 1. D. m có giá trị là A.48 lít.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO.72 lít hiđro (đktc). 0.42)g muối khan. 6. D. sau đó làm bay hơi 98 . Những chất còn lại sau phản ứng. Câu 7.2g Cu vào dung dịch HNO3 loãng. 42g.6g.08g.

68%. 0. . 68%. D. Cho NaOH vào Y. 8. 0.448 lít khí không màu hoá nâu trong không khí (đo ở đktc). C. Các khí đo ở đktc. thu được chất rắn có khối lượng là 0. 4. Câu 7. thu được 336ml hiđro. 40.4g. D. B.02. D. B. 4. C. 60%. thu được kết tủa Z. kim loại Ag. Câu 7. Đáp số khác. 2. B. Không đủ cơ sở để so sánh. B. muối này chuyển thành muối cromat.61 Để khử ion Fe3+ trong dung dịch thành ion Fe2+ có thể dùng một lượng dư A. Fe và Ni. Khối lượng muối khan thu được sau phản ứng là A. thu được 560ml hiđro. Phần trăm về khối lượng của đồng. còn hợp chất Cr(VI) có tính oxi hoá mạnh. B.01. 3.01. Câu 7. Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc). 32%. 64. sắt và đồng thành 2 phần đều nhau. II – BÀI TẬP NÂNG CAO Câu 7. 0. 40%. V1=V2. 3 và 3. Hợp chất Cr(II) có tính khử đặc trưng. 32%. kim loại Ba.Phần 2 : tác dụng với lượng dư dung dịch NaOH. D.72g.1 mol Fe3O4. thu được dung dịch Y.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V 1 lít khí (đktc).02. Mối liên hệ giữa V1 và V2 là A.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb. . C. Lọc lấy kết tủa. Câu 7. C. Câu 7. V1>V2. D. C. B.59 Cho sơ đồ phản ứng sau : Cu + HNO3  → muối + NO + nước.02. B. 2. 32.84g. kim loại Mg. 3 và 8. Câu 7. kim loại Cu.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO 3 thấy thoát ra 0. số cặp kim loại trong đó Fe bị phá huỷ trước là A. nhôm trong hợp kim lần lượt là A. Fe trong 4g hỗn hợp lần lượt là: A.4g. 0. D. 48. 60%.01.63 Chỉ ra câu đúng trong các câu sau : 1. Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là A. Câu 7. V1<V2. C. C. D. 40%.58 Chia 4g hỗn hợp bột kim loại gồm nhôm. Thêm dung dịch kiềm vào muối đicromat. Đáp số khác.dung dịch và đun nóng. 0. Khi nhúng các cặp kim loại trên vào dung dịch axit. 5. C. rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn.Phần 1 : tác dụng với lượng dư dung dịch HCl. B. Fe và Sn. 3 và 6.57 Chất rắn X gồm 0. 1. D.1 mol Fe2O3 và 0. 99 . Giá trị của m là A. Hoà tan X bằng dung dịch HCl dư. 0. Số mol của Al. 3 và 2.

chất B tác dụng với axit chuyển thành chất C có màu da cam. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy. 5. 8. D. 8. Câu 7. D.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. 2. 5. (3) X2 + Cl2 → X3. -0. Cr(OH)2 tác dụng được với dung dịch HCl còn CrO 3 tác dụng được với dung dịch NaOH. X3. Câu 7. FeCO3 lần lượt phản ứng với HNO3 đặc nóng. Crom là kim loại có tính khử mạnh hơn sắt. 7. Suất điện động chuẩn của pin điện hoá là A. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước. Khi cân bằng 2 phản ứng trên. 3. Nếu cho thêm vào một lượng KOH. C. X2.67 Cho các sơ đồ phản ứng : (1) X1 + HCl → X2 + H2. 2. Fe3O4. 0. 100 . Na2CrO4. 1. Số phản ứng thuộc loại oxi hoá. 7. Cr2O3. D. Cr(OH)2 đều có tính chất lưỡng tính. Câu 7. + (5) X4 + NaOH → X6  + NaNO3. Cr(OH)3. B. 3. 7. (4) X2 + NaOH → X5  NaCl. B và C lần lượt là : A.6 V. 4. 4. màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. D. Kim loại crom có thể cắt được thuỷ tinh. B. FeO.64 Cho từng chất Fe. hệ số của ion Cr3+ sẽ là A. 5. Công thức phân tử các chất A. KCr2O4. 8. B. (7) X5 + O2 + H2O → X6 Các chất X1.66 Dung dịch X có màu đỏ cam. C. 2. B. 6. Na2Cr2O7. 1. X6 lần lượt là X1 A B C D Cu Fe Fe Fe X2 CuCl FeCl2 FeCl3 Fe(NO3)3 X3 CuCl2 FeCl3 FeC2 FeCl3 X4 Cu(NO3)2 Fe(NO3)3 Fe(NO3)3 Fe(NO3)2 X5 CuOH Fe(OH)2 Fe(OH)2 Fe(OH)3 X6 Cu(OH)2 Fe(OH)3 Fe(OH)3 Fe(OH)2 Câu 7. C. K2CrO4. Na2Cr2O7. Các hợp chất Cr2O3. 6. Cr2O3. K2CrO4. FeSO4. H2CrO4. 1. A. 2. Dung dịch X chứa chất có công thức phân tử là A. 5. 3. 7. Cr2O3. Fe(NO3)2. Câu 7. 6. K2Cr2O7. CrO. (2) X1 + HNO3 → X4 + NO2 + H2O. Cr2O3. K2Cr2O7. Fe2(SO4)3. Nếu thêm vào đó một lượng H 2SO4. 5. 8.68 Cho sơ đồ phản ứng : Cr + Sn2+  → Cr3+ + Sn (1) Cr + Cu2+  → Cr3+ + Cu (2) a. 4. Fe(OH)3.88 V. 6. C. B.3. 8. K2CrO4. K2Cr2O7. X4. 5. Na2CrO4. C. Các hợp chất CrO. b. X5. 74 V. 3. màu của dung dịch dần dần trở lại đỏ cam. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1). B. D. Fe(NO3)3. Fe2O3. Fe(OH) 2. 3. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo. Biết 0 ECr 3+ / Cr = −0. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ. 8.khử là A.

272g. D. D. 16. 5. 139. Cho dần dần mạt sắt đến dư vào phương trình trên. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu : A.03M là A. B. 0. rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0. 74 V.464 M. B. được 500 ml dung dịch. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M. 0.9g.72.432 M. 21%. B. Tăng 22.5H2O trong nước. b. C. 1. Đáp số khác. 101 . 113. B. Đáp số khác.4 tấn. 57%. C.28 tấn. Phần trăm theo khối lượng FeSO4 tinh khiết là A.0075 mol.6 V. 0. 1. 0.4 V.8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87. Câu 7. C. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0.00075 mol. rửa nhẹ. D.5%) là : A.9g.856g.5 tấn. Câu 7. 90g. Đáp số khác.8 tấn. C.1g. được 200 cm3 dung dịch. Biết 0 ECr 3+ / Cr = −0. B.5 tấn. 1. Giảm 1. Đáp số khác. 74g.71 Khối lượng quặng chứa 92.03 M.4 V. Đáp số khác. Câu 7. B. C. lấy lá kẽm ra khỏi dung dịch. D. C. -0. 0. D. 6 tấn. B. D.82 tấn.88 V.725 M.8 V.02625g. D. B. -0.73. D. -0. Câu 7. a. 2 tấn. Suất điện động chuẩn của pin điện hoá là A.68g. a. c. 1. b. Nếu lấy quặng hematit trên đem luyện gang.856g. b. Câu 7.21g. C. D. Biết 20 cm3 dung dịch này được axit hoá bằng H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0. B. 0.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước. 0.C. 0. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2).00375 mol. B. C. D. D. C. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là A. Đáp án khác. đem cân thấy lá kẽm có khối lượng là A.1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%) A. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ? A. 3.2 tấn. Tăng 1. a. 2. 12.7%. 0. sấy khô.3265 tấn. 11. 0.69 Hoà tan 58g muối CuSO4. Sau phản ứng. C. c. 2. 0. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là A.08 V.

Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là A.56 lít (đktc) NO (là sản phẩm khử duy nhất). 2.78. 1: 5. Lấy m1g X cho vào một ống sứ chịu nhiệt.768 lít. B.04g.22.4g chất rắn X. Tính khối lượng m1. 10. 9. C.72 lít. Cho 40g hỗn hợp vàng. 1. B. Kim loại X là A. 1: 4. Hoà tan hết hỗn hợp gồm 0. D.44g.685g. CuO. Nung m g bột sắt trong oxi. 1M. thoát ra 0. 2. 2. B.24 lít. D. Câu 7. khí CO 2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH) 2 thu được m2g kết tủa trắng. C.88g.84 lít. Câu 7.5g. 20.2 mol FeS2 và 0.72 lít khí (có màu nâu đỏ) duy nhất (đktc).7.32. C.52.36 lít. Câu 7. D.344 lít hiđro (đktc) và dung dịch chứa m g muối. B. D. A. 10.3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất). 6. D. cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6. D. Fe3O4.5g. Thể tích khí CO phản ứng (đktc) là A.81. thu được 3g hỗn hợp chất rắn X. Fe2O3. Câu 7. 1: 6. 1.74.88g. 102 . Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư). D. Giá trị của V (ở đktc) là A. B.98.2M. C. 200ml.77. Ni. FeO và Fe2O3. 12.5M. FeO. Câu 7. 5. C. 127. 10. Sn. Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng.25.75. 7. 63. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư.68 lít.08g. B. Giá trị m và nồng độ dung dịch HNO3 lần lượt là A. 2.8g. 56 lít. Hoà tan hoàn toàn 3. 3. 5. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. 10.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3. Câu 7. nung nóng rồi cho một luồng khí CO đi qua. PbO bằng khí CO ở nhiệt độ cao. 10.6M. thu được 1. bạc.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4. 20. B. C. C.04g. C. 8. D. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19.62.2g gồm Fe. khối lượng chất rắn thu được giảm 4. Tỉ lệ là m2 A. B. 100ml. 1: 3. kẽm tác dụng với oxi dư nung nóng thu được 46. Cho 23. Giá trị của m là A. Câu 7. 3.08g. Giá trị của m là A. m2. sắt. 400ml. B. 20. B.22g hỗn hợp X gồm Fe. Fe3O4) với số mol bằng nhau. 0.27.12 lít.8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+. Câu 7. 300ml. 2. 10.5H2O cho m1 vào m2g dung dịch CuSO4 8%.76. Cr. Khử 16g hỗn hợp các oxit kim loại FeO. Pb.52. 10.685g D. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2.44g. 20.80.24 lít khí NO duy nhất (đktc). đồng.

Câu 7. C. Công thức của sắt oxit là A. B. HCl. 6.56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2. Mg. D.12 lít. Chưa đủ dữ kiện để xác định. 1. A. Beri Câu 7.5M và KNO3 0. 19. Câu 7.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy). Câu 7. C. D. 2. Al. 19. B. Canxi B. Zn và Fe bằng dung dịch HCl.76g kết tủa trắng.36 lít khí SO2 duy nhất (đktc). 1. 4. 2. 103 .0g C.62g chất rắn. HBr) thì thể tích H2 (đktc) thu được là A.36 lít. Zn.89 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt.85g kết tủa. 0. Al và Fe bằng dung dịch H 2SO4 loãng. 8.3g hỗn hợp kim loại gồm Mg. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16. sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO.64g D. Magie C. C. Câu 7.136 lít khí (đktc) và m g muối sunfat. 0. 5.48 lít. D. Fe2O3.16g.00g. 0.7g muối khan.91 Hoà tan hết 5.26g Câu 7. 5.6)g oxit.72g hỗn hợp kim loại gồm Mg.08g. Câu 7. Câu 7.85 Cho 4. Fe3O4.025 mol.1M. Fe3O4.74g. Mặt khác. 4. C.02g.04g. B.84 Để mg phoi bào sắt (X) ngoài không khí.2g. thu được 5g kết tủa. 1. C.688 lít. 10. Thể tích khí NO duy nhất thu được ở đktc là .15 mol. D. B. D. Al) bằng oxi thu được (m +1.Câu 7. B.6g. B. X là A.05 và 0. Fe2O3. 11.24 lít. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0.2g Cu vào 1 lít dung dịch gồm H2SO4 0. D. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15. Tính khối lượng m của X.85g muối clorua khan.448 lít. 3.05 mol. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0. V nhận giá trị bằng A.1M. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3.2M.36 lít.24 lít. 18.92 Hoà tan hết 1. 1. 5. FeO. 3. Số mol khí CO2 thu được là A.25g muối khan. 7.86 Cho 19. Câu 7. thu được V lít khí (đktc) và 3. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4.9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH) 2 0. A.05 và 0. thu được 9.18g. C. m nhận giá trị bằng A. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7. A.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại.00g.48 lít. m có giá trị là A.075 mol. 2.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy).3g. 15. 4. C. 16. 8. thu được 3.12 lít.2g B. 0.016 lít khí (đktc). B.224 lít. C. 0.83 Đốt cháy hết mg hỗn hợp A gồm (Zn. thu được 5g kết tủa. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12.344 lít. Bari D.1M. C. Giá trị của m là A. 0. D. 32.1g.

016 lít H2 (đktc).02.Câu 7. x = 0. Cho 2. Oxit khác. Hoà tan X bằng dung lịch HNO3 loãng. B. Khử hoàn toàn 4.2 mol và 2 anion Cl. 3.8g.336 lít. C. 0.7 C 7. 7.45g.4256 lít.3 .3 B 7. sau một thời gian thu được 13.10 D 7.1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ? A. C. D.20 C 7.72g hỗn hợp gồm 4 chất rắn khác nhau. FeO.336 lít.4 7. x = 0. 0.0336 lít. B.21g .81g hỗn hợp các oxit Fe3O4. C. 0.26 A 7. 0.4 B 7. 24g.4g.x mol.y mol.032g hỗn hợp các oxit (hỗn hợp X).3 và y = 0. sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt. SO42.99 Cho CO qua ống sứ chứa 15.24 A 104 . Câu 7. 1.21 D 7.344 lít H2. D. Khi cô cạn dung dịch.27 A 7. C.5 g.8g bột sắt ngoài không khí. B. 20g. 5. C.96. 5. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0.16 B 7.15 B 7.2.72g.0224 lít. m có giá trị là A. D.896 lít. B. Fe3O4. thu được mg kết tủa Z. 22g. b/7 7. CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0. Giá trị m là A. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VII 7.375g.88g khí CO2. x = 0. 8g. 4. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5. 10 g.18 D 7. 1.48g. D.3g. x = 0. Câu 7. Câu 7.102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian. D.6 lít SO2 (đktc). 5 g. MgO. Al3+ 0.75g hỗn hợp gồm 3 kim loại Fe.792g hỗn hợp bột gồm Fe và Cu ta thu được 1. 6.5g. Fe2O3.28 D 7. Câu 7. người ta thu được 6. C.14 C a/1.95. 8. D.2 B 7. C. Kim loại thu được đem hoà tan hết bằng dung dịch H 2SO4 loãng thấy tạo ra 1. m có giá trị là A. 0.84g Fe và 0.11 B 7. 7.448 lít khí NO duy nhất.25 C 7.016g hỗn hợp các oxit sắt (hỗn hợp X). B. 0.16g. FeO nung nóng.19 C 7. 0.8g một oxit của kim loại M thành kim loại cần 2.23 C 7.93. Câu 7.2g hỗn hợp CuO. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0.98. Al. Một dung dịch có chứa 2 cation là Fe2+ 0. và sắt dư.2g.17 a/2.8 D 7.12 khí (đktc) và dung dịch X.97 Cho 1. Không xác định được.13 7.03. dư. b/6 c/1.03 và y = 0. C.94.728g bột Fe ta thu được 1. D. Sục Y vào dung dịch nước vôi trong có dư. Chưa thể xác định. Cô cạn x thu được m g muối.1 B 7.2g. Zn tan hết trong dung dịch HCl thì thu được 1.6 C 7. B. Kết quả khác. Câu 7. 26g.1 mol.02 và y = 0. D. Câu 7.22 C 7.2 và y = 0.100 Oxi hoá hoàn toàn 0.101 Oxi hoá hoàn toàn 0. thu được 46. Câu 7.30 C 7.29 A 7.12 D 7. 0. Nung nóng 16.9 A 7. C. 5. B. 3.896 lít. 1.5 B 7.9g chất rắn khan.672 lít. 5. B. B.525g. Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là A. Tính a ? A. x và y có giá trị là A. Fe2O3. D. C. Câu 7. D. Tìm công thức của oxit.6g rắn X và hỗn hợp khí Y. A. Giá trị của m là A. Thể tích khí NO duy nhất bay ra (ở đktc) là A. B.

70.59 D 7.c B 7.77 C 7.97 C 7.c B 7.57 A 7.68.87 C 7.36 C 7.73 A 7.92 B 7.a B 7.58 A 7.b C 7.a A 7.89 C 7.70.60 A 7.81 C 7.61 B 7.42 B 7.74 D 7.75 A 7.69.91 C 7.b C 7.46 C 7.31 B 7.78 B 7.63 A 7.68.39 A 7.88 B 7.45 D 7.64 D 7.86 C 7.95 C 7.40 A 7.82 A 7.99 A + 7.38 B 7.56 A 7.70.101 D 7.83 B 7.b B 7.76 A 7.37 A 7.48 B 7.a B 7.71 B 7.93 C 7.79 D 7.50 B 7.65 B 7.016(mol) 105 .03(mol) − 3Cu + 2NO3 + 8H 0.54 B 7.b C 7.67 B 7.016(mol) 0.52 B 7.33 C 7.62 D 7.102 C 7.7.44 B 7. 0.47 B 7.94 C 0.32 B 7.85 A 7.a A 7.49 D 7.68.51 B 7.66 A 7.90 A 7.98 B 7.35 B 7.72.100 D 7.08(mol) → 3Cu 2+ + 2NO + H2 O.34 A 7.53 B 7.41 D 7.43 D 7.80 A 7.72.69.55 C 7.96 C 7.84 D 7.

CHƯƠNG VIII. PHÂN BIỆT MỘT SỐ CHẤT VÔ CƠ & CHUẨN ĐỘ DUNG DỊCH A. không ↑ NO2 nâu NO  NO2↑ (nâu) → khí Dùng phân biệt NO2– và NO3– (vì NO3– không có phản ứng này). vụn Cu Cô cạn. 3NaNO2 + H2SO4 (l) → Na2SO4+NaNO3+2NO↑+H2O H2SO4 (l) + O2 KK to. to O2↑ (que đóm t0 có MnO2 2KClO3  2KCl + 3O2↑ → bùng cháy) x.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. ↓ keo trắng ↓ trắng ↓ đen ↓trắng vàng nhạt Ag+ + X– → AgX↓ vàng ↓ vàng (tan 3Ag+ + PO43– → Ag3PO4↓ trong HNO3) (↑) nâu NO2 3Cu+8H++2NO3–→2Cu2++2NO+4H2O dung dịch Cu2+ (2NO + O2 → 2NO2) xanh 106 .t. Nhận biết một số anion Tt Anion Thuốc thử Dấu hiệu 1 OH– Quỳ tím Hoá xanh SO32– HSO3– + 2 H CO32– HCO3– SiO32– 3 SO42– Ba2+ 4 S2– Cl– Ag+ Br– I– 5 PO43– 6 NO3 – Phương trình phản ứng SO32– + 2HCl → SO2 + H2O CO32– + 2HCl → 2Cl– + CO2 SO2 làm mất màu dung dịch KMnO4 CO2 làm vẩn đục dung dịch Ca(OH)2 trong SiO32– + 2HCl → H2SiO3 + 2Cl– Ba2+ + SO42– → BaSO4↓ 2Ag+ + S2– → Ag2S↓ ↑ SO2 ↑ CO2 Ag+ 7 ClO3– 8 NO2– H2SO4 loãng.

2. − 3 4 + 2 3 - − Đỏ thẫm Vàng tươi Tím hồng Đỏ da cam Lục (hơi vàng) ↓ trắng ↓ trắng ↓ trắng ↓ xanh (nếu dùng dd NH3 thì tạo kết tủa xanh sau đó tan tạo ion phức màu xanh thẫm đặc trưng. còn Fe2+ làm KK 2 + OH − mất màu Fe     Fe OH2 → ( ) ↓    Fe OH3 đỏ↓nâu →( ) dd thuốc ↓ trắng xanh − 2+ + 2+ 3+ MnO4 + 5Fe + 8H → Mn + 5Fe + tím khi có + + 4H2O mặt H ). Nhận biết một số cation Stt ion 1 2 3 4 Li Na+ K+ Ca2+ + Thuốc thử Dấu hiệu Đốt trên ngọn lửa vô sắc − Phương trình phản ứng (phương pháp vật lí) 5 Ba2+ 6 Ca2+ 7 Ba2+ 8 Mg2+ SO42 9 Cu2+ 10 Fe2+ − 2+ OH 2 Cu + 2OH → Cu(OH) ↓ (riêng với Fe3+ đặc +2 NH + 2H O Cu 2+  Cu(OH)2 ↓ → trưng nhất −2NH là dùng ion 2+ +4NH  [ Cu(NH 3 )4 ] → −2OH thioxianat SCN-. tan ngay khi (OH–) dư dd H2S PbS ↓ đen − OH − 3  Cr 3+  Cr (OH )3 ↓   Cr ( OH )6 − → →     18 Pb 2+ (dd màu xanh) Pb + S → PbS↓ (màu đen) 2+ 2− 107 . làm xanh quỳ ẩm) Fe + 3SCN → Fe(SCN) ↓ đỏ máu − Fe3+ + 3OH → Fe(OH)3↓ đỏ nâu NH4+ + OH → NH3↑ + H2O +3OH Al3+  Al(OH)3 ↓ → + OH  [ Al(OH) 4 ] → - 3+ 3 − - 13 Al3+ − 14 Zn 2+ 15 Be2+ 16 Pb2+ 17 Cr 3+ OH từ từ đến dư − +2OH ↓ trắng tan Zn 2+  Zn(OH) 2 ↓ → ngay khi 2− + OH  [ Zn(OH) 4 ] → OH– dư + OH − Be2+  Be( OH )2 ↓  BeO 2 − → → 2 Pb2+ →Pb(OH)2↓ →PbO22 ↓ xanh. to − ↓ đỏ máu ↓ đỏ nâu NH3 ↑ khai. Ca2+ + SO42 → CaSO4↓ (it tan) − Ba2+ + SO42 → BaSO4↓ − Mg2+ + 2OH → Mg(OH)2↓ − 11 Fe3+ 12 NH4+ OH .

O3.1 Có 4 mẫu chất rắn màu trắng BaCO3. B. nếu chỉ dùng H2O và một chất khí (không dùng nhiệt độ. Nhận biết một số chất khí Stt Khí 1 Cl2 2 I2 3 SO2 4 H2S 5 HCl 6 NH3 7 NO 8 NO2 9 CO 10 CO2 11 O2 12 Hơi H2O Thuốc thử Dung dịch (KI + hồ tinh bột) Hồ tinh bột Dấu hiệu Phương trình phản ứng Không màu Cl2 + 2KI → 2KCl+ I2 + I2 → hoá xanh (Hồ tinh bột) → xanh Không màu → hoá xanh SO2 + Br2 + 2H2O → 2HBr + H2SO4 5SO2+2KMnO4+ 2H2O → 2H2SO4+2MnSO4+K2SO4 Pb2+ + H2S → PbS↓ + 2H+ Ag+ + Cl– → AgCl↓ NH3 + H2O→ NH4OH NH3 + HCl → NH4Cl 2NO + O2 → 2NO2 3NO2 + H2O → 2HNO3 + NO dd Br2 hay Mất màu dd KMnO4 dung dịch dd Pb(NO3)2 dd AgNO3 Quỳ tím ẩm HCl (đậm đặc) Không khí Quỳ tím ẩm dd PdCl2 (hay + CuO đen) Cho ↓ đen Cho ↓ trắng Hoá xanh Tạo khói trắng Hoá nâu Hoá đỏ Tạo ↓ Pd CO + PdCl2 + H2O → (hoá đỏ Cu) Pd↓ + 2HCl + CO2↑ CO2 + Ca(OH)2 → CaCO3↓ + H2O t 2Cu + O2  2CuO → 0 ddCa(OH)2 Vẩn đục Cu (đỏ). BaSO4.3. 108 . Na2CO3.5H2O t CuO + H2  Cu↓ + H2O → 0 SO3 + H2O → H2SO4 H2SO4 + BaCl2 → BaSO4 + 2HCl B .BÀI TẬP TRẮC NGHIỆM Câu 8. CO2. to Hoá đen CuO Trắng hoá xanh 13 H2 14 SO3 15 N2 CuSO4 khan CuO (đen) Hoá đỏ (Cu) to Dung dịch Kết tủa BaCl2 trắng BaSO4 (còn lại sau cùng) CuSO4 + 5H2O → CuSO4. điện phân) để phân biệt chúng thì chất khí phải chọn là A. NaHCO3.

dd PdCl2 và dd Br2. KNO3. C. D. axit sunfuric đặc. MgO. B. H2SO4 đặc nguội. HNO3 . HCl. Giấy quỳ tím và dd Ba(OH)2. H2SO4 loãng. axit clo hiđric. bari clorua. vôi sống. dd KOH Câu 8. ta có thể dùng dd A. quỳ tím. B. thuốc thử được chọn là A. C. C. HCl. Câu 8. NH3. đồng sunfat khan. Câu 8. D. để nhận biết 4 chất lỏng trên. dd KMnO4 và dd Br2 C. dd HCl.7 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là NaAlO2. ta có thể dùng A. H2. D. Fe3O4 và FeO người ta dùng A. mỗi ống nghiệm chứa một trong các dd HCl. Zn(OH)2. Dung dịch Ba(OH)2 và dd AgNO3. CO2. chỉ cần dùng một thuốc thử duy nhất là A. Quỳ tím. Câu 8. NaOH. Nếu chỉ được dùng một thuốc thử để nhận biết 5 chất lỏng trên. Na2S. SO2 ta có thể dùng thuốc thử là A.10 Để thu được Al(OH)3 từ hỗn hợp bột Al(OH)3. C. Dùng 2 hoá chất nào trong các cặp hoá chất sau đây để có thể phân biệt được các dd trên? A. B. P2O5. D. C. D. dd HNO3 đặc. B. dd BaCl2. Câu 8. Có thể sử dụng thuốc thử nào sau đây đề phân biệt các lọ dung dịch trên? A. B. NaCl. C. KCl. dd ammoniac.6 Có 5 dd đựng trong 5 lọ mất nhãn là FeCl3. NaCl. Câu 8. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. C đều đúng. Câu 8.9 Để nhận biết 3 dd natri sunfat. dd KOH. Dung dịch AgNO3 và dd phenolphthalein. Cả A.4 Để phân biệt 3 khí CO. BaCl2. FeCl2. B. C.C. SO2.1M). chỉ cần dùng duy nhất một dd là A. NaNO3. nguội. C. H2SO4.3 Để loại bỏ Al ra khỏi hỗn hợp Al. B. Mg và Al 2O3. Câu 8. H2SO4 đặc nóng B. Al. 109 .8 Để làm khô khí amoniac người ta dùng hoá chất là A.5 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. Na2CO3. kali hiđroxit.2 Có 4 lọ hoá chất bị mất nhãn đựng riêng biệt 4 dung dịch không màu sau đây: NH4Cl. dd BaCl2 và dd Br2. kali sunfit và nhôm sunfat (đều có nồng độ khoảng 0. NaOH. D. CO2 và H2O. B. AlCl3. Cu(OH)2. D.11 Có 4 ống nghiệm bị mất nhãn. NaOH. B. D. Câu 8. D. NH4NO3. BaCl2. CuO. dd HNO3. C. dd H2SO4 đặc nguội. không thể thực hiện được. H2O D. Câu 8. B. AgNO3. dd HCl.

Giấy quỳ tím và dd AgNO3. đá vôi.D. Cu có trong mẫu Ag và không làm thay đổi lượng Ag. đun nóng. H2O. D. Ag. Ag. Câu 8.18 Có 4 chất rắn riêng biệt gồm natri cacbonat. C. Câu 8. Có thể nhận biết 3 lọ trên bằng 1 thuốc thử duy nhất là A.12 Để chứng tỏ sự có mặt của ion NO3. P2O5. B. giấy quỳ B. natri sunfat và thạch cao sống (CaSO4. CaO. Ag. B. Ag.2H2O). Mg. C.19 Dung dịch X có chứa các ion: NH4+. Al.14 Có 3 lọ đựng 3 chất bột riêng biệt: Al. Để phân biệt 2 kim loại Al và Ag cần phải dùng A. dd NaOH. Một học sinh dùng các hoá chất dd NaOH. Al2O3. C. tuỳ thuộc vào trật tự tiến hành các thí nghiệm. D. Cu và vài giọt dd H2SO4đặc. H2SO4 đặc nguội. Fe. Cu để chứng minh sự có mặt của các ion trong X. C. Ba. dd BaCl2. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. HCl. Câu 8. NO3-. B. Fe3+.13 Để loại bỏ tạp chất Fe.ta nên dùng thuốc thử là A. cả 3 dung dịch. D. cả 4 dung dịch. chỉ một trong 4 dung dịch.trong dd chứa các ion: NH4+. Câu 8.15 Cho các dd: AgNO3. Chỉ dùng thêm một hoá chất bên ngoài là dd H2SO4 loãng có thể nhận biết được tối đa bao nhiêu kim loại trong các dãy sau? A. HNO3 đặc nguội. FeCl3 Câu 8. vì Fe2+ và Fe3+ khi tác dụng với kiềm tạo kết tủa có màu sắc khác nhau. B. Ag. Fe3+. dd H2SO4. H2SO4 loãng. AgNO3. CO2 B. chỉ 2 trong 4 dung dịch. Mg. Fe. NO3.17 Để làm khô khí H2S. C. CuSO4 khan. B. dd HCl. Mg. dd AgNO3. Ba. 110 . Dung dịch kiềm. Ba. Chỉ dùng H2O và một khí X có thể phân biệt được cả 4 chất. D. B. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Cl2 D. Fe2+. dd NaOH. HCl. X là A. Ba. ta có thể dùng A. D. B. Câu 8. Br2 (Hơi) C. Fe. người ta ngâm mẫu bạc này vào một lượng dư dd A. Cả A. Fe.16 Có 5 mẫu kim loại Ba. Fe. C. C đều đúng Câu 8. D. Ca(OH)2. Kết luận đúng là A. C. Câu 8. dd FeCl2. Al.

(2). (4). Mg(NO3)2. (1). NaAlO2. AgNO3 sau. Cả A. dd NaOH. Các cách đúng là A. (1). Ca(NO3)2. (2). B. NaNO3. B.23 Một học sinh đề nghị các cách để nhận ra lọ chứa khí NH3 lẫn trong các lọ riêng biệt chứa các khí N2. CO2 là: (1) dùng mẩu giấy quỳ tím ướt. (3). dd CuCl2 dư. Có thể dùng thuốc thử nào sau đây để nhận biết chúng? A. Cl2. (3) mẩu bông tẩm dd HCl đặc. Câu 8. (3) nước cất có vài giọt quỳ tím. C. (4). NH4NO3. chỉ dùng AgNO3. (3). Fe với khối lượng Ag không đổi. B. dd phenolphthalein. B. B. BaCl2. Câu 8. C. MgCl2.24 Để thu được Al2O3 từ hỗn hợp bột Al2O3 và CuO mà khối lượng Al2O3 không thay đổi. (3). B.21 Để nhận biết trong thành phần của khí nitơ có lẫn tạp chất hiđroclorua. giấy quỳ tím sau. AgNO3. Ba(OH)2. Fe(NO3)3 và Cu(NO3)2 là A. BaCl2. (2) mẩu bông tẩm nước. (5) mẩu AgCl. Na2CO3. (2). Fe(NO3)3. B. (4) nước vôi trong. B. Cu. NaNO3. dd NH3. Hoá chất cần dùng và thứ tự thực hiện để nhận biết các chất đó là A. (3). (1). dd AlCl3. C. dd HCl. (1).28 Chỉ dùng Na2CO3 có thể phân biệt được mỗi dd trong dãy dd nào sau đây? A. Câu 8. NaCl. Phương pháp đúng là A. cả A. (3). (5). (4). C. NaCl. D. C đều đúng. Quỳ tím. Câu 8. (NH4)2SO4. B. 111 . MgSO4. dùng giấy quỳ tím trước. Câu 8. (1). AlCl3. B. (3). NaOH. Học sinh đó không chứng minh được sự tồn tại của Fe 2+ và Fe3+ vì chúng đều tạo kết tủa với kiềm. (5). D. H2SO4 (loãng). Câu 8. NaCl. Fe(NO3)2. FeCl2 thì chọn thuốc thử là A. Al(NO3)3. (2). C. HNO 3. (4) mẩu Cu(OH)2. mỗi ống đựng 1 dd Na2CO3. dd muối sắt(III) dư. KNO3. D. (3). Ba(NO3)2.25 Chỉ dùng một dd làm thuốc thử để nhận biết các dd muối sau: Al(NO3)3.22 Thuốc thử duy nhất dùng để nhận biết NH4NO3. Al. có thể dùng chất nào sau đây? A. C. dd muối Sắt(II) dư. (1). dùng AgNO3 trước. NaOH. Câu 8. (2) dd NaOH. D. dd NH4Cl. D.D. HCl. D. O2. D. MgCl2. MgCl2. ta có thể dẫn khí qua: (1) dd bạc nitrat. D.26 Tách Ag ra khỏi hỗn hợp bột gồm Ag. Câu 8. dd AgNO3 dư. CaCl2. (1). MgCl2. D. chỉ cần dùng một hoá chất là A. C. Câu 8. Fe(NO3)3.27 Có 3 lọ mất nhãn chứa 3 dd riêng biệt HCl. C đều được. chỉ (1). C.20 Có 4 ống nghiệm mất nhãn. C.

kẽm sunfat. NH4NO3. D. dd AgNO3 vừa đủ.38 Để làm sạch quặng boxit thường có lẫn Fe2O3. Câu 8. cả A. dd Ba(OH)2. NaOH. Ca với axit H2SO4 đặc.31 Chỉ có giấy màu ẩm. dd Ca(OH)2 vừa đủ. NH4Cl. dd BaCl2. kali sunfit. dd NaOH loãng và dd HCl. khí (1) là O2. B. người ta dùng dư hoá chất nào sau đây? A. và giấy tẩm dd muối X người ta có thể phân biệt 4 lọ chứa khí riêng biệt O2. Mg. Ba. D. B.36 Chỉ dùng H2O có thể phân biệt được các chất trong dãy A. C. dd Ca(OH)2 . Ba(OH)2. Cl2.Câu 8. X là muối Pb(NO3)2. dd NaOH. khí (1) là O2. Câu 8. quỳ tím ẩm. X là muối CuSO4. H2O. B. B đều đúng. Câu 8.33 Để loại được H2SO4 có lẫn trong dd HNO3. C. C.B. H2S và Cl2 do có hiện tượng: khí (1) làm tàn lửa cháy bùng lên. SiO2 dùng cho sản xuất Al người ta dùng chất nào trong số các chất sau đây là tốt nhất? A. dd NaOH đặc nóng và CO2.35 Chỉ dùng một thuốc thử duy nhất nào sau đây để phân biệt hai khí SO2 và CO2? A. HNO3 đặc nguội. FeCl3. C. D. dd NaOH loãng và CO2. giấy quỳ tím. khí (2) làm mất màu của giấy. nguội không thay đổi đáng kể nồng độ và không sinh nhiệt)? A. khí (3) làm giấy có tẩm dd muối X hoá đen. Để xác định lọ đựng khí NH3 chỉ cần dùng thuốc thử duy nhất là A. NH3. (NH4)2SO4. Thuốc thử có thể dùng để nhận biết ba dd trên đơn giản nhất là A. khí (2) là Cl2. Na. CuSO4. dd H2SO4. chỉ cần dùng dd A. B. D. dd HClđặc. N2. (NH4)2SO4. D. khí còn lại là N2. Câu 8. dd NaOH đặc nóng và HCl. Na. D. D. C.30 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là (NH4)2SO4. CO2. B. Câu 8. C. AgNO3. khí (3) là Cl2. Câu 8. B. D.32 Có ba dd kali clorua. K. K2SO4. NH4NO3. KOH. lửa. D. dd Br2. dd H2SO4 đặc nguội. NH4NO3. C.34 Có 5 lọ đựng riêng biệt các khí sau: N2. Ca mà khối lượng Al không thay đổi (giả sử phản ứng của Mg. Na. C. để nhận biết 4 chất lỏng trên. NH4Cl. NH4Cl. AgNO3. dd HCl. D.37 Chỉ dùng duy nhất một dd nào sau đây để tách lấy riêng Al ra khỏi hỗn hợp Al. X là muối CuSO4. dd Ba(NO3)2 vừa đủ. dd Ba(OH)2. NH4Cl. B. ta dùng A. C. Câu 8. Kết luận sai là A. Na. K. Câu 8. C.29 Để thu được Ag tinh khiết từ hỗn hợp bột Ag-Fe. dd NaOH. O2. 112 . Câu 8. BaCl2. B. B. Ba. dd H2SO4 loãng. dd HCl.

C đều đúng.30 A 8. natri hiđroxit. và hỗn hợp NaNO3 và KHSO4. B. dd BaCl2. chỉ cần dùng một chất duy nhất là A.42 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. Y có thể dùng hoá chất nào sau đây? A.25 B 8. Al.12 D 8.29 B 8.40 Đốt cháy Fe trong clo dư thu được chất X. Zn.19 C 8. dd HCl.26 C 8. KOH ta có thể …”. AgNO3.10 A 8. Số dd không hoà tan được đồng kim loại là A. K2CO3. B. thuốc thử được chọn là A. D. C. Na2CO3. Câu 8. A. dd H2SO4 và dd BaCl2. C. C. Câu 8.14 8. NH3. dd HNO3 và dd Ba(OH)2.1 B 8.43 “Để phân biệt các dd riêng biệt gồm NaCl. dd H2SO4 và dd AgNO3.1M) bị mất nhãn. H2O. C.15 A 8.9 B 8. chỉ cần Fe kim loại. FeCl2.6 C 8.16 B 8. Mg và Al 2O3.27 D A 113 . D.20 D 8. chì clorua.3 C 8.13 D 8. NaNO3.4 A 8. B. nung sắt với lưu huỳnh thu được chất Y.17 8. không cần dùng bất kể hoá chất nào. B. C. C. Mg(NO3)2. 4. NaOH và O2. D. Thuốc thử để phân biệt các dd đó là A. ĐÁP ÁN 8. Câu 8. bari hiđroxit. BaCO3. Câu 8. 2. H2SO4 thì chọn A. dd HCl. dd KOH.41 Để nhận biết 4 dd: Na2SO4.Câu 8. H2SO4. BaCl2.24 C C 8. quỳ tím Câu 8.2 B 8. quỳ tím.23 C 8. Để xác định thành phần cấu tạo và hoá trị các nguyên tố trong X.5 D 8. B.11 D 8. B. D. dd HNO3 đặc. D. cả A. 3. axit sunfuric. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. D. Hãy chọn đáp án để nối thêm vào phần còn trống sao cho kết luận trên luôn đúng. nguội. dd CH3COOAg. B. CuSO4.18 D 8. B.8 A 8. H2SO4.7 A 8.44 Có các dd Al(NO3)3.22 D 8.28 D 8. BaCl2.21 C 8. 1. dd NaOH.45 Nếu chỉ dùng một thuốc thử duy nhất để phân biệt 3 dd NaOH. D. chỉ cần dùng giấy quỳ tím. LiNO3 (đều có nồng độ khoảng 0. C.39 Cho các dd: FeCl3. Câu 8. HCl.

. nhu cầu của nhân loại về các vật liệu mới với những tính năng vật lí và hoá học. 2. nhiên liệu hoá thạch như dầu mỏ. .45 D 8. Như : . năng lượng địa nhiệt.Vật liệu có nguồn gốc hữu cơ. năng lượng thuỷ triều… . sinh học mới ngày càng cao. . HOÁ HỌC VÀ VẤN ĐỀ PHÁT TRIỂN KINH TẾ.Năng lượng điện hoá trong pin điện hoá hoặc acquy.34 A 8.Sản xuất ra chất thay cho xăng từ nguồn nguyên liệu vô tận là không khí và nước.35 C 8.32 C 8.8.Điều chế etanol từ crackinh dầu mỏ để thay thế xăng.Vật liệu có nguồn gốc vô cơ. XÃ HỘI.44 B 8. dầu. .Sản xuất khí than khô và khí than ướt từ than đá và nước. năng lượng nhân tạo thay thế. .Khai thác và sử dụng năng lượng hoá thạch còn là một trong những nguyên nhân chủ yếu gây nên ô nhiễm môi trường và làm thay đổi khí hậu toàn cầu. Vấn đề vật liệu * Vấn đề về vật liệu đang đặt ra cho nhân loại là gì ? Cùng với sự phát triển của các ngành kinh tế và khoa học kĩ thuật.40 B CHƯƠNG IX.33 A 8.42 D 8.Vật liệu mới: 114 .MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.Năng lượng được sản sinh ra trong các lò phản ứng hạt nhân được sử dụng cho mục đích hoà bình.43 A 8. MÔI TRƯỜNG A.37 A 8. Vấn đề năng lượng và nhiên liệu * Vấn đề về năng lượng và về nhiên liệu đang đặt ra cho nhân loại hiện nay là : . năng lượng mặt trời. năng lượng gió.Điều chế khí metan trong lò biogaz. . * Hoá học đã góp phần giải quyết vấn đề năng lượng và nhiên liệu như thế nào trong hiện tại và tương lai? Hoá học đã nghiên cứu góp phần sản xuất và sử dụng nguồn nhiên liệu.Các nguồn năng lượng. . .41 B 8.36 A 8.39 C 8. than đá.38 D 8. khí tự nhiên… không phải là vô tận mà có giới hạn và ngày càng cạn kiệt.Năng lượng thuỷ điện.31 B 8. * Hoá học đã góp phần giải quyết vấn đề về vật liệu như thế nào? .

mà còn mặc đẹp.Sản xuất những hoá chất bảo quản lương thực và thực phẩm. . Hoá học và vấn đề sức khỏe con người * Dược phẩm .Phòng chống những căn bệnh.Vật liệu compozit. . . .Nghiên cứu ra các loại vacxin. . . .Thuốc bổ dưỡng cơ thể.Góp phần sản xuất ra tơ.Góp phần nghiên cứu thành phần hoá học của một số dược liệu tự nhiên.Vấn đề vi phạm vệ sinh an toàn thực phẩm. 4.Dân số thế giới gia tăng không ngừng. dung dịch để tiêm chích). viên để uống. vì vậy tơ sợi tự nhiên không thể đáp ứng đủ nhu cầu về số lượng cũng như chất lượng.Vật liệu quang điện tử.Các vật liệu cơ bản để chế tạo các thiết bị chuyên dụng trong các nhà máy dệt và trong ngành dệt may.Vật liệu nano (còn gọi là vật liệu nanomet) . . phát triển thực vật. Hoá học và vấn đề thực phẩm * Vấn đề lương thực.… .Sản xuất các loại phân bón hoá học.Nghiên cứu chế biến thức ăn tổng hợp. * Hoá học góp phần giải quyết vấn đề may mặc của nhân loại như : . . 3.. thực phẩm đang đặt ra thách thức lớn cho nhân loại hiện nay . * Chất gây nghiện. hợp thời trang. . động vật: . 4. Hoá học và vấn đề may mặc * Vấn đề may mặc đang đặt ra cho nhân loại hiện nay là : .Nhu cầu của con người không chỉ mặc ấm.Tổng hợp hoá chất có tác dụng diệt trừ cỏ dại. 115 . bột trắng dùng để hít.Dân số thế giới ngày càng tăng.Thuốc tránh thai. .Tổng hợp hoá chất diệt nấm bệnh.Diện tích trồng trọt ngày càng bị thu hẹp. thực phẩm cho nhân loại như : nghiên cứu và sản xuất các chất hoá học có tác dụng bảo vệ. nạn dịch của thế kỉ. sợi hoá học có nhiều ưu điểm nổi bật. . * Hoá học đã góp phần giải quyết vấn đề về lương thực.Sản xuất nhiều loại phẩm nhuộm. . chất ma tuý và cách phòng chống ma tuý (dưới dạng những viên thuốc tân dược.

sử dụng chúng như là một loại thuốc chữa bệnh.… * Ô nhiễm môi trường đất Đất bị ô nhiễm có chứa độc tố.… một số vi khuẩn gây bệnh.2. gây thay đổi khí hậu toàn cầu. các chất phóng xạ.… b) Xác định chất ô nhiễm bằng các thuốc thử. Khí butan (gaz) D. Xăng. chất độc hoá học.1. các vi sinh vật gây bệnh. làm diệt vong một số loại sinh vật. đất. rối loạn tuần hoàn.Nghiện ma tuý sẽ dẫn đến rối loạn tâm. chất có hại cho cây trồng vượt quá nồng độ được quy định. NH3. nước) gây suy giảm sức khỏe của con người. * Vai trò của hoá học trong việc xử lí chất ô nhiễm Xử lí ô nhiễm đất. … * Ô nhiễm không khí Không khí bị ô nhiễm thường có chứa quá mức cho phép nồng độ các khí CO2. Nhiên liệu nào sau đây thuộc loại nhiên liệu sạch đang được nghiên cứu sử dụng thay thế một số nhiên liệu khác gây ô nhiễm môi trường ? A.. sắc kí. Tiêm chích ma tuý có thể gây trụy tim mạch dễ dẫn đến tử vong. .BÀI TẬP TRẮC NGHIỆM Câu 9. như rối loạn tiêu hoá. không khí dựa trên cơ sở khoa học hoá học có kết hợp với khoa học vật lí và sinh học. sinh lí. dầu. hiệu ứng nhà kính. Than đá. CH4 và một số khí độc khác. máy đo pH. các hoá chất vô cơ. mưa axit. Câu 9. Hoá học và vấn đề ô nhiễm môi trường Tác hại của ô nhiễm môi trường (không khí. nước. Người ta đã sản xuất khí metan thay thế một phần cho nguồn nguyên liệu hoá thạch bằng cách nào sau đây ? A.… Thí dụ : hiện tượng thủng tầng ôzôn. C. B. 116 . Thu khí metan từ khí bùn ao. thí dụ CO.Hoá học đã nghiên cứu ma tuý. . các chất dinh dưỡng thực vật. HCl. Lên men các chất thải hữu cơ như phân gia súc trong lò biogaz. * Nhận biết môi trường bị ô nhiễm a) Quan sát qua mùi. B. c) Bằng dụng cụ đo : nhiệt kế. rối loạn chức năng thần kinh.… * Ô nhiễm nước Nước ô nhiễm thường có chứa các chất thải hữu cơ.Luôn nói không với ma tuý. các chất hữu cơ tổng hợp. B. Khí hiđro. màu sắc. bụi. SO2. 4. hô hấp.

C. H2.C. H2. Nước vôi dư. Cách bảo quản thực phẩm (thịt. Không khí chứa 78% N2. Giấm ăn.3. H2. Hg2+. Câu 9. C. NH3. D. Sau bài thực hành hoá học. Một trong những hướng con người đã nghiên cứu để tạo ra nguồn năng lượng nhân tạo to lớn để sử dụng cho mục đích hoà bình. Cd2+. Pb2+. 16% O2. Amoxilin. Etanol. B. 21% O2. Loại thuốc nào sau đây thuộc loại gây nghiện cho con người ? A. dùng nước đá khô. D. Zn2+. Thuốc cảm Pamin. Năng lượng hạt nhân.7. Dùng phân đạm. D. H2O. Nước ruộng lúa chứa khoảng 1% thuốc trừ sâu và phân bón hoá học. Năng lượng mặt trời. HNO3. C. Nước thải từ các bệnh viện. sắt…quá mức cho phép. D. B. Không khí chứa 78% N2. 6% hỗn hợp CO2.6. Vitamin C. Hg2+…Dùng chất nào sau đây để xử lí sơ bộ các chất thải trên ? A. Khí nào sau đây gây ra hiện tượng mưa axit ? A. nước đá. D. CH4. Câu 9.5. Ni2+. Câu 9. trong một số chất thải dạng dung dịch. Năng lượng thuỷ điện. Nước thải nhà máy có chứa nồng độ lớn các ion kim loại nặng như Pb2+. Trường hợp nào sau đây được coi là nước không bị ô nhiễm ? A. Trường hợp nào sau đây được coi là không khí sạch ? A. Năng lượng gió. Câu 9. cá…) bằng cách nào sau đây được coi là an toàn ? A. chứa các ion : Cu2+. Câu 9. Không khí chứa 78% N2. HCl. 2% hỗn hợp CO2. 18% O2.9. Panadol. Không khí chứa 78% N2. B. Seđuxen. nước đá. Fe3+. Câu 9. đó là : A. B. B. SO2. H2O. Lên men ngũ cốc. D. Câu 9. Dùng nước đá hay ướp muối rồi sấy khô. Penixilin. H2O.4. C. Dùng fomon.8. fomon. Nước từ các nhà máy nước hoặc nước giếng khoan không chứa các độc tố như asen. glucozơ. B. CH4 và bụi. 4% hỗn hợp CO2. Cho hơi nước đi qua than nóng đỏ trong lò. C. 20% O2. D. moocphin. 1% hỗn hợp CO2. D. khu vệ sinh chứa các khuẩn gây bệnh. C. 117 . B. C.

2 tấn. 1. C.12. C. Câu 9. Câu 9. 2. A. H2S. KClO3 rắn.0253 mg/l. 15. Than hoạt tính. 27. Khí lò cao.0125 tấn. B. NaOH rắn.14. . C. (Nên biết thêm : hàm lượng cho phép là 0. 0. 1. Na2CO3.0250 mg/l. Biết hiệu suất của quá trình là 80%. 17. Tính khối lượng dung dịch CuSO4 5% thu được từ 0. Có thể điều chế thuốc diệt nấm 5% CuSO4 theo sơ đồ sau : CuS → CuO → CuSO 4 . Hãy tính lượng ngũ cốc chứa 65% tinh bột để sản xuất được 2. A. B. D. B.56 tấn. B. NaOH.11.0 tấn. 12. C. NH3. Câu 9.4 tấn. Nhiều loại sản phẩm hoá học được điều chế từ muối ăn trong nước biển như : HCl. 1.2 tấn. B. Hiệu suất của quá trình là 80%. C. A. 0. A.55 tấn.2 A 9.4 C 9.422 tấn.15 tấn nguyên liệu chứa 80% CuS. D. Có thể điều chế Ancol etylic bằng 2 cách sau : . 4.01 mg/l). Khí dầu mỏ.6 A 9.3 D 9. nước Gia-ven. D. Để đánh giá độ nhiễm bẩn không khí của một nhà máy.0257 mg/l. C. Hãy cho biết hiện tượng đó chứng tỏ trong không khí đã có khí nào trong các khí sau đây ? A. Không khí. Khí tự nhiên. 0. D. C.13.15.0225 mg/l. Câu 9. Biết rằng hao hụt trong quá trình sản xuất là 25%.30 tấn.Cho khí etilen (lấy từ cracking dầu mỏ) hợp nước có xúc tác. SO2. Câu 9. 8. Tính hàm lượng khí đó trong không khí.Cho lên men các nguyên liệu chứa tinh bột. D. Tính khối lượng NaCl cần thiết để sản xuất 15 tấn NaOH. B.3 tấn. 5.422 tấn.10.5 C 9. Chất khí CO (cacbon monoxit) có trong thành phần loại khí nào sau đây ? A. Ancol etylic là sản phẩm trung gian từ đó sản xuất được cao su nhân tạo.422 tấn. 3. tơ sợi tổng hợp. coi hiệu suất phản ứng là 100%. b.Câu 9.1 D 118 9. a.8 A . người ta tiến hành như sau : Lấy 2 lít không khí rồi dẫn qua dung dịch Pb(NO 3)2 dư thì thu được 0. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IX 9.3585 mg chất kết tủa màu đen. B. D. CO2. D.7 D 9. 0. Na2O2 rắn.3 tấn ancol etylic. Trong công nghệ xử lí khí thải do quá trình hô hấp của các nhà du hành vũ trụ hay thuỷ thủ trong tàu ngầm người ta thường dùng hoá chất nào sau đây ? A.

11 A 9.15.12 D 9.15.14 C 9.b A C 119 .10 D 9.13 B 9.9.9.a 9. C 9.

Sign up to vote on this title
UsefulNot useful