HÓA HỌC 12

• • • • • • • • • Chương 1: Este – Lipit Chương 2: Cacbohidrat Chương 3: Amin – Amino axit – Protein Chương 4: Polime – Vật liệu polime Chương 5: Đại cương về kim lọai Chương 6: Kim lọai kiềm – Kim lọai kiềm thổ - Nhôm Chương7: Sắt và một số kim lọai quan trọng Chương 8: Phân biệt một số chất vô cơ Chương 9: Hóa học và vấn đề phát triển kinh tế, xã hội và môi trường

TÀI LIỆU LƯU HÀNH NỘI BỘ

CHƯƠNG I. ESTE - LIPIT A- MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Khái niệm về dẫn xuất của axit cacboxylic - Dẫn xuất của axit cacboxylic là những sản phẩm tạo ra khi thay thế nhóm hiđroxyl -OH trong nhóm cacboxyl -COOH bằng nguyên tử hay nhóm nguyên tử khác: -COOH → -COZ (với Z: OR', NH2, OCOR, halogen, …) - Este là dẫn xuất của axit cacboxylic. Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR' thì được este. - Halogenua axit (quan trọng nhất là clorua axit RCOCl). Để tạo ra halogenua axit có thể dùng các tác nhân như PCl5 (photpho pentaclorua), PCl3 (photpho triclorua), COCl2 (photgen), SOCl2 (thionyl clorua), … RCOOH + PCl5 → RCOCl + POCl3 + HCl 3RCOOH + PCl3 → 3RCOCl + H3PO3 RCOOH + SOCl2 → RCOCl + SO2 + HCl RCOOH + COCl2 → RCOCl + CO2 + HCl - Anhiđrit axit, có 2 loại: đối xứng (dạng (RCO)2O hoặc (ArCO)2O; gọi tên bằng cách thay từ axit bằng anhiđrit (CH3CO)2O là anhiđrit axetic), và không cân đối (sinh ra từ hai axit monocacboxylic khác nhau như CH3CO-O-OCC6H5; gọi tên bằng từ anhiđrit cộng với tên của hai axit - anhiđrit axetic benzoic). Để tạo thành anhiđrit axit có thể sử dụng nhiều phương pháp khác nhau như dùng tác nhân hút nước P2O5 hay tác dụng của nhiệt, … 2. Công thức tổng quát của este a/ Trường hợp đơn giản: là este không chứa nhóm chức nào khác, ta có các công thức như sau :
- Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đơn chức R'OH: RCOOR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đơn chức R'OH: R(COOR')a. - Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đa chức R'(OH)b: (RCOO)bR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đa chức R'(OH)b: Rb(COO)abR'a. Trong đó, R và R' là gốc hiđrocacbon (no, không no hoặc thơm); trường hợp đặc biệt, R có thể là H (đó là este của axit fomic H-COOH).

b/ Trường hợp phức tạp: là trường hợp este còn chứa nhóm OH (hiđroxi este) hoặc este
còn chứa nhóm COOH (este - axit) hoặc các este vòng nội phân tử … Este trong trường hợp này sẽ phải xét cụ thể mà không thể có CTTQ chung được. Ví dụ với glixerol và axit axetic có thể có các hiđroxi este như HOC 3H5(OOCCH3)2 hoặc (HO)2C3H5OOCCH3; hoặc với axit oxalic và metanol có thể có este - axit là HOOC-COOCH3.

c/ Công thức tổng quát dạng phân tử của este không chứa nhóm chức khác Nên sử dụng CTTQ dạng C n H 2n + 2 −2∆ O2a (trong đó n là số cacbon trong phân tử este n ≥ 2, nguyên; ∆ là tổng số liên kết π và số vòng trong phân tử ∆ ≥ 1, 2

nguyên; a là số nhóm chức este a ≥ 1, nguyên), để viết phản ứng cháy hoặc thiết lập công thức theo phần trăm khối lượng của nguyên tố cụ thể. 3. Tính chất hoá học của este a/ Phản ứng thuỷ phân este Tính chất hoá học quan trọng nhất của este là phản ứng thuỷ phân. Sơ đồ thuỷ phân este (về cơ bản, chưa xét các trường hợp đặc biệt) là :

C

O

+H

OH

H +, t o

C O

H

+

OH

O O (este) (nước) (axit) (ancol) Thuỷ phân chính là quá trình nghịch của của phản ứng este hoá.
Phản ứng thuỷ phân có thể xảy ra trong môi trường axit hoặc môi trường bazơ. - Phản ứng thuỷ phân trong môi trường kiềm được gọi là phản ứng xà phòng hoá. Đặc điểm của phản ứng thuỷ phân este: - Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Sản phẩm của phản ứng trong điều kiện này luôn có axit cacboxylic. Để chuyển dịch cân bằng về phía tạo axit và ancol, ta dùng lượng dư nước.

- Phản ứng thuỷ phân este không những thuận nghịch mà còn rất chậm. Để tăng tốc độ phản ứng thuỷ phân ta đun nóng hỗn hợp phản ứng với với chất xúc tác axit (H2SO4, HCl…). - Phản ứng xà phòng hoá chỉ xảy ra một chiều, sản phẩm thu được luôn có muối của axit cacboxylic.

C O

+ OH-

to

C
(muối)

O-

+

OH

(este) (kiềm) O b/ Phản ứng của gốc hiđrocacbon

O (ancol, phenol, anđehit …)

Este không no (este của axit không no hoặc ancol không no) có khả năng tham gia phản ứng cộng và phản ứng trùng hợp – đây là tính chất do liên kết π quy định (tương tự như hiđrocacbon tương ứng). Một số phản ứng thuộc loại này có ứng dụng quan trọng là : - Phản ứng chuyển hoá dầu (chất béo lỏng) thành mỡ (chất béo rắn)
Ni, t , p (C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5 (Triolein) (Tristearin) - Phản ứng trùng hợp vinyl axetat thành poli(vinyl axetat)
0

nCH2

CH OCOCH3

xt, to, p

CH CH2 n OCOCH3

- Trùng hợp metyl metacrylat thành poli(metyl metacrylat) – thuỷ tinh hữu cơ plexiglas).

3

to. 4. Một số phản ứng thuỷ phân đặc biệt của este Căn cứ vào sơ đồ phản ứng xà phòng hoá hay phản ứng thuỷ phân este ta có thể căn cứ vào sản phẩm tạo thành để suy đoán cấu tạo của este ban đầu. Không nhất thiết sản phẩm cuối cùng phải có ancol.nCH2 CH COOCH3 xt. • Este + NaOH  1 muối + 1 ancol + H2O → Este. Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : • Este + NaOH  1 muối + 1 anđehit → Este đơn chức có gốc ancol dạng công thức R-CH=CHThí dụ CH3COOCH=CH-CH3 • Este + NaOH  1 muối + 1 xeton → Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân. Este vòng (được tạo bởi hiđroxi axit) CH 3 CH C O • Este + NaOH  Có MSP = MEste + MO → NaOH R C O O Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi 4 . Phản ứng khử este bởi líti-nhôm hiđrua LiAlH4 thành ancol bậc I 1) LiAlH 4 → RCOOR'  RCH2OH + R'OH 2) H3O + (Chú ý: anhiđrit axit.este: RCOOCH(OH)-R’ • Este + NaOH  1 muối + xeton + H2O → Hiđroxi.este: RCOOC(R)(OH)-R’ • Este + NaOH  1 sản phẩm duy nhất → hoặc “m RẮN = mESTE + mNaOH”. tuỳ thuộc vào việc nhóm – OH đính vào gốc hiđrocacbon có cấu tạo như thế nào mà sẽ có các phản ứng tiếp theo xảy ra để có sản phẩm cuối cùng hoàn toàn khác nhau.axit : HOOC-R-COOR’ • Este + NaOH  2 muối + H2O → Este của phenol: C6H5OOC-R • Este + NaOH  1 muối + anđehit + H2O → Hiđroxi.Phản ứng tráng gương của este của axit fomic– (xem lại anđehit). hoặc nữa là do cấu tạo bất thường của este gây nên. 5. p CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) CH3 metyl metacrylat . halogenua axit cũng bị líti-nhôm hiđrua khử tương tự).

t CH3 CH C O + NaOH CH3 CH C ONa O Chú ý các kết luận in nghiêng ngay dưới mỗi trường hợp trênO chỉ là một thí dụ OH đây o 6. Lipit .đơn giản nhất. . Ví dụ: phản ứng tạo phenyl axetat (CH3CO)2O + C6H5OH  CH3COOC6H5 + CH3COOH → CH3COCl + C6H5OH  CH3COOC6H5 + HCl → c/ Phản ứng cộng vào hiđrocacbon không no của axit cacboxylic Ví dụ: phản ứng tạo vinyl axetat xt. Lipit bao gồm chất béo. Phản ứng xà phòng hoá xảy ra nhanh hơn phản ứng thuỷ phân trong môi trường axit và không thuận nghịch.Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử C (thường từ 12C đến 24C) không phân nhánh. H . Muối natri (hoặc kali) của các axit béo chính là xà phòng.Phản ứng của ancol với anhiđrit axit hoặc clorua axit thì phản ứng xảy ra nhanh hơn và một chiều (không thuận nghịch như khi tác dụng với axit) (CH3CO)2O + C2H5OH  CH3COOC2H5 + CH3COOH → CH3COCl + C2H5OH  CH3COOC2H5 + HCl → b/ Phản ứng của phenol với anhiđrit axit hoặc clorua axit (phenol không tác dụng với axit cacboxylic) tạo este của phenol. sterit. Phản ứng của chất béo với chất kiềm được gọi là phản ứng xà phòng hoá. gọi chung là triglixerit.t  → RCOOH + R'OH ← RCOOR' + H2O  + 0 .Phản ứng của ancol với axit cacboxylic (xem axit). photpholipit.Chỉ số axit: là số mg KOH cần để trung hoà axit béo tự do có trong 1g chất béo. sáp. …hầu hết chúng đều là các este phức tạp.Lipit là những hợp chất hữu cơ có trong tế bào sống. 5 . . anhiđrit axit. Khi thuỷ phân chất béo thì thu được glixerol và axit béo. các em chỉ được vận dụng khi không có dấu hiệu cho phép xác định cụ thể số nhóm chức este trước đó. t 0 CH3COOH + CH≡ CH  CH3COOCH=CH2 → d/ Phản ứng ankyl halogenua và muối bạc hay cacboxylat của kim loại kiềm RCOOAg + R'I → RCOOR' + AgI RCOONa + R′ I → RCOOR' + NaI 7.Khi đun nóng chất béo với dung dịch kiềm thì tạo ra glixerol và hỗn hợp muối của các axit béo. tạo ra este. Một số phương pháp điều chế este a/ Phản ứng của ancol với axit cacboxylic và dẫn xuất như clorua axit. . .

RCOOC6H5 + 2NaOH  RCOONa + C6H5ONa + H2O → t0 3. 8.Chỉ số xà phòng hoá là tổng số mg KOH cần để xà phòng hoá glixerit và trung hoà axit béo tự do có trong 1g chất béo. C3H5(OOC R )3 + 3NaOH  3 R COONa + C3H5(OH)3 → H+ . CH3CH2COOH + Br2  CH3CHBrCOOH + HBr → 10. CxHy(COOM)a + O2  M2CO3 + CO2 + H2O → (sơ đồ phản ứng đốt cháy muối cacboxylat). 2CH3COONa(r) + 4O2  Na2CO3 + 3CO2↑ + 3H2O → t0 17.Chỉ số iot: là số gam iot có thể cộng hợp vào các liên kết bội có trong 100g chất béo. bR(COOH)a + aR'(OH)b ← Rb(COO)abR'a + abH2O  t 5. RCOOC(CH3)=CH2 + NaOH  RCOONa + CH3COCH3 → 6 . t0 18. RCOONa + HCl (dd loãng) → RCOOH + NaCl t0 16. 3CH3COOH + POCl3  3CH3COCl + H3PO4 → CaO. C6H5-CH(CH3)2  C6H5OH + CH3COCH3 2) H 2 O. CH3-CO-CH3 + HCN → (CH3)2C(OH)CN 11. H + 0 0 15. Xà phòng và chất tẩy rửa tổng hợp B . R-Cl + KCN → R-CN + KCl 13.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP t 1. t 0 9. RCOOCH=CH2 + NaOH  RCOONa + CH3CHO → 0 t 2. (CH3)2C(OH)CN + 2H2O → (CH3)2C(OH)COOH + NH3↑ 12.. . 3CH3COOH + PCl3 → 3CH3COCl + H3PO3 t0 7. (C17H35COO)3C3H5 + 3KOH  C17H35COOK + C3H5(OH)3 → 6. t 0 8. t0  → 4. R-CN + 2H2O → R-COOH + NH3↑ 1) O 2 → 14. CH3COONa(r) + NaOH(r)  CH4 + Na2CO3 → photpho.

sau đó cô cạn dung dịch. (5) Sản phẩm của phản ứng giữa axit và ancol là este. còn (2) không cần đun nóng. (2). a. mạch hở có công thức phân tử CnH2nO2 . còn (2) chỉ một chiều. (3) Este no. Nung Y với NaOH (có mặt CaO) thì được một chất khí là CH4. (1). 7 . và (4). Etyl axetat. (4) Hợp chất CH3COOC2H5 thuộc loại este. (4). C.5 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit benzoic là A. a. c. (1). do đó làm tăng hiệu suất tạo este. c. 15. HOOC – COO – CH2 – CH = CH2 và H – COO – CH2 – CH = CH2. (2) metyl propionat. (1) và (4).. (3). (5). Các tên gọi đúng ứng với este có thể có của công thức phân tử đã cho là A. Câu 1. (4). thu chất rắn Y. HOOC – CH2 – COO – CH = CH2 và CH3 – COO – CH = CH2.6 Ứng với công thức phân tử C4H8O2. B. (3) Để điều chế este của phenol không dùng axit cacboxylic để thực hiện phản ứng với phenol. D. Câu 1. b/ (1) tạo sản phẩm axit. (1). 3. Các nhận định đúng là A. B. chỉ (4). (4). (5). (2). 4. (1). (5). (5) isopropyl fomiat. HOOC – CH = CH – COO – CH3 và CH2 = CH – COO – CH3. c. D.7 Phản ứng thuỷ phân của este trong môi trường axit (1) và môi trường bazơ (2) khác nhau ở các điểm : a/ (1) thuận nghịch. Etyl fomiat. B. (4). (5). D. D. C. C.nghịch. (1). (3).2 Có các nhận định sau : (1) Este là sản phẩm của phản ứng giữa axit và ancol. b. Etyl axetic. có thể thu được este có tên là A. c/ (1) cần đun nóng. Câu 1. (3).BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 1. Câu 1. (2). Vậy công thức cấu tạo của E và F là A. (3). sẽ tồn tại các este với tên gọi : (1) etyl axetat. Các nhận định đúng gồm A. (4). Nhận xét đúng là A.C. Đietyl ete. axit sunfuric vừa làm xúc tác vừa có tác dụng hút nước. (4) Phản ứng este hoá là phản ứng thuận . Đun hỗn hợp X với dung dịch NaOH dư. B. (1). (1). (2). (3). D. (3). C. với n ≥ 2 . (5). (4). HOOC–CH = CH– COO–CH3 và CH3–OOC – CH = CH2. (3) metyl iso-propylonat.1 Khi đun hỗn hợp gồm etanol và axit axetic (có mặt H2SO4 đặc làm xúc tác). (2). B. D. (3). (2). (2). (3). b. Câu 1. (2) Este là hợp chất hữu cơ trong phân tử có nhóm – COO. (2) Không thể điều chế được vinyl axetat bằng cách đun sôi hỗn hợp ancol và axit có axit H2SO4 đặc làm xúc tác. (3). (4). a. còn (2) tạo sản phẩm muối. C. đơn chức. C.4 Hỗn hợp X gồm 2 este mạch hở E (C5H6O4) và F (C4H6O2). (4) propyl fomiat. D. (5). (4). B. 14.3 Xét các nhận định sau: (1) Trong phản ứng este hoá. (1). b. B. Câu 1. C. (4).

(3). (2) Chất béo không tan trong nước. chỉ có (1). D. Câu 1. (1). D. 12. CnH2n + 1COOCmH2m +1. (1). CnH2n – 2O2.11 Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi. (3) và (4).10O6. C. (3). B. C. đơn chức chứa 50%C (về khối lượng) có tên gọi là A. C. B. phenyl axetat. CnH2n .10 Este của glixerol với axit cacboxylic (RCOOH) được một số học sinh viết như sau: (1) (RCOO)3C3H5. CnH2nO2. B. CnH2n – 2O2. Rb(COO)abR’a. B. (2) (RCOO)2C3H5(OH). (4) phản ứng oxi hóa. B. nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. (2). CnH2n .18O12.17 Chất X có công thức phân tử C4H8O2. (4). (5) C3H5(COOR)3.Câu 1. C2H5COOCH3 C. Số lượng công thức cấu tạo của các trieste có thể có trong loại sơn nói trên là A. C. C.9 Công thức tổng quát của este tạo bởi một axit cacboxylic no đơn chức và một ancol no đơn chức (cả axit và ancol đều mạch hở) là A. D. CnH2nO2. (3) phản ứng thuỷ phân. metyl benzoat. B. (4). Câu 1. B. D. Các phát biểu đúng là A. (2). CnH2n . (2). Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức C2H3O2Na. D. (2) phản ứng cộng. Công thức cấu tạo của X là A.15 Este mạch hở. C. Câu 1. (4) (ROOC)2C3H5(OH). phenyl fomiat. vinyl fomiat.6O4. Câu 1. 6. etyl axetat.8 Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là A. Câu 1. C.14 Trong thành phần của một số loại sơn có trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. RCOOR’. X có tên gọi là A. Câu 1. 8. CnH2n+2O2. Câu 1. (2). (1). (3). (4). (1).12 Trong số các phản ứng có thể có của este gồm: (1) phản ứng trùng hợp. D. (3) (HO)2C3H5OOCR. D. 18. Câu 1.13 Những phát biểu sau đây : (1) Chất béo không tan trong nước.16 Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. (4). benzyl fomiat. B. (4). vinyl axtetat. B. HCOOC3H7 B. D. (4) Chất béo là este của glixerol và axit hữu cơ. Câu 1. C. Công thức đã viết đúng là A. CH3COOC2H5 D. (5). (1). (3) Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. metyl axetat. (2). ba chức là A. C. 8 . phản ứng đặc trưng cho mọi este là A. CnH2n -16O12. D. chỉ có (5). (1). HCOOC3H5. (3).

C. y = 0. 1. Câu 1. C. B. B. C. (3).18 Khi đun hỗn hợp 2 axit R1COOH và R2COOH với glixerol (axit H2SO4 làm xúc tác) có thể thu được mấy trieste ? A. (3). (2) và (3). 2. x = 1. (2) metyl axetat.05. x = 1. Khi đạt trạng thái cân bằng trong hỗn hợp có 1. D. số đồng phân có khả năng tác dụng với dung dịch NaOH.2.24 Ứng với công thức phân tử C3H6O2. 1. Metyl propionat. (1). (1) và (2). 1. natri kim loại. 0.25 Tên gọi của este (được tạo nên từ axit và ancol thích hợp) có công thức phân tử C4H6O2 là A.2.05. Câu 1. 2. (1). 1. chỉ có (1). 2.90. (3) metyl metacrylat. 2.20 Số nguyên tử cacbon tối thiểu trong phân tử este không no. (4). B. (4) metyl benzoat. 2. 2. 4. dung dịch AgNO3 trong amoniac lần lượt là A.20. một học sinh gọi tên các đồng phân este có thể có gồm: (1) etyl fomiat. 18. B. B. (3). (4). mạch hở là A. B. B. 2. 2. C. 2. D. D. Câu 1. y = 1.75.Câu 1.26 Cho 2 mol CH3COOH thực hiện phản ứng este hoá với 3 mol C2H5OH. (2).2 mol este tạo thành. Các tên gọi đúng là A. B. y = 0. (4). x. 5. Metyl metacrylat. C. C. C. 6. Câu 1. chỉ có (3). C. x = 1. 2. 3.23 Trong số các đồng phân mạch hở có công thức phân tử C2H4O2. (3) iso propyl fomiat.21 Số nguyên tử cacbon tối thiểu trong phân tử este (được tạo nên từ axit và ancol) no đa chức. Câu 1. Ở nhiệt độ đó hằng số cân bằng Kc của phản ứng este hoá là A. 2.19 Trong số các este: (1) metyl axetat. 2.25 mol ancol và 0. y = 1.4. 1. (1). D. C. 1. 9 . B.80. (2) metyl acrylat. x = 1.00.30 mol axit. este mà polime của nó được dùng để sản xuất chất dẻo gồm A. 5. (4) vinyl fomiat. D. natri cacbonat. 3.22 Đun nóng hỗn hợp gồm x mol axit axetic và y mol etylen glicol (xt H2SO4 đặc). mạch hở là A. Tại thời điểm cân bằng thu được 0. D.75 mol este (không tác dụng với Na). 1. D. y có giá trị là A. D. 3. Câu 1. 2. C.00. 1. 4. (2). 4. Metyl acrylat. 2. Vinyl axetat. Câu 1. Câu 1.

no. có một nối ba.28 Hỗn hợp T gồm 2 chất X. Những câu đúng là đáp án nào sau đây ? A. C. Y thuộc dãy đồng đẳng A. a. Thuỷ phân X bằng dung dịch NaOH dư. Đun hồi lưu hỗn hợp etanol.72 lít (đktc) CO2 và 5. Câu 1. axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. este đơn no. Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất.31 Chất hữu cơ X có công thức phân tử là C5H6O4. Y mạch hở (C. d. Phản ứng xà phòng hoá là phản ứng thuỷ phân este trong môi trường kiềm. nhưng đều tác dụng với dung dịch NaOH khi đun nóng.32 Thuỷ phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng. B. HCOO – CH = CH – CH3. HCOO –C(CH3) = CH2. Chất béo là este của glixerol với các axit béo. b/ Các este không tan trong nước do chúng nhẹ hơn nước. a. B. Đun hồi lưu hỗn hợp axit axetic.4g H2O. D.29 Phát biểu nào sau đây sai ? A. thu 6.30 Cách nào sau đây có thể dùng để điều chế etyl axetat ? A. D. B. propyl fomiat. B. Y (chứa các nguyên tử C. thu được 2 sản phẩm hữu cơ X. C. C. Đốt cháy hoàn toàn m g T. rượu trắng và axit sunfuric đặc. giấm và axit sunfuric đặc. Câu 1. d. Chất E là A. Cho X4 tráng gương được sản phẩm X5. D. CH2 = CH – CH2 – OCOH. C.O) đơn chức đều không tác dụng được với Na. e. D. a. Các axit béo có mạch cacbon không phân nhánh. d/ Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. B. Công thức cấu tạo của X có thể là A. Câu 1. HOOC–COO–CH2–CH = CH2. c. O). c/ Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. Vậy X. e/ Chất béo lỏng là các triglixerit chứa gốc axit không no trong phân tử. Vậy công thức cấu tạo của X là A. Cô cạn X1 được chất rắn X2 và hỗn hợp hơi X3. C. H. c. e. C. Đun hồi lưu hỗn hợp etanol. B. 10 . có 1 nối đôi. b. thu được một muối và một ancol. axit axetic và axit sunfuric đặc.Câu 1. e. Câu 1.H. B. đun nóng. Câu 1. Đun sôi hỗn hợp etanol. C. Glixerol khử nước hoàn toàn cho sản phẩm là acrolein. este đơn. CH2 = CH – OCOCH3. d. b. HOOC–CH2–CH = CH–OOCH. số nguyên tử cacbon chẵn. Cho X5 tác dụng với NaOH lại thu được X2. D.33 Cho các câu sau : a/ Chất béo thuộc loại hợp chất este. HOOC–CH2–COO–CH = CH2. este đơn có 2 nối đôi. etyl axetat. HOOC–CH = CH–OOC–CH3.27 Chất X tác dụng với NaOH cho dung dịch X1. este đơn. D. metyl propionat. Chưng cất X3 thu được chất X4. d. a. isopropyl fomiat. Câu 1. D.

vinyl axetat và etyl fomiat cần phải dùng các thuốc thử là A. axit valeric. 50%. 51%. axit axetic. 11 . axit acrylic. C.6 mol.3 mol. 3. 7. 1. cần thực hiện số lượng phản ứng hoá học ít nhất là A. C. F tác dụng với NaOH tạo ra một ancol T. C3H3O2Na và 2 sản phẩm khác. CH2 CH COOC2H5 . 0. (4) axit axetic. C.5 mol. axit fomic. B. CH3–CH2–COO–CH=CH2 và CH2=CH–COO–CH2–CH3.35 Cho a mol chất béo (C17H35COO)3C3H5 tác dụng hết với NaOH thu được 46g glixerol. B. khi đốt cháy một thể tích ancol T cần 3 thể tích oxi (đo ở cùng điều CH2 CH2 O kiện). C. B.40 Cho 0.39 Trong phòng thí nghiệm có các hoá chất được dùng làm thuốc thử gồm: (1) dd brom. a có giá trị là A.Câu 1. CH3–CH(OH)–CH(OH)–CH=CH2 và CH2=CH–CH2–CH2–COOH.38 Cho 10 gam hỗn hợp X gồm etanol và etyl axetat tác dụng vừa đủ với 50g dung dịch natri hiđroxit 4%. B. 3. D. 8 Câu 1.4 mol.37 Từ nguyên liệu đầu là eten và benzen (xúc tác và điều kiện phản ứng có đủ). 0. Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng A. B. 2.15 mol este đơn chức X (C5H8O2) tác dụng vừa đủ với dung dịch NaOH. phân CH 5 C O. D. Số miligam KOH cần để trung hoà các axit tự do có trong 1 gam chất béo. B. polibutađien và poli(butađienstiren). C. O=HC–CH2–CH2–CH2–CH=O và O=HC–CH(OH)–CH2–CH=CH2. Câu 1.41 F là chất CH có 2 . D. 1. 44%. C. Axit tạo F là A. Câu 1. Công thức cấu tạo của X là A. 5. thu sản phẩm 2 muối C3H5O2Na. (5) cồn iot. D. 0. Câu 1. Số liên kết π có trong gốc hiđrocacbon của axit béo. B. CH2 CH(CH3)COOCH3. 2.36 Đun nóng hỗn hợp X và Y có công thức C5H8O2 trong dung dịch NaOH. D. (3) dd AgNO3/NH3. Để phân biệt 3 este: anlyl axetat. cô cạn dung dịch sau phản ứng thu 21g muối khan. D. 1. Câu 1. Câu 1. 22%. 5. D. C. 1. CH2=CH–CH2–CH2 – COOH và CH3–CH2–CH=CH–COOH. Số miligam NaOH cần để trung hoà các axit tự do có trong 1 gam chất béo. CâuCH3COOCH2 hữu cơ CHcông thứcCH2 tử C2H8O2. để điều chế được ba polime gồm polistiren.6. Số mol KOH cần để xà phòng hoá một gam chất béo. 0. D.34 Chỉ số axit của chất béo là A. Công thức cấu tạo của X và Y là A. B. 3. C. (2) dd NaOH. 2.

1 mol. 12g. Câu 1. D.14g hỗn hợp 2 muối và 3. CH3COOCH3 (1. Biết MY > MX. HCOOCH3. Tên gọi của Y là A. HCOOC2H5. CH3COOCH3.48 lít CO2 (đktc) và 3.2g khí oxi ở cùng điều kiện nhiệt độ.44 Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6.6g Z thu được thể tích bằng thể tích của 3.4g một este X thu được một thể tích hơi bằng thể tích của 3. C.52g H2O. Tên gọi của X là A. D. Etyl fomiat. B. 600 mmHg). B.32 lít (ở 1270C. CH3COOC2H5. C2H5COOCH3 (6. (COOC3H5)2. HCOO – C2H5. B. 0. D. Tên gọi của X là A.48g). . D.6g). Công thức cấu tạo mỗi este và số gam tương ứng là A.49 Đốt hoàn toàn 4.01mol. CH3COOCH3. B.8g este đơn chức. HCOOCH3. mạch hở. C.2g một este E thu được 6.1 mol.42 Đốt cháy hoàn toàn m g hỗn hợp các este no. CH3COOC2H5 (4.2g O2 ở cùng điều kiện nhiệt độ và áp suất. CH3COO – CH2CH2CH3.45 Đốt cháy 6g este E thu được 4. 10g. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối lượng bình tăng 6.43 Cho ancol X tác dụng với axit Y thu được este Z. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A. Câu 1.4375. B. 0.6g một ancol Y. C.48 Đốt cháy hoàn toàn 2. C2H4(COOC2H5)2.2g. etyl fomiat. C. thu 13. X có công thức A. Câu 1. có thể tích 8. C.1 mol X với dung dịch NaOH (đủ). C. Propyl axetat. D. Vậy công thức cấu tạo của E là A. Công thức cấu tạo của E là A.2g ancol đơn chức.4g X với dung dịch NaOH (phản ứng hoàn toàn) thu được sản phẩm có 6. C. CH3COOCH3 (2.36 lít oxi (đktc) thu hỗn hợp CO 2 và H2O có tỉ lệ thể tích tương ứng 6 : 5.6g).16g CO2 và 2. axit metacrylic. metyl axetat. 0. 12 B. D. isopropyl fomiat.8g muối. axit fomic. CH3COOC2H5 (6. Biết E có phản ứng tráng gương với dung dịch AgNO3/NH3. HCOOC2H5 (2. Etyl propionat. HCOO – CH2CH2CH3.46 Thuỷ phân hoàn toàn 8. đơn chức. axit axetic. B. C2H3COOC3H7.50 Đun nóng 0. C. mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4.48g).2g.Câu 1.4g). D.22g). CH(COOCH3)3. B. axit acrylic. C. làm bay hơi 8. áp suất. Nếu đun X trong dung dịch H 2SO4 loãng thu được axit Y có dY / H 2 = 36 và ancol đơn chức Z. Câu 1. Câu 1. B. 0. Câu 1.28g X cần 3.4g muối của axit đa chức và 9. C2H5COOC2H5.4g). 1.68g một ancol Y duy nhất có tỉ khối so với oxi là 1. Câu 1.47 Làm bay hơi 7. C2H5COOCH3 (4. (COOC2H5)2. Etyl axetat. vinyl fomiat.01 mol. Khi thực hiện phản ứng xà phòng hoá 7.6g H2O. Công thức của X là A. Câu 1. 10g. D. D. HCOOC2H5 (1.22g). C2H3COOC2H5.

6g. C17 H 35COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | B.53 Cho 21.56 Tổng số miligam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong một gam chất béo gọi là chỉ số xà phòng hoá của chất béo. Để trung hoà 2. D.5M. 7. Câu 1. 6. Câu 1.8g chất béo cần 3ml dung dịch KOH 0.08g.3 mol NaOH. % khối lượng của X trong hỗn hợp ban đầu và giá trị m là A.2 mol HCl. D. 6. C3H5(OOCH)3. 165.54 Khi thuỷ phân a g một este X thu được 0. Este có thể có công thức cấu tạo nào sau đây? C17 H 35COO C H 2 C17 H 35COO C H 2 | | A.5M thu được 24. HCOOC2H5 16. 3. CH3CH2OOC-COOCH2CH3.Câu 1. 155. 185.4g.1M. B.57 Khi thuỷ phân (xúc tác axit) một este thu được glixerol và hỗn hợp các axit stearic và axit panmitic theo tỉ lệ mol tương ứng bằng 2 : 1.1 mol một ancol Y. C17 H 33COO C H | C15 H 31COOCH 2 D.4g hỗn hợp 2 este đơn chức X. Y cần 200ml dung dịch NaOH 1. 20. B. (C2H5COO)3C2H5. Sau khi phản ứng hoàn toàn. cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và m g một muối khan duy nhất Z. Chỉ số axit của mẫu chất béo trên là A. C. thu 9. CH3–C(COOCH3)3. C15 H 31COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | C. Công thức của X là A. Công thức cấu tạo thu gọn của X là A. 20. 175.6g muối và 0. B. 19. 15. CTCT. CH3CH2COOCH3. Câu 1.4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức). C. m lần lượt là A. Câu 1.67%.82g . B. D.08g. B. 8. C. Câu 1. 6. 7. C. HCOOCH3 66. Lượng NaOH dư được trung hoà hết bởi 0.8g chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0. C. C3H5(COOCH3)3.82g.0g.82g . C3H5(COOCH3)3.4g.20%. 8. C. 7. 18. (CH3COO)3C3H5.55 Trong chất béo luôn có một lượng axit béo tự do.1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0. C15 H 31COO C H | C15 H 31COOCH 2 13 .2g . CH3COOCH3 19.02g natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa). Câu 1. D. 16. (HCOO)3C3H5. D.2g. Vậy chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa 89% tristearin là A.52 Để xà phòng hoá hoàn toàn 19.18%.51 Xà phòng hoá hoàn toàn 0. D.2g ancol Y và 20. 8. Giá trị của a. 8.92g glixerol.2g . Số miligam KOH dùng để trung hoà lượng axit béo tự do trong một gam chất béo gọi là chỉ số axit của chất béo. B.

58 Trong chất béo luôn có một lượng axit béo tự do. Khi thuỷ phân hoàn toàn 2. (C15H29COO)3C3H5. 988kg. (1).82g. (3) (C17H31OOC)2C3H5OOCC17H29. Câu 1. (3). Biết X tác dụng với KOH tạo ra 2 chất hữu cơ. giả sử hiệu suất quá trình đạt 90% là A. 125g. Câu 1. C. D. (2).2kg. (4). 929. D. iso propyl fomiat.64 Đun nóng 215g axit metacrylic với 100g metanol (với Hpứ = 60%). (2). D. Tên X là A. 30% tripanmitoyl glixerol (panmitin) và 20% tristearoyl glixerol (stearin) về khối lượng) khi xà phòng hoá bằng natri hiđroxit. D.61 Khối lượng xà phòng thu được từ 1 tấn mỡ động vật (chứa 50% trioleoyl glixerol. C3H6O2. 2. 8.62 Thuỷ phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1. B. C. metyl axetat. Câu 1.3kg. etyl axetat.58g hỗn hợp Y gồm muối của axit linoleic và axit oleic. 10. (C15H31COO)3C3H5. D.90g.787kg. Giá trị của a là A. C. 8.92g glixerol và 9. metyl propionat. 175g. (2) C17H31COOC3H5(OOCC17H29)2. (1). D.84g glixerol và 18. (2). (4). Câu 1. (2).59 Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH.84kg. B. C. Công thức cấu tạo có thể có của các trieste đó là : (1) (C 17H31COO)2C3H5OOCC17H29. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng lớn hơn khối lượng X đã phản ứng. Câu 1.61kg. B.60 Đun sôi a g một triglixerit X với dung dịch KOH cho đến khi phản ứng hoàn toàn. (C17H33COO)3C3H5.145kg chất béo. Câu 1.63 Đốt cháy 3. C. C.65 Một chất hữu cơ X có d X CO2 = 2 .24g muối của axit béo duy nhất. 889. B. 9. (3). 7. 3. 14 . B. 3. 917kg.7g chất hữu cơ X cần dùng 3.92 lít O2 (đktc) thu được CO2 và H2O có tỉ lệ mol 1:1.91g.Câu 1. Khối lượng xà phòng 60% (về khối lượng) thu được là A. (C17H35COO)3C3H5. Chất béo đó là A. C. Vậy công thức phân tử của X là A. B.3kg NaOH. thu 0. D. Những công thức đúng là A.92kg. B.92g. (4). Khối lượng este metyl metacrylat thu được là A. C4H8O2. Câu 1. cần dùng 0. B. C3H4O2. (1). C. C2H4O2. 150g. và mg hỗn hợp muối Na. 100g. (4) (C17H31OCO)2C3H5COOC17H29. thu được 0. D.092kg glixerol.

H-COOCH3. Nhận định nào sau đây là sai ? A. B. B.2g hỗn hợp gồm 2 este đồng phân. C.4g este E thuỷ phân trong dung dịch NaOH thì thu được 8. Công thức cấu tạo của X là A. Câu 1. Câu 1. CH3COOCH3. 6. Câu 1. Công thức của este E là A. thu được muối có khối lượng bằng khối lượng 37 este ban đầu. hai chất Y và Z có số mol bằng nhau. C. D. isopropyl fomiat. C. etyl fomiat. 7. (CH3COO)2C2H4.66 Este X có d X / H 2 = 44 . D. Cho một lượng X tác dụng hoàn 41 toàn với dung dịch NaOH vừa đủ.015 mol H2. (CH3COO)3C3H5. Trong X chắc chắn có một este với công thức và số mol tương ứng là A. 0. 15 . CH3COOCH3.492g muối khan (hao hụt 6%). C. HCOO – CH2 – CH = CH2. D. B.67 Xà phòng hoá 22. CH2 = CH – COO – CH3.70 Cho 7.Câu 1. D. B. 02 .2 mol. Tên gọi của X là A. Đốt cháy hỗn hợp X sẽ thu được nCO2 − nH 2O = 0.71 X là một este hữu cơ đơn chức. C. CH2=CH–COOCH3. D. B.21g hỗn hợp X gồm hai chất hữu cơ Y và Z cùng nhóm chức với dung dịch NaOH dư. Cho lượng 10 chất L phản ứng với Na được 0. Trong hỗn hợp X.72 Thuỷ phân este X (C4H6O2) trong môi trường axit ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. H – COOC2H5 0. mạch hở.15 mol D. C. 8. thu 20. Tên gọi của L là ancol anlylic. Thuỷ phân X tạo nên 2 hợp chất hữu cơ X1. CH3 – CH = CH – OCOH. Câu 1. CH3 – COOC2H3 0.2 mol. D. C. X là A. Nung một trong hai muối thu được với NaOH (vôi tôi – xút) sẽ tạo metan. metyl propionat. CH3 – COOCH3 0. H – COOC2H5 0. Nếu đốt cháy cùng một lượng X1 hay X2 sẽ thu được cùng một thể tích CO2 (ở cùng nhiệt độ và áp suất). 625 ). CH2 = CH – OCO – CH3.69 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit ađipic là A. CH3(CH2)2COOCH3. Chất L 1 phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. etyl axetat. B. Câu 1. C17H35COO(CH2)16CH3. II – BÀI TẬP NÂNG CAO Câu 1. B.2g muối natriaxetat. thu được hỗn hợp muối natri của hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và một chất lỏng L (tỉ khối hơi d L / CH 4 = 3.15 mol. X2. cần dùng 12g NaOH.68 Đun nóng 3.

74 Đun hợp chất X với H2O (xúc tác H+) được axit hữu cơ Y ( dY / N2 = 2. Đốt cháy 0. Cho hơi Z qua ống bột đựng Cu xúc tác đun nóng thì sinh ra chất T có khả năng tham gia phản ứng tráng gương. D. Câu 1. B. D. ancol isopropylic. CH3CH2CH2OH Câu 1. X: C2H4O2. A. axit metacrylic. axit axetic. X: C2H4O2. Metyl axetat. CH3COOCH=CH2. Metyl propionat. Biết Z là ancol đơn chức.4g muối của axit hữu cơ X và 9. Biết rằng một trong 2 chất (X hoặc Y) tạo thành este là đơn chức. D. X: CH2O2. Y: C3H8O. Tên gọi của X.1 mol este E (chứa một loại nhóm chức) cần dùng vừa đủ 100g dung dịch NaOH 12%. CH3COOCH2CH3. D. ancol benzylic. CH3CH2OH.8g X thì cần 3. CH3OCO− CH=CH2. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng bằng lượng 22 este đã phản ứng. thu được 20. ancol anlylic.73 Một este X tạo bởi axit đơn chức và ancol đơn chức có tỉ khối với He bằng 17 22. Nung X với vôi tôi xút thu được ancol Y và muối vô cơ Z. C.2g ancol Y.76 3. Y lần lượt là A. B. axit fomic. sau phản ứng thu được một muối và một anđehit. Tên X là A. CTCT của este không thể là A. HCOOCH(CH3)CH3. C. Isopropyl fomiat. Khi bị oxi hoá chất Y chuyển thành anđehit.77 Thuỷ phân hoàn toàn 0. Để đốt cháy hoàn toàn 2. ancol propylic. Xác định công thức phân tử và gọi tên X. CH2− O C.Câu 1.9g một este đơn chức (mạch hở) tác dụng vừa đủ với 150ml dung dịch KOH 1M. Y. glixerol. D.52g một este E của axit cacboxylic no đơn chức và ancol no đơn chức (cả hai đều mạch hở) phản ứng vừa hết với 40ml dung dịch NaOH 1M.6g chất Y cho 1. glixerol. CTCT của este E và chất Y là (giả sử các phản ứng đều đạt 100%) A. C. CH3− CH− 2 CH 2 2 O O − C=O.78 Cho 12. C2H5− CH− C=O. axit propionic. B. HCOOCH2CH=CH2. Câu 1. Công thức cấu tạo của E là A. Câu 1. C2H5COOCH3. axit axetic. Etyl axetat. glixerol.57 ) và ancol Z.92 lít O2 (đktc) và thu được VCO : V H O = 3 : 2 . D.75 Xà phòng hoá một este no đơn chức E bằng một lượng vừa đủ dung dịch NaOH chỉ thu được một sản phẩm X duy nhất. B. CH3CH2OH. X: C3H6O2. axit valeric. C. HCOOCH=CH–CH3. Đốt cháy hoàn toàn Y thu được CO 2 và H2O có tỉ lệ thể tích 3 : 4. Y: C3H8O3. thu được chất X và chất Y. C. Câu 1. ancol etanol. Biết oxi hoá X bằng CuO đun nóng được sản phẩm có phản ứng tráng gương. CH3CH2OH. axit acrylic. CH2− 2 CH C=O. Y: C3H8O3. 16 . B. B. HCOOCH=CH–CH3 và CH3COOCH=CH2.32g CO2. Y: C3H8O3. HCOOCH2CH2CH3. axit acrylic.

2g NaOH. 8. anlyl butyrat. phenyl fomiat. etyl valerat. Cho 10g E tác dụng với lượng NaOH vừa đủ. (H–COO)3C3H5.79 Đốt cháy 1.10kg natri hiđroxit. etyl propionat. Số lượng CTCT thoả mãn tính chất đã nêu của E là A. (CH2=C(CH3)–COO)3C3H5. benzyl fomiat.14%. D. C2H5OOC–C6H4–COOC2H5 D. 108. C. C.245kg.00g muối khan G. 47. C. Muốn trung hoà dung dịch chứa 0.01 mol este của một ancol đa chức với một axit cacboxylic đơn chức cần dùng 1.82 Muốn thuỷ phân 5.05g muối. B. Câu 1. Cho G tác dụng với axit vô cơ loãng thu được G 1 không phân nhánh. Thành phần % khối lượng của etyl axetat trong hỗn hợp là A.89kg.2M. Câu 1. B. Khi a = 5.83 Đun a gam este mạch không phân nhánh CnH2n+1COOC2H5 với 100ml dd KOH. khối lượng muối natri thu được là A. X khử được AgNO3 trong amoniac. D. vinyl pentanoat. D. C2H5O–C6H4–COOC2H5. 103.6kg. 2. etyl butyrat. (CH3COO)2C2H4. D. Mặt khác muốn trung hoà 20ml dd KOH ban đầu phải dùng 15ml dd H2SO4 nói trên.Câu 1. B.80 Để xà phòng hoá 100kg dầu ăn thuộc loại trioleoyl glixerol có chỉ số axit bằng 7 cần 14. Câu 1. Y lần lượt là A. C. Câu 1. (D = 1. Tên gọi của este đó là A.08g/ml).5ml NaOH 0. B.16%. 36. Giả sử phản ứng xảy ra hoàn toàn.152g H2O.6g hỗn hợp etyl axetat và etyl fomiat cần 25.52g CO2 và 1.5M để trung hoà KOH còn dư.35g este đó cần 3g NaOH và thu được 7. CTCT của este là A. 52.9035g X cần 54. B.81 Khi thuỷ phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. CH3–C6H4–COOC2H5. C.8g thì tên gọi của este là A.60g một este E đơn chức được 3. C2H5OOC–C3H4–COOC2H5. Câu 1. Sau phản ứng phải dùng 25ml dd H2SO4 0.445kg. 100 < M X < 200 . B.18%. Mặc khác để thuỷ phân 6. D. 50. cô cạn dung dịch sau phản ứng thu được 14. 6. B. D. 17 . C. Câu 1. etyl axetat.85 Để thuỷ phân 0. 117. Biết rằng H 2O n 86 CTCT thu gọn của X.84 Thuốc chống muỗi (DEP) thu được khi cho axit thơm (X) tác dụng với ancol Y. 4. C.96ml NaOH 10%.20%. Trong ancol = dung dịch ancol Y 94% (theo khối lượng) tỉ số mol n 14 . còn Y tác dụng với nước brom sinh ra kết tủa trắng. 118. (CH2=CH–COO)3C3H5.

thu được 8. Câu 1. cần dùng 30ml dd NaOH 1M. 191. 90. 18 . 3. (CH3)2CH-COOC2H5 và (CH3)2CHCH2COOCH3. 2.05 mol khí.920. propyl fomiat.19%. 1 để trung hoà dung dịch thu được. D. 173. B. Phần trăm về khối lượng của một trong hai glixerit phải là A. Câu 1. C. vinyl axetat. D.05. B. Câu 1. C. 2. Số CTCT của E và CTCT của các axit X. Y.5M. (CH3)2CHCOOH. Sau khi kết thúc phản ứng. 3. Tên gọi của hai este là A.6g hỗn hợp muối.88 Đun nóng hỗn hợp hai chất đồng phân (X. CH3CH2CH2CH2COOH. CH3CH2CH2COOH. 192.87 Để xà phòng hoá hoàn toàn 2. 18. Khi cho 3. 273.9g hỗn hợp ancol trên tác dụng hết với Na thu được 0. (CH3)2CHCOOH. (CH3)2CHCOOH. 86.20%. D.18%. etyl axetat. Z lần lượt là A.2M.Câu 1. CH3(CH2)3COOH. B.3M. 228. C. mạch hở. Cho hỗn hợp muối đó tác dụng H2SO4 dư được hỗn hợp 3 axit X. Y là A. A. isopropyl fomiat. Z. Câu 1. thu được hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và hai ankanol. etyl fomiat. 188. Chỉ số iot của chất béo được tạo nên từ axit linoleic là A. 22. C. CH3CH2CH2COOH. 196. 190.1%. D.22g hỗn hợp hai este là đồng phân X và Y. Y) với dung dịch H2SO4 loãng. Biết hiệu suất quá trình este hoá và quá trình trùng hợp lần lượt là 60% và 80%. 287. Biết rằng các gốc hiđrocacbon đều có độ phân nhánh cao nhất. B. D. Y. 215kg và 80kg. CH3COOC(CH3)3 và CH3CH2COOCH(CH3)2. B. metyl acrylat. Câu 1. D. B. (CH3)2CHCOOH.86 Đun 20g lipit với dung dịch chứa 10g NaOH.90 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu.9g A với NaOH cho tới phản ứng hoàn toàn. Đun 7. HCOOC(CH3)3 và CH3COOCH(CH3)2. C. C.188.868. D. Phân tử 10 khối trung bình của các axit béo trong thành phần cấu tạo của lipit và chỉ số xà phòng hoá của lipit và lần lượt là A. Z là đồng đẳng kế tiếp của Y và có mạch cacbon không phân nhánh. CH3(CH2)3COOH.92 Một mẫu chất béo chứa gồm trilein và tripanmitin có chỉ số iot là 19.736. 85. B. Khi đốt cháy hoàn toàn hỗn hợp hai este đó thì thu được khí CO2 và hơi nước với tỉ lệ thể tích VH2O :VCO2 = 1:1 . Câu 1.91 Số gam iot có thể cộng vào liên kết bội trong mạch cacbon của 100g chất béo được gọi là chỉ số iot của chất béo. CH3CH2CH2CH2COOH. 20. CTCT của X. 65kg và 40kg. (CH3)3CCOOH. metyl propionat. 20. (CH3)3CCOOH. C. để trung hoà NaOH dư phải dùng 10ml HCl 0. metyl axetat. trong đó X và Y là đồng phân của nhau. 286. Hoà tan 1g hỗn hợp axit trên vào 50ml NaOH 0.89 E là este của glixerol với một số axit monocacboxylic no. 170kg và 80kg. (CH3)2CH-COOC2H5 và (CH3)3COOCH3.5kg và 41kg. cần dùng 90ml dung dịch HCl 0.

Fructozơ là đồng phân của glucozơ. Trong dung dịch. cấu tạo bởi C 1 của gốc α . do đó có thể mở vòng tạo thành nhóm anđehit (– CHO). hai dạng vòng này chiếm ưu thế và luôn chuyển hoá lẫn nhau theo một cân bằng qua dạng mạch hở. fructozơ có sự chuyển hoá thành glucozơ. glucozơ tồn tại chủ yếu ở hai dạng α -glucozơ và β glucozơ (dạng mạch vòng).CHƯƠNG II. nên không có khả năng mở vòng. Trong thiên nhiên. 19 . cấu tạo bởi một nhóm cacbonyl ở C1 (là anđehit) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]4CHO. H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 1 OH H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 6 CH2OH 5 OH 3 H O H 2 OH H OH 1 O C 1 H H 4 OH α -glucozơ glucozơ β -glucozơ Glucozơ có đầy đủ các tính chất của rượu đa chức và anđehit đơn chức. Cấu trúc phân tử a) Glucozơ và fructozơ (C6H12O6) Glucozơ là monosaccarit. CACBOHIĐRAT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. cấu tạo bởi C1 của gốc α .hoặc β . CH2OH[CHOH]3-CO-CH2OH CH2OH[CHOH]4CHO b) Saccarozơ và mantozơ (C12H22O11) Saccarozơ là một đisaccarit. Đơn vị monosaccarit thứ hai có nhóm OH semiaxetal tự do. cấu tạo bởi một nhóm cacbonyl ở vị trí C2 (là xeton) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]3COCH2OH. Mantozơ là đồng phân của saccarozơ. Trong phân tử không còn nhóm OH semiaxetal.glucozơ qua nguyên tử O (C1 – O – C4).glucozơ nối với C4 của gốc α .glucozơ nối với C2 của gốc β fructozơ qua nguyên tử O (C1 – O – C2). Cùng với dạng mạch hở fructozơ có thể tồn tại ở dạng mạch vòng 5 cạnh hoặc 6 cạnh H OH 2 H O OH H 5 2 1 O H O OH H 5 1 CH2OH 2 OH H 3 OH O OH H 5 HOCH2 3 1 OH 4 CH2OH H 6 HOCH2 3 OH H 4 CH2OH 6 4 CH2OH H 6 α -fructozơ fructozơ OH- β -fructozơ Trong môi trường bazơ.

phân tử không có nhóm CHO và các nhóm OH bị che lấp đi. cấu tạo bởi các mắt xích α -glucozơ liên kết với nhau thành mạch xoắn lò xo. (*) phản ứng trong môi trường kiềm. cấu tạo bởi các mắt xích β -glucozơ liên kết với nhau thành mạch kéo dài. không yêu cầu viết sản phẩm. phân tử không có nhóm CHO và mỗi mắt xích còn 3 nhóm OH tự do. 2. Xenlulozơ là đồng phân của tinh bột. nên công thức của xenlulozơ còn có thể viết [C6H7O2(OH)3]n. Tính chất hoá học Cacbohiđrat Glucozơ Tính chất T/c của anđehit + [Ag(NH3)2]OH T/c riêng của –OH hemiaxetal + CH3OH/HCl T/c của poliancol + Cu(OH)2 T/c của ancol (P/ư este hoá) + (CH3CO)2O Ag↓ + Ag↓ Fructozơ Saccarozơ Mantozơ Tinh bột Xenlulozơ Metyl glucozit - - Metyl glucozit - - dd màu xanh lam dd màu xanh lam dd màu xanh lam dd màu xanh lam - - + + + + + Xenlulozơ triaxetat Xenlulozơ trinitrat + + HNO3/H2SO4 P/ư thuỷ phân + H2O/H+ P/ư màu + I2 - + + + + - Glucozơ + Fructozơ Glucozơ Glucozơ Glucozơ - - - - màu xanh đặc trưng - (+) có phản ứng. (-) không có phản ứng.c) Tinh bột và xenlulozơ (C6H10O5)n Tinh bột là polisaccarit. 20 .

CH 2 OH[CHOH]4 CHO + 2[Ag(NH 3) 2]OH  CH 2OH[CHOH] 4COONH 4 +2Ag ↓ + glucozơ amoni gluconat Men röôï u 5. CH2OH[CHOH]3COCH2OH ← CH2OH[CHOH]4CHO  12. C6H12O6  2C2H5OH + 2CO2↑ → o Ni.t0 Men lactic 6.CaO.CH2OH[CHOH]4CHO+5CH3COOH ← CH3COOCH2[CHOOCCH3]4CHO  Xt. 6 CH2OH H 4 OH 5 OH 3 H O H 2 OH H 1 OH H 6 CH2OH 5 OH 3 H OH − O H 2 OH H 1 + HOCH3 HCl 4 OH + H2O OCH3 metyl α -glucozit  → 11.CaO. C12H22O11 + H2O  C6H12O6(Glucozơ) + C6H12O6(Fructozơ) → → 15. C6H12O6  2CH3–CHOH–COOH → Axit lactic (axit sữa chua) Men → 7. (C6H10O5)n + nH2O t0  → xt: H + (Glucozơ) nC6H12O6 (Xenlulozơ) (Glucozơ) Ca(OH)2 9.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP  → 1. C12H22O11. CH2OH[CHOH]4CHO + 2Cu(OH)2  CH2OH[CHOH]4COOH + Cu2O↓ + → +2H2O t → 3NH 3 + O H 2 4. C12H22O11 + Ca(OH)2 + H2O  C12H22O11. CH2OH[CHOH]4COOH + Fe  tạo phức màu vàng xanh. → H 2SO4 loaõ g n 14.2H2O 16. t 0 cô n nC6H12O6 21 . CH2OH[CHOH]4CHO + Br2 + H2O  CH2OH[CHOH]4COOH + 2HBr → 3+ 13. (C6H10O5)n + nH2O  → hoaë men c Axit voâ loaõ g.2H2O + CO2  C12H22O11 + CaCO3↓ 2H2O + → 17.t0 (pentaaxetyl glucozơ) + H2O 2.B . 6H–CHO → C6H12O6 10. CH2OH[CHOH]4CHO + H2  CH2OH[CHOH]4CH2OH → Sobit (Sobitol) t0 3. (C6H10O5)n + nH2O  nC6H12O6 Hoaë H+ c (Tinh bột) 8.

ngược lại. Cacbohiđrat là những hợp chất hữu cơ tạp chức và đa số chúng có công thức chung là Cn(H2O)m. 1.2g. ngược lại. C. 2 loại.0g. t cô n 19.tinh bột 18. (C6H10O5)n + nH2O  nC6H12O6 → xenlulozơ glucozơ H 2SO4 ñ. phản ứng với CuO và với dung dịch AgNO3 trong amoniac. phản ứng với Cu(OH)2 và với dung dịch AgNO3 trong amoniac. 2. C. Câu 2. 4 loại. D. [C6H7O2(OH)3]n + 3nHONO2  [C6H7O2(ONO2)3]n + 3nH2O → (HNO3) xenlulozơ trinitrat C.BÀI TẬP CƠ BẢN Câu 2. 43. 68.1 Tìm từ thích hợp để điền vào chỗ trống trong đoạn văn sau: Ở dạng mạch hở glucozơ và fructozơ đều có nhóm cacbonyl. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)m. 2. fructozơ có thể chuyển hoá thành … và … A. 21. Cacbohiđrat là những hợp chất hữu cơ tạp chức. Câu 2.5 Để tráng bạc một chiếc gương soi. 3 loại.2g. Trong môi trường bazơ. Khối lượng bạc đã sinh ra bám vào mặt kính của gương và khối lượng AgNO 3 cần dùng lần lượt là (biết các phản ứng xảy ra hoàn toàn) A. B. t 0 20. mantozơ. D. ngược lại. B.2g. B. 1 loại. D. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)n. B. D. phản ứng với Na và với dung dịch AgNO3 trong amoniac. người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac.BÀI TẬP TRẮC NGHIỆM I. B.0g. C. 2. 34. 2. nhưng trong phân tử glucozơ nhóm cacbonyl ở nguyên tử C số …. Câu 2.0g. 43. phản ứng với NaOH và với dung dịch AgNO3 trong amoniac.2 Cacbohiđrat là gì? A. 1.4 Những thí nghiệm nào chứng minh được cấu tạo phân tử của glucozơ? A.6g.0g. 22 . D.3 Có mấy loại cacbohiđrat quan trọng? A. 68. glucozơ. 68. 1. glucozơ. còn trong phân tử fructozơ nhóm cacbonyl ở nguyên tử C số…. glucozơ. 43. 2. glucozơ. 6nCO2 + 5nH2O Dieä luï p c  → a/ s maë trôø t i glucozơ (C6H10O5)n 0 Axit voâ loaõ g. C. Câu 2. C.

saccarozơ và anđehit axetic có thể dùng chất nào trong các chất sau làm thuốc thử ? − A. A.12 Chọn câu phát biểu sai: A. glixerol. lòng trắng trứng và rượu etylic. khi đun nóng lòng trắng trứng đông tụ. [Ag(NH3)2]OH. Câu 2. dung dịch HNO3 đặc. D. D. glucozơ và axit axetic.6 Phương án nào dưới đây có thể phân biệt được saccarozơ.10 Chọn cách phân biệt các dung dịch sau đây: Lòng trắng trứng. Cho từng chất tác dụng với dung dịch iot. dung dịch AgNO3/NH3. Chỉ dùng một thuốc thử nào sau đây để phân biệt chúng. C. ancol etylic. HNO3.7 Để phân biệt các dung dịch glucozơ.Câu 2. KOH và axit axetic. Na kim loại. dung dịch brom. Saccarozơ là một đisaccarit. C. B.11 Có 4 dung dịch loãng không màu gồm: Lòng trắng trứng. còn lại glixerol. AgNO3/NH3. C. dung dịch HNO3. Tinh bột và xenlulozơ đều là polisaccarit. chỉ khác nhau về cấu tạo của gốc glucozơ. Glixerol tác dụng Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng.9 Để phân biệt các chất: Glucozơ. B. Câu 2. Cả B. Câu 2. C. tinh bột và xenlulozơ đều cho một loại monosaccarit. B. NaOH. B. hồ tinh bột. Khi thuỷ phân đến cùng saccarozơ. B. Cho từng chất tác dụng với vôi sữa Ca(OH)2. Iot làm hồ tinh bột hoá xanh. Câu 2.8 Có bốn lọ mất nhãn chứa: Glixerol. D. C. còn lại lòng trắng trứng. Cu(OH)2/OH . Câu 2. C. dung dịch KMnO4. Hoà tan từng chất vào nước. còn lại hồ tinh bột. C đều đúng. 23 . glixerol. B. A. tinh bột và xenlulozơ ở dạng bột? A. Nước brom. có thể chỉ dùng một thuốc thử nào sau đây? − A. Cho từng chất tác dụng với dung dịch HNO3/H2SO4. glixerol tác dụng với Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. D. Cu(OH)2/OH . sau đó đun nóng và thử với dung dịch iot. D. B. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên ? A. Iot làm hồ tinh bột hoá xanh. glixerol. lòng trắng trứng tác dụng Cu(OH)2 cho màu xanh tím. Cu(OH)2 trong môi trường kiềm. anđehit axetic. D. Câu 2. dung dịch HCl. C. dung dịch CuSO4.

20 Nhóm gluxit đều có khả năng tham gia phản ứng tráng gương là A. Khối lượng AgNO3 cần dùng và khối lượng Ag tạo ra lần lượt là (giả thiết rằng. D.74g.15 Để tráng bạc một số ruột phích. saccarozơ.18 Tính khối lượng glucozơ tạo thành khi thuỷ phân 1kg mùn cưa có 50% xenlulozơ.5g. B. glucozơ và saccarozơ. 0. fructozơ. Saccarozơ. tinh bột và xenlulozơ đều cho glucozơ. glucozơ và xenlulozơ. D. D.90kg. không mùi. D. saccarozơ và tinh bột. B. Câu 2. B. Giả thiết hiệu suất phản ứng là 80%. Câu 2. 102.444kg. Câu 2. tất cả các chất đã cho.19 Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. Câu 2.80kg. khối lượng ancol thu được là A.8g. tinh bột. B. xenlulozơ. Chất đó là chất nào trong các chất sau ? A. Glucozơ. 0. glucozơ. A. 0. Glucozơ. C. B.17 Khi thuỷ phân 1kg bột gạo có 80% tinh bột. phản ứng xảy ra hoàn toàn.0g.500kg. xenlulozơ. D. C. người ta phải dùng 100g saccarozơ. glucozơ và tinh bột. Glucozơ. Câu 2.6g. axit axetic. D.8g. 52.D. glucozơ và fructozơ. glucozơ. 28. fructozơ. sự chuyển hoá của fructozơ là không đáng kể và hiệu suất các phản ứng đều đạt 90%) A. fructozơ và saccarozơ. dễ tan trong nước. mantozơ. glucozơ. C. glucozơ. fructozơ. xenlulozơ. tinh bột. thì khối lượng glucozơ thu được là bao nhiêu ? Giả thiết rằng.690kg. fructozơ. 52.4g.0g. Saccarozơ. chỉ có glucozơ. 91. C. A.13 Cùng là chất rắn kết tinh. C. 64.8g.5g. Glucozơ. B.89kg. Câu 2. Khi thuỷ phân đến cùng. B. 23. C. 27. 0. 24 . C. tinh bột. không màu. Câu 2.0g. thu được 50g kết tủa. Mantozơ. 88. D. 50. khí CO2 tạo thành được dẫn qua dung dịch nước vôi trong dư. C. 0. mantozơ. 0.555kg. B. hex-3-en. biết hiệu suất lên men là 80%.74g. Câu 2. Chất vừa có tính chất của ancol đa chức. C. xenlulozơ. 18. D. sacacrozơ. Chất này có thể lên men rượu (ancol). 0.21 Cho glucozơ lên men tạo thành ancol. fructozơ. có vị ngọt là tính chất vật lí và trạng thái tự nhiên của nhóm chất nào sau đây? A.99kg. tinh bột. fructozơ.16 Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol là 1:1.14 Cho các chất glucozơ. 0. B. Saccarozơ. saccarozơ. 91. vừa có tính chất của anđehit là A. D. Câu 2.

448. C6H12O6 + CuO  → Dung dịch màu xanh n D. C. B. nhiệt độ. Saccarozơ. xenlulozơ.23 Nhóm gluxit khi thuỷ phân hoàn toàn đều chỉ tạo thành glucozơ là: A. H2/Ni . B. mantozơ. Trong dung dịch. B. C. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. 25 . Câu 2. [Ag(NH3)2]OH. C6H12O6 + Cu(OH)2  → kết tủa đỏ gạch n B. B. D. C.22 Chọn sơ đồ phản ứng đúng của glucozơ A. C6H12O6  m e → C2H5OH + O2 Câu 2.103 lít. C6H12O6  m e → CH3–CH(OH)–COOH C. Mantozơ. [Ag(NH3)2]OH.Câu 2.26 Glucozơ tác dụng được với tất cả chất trong nhóm chất nào sau đây? A. Câu 2. mantozơ. xenlulozơ. C. Câu 2. D. H2O/H+.28 Chọn câu phát biểu đúng: A. tinh bột. Phân biệt mantozơ và saccarozơ bằng phản ứng tráng gương. đun nóng. Phân biệt glucozơ và fructozơ bằng phản ứng tráng gương.03% thể tích không khí. [Ag(NH3)2]OH. Saccarozơ. B. Glucozơ và fructozơ là đồng phân cấu tạo của nhau. Saccarozơ. 112. Phân biệt tinh bột và xenlulozơ bằng I2. Cu(OH)2. CH3COOH/H2SO4 đặc.25 Biết CO2 chiếm 0. nhiệt độ.27 Chọn câu phát biểu sai: A. Cu(OH)2. Cu(OH)2. nhiệt độ.103 lít. Na2CO3. C. H2/Ni . 336. NaOH. xenlulozơ. Câu 2. Metyl α . thể tích không khí (đktc) cần cung cấp cho cây xanh quang hợp để tạo 162g tinh bột là A. Câu 2. Tinh bột có cấu trúc phân tử mạch không phân nhánh. D. tinh bột. đun nóng. Phân biệt glucozơ và saccarozơ bằng phản ứng tráng gương. D. H2/Ni. H2/Ni . Phân biệt saccarozơ và glixerol bằng Cu(OH)2. glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở. tinh bột. D.103 lít. Cu(OH)2.glucozit không thể chuyển sang dạng mạch hở. [Ag(NH3)2]OH.24 Phát biểu nào sau đây không đúng ? A. B.103 lít. nhiệt độ. mantozơ. 224.

Câu 2. Câu 2. C. tinh bột. Glucozơ. etanol. mantozơ. (C6H12O6)n. fructozơ thành những sản phẩm giống nhau là A. D. [Ag(NH3)2]OH. (C6H10O5)n.31 Phản ứng khử glucozơ là phản ứng nào sau đây ? A. quá trình oxi hoá. CxHyOz. D. n có giá trị là A. D. D. phản ứng tráng gương. B. D. 1000. etanol. D. tinh bột.34 Thuốc thử phân biệt glucozơ với fructozơ là A. D. Khối lượng tinh bột cần dùng là A. 56g. Phân biệt saccarozơ và glixerol bằng phản ứng thuỷ phân. B. 60g. etanol. men C.25g. fructozơ.39 Cacbohiđrat khi thuỷ phân tạo ra 2 phân tử monosaccarit là 26 . D. Câu 2. Câu 2. 56. Glucozơ + [Ag(NH3)2]OH. B. to. glucozơ. Câu 2. (C6H10O5)n. phản ứng với H2/Ni.32 Để điều chế 45g axit lactic từ tinh bột và qua con đường lên men lactic. Câu 2. C. phản ứng với kim loại Na. Glucozơ. asmt → Câu 2. Cu(OH)2. phản ứng với Cu(OH)2. B. [C6H7O2(OH)3]n. D. là phản ứng Clorofin hoá học chính của quá trình nào sau đây? A. Câu 2. B.33 Phản ứng chuyển glucozơ.nH2O.C.29 Phương trình: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. hiệu suất thuỷ phân tinh bột và lên men lactic tương ứng là 90% và 80%. Cn(H2O)m. D. C. C. Câu 2. C. [C6H7O2(OH)3]n. Glucozơ + Cu(OH)2. 50g. C. (C6H10O5)n. B. quá trình khử. o C. Glucozơ. Y lần lượt là A. B. dung dịch Br2.30 Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → sobit. Glucozơ + H2/Ni . Glucozơ → etanol. quá trình quang hợp. C. saccarozơ. Tên gọi X.36 Công thức phân tử và công thức cấu tạo của xenlulozơ lần lượt là A. Câu 2. [C6H7O2(OH)2]n. 1500. 950. quá trình hô hấp.38 Gluxit không thể thuỷ phân được nữa là A. R(OH)x(CHO)y. [C6H7O2(OH)3]n. xenlulozơ. t .37 Một polisaccarit (C6H10O5)n có khối lượng phân tử là 162000u. C. 900. Glucozơ. Dung dịch mantozơ có tính khử và bị thuỷ phân thành glucozơ. B. H2. C.35 Cacbohiđrat (gluxit) là những hợp chất hữu cơ tạp chức và có công thức chung là A. D. B. Câu 2. xenlulozơ. mantozơ. B.

C. saccarozơ. tinh bột. phản ứng cộng hiđro. phản ứng tráng gương.45 Sobit (sobitol) là sản phẩm của phản ứng A. Câu 2. oxi hoá glucozơ bằng [Ag(NH3)2]OH. đều có trong biệt dược “huyết thanh ngọt”. B. mantozơ. Câu 2. B. glucozơ. I2. D.41 Polisaccarit khi thuỷ phân đến cùng tạo ra nhiều monosaccarit là A. C. 0. C. B. 0. Cu(OH)2 ở nhiệt độ thường.44 Để xác định trong nước tiểu của người bị bệnh tiểu đường có chứa một lượng nhỏ glucozơ. amilopectin. Câu 2. phản ứng tráng gương.47 Tinh bột trong gạo nếp chứa khoảng 98% là A.43 Trong máu người. đều lấy từ củ cải đường. phản ứng lên men rượu etylic. saccarozơ. alanin. Tinh bột. Saccarozơ.1%. to. D. 27 . D.3%. saccarozơ. D.40 Saccarozơ và glucozơ có đặc điểm giống nhau là A. D. phản ứng khử Cu(OH)2. D. Saccarozơ. B. 0. B. dung dịch AgNO3 trong dung dịch NH3.4%. B.2%.A. xenlulozơ. amilozơ. amilopectin. D. amilozơ. fructozơ. H2/Ni. đều hoà tan Cu(OH)2 ở nhiệt độ thường tạo dung dịch màu xanh đặc trưng. B. D. khử glucozơ bằng H2/Ni. Câu 2. Tinh bột. C. phản ứng tráng gương. D. C. [Ag(NH3)2]OH. glixerol. lên men rượu etylic. 0. Câu 2. Câu 2. Xenlulozơ. có thể dùng 2 phản ứng hoá học là A. Mantozơ. B. Xenlulozơ. Câu 2. đều tham gia phản ứng tráng gương. C. amilozơ. Câu 2. glucozơ tác dụng với Cu(OH)2. xenlulozơ. C. Câu 2. C. phản ứng tráng gương. B.48 Phản ứng chứng tỏ glucozơ có nhiều nhóm OH ở các nguyên tử cacbon liên tiếp nhau là phản ứng với A. Cu(OH)2. B. tinh bột. nồng độ của glucozơ có giá trị hầu như không đổi là A. phản ứng thuỷ phân. C.46 Gluxit chuyển hoá thành glucozơ trong môi trường kiềm là A.42 Chất không phản ứng với glucozơ là A.

(3) vị trí kề nhau. B. Khi bệnh nhân có lượng glucozơ trong máu = 0. Khi bệnh nhân có lượng glucozơ trong máu > 0. D. (8) Cn(H2O)m. dung dịch brom. Từ hay cụm từ thích hợp ở những chỗ trống trong các câu ở đoạn văn trên lần lượt là A. (5). (6) phức bạc amoniac. … cộng với hiđro cho …. Lên men glucozơ.52 Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm ? A. H2/Ni. (7). Câu 2. D. (6). to. phản ứng với AgNO3/NH3. (4).1% → 0. D. phản ứng với Cu(OH)2.53 Fructozơ không phản ứng với chất nào sau đây? A. (4). (2). (6).1%. (5) poliancol. B. Cho hỗn hợp etilen và hơi nước qua tháp chứa H3PO4. Khi bệnh nhân có lượng glucozơ trong máu < 0. D.54 Phản ứng nào sau đây chứng tỏ glucozơ có dạng mạch vòng? A.49 Phản ứng chứng minh glucozơ có nhóm chức anđehit là A. tác dụng với axit tạo sobitol. (1). phản ứng lên men rượu etylic. (8). (6). C. Thuỷ phân dẫn xuất etyl halogenua trong môi trường kiềm. (8). A. (7). (6). nóng. C. B. (1).51 Khi nào bệnh nhân được truyền trực tiếp dung dịch glucozơ (còn được gọi với biệt danh “huyết thanh ngọt”). (8). B.C. bị oxi hoá bởi … trong môi trường bazơ. vậy trong phân tử … ở … Tương tự như glucozơ. t . (4). tác dụng với Cu(OH)2 tạo dung dịch có màu xanh đặc trưng. D. AgNO3/NH3. (5).2%. Câu 2. D. D. (8). (4). (3). o C. (3). C. 28 .50 Phân tử glucozơ tác dụng với Cu(OH)2 cho …. phản ứng với CH3OH/HCl.1%. Khi bệnh nhân có lượng glucozơ trong máu từ 0. (2) có nhiều nhóm OH. (3). (7). Câu 2. (2). (4) fructozơ. Câu 2. Cu(OH)2. C. (1). (5). Cho etilen tác dụng với dung dịch H2SO4 loãng. Cacbohiđrat là những … và đa số chúng có công thức chung là … (1) dung dịch màu xanh lam. B. phản ứng tráng gương. (5). Câu 2. Cu(OH)2 ở nhiệt độ cao. Câu 2. (1).1%. C. (2). (7) hợp chất hữu cơ tạp chức. phản ứng với H2/Ni. (2). (7). tác dụng với axit tạo este có 5 gốc axit. B. (3).

Câu 2. Khối lượng dung dịch so với ban đầu giảm 3. 90. C2H4O2. Biết hiệu suất của quá trình lên men là 90%.56kg. C2H4O2.09J năng lượng mặt trời. saccarozơ.56 Cho 10kg glucozơ chứa 10% tạp chất. C6H12O6. T lần lượt là A. cho toàn bộ lượng CO2 sinh ra hấp thụ vào dung dịch nước vôi trong tạo thành 10g kết tủa. C3H6O3.26g. CH2O. C2H4O2. ancol bị hao hụt 5%. C6H12O6. (4). CH2O. C. T. 14. 90. Câu 2.32g. Y. D. CH2O. C3H6O3. (2) Cu(OH)2. (3) [Ag(NH3)2]OH. 12. (4). C. 88. B. 6CO2 + 6H2O C6H12O6 + 6O2 Nếu trong một phút. Câu 2. D. Với một ngày nắng (từ 6h00 – 17h00) diện tích lá xanh là 1m2. Y. giá trị của a là A. T lần lượt là 6:1:3:2 và số nguyên tử cacbon trong mỗi chất không nhiều hơn 6. Khi oxi hoá hoàn toàn từng chất đều cho cùng kết quả: Cứ tạo ra 4. (3).II. B. B. C. (1).65kg.BÀI TẬP NÂNG CAO Câu 2. Y. Z. Câu 2.4g CO2 thì kèm theo 1. 5.84kg.58 Cho 4 chất hữu cơ X.60 Một cacbohiđrat (Z) có các phản ứng diễn ra theo sơ đồ chuyển hoá sau Cu(OH)2/NaOH to dung dịch xanh lam kết tủa đỏ gạch Z Vậy Z không thể là A.32g. D. lượng glucozơ tổng hợp được bao nhiêu? A. 88. B. (2). C.57 Lên men a g glucozơ.37kg. Công thức phân tử của X. 4. C. 4.26g. 15. Z.4g. C3H6O3.55 Phản ứng tổng hợp glucozơ trong cây xanh cần được cung cấp năng lượng là 2813kJ cho mỗi mol glucozơ tạo thành. lên men thành ancol etylic. nhưng chỉ 10% được sử dụng vào phản ứng tổng hợp glucozơ. 13. (1).59 Saccarozơ đều tác dụng được với nhóm chất nào sau đây ? (1) H2/Ni. Trong quá trình chế biến. 6. Khối lượng ancol etylic thu được bằng bao nhiêu? A.8g H2O và cần một thể tích oxi vừa đúng bằng thể tích CO2 thu được. Câu 2. Z. D. (2). B. (2). B. C6H12O6. C3H6O3. 29 . to. C2H4O2. mỗi cm2 lá xanh nhận được khoảng 2. C6H12O6. Tỉ lệ phân tử khối của X. CH2O. D. glucozơ. (4) CH3COOH (H2SO4 đặc) A.

(C6H10O5)n C6H12O6 CH3CHO CH3COOH CH3COOC2H5 C.39 lít. Z phù hợp với sơ đồ sau là Q X E CO2 C2H5OH Z Y E Q X Y Z A.0g kết tủa. B. C12H22O11 C6H12O6 CH3COOH CH3COOC2H5 CH3COONa B.39 lít. B. Câu 2. Xenlulozơ có phân tử khối nhỏ hơn tinh bột. B. A. thu được 750. B.64 Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh. Q.52 g/ml) cần dùng là bao nhiêu ? A. C. Công thức phân tử của X là A. mỗi mũi tên biểu thị một phản ứng hoá học). 15. Câu 2.66 Để sản xuất ancol etylic người ta dùng nguyên liệu là mùn cưa và vỏ bào từ gỗ chứa 50% xenlulozơ.63 Cho sơ đồ chuyển đổi sau (E. C6H12O6.00 lít.70kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric 96% (D=1. được đều chế từ xenlulozơ và axit nitric. C. C12H24O12. Câu 2. Câu 2. 30 .C. 5000kg.01 mol một cacbohiđrat (X). 15. Giá trị m cần dùng là bao nhiêu ? A.125:1. nhưng phân tử khối của xenlulozơ lớn hơn nhiều so với tinh bột. 940.2. Y. (C6H10O5)n C6H12O6 CH3CHO CH3COONH4 CH3COOH D. Biết hiệu suất mỗi giai đoạn lên men là 80%. Công thức của E. 950. B. Xenlulozơ và tinh bột đều có phân tử khối rất lớn. mantozơ. Q.0. X. C12H22O11. C đều sai.28g CO2 và 1. 14. 949. D. Xenlulozơ và tinh bột có phân tử khối nhỏ. thu được 5. tỉ lệ khối lượng H và O trong X là 0. D. 1000. toàn bộ lượng CO2 sinh ra cho qua dung dịch Ca(OH)2 dư.0. D. Câu 2.5. X. Biết rằng. Câu 2. Xenlulozơ và tinh bột có phân tử khối gần bằng nhau.62 Cho m g tinh bột lên men để sản xuất ancol etylic.98g H2O. B. C. 24. D. D. C.39 lít.65 Chọn câu đúng trong các câu sau: A. Y. (C6H10O5)n. 5031kg. fructozơ. Muốn điều chế 29. hiệu suất quá trình là 70% thì khối lượng nguyên liệu xấp xỉ A.61 Đốt cháy hoàn toàn 0. Z là hợp chất hữu cơ. Nếu muốn điều chế một tấn ancol etylic.

8kg ancol etylic thành ancol 40o. C.7 lít. Sản phẩm được dẫn vào nước vôi trong thu được 0.16%. Câu 2. D.6g CH3COOH. 390kg.1g kết tủa nữa.8kg.69 Lên men 1 tấn tinh bột chứa 5% tạp chất trơ thành ancol etylic. tất cả đều sai. 400kg. 398. C6H12O6. B. Biết khi làm bay hơi 0. 70% và 30%. hiệu suất của mỗi quá trình lên men là 85%. Công thức phân tử của X là A.1g kết tủa và dung dịch A. C. Tinh bột và xenlulozơ không thể hiện tính khử vì trong phân tử không có nhóm chức anđehit (–CH=O). B. 1218.4104g X thu được thể tích khí đúng bằng thể tích 0. 1382666.8 g/cm3.03% thể tích không khí. Khối lượng ancol thu được là A. xenlulozơ điaxetat và 6.0855g một cacbohiđrat X. 1382600 lít. Muốn tạo ra 500g tinh bột thì cần bao nhiêu lít không khí (đktc) để cung cấp đủ lượng CO2 cho phản ứng quang hợp? Giả thiết hiệu suất quá trình là 100% A.67 Chọn phát biểu sai: A. Có thể phân biệt mantozơ và đường nho bằng vị giác. Thể tích dung dịch ancol thu được là A.125 lít. 31 . 76. 1402666. C. Câu 2.25 lít. C. Câu 2. B. biết khối lượng riêng của ancol etylic là 0. Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A. tất cả đều sai. 77.16%. D. C. 1246. C12H22O11. B. Tinh bột có phản ứng màu với iot do tinh bột có cấu tạo mạch ở dạng xoắn có lỗ rỗng. Đun nóng dung dịch A lại được 0.25 lít. to.72 Đốt cháy hoàn toàn 0. D.71 Khí cacbonic chiếm tỉ lệ 0.8kg.C.84% và 23. D. (C6H10O5)n. Có thể phân biệt glucozơ và saccarozơ bằng phản ứng với Cu(OH)2 /OH-. 5100kg. C. 389. Câu 2.1g hỗn hợp X gồm xenlulozơ triaxetat. D.70 Pha loãng 389. C18H36O18. 77% và 23%. đồng thời khối lượng dung dịch tăng 0. 6200kg.84% và 22. Câu 2. thu được 11. B. Câu 2.68 Cho xenlulozơ phản ứng với anhiđrit axetic (xúc tác H2SO4 đặc).7 lít.0815g. D.0552g hỗn hợp hơi ancol etylic và axit fomic đo trong cùng điều kiện. 1206. B. D.

21 A 2.41 B 2.27 D 2.13 A 2.7 A 2.49 D 2.68 B 2.64 A 2.amino axit peptit 2.34 C 2.18 B 2.2 B 2.29 B 2.40 C 2.55 A 2.53 C 2.22 B 2.69 C 2.36 B 2.72 A 2.14 A 2.11 B 2.28 C 2.58 C 2.26 B 2. Tính chất a) Tính chất của nhóm NH2 + Tính bazơ R NH2 + H2O [R NH3]+ + OH- Tác dụng với axit cho muối: R NH2 + HCl [R NH3]+Cl- Lưu ý: Mọi yếu tố làm tăng mật độ electron ở nguyên tử nitơ trong phân tử amin trung hoà nói chung đều làm tăng tính bazơ (trừ trường hợp chịu ảnh hưởng của hiệu ứng che chắn không gian và khả năng solvat hoá trong dung môi nước).48 B 2.57 D 2..12 C 2.35 A 2.5 C 2.30 A 2.47 B 2.52 B 2.3 C 2.8 C 2.62 B 2.17 D 2. R CH COOH.60 B 2.67 A 2.46 C 2.37 C 2.56 B 2.6 C 2. Cấu tạo phân tử: Các nhóm đặc trưng R NH2.50 C 2.9 B 2. NH2 H2N CH CO 1 R .61 C 2.10 D 2..1 A 2.42 D 2.33 C 2.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG II 2.66 A 2.54 D 2. NH CH COOH n R amin α .59 B 2.44 C 2. chẳng hạn các gốc ankyl có hiệu ứng +I.39 C 2.23 C 2.19 C 2.25 B 2.43 A 2.63 B 2.  Những nhóm đẩy electron.32 B 2.15 A 2.31 A 2.45 A 2.24 D 2.16 B 2.65 D 2.20 D 2.71 A 2.38 D 2.4 D 2. sẽ làm cho tính bazơ tăng lên.51 B 2. AMIN – AMINO AXIT – PROTEIN A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.70 C CHƯƠNG III. 32 .

do đó khả năng nhận proton của anilin giảm. đun nóng dung dịch muối điazoni sẽ tạo ra phenol và giải phóng nitơ. + Tác dụng với HNO2 Dựa vào khả năng phản ứng khác nhau đối với HNO 2 của các amin mỗi bậc. Vì vậy các amin mạch hở có tính bazơ mạnh hơn (dung dịch trong nước của chúng có thể làm xanh giấy quỳ) so với amin thơm (Anilin không làm xanh giấy quỳ). Thực tế HNO2 không bền. chỉ cần nêu hiện tượng. ArNH2 + HNO2 + HCl 0-5oC -2H2O ArN2+Cl. sẽ làm tính bazơ yếu đi. nên phải dùng hỗn hợp (NaNO2 + HCl). ngược lại càng có nhiều nhóm gây hiệu ứng –C tính bazơ sẽ càng giảm. 33 . Vì vậy.hay ArN2Cl + NaNO2 + HCl  Thí dụ: C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O (1*)    (anilin) (phenylđiazoni clorua) Đun nóng dung dịch muối điazoni: +  t0 C 6 H N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl (2*) →  5   Lưu ý: Trong công thức phân tử không cần viết các phản ứng (1* và 2*). Điều này được giải thích là: Amin thơm chứa vòng benzen hút electron.π theo chiều chuyển dịch electron hướng vào vòng benzen. − Amin bậc 1 • Amin béo bậc 1 Tác dụng với axit nitrơ tạo ancol tương ứng và giải phóng khí nitơ (hiện tượng sủi bọt khí). làm giảm mật độ điện tích âm ở nguyên tử N.  Về nguyên tắc. Ngược lại nhóm phenyl có hiệu ứng –C hút electron. đồng thời trong phân tử xuất hiện hiệu ứng liên hợp p . càng thay thế nhiều nguyên tử H trong phân tử NH3 bằng những nhóm có hiệu ứng đẩy electron +I tính bazơ càng tăng. người ta có thể phân biệt được chúng. HCl R NH2 + HONO R OH + N2 + H2O NaNO + HCl 2 Thí dụ: C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  • Amin thơm bậc 1 Tác dụng với axit nitrơ trong môi trường axit ở nhiệt độ thấp tạo muối điazoni. ta có thể viết: (CH3)2NH > CH3NH2 > NH3 > C6H5NH2 > (C6H5)2NH > (C6H5)3N.

+ Tác dụng với dẫn xuất halogen: R NH2 + CH3I R NHCH3 + HI b) Amino axit có tính chất của nhóm COOH Tính axit RCH(NH2)COOH + NaOH RCH(NH2)COONa + H2O Phản ứng este hoá: 2 4 RCH(NH2)COOH + R1OH RCH(NH2)COOR1 + H2O c) Amino axit có phản ứng giữa nhóm COOH và nhóm NH2 Tạo muối nội (ion lưỡng cực): H SO H3N+ CH COO- H2N CH COOH R R Phản ứng trùng ngưng của các ε .− Amin bậc 2 Các amin bậc 2 thuộc dãy thơm hay dãy béo đều dễ dàng phản ứng với HNO2 tạo thành nitrozamin (Nitroso) màu vàng: R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (Nitroso – màu vàng) − Amin bậc 3: Không phản ứng (không có hiện tượng gì).và ω . + H2N 4 COOH + nH2O hay2enzim H SO CH2 Rn COOH + Phản ứng màu với Cu(OH)2 cho dung dịch màu xanh tím (dùng để nhận biết protein).amino axit tạo poliamit: NH [CH2]5 CO n + nH2O d) Protein có phản ứng của nhóm peptit CO-NH + Phản ứng thuỷ phân: H 2N CH 1 R H2 N nH2N [CH2]5 COOH to CO HN CH R1 CH CO HN CH R2 CH CO .. NH CH R3 CH R2 COOH + H2N R3 COOH + H2N Rn COOH+ ... e) Anilin và nhiều protein có phản ứng thế dễ dàng nguyên tử H của vòng benzen NH2 NH2 Br Br (trắng) Br (dd) + 3Br2(dd) + 3HBr(dd) 34 ..

R–NO2 + 6 [ H ]  R–NH2 + 2H2O → Fe + HCl C6H5–NH2 + 2H2O 15. R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (nitroso – màu vàng)  → 5. C6H5NH2 + H2SO4  C6H5NH3HSO4 → 11.B . C6H5NH2 + CH3COOH  CH3COONH3C6H5 → 10. R – NH2 + HCl  R – NH3Cl → 35 . R – OH + NH3  R–NH2 + H2O → Al 2O3. 3R – OH + NH3  (R)3N + 3H2O → C2H5OH → 20. H2N + H2SO4 180oC H2N NH2 SO3H + H2O 13. C6H5NH2 + HCl  C6H5NH3Cl → phenylamoni clorua 8. C6H5–NO2 + 6 [ H ]  → Cũng có thể viết: 16. C 6 H 5 N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl →   t0 4. 2C6H5NH2 + H2SO4  [C6H5NH3]2SO4 → 12. C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O    +   3. R – Cl + NH3  R – NH2 + HCl 1000C 21. P 19. P 17. CH3NH3Cl + NaOH  CH3NH2 + NaCl + H2O → 9. C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  + NaNO + HCl  2 2. CH3NH2 + H–COOH  H–COONH3CH3 → metylamoni fomiat 7. R–NO2 + 6HCl + 3Fe  R–NH2 + 3FeCl2 + 2H2O → Al 2O3. NH2 Br Br (dd) + 3Br2(dd) Br Fe + HCl + 3HBr(dd) 14. P 18. CH3 – NH2 + H2O ← CH3 – NH3+ + OH 6.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP NaNO + HCl 2 1. 2R – OH + NH3  (R)2NH + 2H2O → Al 2O3.

p . thêm vài giọt dung dịch Na2CO3 D.BÀI TẬP CƠ BẢN Câu 3. phenylamin và amoniac đúng là A. phenylamin < amoniac < etylamin.1 Sự sắp xếp theo trật tự tăng dần tính bazơ giữa etylamin. 36 xt. CH3CH(Br)COOH + 3NH3  CH3CH(NH2)COONH4 + NH4Br → C. to. amoniac < etylamin < phenylamin. etylamin < amoniac < phenylamin. D. R – Cl + NH3  R – NH3Cl 1000C 23. H2NR(COOH)a + aNaOH  H2N(COONa)a + aH2O → 28. H2N–R–COOH + HONO  HO–R–COOH + N2↑ + H2O → 39. 3R – Cl + NH3  (R)3N + 3HCl 1000 C  →  → 26. B. Câu 3.+ H2O  34. H2N–R–COOH + Na  H2N–R–COONa + H2 → 2 30. 2(H2N)bR(COOH)a + aNa2O  2(H2N)b R(COONa)a + aH2O → HCl  → 32. phenylamin < etylamin < amoniac. [H3N+–R–COOR’]Cl. C. 2R – Cl + NH3  (R)2NH + 2HCl 1000 C C2H5OH → 25. 2(H2N)bR(COOH)a + aBa(OH)2  [(H2N)bR(COO)a]2Baa + 2aH2O → 1 29. H2N–R–COOH + HCl  ClH3N–R–COOH → 36. H2N–R–COOH ← H2N–R–COO.2 Cách thuận lợi nhất để nhận biết lọ đựng dung dịch CH3NH2 là A. B. to. H2N–R–COOH + R’–OH + HCl ←  [H3N+–R–COOR’]Cl.+ NH3  H2N–R–COOR’ + NH4Cl → 35. 41.C2H5OH → 22. p NH[CH2]5CO n + nH2O HN[CH2]6CO n + nH2O 40. (H2N)b R (COOH)a + aNa  (H2N)bR(COONa)a + → a 2 H2 31. R – NH3Cl + NaOH  R – NH2 + NaCl + H2O → C2H5OH → 24. Đưa đầu đũa thuỷ tinh đã nhúng vào dung dịch HCl đậm đặc lên phía trên miệng lọ đựng dung dịch CH3NH2. 2(H2N)bR(COOH)a + bH2SO4  [(H3N)bR(COOH)a]2(SO4)b → 37.BÀI TẬP TRẮC NGHIỆM I. ClH3N–R–COOH + 2NaOH  H2N–R–COONa + NaCl + H2O → HCl 38. nH2N[CH2]5COOH nH2N[CH2]6COOH xt. C.+ H+ ← H3N+–R – COO  27. H2N–R–COOH + R’–OH ←  H2N–R–COOR’ + H2O  HCl   → 33. nhận biết bằng mùi. thêm vài giọt dung dịch H2SO4.

000. Câu 3. C.8 Este A được điều chế từ amino axit B (chỉ chứa C. glixerol. 192.6 Amino axit là một hợp chất hữu cơ tạp chức. 190. CH3OH/HCl. C. NaOH. N) và ancol metylic. 4.Câu 3. H.9 Thuốc thử nào dưới đây dùng để phân biệt các dung dịch glucozơ. Câu 3. B.7 Có 3 chất hữu cơ gồm NH2CH2COOH. D. Câu 3. D. 2. 5. thì số mắt xích alanin trong phân tử A là bao nhiêu? A. 3. 4. O. HCl. CH(NH2)2COOH. HNO3. C. D. C. AgNO3/NH3. Tỉ khối hơi của A so với H2 là 44. CH(NH2)2COOCH3. B. Amino axit thường tồn tại dưới dạng …(5)…cân bằng với dạng …(6)… (1) (2) (3) (4) (5) (6) A. B. B. CH2(NH2)COOH. Nếu phân tử khối của A là 50. amin cacbonyl oxi hoá Axit phân tử phân tử ion lưỡng B. xeton metyl axit lưỡng tính nguyên tử cation Câu 3. 189.4 Số lượng đồng phân amin bậc 2 ứng với công thức phân tử C4H11N là A. 5.10 Khi thuỷ phân 500g protein A thu được 170g alanin. D. D. Đốt cháy hoàn toàn 8. Cu(OH)2. etanol và lòng trắng trứng? A. CH(NH2)2COOCH3. 191. 3. 3.3 Số lượng đồng phân ứng với công thức phân tử C3H9N là A. 2.5 Số lượng đồng phân amin có chứa vòng benzen ứng với công thức phân tử C7H9N là A. Câu 3.2g CO2. C. D. C. 5. 4. Câu 3.5. D. hiđroxyl metylen khử oxi hoá cation anion D. 2. CH(NH2)2COOH.9g este A thu được 13. quỳ tím. CH3CH2COOH và CH3[CH2]3NH2. NaOH. 6.3g H2O và 1. C. CH2(NH2)COOCH3. chỉ cần dùng thuốc thử nào sau đây? A. B. Để nhận ra dung dịch của các hợp chất trên. Câu 3. B. CH2(NH2)COOCH3. CH2(NH2)COOH. Công thức cấu tạo thu gọn của A. B lần lượt là A. 37 . trong phân tử của nó vừa có nhóm …(1)…vừa có nhóm …(2)…nên vừa có tính chất …(3)…vừa có tính chất … (4)….12 lít N2 (đktc). amino cacboxyl bazơ Axit phân tử cực C. B.

Câu 3.11 Chất nào sau đây không có phản ứng với dung dịch C2H5NH2 trong H2O? A. HCl. B. H2SO4. C. NaOH. D. quỳ tím. Câu 3.12 Glixin phản ứng được với tất cả các chất trong nhóm chất nào sau đây (điều kiện phản ứng xem như có đủ): A. Quỳ tím , HCl , NH3 , C2H5OH. B. NaOH, HCl, C2H5OH, CH2 COOH.
NH2

C. Phenoltalein , HCl , C2H5OH , Na. D. Na , NaOH , Br2 , C2H5OH. Câu 3.13 Tìm công thức cấu tạo của hợp chất hữu cơ X chứa 32% C; 6,667% H; 42,667% O; 18,666% N. Biết phân tử X có một nguyên tử N và X có khả năng tham gia phản ứng trùng ngưng. A. H2NCH2COOH. B. C2H5NO2. C. HCOONH3CH3. D. CH3COONH4. Câu 3.14 Hợp chất hữu cơ A có công thức phân tử là C3H7O2N, A tác dụng được với dung dịch NaOH, dung dịch HCl và làm mất màu dung dịch brom. Công thức cấu tạo đúng của A là A. CH3CH(NH2)COOH. B. CH2=CHCOONH4. C. HCOOCH2CH2NH2. D. H2NCH2CH2COOH. Câu 3.15 Cho các chất: etylen glicol (1), axit aminoaxetic (2), axit oxalic (3), axit acrylic (4). Những chất có thể tham gia phản ứng trùng ngưng là A. (1), (2), (3). B. (1), (2). C. Chỉ có (2). D. Cả bốn chất. Câu 3.16 Có các dung dịch chứa trong các lọ mất nhãn sau: Lòng trắng trứng, hồ tinh bột, glixerol. Thuốc thử có thể dùng để phân biệt các dung dịch trên là A. Cu(OH)2. B. I2. C. AgNO3. D. cả A, B đều đúng. Câu 3.17 Số đồng phân của hợp chất hữu cơ thơm có công thức phân tử C7H7NO2 là A. 7. B. 6. C. 5. D. 8. Câu 3.18 Số đồng phân của các chất có công thức phân tử C4H10O (1), C4H9Cl (2), C4H10 (3), C4H11N (4) theo chiều tăng dần là A. (3), (2), (1), (4). B. (4), (1), (2), (3). C. (2), (4), (1), (3). D. (4), (3), (2), (1). 38

Câu 3.19 Cho sơ đồ phản ứng: NaOH C9H17O4N (X)  C5H7O4NNa2 (Y) + 2C2H5OH. → Công thức cấu tạo thu gọn của X, Y lần lượt là A. C2H5OOCCH2CH(NH2)CH2COOC2H5, NaOOCCH2CH(NH2)CH2COONa. B. CH3OOCCH2CH(NH2)CH2COOC3H7, NaOOCCH2CH(NH2)CH2COONa. C. HOOCCH2CH(NH2)CH2COOC4H9, NaOOCCH2CH(NH2)CH2COONa. D. CH3OOCCH2CH(NH2)CH2COOCH(CH3)2, NaOOCCH2CH(NH2)CH2COONa. Câu 3.20 Chọn phát biểu đúng về hợp chất tạp chức: A. Hợp chất hữu cơ có từ hai loại nhóm chức trở lên. B. Hợp chất hữu cơ có từ hai nhóm chức trở lên. C. Hợp chất hữu cơ có nhiều nhóm chức. D. Hợp chất hữu cơ có hai nhóm chức. Câu 3.21 Trong sơ đồ sau, công thức cấu tạo thu gọn phù hợp của A, B, C, D, E lần lượt là
2 2 2 2 + NH 3 + dd NaOH → → → → Etan  A  B  C  D  E  → → 1:1 Cu 1:1 Mn2+ Glixin. A. C2H5Cl, C2H5OH , CH3CHO, CH3COOH , CH3COOCl. B. C2H5Cl, C2H5OH , CH3CHO, CH3COOH, CH2ClCOOH. C. C2H5Cl, C2H5OH , CH3 COCH3, CH3COOH, CH2ClCOOH. D. C2H5Cl, C2H5OH , CH3COOH, CH3COCH3, CH2ClCOOH. Câu 3.22 Cho 3 chất hữu cơ: NH2CH2COOH (1); CH3CH2CH2CH2NH2 (2); CH3CH2COOH (3). Nhiệt độ nóng chảy của chúng được xếp theo trình tự giảm dần là A. (2) < (3) < (1). B. (1) > (3) > (2). C. (3) < (2) < (1). D. (2) > (1) > (3). Câu 3.23 Hợp chất đa chức và hợp chất tạp chức giống nhau ở chỗ A. đều là hợp chất có nhiều nhóm chức. B. đều là hợp chất chứa các nhóm chức giống nhau. C. phân tử luôn có liên kết π. D. mạch cacbon trong phân tử có liên kết π . Câu 3.24 X là một axit α -monoamino monocacboxylic, có tỉ khối hơi so với không khí là 3,07. X là A. glixin. B. alanin. C. axit α - aminobutiric. D. axit glutamic.

+ Cl

+O

+O

+ Cl

39

Câu 3.25 Khi đun nóng chất béo với dung dịch kiềm “....”
A. luôn thu được glixerol và phản ứng xảy ra thuận nghịch. B. luôn thu được glixerol, phản ứng xảy ra nhanh hơn và một chiều. C. luôn thu được muối của axit béo và phản ứng xảy ra thuận nghịch. D. luôn thu được xà phòng, phản ứng xảy ra chậm hơn. Chọn một phương án trong số các phương án trên để điền vào chỗ trống trong câu sao cho đúng ý nghĩa hoá học.

Câu 3.26 Amino axit là
A. hợp chất hữu cơ đa chức, có chứa 2 nhóm chức COOH và NH2. B. hợp chất hữu cơ đa chức, có chứa 2 loại nhóm chức COOH và NH2. C. hợp chất hữu cơ tạp chức, có chứa 2 nhóm chức COOH và NH2. D. hợp chất hữu cơ tạp chức, có chứa 2 loại nhóm chức COOH và NH2.

Câu 3.27 Công thức tổng quát của amino axit là A. RCH(NH2)COOH. B. R(NH2)x(COOH)y. C. R(NH2)(COOH). D. RCH(NH3Cl)COOH. Câu 3.28 Chọn câu phát biểu sai: A. Amino axit là hợp chất hữu cơ tạp chức. B. Tính bazơ của C6H5NH2 yếu hơn NH3. C. Công thức tổng quát của amin no, mạch hở, đơn chức là CnH2n + 3N (n ≥ 1). D. Dung dịch của các amino axit đều làm quỳ tím chuyển sang màu đỏ. Câu 3.29 Hai phương trình phản ứng hoá học sau, chứng minh được nhận định rằng: H2NCH2COOH + NaOH → H2NCH2COONa + H2O. H2NCH2COOH + HCl → HOOCCH2NH3Cl. A. Glixin là một axit. B. Glixin là một bazơ. C. Glixin là một chất lưỡng tính. D. Glixin là một chất trung tính. Câu 3.30 Hợp chất hữu cơ X có công thức cấu tạo thu gọn: HOOCCH2CH2CH(NH2)COOH. Tên gọi của X là A. glixin. B. alanin. C. axit ađipic. D. axit glutamic. Câu 3.31 Cho sơ đồ chuyển hoá sau:
X
H2SO4 - Na2SO4

Y

C2H5OH, H2SO4, to - Na2SO4

CH3

CH

COO

C2H5

NH3HSO4
CH COONa, CH3 CH COOH.

Công thức cấu tạo phù hợp của X, Y lần lượt là
A. CH3 C. CH3 CH COONa, CH3 CH COOH. B. CH3 D. CH3 NH2 CH COONa, CH3 NH2 NH2 CH COOH. NH3HSO4 NH3HSO4 CH COOH, CH3 NH3HSO4 NH2 CH COOH. NH2

Câu 3.32 Phương trình phản ứng hoá học sau chứng minh được rằng: H2NCH2COOH + C2H5OH 40
H+, to

H2NCH2COOC2H5 + H2O.

Câu 3. NaOOC – CH2 – CH2 – CH(NH2) – COOH. Câu 3. B. CuSO4. D. axit glutamic. C. HOOC – CH2 – CH2 – CH(NH2) – COONH4. H nối với O của axit linh động hơn ancol. C. Câu 3. B.37 Để điều chế glixin theo sơ đồ: Axit axetic → axit cloaxetic → glixin. Zn(NO3)2. CH2 CH COOH.36 Chọn câu phát biểu sai: A. D. Axit clohiđric và muối amoni. B. CH3COOK thì số lượng kết tủa thu được là A.40 Cho dung dịch metylamin đến dư vào các dung dịch sau: FeCl3. không xác định được. Glixin có nhóm COOH. Amino axit có tính lưỡng tính. B. B. tất cả A. B. C.39 Sản phẩm của phản ứng este hoá giữa amino axit X và metanol thu được este có tỉ khối hơi so với propin bằng 2. H . 0. có công thức cấu tạo thu gọn là A. C. NH2 C6H5 C. triphenylamin. CH2 CH COOH. glixin. Một số protein bị đông tụ khi đun nóng. B.33 Điều khẳng định nào sau đây là sai ? A. D.A. D. N. D. D. Clo và amoniac. Câu 3. C đều sai. B. Hiđroclorua và amoniac. CH3 CH2 CH NH2 C6H5 COOH. Câu 3. B. anilin. Clo và amin. Glixin có nhóm NH2. O . CH3 CH2 CH C6H5 NH2 COOH. Các protein đều chứa các nguyên tố C . Câu 3.35 Công thức cấu tạo thu gọn của axit 2 – amino – 3 – phenylpropanoic là A. 1. protein bị thuỷ phân tạo ra các amino axit. Amin đơn chức đều chứa một số lẻ nguyên tử H trong phân tử. Cần dùng thêm các chất phản ứng nào sau đây (không kể xúc tác): A. C6H5 NH2 D. Câu 3.38 Tính bazơ của amin nào trong số các amin sau đây là yếu nhất ? A.225. Phân tử khối của một amin đơn chức luôn là số chẵn.34 Muối của axit glutamic dùng làm bột ngọt (còn gọi là mì chính). B. Câu 3. alanin. C. H nối với O của ancol linh động hơn axit. D. Tên gọi của X là A. C. Protein có trong mọi bộ phận của cơ thể động vật là hợp chất hữu cơ đa chức. 41 . Amino axit tham gia phản ứng trùng ngưng. C. HOOC – CH2 – CH2 – CH(NH2) – COOH. NaOOC – CH2 – CH2 – CH(NH2) – COONa. điphenylamin. Ở nhiệt độ thường dưới tác dụng của men.

CH5N và C2H7N. B.52g X tác dụng vừa đủ với 200ml dung dịch HCl thu được 2. 0. Câu 3. Cho 1.48 Hãy chỉ ra câu sai trong các câu sau: A. 1.98g muối. Metylamin có tính bazơ mạnh hơn anilin.04 mol và 0. Câu 3. CH2 CH2 NH O C. CH3 CH2 CH2 CH2 C NH2. C.41 Cho 15g hỗn hợp các amin gồm anilin. khí H2. C3H9N và C2H7N. C3H9N và C4H11N. D. không đủ dữ kiện để tính. Câu 3. 3. B. D. kết quả khác.2M.04g hỗn hợp Y gồm hai amin đơn chức. riêu cua nổi lên được giải thích là do: A. kết quả khác. D. Câu 3. B.45 Hỗn hợp (X) gồm hai amin đơn chức. X còn có khả năng tham gia phản ứng trùng hợp. 42 . no. Khối lượng sản phẩm thu được có giá trị là A. 3. thì số lượng kết tủa thu được là A. B. metylamin. Công thức cấu tạo của X là CH2 CH2 CH2 A. 21. Câu 3. Sự đông tụ của protit.46 Cho 3. Câu 3. Các chất bẩn trong cua chưa được làm sạch hết. D. (CH3COO)2Pb.06 mol và 0. D. 2. 16.96g muối. Ngoài ra. khi tác dụng với dung dịch NaOH chỉ thu được sản phẩm hữu cơ duy nhất. C. mạch hở tác dụng vừa đủ với dung dịch HCl thu được 5.3M. X có đặc điểm cấu tạo và các tính chất sau: phân tử có mạch cacbon không phân nhánh. mạch hở là CnH2n+2+kNk.02 mol và 0.42 Cho dung dịch metylamin đến dư vào các dung dịch sau: (CH3COO)2Cu. Công thức tổng quát của amin no. C. C. Tất cả các nguyên nhân nêu ở A. Có phản ứng hoá học của NaCl với chất có trong nước lọc khi xay (giã) cua.44 Điều chế anilin bằng cách khử nitrobenzen thì dùng chất khử nào sau đây ? A. 0. số mol hai amin bằng nhau. Công thức phân tử của hai amin là A.825g. B. C. Biết trong hỗn hợp. C = O. C. CH3COOAg. Câu 3. H2N[CH2]4 CHO. đimetylamin. NH3. B. Tính bazơ của các amin đều mạnh hơn NH3. (CH3COO)2Mg.47 Hợp chất hữu cơ (X) có công thức phân tử CxHyNO có khối lượng phân tử bằng 113u.C. B. B. D. kết quả khác. D. 20.1M. D.123g. Tổng số mol hai amin và nồng độ mol/l của dung dịch HCl là A. Fe + dung dịch HCl. 2. không làm mất màu dung dịch Br2. C. 0. đietylmetylamin tác dụng vừa đủ với 50ml dung dịch HCl 1M. cacbon.18g. D. C. 0. Câu 3.43 Khi nấu canh cua. B. Các amin đều kết hợp với proton.

C4H11N. D. CH3NH2 và C4H9NH2. D. B. Giả thiết không khí chỉ gồm nitơ và oxi. C3H9N. A và C đúng. thu được 2. C5H11N. C3H7N. 8. 43 . CH3-C6H4-NH2 . C5H13N. C. D. đơn chức. C3H7NH2 và C4H9NH2. X có công thức phân tử là A.52 Khi đốt cháy hoàn toàn một amin đơn chất X. CH3 Câu 3. Đốt cháy hoàn toàn 3. CH3 .21g amin A sinh ra khí CO 2. bậc I (có số nguyên tử C nhỏ hơn hoặc bằng 4) phải dùng một lít dung dịch X. thu được 17. C. 9. Công thức phân tử của hai amin lần lượt là A. CH3 . C4H11N.44 lít khí nitơ. CH3-CH2-CH2-NH2.54 Dung dịch X chứa HCl và H2SO4 có pH = 2.BÀI TẬP NÂNG CAO Câu 3. tác dụng vừa đủ với dung dịch HCl. CH3N. B.53 Cho 20g hỗn hợp gồm 3 amin no.4 lít khí CO2 và 1. CH5N và C2H7N.6g khí cacbonic. Nếu 3 amin trên được trộn theo tỉ lệ số mol 1:10:5 và thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là A. C2H7N và C3H9N.6g hơi nước và 69. Giá trị m và tên gọi của amin là A. Biết rằng tên của A có tiếp đầu ngữ “para”.125g H2O. 8. Câu 3. D. 7.49 Đốt cháy hoàn toàn hỗn hợp hai amin no.51 Đốt cháy hoàn toàn m g một amin A bằng lượng không khí vừa đủ. đimetylamin. C. là đồng đẳng liên tiếp. B lần lượt là NH2 NH2 A. II. 12.68g hỗn hợp muối. đơn chức là đồng đẳng liên tiếp của nhau. đơn chức. C4H9N. C2H5NH2 và C4H9NH2. Câu 3. trong đó nitơ chiếm 80% thể tích (các V đo ở đktc). kết quả khác. B. C4H11N. B. Câu 3. CH3-C6H4-NH2 . C. etylamin hoặc đimetylamin. C2H7N. Công thức phân tử của 2 amin là A.Câu 3. C3H9N và C4H11N. Khi đốt cháy amin B thấy VCO2 : VH2O = 2 : 3 . C2H7N. hơi H2O và 336 cm3 khí N2 (đktc).50 Có hai amin bậc một gồm A (đồng đẳng của anilin) và B (đồng đẳng của metylamin). Công thức cấu tạo của A.4 lít N2 (các V đo ở đktc). C. Để trung hoà hoàn toàn 0.24 lít khí CO2 (đktc) và 3. CH3-CH-NH2. D. C5H13N. C. C4H9-NH2. etylamin. CH3-CH2-CH2-NH2.59g hỗn hợp 2 amin no. etylamin. C3H9N. 9. cô cạn dung dịch thu được 31. người ta thu được 10. D. B.6g H2O. B. C3H9N. C2H7N. C3H9N.

08g CO2. C3H5COONH4. amino cacboxyl 44 .58 Một hợp chất hữu cơ A mạch thẳng có công thức phân tử là C3H10O2N2.1 mol X cần 600ml dung dịch HCl 0. B. B’ tác dụng với HCl tạo ra B”. C lần lượt là A. C đều đúng. B. D. Câu 3. CH3CH(NH2)COONH4. C4H9NO2.99g H2O và 336ml N2 (đktc).(4)…mà phân tử chứa …(5)…. B.4 ≤ X < 1. nguyên tử hiđro khi thay thế amino cacboxyl D.75 < X ≤ 1. A và B đều đúng. C3H5COONH4. Câu 3. cả A.8 ≤ X < 2. B tác dụng với H mới sinh tạo ra B’. 0. Câu 3. C có cùng công thức phân tử C 4H9O2N. H2NC3H6COOH. công thức cấu tạo thu gọn có thể có của X là A.2. Công thức cấu tạo thu gọn của A. A và B đều sai.59 Những từ hay cụm từ thích hợp với những chỗ trống ở các câu trong đoạn văn sau là Amin là những hợp chất hữu cơ được tạo thành …(1)…một hay nhiều …(2)… trong phân tử amoniac bởi …(3)…. Câu 3. H2NC3H6COOH. Vì có nhóm …(6)… và nhóm …(7)… trong phân tử. 0. 0. Biết X là amin bậc I. D. khi thay thế khi thay thế khi thay thế nguy ên tử hiđr o (2) nguyên tử hiđro cacboxyl (3) một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon (4) luỡng tính tạp chức tạp chức tạp chức (5) đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino (6) tạp chức (7) cacboxyl (8) amino (9) trùng ngưng trùng ngưng trùng ngưng trùng ngưng B.57 Các chất A.. C4H9NO2. CH3NHC6H3(NH2)2. B. H2NC3H6COOH. C3H5COONH4. D.5.55 Khi đốt cháy mỗi đồng đẳng của ankylamin. Biết A tác dụng với cả HCl và Na2O. Amino axit là loại hợp chất hữu cơ .56 Đốt cháy hoàn toàn một amin thơm X thu được 3. C4H9NO2. thì tỉ lệ thể tích X = VCO2 : VH2O biến đổi như thế nào theo số lượng nguyên tử cacbon tăng dần trong phân tử ? A. C3H5COONH4. 0. B. H2NCH2CH2COONH4.. CH3C6H2(NH2)3. D.Câu 3. B” tác dụng với NaOH tạo ra B’. amino axit biểu hiện tính chất …(8)…và tính chất đặc biệt là phản ứng …(9)… (1) A. C. C. B. Công thức cấu tạo của A là A. H2NCH2C6H3(NH2)2.4 ≤ X < 1. A tác dụng với kiềm tạo thành NH3.5M. H2NC3H6COOH. Để trung hoà 0. C4H9NO2. C. A tác dụng với dung dịch axit tạo thành muối amin bậc I. 0. amino nguyên tử hiđro luỡng tính luỡng tính luỡng tính C. Mặt khác. C. C tác dụng với NaOH tạo ra muối và NH 3.

X vừa tác dụng được với dung dịch HCl vừa tác dụng được với dung dịch NaOH. H2NCH(NH2)[CH2]2COOH. Đốt cháy hoàn toàn một lượng X thu được CO2 và N2 theo tỉ lệ thể tích 4:1. thu được VCO2 : VH 2O = 6 : 7 . 3 mol CO2 và 0.61 Khi đốt cháy hoàn toàn đồng đẳng X của axit aminoaxetic. B đều no. tất cả đều sai. H2N[CH2]4COOH. H2N[CH2]4COOH. Cho tỉ lệ phân tử khối của chúng là 1. X là hợp chất nào sau đây? A. D. 45 . B. HOOCCH2CH(NH2)COOH. cả A. Biết rằng. Biết rằng. chứa 1 chức axit.60 Amino axit X chứa một nhóm chức amin bậc I trong phân tử. O. ngoài ra còn tác dụng được với nước brom. C. mạch hở. thu được 4. H2NCH2COOH. Biết X tác dụng với dung dịch NaOH và dung dịch HCl. Công thức cấu tạo thu gọn của hai amino axit lần lượt là A. thì thấy khối lượng bình này tăng thêm 32. H2NCH2COOH.7g chất X. O. tạo ra 28. H2NCH2CH2COOH. Câu 3. CH3CH(NH2)CH2COOH. H2NCH2COOH. B. H2N[CH2]3COOH. Mặt khác. nitơ chiếm 18.1 mol A phản ứng vừa hết với 100ml dung dịch HCl 1M tạo ra 18. HOOCCH(NH2)COOH. H2N[CH2]3COOH. C2H5COONH4 hoặc HCOONH3CH3. Mặt khác. C. C. cần 140ml dung dịch KOH 3M. Đốt cháy 7. CH2=C(NH2)-COOH. C đều sai. Biết A có cấu tạo mạch không phân nhánh và nhóm amino ở vị trí α .928 lít khí CO2 (đo ở 27. B. B.05g A khi tác dụng với một lượng NaOH dư.8g.65 A là một amino axit trong phân tử ngoài các nhóm cacboxyl và amino không có nhóm chức nào khác. Công thức cấu tạo thu gọn của A là A. X là hợp chất nào sau đây? A. C đều sai. cả A. CH3NH[CH2]3COOH. Công thức cấu tạo thu gọn của X là A.3oC. Để tác dụng hết với các chất trong dung dịch A. B. D. H2NCH(NH2)COOH. N trong đó hiđro chiếm 9. D. H2NCH2COOH.18%. CH2=CH-COONH4.15g dung dịch HCl 20% được dung dịch A. B đều đúng. D.37. Câu 3. CH3COONH4 hoặc HCOONH3CH3. CH3NH[CH2]2COOH. Công thức cấu tạo thu gọn có thể có của X là A. N và có phân tử khối là 89. Câu 3. CH3NHCH2COOH. chỉ chứa nguyên tố C.35g muối. Câu 3. cả A. 1atm). không phân nhánh .63 Hợp chất hữu cơ X có phân tử khối nhỏ hơn phân tử khối của benzen. C. H2N-CH=CH-COOH.64 Cho a g hỗn hợp hai amino axit A. đốt cháy a g hỗn hợp hai amino axit trên và cho sản phẩm cháy qua dung dịch NaOH dư. 1 chức amino tác dụng với 40.65g muối khan. Khi đốt cháy 1 mol X thu được hơi nước. khi đốt cháy thu được khí nitơ ở dạng đơn chất. H2N[CH2]3COOH. CH3CH(NH2)COOH. B.62 Hợp chất X chứa các nguyên tố C. kết quả khác. H2NCH2COOH. Biết 0. H.09%. 22.Câu 3.5 mol N2. H. H2NCH2CH2COOH. C. B. Câu 3. B. D.

H. thấy khối lượng bình đựng nước vôi trong tăng 3.72 Amino axit (Y) có công thức dạng NCxHy(COOH)m. B. N với tỉ lệ khối lượng tương ứng là 3:1:4:7. C3H8O2N2.0g kết tủa. (1) < (2) < (4) < (3) < (5) < (6). hiđro.69 Câu khẳng định nào sau đây luôn đúng: A. (2). D. Công thức cấu tạo của X là A. (1) mọi bộ phận của cơ thể. B. Phân tử khối của một amino axit (gồm một chức amino và một chức cacboxyl) luôn luôn là số lẻ. CH4ON2. D. CH3CH(NH2)2. Dung dịch amino axit không làm giấy quỳ đổi màu. (1) < (4) < (3) < (2) < (5) < (6). B. D. (2).66 X là một α -amino axit no chỉ chứa một nhóm –NH2 và một nhóm –COOH. (2) anilin. D.344 lít (đktc).Một số protein bị … khi đun nóng hoặc khi cho thêm một số hoá chất. C đều đúng. Câu 3. B. HOOCCH2CH2CH(NH2)COOH. Câu 3. H2NCH2CH2NH2. (4). B. (3). (6) đimetylamin. NC4H8(COOH)2. thu được 18. nitơ. Hai chất (X) và (Y) có cùng số mol. Mọi amin đơn chức đều chứa một số lẻ số nguyên tử H trong phân tử. kết quả khác.448 lít (đktc) một khí không bị hấp thụ. C3H8ON2. (4). (2) < (1) < (3) < (4) < (5) < (6). (1). C. CH3CH(NH2)COOH. (4). CH3CH2NH2. D. thu toàn bộ sản phẩm qua bình chứa nước vôi trong dư. .75g muối của X. (3) p-nitroanilin. Amin luôn luôn phản ứng với H+. X có công thức cấu tạo nào sau đây? A.02 mol một amin bậc I (X) với lượng oxi vừa đủ. C. Các amino axit đều tan trong nước.71 Đốt cháy hoàn toàn 0. Trình tự tính bazơ tăng dần theo chiều từ trái sang phải là A.67 Chọn phát biểu sai: A. C. C. C.1g X tác dụng với dung dịch HCl dư. Thuỷ phân protein bằng axit khi đun nóng sẽ cho một hỗn hợp các amino axit. Biết phân tử X có 2 nguyên tử nitơ. Cho 15. Câu 3. (4) đông tụ Những từ hoặc cụm từ thích hợp theo trình tự từ trên xuống là A. (4) p-nitrotoluen. (3). D. CH3CH2CH(NH2)COOH. B. CH3CH2CH(NH2)COOH. C. (3). 46 .73 Hợp chất X chứa các nguyên tố C. Công thức cấu tạo thu gọn của (Y) là A. D.C. B và C đều đúng. H2NCH2CH2COOH. N(CH2COOH)3. H2NCH2CH2COOH. (2). B. protein … tạo ra các amino axit. (3). B. khi lọc dung dịch thu được 4. Câu 3.82g (Y). Câu 3. C. Lấy một lượng axit aminoaxetic (X) và 3. D. Câu 3.68 Hãy điền những từ hoặc cụm từ thích hợp vào các chỗ trống ở các câu sau . Câu 3. kết quả khác. Phân tử khối của một amin đơn chức luôn là số chẵn. (4) < (3) < (2) < (1) < (5) < (6). CH3NHCH2COOH.Các protein đều chứa các nguyên tố … . C. (2). O. thể tích khí oxi cần dùng để đốt cháy hết (Y) nhiều hơn để đốt cháy hết (X) là 1. D. Đốt cháy hoàn toàn lượng (X) và (Y) trên. (5) metylamin. (1).70 Cho các chất: (1) amoniac. (2) bị thuỷ phân. (1). (4).Protein có trong … . (1). Công thức phân tử của X là A.2g và còn lại 0.Ở nhiệt độ thường dưới tác dụng của men. (3) cacbon. B. Câu 3. oxi.

67 D 3.66 D 3.22 B 3.n + n.47 A 3.7 D 3.41 A 3. .34 B 3.38 C 3.55 C 3. đồng thời giải phóng những phân tử nhỏ (như H2O.69 D 3.31 C 3. Khái niệm về polime Polime là các hợp chất có phân tử khối rất lớn do nhiều đơn vị nhỏ gọi là mắt xích liên kết với nhau tạo nên.11 C 3.71 D 3.12 B 3.17 A 3. POLIME A.53 A 3.50 B 3.M = M’.68 B 3.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG III 3.2 D 3.23 A 3.62 C 3.26 D 3.61 A 3.42 C 3.40 B 3.72 C 3.65 C 3.10 C 3.6 B 3. . ta phân biệt polime trùng hợp và polime trùng ngưng.39 B 3. polime nhân tạo (bán tổng hợp).4 B 3.54 D 3.58 C 3.18 Có liên kết đôi hoặc vòng Có hai nhóm chức có khả không bền năng phản ứng trở lên Trùng ngưng Định nghĩa Quá trình Sản phẩm Khối luợng Điều kiện của monome 47 .64 D 3.52 C 3.27 B 3.56 D 3.…) n Monome → Polime n Monome → Polime+ nH2O Polime trùng hợp Polime trùng ngưng n.3 C 3.33 A 3.48 B 3.37 D 3.30 D 3.29 C 3.73 A 3.24 B 3.63 B 3. Phản ứng Trùng hợp Mục so sánh Là quá trình kết hợp nhiều phân tử nhỏ giống nhau hoặc tương tự nhau (monome) thành phân tử lớn (polime) Là quá trình kết hợp nhiều phân tử nhỏ thành phân tử lớn (polime).44 D 3.Theo phản ứng polime hoá.15 A 3.20 A 3.49 A 3.8 C 3. polime tổng hợp.57 D 3.M = M.35 B 3.21 B 3.16 A 3.32 D 3.25 B 3.13 A 3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.Theo nguồn gốc. ta phân biệt polime thiên nhiên.70 C CHƯƠNG IV.59 C 3.60 A 3.43 C 3.19 A 3.46 A 3.5 D 3.14 B 3.1 C 3.18 A 3.Số mắt xích (n) trong phân tử polime được gọi là hệ số polime hoá hay độ polime hoá.45 A 5.9 C 3.51 D 3.28 D 3.36 A 3. .n n.

không có nhiệt nóng chảy xác định. to. . to. Polime có nhóm chức trong mạch như –CO-NH.2. b) Tính chất hoá học: có 3 loại phản ứng .Tơ: vật liệu polime hình sợi. 3. Đa số polime có tính dẻo.Phản ứng khâu mạch polime: Phản ứng tạo cầu nối giữa các mạch (cầu -S-S.hay -CH2-) thành polime mạng không gian hoặc phản ứng kéo dài thêm mạch polime. bền. một số polime có tính đàn hồi. một số tan trong các dung môi hữu cơ. Khái niệm về các vật liệu polime o .Phản ứng giữ nguyên mạch polime: Phản ứng cộng vào liên kết đôi hoặc thay thế các nhóm chức ngoại mạch. một số có tính dai.Phân tử polime có thể có cấu tạo điều hoà (nếu các mắt xích nối với nhau theo một trật tự xác định) và không điều hoà (nếu các mắt xích nối với nhau không theo một trật tự nào cả). dài và mảnh. . p CH2 CH n Cl poli(vinyl clorua) (PVC) c) Nhựa PS 48 .MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. dạng mạch phân nhánh và dạng mạch không gian.dễ bị thuỷ phân khi có mặt axit hay bazơ.Phân tử polime có thể tồn tại ở dạng mạch không phân nhánh. Nhựa a) Nhựa PE nCH2 CH2 xt.Keo dán hữu cơ: vật liệu polime có khả năng kết nối chắc chắn hai mảnh vật liệu khác. . p CH2 etilen CH2 n polietilen(PE) b) Nhựa PVC nCH2 CH Cl vinyl clorua xt. 4.Chất dẻo: vật liệu polime có tính dẻo. hữu cơ khác.Phản ứng cắt mạch polime: Polime bị giải trùng ở nhiệt độ thích hợp. Tính chất a) Tính chất vật lí Hầu hết polime là chất rắn. . Thí dụ: t CH2 CH n + nCH3COONa CH CH2 n + nNaOH OCOCH3 OH . B . Cấu trúc . không bay hơi. . -COOCH2. có thể kéo thành sợi. .Vật liệu compozit: vật liệu tổ hợp gồm polime làm nhựa nền và các vật liệu vô cơ.Cao su: vật liệu có tính đàn hồi.

. p CH3 metyl metacrylat f) Nhựa PPF Poli(phenol . 49 . p CH CH2 C6H5 n d) Nhựa PVA nCH2 CH OCOCH3 xt. to.nCH C6H5 CH2 xt.t + o CH2 n + nH2O − Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. − Nhựa novolac: Nếu dư phenol và xúc tác axit. OH . nhựa rezol. to. nhựa rezit. to.plexiglas) nCH2 CH COOCH3 xt.. CH2 CH2 CH2OH CH2 CH2 OH . p CH CH2 n OCOCH3 Thuỷ phân PVA trong môi trường kiềm: CH CH2 n + nNaOH OCOCH3 to CH2 CH n + nCH3COONa OH CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) e) Nhựa PMM (thuỷ tinh hữu cơ .. − Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. OH OH n + nHCHO H ..fomanđehit) (PPF) có 3 dạng: nhựa novolac.

H2 C . .. xt CH2 CH C Cl CH2 n f) Cao su flopren nCH2 C F xt. .. to. to. H2C . p. xt CH2 CH CH CH2 CH C6 H 5 CH2 n d) Cao su buna – N nCH2 CH CH CH2 + nCH CN o CH2 t . p..... Cao su a) Cao su buna Na. xt CH2 CH CH CH2 CH CN CH2 n e) Cao su clopren nCH2 CH C CH2 Cl CH CH2 to. t nCH2=CH− CH=CH2  → 0 ( CH 2 CH = CH CH 2 )n buta-1. Tơ a) Tơ capron (nilon – 6) 50 .. .CH2 OH OH CH2 OH CH2 OH CH2 CH2 OH CH2 CH2 OH CH2 CH2 CH2 .... p C CH CH2 n CH3 poliisopren (cao su isopren) CH2 o CH2 t ..3-dien (isopren) c) Cao su buna – S nCH2 CH CH CH2 + nCH C6 H 5 nCH2 xt. p CH2 C F CH CH2 n 3.3-đien (butađien) b) Cao su isopren polibutađien (cao su buna) C CH CH2 CH3 2-metylbuta-1. p. 2..

Câu 4. B. tơ tằm. vì: A. tơ nilon kém bền với nhiệt. len. 3 → → 2 → 4 → 5 → 1.2 Tơ nilon – 6. NHCH(CH3)CO n . C. to. D. p CH2 CH CH CH Cl xt. tơ tằm. metan (3). to.6 có công thức là A. Len. tơ nilon dễ cháy. to. p n 2 n + HCl 2 Cl Cl e) Tơ dacron (lapsan) nHOOC C6H4 COOH + nHO CH2 CH2 axit terephtalic etylen glicol CO OH C6H4 CO O CH2 CH2 O n + 2nH2O poli(etylen terephtalat) (lapsan) C. to. p NH[CH2]5CO n b) Tơ enang (nilon – 7) nH2N[CH2]6COOH c) Tơ nilon – 6. tơ nilon có các nhóm (. tơ tằm. Len. 4 → 6 → 3 → 2 → 5 → 1.1 Hợp chất đầu và các hợp chất trung gian trong quá trình điều chế ra cao su buna (1) là: etilen (2). tơ tằm. Câu 4. to. C. p NH[CH2]5CO n + nH2O xt. Len.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 4. 6 B.3 Không nên ủi (là) quá nóng quần áo bằng nilon. NH[CH2]6CO n . p HN[CH2]6CO n + nH2O NH[CH2]6NHCO[CH2]4CO n + 2nH2O d) Tơ clorin CH2 CH CH2 Cl CH Cl n 2 + n 2 Cl2 xt. C. D.NH -) trong phân tử kém bền với nhiệt. B. Len. to. D. NH[CH2]6NHCO[CH2]4CO n . 51 . tơ nilon mềm mại. NH[CH2]5CO n . Hãy sắp xếp các chất theo đúng thứ tự xảy ra trong quá trình điều chế A.6) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH xt. tơ tằm.nH2N[CH2]5COOH n CH2 CH2 CH2 CH2 xt. p CH2 C=O NH xt.CO . rượu etylic (4). 2 → 6 → 3 → 4 → 5 → 1. axetilen (6). đivinyl (5). 6 → 4 → 2 → 5 → 3 → 1.

C. C. Axetilen. butađien. tơ poliamit. Câu 4.5 Khi H2SO4 đậm đặc rơi vào quần áo bằng vải sợi bông. C. D. CH2=CH–Cl(3).Câu 4. CH2 C(COOCH3) CH3 n D. B. Y . Câu 4. (2). B. chỗ vải đó bị đen lại do có sản phẩm tạo thành là A. CH ≡ CH(2). (1). etanol. Phản ứng đồng trùng hợp. Câu 4. Phản ứng đồng trùng ngưng. polistiren.11 Tơ enang thuộc loại A. Etilen. butađien.8 Cao su buna . Axetilen. C. Anđehit axetic. Tất cả đều sai. (2). D. (3).S được điều chế bằng : A. CH CH CH2 CH CH2 C6H5 . Polivinyl axetat (PVA). vinylaxetilen. Câu 4. nhựa phenol-fomanđehit. Polimetyl acrylat (PMA). B. tơ axetat. D. vinylaxetilen.10 Tên của polime có công thức sau là OH CH2 n A. butađien. Câu 4. butađien. etanol. Phản ứng trùng hợp. H2S. C. B. nhựa bakelít. Phản ứng trùng ngưng. tơ tằm.4 Những phân tử nào sau đây có thể tham gia phản ứng trùng hợp ? CH2=CH2(1). Câu 4. D. (3). CH3–CH3(4) A. Câu 4.9 Thuỷ tinh plexiglas là polime nào sau đây? A. cacbon. D. S.12 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – S? 52 . D. Câu 4. tơ polieste. C.6 Cho sơ đồ sau: CH4 → X → Y → Z → cao su buna. nhựa dẻo. B. PbS. (3). B. CH2 C. C. CH CH2 C6H5 n . (1). (1). B. B. n . (3). CH2 CH CH CH2 n . Tên gọi của X . Z trong sơ đồ trên lần lượt là A. D.7 Cao su buna – S có công thức là A. (2). Polimetyl metacrylat (PMM). (4).

Công thức cấu tạo thu gọn của X là . xt CH2 CH2 to. nCH2 B. CH C CH2 n . D. m CH3 CH2 + mCH C6H5 to. nCH2 C. xt to. p. m CH3 CH2 + mCH C6H5 o CH2 t . p.CH2 C CH CH2 .16 Để điều chế nilon . p.6 người ta dùng axit nào để trùng ngưng với hexametylen điamin ? A. . p. nCH2 D.CH3 CH2 C CH B. axit axetic. B. p. nCH2 D. p. Câu 4. xt CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n .CH2 CH3 CH CH CH2 . nCH2 CH CH CH CH CH C Cl C CH CH2 to. p. xt CH2 CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n .A.14 Phản ứng nào sau đây tạo ra sản phẩm là cao su cloropren? A. xt CH2 CH2 CH2 CH CH CH2 n .15 Hiđro hoá hợp chất hữu cơ X được isopentan. nCH2 B. . xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. CH2 CH2 n n . nCH2 CH CH CH CH CH C Cl C CH CH2 CH2 CH2 to.17 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – N? 53 . C. xt to.CH3 C C CH2 . C. nCH2 C. D. nCH2 CH CH CH CH CH C Cl C CH CH2 to. axit ađipic. p. CH2 CH2 n n . m . CH C CH2 n CH3 CH2 CH CH CH2 n CH C6H5 CH2 . xt Câu 4. p. axit stearic. xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. p.13 Phản ứng nào sau đây tạo ra sản phẩm là cao su isopren? A. X tham gia phản ứng trùng hợp được một loại cao su. xt to. Cl . axit oxalic. p. nCH2 C. xt CH2 CH2 to. A. nCH2 D. p. . CH3 CH2 + mCH C6H5 o CH2 t .6. xt to. CH3 Câu 4. nCH2 B.

caprolactam. nCH2 CH CH C CH2 CH3 C Cl CH2 to. phenol. p. Câu 4. Câu 4. C. C. Câu 4. D.21 Tơ enang được điều chế bằng cách A.CH2 CH COOC2H5. A. C. p. C. B. C. B. –NH– trong phân tử.26 Một polime Y có cấu tạo mạch như sau: 54 . trùng ngưng HOOC-(CH2)4-COOH.22 Nhựa PS được điều chế từ monome nào sau đây? A. D. xt CH3 n n . phenol.20 Tơ capron được điều chế từ monome nào sau đây ? A. xt CH2 CH2 CH C CH C Cl CH2 CH2 to. D.CH2 CH COOCH3. axit metacrylic. xt CH2 CH CH2 CH o CH2 + mCH CH2 t .CH2 CH CH2 OH. trùng ngưng alanin. nhựa bakelít. C. B. CH C6H5 CH2 . B. metyl metacrylat. C. p. D. axit caproic.CH3 CH3 CH2 C CH.18 Tên của monome tạo ra polime có công thức CH3 C CH2 n COOH là A. D. CH CH CH2 CH2 CH CN CH2 n . nCH2 CH CH CH2 + nCH CN CH o CH2 t .A. Câu 4. nCH2 B. caprolactam.23 Chất có khả năng trùng hợp thành cao su là B. –CO–NH– trong phân tử. m C. thuỷ tinh hữu cơ. –CH(CN)– trong phân tử.19 Sản phẩm của phản ứng trùng hợp metyl metacrylat được gọi là A. C. axit metacrylic. D. trùng hợp axit acrylic. trùng ngưng H2N-(CH2)6-COOH. stiren. p. B. xt C6H5 n Câu 4. Câu 4. B. . D. axit acrylic. –CO– trong phân tử. Câu 4. Câu 4. Câu 4.CH2 CH3 CH CH2 CH2 CH3. metyl acrylat. B.25 Tơ poliamit là những polime tổng hợp có chứa nhiều nhóm A.CH2 C CH CH2.CH2 CH OCOCH3. nhựa PVC. CH3 C C CH2.24 Từ monome nào sau đây có thể điều chế được poli(vinyl ancol) ? A. chất dẻo. nCH2 CH D. D. axit metacrylic.

B. B.27 Tiến hành clo hoá poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo ? B. Câu 4. A. Vậy. Các vật liệu polime thường là chất rắn không bay hơi.B. C. − 2− 2− 2− CH CH CH .18% clo theo khối lượng. C6H5CH=CH2. C6H5CH2CH2OH. D.3 – đien (butađien). C. II – BÀI TẬP NÂNG CAO Câu 4. Câu 4. NHCH(CH3)CO n . Cứ 2. CH3-C6H4CH2OH .30 Chọn câu phát biểu sai: A. Công thức cấu tạo thu gọn của X. 1 : 3. B. Trong X có chứa 66. NH[CH2]6NHCO[CH2]4CO n . − 2− 2− 2− 2− CH CH CH CH . 1 : 1. A. B. C6H5CH2CH2OH. C. Câu 4. D. 1 : 2. 3. 1.29 Tiến hành phản ứng đồng trùng hợp giữa stiren và buta – 1.32 Hệ số trùng hợp (số mắt xích) của tơ nilon – 6. Tỉ lệ số mắt xích (butađien : stiren) trong loại polime trên là A. Hầu hết các polime không tan trong nước và các dung môi thông thường.731 gam Br2. 4. C6H5CH(CH3)OH. thu được polime X. D.834 gam X phản ứng vừa hết với 1. C.31 Cho sơ đồ phản ứng sau: → xt . D. Y lần lượt là: A.6 có phân tử khối (M = 2500) là 55 . Polime là những chất có phân tử khối rất lớn do nhiều mắt xích liên kết với nhau. C. p − H 2O X  Y  polime. → X có công thức phân tử C8H10O không tác dụng với NaOH. − 2− CH . C6H5COCH3. C6H5CH2CHO. còn tinh bột và xenlulozơ là loại polime tổng hợp. Câu 4. 2 : 3.… − 2− 2− 2− 2− 2− 2− 2− 2− … CH CH CH CH CH CH CH CH Công thức một mắt xích của polime Y là A.28 Tơ capron (nilon – 6) có công thức là NH[CH2]5CO n . 2. C. Polietilen và poli(vinyl clorua) là loại polime thiên nhiên. C6H5CH=CH2. NH[CH2]6CO n . D. Câu 4. D. t o . − 2− 2− CH CH .

B. C. (2). amilopectin. (3).36 Chất dẻo PVC được điều chế theo sơ đồ sau: CH 4  H = 1 → A  H = 9%→ B  H = 9 → PVC. (9).38 Cho các chất sau: butan (1). axetilen (8). 5883 m3. amilopectin. PVC. (1). N2) trong đó có 57. (4). x 3 = . PVC. (1).3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y. (10).35 Cho các polime : PE. = . (1) → (4) → (5) → (6). amilopectin. D.  5%  5 Câu 4. amilozơ. 13.37 Đồng trùng hợp đimetyl buta–1. benzen (3).A. xenlulozơ. B. (2).33 Điều chế nhựa phenol-fomanđehit (1). (7). y 2 D. Câu 4. amilozơ . D. etilen (9). các chất đầu và chất trung gian trong quá trình điều chế là: metan (2). vậy để điều chế một tấn  0% PVC thì số m3 khí thiên nhiên (đktc) cần là A. PVC. D. xenlulozơ. amilozơ. (6). (1). etilen (4). PE. B. cao su buna. B. (8). Hãy cho biết sơ đồ chuyển hoá nào sau đây có thể dùng để điều chế poli(vinyl clorua) ? A. natri phenolat (7). PE. (5). 11. (5). H2O. anđehit fomic (4). B. (7). PVC. Chọn các chất thích hợp cho sơ đồ đó là A. D. poli(vinyl ancol). (1). cao su buna.34 Đun nóng poli (vinyl axetat) với kiềm ở điều kiện thích hợp ta thu được sản phẩm trong đó có A. 6235 m3. (3). x 3 = . (3). 4576 m3. 12. phenyl clorua (10). xenlulozơ. Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 x 2 A. (5).69% CO2 về thể tích. Câu 4. C. cả A và B. D. (2). PE. ancol vinylic. xenlulozơ. C. 56 . y 3 y 3 C. B. B. nhựa PVC (6). cao su lưu hoá. Đốt cháy hoàn toàn một lượng polime này. axeton. C. (2). D. (6). (1) → (2) → (4) → (5) → (6). cao su lưu hoá. (7). Câu 4. thu được một loại polime. etin (2). 10. (8). Câu 4. ancol etylic. = . y 5 Câu 4. 7225 m3. (4). (9). (4). thu được hỗn hợp khí và hơi (CO2. C.cao su buna. C. phenol (5). PE. (3). (6). Biết CH4 chiếm 95% thể tích khí thiên nhiên. cao su buna . Polime có dạng cấu trúc mạch không phân nhánh là A. metan (3). amilozơ. benzyl clorua (6). (5). (1) → (3) → (2) → (5) → (6). PVC. vinyl clorua (5).

anđehit axetic. HO-CH2-CH2-OH. Công thức của X. Dùng kim may (máy may) may thử vài đường chỉ trên lụa. D. So sánh khả năng thấm nước của chúng. HOOC-CH2CH2-COOH. C. to. HO-C6H4-OH. p HN[CH2]6CO xt. axeton. tơ xenlulozơ axetat) và tơ thiên nhiên (tơ tằm. HOOC-C6H4-COOH. to. B. B. So sánh độ bóng của lụa. ta thu được sản phẩm trong đó có: A. p + n Cl2 A. nhẵn Câu 4. C đều đúng. chỉ phản ứng (1).40 Có thể phân biệt các đồ dùng làm bằng da thật và da nhân tạo (PVC) bằng cách nào sau đây? A. khét. mềm mại hơn tơ nhân tạo. còn da nhân tạo không cho mùi D. Đốt hai mẫu lụa. chỉ phản ứng (3). Đốt hai mẫu da. B.Câu 4. da thật mềm mại hơn da nhân tạo. B. B. da thật ở vết cắt bị xơ. ancol vinylic. C.39 Khi cho hai chất X và Y trùng ngưng tạo ra polime Z có công thức O CH2 CH2 O C C6H4 C n O O . C. ancol etylic. lụa sản xuất từ tơ thiên nhiên dễ may hơn lụa sản xuất từ tơ nhân tạo. D. Câu 4.42 Xét các phản ứng sau đây. So sánh độ mềm mại của chúng. HO-CH2-COOH. phản ứng nào thuộc loại phản ứng trùng ngưng ? (1) nH2N[CH2]6COOH xt. Y lần lượt là A. len). len) người ta dùng cách nào sau đây? A. da thật dễ thấm nước hơn. còn mẫu lụa sản xuất từ tơ nhân tạo không cho mùi khét. C. n CH2 CH CH CH n + 2HCl . lụa sản xuất từ tơ thiên nhiên có độ bóng cao hơn lụa sản xuất từ tơ nhân tạo. B.43 Để phân biệt lụa sản xuất từ tơ nhân tạo (tơ visco. So sánh độ mềm mại của chúng. HO-C6H4-COOH. Câu 4. mẫu lụa sản xuất từ tơ thiên nhiên cho mùi khét. D. cả A. hai phản ứng (2) và (3). mẫu da thật cho mùi khét. p n + nH2O .41 Đun nóng vinyl axetat với kiềm ở điều kiện thích hợp. Câu 4. còn da nhân tạo thì bóng. D. NH[CH2]6NHCO[CH2]4CO n + 2nH2O . Dùng dao cắt ngang hai mẫu da. Cl Cl Cl 2 (2) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH (3) CH2 CH CH2 CH Cl Cl n 2 2 xt. 57 . C. to. tơ thiên nhiên (tơ tằm. hai phản ứng (1) và (2).

13 C 4.25 A 4. (7) tơ axetat. protein. ĐẠI CƯƠNG VỀ KIM LOẠI A. 65kg và 40kg.000.46 B 4. polietilen.11 B 4. C. 171kg và 82kg.37 A 4.46 Polime ( CH 2 CH(OH) ) n là sản phẩm của phản ứng trùng hợp sau đó thuỷ phân trong môi trường kiềm của monome nào sau đây ? A. Câu 4.2 C 4.6.27 B 4.21 C 4.10 A 4. C. C. Công thức một mắt xích của X là A.Câu 4. C.1 A 4. CH2 = CH – COOCH3. (2).43 C 4.9 A 4. Câu 4. – CHCl – CHCl – . Loại tơ có nguồn gốc xenlulozơ là A.40 C CHƯƠNG V. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IV 4.24 B 4. C2H5COOCH2CH = CH2. – CH2 – CHCl – . CH3COOCH = CH2.3 B 4. C. B. (3). (6). (3) sợi đay. tơ poliamit.31 C 4. tơ polieste. Câu 4.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.30 D 4. B. – CH = CCl – . tơ visco.49 Khi đốt cháy một loại polime chỉ thu được khí CO 2 và hơi H2O với tỉ lệ n CO2 : n H2O = 1:1 .45 C 4. (5). 2. B. (1).15 C 4.7 C 4.48 B 4.19 D 4. D. (7).17 C 4. (6). Câu 4.5 A 4.44 Polime X (chứa C. (6) nilon – 6. polime trên thuộc loại nào trong số các polime sau ? A. (5). (2). D. (3).44 A 4.26 D 4. D. H. (6). D. (5) tơ visco.32 B 4. chu kì (số lớp electron).47 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu ? Biết hiệu suất quá trình este hoá và trùng hợp lần lượt là 60% và 80%.47 A 4.6 C 4.14 B 4.18 C 4. (2).42 C 4. poli(vinyl clorua).20 B 4.48 Cho các polime sau đây: (1) tơ tằm.4 D 4.39 A 4. C.41 C 4.22 D 4. số thứ tự nhóm A (số electron ngoài cùng). – CCl = CCl – .38 D 4. số thứ tự nhóm B (số electron ngoài cùng + số electron kề ngoài cùng chưa bão hoà). (4) tơ enang. 58 .23 A 4. D.16 D 4.29 B 4.45 Tơ lapsan thuộc loại A. tơ axetat. 3 electron ở lớp ngoài cùng.33B 4. Cl) có hệ số trùng hợp là 560 và phân tử khối là 35.34 C 4. CH2 = CHCOOCH2CH = CH2.36 A 4. (7). 2. B. A. Vị trí của kim loại: ô nguyên tố (Z). B. B. 175kg và 70kg.12 D 4. (2) sợi bông. Câu 4.28 A 4.35 D 4. Cấu tạo của kim loại: thường có 1. 215kg và 80kg.49 B 4. D. tinh bột. Vậy.8 B 4.

Hợp kim: là vật liệu kim loại có chứa một kim loại cơ bản và một số kim loại khác hay với một vài hợp kim. Nhớ thứ tự các cặp oxi hoá khử sau : Cu2+/Cu Fe3+/Fe2+ Ag+/Ag 2 Fe3+ + Cu → Cu2+ + 2Fe2+ Fe3+ không oxi hoá Ag. IIA (trừ Be. Cấu tạo của đơn chất kim loại: mạng tinh thể gồm có các ion dương dao động liên tục ở các nút mạng và các electron tự do chuyển động hỗn loạn giữa các ion dương.Ăn mòn hoá học là quá trình oxi hoá .khử. phi kim. Au).Ăn mòn điện hoá là quá trình oxi hoá . 3Cu + 8HNO3 → 3Cu(NO3)2 + 2NO + 4H2O .Tác dụng với phi kim : xM + M+ y O2 → MxOy 2 n Cl2 → MCln 2 n H2 2 . trong đó các electron của kim loại được chuyển trực tiếp đến các chất trong môi trường.Chú ý rằng. Tính chất vật lí chung của kim loại: tính dẻo. K. Fe + Cu2+ → Fe2+ + Cu . dẫn nhiệt. dẫn điện và dẫn nhiệt kém hơn kim loại nguyên chất. Hợp kim có t0 nóng chảy thấp hơn. . trong đó kim loại bị oxi hoá do tác dụng của dung dịch chất điện li và tạo nên dòng electron chuyển dời từ cực âm đến cực dương. Cr thụ động trong dd HNO3 đặc nguội.Tác dụng với H2O IA. H2SO4 đặc nguội. các điện cực cùng tiếp xúc với 1 dung dịch chất điện li.Dãy điện hoá kim loại cho phép dự đoán chiều phản ứng giữa 2 cặp oxi hoá khử : chất oxi hoá mạnh nhất sẽ oxi hoá chất khử mạnh nhất sinh ra chất oxi hoá yếu hơn và chất khử yếu hơn. Al. . Tính chất hoá học chung: tính khử : M  M n+ + ne → .Tác dụng với axit HCl.Tác dụng với dd muối Kim loại mạnh (trừ Ba. 8. H2SO4 đặc oxi hoá kim loại (trừ Pt. Liên kết kim loại: lực hút tĩnh điện giữa các electron tự do và các ion dương kim loại. 5.3. 4. dẫn điện. các điện cực tiếp xúc với nhau. . . 6.khử. 59 . Na + 2H2O → 2NaOH + H2 . Mg) khử H2O ở t0 thường thành H2. Na) khử ion của kim loại yếu hơn trong dd muối thành kim loại tự do. H2SO4 loãng : M + n H+ → Mn+ + Kim loại sau H không khử được H+ thành H2. H2SO4 đặc Dung dịch HNO3.3 điều kiện cần và đủ để kim loại bị ăn mòn điện hoá : các điện cực khác chất. ánh kim do các electron tự do gây ra. hợp chất khử chứa nguyên tố có số oxi hoá thấp lên cao và nó bị khử xuống mức oxi hoá thấp hơn. Ca. muốn B được bảo vệ thì A phải có tính khử mạnh hơn B.Fe. 9.Tác dụng với dd HNO3. . nhưng cứng hơn kim loại nguyên chất. với cặp kim loại A─B. Sự ăn mòn kim loại: là sự oxi hoá kim loại do tác dụng của các chất trong môi trường xung quanh : M → Mn+ + ne .

C. Nguyên tắc điều chế kim loại: là sự khử ion kim loại : Mn+ + ne → M . Al. A là nguyên tử khối (hoặc phân tử khối). ne là số mol electron trao đổi trong quá trình điện phân. Công thức của định luật Farađay a) m = A 1 .10. * Phương pháp điện phân dung dịch để điều chế kim loại sau Al. n là hoá trị (hoặc số mol electrron trao đổi tính cho 1 mol chất thoát ra ở điện cực. t là thời gian điện phân tính bằng giây. .Các phương pháp điều chế kim loại : * Phương pháp thuỷ luyện cần có dung dịch muối của kim loại cần điều chế (sau Al) và kim loại có tính khử mạnh hơn (trừ Ba. m là lượng chất thoát ra ở điện cực theo gam. 11. CO. K. t là thời gian điện phân tính bằng giây. Ca. Al) và oxit của kim loại cần điều chế (sau Al). IIA.It n 96500 Trong đó I là cường độ dòng điện tính bằng Ampe. b) It = ne. Na) * Phương pháp nhiệt luyện cần có 1 trong 4 chất khử (H2. 60 .96500 Trong đó I là cường độ dòng điện tính bằng Ampe. * Phương pháp điện phân nóng chảy để điều chế kim loại IA.

CuSO4 + H2O  Cu + → 26.MỘT SỐ PHẢN ỨNG THƯỜNG GẶP t 1. 2NaOH  2Na + O2 + H2O → 2 ñpnc 20. 3Fe3O4 + 8Al  4Al2O3 + 9Fe → 3 ñpnc 17. Al2O3  2Al + O2 → 2 ñpnc 18. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 61 . Fe + 3AgNO3. Fe + S  → t0 3. Fe + H2O → FeO + H2 1 7. 2Fe + 3Cl2  → 0 t 2. Fe2(SO4)3 + Cu  CuSO4 + 2FeSO4 → 12. Fe2O3 + 3CO  2Fe + 3CO2 → t0 16. MgCl2  Mg + Cl2 → ñpdd 23. H2 + PbO  H2O + Pb → t0 15. Fe + 2HCl  → 0 2FeCl3 FeS Fe3O4 FeCl2 + H2 5. CuCl2  Cu + Cl2 → 0 1 O2 + H2SO4 2 1 ñpdd 25. dư  Fe(NO3)3 + 3Ag → t 14. Ba + 2H2O  Ba(OH)2 + H2 → 0 9.B. Na + H2O  NaOH + H2 → 2 8. 2NaCl  2 Na + Cl2 → 1 ñpnc 19. 2FeCl3 + Fe  3FeCl2 → 11. 3Fe + 2O2  → 4. 2AgNO3 + H2O  2Ag + O2 + 2HNO3 → 2 ñpdd 24. Fe + 2AgNO3  Fe(NO3)2 + 2Ag → 13. Fe + CuSO4  FeSO4 + Cu → 10. Fe + 4HNO3  Fe(NO3)3 + NO + 2H2O → >570 C 6.

ô 26. Cl.4g hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 0. Dãy gồm các nguyên tử và ion có cấu hình electron trên là A.44g một kim loại hoá trị II trong 150ml dung dịch H 2SO40. chu kì 4. Câu 5. F. Câu 5. chu kì 4. ô 18. 63. C. ô 20. B. D. Nguyên tử M là A. D. liên kết giữa các nguyên tử bằng các cặp electron dùng chung. Be. các ion dương kim loại và các electron tự do. ô 20. C. 81%. Số g muối tạo ra là A. nhóm VIIIA. C.5 Cation M có cấu hình electron ở phân lớp ngoài cùng là 2p6.6g khí H2 bay ra. D. D.7.6 Hoà tan 1. Cl. C. nhóm IIB. D. chu kì 3.7 Hoà tan hoàn toàn 15. Ar. Câu 5.1 Vị trí của nguyên tử M (Z = 26) trong bảng hệ thống tuần hoàn là A. Vị trí M trong bảng hệ thống tuần hoàn là A. chu kì 4. C. 82%. C. nhóm VIIIA. Câu 5.8 Liên kết kim loại là A.7. Ca. C.4 Cho cấu hình electron: 1s22s22p63s23p6. Na. 62 . Ca2+. Câu 5. B. nhóm VIIIB.7. B. D. chu kì 4. Muốn trung hoà axit dư trong dung dịch thu được phải dùng hết 30ml dung dịch NaOH 1M. ô 18. Cl. Ar.5M. C. Ba. nhóm IIB. D. các electron tự do. 36.3 Trong mạng tinh thể kim loại có A. Cl-. B.C . K+. chu kì 3. Mg. B. B. Kim loại đó là A. Ar. Câu 5. nhóm IIA. + Câu 5. 83%. Phần trăm khối lượng của Al trong hợp kim là A. chu kì 4. K+. 84%. 35. C. K. ô 26. liên kết sinh ra bởi lực hút tĩnh điện giữa ion dương và các ion âm. cứ 10 mol Al thì có 1 mol Ni. Ar. 2+ Câu 5. chu kì 4.9 Trong hợp kim Al. B.2 Ion M có cấu hình electron ở lớp ngoài cùng là 3s 23p6. D. Ca2+. nhóm IIA. các nguyên tử kim loại. B. B. liên kết sinh ra bởi lực hút tĩnh điện giữa các ion dương và các electron tự do.7. ion âm phi kim và ion dương kim loại. liên kết sinh ra bởi lực hút tĩnh điện giữa nguyên tử H tích điện dương và nguyên tử O tích điện âm. nhóm VIIIB. ô 26. ô 26. D. 53.Ni.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 5. F.

X ( Ag). X ( Ag). Zn(NO3)2.20 Cho bột Cu đến dư vào dung dịch hỗn hợp gồm Fe(NO3)3 và AgNO3 thu được chất rắn X và dung dịch Y.1%. ZnCl2. B.398g kết tủa. Câu 5. Pb(NO3)2.10 Ngâm 2.5g hợp kim của Ag vào dung dịch HNO3. dẫn nhiệt. Câu 5. dẫn điện. nhiệt độ nóng chảy cao hơn kim loại nguyên chất. 73. 74. Cu2+. dẫn điện. ánh kim. Tính cứng. dẫn điện. C. Ag+.16 Ngâm một lá kẽm nhỏ trong một dung dịch có chứa 2. C. D. Câu 5. CuSO4. Ni khử được các ion kim loại A. 75. C. Sn(NO3)2.15 Một phương pháp hoá học làm sạch một loại thuỷ ngân có lẫn Zn.Fe khử Cu2+ thành Cu. B. Thêm dung dịch HCl vào dung dịch trên. AgNO3. D. NaCl. C. B. Nhiệt độ nóng chảy cao.Câu 5. thu được 0. Cu. Ag.1%. Ag+. Câu 5. CuAl. B. Lá sắt bị ăn mòn kiểu hoá học. tính dẻo hơn kim loại nguyên chất. D. Zn. 72. Hg(NO3)2. tính cứng hơn kim loại nguyên chất. Fe2+).1%. AlCl3. D. dẫn nhiệt. Ag+.Zn trong dung dịch HCl đến phản ứng hoàn toàn thu được 0. B. dẫn nhiệt.18 Cho lá sắt vào dung dịch HCl loãng có một lượng nhỏ CuSO4 thấy H2 thoát ra càng lúc càng nhanh do A. Y ( Cu2+. Câu 5. Thành phần %Ag trong hợp kim là A. Sn. X ( Ag. Công thức hoá học của hợp kim là A. 61%. X có thể là A. D. B. dẫn nhiệt. C. Fe2+). Cu2+. Thành phần % của Fe là A. B. Pb(NO3)2. Phản ứng xong. Cu.19 Ngâm một lá Ni lần lượt trong những dung dịch muối sau : MgSO4. C.33g hợp kim Fe. ánh kim. B. Sn. Pb2+. tính dẫn điện. Na+. Pb là ngâm hỗn hợp trong dung dịch X dư. Cu2+. C. Lá sắt bị ăn mòn kiểu điện hoá. Y (Cu2+). Fe. D. ánh kim. X. Y (Cu2+). B. Ag+. dẫn điện. Câu 5. Tính dẻo. ánh kim. C. X (Fe). 62%.3% Al. Câu 5. B. D. 63 .1%. CuAl3.24g ion M 2+. Cu). D. M là A. C. Cd. C. Cu3Al2. D. Mg2+.13 Hợp kim có A. 63%. Y ( Cu2+. Câu 5. C.14 Một hợp kim Cu-Al chứa 12. Y lần lượt là A. Câu 5.11 Hoà tan 0. Al3+.Fe tan trong dung dịch HCl tạo khí H2.17 Để bảo vệ vỏ tàu đi biển phần ngâm dưới nước người ta nối nó với A.12 Tính chất vật lí chung của kim loại là A.94g.896 lít H2 (đktc). khối lượng lá kẽm tăng thêm 0. B. dẫn nhiệt cao hơn kim loại nguyên chất. 60%. D. Ni. Câu 5. Tính mềm. Cu3Al. Cu2+. D.

Fe3+/ Fe2+. (1) và (2). FeO. C. Ag+.23 Cho các ion : Fe . Cu2+/ Cu. Fe2+. B. AgNO3.22 Ngâm một lá Zn trong 200ml dung dịch AgNO3 0. Câu 5. C. Cu2+. xuất hiện kết tủa xanh. Ag+. Cu. có khí thoát ra. dung dịch mất màu xanh. Câu 5. có khí thoát ra.25 Trong một dung dịch A có chứa đồng thời các cation sau : K+. Ag+/Ag. Câu 5. Cu2+. Fe3+/Fe2+. NO3-. Cl-. C. Fe. C. C.21 Chọn một dãy chất tính oxi hoá tăng A. Ag+/Ag. D. Fe3+/ Fe2+. xuất hiện Cu màu đỏ. Cu. Fe2+. xuất hiện kết tủa xanh. Cu(NO3)2. tăng 0. Fe2+. tăng 1. Al3+. Câu 5. B. D. Fe2+/ Fe. FeCl2. C. Al3+. B. không bị khử. Al3+. Ba2+. Ag . Chọn một dãy điện hoá gồm các cặp oxi hoá. Tách Ag ra khỏi hỗn hợp với khối lượng không đổi người ta dùng dung dịch A. Fe3+.24 Có một hỗn hợp gồm: Fe.28 Khi nung Fe(OH)2 trong không khí ẩm đến khối lượng không đổi.26 Cho các cặp oxi hoá. xuất hiện Cu màu đỏ. Cu2+. Kim loại Cu khử được các ion trong các cặp oxi hoá trên là A. Ag+/ Ag. Fe2+. C. D. Fe3+. tính khử của kim loại giảm A. Fe3+.30 Có 2 ống nghiệm đựng dung dịch CuSO4. Cu. Ag+. D..27 Cho các cặp oxi hoá. Al. Fe3+.43g. Trong dung dịch A chỉ chứa một loại anion là A. B. Fe3+/ Fe2+. Fe2+/ Fe. sau đó kết tủa không tan. Khi phản ứng kết thúc khối lượng lá Zn A.51g. Ion Cu2+ bị khử thành Cu trong thí nghiệm A. D.Ag+/Ag. Cu2+/ Cu. FeCl3. D. Fe2+/ Fe. 2+ Câu 5. D. Cu2+. Fe2+. D. Cu2+/ Cu. C. (2). Ag+. Câu 5. Fe2+.khử xếp theo chiều tính oxi hoá của ion kim loại tăng.51g. dung dịch có màu xanh. Fe2+.1M. D. Câu 5. giảm 1. B. Fe2O3. Câu 5. B.29 Thả Na vào dung dịch CuSO4 quan sát thấy hiện tượng A. D. Ag+/Ag. Fe .43g. SO42-. Al3+. B. Fe3+. Fe2+/ Fe.Câu 5. sau đó kết tủa tan. Ag. B. Cu2+/Cu. Fe2+/ Fe. Fe3+. Ag+. 64 . B. 2+ + C. Al3+. Cu2+. B. giảm 0. CO32-. Fe3O4. Fe3+/ Fe2+. Câu 5. Ag+/Ag. ta thu được chất rắn là A. Ag+ và các kim loại : Fe. Fe3+. Ag+.khử : Al3+/Al. Cu2+/Cu. ống nghiệm (2) một đinh Fe đã làm sạch. Fe(OH)3. Cho vào ống nghiệm (1) một miếng nhỏ Na. C. Kim loại khử được ion Fe3+ thành Fe là A. Fe2+/ Fe. Cu2+/Cu. Cu. (1). Fe3+/ Fe2+.khử : Al3+/Al. Ag.

Sau phản ứng khối lượng kim loại có trong bình là 1. 53%. Na ở catot. 56%. Câu 5. 0.154g. Nồng độ C% của dung dịch CuSO4 còn lại là A.37 Điện phân NaCl nóng chảy với điện cực trơ. 4.35 Cho sơ đồ : CaCO3 → CaO → CaCl2 → Ca. Câu 5. 24. 0. NaOH.87%.38 Một loại quặng sắt chứa 80% Fe2O3 và 10% SiO2. Câu 5. Điều kiện phản ứng và hoá chất thích hợp cho sơ đồ trên lần lượt là A. C. Cu. 3. 2. Thành phần % theo khối lượng của Fe và Si trong quặng này lần lượt là A. C. Câu 5. Cl2 ở anot.12M. Ba. dung dịch HCl. 65 . Fe. MgO cần dùng 7g khí CO. Hg. B. 25.1M. điện phân dung dịch CaCl2.36 Từ dung dịch CuSO4 để điều chế Cu. Câu 5. dung dịch H2SO4 loãng. B. 9.40 Hoà tan m g Ba vào nước thu được 1 lít dung dịch có pH = 12. FeO.7%. C. Khi que sắt đã được mạ kín thì có khối lượng là 5. Câu 5. 0. sau 1930 giây thấy khối lượng catot tăng 1.32 Nhúng một que sắt nặng 5g vào 50ml dung dịch CuSO 4 15% (D = 1. 2. D. 52%. 9000C.9%.34 Để khử hoàn toàn 30g hỗn hợp gồm CuO. Al. 0.15g. D. B. Mg. Fe.12g bột Fe và 0. B. dung dịch HNO3.92 gam. Fe.33 Ngâm một lá kim loại có khối lượng 50g trong dung dịch HCl. Cl2 ở catot. D. 9000C. Câu 5. D. C.74g.6%. điện phân CaCl2 nóng chảy. 0. NaClO. C. dung dịch HCl. D. điện phân CaSO4 nóng chảy.39 Điện phân (điện cực trơ) dung dịch muối sunfat của một kim loại hoá trị II với cường độ dòng điện 3A. B. Fe 2O3 Fe3O4. D.7%. B.15g. 3. Cu.Câu 5. 3.7%. Ni. Cl2 ở anot. Câu 5.12 g/ml).685g.7%. 23. D. Câu 5. B.31 Cho 1. D. 4. 9000C. Na. người ta thu được A. C. Sau khi thu được 336ml H2 (đktc) thì thấy khối lượng lá kim loại giảm 1. 54%. người ta dùng A. Số gam chất rắn thu được sau phản ứng là A.88g.06M. H2 ở catot. Kim loại đó là A. Giá trị của m là A. 9000C. C. B. Fe. 8. 9. C. 26. C. Tên kim loại là A. điện phân Ca(NO3)2 nóng chảy. Nồng độ mol/lít của dung dịch CuSO4 trước phản ứng là A.68%. D.53%.04M. B. B. 8. D. Ag. Na ở anot. có màng ngăn 2 điện cực. C.24g bột Mg vào một bình chứa sẵn 250ml dung dịch CuSO4.

MgCl2. D. NaOH. NaCl. Sau một thời gian. Kim loại M là A. Al. B. CaCl2. C.63g. 6. Ba. Mg. Fe. Mg. Fe. người ta thu được sản phẩm là A. không có màng ngăn 2 điện cực. 27. D. Mg. D. Cho dd MgCl2 tác dụng dd Na2CO3. Al.Câu 5. Ở catot thu được 7. Ba.7g. D. Khi cô cạn dung dịch thu được số gam muối khan là A. Khối lượng sắt đã tham gia phản ứng là A. Câu 5.48 lít.45 Sau một thời gian điện phân dung dịch CuCl2 thu được 1. Chất rắn sau phản ứng tan trong dung dịch HCl dư tạo 13.43 Điện phân dung dịch NaOH với điện cực trơ. C. D. Fe. C. NaCl.47 Cho 16. Al. 0. 27. C.75g. 3. Mg. 9. Câu 5.49 Cho 19. D. KCl.72 lít khí (đktc). Cu. sau đó thêm 500ml dung dịch HCl 2M.8g. Điện phân dung dịch MgCl2.44 Ion Mg bị khử trong trường hợp A. người ta lọc lấy dung dịch có pH = 2. B. 28. Mg. Cu. C. Al.24 lít. C.2g kim loại M (hoá trị không đổi) tác dụng với 0. 0. B. D. Al.36 lít.14g. Thể tích khí NO (đktc) thu được là A. Điện phân MgCl2 nóng chảy. Mg. B. NaClO. B. D.48 Có 5 mẫu kim loại: Mg. Ca.2 gam kim loại và 6. Số gam Cu điều chế được từ các thí nghiệm trên là A. C.2g. Al.50 Có dung dịch HCl 0. B. 0. Fe. Ba.46 Hoà tan hoàn toàn 10g hỗn hợp Al và Mg trong dung dịch HCl thu được 0.41 Điện phân muối clorua nóng chảy của kim loại M thu được 12g kim loại và 0. Câu 5. Câu 5.72 lít. 28. Ba. 4. C. Cu. 12. B.44 lít khí (đktc).1M. Cl2.5g khí H2.25g.2g. 2g. Nếu chỉ dùng thêm dung dịch H2SO4 loãng thì có thể nhận biết A.25g. Câu 5. Muối clorua đó là A.2g Cu vào 500 ml dung dịch NaNO3 1M. Câu 5. Câu 5. Thả Na vào dung dịch MgCl2. C.6g. 2. B. phản ứng xong thấy khối lượng đinh Fe tăng thêm 1. 2+ Câu 5. 1. Câu 5. M là A. B.26g.42 Điện phân nóng chảy muối clorua của kim loại M. C. 66 .3 mol khí.15 mol O 2. B.75g. D. Rót 250ml dung dịch này vào cốc đựng mạt sắt.12 lít khí (đktc) ở anot. Ca. 3. Na. Ngâm một đinh Fe trong dung dịch còn lại sau điện phân. Ba. D.

Câu 5. C.6. CO2 + Ca(OH)2 → CaCO3 + H2O. Nồng độ mol/l của dung dịch CuSO4 đã pha chế là A. D. C. lượng kết tủa thu được lớn nhất là A. dung dịch NaHCO3.54 Một hỗn hợp X gồm Na và Al được trộn theo tỉ lệ mol 1: 2. sau khi kết thúc phản ứng thu được 8. magie.55 Hoà tan 1.11 mol khí CO2 đi qua dung dịch NaOH sinh ra 11. 0.52 và 8. Câu 5. Fe. 0.4g. B. C. C. Để phản ứng hết với dung dịch này cần 20ml dung dịch BaCl2 0. B.02. Dung dịch HCl. 1. Câu 5.232M. B. D.2. canxi. C. Hai kim loại X.51 Cho 0.60 Cho phương trình phản ứng : a X + b Y(NO3)a → a X(NO3)b + b Y Biết dung dịch X(NO3)b có màu xanh. Mg. C. Ca(HCO3)2 → CaCO3 + CO2 + H2O.76.725M. Câu 5. sau đó cô cạn dung dịch thu được 5. BaSO4. C.Câu 5. Cho X vào một lượng nước dư. n CO2 = 2 n Ca(OH)2 . D. Tên kim loại đó là A. Số phương trình phản ứng hoá học (dạng phân tử) xảy ra khi cho các chất tác dụng với nhau từng đôi một là A. 2. 0. Công thức của muối sunfat là A. Giá trị của m là A. D. Ag.58 Cho các chất: CaCO3. Cu. 4.56 Hoà tan 2. Câu 5.464M.27g. Câu 5. Na2CO3 + Ca(OH)2 → CaCO3 + 2 NaOH. Câu 5. kẽm. n CO2 < n Ca(OH)2 . Cu. Dung dịch HNO3. Cu. B.5H2O trong nước được 500ml dung dịch. CaSO4. D. 5.57 Hoà tan 58g muối CuSO4. B. Dung dịch CuSO4.42 và 11. B. thuốc thử đó là A. D. 0. 0. C.52 Cho dòng khí CO2 liên tục đi qua cốc đựng dung dịch Ca(OH)2. Số g mỗi muối trong hỗn hợp là A. D. n CO2 = n Ca(OH)2 .53 Hiện tượng tạo thành các thạch nhũ trong các hang động được giải thích bằng phản ứng A.84 và 10.3625M.68 và 9. Ag. Câu 5. bari. D. D.55g muối khan. CaO + CO2 → CaCO3.0g một kim loại hoá trị II trong dung dịch HCl. dung dịch HCl. C. B.92. C.54g.75M. 1. B. 0. 3. B. 67 . D. dung dịch NaOH.7g.44g hỗn hợp 2 muối. MgSO4. 0. Fe. n CO2 > n Ca(OH)2 . BeSO4.8g muối sunfat của một kim loại nhóm IIA trong nước rồi pha loãng cho đủ 50ml dung dịch. Câu 5.59 Dùng một thuốc thử phân biệt Fe2O3 và Fe3O4. 0.96 lít khí H 2 và m g một chất rắn. B. Y lần lượt là A. Dung dịch H2SO4 loãng. 2.

MgSO4.66 Một kim loại dùng để loại bỏ tạp chất Fe2(SO4)3 trong dung dịch FeSO4 là A.62 Điện phân nóng chảy 76g muối MCl2 thu được 0. Câu 5.61 Cho a g kim loại M tác dụng vừa đủ với V lít dung dịch HCl 2M thu được (a + 21. 56. D. 3a + 2b = c + 2d. b. d là A. MnO4. Fe(NO3)2.10. C. b mol Cu2+. B. Fe2(SO4)3.68 Trong một cốc nước chứa a mol Al3+.3) g muối MCln.65 Có các kim loại Cu.2 lít. Biết rằng toàn bộ Cu sinh ra đều bám hết vào thanh M. c mol Cl-. MnO4. Câu 5. C. D. II – BÀI TẬP NÂNG CAO Câu 5. Câu 5. B. D. B. B. Biết hiệu suất phản ứng điện phân là 80%. Câu 5. 0. Zn. Fe2(SO4)3.80g. Câu 5. D.69 Cho Cu vào hỗn hợp gồm NaNO3 và H2SO4 loãng. khối lượng thanh M tăng 0. 27. dung dịch KMnO4 bị mất màu là do A.không màu trong môi trường axit. Cho A tác dụng hết với dung dịch HNO3 loãng. Câu 5. 9. 0. c. MgSO4. D. C.là A. 10.bị khử thành Mn2+. Fe và các dung dịch muối Cu(NO3)2. 65. B. C. Câu 5.67 Cho hỗn hợp X gồm Mg và Fe vào dung dịch axit H 2SO4 đặc nóng đến khi các phản ứng xảy ra hoàn toàn. Nguyên tử khối của M là A. Số phương trình phản ứng hoá học xảy ra khi cho kim loại và muối tác dụng với nhau là A. Giá trị m là A. thu được dung dịch Y và một phần sắt không tan. C. MnO4. 24. Ca. 1. C.bị oxi hoá.1 mol khí duy nhất NO (đktc). D. 0.08g. dư thu được 0.3 lít. Chất tan có trong dung dịch Y là A. MnO4. 2a + 2b = c + d.08g. bị khử. FeSO4.Câu 5. d mol SO42-. Mg. Câu 5. C.6 lít. D.70 m g phoi sắt để ngoài không khí lâu ngày bị gỉ tạo thành hỗn hợp A có khối lượng 12g gồm 4 chất rắn. C. D.tạo thành phức với Fe2+. D. Ba.8g. B. FeSO4. Tên của M là A. AgNO3.4M đến khi dung dịch hết màu xanh. 2a + 3b = 2c + d. 3a + 2b = c + d. 68 . B. C. MgSO4. 2. Cu. Ag. Cu.4 lít.64g. 0. bị oxi hoá. không bị khử không bị oxi hoá. B.64 Khi phản ứng với Fe2+ trong môi trường axit dư. 9. Vai trò của ion NO3. vừa bị khử vừa bị oxi hoá. Fe. B. V có giá trị là A. 4.63 Khuấy một thanh kim loại M hoá trị 2 trong 200ml dung dịch Cu(NO3)2 0. D.64 mol khí Cl2 ở anot. Ag. B. C. Biểu thức liên hệ giữa a. MgSO4. 3.

72 Oxi hoá m g sắt ngoài không khí. 25.77 Cho 10. 3. 29g. B. 2. D. Câu 5. 3.224 lít.8g. không tác dụng với nước và đứng trước Cu. Ca và Sr. D. D.71 11. B. Cô cạn dung dịch thì số gam muối khan thu được là A. Cho A tác dụng hết với dung dịch HNO3 loãng. 4. Đem Cu cho tan hết trong dung dịch HNO3 loãng dư.336 lít.8g hỗn hợp 2 muối cacbonat của 2 kim loại thuộc nhóm II ở 2 chu kì kế tiếp nhau khi tác dụng hết với dung dịch HCl thu được 0.Phần 1: hoà tan hết trong dung dịch chứa HCl và H2SO4 loãng thu được 3. D. Nếu cho X tác dụng hết với dung dịch HNO3 loãng.5M được dung dịch Z và 4. C. 1.95g. dư thu được 6.74 Hỗn hợp X gồm 2 kim loại đều có hoá trị không đổi.48 lít. D.3 mol khí (đktc).Phần 2: hoà tan hết trong dung dịch HNO3 loãng thu được V lít khí NO (đktc). Giá trị của V là A. 3. 0.242 lít. B. X2 có hoá trị không đổi. 25. Câu 5. B. 35. sau một thời gian thu được m g hỗn hợp X gồm các oxit và sắt dư. B. 39.36 lít. 35g. Câu 5. C. Hoà tan hết hỗn hợp X bằng H2SO4 đặc. 24g. Be và Mg.6 lít.0.87g.5g. 3. Câu 5. D. C. 2.25g.025 mol khí NO thoát ra. Câu 5.53g. 37. C. Vậy 2 kim loại đó là A. thu được Cu. 2.2g hỗn hợp 3 kim loại Mg. Cô cạn dung dịch thì số gam muối khan là A. C. B. C. Hoà tan hết X bằng dung dịch HNO3 thấy có 0. Câu 5. Cho X tan hết trong dung dịch CuSO 4 dư. 20g.75 Hỗn hợp X gồm 2 kim loại X1. 26g. V có giá trị là A. Thành phần % về khối lượng Mg trong hỗn hợp X là A. Giá trị m là A.12 lít NO duy nhất (đktc). 26%.21 %.76 Cho 36. được 3g hỗn hợp rắn gồm 4 chất.52g.36 lít. B. Câu 5. Câu 5.79 Cho 22g hỗn hợp muối cacbonat của kim loại IA và IIA tác dụng với dung dịch HCl dư thu được 0.2. dư thì thể tích N2 (đktc) là A. 22g.224 lít.98g.Câu 5.01%.368 lít H 2 (đktc). dư thu được V lít NO (đktc) duy nhất. D. D. 0. Giá trị m là A. 36%. C. D.8g bột sắt ngoài không khí.63 lít. 2. C.80 Cho 3. 0. 27g.72 lít khí (đktc).2g sắt để ngoài không khí bị gỉ thành 13.24 lít. D.24 lít. C. 5. được 1.78 Cho 11g hỗn hợp nhiều kim loại trước hiđro tác dụng với dung dịch H2SO4 loãng.2g. 27. B.73 Nung nóng 16.6 lít khí (đktc). Cô cạn dung dịch thì số gam muối khan thu được là A. .87g hỗn hợp X gồm Mg và Al vào 250ml dung dịch Y chứa axit HCl 1M và H2SO4 0. Sr và Ba. 28g. Zn. 0.3g. Câu 5.252g. 18.36 lít H2 (đktc). Mg và Ca.6 lít SO2 (đktc). nóng thu được 5.7g. 69 . 3. 0. Al tác dụng hết với dung dịch HCl dư thu được 5.336 lít. C.4 mol khí CO2. B. Chia X thành phần bằng nhau: .6g chất rắn A. B.

Câu 5.81 Hoà tan hoàn toàn 2,81g hỗn hợp gồm Fe2O3, Al2O3, MgO, ZnO trong 500ml dung dịch axit H2SO4 0,2M (vừa đủ). Cô cạn dung dịch sau phản ứng, muối sunfat khan thu được có khối lượng là A. 6,81g. B. 10,81g. C. 5,81g. D. 4,81g. Câu 5.82 Cho 1,935g hỗn hợp gồm 2 kim loại Mg và Al tác dụng với 125ml dung dịch gồm HCl 1M và H2SO4 loãng 0,28M, thu được dung dịch X và 2,184 lít H 2 (đktc). Cô cạn dung dịch, thu được số gam muối là A. 9,7325g. B. 9,3725g. C. 9,7532g. D. 9,2357g. Câu 5.83 Cho 10g hỗn hợp gồm Al và một kim loại M (hoá trị x) tác dụng với 100ml dung dịch gồm H2SO4 aM và HCl 3aM, thu được 5,6 lít H2 (đktc), dung dịch X và 1,7g chất rắn. Khối lượng muối thu được là A. 2,85g. B. 2,855g. C. 28,55g. D. 28,5g. Câu 5.84 Cho 7,2g Mg tác dụng hết với dung dịch HNO 3 loãng, dư thu được 6,72 lít khí Y và dung dịch Z. Làm bay hơi Z thu được 47,4g chất rắn khan. Công thức phân tử của khí Y là A. N2O. B. NO. C. N2. D. NO2. Câu 5.85 Đốt nóng một hỗn hợp X gồm Al và Fe3O4 trong điều kiện không có không khí được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: Phần 1: tác dụng với dung dịch NaOH dư thu được 3,36 lít H2 (đktc). Phần 2 : tác dụng với dung dịch HCl dư thu được 13,44 lít H 2 (đktc). Thành phần % về khối lượng của Al trong hỗn hợp X là (hiệu suất phản ứng 100%) A. 27,95%. B. 2,795%. C. 72,05%. D. 7,205%. Câu 5.86 Cho hỗn hợp A gồm bột Al và Fe3O4. Nung nóng A ở nhiệt độ cao trong môi trường không có không khí để phản ứng xảy ra hoàn toàn thu được hỗn hợp B. Nghiền nhỏ B rồi chia làm 2 phần: - Phần 1 (ít) tác dụng với dung dịch NaOH dư thu được 1,176 lít H2 (đktc). Tách riêng chất không tan đem hoà tan trong dung dịch HCl dư thu được 1,008 lít khí (đktc) - Phần 2 (nhiều) tác dụng với dung dịch HCl dư thu được 6,552 lít khí (đktc).Khối lượng hỗn hợp A là A. 22,02g. B. 8,1g. C. 13,92g. D. 3,465g. Câu 5.87 Một hỗn hợp gồm Na, Ba có tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí B. Thể tích dung dịch HCl 0,1 M để trung hoà

1 dung dịch A là 10

A. 0,4 lít. B. 0,2 lít. C. 0,6 lít. D. 6 lít. Câu 5.88 Cho m gam hỗn hợp X gồm K và Al tác dụng với nước dư thu được 0,25 mol khí. Nếu cho m gam X tác dụng với Ba(OH)2 dư thu được 0,4 mol khí (các phản ứng đều xảy ra hoàn toàn). m có giá trị là A. 12,8g. B. 16g. C. 18g. D. 10,95g.

70

Câu 5.89 Dùng CO khử m g Fe2O3 ở nhiệt độ cao được 0,4 mol CO2 và hỗn hợp rắn X (gồm 4 chất). Hoà tan hết X cần 0,9 lít dung dịch HCl 1M thấy có 0,25 mol khí thoát ra. Giá trị m là A. 32g. B. 40g. C. 80g. D. 3,2g. Câu 5.90 Dùng CO khử m g Fe2O3 ở nhiệt độ cao thu được 1,1 gam CO2 và chất rắn X gồm 3 oxit. X phản ứng vừa đủ với 0,25 lít dung dịch H2SO4 loãng 0,5M. Giá trị m là A. 8,0g. B. 4,0g. C. 1,6g. D. 3,2g. Câu 5.91 Cho 0,1 mol CO (đktc) từ từ đi qua ống sứ nung nóng đựng 4 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Hỗn hợp khí thu được sau phản ứng có tỉ khối hơi so với H2 bằng 20. Công thức của oxit sắt và thành phần % CO 2 theo thể tích trong hỗn hợp khí sau phản ứng là A. FeO ; 75% B. Fe2O3 ; 75% C. Fe2O3 ; 65% D. Fe3O4 ; 75% Câu 5.92 Một dung dịch có chứa 2 cation là Fe2+ (0,1 mol); Al3+ (0,2 mol) và 2 anion Cl- (x mol), SO42- (y mol). Khi cô cạn dung dịch thu được 46,9 gam chất rắn khan. x và y có giá trị lần lượt là A. 0,02 và 0,03. B. 0,03 và 0,02. C. 0,2 và 0,3. D. 0,3 và 0,2. Câu 5.93 Thêm V lít dung dịch Na2CO3 1M vào một dung dịch có chứa đồng thời các ion − − sau: Ba2+; Ca2+; Mg2+; 0,2 mol Cl ; 0,3 mol NO3 . Để tạo lượng kết tủa lớn nhất thì giá trị của V là B. 0,25 lít. A. 2,5 lít. C. 0,5 lít. D. 5 lít. Câu 5.94 Hoà tan 16,2g Al trong dung dịch HNO3 loãng, dư thu được hỗn hợp khí gồm NO và N2 có tỉ khối hơi so với H2 là 14,4. Thể tích (tính theo lít) của NO, N2 lần lượt là A. 2,24 và 3,36. B. 0,224 và 0,336. C. 22,4 và 33,6. D. 2,24 và 4,48. Câu 5.95 Cho 13,5g nhôm tác dụng vừa đủ với dung dịch HNO 3 0,86M thu được hỗn hợp khí gồm NO và N2O có tỉ khối hơi đối với H 2 bằng 19,2. Thể tích dung dịch HNO3 cần dùng là A. 2,2 lít. B. 0,22 lít. C. 0,46 lít. D. 4,65 lít. Câu 5.96 Hoà tan một hợp kim Ba-Na với tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí. Thêm m g NaOH vào

1 dung dịch A ta được dung dịch B. Cho dung dịch B tác 10

dụng với 100ml dung dịch Al2(SO4)3 0,2M được kết tủa C. Giá trị m để được kết tủa C lớn nhất, nhỏ nhất lần lượt là A. 2,4g và 4g. B. 4g và 2,4g. C. 4,8g và 6,4g. D. 6,4g và 4,8g. Câu 5.97 Rót 150ml dung dịch NaOH 7M vào 50ml dung dịch Al 2(SO4)3 2M. Khối lượng chất dư sau thí nghiệm là A. 10g. B. 14g. C. 12g. D. 16g.

71

Câu 5.98 Dung dịch chứa 16,8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3, thêm vào 13,68g Al2(SO4)3 thu được kết tủa và dung dịch A. Đun nóng kết tủa đến khối lượng không đổi được chất rắn B. Khối lượng chất rắn B là A. 2,12g. B. 21,2g. C. 42,2g. D. 4,22g. Câu 5.99 Cho 18,9g muối Na2SO3 tác dụng hết với dung dịch HCl thu được khí A (đktc). Dẫn khí A vào dung dịch Ba(OH)2 dư. Sau khi hấp thụ, khối lượng dung dịch sẽ A. tăng 22,95g. B. giảm 22,95g. C. tăng 20,25g. D. giảm 20,25g. Câu 5.100 Đốt cháy hoàn toàn 0,336 lít C3H8 (đktc) bằng lượng oxi vừa đủ. Thu được toàn bộ sản phẩm cháy cho vào 35 ml dung dịch Ca(OH) 2 1M. Sau khi hấp thụ, khối lượng dung dịch A. tăng 0,56g. B. giảm 0,56g. C. tăng 5,6g. D. giảm 5,6g. Câu 5.101 m g hỗn hợp Mg, Al tác dụng với 250ml dung dịch X chứa hỗn hợp HCl 1M và H2SO4 0,5M sinh ra 5,32 lít H2 (đktc) và dung dịch Y (coi Vdung dịch không đổi). dung dịch có pH là A. 1. B. 7. C. 2. D. 6. Câu 5.102 Trộn 100ml dung dịch gồm Ba(OH)2 0,1M và NaOH 0,1M với 400ml dung dịch gồm H2SO4 0,0375M và HCl 0,0125M thu được dung dịch X. pH của dung dịch X là A. 2. B. 7. C. 6. D. 1.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG V
5.1 A 5.11 A 5.21 A 5.31 A 5.41 A 5.51 A 5.61 C 5.71 A 5.81 B 5.91 B 5.101 A 5.2 A 5.12 A 5.22 B 5.32 D 5.42 B 5.52 A 5.62 A 5.72 A 5.82 A 5.92 C 5.102 A 5.3 C 5.13 A 5.23 A 5.33 A 5.43 B 5.53 B 5.63 B 5.73 C 5.83 C 5.93 A 5.4 D 5.14 A 5.24 C 5.34 D 5.44 B 5.54 C 5.64 A 5.74 A 5.84 D 5.94 A 5.5 D 5.15 D 5.25 B 5.35 D 5.45 A 5.55 B 5.65 C 5.75 D 5.85 A 5.95 A 5.6 A 5.16 C 5.26 D 5.36 C 5.46 A 5.56 A 5.66 A 5.76 C 5.86 A 5.96 A 5.7 B 5.17 A 5.27 A 5.37 A 5.47 B 5.57 A 5.67 C 5.77 B 5.87 C 5.97 A 5.8 A 5.18 B 5.28 B 5.38 A 5.48 D 5.58 D 5.68 B 5.78 B 5.88 D 5.98 D 5.9 B 5.19 C 5.29 B 5.39 B 5.49 C 5.59 C 5.69 A 5.79 D 5.89 A 5.99 B 5.10 D 5.20 A 5.30 B 5.40 A 5.50 D 5.60 B 5.70 B 5.80 A 5.90 A 5.100 A

72

+2. KIM LOẠI KIỀM. Na. P2O5 hay axit H2S.NaOH. muối.KNO3. 2).CHƯƠNG VI. KIM LOẠI KIỀM THỔ VÀ NHÔM A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Điều chế IA. 6. và tan cả trong nước có hoà tan CO2 t0 CaCO3  CaO + CO2 →  → CaCO3 + H2O + CO2 ← Ca(HCO3)2  0 0 . Số oxi hoá: trong các hợp chất IA. Fr 2. Sơ lược về muối cacbonat và hiđrocacbonat . ta nên dùng công thức phân tử của các muối để xác định tỉ lệ giữa số mol nguyên tử kim loại với số mol nguyên tử phi kim trong oxit axit (axit) 8.→ CO32. bazơ mạnh. Tính chất của một số hiđroxit . Ra 3. Ca. Kim loại kiềm (IA): Li. kém bền với nhiệt HCO3. Mg. Sr.Khi cho CO2. và tăng theo chiều Z tăng : M → Mn+ + ne (n = 1. 5. Cs. Ca(OH)2 có đầy đủ tính chất của một dung dịch bazơ như làm quỳ tím hoá xanh. Ba. ns2 4. Tính khử: IA. Ca(HCO3)2 lưỡng tính. mang gần như đầy đủ tính chất chung của muối như tác dụng với dung dịch axit mạnh.+ H+ → H2O + CO2 HCO3. → 2 ñpnc 4MOH  4M + O2 + 2H2O → 7. Tất cả các kim loại ở hai nhóm này đều tác dụng với phi kim. dung dịch axit. IIA: ns1.CaCO3 bị nhiệt phân. . hay dung dịch muối khác. oxit axit.NaHCO3. tác dụng với axit. H3PO4 … vào dung dịch bazơ.+ OH. IIA: sử dụng phương pháp điện phân nóng chảy n ñpnc MXn  M + X2 (X = halogen).Na2CO3 dễ tan trong nước. để xác định muối sinh ra. Điều chế bazơ tan: sử dụng phương pháp điện phân dung dịch muối tương ứng với điện cực trơ. Ca(NO3)2 bị phân huỷ ở t > 330 C thành muối nitrit và oxi 1 t0 KNO3  KNO2 + O2 → 2 t0 Ca(NO3)2  Ca(NO2)2 + O2 → 73 . IIA đều có tính khử (IIA khử yếu hơn IA). H2O (trừ Be). . Cấu hình electron ở lớp ngoài cùng của IA. SO2.+ H2O t0 Ca(HCO3)2  CaCO3 + H2O + CO2 → . tan trong axit mạnh. Rb. có màng ngăn hai điện cực. Kim loại kiềm thổ (IIA): Be. ñpdd 2NaCl + 2H2O  2NaOH + H2 + Cl2 → (nếu không có màng ngăn : 2NaOH + Cl2 → NaCl + NaClO + H2O) 9. IIA có số oxi hoá +1.

.Điện phân Al2O3 nóng chảy (không thể điện phân nóng chảy AlCl3) để điều chế Al kim loại. Al(OH)3 lưỡng tính. MgSO4). 2Al + O2  Al2O3 → 2 1 t0 4. CaSO4. Mg + O2  MgO → 2 3 t0 3.10. 11. . MgCl2. Mg + 2HCl → MgCl2 + H2 3 9. .Vật bằng nhôm bền trong không khí.Al2O3. Mg2+ trong nước cứng. Nước cứng .Cách làm mềm nước cứng tạm thời: đun. . 2Al + 6H2SO4 đặc  Al2(SO4)3 + 3SO2 + 6H2O → 14. Al + 4HNO3 đặc  Al(NO3)3 + NO + 2H2O → 12.Cách làm mềm nước cứng vĩnh cửu dùng Na2CO3 hoặc Na3PO4. chu kì 3.Nước cứng là nước chứa nhiều ion Ca2+. . 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O t0 13.Nhôm bị phá huỷ trong kiềm. Nhôm . Ca + 2H2O → Ca(OH)2 + H2 16. nhóm IIIA.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1 t0 1. . K + Cl2  KCl → 2 t0 5. 2K + 2H2O → 2KOH + H2 15. IIA.Nhôm có tính khử mạnh (Al → Al3+ + 3e) nhưng kém kim loại nhóm IA. . 2Na + O2  Na2O → 2 1 t0 2. Al + Cl2  AlCl3 → 2 1 7. . Nước cứng vĩnh cửu chứa muối clorua hay sunfat của Ca2+ hay Mg2+ (CaCl2. Na + HCl → NaCl + H2 2 8. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O t0 11.Vị trí Al trong bảng tuần hoàn: ô 13. B . dd Na2CO3. tham gia phản ứng nhiệt nhôm. Ca + Cl2  CaCl2 → 3 t0 6. Al + 3HCl → AlCl3 + H2 2 10. Nước cứng tạm thời chứa muối Ca(HCO3)2 hay Mg(HCO3)2. 2Al + 6H2O → 2Al(OH)3 + 3H2 74 . Mg2+. dùng bazơ tan. H2O vì trên bề mặt nhôm được phủ kín một lớp Al2O3 bảo vệ.Nguyên tắc làm mềm nước cứng là làm giảm nồng độ các ion Ca2+.

NaOH + HCl → NaCl + H2O 31. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. Ca(OH)2 + CO2 → CaCO3 + H2O 30. 2Mg(NO3)2  2MgO + 4NO2 + O2 → 46. Mg(HCO3)2  MgCO3 + CO2↑ + H2O → 36. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. 2NaCl + 2H2O  2NaOH + H2 + Cl2 coù ng ngaê maø n 26. Mg + CuSO4 → MgSO4 + Cu t0 19. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48.+ NH3 → MgNH4PO4 ↓ (màu trắng) 50. MgCl2  Mg + Cl2 → ñpnc 24. Na2CO3 + 2HCl → 2NaCl + H2O + CO2↑ 39. Al(OH)3 + NaOH → Na[Al(OH)4] 0 ñpdd 75 . NaHCO3 + NaOH → Na2CO3 + H2O 38. 2Al + Fe2O3  Al2O3 + 2Fe → 20. CaCO3 + H2O + CO2 ← Ca(HCO3)2  t 41. NaHCO3 + HCl → NaCl + CO2↑ + H2O 37. 2NaHCO3  Na2CO3 + CO2↑ + H2O → t0 34. 2KNO3  2KNO2 + O2 → t0 43. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 t0 33. CaCO3 + 2HCl → CaCl2 + H2O + CO2↑  → 40. Ca(HCO3)2  CaCO3 + CO2↑ + H2O → t0 35. 2NaCl  2Na + Cl2 → 1 ñpnc 22. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. 2KNO3 + 3C + S  N2 + 3CO2 + K2S → t0 44. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. NaOH + CO2 → NaHCO3 27. Mg2+ + HPO42. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 ñpnc 21. CaCO3  CaO + CO2 → t0 42. 2NaOH + CO2 → Na2CO3 + H2O 29. 2NaOH  2Na + O2 + H2O → 2 ñpnc 23. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2↓ 32.17. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. 2Al2O3  4Al + 3O2 → → 25. Ca(NO3)2  Ca(NO2)2 + O2 → t0 45.

12. 2Al(OH)3  Al2O3 + 3H2O → C. 12.6g. LiCl. Có số oxi hoá +1 trong các hợp chất. Khối lượng muối thu được là A.2 gam nước là A.45%. Có nhiệt độ nóng chảy thấp nhất trong tất cả kim loại. 2. C. Câu 6. B. 4.3 Nồng độ phần trăm của dung dịch tạo thành khi hoà tan 7.8 gam kali kim loại vào 36. C. 168g. + C. B. D. K+.9g. D. Câu 6. Na2CO3.04 mol khí ở anot và 3. 24g.1g hỗn hợp 2 kim loại kiềm ở hai chu kì kế tiếp nhau trong bảng tuần hoàn tác dụng hết với nước thu được 1. 32%. Ag+. B. NH4Cl. 16.7 Nung 100g hỗn hợp gồm Na2CO3 và NaHCO3 cho đến khi khối lượng của hỗn hợp không đổi được 69g chất rắn. NaCl. 84% . 16%.4 Điện phân muối clorua kim loại kiềm nóng chảy thu được 0. Kim loại kiềm có tính khử mạnh.1 Cation M+ có cấu hình electron ở lớp ngoài cùng là 3s23p6. B. D.8g. 25. 68%. 25. NaHSO4 .BÀI TẬP CƠ BẢN Câu 6. 12.8 Cho 3.12 gam kim loại ở catot.72%.119g.BÀI TẬP TRẮC NGHIỆM I. D. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl t0 55. D. 76 . C. B.9 Dung dịch muối có pH > 7 là A. 11. 16% . Câu 6. C. 50g.8g. Công thức phân tử của muối kim loại kiềm là A.5 Cho 200g CaCO3 tác dụng hoàn toàn với dung dịch H2SO4 loãng để lấy khí CO2 sục vào dung dịch chứa 60g NaOH. B. 68% . Câu 6. 48g. Khối lượng kiềm là A. Thành phần % theo khối lượng của Na2CO3 và NaHCO3 lần lượt là A. C.Cu+. 126g. Câu 6.4g. 84%. B. KCl. B. C. Khối lượng muối natri thu được là A. Câu 6. Câu 6.12 lít H2 (đktc) và dung dịch kiềm.79%. D. M+ là cation: A. D. D.54.2 Tính chất không phải của kim loại kiềm là A. C.57%. Câu 6. Na . B. Độ cứng cao.69g. RbCl. KCl.6 Cho 197g BaCO3 tác dụng hoàn toàn với dung dịch HCl để lấy khí CO2 sục vào dung dịch chứa 84g KOH. 32% . C. D.

2g hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2. Ca. Mg.1 gam muối clorua. B. pH > 7.36 và 4. D. pH < 7.2.8g CaO tác dụng với một lượng nước dư thu được dung dịch X. D. 3. Điện phân dung dịch CaCl2 với điện cực trơ. 7. Câu 6. D. Dung dịch thu được có pH A. C.55g. C.4% và 29. C. BaCO3 . C. C.84g hỗn hợp CaCO3 và MgCO3 tác dụng hết với dung dịch HCl thu được 0. 3. Mg. Câu 6.0 gam kim loại nhóm IIA tác dụng hết với dung dịch HCl tạo ra 11. Câu 6. Ba. Be. Be. 77 . D. Câu 6. có màng ngăn. Mg. Sục 1. Be. B.5g. 70. B. 4. Be.Câu 6. 4.85%. Câu 6. C.11 Cho 2. Ba. D. 4. Ca. Kim loại đó là A.44g kim loại hoá trị II trong 150ml dung dịch H2SO4 0. Điện phân CaCl2 nóng chảy. Thành phần % theo khối lượng của CaCO3 và MgCO3 trong hỗn hợp lần lượt là A. B. Số gam CaCO3 và MgCO3 lần lượt là A.18 Kim loại thuộc nhóm IIA không tác dụng với nước ngay cả ở nhiệt độ cao là A. D. B. Câu 6. Câu 6. pH = 7. Chỉ dùng nước và khí CO2 phân biệt được số chất là A.48. 59.19 Trường hợp ion canxi bị khử thành Ca là A.68 lít khí CO2 (đktc) vào dung dịch X.48 và 3.016 lít CO2 (đktc). 4.2 và 4. 5. BaSO4 . pH = 5. Mg. 2.13 Khi lấy 14.25.6% và 70.15 Hoà tan 8. 29. B.5M. khối lượng kết tủa thu được là A.6%. C. B.15%. C. 40.5g.03 mol khí CO2. 4 và 4.36. D. 2. C. B. D.16 Cho 2. Câu 6.17 Có 5 chất bột trắng là: NaCl. 6. Na2SO4 .25g muối clorua của một kim loại hoá trị II và một lượng muối nitrat của kim loại đó có số mol bằng số mol muối clorua thì thấy khác nhau 7. Ba. Kim loại đó là A. D. Cho dung dịch CaCl2 tác dụng với dung dịch AgNO3.95g. Ca.14 Cho 4.10 Cho a mol NO2 hấp thụ hoàn toàn vào dung dịch chứa a mol NaOH. Để trung hoà axit dư phải dùng hết 30ml dung dịch NaOH 1M. Na2CO3 .4%.12 Hoà tan hoàn toàn 1. B.15% và 40. Câu 6. C. Ca.85% và 59. Kim loại đó là A. B. Ba.05g.

12. Na2CO3 + Ca(OH)2 CaCO3 + 2NaOH.05 mol HCO3–.27 Một phương trình phản ứng hoá học giải thích việc dùng dung dịch Na2CO3 làm mềm nước cứng vĩnh cửu là A. 14.22 Cho 10 lít hỗn hợp khí (đktc) gồm CO và CO2 trong đó CO2 chiếm 39.25g. 0.5g. Dung dịch HCl. D. C. D. Câu 6.05g. Nước cứng toàn phần. C. Điện phân Al2O3 nóng chảy. B.29 Ion Al bị khử trong trường hợp A. 0. B. HCl. C. 0. B. Na2CO3. 0. Thành phần % theo khối lượng của CaCO3. Tính cứng toàn phần. Ca(OH)2. Câu 6. C. 0.02 mol Ca2+. Câu 6. D.02 mol Cl– . D.65g. Thả Na vào dung dịch Al2(SO4)3. D. D. Na2CO3 + 2HCl 2NaCl + H2O + CO2.2 lít khí CO2 (0oC. C.01 mol Mg2+.24 Dung dịch làm mềm nước cứng tạm thời và vĩnh cửu là A. Câu 6. C. Na3PO4. Điện phân dung dịch AlCl3 với điện cực trơ có màng ngăn. NaNO3. 0. Nước trong bình có A. tạm thời. Tính mềm. D. C. Câu 6. 92%. Nước khoáng. 2.D. nước mềm.2% (theo thể tích) đi qua dung dịch chứa 7. C. Nước cứng tạm thời.8 atm). 78 . B. vĩnh cửu. Câu 6. Câu 6.02 mol Cl– ta được nước cứng A. Số g chất kết tủa sau phản ứng là A.4g Ca(OH)2 . B. 100%. Dùng H2 khử Al2O3 ở nhiệt độ cao. Dung dịch NaCl.05 mol HCO3–. Tính cứng tạm thời. Ca(OH)2. B.01 mol Na+.01 mol Mg2+. Dung dịch Na3PO4.26 Đun sôi nước chứa 0. Na2CO3. toàn phần. Na2CO3 + Ca(HCO3)2 CaCO3 + 2NaHCO3. Câu 6.23 Một loại nước có chứa nhiều muối Ca(HCO3)2 thuộc loại A. C. Cho dung dịch Ca(OH)2 tác dụng với dung dịch HCl. D. 0.28 Trong phương pháp trao đổi ion để làm mềm nước cứng người ta dùng A. 40%. 0.01 mol Na+. B. B. Dung dịch Na2CO3.25 Trong một bình nước có chứa 0. 0. B.MgCO3 trong quặng là A. 3+ Câu 6. Tính cứng vĩnh cửu. Câu 6.20 Phân biệt dung dịch Ca(HCO3)2 với dung dịch CaCl2 bằng A.21 Khi nung 40g quặng đôlômit thu được 11.02 mol Ca2+. C. 4. D. Zeolít. Na2CO3 + CaCl2 CaCO3 + 2NaCl. B. D. 50%. Nước cứng vĩnh cửu.

H2SO4 đặc nóng. đpnc. NaOH dư. chất không có tính lưỡng tính là A. HCl. C. HCl. Nhôm có tính khử mạnh chỉ sau kim loại kiềm và kiềm thổ. Al(OH)3 + NaOH Na[Al(OH)4]. Al(OH)3 .30 Phương trình phản ứng hoá học chứng minh Al(OH)3 có tính axit là A. Câu 6. NaOH dư. nhóm IB. NaHCO3. C.34 Cho sơ đồ : +X +Y +Z → Al → Al2(SO4)3 → Al(OH)3  Ba [ Al(OH) 4 ] 2 Al(OH)3 Al2O3 Al.33 Trong những chất sau. B. B. H2SO4 loãng. D. B.Câu 6.36 Cho dần từng giọt dung dịch NaOH (1). Lúc đầu đều có kết tủa keo trắng. chu kì 3. t0. đpnc. đpnc. đpnc. Ba(OH)2. AlCl3 + 3H2O + 3NH3 Al(OH)3 + 3NH4Cl. H2SO4 loãng. ô 13. C. C.31 Cation M có cấu hình electron ở lớp ngoài cùng là 2s22p6. D. ô 13. (2) lần lượt là A. B. chu kì 3. Ba(OH)2. Nhôm là kim loại lưỡng tính. ô 13. HCl. t0.32 Chọn câu không đúng A. D. Nhôm là kim loại nhẹ. sau đó kết tủa không tan ra. Câu 6. Ba(OH)2. Nhôm bị phá hủy trong môi trường kiềm. Al(OH)3 + 3HCl AlCl3 + 3H2O. ZnSO4. Al2O3 + 3H2O 2Al(OH)3. Vị trí M trong bảng tuần hoàn là A. X. C. E (dung dịch) và (1). 2Al(OH)3 2Al + 3H2O + O2. nhóm IA. C. ở (1) kết tủa không tan.35 Để làm kết tủa hoàn toàn Al(OH)3 người ta thực hiện phản ứng A. nhóm IIIB. ô 13. Câu 6. NaOH. Al2O3. 2 3+ Câu 6. chu kì 3. D. C. Câu 6. Y. chu kì 3. H2SO4 đặc nguội. HCl. Câu 6. nhóm IIIA. B. 3 D. t0. D. Lúc đầu đều có kết tủa keo trắng. Lúc đầu đều có kết tủa keo trắng. dung dịch NH3 (2) lần lượt đến dư vào ống đựng dung dịch AlCl3 thấy A. ở (1) kết tủa tan. NaAlO2 + H2O + HCl Al(OH)3 + NaCl. AlCl3 + 3NaOH Al(OH)3 + 3NaCl. Z. B. ở (2) kết tủa không tan. Lúc đ ầu đều có kết tủa keo trắng. D. dẫn điện. t0. B. 2Al(OH)3 Al2O3 + 3H2O. dẫn nhiệt tốt. ở (2) kết tủa tan. sau đó kết tủa tan ra. NaOH đủ. 79 . Ba(OH)2.

ở (1) không hiện tượng. C.nH2O.40 Có 2 lọ không ghi nhãn đựng dung dịch AlCl 3 (1) và dung dịch NaOH (2).65A trong thời gian 3000 giây thu được 2. B. C. 4. 15. Chỉ dùng thêm nước làm thuốc thử thì số kim loại có thể phân biệt được là A.Câu 6. C. ở (3) xuất hiện kết tủa trắng không tan. ở (1) kết tủa không tan. D. (2) là NaOH. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa. ở (2) và (3) xuất hiện kết tủa trắng rồi tan. 13. 2. D. C. Al. 10. kết tủa trắng tăng dần rồi tan. người ta phân biệt chúng bằng cách A. B. 2. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa rồi tan ra.Al2(SO4)3. không tan. nhận ra (1) là AlCl3 . Kết thúc phản ứng thu được số gam chất rắn là A. B. Mg2+ (3) ta quan sát thấy A.24H2O.95. sau đó kết tủa không tan ra.38 Phèn chua có công thức là A. 80%. Lúc đầu đều có kết tủa keo trắng.2. Câu 6. nhận ra (1) là AlCl3 . D. Câu 6. Câu 6.55g. (2) là NaOH. B. B. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. C. không tan. ở (1) không hiện tượng. ở (1) không hiện tượng. (2) là NaOH. rồi kết tủa không tan. ở (2) xuất hiện kết tủa trắng rồi tan. Lúc đầu đều có kết tủa keo trắng. B. Lúc đầu đều có kết tủa keo trắng. D.42 Cho 100ml dung dịch AlCl3 1M tác dụng với 200ml dung dịch NaOH. kết tủa trắng tăng dần. 0. 60%.75M.8.35M. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. Câu 6.43 Hoà tan 5. C. C. MgSO4. ở (3) xuất hiện kết tủa trắng.35M. Hiệu suất điện phân là A. (2) là NaOH.37 Cho dần từng giọt dung dịch HCl (1) . 3. Câu 6. 2.35M và 0.44 Điện phân Al2O3 nóng chảy với dòng điện cường độ 9. Al3+ (2). D.75M và 0. Al2O3. K2SO4. ở (1) kết tủa tan. Na3AlF6. CO 2 (2) lần lượt vào ống đựng dung dịch Na[Al(OH)4] thấy A.75M và 0. 80 . ở (2) xuất hiện kết tủa trắng.24H2O. 70%. rồi không tan.75M và 0. Câu 6. Fe.75M. ở (2) kết tủa tan.41 Có 4 mẫu bột kim loại là Na. sau đó kết tủa tan ra. 13. 0.16g Al. D. Không dùng thêm chất khác. Câu 6. B. ở (2) kết tủa không tan.Al2(SO4)3. D. ở (1) không hiện tượng. D. Kết tủa tạo thành được làm khô và nung đến khi khối lượng không đổi cân nặng 2. Lúc đầu đều có kết tủa keo trắng. nhận ra (1) là AlCl3 .4g bột Al vào 150ml dung dịch hỗn hợp chứa Fe(NO3)3 1M và Cu(NO3)2 1M. 90%. 1. B.39 Cho từ từ đến dư dung dịch NaOH lần lượt vào các dung dịch đựng Na+ (1). Mg. Nồng độ mol/l của dung dịch NaOH ban đầu là A. nhận ra (1) là AlCl3 . C.2.

x có giá trị là A. B. các thể tích khí đo ở đktc). C.47 Một hoá chất để phân biệt Al.10g. Al. m có giá trị là A. B. Câu 6. 13.48 Một hoá chất để phân biệt các dung dịch riêng biệt NaCl.22g muối khan.52 gam muối. Câu 6. (Các phản ứng đều xảy ra hoàn toàn. Mg.51 Cho 2. Al (điều kiện phản ứng coi như có đủ) có thể điều chế được A. Câu 6. C. Câu 6. AlCl3 . BaO. H2O. 11.45g. B. 18g. C. D. m có giá trị là A. D. D. C.54 Hoà tan 4. Dung dịch NaOH. dung dịch HCl.52 Cho 3.05g. 3. là A. 3.34g.10. C. 2.2g. B. 16g.45 Một thuốc thử phân biệt 3 chất rắn Mg.136 lít khí (đktc) và m g muối clorua. H2O. 5. dư thu được V lít khí NO (đktc) và dung dịch X. Mặt khác. Câu 6. HCl đặc. thu được 3. Al và Fe bằng dung dịch HCl.95g. Dung dịch Na2CO3. D. Al2O3 . D.6g.22g hỗn hợp kim loại gồm K. 3.07g.96 lít khí. 12. D. Dung dịch Na2CO3. B. Na.20g. 12. Câu 6. B. H2SO4 đặc nguội.49 Hoà tan hết 10g hỗn hợp muối cacbonat của kim loại IA và IIA bằng dung dịch HCl dư.15. Cô cạn dung dịch X thu được 35.32 gam nhôm kim loại bằng dung dịch HNO3 loãng. Câu 6.4048 lít. 4. CaCl2 . H2O.53 Hỗn hợp X gồm K và Al. Cô cạn dung dịch X được m g chất rắn. CuO.46 Chỉ dùng các chất ban đầu là NaCl. 4. Al2O3 đựng trong các lọ riêng biệt là dung dịch A. amoniac. C. Al(OH)3. MgO. 12.Câu 6. 3.80g.6 lít khí. 81 . m g X tác dụng với dung dịch Ba(OH)2 dư thu được 8.24 lít khí (đktc). Giá trị của V là A.8g.44g. Al2O3 D. B. 11. B. m g X tác dụng với nước dư được 5. Al(OH)3. Dung dịch HCl.5088 lít. D.6000 lít. NaOH. 14. Na và Ba vào nước được 500ml dung dịch X có pH = 13. Công thức của oxit là A. m nhận giá trị bằng A. AlCl3. Ca.00g. Câu 6. C. D. C. Sau đó cô cạn dung dịch thu được x gam muối khan.06g oxit của kim loại M (có hoá trị n) tan trong HNO3 dư thì thu được 5. D. 9. dung dịch NaOH. B. C.5g hỗn hợp kim loại gồm Mg. AlCl3 là A. B.02g. C.4800 lít. ZnO. Câu 6. thu được 2.50 Hoà tan hết 3.

5.1020kg. D.56 Cho hỗn hợp 0. 36. D. C. B. Câu 6. 27g. 54g. C. C.1 mol Ba và 0.1800kg Câu 6.04g hỗn hợp Fe và Cu tác dụng với dung dịch HNO 3 loãng thu được 0.6g nước để thu được dung dịch có nồng độ 14% là A.62 3.2 mol Al vào nước dư thì thể tích khí thoát ra (đktc) là A. B.55 Khối lượng K2O cần lấy để hoà tan vào 70. 21ml. 6. D. D. D. 82 . C. 69.48 lít.9g. D. 7. 9%. 102kg. 6.96 lít H2 (đktc).68%. 4. 210ml.2%.2%. 10200kg .88 lít H2(đktc).84g muối sunfat. 3. 0. 18kg C.102kg. dư thu được 10. 8.59 Khối lượng Al2O3 và khối lượng cacbon bị tiêu hao cần để sản xuất được 0.8 lít H2 (00C. Câu 6. nếu đem tác dụng với dung dịch HCl dư thu được 26. 4. 90%. Câu 6. % Fe theo khối lượng là A. Câu 6.896 lít NO (đktc). Khối lượng Al trong hỗn hợp ban đầu là A.4g. K. 3. Câu 6.24 lít. B. Fe.61 Hỗn hợp Al và Fe3O4 đem nung không có không khí.96 lít. Kim loại là A. 20ml. 8.63 2. C. B.60 31.32%. C. 2. 63.8%. 180kg B. Biết đã dùng dư 10ml thì thể tích dung dịch NaOH 4M đã lấy ban đầu là A.52g một kim loại tan hết trong dung dịch H 2SO4 loãng thu được 6. 180kg D. 34. B.8g.72 lít H2(đktc). D. C. 6. Al. D.46%. 200ml. 4.6%. Câu 6.4g. B.58 Hợp kim Al-Mg tác dụng vừa đủ với dung dịch HCl thu được 8.72 lít H2 (đktc).57 Cho 9g hợp kim Al tác dụng với dung dịch NaOH đặc.08 lít H2 (đktc). nóng. % Al trong hợp kim là A.7g. B. 73%.54 tấn Al bằng phương pháp điện phân nóng chảy Al2O3 với anot bằng cacbon (coi như hiệu suất điện phân bằng 100%. và khí thoát ra ở anot chỉ là CO2) có giá trị lần lượt bằng A. % Al tính theo khối lượng là A.92%. Câu 6. 9.Câu 6.72 lít. 2.2g hỗn hợp Al và Al2O3 tác dụng với dung dịch NaOH dư thu được 16. Hỗn hợp sau phản ứng nhiệt nhôm nếu đem tác dụng với NaOH dư thu được 6.8atm).4g. Cũng lượng hợp kim trên tác dụng vừa đủ với dung dịch NaOH thu được 6. C. Ca. B.3%.

Câu 6.7H2O tác dụng với H2O thu được 300ml dung dịch. sự điện phân dung dịch muối.7H2O. 8. thu được chất rắn Y. E0 (pin) = E0 (catot) – E0 (anot).48 lít. D.6255g.5g.Câu 6. 3.136g. sự khử chất oxi hoá.1M. sự điện phân dung dịch muối. nguyên tử Cu. sự điện li dung dịch muối. anot là nơi xảy ra A. 2. C.68%. D. sự oxi hoá chất khử B.36g. electron.2g.6g. Giá trị a là A. Fe C. C.68 Cho dung dịch chứa 16. catot là nơi xảy ra A. 5. ion.69 50g một lá kim loại tan hết trong dung dịch HCl thu được 336ml H 2(đktc) và thấy khối lượng lá kim loại giảm 1. Thêm H2SO4 vào 20ml dung dịch trên thấy làm mất màu 30ml dung dịch KMnO 4 0. B. Câu 6.255g.71 Trong pin điện hoá. C. Mg D.6 gam FeSO4. C. Giá trị a là A. Còn nếu cho a g hỗn hợp trên tác dụng với dung dịch CuSO4 dư thì được chất rắn có khối lượng tăng thêm 0. D.96 lít. 42.96 lít H2 (đktc). 4. 0. dung dịch thu được cho bay hơi H2O được 55. B.BÀI TẬP NÂNG CAO Câu 6.12g.8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3. Na II. 0. 6. C. 62.73 Trong cầu muối của pin điện hoá Zn – Cu xảy ra sự di chuyển các A. 13. D.65 Cho Fe tác dụng với dung dịch H2SO4 loãng.22g. 11g. 1. E0 (pin) = E0 (anot) + E0 (catot). Câu 6.6g O2 (đktc). Câu 6. C. Thể tích H2 (đktc) là A. E0 (pin) = E0 (anot) − E0 (catot). Câu 6.72 lít. 16.36 lít.72 Trong pin điện hoá.2g. Câu 6.8g so với ban đầu.64 Cho a g hỗn hợp gồm Al và Fe tác dụng với dung dịch NaOH dư thu được 1 thể tích H2 bằng thể tích của 9. C. C. E0 (pin) = E0 (catot) + E0 (anot). 21. sự khử chất oxi hoá. 83 .66 Cho a g FeSO4. Khối lượng chất rắn Y là A.22g.5g. B. B.68g Al2(SO4)3 nữa thì thu được kết tủa X.70 Suất điện động chuẩn E0 (pin) tính bằng A. 625. a có giá trị là A.5g.0136g. sự điện li dung dịch muối. B. B. C. 6. Câu 6. B. D.2g Fe. Al B.55g. Câu 6. 0. B. nguyên tử Zn. 4. D. D.67 Khi khử hoàn toàn a g hỗn hợp gồm Fe và Fe 2O3 ở nhiệt độ cao thu đựơc 11. D. Nhiệt phân hoàn toàn X.sự oxi hoá chất khử. tiếp tục thêm vào dung dịch sau phản ứng 13. D. Tên lá kim loại là A. Nếu cho a g hỗn hợp trên tác dụng với dung dịch HCl dư thì được 8.

C.79 Cho 3. 20. C.5g muối Na2CO3.4%.94V. Mặt khác khi cho 5.6H2O. 2. D.76V. C.H2O.77 Hoà tan 2. 0.5H2O. MgCO3. + 0.6%.26%.xH2O trong 250cm3 nước cất.32g. Câu 6. 7.6H2O. Câu 6. B.75 Suất điện động chuẩn của pin điện hoá Sn −Ag là A. Câu 6.8%. Fe3+ + 3Ag → Fe + 3Ag3+ Câu 6. 0.82 Cho 5.7H2O.81 Cho 5g Na có lẫn Na2O và tạp chất trơ tác dụng với H2O thu được dung dịch X và 1. Nồng độ % của dung dịch NaOH trước điện phân là A. Nồng độ mol/lít của dung dịch NaOH đã dùng là A.24M hoặc 0. Na2CO3.12M hoặc 0. Thành phần % theo khối lượng của tạp chất trơ là A. C.76V. thu được một chất khí và dung dịch X. Na2CO3.1M. Công thức hoá học của muối cacbonat là A. + 1.36g so với trước khi nung.6H2O. B.8g muối cacbonat của một kim loại hoá trị II hoà tan trong dung dịch H2SO4 loãng vừa đủ.yMgCl2.66V. 0. Na2CO3. Câu 6.6g muối sunfat trung hoà khan. Câu 6.2MgCl2. thu được 0. D. B. D. KCl. 0. KCl.MgCl2. D.875 lít khí Y (đktc). D. B. B.78 Cho công thức hoá học của muối cacnalít là xKCl. 24%. Công thức hoá học của cacnalit là A. CaCO3.2MgCl2. ZnCO3.42g Al2(SO4)3 tác dụng với 250ml dung dịch NaOH aM.0. lọc lấy kết tủa đem nung đến khối lượng không đổi thì được chất rắn có khối lượng giảm 0.1g cacnalít thì khối lượng giảm 4.zH2O.khử Ag+/Ag và Fe2+/Fe là A.04M hoặc 0. 2KCl.8M.7%. D.10V và E0(Cu2+/Cu) = +0. B. 2KCl. 0 Câu 6. FeCO3. Dung dịch X trung hoà vừa đủ 200ml dung dịch HCl 1M.5cm3 dung dịch HCl 0. D.1.2M hoặc 2. 84 .Câu 6. 0. Biết khi nung nóng 11.08M. D. Công thức hoá học của muối ngậm nước là A. thế điện cực chuẩn (E0) của cặp oxi hoá – khử Zn2+/Zn là A.76 Biết E pin (Zn – Cu) = 1. Fe + 3Ag3+ → Fe3+ + 3Ag D. B.44V.44V. C.78g chất kết tủa.6H2O. 2. Fe2+ + 2Ag → 2Ag+ + Fe C. − 0. Sau điện phân còn lại 100g dung dịch 24%.28M.55g cacnalít tác dụng với dung dịch KOH dư. 2Ag+ + Fe → Fe2+ + 2Ag B.74 Phản ứng xảy ra trong pin điện hoá được cấu tạo bởi cặp oxi hoá. –1. 1. Na2CO3. 1.09V. C.80 Điện phân dung dịch NaOH với cường độ không đổi là 10A trong 268 giờ. 12. Cô cạn X thu được 7. Biết 25cm3 dung dịch này tác dụng vừa đủ với 17.2%. 77%. Câu 6.MgCl2. C. B.10H2O. C.79V.34V.56M.

Dẫn từ từ toàn bộ Y vào ống chứa bột CuO dư.Câu 6. 3 D.6 B.4 mol O2 thu được 64. . 1s22s22p63s2. 23.Fe(NO3)2.88 Cho dung dịch X chứa các ion Mg2+.03%.89%.56g. Fe(NO3)3.86 Hỗn hợp X gồm a mol Al và 0.4. 4 Câu 6. 7.1s22s22p63s23p1.95g.85 Cho 23. 5.4 C. Hấp thụ hoàn toàn X vào nước được 300ml dung dịch Y.8. 41.Thí nghiệm 2: X tác dụng với dung dịch BaCl2 dư thu được 9. 35. 2. Câu 6. D. 2 C.1s22s22p63s23p2. 3. NO và còn dư Fe. đến khi kết tủa hoàn toàn thì cần 400ml dung dịch HCl. D.83 Nung 6. 15. Dung dịch X chứa chất tan A. sau một thời gian thu được 4.32g kết tủa. D. Nếu cho 23. C. SO42-. Fe.Thí nghiệm 1: X tác dụng với dung dịch NaOH dư. D.675 mol SO2.Fe(NO3)3 và HNO3 D. Chấm dứt phản ứng thu được dung dịch X. pH của dung dịch Y là A.4g X gồm Al. B.97%. C. Giá trị của a là A. 6.4.22g.6g hỗn hợp chất rắn. C. HNO3 Câu 6. Thêm từ từ dung dịch HCl 1M vào X.11g. 10. dư thu được 0. Fe(NO3)2 và Fe(NO3)3 C.15g hỗn hợp X gồm Zn và Cu vào 140ml dung dịch AgNO3 1M. Tổng khối lượng các ion trong dung dịch X là A.16g kết tủa và 0.89 Cho 5. 5.8.6. D. n. C. e) là 40.4g X tác dụng với dung dịch H2SO4 loãng dư thu được khí Y. 0. B. 0.3 D.2g. 0.58g Cu(NO3)2 trong bình kín.2g so với ban đầu. C. 85 .4g.32g. nung nóng thấy khối lượng chất rắn trong ống giảm 7. Số gam K là A. NH4+. lúc đầu không thấy kết tủa.96g chất rắn và hỗn hợp khí X. Fe(NO3)2. 0.2 Câu 6.06 mol khí. nóng.87 Khuấy đều một lượng bột Fe và Fe3O4 vào dung dịch HNO3 loãng. Khối lượng Zn trong hỗn hợp là A. B.84 Cho 21g hỗn hợp 2 kim loại K và Al hoà tan hoàn toàn trong nước được dung dịch X. Câu 6. Sau khi phản ứng xong được 15. 1. cấu hình electron của R là A.6g. Cl-. 58. Thành phần % theo khối lượng của Al trong X là A.3 mol Mg phản ứng hết với hỗn hợp Y (vừa đủ) gồm b mol Cl2 và 0. . Câu 6.76g hỗn hợp 2 kim loại và dung dịch Y. B. 1 B. R có hoá trị II. 1. 1s22s22p63s23p3.90 Nguyên tố R có tổng số hạt (p. B. Câu 6.12.08%. đun nóng thu được 1. Cu tác dụng với dung dịch H 2SO4 đặc. B.

Ba(OH)2. NH3.93 Hoà tan hoàn toàn 1.97 Thứ tự pH theo chiều tăng dần các dung dịch có cùng nồng độ mol của NH 3. Khi trộn dung dịch X vào dung dịch Y tạo thành 1.15M C.88 D.1M. B. O (A = 16. 1s22s22p2. 1s22s22p63s23p63d64s2. Câu 6.64g kết tủa. 1M. D.5g CuCl2 và 14. Nồng độ mol/l của dung dịch HCl là A. Mặt khác cho 7. cường độ dòng điện là 5. Nồng độ mol/l của dung dịch CuSO4 ban đầu là A. Ba(OH)2 là A. C.02M. B. C. Số hạt mang điện của nguyên tử Y nhiều hơn X là 12 hạt. B.1M.804A đến khi bọt khí bắt đầu thoát ra ở cực âm thì mất 2 giờ. Câu 6. 0. C.100 Điện phân 100ml một dung dịch có hoà tan 13. C.90. trong đó tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện là 42 hạt.[KCldư] = 0. NaOH. Ba(OH)2. 0.9M. 0.9M. D.275M. 3M Câu 6. 3. Nồng độ mol các chất có trong dung dịch sau điện phân đã được pha loãng cho đủ 200ml là A.98 Sau một thời gian điện phân 200ml dung dịch CuSO4 với điện cực trơ.62g Al trong 280ml dung dịch HNO3 1M thu được dung dịch X và khí NO (sản phẩm khử duy nhất).9g KCl có màng ngăn và địên cực trơ mất 2 giờ. 1. 2 2 6 2 4 C. Al và Fe. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 43 hạt.đều có cấu hình electron ở phân lớp ngoài cùng là 2p 6. 1s22s22p63s23p3. khi đó khối lượng cực âm tăng thêm 3.56g chất kết tủa.44g.12 hoặc 0. D.5M D.12 C. Câu 6. Câu 6. [ KOH] = 0. 0. B. O. Ba. Z = 1). NaOH. NaOH. NH3. B.5M. NaCl. n. NaOH.35g hai kim loại kiềm thuộc 2 chu kì liên tiếp vào 500ml dung dịch HCl được dung dịch Y và 2. Be. 0. C.9M. X và Y lần lượt là A. Ca. C. NaOH.8 lít khí H2 (đktc).75M. 0.95 Tổng số hạt (p. X và Y lần lượt là A. e) trong 2 nguyên tử kim loại X và Y là 142. 0.Câu 6. Ba(OH)2. MgCl2. O. Fe và Cu. 0. 1s 2s 2p 3s 3p . B. 86 . D.3M B. Ba(OH)2. Câu 6. B. Biết H (A = 1. Câu 6.9M. Câu 6. C. cần dùng 100ml dung dịch H2S 0. Câu 6.12 hoặc 0. Nồng độ mol/l của dung dịch CuSO4 trước điện phân là A. 0. D. Giá trị của x là A.[ KOH] = 0.[ KOH] = 0. Vậy X có cấu hình electron là A. Để kết tủa hết ion Cu2+ còn lại trong dung dịch sau điện phân.[KCldư] = 0.92 Cation X2+ và anion Y2. 0. Mg.96 Cho x mol CO2 hấp thụ hoàn toàn vào 200ml dung dịch hỗn hợp gồm KOH 1M và Ba(OH)2 0.2M. D.35M. D. B. Ca và Fe.99 Điện phân 200ml dung dịch có chứa 2 muối là Cu(NO3)2 và AgNO3 với cường độ dòng điện là 0. Z = 8).91 Nguyên tử của nguyên tố X có tổng số electron trong các phân lớp p là 7. Tổng các hạt trong ion đó là 123. NH3.18M.75M thu được 23.1A.52M. AlCl3. Mg và Fe. khối lượng dung dịch giảm 8g. 0.38. Công thức hoá học của hợp chất tạo bởi X và Y là A. D. 0. [ KOH] = 0. NH3. O. B.94 Cho ion HXO3-. FeCl3. O. nguyên tử của nguyên tố Y có tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện của X là 8.

34 6. 88%.80 A B A A C A A A B A 6. D. 90%.4% so với ban đầu.96g.36 6. Kết quả về khối lượng: lá (1) tăng 1.99 6.67 6.8g.31 6. 1.93 6.87 6.13 6. thu được chất rắn và dung dịch X.19 6.12 6. Zn. %Fe trong đinh thép là A. C. D.59 6. Fe3O4. Câu 6.89 6.35 6.101 6.94 6. M là A.14g vào dung dịch H 2SO4 loãng dư.76 6.71 6.81 6.65 6.16 6.8 B 6.2%. Kim loại thu được đem hoà tan trong dung dịch HCl thu được 1. B. lá (2) vào dung dịch CdCl2 đến khi thấy số mol CuCl2 và CdCl2 trong hai dung dịch giảm như nhau thì nhấc ra.5 A 6.6g.26 6.85 6.17 6.63 6.55 6. 98.103 6. Zn .57 6.22 6. lá (2) vào dung dịch Cu(NO 3)2 đến khi thấy số mol Pb(NO3)2 và Cu(NO3)2 trong hai dung dịch giảm như nhau thì nhấc ra.25 6. Lấy 2 lá kim loại M có khối lượng bằng nhau.21 6.73 6. Kết quả về khối lượng : lá (1) tăng 19%.79 6. cần 2.91 6.344 lít H2 (đktc). M là A.47 6. Cu.97 6.23 6.50 D A B C B B A A B A 6.6% so với ban đầu.1M vào X đến khi dung dịch X bắt đầu có màu hồng. C.78 6. D. Câu 6. 1.86 6.016 lít khí H2 (đktc).90 C A A A A A A B B B 6.92g Fe. 1. C. lá (2) giảm 9. Lấy 2 lá kim loại M có khối lượng bằng nhau.68 6. 16. Fe. Fe2O3 .104 Khử 4.102 M là kim loại hoá trị II. Fe 2O3 tác dụng với CO dư ở nhiệt độ cao thu được 3.104 6.40 A D C B A C C A A C 6.46 6.29 6.7 B 6.37 6.92 6. D. Câu 6. thấy đã dùng hết 40ml dung dịch KMnO4. Cd.3 A 6. C. B. Nhúng lá (1) vào dung dịch Pb(NO3)2. 49.84 6.105 4. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VI 6.103 Cho một cây đinh thép nặng 1.15 6.96 6. Mg.51 6.66 6. Cu.11 6.24 6. Nhỏ từ từ dung dịch KMnO4 0.95 6.68g.1%.9 6.101 M là kim loại hoá trị II. B. Khối lượng Fe trong hỗn hợp là A.82 6.6 A 6. Cũng lượng hỗn hợp trên ngâm trong dung dịch CuSO4 dư thì khối lượng chất rắn thu được là 4. D.102 6.56 6.74 6. Mg.60 C B A D D D A B C D 6.105 A A A A A 87 . C.20 A B C C A A D A B A 6.70 A A D A B C D D B A 6.45 6.64 6.30 A C C C C B A A B C 6.33 6.53 6. ZnO. Nhúng lá (1) vào dung dịch CuCl2.98 6.44 6.27 6.41 6.49 6.69 6.48 6. FeO.88 6. B.52 6. lá (2) tăng 8.72 6.14 6.2 D 6.1 D 6.43 6.8g một oxit của kim loại trong dãy điện hoá ở nhiệt độ cao.62 6.38 6.100 A C A C A A A B B A 6.61 6.54 6.58 6.44g. Câu 6.83 6.75 6.18 6.4 A 6.72g hỗn hợp bột các chất Fe.10 D A 6. B.39 6. Công thức hoá học của oxit kim loại là A.77 6.42 6.2 %.28 6. CuO.Câu 6.32 6.

Tính khử và tính oxi hoá. tính axit.Tính oxi hoá.Cấu hình electron nguyên tử Cr : [Ar]3d54s1.Thế điện cực chuẩn E Cr3+ /Cr = -0. .Oxit và hiđroxit có tính bazơ.Oxit và hiđroxit có tính bazơ.77V.Tính khử.Oxit và hiđroxit có tính bazơ. . 0 0 0 0 . E Fe3+ /Fe2+ = 0.44V. 4.Oxit và hiđroxit có tính .2 KI Cr +6 (dd) Kiềm Axit Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 . t0 2 Cr2O3 (r) + NH 3 CrO3 + bột Al + Cl . Số oxi hoá +3 Số oxi hoá +6 . Crom − Sắt − Đồng . . 3.Oxit và hiđroxit có lưỡng tính. Cu : [Ar]3d104s1. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 .Tính khử. Sơ đồ minh hoạ tính chất hoá học của crom + O .74V. E Fe2+ /Fe = -0. Fe : [Ar]3d64s2. 2. Sơ đồ minh hoạ tính chất hoá học đồng + + 88 . t0 2 Nước CrCl3 (r) + Cl +Zn 2 +(O +H O) 2 2 H2CrO47 H2Cr2O Cr HCl H2SO4(l) Cr (dd) Axit Cr(OH)2 +2 Cr +3 +Br (dd) +SO2. CROM − SẮT − ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.34V. . E Cu 2+ /Cu = 0. Số oxi hoá +3 .CHƯƠNG VII. .Tính oxi hoá.

Ni. 89 . Zn.Cu(OH)2 (r) CuCl2 (r) Số oxi hoá +2 . Au. Sơ lược về các kim loại Ag.Tính oxi hoá. Sn. NH .5H2O Cu(NO3)2. +1.[Cu(NH3)4]2+ NH3 Cu(OH)2 OH - H + HCl + O2. (+2) Ag+/Ag +0.76 Mạnh Sn +2. → t0 2.26 Rất yếu T. Fe + 2HCl  → FeCl2 + H2. AgNO3 Cu2+ (dd) H + Kết tinh CuSO4. H2SO4 đ dd FeCl3. 2Fe + 3Cl2  2FeCl3. +4 Pb2+/Pb -0.Bình Au Zn +2 Zn2+/Zn -0.Oxit và hiđroxit có tính bazơ. HNO3. t Không khi ẩm Khí Clo khô t0 CuCO3.08 Rất yếu Ni +2.5 -0. 10000C Cu 0 Không khí. → 0 t 3. Fe + 6HNO3 đặc  → Fe(NO3)3 + 3NO2 + 3H2O.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) t0 1. .3H2O Không khí. 3Fe + 2O2  Fe3O4. → 4. Pb Số oxi hoá Eo(V) Tính khử Ag +1. Fe + 4HNO3 loãng  → Fe(NO3)3 + NO + 2H2O. 5.13 Yếu B . → 7. 2Fe + 6H2SO4 đặc  Fe2(SO4)3 + 3SO2 + 6H2O.14 Yếu Pb +2. 8. 5. t 0 CuO (đen) 3 Cu2O (đỏ) Chất khử CO. t0 6. +3 (+3) Au3+/Au Ni2+/Ni +1. +4 Sn2+/Sn -0. Fe + H2SO4 loãng  → FeSO4 + H2. Fe + S  FeS.

FeCl2 + 2NaOH  → Fe(OH)2 + 2NaCl. → 0 t Fe2O3 + 3CO  2Fe + 3CO2. 17. <5700 C 3Fe + 4H2O → Fe3O4 + 4H2. → 0 t 2Cr + 3Cl2  2CrCl3. 39. 36. 33.. 35. → 0 t 2FeO + 4H2SO4 đặc  Fe2(SO4)3 + SO2 + 4H2O. 26. Fe(OH)3 + 3HCl  → FeCl3 + 3H2O. 22. t0 FeO + CO  Fe + CO2. 12.. → t0 2Cr + 3S  Cr2S3. 2FeCl3 + Fe  → 3FeCl2. 23. 34... 24. 10. 42. 38. 29. 37. 90 Fe (dư) + HNO3  → Fe(NO3)2 + .. 20. 40. 2FeS2 + 14H2SO4  → Fe2(SO4)3 + 15SO2 + 14H2O. Fe(OH)2 + H2SO4  → FeSO4 + 2H2O. 30. → FeO + H2SO4 loãng  → FeSO4 + H2O. 28. 41. Fe2O3 + 3H2SO4  → Fe2(SO4)3 + 3H2O. Fe + 3AgNO3 (dư)  → Fe(NO3)3 + . 44.. 18. → Fe2O3 + 3H2SO4 loãng  → Fe2(SO4)3 + 3H2O. FeO + 2HCl  → FeCl2 + H2O. Fe + 2AgNO3  → Fe(NO3)2 + 2Ag.9. Fe2O3 + 6HCl  → 2FeCl3 + 3H2O. 25. → . → Fe(OH)2 + 2HCl  → FeCl2 + 2H2O. >5700 C Fe + H2O → FeO + H2.. 0 t 3Fe2O3 + CO  2Fe3O4 + CO2. t0 3FeO + 10HNO3 đặc  3Fe(NO3)3 + NO + 5H2O. Fe (dư) + H2SO4 (đặc)  → FeSO4 + . → 2Fe(OH)3 + 3H2SO4  → Fe2(SO4)3 + 6H2O.. 10FeSO4 + 2KMnO4 + 8H2SO4  → 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. 14. 21. → t0 4Cr + 3O2  2Cr2O3. 19. 13. 27. → t0 Fe2O3 + CO  2FeO + CO2. 2FeCl2 + Cl2  → 2FeCl3. 43. 32. 31. t0 4FeS2 + 11O2  2Fe2O3 + 8SO2.. Fe + CuSO4  → FeSO4 + Cu.. t0 2Fe(OH)3  Fe2O3 + 3H2O. 4Fe(OH)2 + O2 + 2H2O  → 4Fe(OH)3. 2FeCl3 + 2KI  → 2FeCl2 + 2KCl + I2. 16. 11. 15.. FeCl3 + 3NaOH  → Fe(OH)3 + 3NaCl. 2FeCl3 + Cu  → 2FeCl2 + CuCl2.

63.45. 68. 67. 4CrCl2 + O2 + 4HCl  → 4CrCl3 + 2H2O. 2CrCl3 + Zn  → ZnCl2 + 2CrCl2. 80. → t0 2Na2Cr2O7  2Na2O + 2Cr2O3 + 3O2. to 4Cr(OH)2 + O2 + 2H2O  4Cr(OH)3. 2NaCrO2 + 3Br2 + 8NaOH  → 2Na2CrO4 + 6NaBr +4H2O 2Na2Cr2O7 + 3C  → 2Na2CO3 + CO2 + 2Cr2O3. 76. → >1000 C 2CrO + O2  2Cr2O3. K2Cr2O7+6KI+7H2SO4  Cr2(SO4)3+4K2SO4+3I2+7H2O. 0 t Cu + Cl2  CuCl2. → 91 . Cr(OH)3 + 3HCl  → CrCl3 + 3H2O. 2CrCl2 + Cl2  → 2CrCl3. Na2Cr2O7 + S  → Na2SO4 + Cr2O3. 70. CrCl2 + 2NaOH  → Cr(OH)2 + 2NaCl. 72. Cr + 2HCl  → CrCl2 + H2. 64. 48. → CrO3 + H2O  → H2CrO4. 2CrCl3 + 3Cl2 + 16NaOH  → 2Na2CrO4 + 12NaCl + 8H2O. 79. 53. 2Cr + 3SnCl2  → 2CrCl3 + 3Sn. 75. 65. 77. 46. 61. 4200 C 4CrO3  2Cr2O3 + 3O2. 2CrO3 + H2O  → H2Cr2O7. 59. → t0 2Cu + O2  2CuO. Cr(OH)3 + NaOH  → Na[Cr(OH)4] (hay NaCrO2). 62. K2Cr2O7 + 3H2S + 4H2SO4  → Cr2(SO4)3 +3S + K2SO4 + 7H2O. → Cr(OH)2 + 2HCl  → CrCl2 + 2H2O. 0 t (NH4)2Cr2O7  Cr2O3 + N2 + 4H2O. 73. → 2CrO3 + 2NH3  → Cr2O3 + N2 + 3H2O. 56. o t 2Cr(OH)3  Cr2O3 + 3H2O. 55. 49. 54. 74. Cr + H2SO4  → CrSO4 + H2. 51. → K2Cr2O7 + 6FeSO4 + 7H2SO4  → 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. CrCl3 + 3NaOH  → Cr(OH)3 + 3NaCl. 66. 0 t Cr2O3 + 2Al  2Cr + Al2O3. 60. 69. Na2Cr2O7 + 14HCl  → 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 58. Cr2O3 + 3H2SO4  → Cr2(SO4)3 + 3H2O. → CrO + 2HCl  → CrCl2 + H2O. 50. 71. 52. → 2Na2CrO4 + H2SO4  → Na2Cr2O7 + Na2SO4 + H2O. 2Cr2O3 + 8NaOH + 3O2  → 4Na2CrO4 + 4H2O. K2Cr2O7 + 3K2SO3 + 4H2SO4  → Cr2(SO4)3 + 4K2SO4 + 4H2O. 57. 78. 47.

102. 89. 110. Cu + 2FeCl3  → CuCl2 + 2FeCl2. → Cu(OH)2 + 4NH3  → [Cu(NH3)4]2+ + 2OH-. → 0 t Zn + S  ZnS. 88. → Cu + 2H2SO4 đặc  → CuSO4 + SO2 + 2H2O. → t0 Zn + O2  2ZnO. 99. 111. 113. → 3Pb + 8HNO3 loãng  → 3Pb(NO3)2 + 2NO + 4H2O. 105. 109. 0 t Cu(OH)2  CuO + H2O. 83. CuS + 4H2SO4 đặc  → CuSO4 + 4SO2 + 4H2O. Cu + 2AgNO3  → Cu(NO3)2 + 2Ag. → CuS + 2AgNO3  → 2AgS + Cu(NO3)2. 100. 92 t Cu + S  CuS. 114. → ñieä phaâ dung dò n n ch 2CuSO4 + 2H2O  2Cu + 2H2SO4 + O2. 95. 104. 85. 98. → ñieä phaâ dung dò n n ch CuCl2  Cu + Cl2. → t0 CuO + CO  Cu + CO2. 2Cu + 4HCl + O2  → 2CuCl2 + 2H2O. 84. → ñieä phaâ dung dò n n ch 2Cu(NO3)2 + 2H2O  2Cu + 4HNO3 + O2. Cu + 4HNO3 đặc  → Cu(NO3)2 + 2NO2 + 2H2O. Sn + 2HCl  → SnCl2 + H2. 101.81. 106. 3Cu + 8NaNO3 + 4H2SO4  → 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. t0 Sn + O2  SnO2. 93. → t0 3CuO + 2NH3  N2 + 3Cu + 3H2O. 96. Cu(OH)2 + 2HCl  → CuCl2 + 2H2O. 82. → 0 t Ni + Cl2  NiCl2. 115. 87. 112. 5000 C 2Ni + O2  2NiO. 103. 90. 86. Cu(OH)2 + H2SO4  → CuSO4 + 2H2O.Cu(OH)2  2CuO + CO2 + H2O. 107. 92. → 0 . → 0 t CuCO3. → t0 CuO + Cu  Cu2O. → t0 Pb + S  PbS. 116. 0 t CuO + H2  Cu + H2O. → Cu2O + H2SO4 loãng  → CuSO4 + Cu + H2O. → t0 Zn + Cl2  ZnCl2. → 0 t 2Pb + O2  2PbO. 97. 0 t 2Cu(NO3)2  2CuO + 2NO2 + 3O2. CuO + H2SO4  → CuSO4 + H2O. 3Cu + 8HNO3 loãng  → 3Cu(NO3)2 + 2NO + 4H2O. 108. CuO + 2HCl  → CuCl2 + H2O. 91. 94.

Pirit sắt. B. Ag + 2HNO3(đặc)  → AgNO3 + NO2 + H2O. +2. +3. C. +3. B. Phản ứng phân huỷ không phải là oxi hoá. [Ar]3d10. Câu 7. B. +2. 9 C. +6. → Au +HNO3 + 3HCl  → AuCl3 + 2H2O + NO. Câu 7. Manhetit. Zn(HCO3)2. [Ar]3d . C.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ? 93 . 122.khử. +6. Hg. t0 2AgNO3  2Ag + 2NO2 + O2.117. Phản ứng trên thuộc loại phản ứng nào sau đây ? A. − 5Sn 2+ + 2 MnO4 + 16 H + → 5Sn4+ + 2 Mn2+ + 8 H2 O. [Ar]3d3. D. Câu 7. C. Cr2O3. [Ar]3d7.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 7. C. Mg. B. D. D. Na. 119. D. B. B. Ba. Ba. Ag. C . [Ar]3d5. Na. D. Câu 7. Câu 7.4 Các số oxi hoá đặc trưng của crom là ? A. +4. Câu 7. Mg.5 Khi nung Na2Cr2O7 thu được Na2O. D. 124. Phản ứng oxi hoá. MnSO4. D. ZnSO4.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư. ZnSO4. Zn(OH)2. 121.2 Cấu hình electron nào sau đây là của ion Fe3+ ? A. 2Ag + O3  → Ag2O + O2. Fe. Mg. Hematit. B.khử nội phân tử.khử. Cấu hình electron của ion Cu2+ là A. Na. Phản ứng oxi hoá. O2. Đó là muối nào sau đây ? A. Ag2O + H2O2  → 2Ag + H2O + O2. 120. 118. Phản ứng tự oxi hoá. [Ar]3d . +4.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ? A. C. 123. Câu 7.khử phức tạp. +2. 2Ag + 2H2S + O2  → 2Ag2S + 2H2O. Ag.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ? A. Câu 7. [Ar]3d6. B. → ñieä phaâ dung dò n n ch 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2.6. [Ar]3d8. +6. +6. ZnO. +1. Xiđerit. D. +4. C.7 Hợp chất nào sau đây không có tính chất lưỡng tính ? A. CaSO4. 4 C. MgSO4.

CuSO4. B. dung dịch HCl.11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ? A. dung dịch H2SO4.13 Có 2 lá sắt khối lượng bằng nhau. Dung dịch : NaOH. FeS2(5). D. C. Fe3O4(3). m1>m2. C. B. FeSO3(8). Câu 7. Dung dịch : KOH. B. Câu 7. CuS(3). Crom là kim loại có tính khử mạnh hơn sắt. CrO là oxít bazơ. Fe có khả năng tan trong dung dịch FeCl3. Ag có khả năng tan trong dung dịch FeCl3. B. B.5H2O(6). Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau : 94 . NO2. D. Cu có khả năng tan trong dung dịch FeCl3. Câu 7.10 Phân biệt 3 mẫu hợp kim sau : Al-Fe. c. HCl. Cu2O(2). Al-Cu. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2. D. D. Cu2S(4). Lá 2 đốt trong khí clo dư thu được m2g muối. NH3. C. FeS(4). Chất có phần trăm khối lượng sắt lớn nhất là………… b. Mối liên hệ giữa m1 và m2 là A. Chất có % khối lượng đồng lớn nhất là……………. a. sắt kim loại. người ta thường cho vào đó : A. Không thay đổi. Các chất có % khối lượng đồng bằng nhau là…………….. m2>m1. Chất có phần trăm khối lượng sắt nhỏ nhất là………… Câu 7. Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan. m1=m2... FeSO4(6). D.17 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất: CuO(1). b. Hoá chất cần dùng là : A. C.15 Cho biết câu sai trong các câu sau : A. NO. Chất có % khối lượng đồng nhỏ nhất là……………. dung dịch NaOH. dung dịch AgNO3. C. Câu 7. Fe2(SO4)3(7). Không xác định được. Tăng lên.14 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất : FeO(1). Câu 7. Cu-Fe bằng phương pháp hoá học. C. N2O. B. Câu 7. Câu 7. Câu 7. C đều đúng. để bảo quản dung dịch muối sắt (II). B. D. Cả A. HNO3 đặc nguội.16 Trong phòng thí nghiệm.12 Cho biết câu nào không đúng trong các câu sau: A. C. Giảm đi. H2SO4 loãng. a.A. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép. Kim loại Cr có thể cắt được thuỷ tinh. D. CuSO4(5). Fe2O3(2). B.

C.84.36 lít. FeCl3. CuSO4 có thể dùng làm khô khí NH3. 27. HCl.22 Cho 2.6g.999g. Ngâm lá kẽm vào dung dịch. Thể tích khí (ở đktc) là A. xăng. C. Khối lượng của hỗn hợp A là bao nhiêu gam ? 95 . CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả. D. 2.19.36. 0. FeCl3. 27.92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0. Fe3O4. Fe. Đốt cháy hết phần 2 trong oxi thu được 4. 4. 0. [Ar]3d5. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ? A. 0.0896 lít.016 lít hiđro (đktc). 18. 8.16M và H2SO4 0. Phần 1 tác dụng hết với dung dịch HCl thu được 2. Al. 10. B.36. Câu 7. FeCl3.16. FeCl2. Ngâm lá sắt vào dung dịch. [Ar]3d2.27 Hỗn hợp A gồm FeO.7H2O có khối lượng là 55. sấy khô. Fe2O3.52g một kim loại tác dụng hết với H2SO4 loãng. B. [Ar]3d .26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO 4.24 Lấy 5. Cu có thể tan trong dung dịch AlCl3. thu được 6. Mg. 0. FeCl2. Ngâm lá đồng vào dung dịch.36. B. B.20 Cấu hình electron của Cr3+ là phương án nào ? A. Câu 7.2857g. FeCl2.252g. 2. Khối lượng mol của M. Kim loại đó là kim loại nào ? A. Dung dịch thu được sau phản ứng gồm các chất A. 2. cân nặng 4. C. Câu 7. C. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư. 0. Câu 7.5 mol. Khối lượng sắt tham gia phản ứng là bao nhiêu ? A. chia làm 2 phần bằng nhau.A. số gam của Fe. [Ar]3d4.23 Cho 1.3584 lít. Chọn câu đúng trong các câu sau : A.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi. B. B.672 lít.100g. 3 C. 3. 0. D. C. D. B.16 lít. Câu 7.25 Cho Fe tác dụng với dung dịch H2SO4 loãng. Trong hỗn hợp A mỗi oxit đều có 0. C. 54.52g hỗn hợp A) lần lượt là A. Câu 7. 1. D. B. 3. HCl. Câu 7. Zn. C. 1. 7.48 lít.33 lít. C. Cho AgNO3 vào dung dịch. 3. 2.16.3999g . D. D. HCl. B. 3. Câu 7. D. D. Cu có thể tan trong dung dịch FeCl2.68. Câu 7.16.36g hỗn hợp gồm Fe3O4 và oxit của M. D.52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi.4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15.448 lít. M (trong 5. sau một thời gian lấy đinh sắt ra.84g muối sunfat. dung dịch thu được cho bay hơi được tinh thể FeSO4.

15. 232. Phản ứng này không thể xảy ra. 88. 116. 0. C.1M. 35. Hoà tan chất rắn X trên vào dung dịch HNO3 0. D.69.5 lít.5 ml. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ? A. Biết hiệu suất của quá trình 96%. B. Na2Cr2O7 còn dư 1 mol. 30. Đáp số khác.31 Một thanh đồng nặng 140. 0.84 lít. Zn.35 Đốt 12. 10.48 lít khí duy nhất NO (đktc). 22. B. B. Câu 7. 0. B.5M thu được 448 ml khí NO (đktc). Khối lượng muối sunfat khan thu được là A.4.2 g/ml) đã tác dụng với thanh đồng là A. 25.68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra. Câu 7. 3. Na2Cr2O7 còn dư 0.56. 22.5M thu được 448 ml khí NO (đktc). Giá trị của m là A. dư thu được 4. Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là A. D. Khối lượng kết tủa thu được là bao nhiêu gam ? A. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư.36 Cho 1.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H 2SO4 loãng thu được 560ml khí ở đktc. Câu 7. C. CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0. B.2g kim loại M tác dụng với dung dịch HNO3 loãng.36 lít. 21. 16g. C.5 mol. Câu 7.8g đồng trong không khí thu được chất rắn X. Hoà tan chất rắn X trên vào dung dịch HNO3 0.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%. C. 464. ZnO. Thể tích dung dịch AgNO3 32% (D=1. Câu 7.24 lít.32 Cho 19. 1. C.65.08g.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao. 177 ml. C. B. D.12 lít.65. Na2Cr2O7 đã hết. 25.52g. D. Fe. Câu 7. 54. Đáp số khác. 21. Cu. 3. C. 50. C.2.A. Vậy: A. M là kim loại nào ? A. Câu 7. 15. Khối lượng chất rắn X là A.33 Cho 7.56.04 lít. 177 lít. C. Câu 7. 2.405g D. 88. D.8 lít. Câu 7. 20.9333 lít D. C. Mg. B. 0. Cr2O3 và 48g oxi.405g hỗn hợp Fe2O3. B. B. Câu 7. D.34 Đốt 12.8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171. D.2g. C. B. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO 4 96 .8g đồng trong không khí thu được chất rắn X.

2g. cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1.5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6. B.24% khối lượng.thì thu được một chất rắn. Thành phần phần trăm của Fe. Hiệu suất của phản ứng khử CuO là A. Câu 7.2g. C. Câu 7. Câu 7. C.72 lít (đktc). Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38. D. Fe3O4. 9. D. đem hoà tan vào dung dịch HCl thấy bay ra 0.4g. Al.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra. B. 55. 75%. brom. C. Các khí đo ở đktc. Cho 14. 2. B. 1. 2. Câu 7.76g chất rắn.40 Cho 100g hợp kim gồm có Fe. Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4. 4. Câu 7. p. D. 11. C. Fe. nếu sục thật 97 . Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là A. 2.8g.4. 13%. FeO. Giá trị của V là bao nhiêu ? A.24 lít.4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1. Câu 7. C.36 lít. Nguyên tố X là A. Đáp số khác. 60g.8g. 5%. D.12 lít. 3. B. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là A. Fe2O3. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4.48 lít NO (đktc).8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra. Không xác định được. Oxit sắt đó là ? A.8 lít khí. Cr và Al trong hợp kim lần lượt là A. 4. B. 85%.5g. D.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e. crom. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22. B. Câu 7. Cu. 2. sấy khô thấy khối lượng tăng 1. 60. D.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32. 10.6.98 lít khí. Câu 7. trong đó Cu chiếm 43. B. 80%.2. D. 14g. D.8g. Tên của kim loại đã dùng là A. C. 83%. sắt. 19. Câu 7. Mặt khác. B.41 Hỗn hợp X gồm Cu và Fe.4g.43 Nhúng thanh sắt vào dung dịch CuSO4.448 lít khí (đktc). 80%. 84%. 15%. 32g.5g.8. 1. 4%.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X. Zn. 50g.38 Khử 2. Sau phản ứng thu được 1. 70%. n) là 82. 84%. 28g. 12%.48 lít.05%. C photpho. Có bao nhiêu gam Cu đã bám vào thanh sắt ? A.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X. 4%. 4. 3. C. sau một thời gian lấy thanh sắt ra rửa sạch. D. C. 1.95%. B.

92g. C.0053 lít. Câu 7. C. Thành phần phần trăm cacbon trong mẫu thép là A. Fe3O4 thấy có 4. Câu 7. Không xác định được. 4.08g. 2. Công thức của muối sắt là A. 46. B. FeCl3. 0.72 lít.89g. FeCl2.6g.88g nước.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH. B.25g sắt clorua tác dụng với dung dịch AgNO 3 dư tạo ra 8.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO 3 tạo ra 2. 8. 6. B. 6. 1. nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6.24 lít. Cả FeCl2 và FeCl3. 5.196 lít khí CO2 (0oC và 0. B. Câu 7. C. Câu 7. C.72 lít hiđro (đktc). 4. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3. thấy có 0. 16g.53 Khử 9. Thể tích hiđro đã dùng (170C và 725mmHg) là A. FeCl2. D.48 lít. 0.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao. C. C. chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO 3. thu được sắt và 2. FeCl3.88 lít hiđro (đktc).36 lít. Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là A. Công thức của muối sắt đã dùng là A.42)g muối khan. D. Thể tích CO (đktc) đã dùng là A.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư.47 Một dung dịch có hoà tan 3. Fe2O3. 42g. C.42%. C. 27g. B. thu được chất rắn có khối lượng 11.48 lít. Không xác định được. D.4 lít.54 Hoà tan hoàn toàn 19. 9g. D. B. D. 22. nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26. 69.61g kết tủa trắng. 3. D. sau đó làm bay hơi 98 . B. Câu 7.4g.72 lít.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí.2g.2g Cu vào dung dịch HNO3 loãng. 4 lít.672 lít.6492 g AgCl. 6. B. 6. B.6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao. 0. Đáp số khác.8 at) thoát ra.48 lít.84%.24 lít. 27g. Câu 7. Cả FeCl2 và FeCl3. 4.chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m 1 + 1.584 lít. 2. 5.64g. Câu 7. D. D.48 lít khí CO2 (đktc) thoát ra. Câu 7.4%. 3. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là A. 0. 3.6g. Những chất còn lại sau phản ứng. Câu 7. Sau khi phản ứng kết thúc. D. Đáp số khác. C. Thể tích CO (đktc) đã tham gia phản ứng là A. 69.12 lít.36 lít. m có giá trị là A.

Đáp số khác.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V 1 lít khí (đktc). 64. thu được dung dịch Y.Phần 1 : tác dụng với lượng dư dung dịch HCl. Fe và Sn. D. Các khí đo ở đktc. V1=V2.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO 3 thấy thoát ra 0. C.448 lít khí không màu hoá nâu trong không khí (đo ở đktc). Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là A. Khối lượng muối khan thu được sau phản ứng là A. Câu 7.59 Cho sơ đồ phản ứng sau : Cu + HNO3  → muối + NO + nước. B. Thêm dung dịch kiềm vào muối đicromat. 3 và 8. thu được chất rắn có khối lượng là 0. Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc). 0. Cho NaOH vào Y. 32. 8. còn hợp chất Cr(VI) có tính oxi hoá mạnh. 3 và 6. C. . 5. 60%.01. Hoà tan X bằng dung dịch HCl dư. 40%. C. 2. C. 40%.1 mol Fe2O3 và 0. D. B. 0. 4. B. 68%. 48. Fe và Ni. Phần trăm về khối lượng của đồng.02. Câu 7. sắt và đồng thành 2 phần đều nhau. Fe trong 4g hỗn hợp lần lượt là: A.58 Chia 4g hỗn hợp bột kim loại gồm nhôm. D.02. 32%. kim loại Mg. Không đủ cơ sở để so sánh.dung dịch và đun nóng. nhôm trong hợp kim lần lượt là A. 0. Số mol của Al. D. D. C. D. Câu 7. 1. 3 và 2. kim loại Ba. Mối liên hệ giữa V1 và V2 là A. Giá trị của m là A.01. Hợp chất Cr(II) có tính khử đặc trưng. 0. muối này chuyển thành muối cromat. kim loại Ag.1 mol Fe3O4. C. 0. B. 68%.Phần 2 : tác dụng với lượng dư dung dịch NaOH.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb. V1<V2. Khi nhúng các cặp kim loại trên vào dung dịch axit. Đáp số khác.63 Chỉ ra câu đúng trong các câu sau : 1. B. . V1>V2. thu được kết tủa Z. 2. C. Câu 7.72g.84g. II – BÀI TẬP NÂNG CAO Câu 7. số cặp kim loại trong đó Fe bị phá huỷ trước là A. Câu 7. B. Câu 7.61 Để khử ion Fe3+ trong dung dịch thành ion Fe2+ có thể dùng một lượng dư A. C. B. B. rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn.57 Chất rắn X gồm 0. Câu 7.4g. Lọc lấy kết tủa. 3 và 3. kim loại Cu.01. D. thu được 560ml hiđro.4g. thu được 336ml hiđro. D. 60%.02. 40. 32%. 0. 4. 99 . 3.

màu của dung dịch dần dần trở lại đỏ cam. Các hợp chất Cr2O3. Khi cân bằng 2 phản ứng trên. 8. 1. B và C lần lượt là : A. (7) X5 + O2 + H2O → X6 Các chất X1. 74 V. Na2CrO4. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo. Fe(OH)3. K2CrO4. X5. Câu 7. B. 8. D.64 Cho từng chất Fe. Fe(NO3)2. Fe2O3. 5. 5. 8.6 V. Các hợp chất CrO. B. + (5) X4 + NaOH → X6  + NaNO3. Fe2(SO4)3. X2. Na2CrO4. Số phản ứng thuộc loại oxi hoá. 4. 6. 8. 3. Cr2O3. 4. Cr(OH)2 tác dụng được với dung dịch HCl còn CrO 3 tác dụng được với dung dịch NaOH. 5. 3. Câu 7. màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. Na2Cr2O7. 3. 4. (2) X1 + HNO3 → X4 + NO2 + H2O. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy.88 V. Cr(OH)3. Cr2O3. Fe(NO3)3. A. Cr2O3. Fe(OH) 2.67 Cho các sơ đồ phản ứng : (1) X1 + HCl → X2 + H2. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước. 7. Câu 7. 5. b. Kim loại crom có thể cắt được thuỷ tinh.68 Cho sơ đồ phản ứng : Cr + Sn2+  → Cr3+ + Sn (1) Cr + Cu2+  → Cr3+ + Cu (2) a. KCr2O4. Crom là kim loại có tính khử mạnh hơn sắt. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ. D. 2. Biết 0 ECr 3+ / Cr = −0.khử là A. 3. C. 2. (3) X2 + Cl2 → X3. B. B. X3. K2Cr2O7.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. 8. B. Na2Cr2O7. 2. K2CrO4. Nếu thêm vào đó một lượng H 2SO4. D. hệ số của ion Cr3+ sẽ là A. 1. 3. CrO. 2. FeO. Cr2O3. X4. C. C. C. 1. 6. D. 7. 5. -0. X6 lần lượt là X1 A B C D Cu Fe Fe Fe X2 CuCl FeCl2 FeCl3 Fe(NO3)3 X3 CuCl2 FeCl3 FeC2 FeCl3 X4 Cu(NO3)2 Fe(NO3)3 Fe(NO3)3 Fe(NO3)2 X5 CuOH Fe(OH)2 Fe(OH)2 Fe(OH)3 X6 Cu(OH)2 Fe(OH)3 Fe(OH)3 Fe(OH)2 Câu 7. Công thức phân tử các chất A. FeSO4. chất B tác dụng với axit chuyển thành chất C có màu da cam. D. B. (4) X2 + NaOH → X5  NaCl. Câu 7.66 Dung dịch X có màu đỏ cam. 8. Nếu cho thêm vào một lượng KOH. 0. 7. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1). 5. Suất điện động chuẩn của pin điện hoá là A. Cr(OH)2 đều có tính chất lưỡng tính. 7.3. K2CrO4. 6. K2Cr2O7. 100 . Fe3O4. Dung dịch X chứa chất có công thức phân tử là A. FeCO3 lần lượt phản ứng với HNO3 đặc nóng. H2CrO4. C. K2Cr2O7. 6.

b. 2 tấn. C.2 tấn. B.00075 mol.9g.4 V. Câu 7. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M.82 tấn. 11.272g.1g. 74g. Câu 7. 5. -0. 1. Cho dần dần mạt sắt đến dư vào phương trình trên. rửa nhẹ. D.4 V.5 tấn. đem cân thấy lá kẽm có khối lượng là A. 0. B. C.28 tấn. B. -0. 0. 0. 139. Biết 20 cm3 dung dịch này được axit hoá bằng H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0.02625g.71 Khối lượng quặng chứa 92. D. 2. Giảm 1. rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0. 0.725 M. Câu 7. D.00375 mol. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là A.9g. 21%. D. 57%. 0. Đáp số khác. 3.432 M.0075 mol.5%) là : A. Đáp số khác. B. Câu 7. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu : A. Đáp số khác.856g. 74 V. B. 0. Đáp số khác.68g. B. 101 .8 tấn. c. 1. Phần trăm theo khối lượng FeSO4 tinh khiết là A. D. -0. Đáp số khác. Đáp án khác. 0.1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%) A. a. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0.8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87.08 V. a. 2. 12. C. D. Sau phản ứng. C. sấy khô. D. B. C. Nếu lấy quặng hematit trên đem luyện gang. 0. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ? A. được 200 cm3 dung dịch. c. 0. 0. được 500 ml dung dịch. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là A. C.856g.8 V. B. 16. 90g. lấy lá kẽm ra khỏi dung dịch. D. D. C.3265 tấn.5H2O trong nước. Câu 7. 0. B.72. C. D. b.4 tấn.69 Hoà tan 58g muối CuSO4.73.88 V. Suất điện động chuẩn của pin điện hoá là A. 1.7%. C.03 M.5 tấn. 1.464 M.C.6 V. a. Biết 0 ECr 3+ / Cr = −0. D. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2). 6 tấn. 113. Tăng 1. Tăng 22.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước. C.03M là A.21g. B. b.

Giá trị của m là A.80. 9. Tỉ lệ là m2 A.77.4g chất rắn X. Cho 23.8g. 1M. kẽm tác dụng với oxi dư nung nóng thu được 46. Giá trị của V (ở đktc) là A. D.72 lít khí (có màu nâu đỏ) duy nhất (đktc). 400ml. khối lượng chất rắn thu được giảm 4. 2.24 lít khí NO duy nhất (đktc). C.27. C. 20. Giá trị m và nồng độ dung dịch HNO3 lần lượt là A. B.88g.22g hỗn hợp X gồm Fe. 2.68 lít. B. Ni. khí CO 2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH) 2 thu được m2g kết tủa trắng.81. C. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư. 10. 2.7. 1: 4.5g. 8.5H2O cho m1 vào m2g dung dịch CuSO4 8%. Câu 7. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6.22. D. 1: 6. Fe3O4) với số mol bằng nhau. 300ml. Hoà tan hoàn toàn 3. C. CuO. Fe2O3. 12. C.52. B. 2.44g. 2. Giá trị của m là A. 10.08g. B. Câu 7. 5. Cho 40g hỗn hợp vàng. 200ml. 5.12 lít.2g gồm Fe. Câu 7. Cr. 20. C.44g.685g. B.84 lít.32. PbO bằng khí CO ở nhiệt độ cao. D. 1: 3.25. 102 .08g. 6. 10.685g D.6M. 10. Fe3O4. thoát ra 0.2 mol FeS2 và 0.3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất).344 lít hiđro (đktc) và dung dịch chứa m g muối. Câu 7. 10. D. 56 lít.78. Pb.04g. 1. B. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2. Câu 7. thu được 3g hỗn hợp chất rắn X. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19. 1. B. C.36 lít. Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng. Kim loại X là A. Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là A. 100ml. 10.24 lít. B. Nung m g bột sắt trong oxi.74. Thể tích khí CO phản ứng (đktc) là A. Hoà tan hết hỗn hợp gồm 0. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư). 20. Tính khối lượng m1.76. D.88g. D. 20. C. Lấy m1g X cho vào một ống sứ chịu nhiệt. sắt. thu được 1. FeO và Fe2O3.75.2M. Khử 16g hỗn hợp các oxit kim loại FeO. m2. D.56 lít (đktc) NO (là sản phẩm khử duy nhất). B. Câu 7. 127. FeO. Câu 7. D.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3.5g. 3. 63. 7. 10. A. Sn.768 lít. bạc. đồng.62.8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+.52.04g. nung nóng rồi cho một luồng khí CO đi qua.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4.5M. 1: 5. B. Câu 7.98.72 lít. 3. 0.

025 mol. 8. Bari D.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy). 0. 0. C. 16. A.85g kết tủa.016 lít khí (đktc). dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH) 2 0.6)g oxit.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại.84 Để mg phoi bào sắt (X) ngoài không khí. 4. 4.00g.85 Cho 4.3g. 1.02g. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15. 0. 3. Beri Câu 7. 4. C. Al. Fe2O3.91 Hoà tan hết 5.15 mol.36 lít. 0.74g. Công thức của sắt oxit là A.5M và KNO3 0.1M. Giá trị của m là A. Câu 7.86 Cho 19. A.Câu 7. B.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy).18g. 0. 11.1M. HBr) thì thể tích H2 (đktc) thu được là A.04g.26g Câu 7. B. 2. C.2g B. B.25g muối khan. Canxi B. HCl.075 mol.688 lít.00g.36 lít khí SO2 duy nhất (đktc).85g muối clorua khan.48 lít.64g D.136 lít khí (đktc) và m g muối sunfat. 15. B.36 lít.2g Cu vào 1 lít dung dịch gồm H2SO4 0. Fe3O4.48 lít. 1. Mg. FeO. 32. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0. C. C. Magie C. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7. Câu 7. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16. 5.72g hỗn hợp kim loại gồm Mg.56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2.62g chất rắn. D. 5. 18. C. 3.24 lít.24 lít. D. Số mol khí CO2 thu được là A.16g.2g. thu được 9.92 Hoà tan hết 1. 5.7g muối khan.05 mol. Câu 7. 103 . 19.12 lít. 1. thu được 5g kết tủa. thu được V lít khí (đktc) và 3.1g. 7. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4. Câu 7. Zn. Câu 7. C.1M.344 lít. m có giá trị là A. D. Al) bằng oxi thu được (m +1. 2. C. C. 1. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0. B. A.08g. 0.6g. X là A.3g hỗn hợp kim loại gồm Mg. B. m nhận giá trị bằng A.76g kết tủa trắng. 10. D. 6. Câu 7.448 lít.2M. Chưa đủ dữ kiện để xác định. D. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3.12 lít.0g C. Thể tích khí NO duy nhất thu được ở đktc là .224 lít. thu được 5g kết tủa. B. Câu 7. 2. thu được 3. Tính khối lượng m của X. Mặt khác. 8. Fe3O4.05 và 0.9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao. Fe2O3. V nhận giá trị bằng A.83 Đốt cháy hết mg hỗn hợp A gồm (Zn. D. Al và Fe bằng dung dịch H 2SO4 loãng. D. sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO.89 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt. 19. Zn và Fe bằng dung dịch HCl.05 và 0.

28 D 7. Khử hoàn toàn 4.19 C 7. Kết quả khác. C. Chưa thể xác định.03. 5 g. b/7 7. Hoà tan X bằng dung lịch HNO3 loãng. C.2g.9g chất rắn khan.4 7. thu được 46. 1. Khi cô cạn dung dịch. D.93.81g hỗn hợp các oxit Fe3O4.4g. Fe2O3. D. C.8g bột sắt ngoài không khí. Fe3O4. B. Giá trị m là A. 24g.016 lít H2 (đktc).102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian.26 A 7. Câu 7. Câu 7. D.375g.48g. B.02. 6. Zn tan hết trong dung dịch HCl thì thu được 1. Cho 2. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0.24 A 104 . A.27 A 7.94.16g.2 B 7.4 B 7.Câu 7. 0.12 khí (đktc) và dung dịch X. 3. Câu 7.21 D 7.8g một oxit của kim loại M thành kim loại cần 2.3g.45g. B. Câu 7. dư. 1.3 . D.30 C 7. B.0336 lít.016g hỗn hợp các oxit sắt (hỗn hợp X). thu được mg kết tủa Z. Câu 7. D.72g.3 và y = 0.448 lít khí NO duy nhất.525g. SO42.96.0224 lít.5 g.x mol.336 lít.84g Fe và 0. m có giá trị là A.15 B 7.22 C 7. 1.88g khí CO2. C.18 D 7. 5. Cô cạn x thu được m g muối.23 C 7. sau một thời gian thu được 13. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0. 5.7 C 7.792g hỗn hợp bột gồm Fe và Cu ta thu được 1. 26g.5g. 0. 8.13 7. B. C.2 mol và 2 anion Cl.6 C 7. 10 g. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5. FeO. D.2 và y = 0.25 C 7.336 lít.5 B 7. 0.20 C 7.y mol.1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ? A. Oxit khác. MgO. 0.101 Oxi hoá hoàn toàn 0. 8g. 22g.11 B 7.29 A 7.21g . 5. 3. Câu 7.02 và y = 0. B. b/6 c/1. C.3 B 7. D.8 D 7.2g. Al3+ 0. 0. Al. m có giá trị là A.99 Cho CO qua ống sứ chứa 15. x = 0. Tính a ? A. 4. Không xác định được.344 lít H2.896 lít. C. D. người ta thu được 6.032g hỗn hợp các oxit (hỗn hợp X). Câu 7. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VII 7. 5. B. và sắt dư.16 B 7. C.728g bột Fe ta thu được 1. 20g. x = 0. Sục Y vào dung dịch nước vôi trong có dư. x = 0. x = 0. Fe2O3.1 B 7.4256 lít. Tìm công thức của oxit. D. B. 0.14 C a/1.100 Oxi hoá hoàn toàn 0. sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt. 7.75g hỗn hợp gồm 3 kim loại Fe. 0.896 lít. FeO nung nóng.672 lít.6 lít SO2 (đktc). B.1 mol.95. Một dung dịch có chứa 2 cation là Fe2+ 0. Câu 7.03 và y = 0. Câu 7. 0.12 D 7. C. 7. Giá trị của m là A.9 A 7.72g hỗn hợp gồm 4 chất rắn khác nhau. Kim loại thu được đem hoà tan hết bằng dung dịch H 2SO4 loãng thấy tạo ra 1. x và y có giá trị là A. C. CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0.98.17 a/2. Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là A.10 D 7. Thể tích khí NO duy nhất bay ra (ở đktc) là A.2g hỗn hợp CuO.2.6g rắn X và hỗn hợp khí Y. D. B. Nung nóng 16.97 Cho 1.8g.

a B 7.69.64 D 7.41 D 7.37 A 7.68.45 D 7.42 B 7.87 C 7.79 D 7.97 C 7.03(mol) − 3Cu + 2NO3 + 8H 0.43 D 7.76 A 7.a A 7.b C 7.85 A 7.b B 7.47 B 7.93 C 7.77 C 7.91 C 7.b C 7.7.96 C 7.70.50 B 7.39 A 7.71 B 7.56 A 7.90 A 7.70.49 D 7.46 C 7.83 B 7.101 D 7.72.016(mol) 105 .68.95 C 7.54 B 7.40 A 7.61 B 7.75 A 7.62 D 7.69.84 D 7.016(mol) 0.102 C 7.52 B 7.81 C 7.86 C 7.38 B 7.a B 7.67 B 7.55 C 7.100 D 7.66 A 7.94 C 0.70.65 B 7.80 A 7.36 C 7.60 A 7.68.82 A 7.a A 7.58 A 7.99 A + 7.92 B 7.59 D 7.32 B 7.34 A 7.c B 7.74 D 7.b C 7.63 A 7.08(mol) → 3Cu 2+ + 2NO + H2 O.48 B 7.88 B 7.73 A 7.35 B 7.31 B 7. 0.51 B 7.53 B 7.78 B 7.57 A 7.89 C 7.98 B 7.44 B 7.72.c B 7.33 C 7.

3NaNO2 + H2SO4 (l) → Na2SO4+NaNO3+2NO↑+H2O H2SO4 (l) + O2 KK to. Nhận biết một số anion Tt Anion Thuốc thử Dấu hiệu 1 OH– Quỳ tím Hoá xanh SO32– HSO3– + 2 H CO32– HCO3– SiO32– 3 SO42– Ba2+ 4 S2– Cl– Ag+ Br– I– 5 PO43– 6 NO3 – Phương trình phản ứng SO32– + 2HCl → SO2 + H2O CO32– + 2HCl → 2Cl– + CO2 SO2 làm mất màu dung dịch KMnO4 CO2 làm vẩn đục dung dịch Ca(OH)2 trong SiO32– + 2HCl → H2SiO3 + 2Cl– Ba2+ + SO42– → BaSO4↓ 2Ag+ + S2– → Ag2S↓ ↑ SO2 ↑ CO2 Ag+ 7 ClO3– 8 NO2– H2SO4 loãng. ↓ keo trắng ↓ trắng ↓ đen ↓trắng vàng nhạt Ag+ + X– → AgX↓ vàng ↓ vàng (tan 3Ag+ + PO43– → Ag3PO4↓ trong HNO3) (↑) nâu NO2 3Cu+8H++2NO3–→2Cu2++2NO+4H2O dung dịch Cu2+ (2NO + O2 → 2NO2) xanh 106 .CHƯƠNG VIII.t. vụn Cu Cô cạn. không ↑ NO2 nâu NO  NO2↑ (nâu) → khí Dùng phân biệt NO2– và NO3– (vì NO3– không có phản ứng này). to O2↑ (que đóm t0 có MnO2 2KClO3  2KCl + 3O2↑ → bùng cháy) x.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. PHÂN BIỆT MỘT SỐ CHẤT VÔ CƠ & CHUẨN ĐỘ DUNG DỊCH A.

Ca2+ + SO42 → CaSO4↓ (it tan) − Ba2+ + SO42 → BaSO4↓ − Mg2+ + 2OH → Mg(OH)2↓ − 11 Fe3+ 12 NH4+ OH . còn Fe2+ làm KK 2 + OH − mất màu Fe     Fe OH2 → ( ) ↓    Fe OH3 đỏ↓nâu →( ) dd thuốc ↓ trắng xanh − 2+ + 2+ 3+ MnO4 + 5Fe + 8H → Mn + 5Fe + tím khi có + + 4H2O mặt H ).2. to − ↓ đỏ máu ↓ đỏ nâu NH3 ↑ khai. Nhận biết một số cation Stt ion 1 2 3 4 Li Na+ K+ Ca2+ + Thuốc thử Dấu hiệu Đốt trên ngọn lửa vô sắc − Phương trình phản ứng (phương pháp vật lí) 5 Ba2+ 6 Ca2+ 7 Ba2+ 8 Mg2+ SO42 9 Cu2+ 10 Fe2+ − 2+ OH 2 Cu + 2OH → Cu(OH) ↓ (riêng với Fe3+ đặc +2 NH + 2H O Cu 2+  Cu(OH)2 ↓ → trưng nhất −2NH là dùng ion 2+ +4NH  [ Cu(NH 3 )4 ] → −2OH thioxianat SCN-. tan ngay khi (OH–) dư dd H2S PbS ↓ đen − OH − 3  Cr 3+  Cr (OH )3 ↓   Cr ( OH )6 − → →     18 Pb 2+ (dd màu xanh) Pb + S → PbS↓ (màu đen) 2+ 2− 107 . − 3 4 + 2 3 - − Đỏ thẫm Vàng tươi Tím hồng Đỏ da cam Lục (hơi vàng) ↓ trắng ↓ trắng ↓ trắng ↓ xanh (nếu dùng dd NH3 thì tạo kết tủa xanh sau đó tan tạo ion phức màu xanh thẫm đặc trưng. làm xanh quỳ ẩm) Fe + 3SCN → Fe(SCN) ↓ đỏ máu − Fe3+ + 3OH → Fe(OH)3↓ đỏ nâu NH4+ + OH → NH3↑ + H2O +3OH Al3+  Al(OH)3 ↓ → + OH  [ Al(OH) 4 ] → - 3+ 3 − - 13 Al3+ − 14 Zn 2+ 15 Be2+ 16 Pb2+ 17 Cr 3+ OH từ từ đến dư − +2OH ↓ trắng tan Zn 2+  Zn(OH) 2 ↓ → ngay khi 2− + OH  [ Zn(OH) 4 ] → OH– dư + OH − Be2+  Be( OH )2 ↓  BeO 2 − → → 2 Pb2+ →Pb(OH)2↓ →PbO22 ↓ xanh.

3.1 Có 4 mẫu chất rắn màu trắng BaCO3.BÀI TẬP TRẮC NGHIỆM Câu 8. B. BaSO4. điện phân) để phân biệt chúng thì chất khí phải chọn là A.5H2O t CuO + H2  Cu↓ + H2O → 0 SO3 + H2O → H2SO4 H2SO4 + BaCl2 → BaSO4 + 2HCl B . nếu chỉ dùng H2O và một chất khí (không dùng nhiệt độ. Nhận biết một số chất khí Stt Khí 1 Cl2 2 I2 3 SO2 4 H2S 5 HCl 6 NH3 7 NO 8 NO2 9 CO 10 CO2 11 O2 12 Hơi H2O Thuốc thử Dung dịch (KI + hồ tinh bột) Hồ tinh bột Dấu hiệu Phương trình phản ứng Không màu Cl2 + 2KI → 2KCl+ I2 + I2 → hoá xanh (Hồ tinh bột) → xanh Không màu → hoá xanh SO2 + Br2 + 2H2O → 2HBr + H2SO4 5SO2+2KMnO4+ 2H2O → 2H2SO4+2MnSO4+K2SO4 Pb2+ + H2S → PbS↓ + 2H+ Ag+ + Cl– → AgCl↓ NH3 + H2O→ NH4OH NH3 + HCl → NH4Cl 2NO + O2 → 2NO2 3NO2 + H2O → 2HNO3 + NO dd Br2 hay Mất màu dd KMnO4 dung dịch dd Pb(NO3)2 dd AgNO3 Quỳ tím ẩm HCl (đậm đặc) Không khí Quỳ tím ẩm dd PdCl2 (hay + CuO đen) Cho ↓ đen Cho ↓ trắng Hoá xanh Tạo khói trắng Hoá nâu Hoá đỏ Tạo ↓ Pd CO + PdCl2 + H2O → (hoá đỏ Cu) Pd↓ + 2HCl + CO2↑ CO2 + Ca(OH)2 → CaCO3↓ + H2O t 2Cu + O2  2CuO → 0 ddCa(OH)2 Vẩn đục Cu (đỏ). NaHCO3. to Hoá đen CuO Trắng hoá xanh 13 H2 14 SO3 15 N2 CuSO4 khan CuO (đen) Hoá đỏ (Cu) to Dung dịch Kết tủa BaCl2 trắng BaSO4 (còn lại sau cùng) CuSO4 + 5H2O → CuSO4. 108 . CO2. Na2CO3. O3.

dd KOH Câu 8. đồng sunfat khan. Dung dịch AgNO3 và dd phenolphthalein.2 Có 4 lọ hoá chất bị mất nhãn đựng riêng biệt 4 dung dịch không màu sau đây: NH4Cl. vôi sống. Dùng 2 hoá chất nào trong các cặp hoá chất sau đây để có thể phân biệt được các dd trên? A. dd BaCl2. nguội. mỗi ống nghiệm chứa một trong các dd HCl. Dung dịch Ba(OH)2 và dd AgNO3. NaOH.11 Có 4 ống nghiệm bị mất nhãn. B. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. H2SO4. MgO. Câu 8. ta có thể dùng dd A. D. Câu 8. HCl. dd ammoniac. C. HCl. B. BaCl2. C. kali hiđroxit. C. B. dd PdCl2 và dd Br2.6 Có 5 dd đựng trong 5 lọ mất nhãn là FeCl3. Mg và Al 2O3. C. Câu 8. NaCl. CO2. B. D. quỳ tím. dd HNO3. dd HCl.3 Để loại bỏ Al ra khỏi hỗn hợp Al. axit sunfuric đặc. Giấy quỳ tím và dd Ba(OH)2. NH3. Quỳ tím. H2SO4 đặc nóng B. H2SO4 loãng. chỉ cần dùng duy nhất một dd là A. D. dd BaCl2 và dd Br2. dd HNO3 đặc. KCl.1M).4 Để phân biệt 3 khí CO. D. Cu(OH)2. Al. B. ta có thể dùng A. NaOH. BaCl2. C đều đúng. B. D. Na2CO3. NH4NO3. D. dd H2SO4 đặc nguội. thuốc thử được chọn là A. H2. SO2 ta có thể dùng thuốc thử là A. B.10 Để thu được Al(OH)3 từ hỗn hợp bột Al(OH)3. 109 . D. Câu 8. chỉ cần dùng một thuốc thử duy nhất là A. để nhận biết 4 chất lỏng trên. Nếu chỉ được dùng một thuốc thử để nhận biết 5 chất lỏng trên. P2O5. C. NaNO3. axit clo hiđric. Cả A. D. C.5 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. Câu 8. B. Câu 8. FeCl2. HNO3 . Fe3O4 và FeO người ta dùng A. dd KMnO4 và dd Br2 C. không thể thực hiện được. C.9 Để nhận biết 3 dd natri sunfat. D. NaOH. dd HCl.7 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là NaAlO2. Na2S. AgNO3.C. B. C. dd KOH. Có thể sử dụng thuốc thử nào sau đây đề phân biệt các lọ dung dịch trên? A.8 Để làm khô khí amoniac người ta dùng hoá chất là A. bari clorua. SO2. H2SO4 đặc nguội. B. Câu 8. C. CO2 và H2O. KNO3. NaCl. H2O D. Câu 8. CuO. Zn(OH)2. kali sunfit và nhôm sunfat (đều có nồng độ khoảng 0. AlCl3. Câu 8.

15 Cho các dd: AgNO3. Ag. giấy quỳ B. HNO3 đặc nguội. Fe. B.18 Có 4 chất rắn riêng biệt gồm natri cacbonat. B. Ba. D. Câu 8.19 Dung dịch X có chứa các ion: NH4+. B. dd NaOH. đá vôi. C đều đúng Câu 8. Ba.ta nên dùng thuốc thử là A. Câu 8. B. Br2 (Hơi) C. C. Fe3+. người ta ngâm mẫu bạc này vào một lượng dư dd A. Câu 8. Chỉ dùng thêm một hoá chất bên ngoài là dd H2SO4 loãng có thể nhận biết được tối đa bao nhiêu kim loại trong các dãy sau? A. dd FeCl2. B. dd BaCl2. dd HCl.D. C. Al. cả 4 dung dịch. D.trong dd chứa các ion: NH4+. Câu 8. Cu và vài giọt dd H2SO4đặc. Câu 8. Kết luận đúng là A. vì Fe2+ và Fe3+ khi tác dụng với kiềm tạo kết tủa có màu sắc khác nhau. CO2 B. chỉ 2 trong 4 dung dịch. X là A. Một học sinh dùng các hoá chất dd NaOH. Fe2+. C. Mg. Chỉ dùng H2O và một khí X có thể phân biệt được cả 4 chất. Ag. Mg. Cl2 D.17 Để làm khô khí H2S. Ag. cả 3 dung dịch. chỉ một trong 4 dung dịch. dd AgNO3. C. H2SO4 đặc nguội. Fe. H2SO4 loãng. dd NaOH. AgNO3. tuỳ thuộc vào trật tự tiến hành các thí nghiệm. NO3-. B. Mg. D. Cu để chứng minh sự có mặt của các ion trong X. D. Dung dịch kiềm. HCl. 110 . Ba. dd H2SO4. đun nóng. Ca(OH)2. Ba.12 Để chứng tỏ sự có mặt của ion NO3. H2O. CaO. Fe3+. B. Fe. Al. C. Có thể nhận biết 3 lọ trên bằng 1 thuốc thử duy nhất là A. CuSO4 khan. P2O5. Fe. ta có thể dùng A. C.14 Có 3 lọ đựng 3 chất bột riêng biệt: Al.13 Để loại bỏ tạp chất Fe. Fe. Ag. Cả A. D.16 Có 5 mẫu kim loại Ba. C. Ag. D. Cu có trong mẫu Ag và không làm thay đổi lượng Ag.2H2O). Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Câu 8. Giấy quỳ tím và dd AgNO3. HCl. NO3. FeCl3 Câu 8. Al2O3. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Để phân biệt 2 kim loại Al và Ag cần phải dùng A. natri sunfat và thạch cao sống (CaSO4.

Fe(NO3)2. (3). giấy quỳ tím sau. Câu 8. (4) mẩu Cu(OH)2. MgSO4. dd muối Sắt(II) dư. Ba(OH)2. MgCl2. dd NH4Cl. Fe với khối lượng Ag không đổi. dd AlCl3. (3) mẩu bông tẩm dd HCl đặc. (NH4)2SO4. B. C. NaNO3. C. (4). C. (3). D.20 Có 4 ống nghiệm mất nhãn. Al(NO3)3. B. Có thể dùng thuốc thử nào sau đây để nhận biết chúng? A. (2). HNO 3. 111 . D. CO2 là: (1) dùng mẩu giấy quỳ tím ướt.23 Một học sinh đề nghị các cách để nhận ra lọ chứa khí NH3 lẫn trong các lọ riêng biệt chứa các khí N2. (3) nước cất có vài giọt quỳ tím. NaCl. Câu 8. (3). AgNO3 sau. Ca(NO3)2. B.21 Để nhận biết trong thành phần của khí nitơ có lẫn tạp chất hiđroclorua. B. NaNO3. BaCl2. D.D. C. C. NaOH. (1). CaCl2. Cl2. D. (1). Quỳ tím. D. Fe(NO3)3.24 Để thu được Al2O3 từ hỗn hợp bột Al2O3 và CuO mà khối lượng Al2O3 không thay đổi. Fe(NO3)3. chỉ (1). (3). FeCl2 thì chọn thuốc thử là A. MgCl2. dd muối sắt(III) dư. (1). C đều đúng. dùng giấy quỳ tím trước. (5). AgNO3. Hoá chất cần dùng và thứ tự thực hiện để nhận biết các chất đó là A. H2SO4 (loãng). Các cách đúng là A. BaCl2. có thể dùng chất nào sau đây? A. (4).28 Chỉ dùng Na2CO3 có thể phân biệt được mỗi dd trong dãy dd nào sau đây? A. Học sinh đó không chứng minh được sự tồn tại của Fe 2+ và Fe3+ vì chúng đều tạo kết tủa với kiềm. (3).27 Có 3 lọ mất nhãn chứa 3 dd riêng biệt HCl. Câu 8. Phương pháp đúng là A. MgCl2. chỉ dùng AgNO3. dd CuCl2 dư. dd phenolphthalein. (2). NaCl. D. Câu 8.22 Thuốc thử duy nhất dùng để nhận biết NH4NO3.26 Tách Ag ra khỏi hỗn hợp bột gồm Ag. KNO3. Câu 8. (3). Câu 8. dd AgNO3 dư. B. C. Câu 8. Fe(NO3)3 và Cu(NO3)2 là A. chỉ cần dùng một hoá chất là A. O2. B. (1). (1). (2) mẩu bông tẩm nước. (4). (2). dd HCl. Câu 8. dd NaOH. NaCl. C. NaOH. (2) dd NaOH. D. Cu. MgCl2. Mg(NO3)2. Al. B. mỗi ống đựng 1 dd Na2CO3. cả A. dd NH3. Ba(NO3)2. C. Na2CO3. (1). D.25 Chỉ dùng một dd làm thuốc thử để nhận biết các dd muối sau: Al(NO3)3. NaAlO2. (3). C đều được. (2). (4) nước vôi trong. Câu 8. (5) mẩu AgCl. ta có thể dẫn khí qua: (1) dd bạc nitrat. B. Cả A. C. B. HCl. NH4NO3. dùng AgNO3 trước. B. AlCl3. (1). D. (5).

D. Ba.31 Chỉ có giấy màu ẩm. Câu 8. O2. chỉ cần dùng dd A. NH4NO3. Câu 8. dd H2SO4 loãng. Mg. X là muối CuSO4. D. HNO3 đặc nguội. khí (3) là Cl2. Ba(OH)2. N2. K. C. NH4Cl. dd NaOH loãng và dd HCl. CO2. dd Ba(OH)2. H2O. H2S và Cl2 do có hiện tượng: khí (1) làm tàn lửa cháy bùng lên. X là muối CuSO4. dd NaOH. C. dd H2SO4 đặc nguội. AgNO3. Câu 8. NH3. 112 . khí (2) làm mất màu của giấy. B. B.35 Chỉ dùng một thuốc thử duy nhất nào sau đây để phân biệt hai khí SO2 và CO2? A.36 Chỉ dùng H2O có thể phân biệt được các chất trong dãy A. dd AgNO3 vừa đủ. Cl2. Na. Câu 8. khí còn lại là N2. C. quỳ tím ẩm. dd HCl. kẽm sunfat. K2SO4. C. AgNO3. dd HCl. D. D. D. Ba. Thuốc thử có thể dùng để nhận biết ba dd trên đơn giản nhất là A. KOH. khí (1) là O2.34 Có 5 lọ đựng riêng biệt các khí sau: N2. dd Ba(NO3)2 vừa đủ. K. Câu 8. Để xác định lọ đựng khí NH3 chỉ cần dùng thuốc thử duy nhất là A. Câu 8. D. B. NH4Cl.29 Để thu được Ag tinh khiết từ hỗn hợp bột Ag-Fe. D. kali sunfit. D. Câu 8. ta dùng A. NH4Cl. C. NH4Cl. dd Br2. dd NaOH đặc nóng và CO2. CuSO4. B. dd NaOH loãng và CO2. dd Ba(OH)2.30 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là (NH4)2SO4. giấy quỳ tím. dd Ca(OH)2 . dd Ca(OH)2 vừa đủ. B. và giấy tẩm dd muối X người ta có thể phân biệt 4 lọ chứa khí riêng biệt O2. SiO2 dùng cho sản xuất Al người ta dùng chất nào trong số các chất sau đây là tốt nhất? A. dd BaCl2. Ca mà khối lượng Al không thay đổi (giả sử phản ứng của Mg. FeCl3. B. nguội không thay đổi đáng kể nồng độ và không sinh nhiệt)? A. Ca với axit H2SO4 đặc. Câu 8. NH4NO3.33 Để loại được H2SO4 có lẫn trong dd HNO3. khí (1) là O2. dd NaOH. khí (3) làm giấy có tẩm dd muối X hoá đen. người ta dùng dư hoá chất nào sau đây? A. B. B đều đúng. D. dd NaOH đặc nóng và HCl. (NH4)2SO4. C. khí (2) là Cl2. C.32 Có ba dd kali clorua. NaOH. dd H2SO4.Câu 8. lửa. BaCl2. dd HClđặc. Câu 8. cả A. Na. C. (NH4)2SO4. X là muối Pb(NO3)2. C. D. Na. Na.37 Chỉ dùng duy nhất một dd nào sau đây để tách lấy riêng Al ra khỏi hỗn hợp Al. B. B. để nhận biết 4 chất lỏng trên. NH4NO3. Kết luận sai là A. C.38 Để làm sạch quặng boxit thường có lẫn Fe2O3.B.

Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên.1 B 8. chì clorua.20 D 8. NaOH và O2. AgNO3. NH3.28 D 8. Câu 8. cả A. dd HCl.5 D 8.Câu 8. HCl. dd HNO3 đặc. Mg(NO3)2.14 8.29 B 8. natri hiđroxit. C. Na2CO3. BaCO3. 1.4 A 8.40 Đốt cháy Fe trong clo dư thu được chất X. KOH ta có thể …”. D. Mg và Al 2O3. H2SO4 thì chọn A. dd CH3COOAg. nguội. C. A.3 C 8. D.41 Để nhận biết 4 dd: Na2SO4. dd KOH. B. chỉ cần dùng một chất duy nhất là A.25 B 8. B. dd H2SO4 và dd AgNO3.45 Nếu chỉ dùng một thuốc thử duy nhất để phân biệt 3 dd NaOH.27 D A 113 . B. quỳ tím. C.10 A 8.12 D 8. B.39 Cho các dd: FeCl3. dd NaOH.42 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. FeCl2.11 D 8. D. Zn. D. C đều đúng. BaCl2. Al.24 C C 8. dd BaCl2. không cần dùng bất kể hoá chất nào. H2O.21 C 8. Thuốc thử để phân biệt các dd đó là A. H2SO4.23 C 8.30 A 8. thuốc thử được chọn là A. D. chỉ cần dùng giấy quỳ tím. NaNO3.22 D 8. Câu 8. CuSO4. dd HNO3 và dd Ba(OH)2. dd H2SO4 và dd BaCl2.26 C 8.43 “Để phân biệt các dd riêng biệt gồm NaCl.6 C 8. B. H2SO4. Số dd không hoà tan được đồng kim loại là A. Để xác định thành phần cấu tạo và hoá trị các nguyên tố trong X. C.13 D 8. Câu 8.8 A 8. và hỗn hợp NaNO3 và KHSO4.17 8. Hãy chọn đáp án để nối thêm vào phần còn trống sao cho kết luận trên luôn đúng. Câu 8. Câu 8. B. Y có thể dùng hoá chất nào sau đây? A.19 C 8. chỉ cần Fe kim loại.9 B 8. B.2 B 8. dd HCl. axit sunfuric. C.44 Có các dd Al(NO3)3.7 A 8. quỳ tím Câu 8. 2. D.15 A 8.16 B 8. LiNO3 (đều có nồng độ khoảng 0. 3. 4.1M) bị mất nhãn.18 D 8. bari hiđroxit. K2CO3. C. C. nung sắt với lưu huỳnh thu được chất Y. D. B. BaCl2. ĐÁP ÁN 8.

44 B 8. * Hoá học đã góp phần giải quyết vấn đề về vật liệu như thế nào? . năng lượng mặt trời. Vấn đề năng lượng và nhiên liệu * Vấn đề về năng lượng và về nhiên liệu đang đặt ra cho nhân loại hiện nay là : . 2.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. MÔI TRƯỜNG A.45 D 8. .Vật liệu có nguồn gốc hữu cơ. . * Hoá học đã góp phần giải quyết vấn đề năng lượng và nhiên liệu như thế nào trong hiện tại và tương lai? Hoá học đã nghiên cứu góp phần sản xuất và sử dụng nguồn nhiên liệu.35 C 8.Năng lượng thuỷ điện. .37 A 8. nhu cầu của nhân loại về các vật liệu mới với những tính năng vật lí và hoá học. nhiên liệu hoá thạch như dầu mỏ.Điều chế etanol từ crackinh dầu mỏ để thay thế xăng.41 B 8. .43 A 8. .Khai thác và sử dụng năng lượng hoá thạch còn là một trong những nguyên nhân chủ yếu gây nên ô nhiễm môi trường và làm thay đổi khí hậu toàn cầu. . .33 A 8. sinh học mới ngày càng cao.36 A 8.40 B CHƯƠNG IX.31 B 8. Vấn đề vật liệu * Vấn đề về vật liệu đang đặt ra cho nhân loại là gì ? Cùng với sự phát triển của các ngành kinh tế và khoa học kĩ thuật. . năng lượng gió. khí tự nhiên… không phải là vô tận mà có giới hạn và ngày càng cạn kiệt.Vật liệu có nguồn gốc vô cơ.Các nguồn năng lượng.Sản xuất ra chất thay cho xăng từ nguồn nguyên liệu vô tận là không khí và nước. Như : . XÃ HỘI.42 D 8. năng lượng thuỷ triều… .34 A 8.Điều chế khí metan trong lò biogaz. dầu.Năng lượng điện hoá trong pin điện hoá hoặc acquy. năng lượng nhân tạo thay thế.Sản xuất khí than khô và khí than ướt từ than đá và nước.32 C 8. than đá.39 C 8.8. năng lượng địa nhiệt.Vật liệu mới: 114 .Năng lượng được sản sinh ra trong các lò phản ứng hạt nhân được sử dụng cho mục đích hoà bình. HOÁ HỌC VÀ VẤN ĐỀ PHÁT TRIỂN KINH TẾ.38 D 8.

* Hoá học đã góp phần giải quyết vấn đề về lương thực. 4. . . hợp thời trang.Tổng hợp hoá chất có tác dụng diệt trừ cỏ dại. . vì vậy tơ sợi tự nhiên không thể đáp ứng đủ nhu cầu về số lượng cũng như chất lượng.Vật liệu compozit.Nhu cầu của con người không chỉ mặc ấm. chất ma tuý và cách phòng chống ma tuý (dưới dạng những viên thuốc tân dược. viên để uống. mà còn mặc đẹp. thực phẩm cho nhân loại như : nghiên cứu và sản xuất các chất hoá học có tác dụng bảo vệ. động vật: . nạn dịch của thế kỉ. . . bột trắng dùng để hít.Dân số thế giới gia tăng không ngừng.Vật liệu nano (còn gọi là vật liệu nanomet) . Hoá học và vấn đề sức khỏe con người * Dược phẩm .. . 3.Nghiên cứu ra các loại vacxin.Góp phần nghiên cứu thành phần hoá học của một số dược liệu tự nhiên. * Chất gây nghiện.Vật liệu quang điện tử.Thuốc tránh thai.Tổng hợp hoá chất diệt nấm bệnh. thực phẩm đang đặt ra thách thức lớn cho nhân loại hiện nay . Hoá học và vấn đề thực phẩm * Vấn đề lương thực. . 115 .Thuốc bổ dưỡng cơ thể.Sản xuất những hoá chất bảo quản lương thực và thực phẩm. * Hoá học góp phần giải quyết vấn đề may mặc của nhân loại như : .… .Nghiên cứu chế biến thức ăn tổng hợp.Các vật liệu cơ bản để chế tạo các thiết bị chuyên dụng trong các nhà máy dệt và trong ngành dệt may. .Dân số thế giới ngày càng tăng. Hoá học và vấn đề may mặc * Vấn đề may mặc đang đặt ra cho nhân loại hiện nay là : . .Sản xuất nhiều loại phẩm nhuộm. .Phòng chống những căn bệnh. . 4. .Góp phần sản xuất ra tơ.Diện tích trồng trọt ngày càng bị thu hẹp. phát triển thực vật. .Sản xuất các loại phân bón hoá học. sợi hoá học có nhiều ưu điểm nổi bật.Vấn đề vi phạm vệ sinh an toàn thực phẩm. dung dịch để tiêm chích).

gây thay đổi khí hậu toàn cầu. màu sắc. Xăng. 4. rối loạn tuần hoàn. như rối loạn tiêu hoá. dầu. . rối loạn chức năng thần kinh. B. hô hấp. không khí dựa trên cơ sở khoa học hoá học có kết hợp với khoa học vật lí và sinh học.2.… một số vi khuẩn gây bệnh. các chất phóng xạ. Thu khí metan từ khí bùn ao. C.… * Ô nhiễm nước Nước ô nhiễm thường có chứa các chất thải hữu cơ.BÀI TẬP TRẮC NGHIỆM Câu 9. thí dụ CO. sắc kí.… b) Xác định chất ô nhiễm bằng các thuốc thử. làm diệt vong một số loại sinh vật. nước.1. Than đá.. 116 . máy đo pH. NH3. chất độc hoá học.Nghiện ma tuý sẽ dẫn đến rối loạn tâm. SO2. CH4 và một số khí độc khác. mưa axit. . các chất dinh dưỡng thực vật. B. hiệu ứng nhà kính. nước) gây suy giảm sức khỏe của con người. Người ta đã sản xuất khí metan thay thế một phần cho nguồn nguyên liệu hoá thạch bằng cách nào sau đây ? A. Khí hiđro. HCl. các vi sinh vật gây bệnh. c) Bằng dụng cụ đo : nhiệt kế. sinh lí. sử dụng chúng như là một loại thuốc chữa bệnh.… * Ô nhiễm môi trường đất Đất bị ô nhiễm có chứa độc tố. B. chất có hại cho cây trồng vượt quá nồng độ được quy định.… Thí dụ : hiện tượng thủng tầng ôzôn. bụi. đất. Tiêm chích ma tuý có thể gây trụy tim mạch dễ dẫn đến tử vong. Hoá học và vấn đề ô nhiễm môi trường Tác hại của ô nhiễm môi trường (không khí. Khí butan (gaz) D. * Vai trò của hoá học trong việc xử lí chất ô nhiễm Xử lí ô nhiễm đất. … * Ô nhiễm không khí Không khí bị ô nhiễm thường có chứa quá mức cho phép nồng độ các khí CO2. Câu 9. các chất hữu cơ tổng hợp.Luôn nói không với ma tuý. Lên men các chất thải hữu cơ như phân gia súc trong lò biogaz. các hoá chất vô cơ. * Nhận biết môi trường bị ô nhiễm a) Quan sát qua mùi.Hoá học đã nghiên cứu ma tuý. Nhiên liệu nào sau đây thuộc loại nhiên liệu sạch đang được nghiên cứu sử dụng thay thế một số nhiên liệu khác gây ô nhiễm môi trường ? A.

sắt…quá mức cho phép. nước đá. Nước ruộng lúa chứa khoảng 1% thuốc trừ sâu và phân bón hoá học. B. Seđuxen. Dùng fomon. 20% O2. D. chứa các ion : Cu2+. 18% O2. Trường hợp nào sau đây được coi là nước không bị ô nhiễm ? A. Cách bảo quản thực phẩm (thịt. Nước từ các nhà máy nước hoặc nước giếng khoan không chứa các độc tố như asen. Fe3+. 6% hỗn hợp CO2. D. Câu 9. C. Không khí chứa 78% N2. Cho hơi nước đi qua than nóng đỏ trong lò. dùng nước đá khô. Năng lượng mặt trời. Không khí chứa 78% N2. H2O. Etanol. Câu 9. fomon. Không khí chứa 78% N2. Câu 9.9. H2. Panadol. Câu 9. Nước thải từ các bệnh viện. H2.C. Năng lượng thuỷ điện.7. Dùng phân đạm. B. D. Dùng nước đá hay ướp muối rồi sấy khô. Nước vôi dư. B. 21% O2. Pb2+. CH4. nước đá.5. H2. B. D. SO2. H2O. moocphin. Hg2+…Dùng chất nào sau đây để xử lí sơ bộ các chất thải trên ? A. Một trong những hướng con người đã nghiên cứu để tạo ra nguồn năng lượng nhân tạo to lớn để sử dụng cho mục đích hoà bình. CH4 và bụi. C. H2O.4. đó là : A. 117 .3. HCl. Không khí chứa 78% N2. Giấm ăn. Lên men ngũ cốc. Penixilin. C. HNO3. C. 16% O2. Amoxilin. Hg2+. Câu 9. C. khu vệ sinh chứa các khuẩn gây bệnh. Loại thuốc nào sau đây thuộc loại gây nghiện cho con người ? A. 1% hỗn hợp CO2. Thuốc cảm Pamin. Năng lượng gió. Câu 9. cá…) bằng cách nào sau đây được coi là an toàn ? A. 4% hỗn hợp CO2. Zn2+. Trường hợp nào sau đây được coi là không khí sạch ? A. Vitamin C. NH3. Cd2+. D.8. Nước thải nhà máy có chứa nồng độ lớn các ion kim loại nặng như Pb2+. Ni2+. D. Năng lượng hạt nhân. D. Sau bài thực hành hoá học. C.6. Câu 9. glucozơ. Khí nào sau đây gây ra hiện tượng mưa axit ? A. trong một số chất thải dạng dung dịch. B. 2% hỗn hợp CO2. D. B. B. C.

1. C. Hãy tính lượng ngũ cốc chứa 65% tinh bột để sản xuất được 2.01 mg/l).3 D 9.422 tấn. Khí tự nhiên. Than hoạt tính. Tính khối lượng dung dịch CuSO4 5% thu được từ 0. 2.422 tấn. Tính khối lượng NaCl cần thiết để sản xuất 15 tấn NaOH. D.2 A 9.30 tấn. B. Hãy cho biết hiện tượng đó chứng tỏ trong không khí đã có khí nào trong các khí sau đây ? A. Nhiều loại sản phẩm hoá học được điều chế từ muối ăn trong nước biển như : HCl.3 tấn ancol etylic. 17. NaOH.5 C 9. Tính hàm lượng khí đó trong không khí.4 C 9. CO2.0225 mg/l. 0.13. KClO3 rắn. b. D. C. H2S. Khí lò cao.0 tấn.12. 5.0253 mg/l.10. SO2. C. B. 15.8 A . 0. 1. nước Gia-ven. Câu 9.15.422 tấn.0125 tấn.4 tấn. Câu 9.14.2 tấn. NaOH rắn. Có thể điều chế Ancol etylic bằng 2 cách sau : . C. C. Na2O2 rắn.Cho lên men các nguyên liệu chứa tinh bột. Trong công nghệ xử lí khí thải do quá trình hô hấp của các nhà du hành vũ trụ hay thuỷ thủ trong tàu ngầm người ta thường dùng hoá chất nào sau đây ? A.7 D 9. (Nên biết thêm : hàm lượng cho phép là 0. 4.0257 mg/l. B. D. 3.15 tấn nguyên liệu chứa 80% CuS. A. tơ sợi tổng hợp. Ancol etylic là sản phẩm trung gian từ đó sản xuất được cao su nhân tạo. Có thể điều chế thuốc diệt nấm 5% CuSO4 theo sơ đồ sau : CuS → CuO → CuSO 4 . 27. A. Câu 9.Câu 9. 8.Cho khí etilen (lấy từ cracking dầu mỏ) hợp nước có xúc tác. Không khí.11. 0. Khí dầu mỏ. . D.3 tấn. Chất khí CO (cacbon monoxit) có trong thành phần loại khí nào sau đây ? A.55 tấn. người ta tiến hành như sau : Lấy 2 lít không khí rồi dẫn qua dung dịch Pb(NO 3)2 dư thì thu được 0. D. 12. B. C.2 tấn. Na2CO3.3585 mg chất kết tủa màu đen. 0. D. a. Câu 9.56 tấn. D. A.0250 mg/l. B. A. B. Để đánh giá độ nhiễm bẩn không khí của một nhà máy. NH3. C. coi hiệu suất phản ứng là 100%. Câu 9. Biết hiệu suất của quá trình là 80%.1 D 118 9. B. 1. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IX 9.6 A 9. Hiệu suất của quá trình là 80%. Biết rằng hao hụt trong quá trình sản xuất là 25%.

a 9.9.15.9.b A C 119 .12 D 9. C 9.13 B 9.14 C 9.10 D 9.15.11 A 9.

Sign up to vote on this title
UsefulNot useful