HÓA HỌC 12

• • • • • • • • • Chương 1: Este – Lipit Chương 2: Cacbohidrat Chương 3: Amin – Amino axit – Protein Chương 4: Polime – Vật liệu polime Chương 5: Đại cương về kim lọai Chương 6: Kim lọai kiềm – Kim lọai kiềm thổ - Nhôm Chương7: Sắt và một số kim lọai quan trọng Chương 8: Phân biệt một số chất vô cơ Chương 9: Hóa học và vấn đề phát triển kinh tế, xã hội và môi trường

TÀI LIỆU LƯU HÀNH NỘI BỘ

CHƯƠNG I. ESTE - LIPIT A- MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Khái niệm về dẫn xuất của axit cacboxylic - Dẫn xuất của axit cacboxylic là những sản phẩm tạo ra khi thay thế nhóm hiđroxyl -OH trong nhóm cacboxyl -COOH bằng nguyên tử hay nhóm nguyên tử khác: -COOH → -COZ (với Z: OR', NH2, OCOR, halogen, …) - Este là dẫn xuất của axit cacboxylic. Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR' thì được este. - Halogenua axit (quan trọng nhất là clorua axit RCOCl). Để tạo ra halogenua axit có thể dùng các tác nhân như PCl5 (photpho pentaclorua), PCl3 (photpho triclorua), COCl2 (photgen), SOCl2 (thionyl clorua), … RCOOH + PCl5 → RCOCl + POCl3 + HCl 3RCOOH + PCl3 → 3RCOCl + H3PO3 RCOOH + SOCl2 → RCOCl + SO2 + HCl RCOOH + COCl2 → RCOCl + CO2 + HCl - Anhiđrit axit, có 2 loại: đối xứng (dạng (RCO)2O hoặc (ArCO)2O; gọi tên bằng cách thay từ axit bằng anhiđrit (CH3CO)2O là anhiđrit axetic), và không cân đối (sinh ra từ hai axit monocacboxylic khác nhau như CH3CO-O-OCC6H5; gọi tên bằng từ anhiđrit cộng với tên của hai axit - anhiđrit axetic benzoic). Để tạo thành anhiđrit axit có thể sử dụng nhiều phương pháp khác nhau như dùng tác nhân hút nước P2O5 hay tác dụng của nhiệt, … 2. Công thức tổng quát của este a/ Trường hợp đơn giản: là este không chứa nhóm chức nào khác, ta có các công thức như sau :
- Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đơn chức R'OH: RCOOR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đơn chức R'OH: R(COOR')a. - Tạo bởi axit cacboxylic đơn chức RCOOH và ancol đa chức R'(OH)b: (RCOO)bR'. - Tạo bởi axit cacboxylic đa chức R(COOH)a và ancol đa chức R'(OH)b: Rb(COO)abR'a. Trong đó, R và R' là gốc hiđrocacbon (no, không no hoặc thơm); trường hợp đặc biệt, R có thể là H (đó là este của axit fomic H-COOH).

b/ Trường hợp phức tạp: là trường hợp este còn chứa nhóm OH (hiđroxi este) hoặc este
còn chứa nhóm COOH (este - axit) hoặc các este vòng nội phân tử … Este trong trường hợp này sẽ phải xét cụ thể mà không thể có CTTQ chung được. Ví dụ với glixerol và axit axetic có thể có các hiđroxi este như HOC 3H5(OOCCH3)2 hoặc (HO)2C3H5OOCCH3; hoặc với axit oxalic và metanol có thể có este - axit là HOOC-COOCH3.

c/ Công thức tổng quát dạng phân tử của este không chứa nhóm chức khác Nên sử dụng CTTQ dạng C n H 2n + 2 −2∆ O2a (trong đó n là số cacbon trong phân tử este n ≥ 2, nguyên; ∆ là tổng số liên kết π và số vòng trong phân tử ∆ ≥ 1, 2

nguyên; a là số nhóm chức este a ≥ 1, nguyên), để viết phản ứng cháy hoặc thiết lập công thức theo phần trăm khối lượng của nguyên tố cụ thể. 3. Tính chất hoá học của este a/ Phản ứng thuỷ phân este Tính chất hoá học quan trọng nhất của este là phản ứng thuỷ phân. Sơ đồ thuỷ phân este (về cơ bản, chưa xét các trường hợp đặc biệt) là :

C

O

+H

OH

H +, t o

C O

H

+

OH

O O (este) (nước) (axit) (ancol) Thuỷ phân chính là quá trình nghịch của của phản ứng este hoá.
Phản ứng thuỷ phân có thể xảy ra trong môi trường axit hoặc môi trường bazơ. - Phản ứng thuỷ phân trong môi trường kiềm được gọi là phản ứng xà phòng hoá. Đặc điểm của phản ứng thuỷ phân este: - Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Sản phẩm của phản ứng trong điều kiện này luôn có axit cacboxylic. Để chuyển dịch cân bằng về phía tạo axit và ancol, ta dùng lượng dư nước.

- Phản ứng thuỷ phân este không những thuận nghịch mà còn rất chậm. Để tăng tốc độ phản ứng thuỷ phân ta đun nóng hỗn hợp phản ứng với với chất xúc tác axit (H2SO4, HCl…). - Phản ứng xà phòng hoá chỉ xảy ra một chiều, sản phẩm thu được luôn có muối của axit cacboxylic.

C O

+ OH-

to

C
(muối)

O-

+

OH

(este) (kiềm) O b/ Phản ứng của gốc hiđrocacbon

O (ancol, phenol, anđehit …)

Este không no (este của axit không no hoặc ancol không no) có khả năng tham gia phản ứng cộng và phản ứng trùng hợp – đây là tính chất do liên kết π quy định (tương tự như hiđrocacbon tương ứng). Một số phản ứng thuộc loại này có ứng dụng quan trọng là : - Phản ứng chuyển hoá dầu (chất béo lỏng) thành mỡ (chất béo rắn)
Ni, t , p (C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5 (Triolein) (Tristearin) - Phản ứng trùng hợp vinyl axetat thành poli(vinyl axetat)
0

nCH2

CH OCOCH3

xt, to, p

CH CH2 n OCOCH3

- Trùng hợp metyl metacrylat thành poli(metyl metacrylat) – thuỷ tinh hữu cơ plexiglas).

3

nCH2 CH COOCH3 xt. halogenua axit cũng bị líti-nhôm hiđrua khử tương tự). 4. Este vòng (được tạo bởi hiđroxi axit) CH 3 CH C O • Este + NaOH  Có MSP = MEste + MO → NaOH R C O O Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi 4 .este: RCOOC(R)(OH)-R’ • Este + NaOH  1 sản phẩm duy nhất → hoặc “m RẮN = mESTE + mNaOH”. 5.axit : HOOC-R-COOR’ • Este + NaOH  2 muối + H2O → Este của phenol: C6H5OOC-R • Este + NaOH  1 muối + anđehit + H2O → Hiđroxi. Phản ứng khử este bởi líti-nhôm hiđrua LiAlH4 thành ancol bậc I 1) LiAlH 4 → RCOOR'  RCH2OH + R'OH 2) H3O + (Chú ý: anhiđrit axit. p CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) CH3 metyl metacrylat . Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : • Este + NaOH  1 muối + 1 anđehit → Este đơn chức có gốc ancol dạng công thức R-CH=CHThí dụ CH3COOCH=CH-CH3 • Este + NaOH  1 muối + 1 xeton → Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân. to. hoặc nữa là do cấu tạo bất thường của este gây nên. tuỳ thuộc vào việc nhóm – OH đính vào gốc hiđrocacbon có cấu tạo như thế nào mà sẽ có các phản ứng tiếp theo xảy ra để có sản phẩm cuối cùng hoàn toàn khác nhau.Phản ứng tráng gương của este của axit fomic– (xem lại anđehit).este: RCOOCH(OH)-R’ • Este + NaOH  1 muối + xeton + H2O → Hiđroxi. • Este + NaOH  1 muối + 1 ancol + H2O → Este. Không nhất thiết sản phẩm cuối cùng phải có ancol. Một số phản ứng thuỷ phân đặc biệt của este Căn cứ vào sơ đồ phản ứng xà phòng hoá hay phản ứng thuỷ phân este ta có thể căn cứ vào sản phẩm tạo thành để suy đoán cấu tạo của este ban đầu.

Phản ứng của ancol với axit cacboxylic (xem axit). H . Lipit . . Phản ứng xà phòng hoá xảy ra nhanh hơn phản ứng thuỷ phân trong môi trường axit và không thuận nghịch. Muối natri (hoặc kali) của các axit béo chính là xà phòng. .t  → RCOOH + R'OH ← RCOOR' + H2O  + 0 . Khi thuỷ phân chất béo thì thu được glixerol và axit béo. anhiđrit axit.đơn giản nhất. gọi chung là triglixerit. . Phản ứng của chất béo với chất kiềm được gọi là phản ứng xà phòng hoá. Lipit bao gồm chất béo. sterit. …hầu hết chúng đều là các este phức tạp. tạo ra este.Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử C (thường từ 12C đến 24C) không phân nhánh.Chỉ số axit: là số mg KOH cần để trung hoà axit béo tự do có trong 1g chất béo.Khi đun nóng chất béo với dung dịch kiềm thì tạo ra glixerol và hỗn hợp muối của các axit béo. sáp.Lipit là những hợp chất hữu cơ có trong tế bào sống.Phản ứng của ancol với anhiđrit axit hoặc clorua axit thì phản ứng xảy ra nhanh hơn và một chiều (không thuận nghịch như khi tác dụng với axit) (CH3CO)2O + C2H5OH  CH3COOC2H5 + CH3COOH → CH3COCl + C2H5OH  CH3COOC2H5 + HCl → b/ Phản ứng của phenol với anhiđrit axit hoặc clorua axit (phenol không tác dụng với axit cacboxylic) tạo este của phenol. t CH3 CH C O + NaOH CH3 CH C ONa O Chú ý các kết luận in nghiêng ngay dưới mỗi trường hợp trênO chỉ là một thí dụ OH đây o 6. Một số phương pháp điều chế este a/ Phản ứng của ancol với axit cacboxylic và dẫn xuất như clorua axit. các em chỉ được vận dụng khi không có dấu hiệu cho phép xác định cụ thể số nhóm chức este trước đó. t 0 CH3COOH + CH≡ CH  CH3COOCH=CH2 → d/ Phản ứng ankyl halogenua và muối bạc hay cacboxylat của kim loại kiềm RCOOAg + R'I → RCOOR' + AgI RCOONa + R′ I → RCOOR' + NaI 7. 5 . photpholipit. . Ví dụ: phản ứng tạo phenyl axetat (CH3CO)2O + C6H5OH  CH3COOC6H5 + CH3COOH → CH3COCl + C6H5OH  CH3COOC6H5 + HCl → c/ Phản ứng cộng vào hiđrocacbon không no của axit cacboxylic Ví dụ: phản ứng tạo vinyl axetat xt.

CH3CH2COOH + Br2  CH3CHBrCOOH + HBr → 10. t0  → 4. bR(COOH)a + aR'(OH)b ← Rb(COO)abR'a + abH2O  t 5. H + 0 0 15. 3CH3COOH + POCl3  3CH3COCl + H3PO4 → CaO. t0 18. 2CH3COONa(r) + 4O2  Na2CO3 + 3CO2↑ + 3H2O → t0 17. RCOONa + HCl (dd loãng) → RCOOH + NaCl t0 16. R-CN + 2H2O → R-COOH + NH3↑ 1) O 2 → 14.Chỉ số iot: là số gam iot có thể cộng hợp vào các liên kết bội có trong 100g chất béo. t 0 9. RCOOC(CH3)=CH2 + NaOH  RCOONa + CH3COCH3 → 6 . 8. t 0 8. RCOOC6H5 + 2NaOH  RCOONa + C6H5ONa + H2O → t0 3.Chỉ số xà phòng hoá là tổng số mg KOH cần để xà phòng hoá glixerit và trung hoà axit béo tự do có trong 1g chất béo.. CH3COONa(r) + NaOH(r)  CH4 + Na2CO3 → photpho. RCOOCH=CH2 + NaOH  RCOONa + CH3CHO → 0 t 2. CxHy(COOM)a + O2  M2CO3 + CO2 + H2O → (sơ đồ phản ứng đốt cháy muối cacboxylat).MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP t 1. CH3-CO-CH3 + HCN → (CH3)2C(OH)CN 11. C6H5-CH(CH3)2  C6H5OH + CH3COCH3 2) H 2 O. C3H5(OOC R )3 + 3NaOH  3 R COONa + C3H5(OH)3 → H+ . R-Cl + KCN → R-CN + KCl 13. 3CH3COOH + PCl3 → 3CH3COCl + H3PO3 t0 7. (CH3)2C(OH)CN + 2H2O → (CH3)2C(OH)COOH + NH3↑ 12. . (C17H35COO)3C3H5 + 3KOH  C17H35COOK + C3H5(OH)3 → 6. Xà phòng và chất tẩy rửa tổng hợp B .

a. (2). Các nhận định đúng là A. mạch hở có công thức phân tử CnH2nO2 . (3) Este no. (4). (1) và (4). có thể thu được este có tên là A. (5). C. (1). (4) propyl fomiat. (2). Câu 1. (3). b. (2) Không thể điều chế được vinyl axetat bằng cách đun sôi hỗn hợp ancol và axit có axit H2SO4 đặc làm xúc tác. (2). Đun hỗn hợp X với dung dịch NaOH dư. (1).nghịch. 14. (5). c. B.1 Khi đun hỗn hợp gồm etanol và axit axetic (có mặt H2SO4 đặc làm xúc tác). (2) Este là hợp chất hữu cơ trong phân tử có nhóm – COO. (5). C. axit sunfuric vừa làm xúc tác vừa có tác dụng hút nước. (4). (3). B. (1). (1). (5). (5). đơn chức. C. Etyl fomiat. (3) metyl iso-propylonat. 3. C. (3). (3). b. (1). 15.. Vậy công thức cấu tạo của E và F là A. (4). (2). B. (4) Phản ứng este hoá là phản ứng thuận .C. (3). 7 . (1). do đó làm tăng hiệu suất tạo este. D. Nung Y với NaOH (có mặt CaO) thì được một chất khí là CH4. với n ≥ 2 . Câu 1. D. D.4 Hỗn hợp X gồm 2 este mạch hở E (C5H6O4) và F (C4H6O2).6 Ứng với công thức phân tử C4H8O2. Etyl axetat. D. HOOC – CH2 – COO – CH = CH2 và CH3 – COO – CH = CH2. (2).3 Xét các nhận định sau: (1) Trong phản ứng este hoá. Các nhận định đúng gồm A. (4) Hợp chất CH3COOC2H5 thuộc loại este. Nhận xét đúng là A. a. D. c/ (1) cần đun nóng.7 Phản ứng thuỷ phân của este trong môi trường axit (1) và môi trường bazơ (2) khác nhau ở các điểm : a/ (1) thuận nghịch. (2). Etyl axetic.2 Có các nhận định sau : (1) Este là sản phẩm của phản ứng giữa axit và ancol. c. C. (4). sẽ tồn tại các este với tên gọi : (1) etyl axetat. D. B. b/ (1) tạo sản phẩm axit. C. (3). (2). 4. Câu 1. còn (2) tạo sản phẩm muối. Câu 1. (5). C. b. (2) metyl propionat. B. (3). (4). thu chất rắn Y. còn (2) chỉ một chiều. chỉ (4). (4). c. (4). Câu 1.5 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit benzoic là A. sau đó cô cạn dung dịch. còn (2) không cần đun nóng. B. HOOC – COO – CH2 – CH = CH2 và H – COO – CH2 – CH = CH2. (1). D. Các tên gọi đúng ứng với este có thể có của công thức phân tử đã cho là A. (5) isopropyl fomiat. và (4). B. Đietyl ete. HOOC–CH = CH– COO–CH3 và CH3–OOC – CH = CH2. (4). a. (3).BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 1. HOOC – CH = CH – COO – CH3 và CH2 = CH – COO – CH3. (4). Câu 1. (3). (3) Để điều chế este của phenol không dùng axit cacboxylic để thực hiện phản ứng với phenol. (5) Sản phẩm của phản ứng giữa axit và ancol là este. (1).

11 Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi. D. ba chức là A. (2). D. Câu 1. (5). (2) (RCOO)2C3H5(OH). (1). Câu 1. Câu 1. C. HCOOC3H7 B. (2).15 Este mạch hở.10 Este của glixerol với axit cacboxylic (RCOOH) được một số học sinh viết như sau: (1) (RCOO)3C3H5. (1). (1). 8 . 18. (4). C. (4). D. Câu 1.9 Công thức tổng quát của este tạo bởi một axit cacboxylic no đơn chức và một ancol no đơn chức (cả axit và ancol đều mạch hở) là A. metyl benzoat. phản ứng đặc trưng cho mọi este là A. (5) C3H5(COOR)3. B. CnH2nO2. 8. X có tên gọi là A. phenyl axetat.18O12. CnH2n . Công thức đã viết đúng là A. (4) Chất béo là este của glixerol và axit hữu cơ. Câu 1. (3) phản ứng thuỷ phân. chỉ có (5). nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. Câu 1. C. B. B. CnH2n + 1COOCmH2m +1. Rb(COO)abR’a. phenyl fomiat. (2). metyl axetat. (2). C. 12. CnH2nO2. benzyl fomiat. D.Câu 1. CnH2n – 2O2. D. (4). (2) phản ứng cộng. CnH2n – 2O2. (1). (2) Chất béo không tan trong nước. (3). (1). D. C. Câu 1. vinyl fomiat.17 Chất X có công thức phân tử C4H8O2. C. chỉ có (1). 6. Câu 1. (3) và (4). CH3COOC2H5 D. D.16 Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. Các phát biểu đúng là A. B. B. (4) (ROOC)2C3H5(OH).14 Trong thành phần của một số loại sơn có trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. C. CnH2n+2O2. D.13 Những phát biểu sau đây : (1) Chất béo không tan trong nước. (4). B. HCOOC3H5. CnH2n . (1). B. (4). C. C. (3) (HO)2C3H5OOCR.10O6. RCOOR’. D. đơn chức chứa 50%C (về khối lượng) có tên gọi là A. Số lượng công thức cấu tạo của các trieste có thể có trong loại sơn nói trên là A. (3) Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. etyl axetat. (3). (3). (3). CnH2n . B. vinyl axtetat.6O4. CnH2n -16O12. (2). Câu 1. (4) phản ứng oxi hóa. C2H5COOCH3 C.8 Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là A. B. Công thức cấu tạo của X là A.12 Trong số các phản ứng có thể có của este gồm: (1) phản ứng trùng hợp. Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức C2H3O2Na.

Tại thời điểm cân bằng thu được 0.25 Tên gọi của este (được tạo nên từ axit và ancol thích hợp) có công thức phân tử C4H6O2 là A. 1. mạch hở là A.75 mol este (không tác dụng với Na). y = 0. (4).05. 1. Câu 1. 2. C. 1. natri kim loại. Câu 1.22 Đun nóng hỗn hợp gồm x mol axit axetic và y mol etylen glicol (xt H2SO4 đặc).20. 3. chỉ có (1). Câu 1. B. este mà polime của nó được dùng để sản xuất chất dẻo gồm A.18 Khi đun hỗn hợp 2 axit R1COOH và R2COOH với glixerol (axit H2SO4 làm xúc tác) có thể thu được mấy trieste ? A. C. chỉ có (3). (3) metyl metacrylat.90. 1. C. C. D. B. 2. 2. x = 1. (1) và (2). Câu 1. 2.2. C. D. Câu 1. (3) iso propyl fomiat. 3. 1. C. Metyl acrylat. y có giá trị là A.80.2.05. (2).00. y = 1. 1. 4. 0.24 Ứng với công thức phân tử C3H6O2.75. x = 1. Câu 1. x = 1. B. 5. 2. 2. D. D. B. mạch hở là A. dung dịch AgNO3 trong amoniac lần lượt là A. 2. Câu 1. B. x.26 Cho 2 mol CH3COOH thực hiện phản ứng este hoá với 3 mol C2H5OH. Metyl metacrylat. 2.20 Số nguyên tử cacbon tối thiểu trong phân tử este không no.30 mol axit. (2) và (3). số đồng phân có khả năng tác dụng với dung dịch NaOH. 6. (4).4. 2. 18. C. (1). D. x = 1. Ở nhiệt độ đó hằng số cân bằng Kc của phản ứng este hoá là A. B. 5. (2) metyl axetat. Metyl propionat. 4.21 Số nguyên tử cacbon tối thiểu trong phân tử este (được tạo nên từ axit và ancol) no đa chức. 2. y = 1. một học sinh gọi tên các đồng phân este có thể có gồm: (1) etyl fomiat. 1. Khi đạt trạng thái cân bằng trong hỗn hợp có 1. 9 . B.2 mol este tạo thành. B. C. (3). (2).23 Trong số các đồng phân mạch hở có công thức phân tử C2H4O2. natri cacbonat. Vinyl axetat. 2. (1). Các tên gọi đúng là A. (4) vinyl fomiat. B. 2. 3. (3). 4. 2. (4).25 mol ancol và 0. (2) metyl acrylat. (4) metyl benzoat. D. y = 0. D. C. Câu 1. 1.19 Trong số các este: (1) metyl axetat. C. 2. (1).Câu 1. (3).00. D.

O). Các axit béo có mạch cacbon không phân nhánh. Đun sôi hỗn hợp etanol. HCOO –C(CH3) = CH2. C.H. Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. e/ Chất béo lỏng là các triglixerit chứa gốc axit không no trong phân tử. axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. propyl fomiat. Công thức cấu tạo của X có thể là A. Vậy X. thu được 2 sản phẩm hữu cơ X.33 Cho các câu sau : a/ Chất béo thuộc loại hợp chất este. B. Câu 1.32 Thuỷ phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng. isopropyl fomiat. rượu trắng và axit sunfuric đặc. b.28 Hỗn hợp T gồm 2 chất X. a. B.27 Chất X tác dụng với NaOH cho dung dịch X1. D. Vậy công thức cấu tạo của X là A. este đơn. HOOC–CH2–COO–CH = CH2. D. HOOC–CH = CH–OOC–CH3. a. e. Chất E là A. số nguyên tử cacbon chẵn. có 1 nối đôi. D. este đơn no.72 lít (đktc) CO2 và 5. Câu 1. Đun hồi lưu hỗn hợp etanol. B. C. e. a. C. c. Cho X5 tác dụng với NaOH lại thu được X2. HOOC–COO–CH2–CH = CH2.29 Phát biểu nào sau đây sai ? A.30 Cách nào sau đây có thể dùng để điều chế etyl axetat ? A. B. Câu 1. đun nóng. CH2 = CH – CH2 – OCOH. Y mạch hở (C. có một nối ba. e.O) đơn chức đều không tác dụng được với Na. HOOC–CH2–CH = CH–OOCH. H.Câu 1. metyl propionat. d/ Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. este đơn có 2 nối đôi. C. Những câu đúng là đáp án nào sau đây ? A. B. Glixerol khử nước hoàn toàn cho sản phẩm là acrolein. Câu 1. C. Đun hồi lưu hỗn hợp etanol. c/ Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. Y thuộc dãy đồng đẳng A. este đơn. axit axetic và axit sunfuric đặc. c.4g H2O. Thuỷ phân X bằng dung dịch NaOH dư. a. B. b. CH2 = CH – OCOCH3. Cô cạn X1 được chất rắn X2 và hỗn hợp hơi X3. D. HCOO – CH = CH – CH3. Y (chứa các nguyên tử C. d.31 Chất hữu cơ X có công thức phân tử là C5H6O4. C. d. C. Chưng cất X3 thu được chất X4. nhưng đều tác dụng với dung dịch NaOH khi đun nóng. D. D. Cho X4 tráng gương được sản phẩm X5. Chất béo là este của glixerol với các axit béo. D. B. etyl axetat. no. d. Đốt cháy hoàn toàn m g T. thu được một muối và một ancol. Đun hồi lưu hỗn hợp axit axetic. b/ Các este không tan trong nước do chúng nhẹ hơn nước. Câu 1. d. thu 6. 10 . Câu 1. Phản ứng xà phòng hoá là phản ứng thuỷ phân este trong môi trường kiềm. giấm và axit sunfuric đặc.

Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng A. 2. 8 Câu 1. B. (4) axit axetic. 3. B. D. axit fomic. C3H3O2Na và 2 sản phẩm khác.34 Chỉ số axit của chất béo là A. vinyl axetat và etyl fomiat cần phải dùng các thuốc thử là A. (5) cồn iot. B. 1.5 mol. B. C. B. Số mol KOH cần để xà phòng hoá một gam chất béo. D. cần thực hiện số lượng phản ứng hoá học ít nhất là A.36 Đun nóng hỗn hợp X và Y có công thức C5H8O2 trong dung dịch NaOH. Câu 1. F tác dụng với NaOH tạo ra một ancol T.4 mol. 0.15 mol este đơn chức X (C5H8O2) tác dụng vừa đủ với dung dịch NaOH. CH2 CH COOC2H5 . polibutađien và poli(butađienstiren).39 Trong phòng thí nghiệm có các hoá chất được dùng làm thuốc thử gồm: (1) dd brom. 0. 0. CH2 CH(CH3)COOCH3. axit acrylic. C. B. C. 51%. để điều chế được ba polime gồm polistiren. CH3–CH(OH)–CH(OH)–CH=CH2 và CH2=CH–CH2–CH2–COOH. CâuCH3COOCH2 hữu cơ CHcông thứcCH2 tử C2H8O2. 44%. C. (2) dd NaOH. O=HC–CH2–CH2–CH2–CH=O và O=HC–CH(OH)–CH2–CH=CH2.35 Cho a mol chất béo (C17H35COO)3C3H5 tác dụng hết với NaOH thu được 46g glixerol. D.41 F là chất CH có 2 . 11 . axit axetic.Câu 1. D. khi đốt cháy một thể tích ancol T cần 3 thể tích oxi (đo ở cùng điều CH2 CH2 O kiện). C. C. 3. Câu 1.6. Công thức cấu tạo của X và Y là A. Để phân biệt 3 este: anlyl axetat. a có giá trị là A. phân CH 5 C O. axit valeric. 3. 5. thu sản phẩm 2 muối C3H5O2Na. cô cạn dung dịch sau phản ứng thu 21g muối khan. 2. 1. (3) dd AgNO3/NH3. 5. D. 1. 22%.40 Cho 0. Axit tạo F là A. CH3–CH2–COO–CH=CH2 và CH2=CH–COO–CH2–CH3.37 Từ nguyên liệu đầu là eten và benzen (xúc tác và điều kiện phản ứng có đủ). C. C. D. Câu 1. Số miligam NaOH cần để trung hoà các axit tự do có trong 1 gam chất béo.6 mol. D. Câu 1. Số liên kết π có trong gốc hiđrocacbon của axit béo. Số miligam KOH cần để trung hoà các axit tự do có trong 1 gam chất béo. 1. Công thức cấu tạo của X là A. 7. Câu 1.3 mol. 50%. D. 2. B. 0. CH2=CH–CH2–CH2 – COOH và CH3–CH2–CH=CH–COOH.38 Cho 10 gam hỗn hợp X gồm etanol và etyl axetat tác dụng vừa đủ với 50g dung dịch natri hiđroxit 4%. B.

0. Tên gọi của Y là A.49 Đốt hoàn toàn 4. C. D. Câu 1. Câu 1. 0.01 mol. Công thức cấu tạo mỗi este và số gam tương ứng là A.48g).50 Đun nóng 0. 0. HCOOC2H5 (1.45 Đốt cháy 6g este E thu được 4. C. C2H5COOCH3 (6.2g.4g X với dung dịch NaOH (phản ứng hoàn toàn) thu được sản phẩm có 6. Etyl fomiat. CH3COOC2H5 (6. CH3COOC2H5 (4.2g ancol đơn chức. áp suất. C2H4(COOC2H5)2. axit acrylic. mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4.4375. HCOOC2H5. Câu 1. B. 600 mmHg). D. CH3COOCH3 (1.2g O2 ở cùng điều kiện nhiệt độ và áp suất. Công thức của X là A.22g).44 Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6. Etyl propionat.1 mol.8g muối. C2H3COOC2H5. D.6g). B. Tên gọi của X là A. Câu 1. etyl fomiat. C. Biết MY > MX. Câu 1. CH3COOCH3.42 Đốt cháy hoàn toàn m g hỗn hợp các este no. Câu 1. 10g.6g một ancol Y. vinyl fomiat.2g khí oxi ở cùng điều kiện nhiệt độ. C.2g một este E thu được 6.22g). axit metacrylic.1 mol.01mol.48g). Propyl axetat. B.6g Z thu được thể tích bằng thể tích của 3. 0. CH3COOC2H5. C2H5COOCH3 (4.4g muối của axit đa chức và 9. (COOC3H5)2. CH3COO – CH2CH2CH3. axit fomic. HCOOCH3. mạch hở. . axit axetic. đơn chức. có thể tích 8. D. Biết E có phản ứng tráng gương với dung dịch AgNO3/NH3. C. Etyl axetat. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A. làm bay hơi 8. D.32 lít (ở 1270C.2g. Tên gọi của X là A. D.6g). B. Vậy công thức cấu tạo của E là A. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối lượng bình tăng 6. 12g. C2H5COOC2H5. HCOOCH3. C2H3COOC3H7.48 Đốt cháy hoàn toàn 2.1 mol X với dung dịch NaOH (đủ). isopropyl fomiat. C. 10g. B. thu 13. Khi thực hiện phản ứng xà phòng hoá 7. B.36 lít oxi (đktc) thu hỗn hợp CO 2 và H2O có tỉ lệ thể tích tương ứng 6 : 5. Nếu đun X trong dung dịch H 2SO4 loãng thu được axit Y có dY / H 2 = 36 và ancol đơn chức Z. Công thức cấu tạo của E là A. D.14g hỗn hợp 2 muối và 3. C. HCOOC2H5 (2. B. D. HCOO – C2H5. CH3COOCH3 (2. C.4g).48 lít CO2 (đktc) và 3.4g).47 Làm bay hơi 7.43 Cho ancol X tác dụng với axit Y thu được este Z.16g CO2 và 2. C.52g H2O. CH(COOCH3)3. 12 B.28g X cần 3.68g một ancol Y duy nhất có tỉ khối so với oxi là 1. D. HCOO – CH2CH2CH3. CH3COOCH3. Câu 1. metyl axetat.Câu 1. B.4g một este X thu được một thể tích hơi bằng thể tích của 3.46 Thuỷ phân hoàn toàn 8.6g H2O. (COOC2H5)2. X có công thức A. Câu 1.8g este đơn chức. 1.

51 Xà phòng hoá hoàn toàn 0. Este có thể có công thức cấu tạo nào sau đây? C17 H 35COO C H 2 C17 H 35COO C H 2 | | A.55 Trong chất béo luôn có một lượng axit béo tự do. Câu 1. 20. % khối lượng của X trong hỗn hợp ban đầu và giá trị m là A. 8.08g. Công thức của X là A. C17 H 33COO C H | C15 H 31COOCH 2 D. CH3–C(COOCH3)3.57 Khi thuỷ phân (xúc tác axit) một este thu được glixerol và hỗn hợp các axit stearic và axit panmitic theo tỉ lệ mol tương ứng bằng 2 : 1. B.56 Tổng số miligam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong một gam chất béo gọi là chỉ số xà phòng hoá của chất béo.4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức).1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0. m lần lượt là A. C15 H 31COO C H | C15 H 31COOCH 2 13 . 20.20%.1M. D. Câu 1.6g muối và 0. Câu 1.92g glixerol. C3H5(COOCH3)3. C3H5(OOCH)3. Giá trị của a.3 mol NaOH.54 Khi thuỷ phân a g một este X thu được 0. 6.82g.82g .5M.8g chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0. B. (C2H5COO)3C2H5.4g hỗn hợp 2 este đơn chức X. B. Vậy chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa 89% tristearin là A. CH3CH2COOCH3. B. CTCT. 6. C. D. 165. 15. C.6g. 7. cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và m g một muối khan duy nhất Z.2 mol HCl. HCOOC2H5 16. 8.2g. 8. Công thức cấu tạo thu gọn của X là A. CH3CH2OOC-COOCH2CH3. 19.52 Để xà phòng hoá hoàn toàn 19. Để trung hoà 2.4g.2g . Y cần 200ml dung dịch NaOH 1. D. (CH3COO)3C3H5. B.2g ancol Y và 20.0g. 155. C3H5(COOCH3)3. Câu 1.53 Cho 21. thu 9. D. C15 H 31COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | C. Lượng NaOH dư được trung hoà hết bởi 0.2g . C. 18. Câu 1.82g .02g natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa). 185. Chỉ số axit của mẫu chất béo trên là A. HCOOCH3 66. 8. 3. Số miligam KOH dùng để trung hoà lượng axit béo tự do trong một gam chất béo gọi là chỉ số axit của chất béo. CH3COOCH3 19.08g. C. B.Câu 1.18%. D.8g chất béo cần 3ml dung dịch KOH 0. 7. C.5M thu được 24. 16. 7. 175. D. C17 H 35COO C H | C17 H 35COOCH 2 C17 H 35COO C H 2 | B. Câu 1. (HCOO)3C3H5.1 mol một ancol Y. C.4g.67%. Sau khi phản ứng hoàn toàn. 6.

Câu 1. metyl propionat. C.787kg. C3H6O2. D. 3.92kg. giả sử hiệu suất quá trình đạt 90% là A. B. (4). (3). Khi thuỷ phân hoàn toàn 2.65 Một chất hữu cơ X có d X CO2 = 2 .84kg. 889. (3) (C17H31OOC)2C3H5OOCC17H29.2kg. 917kg. (C17H33COO)3C3H5.58 Trong chất béo luôn có một lượng axit béo tự do. metyl axetat. B. C. Câu 1. D.91g. iso propyl fomiat. Câu 1. C4H8O2.92g. C. etyl axetat.90g.59 Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. B.60 Đun sôi a g một triglixerit X với dung dịch KOH cho đến khi phản ứng hoàn toàn. 8. D. B. Giá trị của a là A. (4) (C17H31OCO)2C3H5COOC17H29. D. Chất béo đó là A. D. 14 . (3). C3H4O2. C2H4O2. 150g. 929.64 Đun nóng 215g axit metacrylic với 100g metanol (với Hpứ = 60%). thu được 0. (C17H35COO)3C3H5. 2. (4). Khối lượng este metyl metacrylat thu được là A. D. (2). Câu 1. B. C. 7. (C15H29COO)3C3H5. (1). 9. B. Vậy công thức phân tử của X là A.24g muối của axit béo duy nhất. 3. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng lớn hơn khối lượng X đã phản ứng.84g glixerol và 18. D. Câu 1. B.61kg. Khối lượng xà phòng 60% (về khối lượng) thu được là A. Câu 1. Câu 1. C. Câu 1.62 Thuỷ phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1. B. Biết X tác dụng với KOH tạo ra 2 chất hữu cơ.3kg.63 Đốt cháy 3. 8. 125g.145kg chất béo. Công thức cấu tạo có thể có của các trieste đó là : (1) (C 17H31COO)2C3H5OOCC17H29.92g glixerol và 9.092kg glixerol. (1). 988kg. cần dùng 0. C.82g.58g hỗn hợp Y gồm muối của axit linoleic và axit oleic. Những công thức đúng là A. Tên X là A. C. C.61 Khối lượng xà phòng thu được từ 1 tấn mỡ động vật (chứa 50% trioleoyl glixerol.3kg NaOH. 100g. (2). (1). 10. và mg hỗn hợp muối Na.92 lít O2 (đktc) thu được CO2 và H2O có tỉ lệ mol 1:1. (2) C17H31COOC3H5(OOCC17H29)2. (2). (2). D. thu 0.7g chất hữu cơ X cần dùng 3. 175g. 30% tripanmitoyl glixerol (panmitin) và 20% tristearoyl glixerol (stearin) về khối lượng) khi xà phòng hoá bằng natri hiđroxit. (4). (C15H31COO)3C3H5.

Câu 1. C. CH2=CH–COOCH3. Câu 1.2 mol.21g hỗn hợp X gồm hai chất hữu cơ Y và Z cùng nhóm chức với dung dịch NaOH dư. D.66 Este X có d X / H 2 = 44 .2g muối natriaxetat.72 Thuỷ phân este X (C4H6O2) trong môi trường axit ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. isopropyl fomiat. D.4g este E thuỷ phân trong dung dịch NaOH thì thu được 8. Trong X chắc chắn có một este với công thức và số mol tương ứng là A. B. C. 15 . 625 ). Công thức cấu tạo của X là A.69 Tổng số liên kết π và số vòng trong phân tử este (không chứa nhóm chức nào khác) tạo bởi glixerol và axit ađipic là A.492g muối khan (hao hụt 6%). mạch hở. 02 . B. Đốt cháy hỗn hợp X sẽ thu được nCO2 − nH 2O = 0.2g hỗn hợp gồm 2 este đồng phân. D. C17H35COO(CH2)16CH3. B.70 Cho 7. Câu 1.2 mol. Tên gọi của X là A. thu được muối có khối lượng bằng khối lượng 37 este ban đầu. hai chất Y và Z có số mol bằng nhau. 6. B. D. X là A. CH3 – COOC2H3 0. CH3 – COOCH3 0. Chất L 1 phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. Nung một trong hai muối thu được với NaOH (vôi tôi – xút) sẽ tạo metan.15 mol. Nếu đốt cháy cùng một lượng X1 hay X2 sẽ thu được cùng một thể tích CO2 (ở cùng nhiệt độ và áp suất).67 Xà phòng hoá 22. X2. Công thức của este E là A. 0. etyl fomiat.68 Đun nóng 3. C. (CH3COO)2C2H4. CH3 – CH = CH – OCOH. (CH3COO)3C3H5. H-COOCH3.15 mol D. Cho lượng 10 chất L phản ứng với Na được 0. Thuỷ phân X tạo nên 2 hợp chất hữu cơ X1. etyl axetat. II – BÀI TẬP NÂNG CAO Câu 1. thu được hỗn hợp muối natri của hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và một chất lỏng L (tỉ khối hơi d L / CH 4 = 3. Câu 1. CH2 = CH – OCO – CH3. Tên gọi của L là ancol anlylic.015 mol H2. CH3(CH2)2COOCH3. CH3COOCH3. Cho một lượng X tác dụng hoàn 41 toàn với dung dịch NaOH vừa đủ. D. B. Trong hỗn hợp X. Câu 1. thu 20. C. H – COOC2H5 0. metyl propionat. C. HCOO – CH2 – CH = CH2. cần dùng 12g NaOH. H – COOC2H5 0. 8. CH2 = CH – COO – CH3. B. C. D. CH3COOCH3. B. Câu 1. Nhận định nào sau đây là sai ? A. C.71 X là một este hữu cơ đơn chức. 7.

75 Xà phòng hoá một este no đơn chức E bằng một lượng vừa đủ dung dịch NaOH chỉ thu được một sản phẩm X duy nhất. D. Y: C3H8O3. ancol isopropylic. glixerol. C2H5COOCH3. ancol benzylic. HCOOCH=CH–CH3. D. D. axit axetic.Câu 1. CH3COOCH2CH3.78 Cho 12. Đốt cháy hoàn toàn Y thu được CO 2 và H2O có tỉ lệ thể tích 3 : 4. ancol propylic. X: C2H4O2. HCOOCH2CH=CH2. C. CH3COOCH=CH2. HCOOCH(CH3)CH3. Y. axit metacrylic. ancol etanol. CH3− CH− 2 CH 2 2 O O − C=O. axit propionic. axit acrylic. Đốt cháy 0.76 3. axit valeric. Biết Z là ancol đơn chức. glixerol.74 Đun hợp chất X với H2O (xúc tác H+) được axit hữu cơ Y ( dY / N2 = 2. Y lần lượt là A. X: CH2O2. Nung X với vôi tôi xút thu được ancol Y và muối vô cơ Z.6g chất Y cho 1. Metyl propionat. thu được chất X và chất Y.1 mol este E (chứa một loại nhóm chức) cần dùng vừa đủ 100g dung dịch NaOH 12%.9g một este đơn chức (mạch hở) tác dụng vừa đủ với 150ml dung dịch KOH 1M. C.77 Thuỷ phân hoàn toàn 0. C.8g X thì cần 3. Khi đun nóng X với dung dịch NaOH tạo ra muối có khối lượng bằng lượng 22 este đã phản ứng. B. Cho hơi Z qua ống bột đựng Cu xúc tác đun nóng thì sinh ra chất T có khả năng tham gia phản ứng tráng gương. Etyl axetat. Isopropyl fomiat.2g ancol Y. Y: C3H8O3. C. CH3CH2CH2OH Câu 1. HCOOCH=CH–CH3 và CH3COOCH=CH2. Xác định công thức phân tử và gọi tên X. Biết oxi hoá X bằng CuO đun nóng được sản phẩm có phản ứng tráng gương.4g muối của axit hữu cơ X và 9. B. CTCT của este E và chất Y là (giả sử các phản ứng đều đạt 100%) A. axit axetic. CTCT của este không thể là A.73 Một este X tạo bởi axit đơn chức và ancol đơn chức có tỉ khối với He bằng 17 22. Metyl axetat. Biết rằng một trong 2 chất (X hoặc Y) tạo thành este là đơn chức. X: C2H4O2.57 ) và ancol Z. Câu 1. axit acrylic. Y: C3H8O3. CH3CH2OH. D. sau phản ứng thu được một muối và một anđehit. CH2− O C. X: C3H6O2. Công thức cấu tạo của E là A. Để đốt cháy hoàn toàn 2. CH3OCO− CH=CH2. 16 .32g CO2. Câu 1. B. Tên gọi của X. B. D. ancol anlylic. CH3CH2OH. D. B. glixerol. Y: C3H8O. A. thu được 20. C. Tên X là A. Câu 1. CH2− 2 CH C=O. C2H5− CH− C=O. Khi bị oxi hoá chất Y chuyển thành anđehit. Câu 1. CH3CH2OH.92 lít O2 (đktc) và thu được VCO : V H O = 3 : 2 . B.52g một este E của axit cacboxylic no đơn chức và ancol no đơn chức (cả hai đều mạch hở) phản ứng vừa hết với 40ml dung dịch NaOH 1M. axit fomic. HCOOCH2CH2CH3.

còn Y tác dụng với nước brom sinh ra kết tủa trắng. Câu 1. 47. Câu 1. D. C.52g CO2 và 1. D.8g thì tên gọi của este là A. 4.20%. 36.18%. B. 2. 50.08g/ml).6kg. Câu 1.16%. 100 < M X < 200 .85 Để thuỷ phân 0.05g muối. 6. Câu 1. Câu 1. 52. Số lượng CTCT thoả mãn tính chất đã nêu của E là A.6g hỗn hợp etyl axetat và etyl fomiat cần 25. 8.81 Khi thuỷ phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. B.152g H2O. C2H5OOC–C3H4–COOC2H5. C.00g muối khan G. (CH2=C(CH3)–COO)3C3H5. (D = 1.5M để trung hoà KOH còn dư. C.5ml NaOH 0. Muốn trung hoà dung dịch chứa 0. B. C. Cho G tác dụng với axit vô cơ loãng thu được G 1 không phân nhánh.445kg. vinyl pentanoat. CTCT của este là A. C.82 Muốn thuỷ phân 5. B.80 Để xà phòng hoá 100kg dầu ăn thuộc loại trioleoyl glixerol có chỉ số axit bằng 7 cần 14. D. C.84 Thuốc chống muỗi (DEP) thu được khi cho axit thơm (X) tác dụng với ancol Y. etyl butyrat. D. 108. Tên gọi của este đó là A. 118. B. CH3–C6H4–COOC2H5. X khử được AgNO3 trong amoniac.83 Đun a gam este mạch không phân nhánh CnH2n+1COOC2H5 với 100ml dd KOH. anlyl butyrat. Mặc khác để thuỷ phân 6. D. Câu 1. Y lần lượt là A.89kg.2M. C2H5O–C6H4–COOC2H5. Cho 10g E tác dụng với lượng NaOH vừa đủ.96ml NaOH 10%. cô cạn dung dịch sau phản ứng thu được 14. phenyl fomiat. 103. (CH2=CH–COO)3C3H5. Giả sử phản ứng xảy ra hoàn toàn. (CH3COO)2C2H4.2g NaOH. Mặt khác muốn trung hoà 20ml dd KOH ban đầu phải dùng 15ml dd H2SO4 nói trên. Trong ancol = dung dịch ancol Y 94% (theo khối lượng) tỉ số mol n 14 .9035g X cần 54. (H–COO)3C3H5. B. D. 17 .60g một este E đơn chức được 3. C2H5OOC–C6H4–COOC2H5 D.79 Đốt cháy 1.14%. 117. Biết rằng H 2O n 86 CTCT thu gọn của X. C.10kg natri hiđroxit.245kg. etyl propionat.Câu 1. Khi a = 5.01 mol este của một ancol đa chức với một axit cacboxylic đơn chức cần dùng 1. B. etyl axetat. etyl valerat. benzyl fomiat. Thành phần % khối lượng của etyl axetat trong hỗn hợp là A. khối lượng muối natri thu được là A. Sau phản ứng phải dùng 25ml dd H2SO4 0.35g este đó cần 3g NaOH và thu được 7.

metyl acrylat. thu được 8. 1 để trung hoà dung dịch thu được.22g hỗn hợp hai este là đồng phân X và Y. B. Cho hỗn hợp muối đó tác dụng H2SO4 dư được hỗn hợp 3 axit X.188. C. 3. CH3CH2CH2COOH. Z là đồng đẳng kế tiếp của Y và có mạch cacbon không phân nhánh. Khi cho 3. 188. 196. C. HCOOC(CH3)3 và CH3COOCH(CH3)2. Y là A. CH3(CH2)3COOH. etyl axetat.868. CH3(CH2)3COOH. Tên gọi của hai este là A. (CH3)2CH-COOC2H5 và (CH3)3COOCH3. B. Biết rằng các gốc hiđrocacbon đều có độ phân nhánh cao nhất. Đun 7.91 Số gam iot có thể cộng vào liên kết bội trong mạch cacbon của 100g chất béo được gọi là chỉ số iot của chất béo.9g A với NaOH cho tới phản ứng hoàn toàn. Câu 1. Câu 1. 3.6g hỗn hợp muối. Sau khi kết thúc phản ứng. Câu 1. 90. Z lần lượt là A.19%. cần dùng 90ml dung dịch HCl 0. 65kg và 40kg. vinyl axetat.05. C. 22. C. (CH3)2CH-COOC2H5 và (CH3)2CHCH2COOCH3. C. CH3CH2CH2CH2COOH. B.Câu 1.90 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu. Số CTCT của E và CTCT của các axit X. Y. D.5kg và 41kg. (CH3)3CCOOH. để trung hoà NaOH dư phải dùng 10ml HCl 0. propyl fomiat. CTCT của X. D. 85.736. Biết hiệu suất quá trình este hoá và quá trình trùng hợp lần lượt là 60% và 80%. D. mạch hở. 215kg và 80kg. 18. D. 190. (CH3)3CCOOH. 192.20%. (CH3)2CHCOOH. Câu 1.9g hỗn hợp ancol trên tác dụng hết với Na thu được 0. Hoà tan 1g hỗn hợp axit trên vào 50ml NaOH 0. B. Câu 1.92 Một mẫu chất béo chứa gồm trilein và tripanmitin có chỉ số iot là 19. Chỉ số iot của chất béo được tạo nên từ axit linoleic là A.1%.05 mol khí. metyl propionat.2M. 191. D. 20. (CH3)2CHCOOH.87 Để xà phòng hoá hoàn toàn 2. B.88 Đun nóng hỗn hợp hai chất đồng phân (X. 2. 173.3M. etyl fomiat. Phân tử 10 khối trung bình của các axit béo trong thành phần cấu tạo của lipit và chỉ số xà phòng hoá của lipit và lần lượt là A. 273. 20. 287. cần dùng 30ml dd NaOH 1M. C. 170kg và 80kg. (CH3)2CHCOOH. Khi đốt cháy hoàn toàn hỗn hợp hai este đó thì thu được khí CO2 và hơi nước với tỉ lệ thể tích VH2O :VCO2 = 1:1 .920. trong đó X và Y là đồng phân của nhau. (CH3)2CHCOOH. D. 286. Y) với dung dịch H2SO4 loãng. 18 . Y. Phần trăm về khối lượng của một trong hai glixerit phải là A. C. 228. isopropyl fomiat. CH3CH2CH2COOH. B.18%. A. Câu 1. D.86 Đun 20g lipit với dung dịch chứa 10g NaOH. CH3COOC(CH3)3 và CH3CH2COOCH(CH3)2. B. CH3CH2CH2CH2COOH.5M. 86. metyl axetat. Z. thu được hai axit ankanoic kế tiếp nhau trong dãy đồng đẳng và hai ankanol.89 E là este của glixerol với một số axit monocacboxylic no. 2.

cấu tạo bởi một nhóm cacbonyl ở C1 (là anđehit) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]4CHO. cấu tạo bởi C1 của gốc α . Đơn vị monosaccarit thứ hai có nhóm OH semiaxetal tự do. CH2OH[CHOH]3-CO-CH2OH CH2OH[CHOH]4CHO b) Saccarozơ và mantozơ (C12H22O11) Saccarozơ là một đisaccarit. Cấu trúc phân tử a) Glucozơ và fructozơ (C6H12O6) Glucozơ là monosaccarit. Fructozơ là đồng phân của glucozơ. Cùng với dạng mạch hở fructozơ có thể tồn tại ở dạng mạch vòng 5 cạnh hoặc 6 cạnh H OH 2 H O OH H 5 2 1 O H O OH H 5 1 CH2OH 2 OH H 3 OH O OH H 5 HOCH2 3 1 OH 4 CH2OH H 6 HOCH2 3 OH H 4 CH2OH 6 4 CH2OH H 6 α -fructozơ fructozơ OH- β -fructozơ Trong môi trường bazơ.CHƯƠNG II. Trong dung dịch. Trong phân tử không còn nhóm OH semiaxetal. CACBOHIĐRAT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. nên không có khả năng mở vòng. cấu tạo bởi một nhóm cacbonyl ở vị trí C2 (là xeton) và năm nhóm – OH ở năm nguyên tử cacbon còn lại (là poliancol): CH2OH[CHOH]3COCH2OH. 19 . fructozơ có sự chuyển hoá thành glucozơ. Mantozơ là đồng phân của saccarozơ. Trong thiên nhiên. cấu tạo bởi C 1 của gốc α .hoặc β . do đó có thể mở vòng tạo thành nhóm anđehit (– CHO). glucozơ tồn tại chủ yếu ở hai dạng α -glucozơ và β glucozơ (dạng mạch vòng).glucozơ nối với C2 của gốc β fructozơ qua nguyên tử O (C1 – O – C2). hai dạng vòng này chiếm ưu thế và luôn chuyển hoá lẫn nhau theo một cân bằng qua dạng mạch hở.glucozơ qua nguyên tử O (C1 – O – C4).glucozơ nối với C4 của gốc α . H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 1 OH H 4 OH H 6 CH2OH 5 OH 3 O H 2 OH H 6 CH2OH 5 OH 3 H O H 2 OH H OH 1 O C 1 H H 4 OH α -glucozơ glucozơ β -glucozơ Glucozơ có đầy đủ các tính chất của rượu đa chức và anđehit đơn chức.

(*) phản ứng trong môi trường kiềm. không yêu cầu viết sản phẩm. 20 .c) Tinh bột và xenlulozơ (C6H10O5)n Tinh bột là polisaccarit. Tính chất hoá học Cacbohiđrat Glucozơ Tính chất T/c của anđehit + [Ag(NH3)2]OH T/c riêng của –OH hemiaxetal + CH3OH/HCl T/c của poliancol + Cu(OH)2 T/c của ancol (P/ư este hoá) + (CH3CO)2O Ag↓ + Ag↓ Fructozơ Saccarozơ Mantozơ Tinh bột Xenlulozơ Metyl glucozit - - Metyl glucozit - - dd màu xanh lam dd màu xanh lam dd màu xanh lam dd màu xanh lam - - + + + + + Xenlulozơ triaxetat Xenlulozơ trinitrat + + HNO3/H2SO4 P/ư thuỷ phân + H2O/H+ P/ư màu + I2 - + + + + - Glucozơ + Fructozơ Glucozơ Glucozơ Glucozơ - - - - màu xanh đặc trưng - (+) có phản ứng. nên công thức của xenlulozơ còn có thể viết [C6H7O2(OH)3]n. cấu tạo bởi các mắt xích β -glucozơ liên kết với nhau thành mạch kéo dài. (-) không có phản ứng. cấu tạo bởi các mắt xích α -glucozơ liên kết với nhau thành mạch xoắn lò xo. Xenlulozơ là đồng phân của tinh bột. 2. phân tử không có nhóm CHO và mỗi mắt xích còn 3 nhóm OH tự do. phân tử không có nhóm CHO và các nhóm OH bị che lấp đi.

→ H 2SO4 loaõ g n 14. C6H12O6  2C2H5OH + 2CO2↑ → o Ni.2H2O 16. CH2OH[CHOH]3COCH2OH ← CH2OH[CHOH]4CHO  12. (C6H10O5)n + nH2O  nC6H12O6 Hoaë H+ c (Tinh bột) 8. C12H22O11 + H2O  C6H12O6(Glucozơ) + C6H12O6(Fructozơ) → → 15.t0 Men lactic 6.CaO. t 0 cô n nC6H12O6 21 . 6 CH2OH H 4 OH 5 OH 3 H O H 2 OH H 1 OH H 6 CH2OH 5 OH 3 H OH − O H 2 OH H 1 + HOCH3 HCl 4 OH + H2O OCH3 metyl α -glucozit  → 11. C12H22O11 + Ca(OH)2 + H2O  C12H22O11.B . (C6H10O5)n + nH2O  → hoaë men c Axit voâ loaõ g.CaO. 6H–CHO → C6H12O6 10. CH2OH[CHOH]4CHO + 2Cu(OH)2  CH2OH[CHOH]4COOH + Cu2O↓ + → +2H2O t → 3NH 3 + O H 2 4.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP  → 1. CH 2 OH[CHOH]4 CHO + 2[Ag(NH 3) 2]OH  CH 2OH[CHOH] 4COONH 4 +2Ag ↓ + glucozơ amoni gluconat Men röôï u 5. CH2OH[CHOH]4CHO + H2  CH2OH[CHOH]4CH2OH → Sobit (Sobitol) t0 3.2H2O + CO2  C12H22O11 + CaCO3↓ 2H2O + → 17.t0 (pentaaxetyl glucozơ) + H2O 2. CH2OH[CHOH]4COOH + Fe  tạo phức màu vàng xanh.CH2OH[CHOH]4CHO+5CH3COOH ← CH3COOCH2[CHOOCCH3]4CHO  Xt. C12H22O11. CH2OH[CHOH]4CHO + Br2 + H2O  CH2OH[CHOH]4COOH + 2HBr → 3+ 13. (C6H10O5)n + nH2O t0  → xt: H + (Glucozơ) nC6H12O6 (Xenlulozơ) (Glucozơ) Ca(OH)2 9. C6H12O6  2CH3–CHOH–COOH → Axit lactic (axit sữa chua) Men → 7.

tinh bột 18. 68. ngược lại.0g. Trong môi trường bazơ. phản ứng với Cu(OH)2 và với dung dịch AgNO3 trong amoniac. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)m. 34. phản ứng với Na và với dung dịch AgNO3 trong amoniac. 3 loại. 4 loại. người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac. mantozơ. C. phản ứng với CuO và với dung dịch AgNO3 trong amoniac. D. 1.0g. B. 2.4 Những thí nghiệm nào chứng minh được cấu tạo phân tử của glucozơ? A. Cacbohiđrat là những hợp chất hữu cơ tạp chức và đa số chúng có công thức chung là Cn(H2O)m.2g. 2. Câu 2.0g. 1 loại. Cacbohiđrat là những hợp chất hữu cơ tạp chức. B.3 Có mấy loại cacbohiđrat quan trọng? A. t cô n 19. 21. 6nCO2 + 5nH2O Dieä luï p c  → a/ s maë trôø t i glucozơ (C6H10O5)n 0 Axit voâ loaõ g. 43. Cacbohiđrat là những hợp chất hữu cơ đa chức và đa số chúng có công thức chung là Cn(H2O)n.2g.BÀI TẬP CƠ BẢN Câu 2. 2. glucozơ. B. B. 43. D. 2. 22 . 68. C.5 Để tráng bạc một chiếc gương soi.1 Tìm từ thích hợp để điền vào chỗ trống trong đoạn văn sau: Ở dạng mạch hở glucozơ và fructozơ đều có nhóm cacbonyl. 1. glucozơ. D. 68. D. glucozơ. [C6H7O2(OH)3]n + 3nHONO2  [C6H7O2(ONO2)3]n + 3nH2O → (HNO3) xenlulozơ trinitrat C. fructozơ có thể chuyển hoá thành … và … A.2g. C. C. Câu 2. Câu 2. 2. D. (C6H10O5)n + nH2O  nC6H12O6 → xenlulozơ glucozơ H 2SO4 ñ. glucozơ.6g. t 0 20. Khối lượng bạc đã sinh ra bám vào mặt kính của gương và khối lượng AgNO 3 cần dùng lần lượt là (biết các phản ứng xảy ra hoàn toàn) A. 2 loại. 1.2 Cacbohiđrat là gì? A. ngược lại. C. phản ứng với NaOH và với dung dịch AgNO3 trong amoniac. B. Câu 2. còn trong phân tử fructozơ nhóm cacbonyl ở nguyên tử C số…. 43.BÀI TẬP TRẮC NGHIỆM I. ngược lại.0g. nhưng trong phân tử glucozơ nhóm cacbonyl ở nguyên tử C số ….

Cu(OH)2/OH . Tinh bột và xenlulozơ đều là polisaccarit. Cho từng chất tác dụng với dung dịch HNO3/H2SO4. chỉ khác nhau về cấu tạo của gốc glucozơ. Khi thuỷ phân đến cùng saccarozơ. [Ag(NH3)2]OH. C. C. Nước brom. lòng trắng trứng và rượu etylic. còn lại hồ tinh bột. Cả B.Câu 2.6 Phương án nào dưới đây có thể phân biệt được saccarozơ. B. D. Hoà tan từng chất vào nước. dung dịch HNO3. Câu 2. B. Cu(OH)2 trong môi trường kiềm.10 Chọn cách phân biệt các dung dịch sau đây: Lòng trắng trứng. D.8 Có bốn lọ mất nhãn chứa: Glixerol. dung dịch HNO3 đặc. Câu 2. C. dung dịch HCl. dung dịch CuSO4. dung dịch KMnO4. glixerol. Iot làm hồ tinh bột hoá xanh. Câu 2. D. A.9 Để phân biệt các chất: Glucozơ. còn lại lòng trắng trứng. B. 23 .7 Để phân biệt các dung dịch glucozơ.11 Có 4 dung dịch loãng không màu gồm: Lòng trắng trứng. Câu 2. NaOH. HNO3. Na kim loại. C. Chỉ dùng một thuốc thử nào sau đây để phân biệt chúng. D. C đều đúng. C. có thể chỉ dùng một thuốc thử nào sau đây? − A. Câu 2. glixerol. Cu(OH)2/OH .12 Chọn câu phát biểu sai: A. hồ tinh bột. Thuốc thử nào sau đây có thể dùng để phân biệt các dung dịch trong từng lọ trên ? A. ancol etylic. glixerol. glucozơ và axit axetic. dung dịch AgNO3/NH3. lòng trắng trứng tác dụng Cu(OH)2 cho màu xanh tím. tinh bột và xenlulozơ ở dạng bột? A. B. KOH và axit axetic. còn lại glixerol. B. glixerol tác dụng với Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. Câu 2. Cho từng chất tác dụng với dung dịch iot. C. C. anđehit axetic. sau đó đun nóng và thử với dung dịch iot. D. D. dung dịch brom. Cho từng chất tác dụng với vôi sữa Ca(OH)2. Iot làm hồ tinh bột hoá xanh. AgNO3/NH3. saccarozơ và anđehit axetic có thể dùng chất nào trong các chất sau làm thuốc thử ? − A. B. B. tinh bột và xenlulozơ đều cho một loại monosaccarit. A. Glixerol tác dụng Cu(OH)2 ở nhiệt độ thường tạo dung dịch xanh lam đặc trưng. Saccarozơ là một đisaccarit. khi đun nóng lòng trắng trứng đông tụ.

fructozơ.16 Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol là 1:1. 52. fructozơ. B. không mùi. không màu. sacacrozơ. C.99kg.89kg. axit axetic. Khối lượng AgNO3 cần dùng và khối lượng Ag tạo ra lần lượt là (giả thiết rằng. 28. fructozơ. C. D. fructozơ.8g. D. sự chuyển hoá của fructozơ là không đáng kể và hiệu suất các phản ứng đều đạt 90%) A. thì khối lượng glucozơ thu được là bao nhiêu ? Giả thiết rằng. vừa có tính chất của anđehit là A. Glucozơ. 27. 18. thu được 50g kết tủa. xenlulozơ. Saccarozơ. Glucozơ. A. Câu 2.14 Cho các chất glucozơ. 23.15 Để tráng bạc một số ruột phích. người ta phải dùng 100g saccarozơ. tinh bột. glucozơ và xenlulozơ.13 Cùng là chất rắn kết tinh. 0. B. C. 88. 24 . C. xenlulozơ. Giả thiết hiệu suất phản ứng là 80%. 91.444kg.500kg.5g. B. saccarozơ. Chất đó là chất nào trong các chất sau ? A. Saccarozơ.5g. B. fructozơ. A.74g. Saccarozơ. Glucozơ. Khi thuỷ phân đến cùng.4g. biết hiệu suất lên men là 80%. Chất này có thể lên men rượu (ancol). glucozơ và fructozơ. saccarozơ và tinh bột. D. Câu 2. 102. C. glucozơ. D. phản ứng xảy ra hoàn toàn. C. D. Câu 2. C. 0. glucozơ và tinh bột.18 Tính khối lượng glucozơ tạo thành khi thuỷ phân 1kg mùn cưa có 50% xenlulozơ.8g.0g. Glucozơ. 64. Câu 2.8g. glucozơ.80kg. tinh bột và xenlulozơ đều cho glucozơ. dễ tan trong nước. glucozơ.17 Khi thuỷ phân 1kg bột gạo có 80% tinh bột. mantozơ. 91. tinh bột. D.0g.0g. Câu 2.90kg. 0. D. tinh bột.690kg. Mantozơ. mantozơ. chỉ có glucozơ. 0. khối lượng ancol thu được là A. có vị ngọt là tính chất vật lí và trạng thái tự nhiên của nhóm chất nào sau đây? A. xenlulozơ. B. khí CO2 tạo thành được dẫn qua dung dịch nước vôi trong dư.6g. tinh bột. Chất vừa có tính chất của ancol đa chức. tất cả các chất đã cho. glucozơ và saccarozơ. B.D.555kg.21 Cho glucozơ lên men tạo thành ancol. D. Câu 2. 0. 0. D. 52. C. C. glucozơ. B. saccarozơ. hex-3-en. fructozơ. 0.19 Nhóm gluxit đều tham gia phản ứng thuỷ phân là A. Câu 2. fructozơ và saccarozơ. 0. Câu 2. Câu 2. B. B.74g. xenlulozơ.20 Nhóm gluxit đều có khả năng tham gia phản ứng tráng gương là A. 50.

103 lít. 336.103 lít. [Ag(NH3)2]OH.25 Biết CO2 chiếm 0.Câu 2. Phân biệt tinh bột và xenlulozơ bằng I2. Cu(OH)2. B. tinh bột. CH3COOH/H2SO4 đặc. Cu(OH)2.22 Chọn sơ đồ phản ứng đúng của glucozơ A. Saccarozơ. D.27 Chọn câu phát biểu sai: A. C. Câu 2. mantozơ. Na2CO3. H2O/H+. Mantozơ. Câu 2. Phân biệt glucozơ và fructozơ bằng phản ứng tráng gương. đun nóng. mantozơ. C. B. Glucozơ và fructozơ là đồng phân cấu tạo của nhau. C. H2/Ni. Tinh bột có cấu trúc phân tử mạch không phân nhánh. Saccarozơ. C. đun nóng. glucozơ tồn tại ở dạng mạch vòng ưu tiên hơn dạng mạch hở. B. Phân biệt mantozơ và saccarozơ bằng phản ứng tráng gương. 448.103 lít. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc. H2/Ni . [Ag(NH3)2]OH. NaOH.26 Glucozơ tác dụng được với tất cả chất trong nhóm chất nào sau đây? A. [Ag(NH3)2]OH. xenlulozơ. C6H12O6  m e → C2H5OH + O2 Câu 2. nhiệt độ. tinh bột. thể tích không khí (đktc) cần cung cấp cho cây xanh quang hợp để tạo 162g tinh bột là A.28 Chọn câu phát biểu đúng: A. D. 224. nhiệt độ. D. H2/Ni . nhiệt độ. B. Câu 2. Trong dung dịch. C6H12O6 + CuO  → Dung dịch màu xanh n D.24 Phát biểu nào sau đây không đúng ? A. [Ag(NH3)2]OH.glucozit không thể chuyển sang dạng mạch hở. Saccarozơ. xenlulozơ. 112. nhiệt độ. Metyl α . xenlulozơ.103 lít. B. Câu 2. Phân biệt glucozơ và saccarozơ bằng phản ứng tráng gương. Cu(OH)2. mantozơ. tinh bột. D. Câu 2. H2/Ni . C. 25 . Phân biệt saccarozơ và glixerol bằng Cu(OH)2.23 Nhóm gluxit khi thuỷ phân hoàn toàn đều chỉ tạo thành glucozơ là: A. C6H12O6 + Cu(OH)2  → kết tủa đỏ gạch n B.03% thể tích không khí. D. Cu(OH)2. B. C6H12O6  m e → CH3–CH(OH)–COOH C.

etanol. Glucozơ. 1500. 60g. 900.38 Gluxit không thể thuỷ phân được nữa là A. fructozơ. Câu 2. B.37 Một polisaccarit (C6H10O5)n có khối lượng phân tử là 162000u. [Ag(NH3)2]OH.34 Thuốc thử phân biệt glucozơ với fructozơ là A. [C6H7O2(OH)3]n. D. Cu(OH)2.31 Phản ứng khử glucozơ là phản ứng nào sau đây ? A. (C6H10O5)n. etanol. C. Glucozơ → etanol. B. men C. Y lần lượt là A. xenlulozơ. C. [C6H7O2(OH)2]n. Câu 2.32 Để điều chế 45g axit lactic từ tinh bột và qua con đường lên men lactic. B. Glucozơ. asmt → Câu 2. R(OH)x(CHO)y. B. là phản ứng Clorofin hoá học chính của quá trình nào sau đây? A. tinh bột. Glucozơ + Cu(OH)2. [C6H7O2(OH)3]n. 950. Glucozơ. quá trình khử. Câu 2. phản ứng với kim loại Na. C. Câu 2. tinh bột. Câu 2. H2. C. Glucozơ + H2/Ni . Khối lượng tinh bột cần dùng là A. D. quá trình hô hấp. Glucozơ + [Ag(NH3)2]OH. B. dung dịch Br2. (C6H10O5)n. Câu 2.35 Cacbohiđrat (gluxit) là những hợp chất hữu cơ tạp chức và có công thức chung là A. [C6H7O2(OH)3]n.30 Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → sobit. hiệu suất thuỷ phân tinh bột và lên men lactic tương ứng là 90% và 80%. Câu 2. B. D.33 Phản ứng chuyển glucozơ.nH2O. 56. Cn(H2O)m. CxHyOz. D. C. D. C. to. o C. saccarozơ. D. B. D.25g. 1000. etanol.C. mantozơ. C. t . fructozơ thành những sản phẩm giống nhau là A. D. mantozơ.36 Công thức phân tử và công thức cấu tạo của xenlulozơ lần lượt là A. 50g. (C6H12O6)n. phản ứng tráng gương. 56g. C. n có giá trị là A. D. Phân biệt saccarozơ và glixerol bằng phản ứng thuỷ phân. (C6H10O5)n. D. quá trình quang hợp.29 Phương trình: 6nCO2 + 5nH2O  (C6H10O5)n + 6nO2. Glucozơ.39 Cacbohiđrat khi thuỷ phân tạo ra 2 phân tử monosaccarit là 26 . glucozơ. C. xenlulozơ. D. B. Tên gọi X. Câu 2. B. quá trình oxi hoá. B. phản ứng với H2/Ni. Câu 2. phản ứng với Cu(OH)2. Dung dịch mantozơ có tính khử và bị thuỷ phân thành glucozơ. Câu 2.

B. Câu 2.44 Để xác định trong nước tiểu của người bị bệnh tiểu đường có chứa một lượng nhỏ glucozơ. Xenlulozơ. tinh bột. amilopectin. Câu 2. H2/Ni. phản ứng khử Cu(OH)2. phản ứng tráng gương. Saccarozơ. D.42 Chất không phản ứng với glucozơ là A.4%. phản ứng thuỷ phân. B. amilozơ. [Ag(NH3)2]OH. 0. C.3%. Cu(OH)2 ở nhiệt độ thường. Tinh bột. D.41 Polisaccarit khi thuỷ phân đến cùng tạo ra nhiều monosaccarit là A. mantozơ. phản ứng tráng gương. B. C. khử glucozơ bằng H2/Ni. glucozơ. Câu 2. Câu 2. Mantozơ. B. Câu 2.48 Phản ứng chứng tỏ glucozơ có nhiều nhóm OH ở các nguyên tử cacbon liên tiếp nhau là phản ứng với A. B. D. C. Câu 2. đều có trong biệt dược “huyết thanh ngọt”. xenlulozơ.A. C.2%.47 Tinh bột trong gạo nếp chứa khoảng 98% là A. D. đều lấy từ củ cải đường. lên men rượu etylic. Câu 2. oxi hoá glucozơ bằng [Ag(NH3)2]OH.40 Saccarozơ và glucozơ có đặc điểm giống nhau là A. nồng độ của glucozơ có giá trị hầu như không đổi là A. C. D. saccarozơ. B. xenlulozơ. phản ứng lên men rượu etylic. Cu(OH)2. glixerol. 0. 0. đều tham gia phản ứng tráng gương. amilozơ. alanin. D. B. C. fructozơ. Câu 2. C. amilozơ. C.46 Gluxit chuyển hoá thành glucozơ trong môi trường kiềm là A. B. Tinh bột. đều hoà tan Cu(OH)2 ở nhiệt độ thường tạo dung dịch màu xanh đặc trưng. C. Câu 2. phản ứng cộng hiđro. 0.45 Sobit (sobitol) là sản phẩm của phản ứng A. saccarozơ. tinh bột. 27 . B. phản ứng tráng gương.43 Trong máu người. B. to. saccarozơ. I2. phản ứng tráng gương. dung dịch AgNO3 trong dung dịch NH3. Saccarozơ. Xenlulozơ. có thể dùng 2 phản ứng hoá học là A. glucozơ tác dụng với Cu(OH)2. D. D. amilopectin. D.1%.

1%. Cacbohiđrat là những … và đa số chúng có công thức chung là … (1) dung dịch màu xanh lam. Cho etilen tác dụng với dung dịch H2SO4 loãng. (4). Khi bệnh nhân có lượng glucozơ trong máu từ 0. tác dụng với axit tạo sobitol. (7). (2). Từ hay cụm từ thích hợp ở những chỗ trống trong các câu ở đoạn văn trên lần lượt là A. B. phản ứng tráng gương. (6) phức bạc amoniac. (5). C. 28 . Cu(OH)2. (2). (3). (2). tác dụng với Cu(OH)2 tạo dung dịch có màu xanh đặc trưng. D. (1). B. (3). (1). (3) vị trí kề nhau. bị oxi hoá bởi … trong môi trường bazơ. Câu 2. (4). (2). (4). … cộng với hiđro cho …. dung dịch brom. phản ứng với CH3OH/HCl. (8). B. Câu 2. tác dụng với axit tạo este có 5 gốc axit. Lên men glucozơ. Câu 2. t . (4).52 Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm ? A. H2/Ni. D. (6). (5). (6). (4) fructozơ. C. (8). nóng. Câu 2. phản ứng với H2/Ni. (5). (7).49 Phản ứng chứng minh glucozơ có nhóm chức anđehit là A. Câu 2. (8) Cn(H2O)m. Cho hỗn hợp etilen và hơi nước qua tháp chứa H3PO4.1% → 0. Khi bệnh nhân có lượng glucozơ trong máu = 0. D. (8). (5) poliancol. B. Khi bệnh nhân có lượng glucozơ trong máu < 0. B. C. C.1%. phản ứng với AgNO3/NH3.C.1%.51 Khi nào bệnh nhân được truyền trực tiếp dung dịch glucozơ (còn được gọi với biệt danh “huyết thanh ngọt”). (3). (6). Thuỷ phân dẫn xuất etyl halogenua trong môi trường kiềm. Câu 2. vậy trong phân tử … ở … Tương tự như glucozơ. A. (1). phản ứng lên men rượu etylic. C. D. (6). phản ứng với Cu(OH)2. (2) có nhiều nhóm OH.50 Phân tử glucozơ tác dụng với Cu(OH)2 cho ….2%. (5). (8). D. D. D. (3). Khi bệnh nhân có lượng glucozơ trong máu > 0. (7).54 Phản ứng nào sau đây chứng tỏ glucozơ có dạng mạch vòng? A. B.53 Fructozơ không phản ứng với chất nào sau đây? A. (1). AgNO3/NH3. (7) hợp chất hữu cơ tạp chức. o C. to. Cu(OH)2 ở nhiệt độ cao. (7).

CH2O. cho toàn bộ lượng CO2 sinh ra hấp thụ vào dung dịch nước vôi trong tạo thành 10g kết tủa. C2H4O2. D.56kg. CH2O.BÀI TẬP NÂNG CAO Câu 2.32g. 15. (4).84kg. Y.26g. Y. (1). Z. 13. (2). Câu 2. B. B. nhưng chỉ 10% được sử dụng vào phản ứng tổng hợp glucozơ.56 Cho 10kg glucozơ chứa 10% tạp chất.60 Một cacbohiđrat (Z) có các phản ứng diễn ra theo sơ đồ chuyển hoá sau Cu(OH)2/NaOH to dung dịch xanh lam kết tủa đỏ gạch Z Vậy Z không thể là A. Z. Câu 2.57 Lên men a g glucozơ. ancol bị hao hụt 5%. 4.09J năng lượng mặt trời. C6H12O6. T. to. C. B. 90.4g. Khối lượng ancol etylic thu được bằng bao nhiêu? A. B. 88. Với một ngày nắng (từ 6h00 – 17h00) diện tích lá xanh là 1m2.8g H2O và cần một thể tích oxi vừa đúng bằng thể tích CO2 thu được. (2). C3H6O3. 6. C6H12O6. CH2O. (2). Tỉ lệ phân tử khối của X.58 Cho 4 chất hữu cơ X. 14. B. C. (3) [Ag(NH3)2]OH.55 Phản ứng tổng hợp glucozơ trong cây xanh cần được cung cấp năng lượng là 2813kJ cho mỗi mol glucozơ tạo thành. D. saccarozơ. D. giá trị của a là A. (3). D.26g.32g. C6H12O6. C2H4O2.4g CO2 thì kèm theo 1. Câu 2. B.59 Saccarozơ đều tác dụng được với nhóm chất nào sau đây ? (1) H2/Ni. 12.II. C3H6O3. Câu 2. 6CO2 + 6H2O C6H12O6 + 6O2 Nếu trong một phút. C6H12O6. Biết hiệu suất của quá trình lên men là 90%. CH2O. 5. C. (4) CH3COOH (H2SO4 đặc) A. (4). 88. Y. D. lên men thành ancol etylic. Khi oxi hoá hoàn toàn từng chất đều cho cùng kết quả: Cứ tạo ra 4. 29 . Trong quá trình chế biến. C.65kg. Công thức phân tử của X. C2H4O2. T lần lượt là 6:1:3:2 và số nguyên tử cacbon trong mỗi chất không nhiều hơn 6. 90. C. T lần lượt là A. C3H6O3. (1). glucozơ. Z. Câu 2. C2H4O2. (2) Cu(OH)2. Khối lượng dung dịch so với ban đầu giảm 3. C3H6O3. mỗi cm2 lá xanh nhận được khoảng 2. 4. lượng glucozơ tổng hợp được bao nhiêu? A.37kg.

65 Chọn câu đúng trong các câu sau: A. mantozơ. C.0. toàn bộ lượng CO2 sinh ra cho qua dung dịch Ca(OH)2 dư.52 g/ml) cần dùng là bao nhiêu ? A. thu được 750. 5031kg.28g CO2 và 1. (C6H10O5)n C6H12O6 CH3CHO CH3COOH CH3COOC2H5 C. B.01 mol một cacbohiđrat (X). C6H12O6.66 Để sản xuất ancol etylic người ta dùng nguyên liệu là mùn cưa và vỏ bào từ gỗ chứa 50% xenlulozơ.C. Xenlulozơ có phân tử khối nhỏ hơn tinh bột.125:1. Z là hợp chất hữu cơ. X. D. Công thức phân tử của X là A. Nếu muốn điều chế một tấn ancol etylic. 14.39 lít. B. Q. fructozơ. Y. C12H22O11. Xenlulozơ và tinh bột đều có phân tử khối rất lớn. Xenlulozơ và tinh bột có phân tử khối nhỏ.0. 30 . A. Biết rằng. Câu 2. 15. Z phù hợp với sơ đồ sau là Q X E CO2 C2H5OH Z Y E Q X Y Z A. D.39 lít. mỗi mũi tên biểu thị một phản ứng hoá học). nhưng phân tử khối của xenlulozơ lớn hơn nhiều so với tinh bột.62 Cho m g tinh bột lên men để sản xuất ancol etylic. B. B. Câu 2. tỉ lệ khối lượng H và O trong X là 0. Công thức của E. C12H22O11 C6H12O6 CH3COOH CH3COOC2H5 CH3COONa B.39 lít. D.70kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric 96% (D=1. Q. B. hiệu suất quá trình là 70% thì khối lượng nguyên liệu xấp xỉ A. Câu 2. C. Câu 2.98g H2O. Câu 2. 950. Xenlulozơ và tinh bột có phân tử khối gần bằng nhau. 24. X. C đều sai. C. (C6H10O5)n. thu được 5. 5000kg. 940. Biết hiệu suất mỗi giai đoạn lên men là 80%. D.61 Đốt cháy hoàn toàn 0. 15.00 lít.64 Xenlulozơ trinitrat là chất dễ cháy và nổ mạnh.2. Câu 2. (C6H10O5)n C6H12O6 CH3CHO CH3COONH4 CH3COOH D.63 Cho sơ đồ chuyển đổi sau (E. C12H24O12.5. 1000. B. được đều chế từ xenlulozơ và axit nitric. Y. Muốn điều chế 29. D. 949. Giá trị m cần dùng là bao nhiêu ? A.0g kết tủa. C.

1218. C.8 g/cm3. 76. Công thức phân tử của X là A. Tinh bột có phản ứng màu với iot do tinh bột có cấu tạo mạch ở dạng xoắn có lỗ rỗng. Tinh bột và xenlulozơ không thể hiện tính khử vì trong phân tử không có nhóm chức anđehit (–CH=O).8kg. Câu 2.8kg ancol etylic thành ancol 40o.71 Khí cacbonic chiếm tỉ lệ 0. D. 31 . Câu 2.6g CH3COOH. D. 77. tất cả đều sai. đồng thời khối lượng dung dịch tăng 0.25 lít. D. C.03% thể tích không khí. B. to.25 lít. D. 1382600 lít. Có thể phân biệt glucozơ và saccarozơ bằng phản ứng với Cu(OH)2 /OH-. 389. 400kg. xenlulozơ điaxetat và 6.84% và 22.1g kết tủa nữa. Sản phẩm được dẫn vào nước vôi trong thu được 0. 398. C. (C6H10O5)n.84% và 23. Biết khi làm bay hơi 0. Khối lượng ancol thu được là A. Có thể phân biệt mantozơ và đường nho bằng vị giác. B. Muốn tạo ra 500g tinh bột thì cần bao nhiêu lít không khí (đktc) để cung cấp đủ lượng CO2 cho phản ứng quang hợp? Giả thiết hiệu suất quá trình là 100% A.4104g X thu được thể tích khí đúng bằng thể tích 0.C.68 Cho xenlulozơ phản ứng với anhiđrit axetic (xúc tác H2SO4 đặc). B. B. Câu 2. 1402666. C.72 Đốt cháy hoàn toàn 0. B.70 Pha loãng 389. C.0815g.16%. 1382666. 5100kg. thu được 11.8kg. 6200kg. D.1g hỗn hợp X gồm xenlulozơ triaxetat.7 lít. Câu 2. 1206. Đun nóng dung dịch A lại được 0.125 lít.0552g hỗn hợp hơi ancol etylic và axit fomic đo trong cùng điều kiện.16%.1g kết tủa và dung dịch A.67 Chọn phát biểu sai: A. B. Thể tích dung dịch ancol thu được là A. biết khối lượng riêng của ancol etylic là 0. 77% và 23%. 390kg. C18H36O18.69 Lên men 1 tấn tinh bột chứa 5% tạp chất trơ thành ancol etylic. D. C12H22O11. Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A. C. Câu 2. 70% và 30%. C6H12O6. hiệu suất của mỗi quá trình lên men là 85%.7 lít. tất cả đều sai.0855g một cacbohiđrat X. D. Câu 2. 1246.

57 D 2.20 D 2.68 B 2.39 C 2. AMIN – AMINO AXIT – PROTEIN A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.3 C 2.52 B 2.. NH2 H2N CH CO 1 R .21 A 2.18 B 2.34 C 2.2 B 2.8 C 2.38 D 2.69 C 2.65 D 2.25 B 2.28 C 2. chẳng hạn các gốc ankyl có hiệu ứng +I.22 B 2.  Những nhóm đẩy electron.29 B 2.32 B 2.64 A 2.48 B 2. NH CH COOH n R amin α . Tính chất a) Tính chất của nhóm NH2 + Tính bazơ R NH2 + H2O [R NH3]+ + OH- Tác dụng với axit cho muối: R NH2 + HCl [R NH3]+Cl- Lưu ý: Mọi yếu tố làm tăng mật độ electron ở nguyên tử nitơ trong phân tử amin trung hoà nói chung đều làm tăng tính bazơ (trừ trường hợp chịu ảnh hưởng của hiệu ứng che chắn không gian và khả năng solvat hoá trong dung môi nước). R CH COOH.1 A 2.33 C 2.58 C 2.45 A 2.50 C 2. Cấu tạo phân tử: Các nhóm đặc trưng R NH2.31 A 2.13 A 2.6 C 2.4 D 2.15 A 2.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG II 2.16 B 2.44 C 2.55 A 2.46 C 2.40 C 2.53 C 2.56 B 2.5 C 2.67 A 2.19 C 2.61 C 2.10 D 2.42 D 2.amino axit peptit 2.30 A 2.66 A 2.11 B 2..36 B 2.41 B 2.71 A 2.23 C 2.37 C 2.12 C 2. 32 .17 D 2.70 C CHƯƠNG III.43 A 2.26 B 2.24 D 2.35 A 2.47 B 2. sẽ làm cho tính bazơ tăng lên.54 D 2.51 B 2.60 B 2.9 B 2.62 B 2.49 D 2.72 A 2.59 B 2.63 B 2.14 A 2.27 D 2.7 A 2.

do đó khả năng nhận proton của anilin giảm. đun nóng dung dịch muối điazoni sẽ tạo ra phenol và giải phóng nitơ. chỉ cần nêu hiện tượng. đồng thời trong phân tử xuất hiện hiệu ứng liên hợp p .hay ArN2Cl + NaNO2 + HCl  Thí dụ: C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O (1*)    (anilin) (phenylđiazoni clorua) Đun nóng dung dịch muối điazoni: +  t0 C 6 H N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl (2*) →  5   Lưu ý: Trong công thức phân tử không cần viết các phản ứng (1* và 2*). ngược lại càng có nhiều nhóm gây hiệu ứng –C tính bazơ sẽ càng giảm. − Amin bậc 1 • Amin béo bậc 1 Tác dụng với axit nitrơ tạo ancol tương ứng và giải phóng khí nitơ (hiện tượng sủi bọt khí). càng thay thế nhiều nguyên tử H trong phân tử NH3 bằng những nhóm có hiệu ứng đẩy electron +I tính bazơ càng tăng.π theo chiều chuyển dịch electron hướng vào vòng benzen. Điều này được giải thích là: Amin thơm chứa vòng benzen hút electron. sẽ làm tính bazơ yếu đi. làm giảm mật độ điện tích âm ở nguyên tử N. Vì vậy. Ngược lại nhóm phenyl có hiệu ứng –C hút electron. ArNH2 + HNO2 + HCl 0-5oC -2H2O ArN2+Cl. + Tác dụng với HNO2 Dựa vào khả năng phản ứng khác nhau đối với HNO 2 của các amin mỗi bậc. HCl R NH2 + HONO R OH + N2 + H2O NaNO + HCl 2 Thí dụ: C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  • Amin thơm bậc 1 Tác dụng với axit nitrơ trong môi trường axit ở nhiệt độ thấp tạo muối điazoni. nên phải dùng hỗn hợp (NaNO2 + HCl). ta có thể viết: (CH3)2NH > CH3NH2 > NH3 > C6H5NH2 > (C6H5)2NH > (C6H5)3N. Thực tế HNO2 không bền. 33 .  Về nguyên tắc. người ta có thể phân biệt được chúng. Vì vậy các amin mạch hở có tính bazơ mạnh hơn (dung dịch trong nước của chúng có thể làm xanh giấy quỳ) so với amin thơm (Anilin không làm xanh giấy quỳ).

− Amin bậc 2 Các amin bậc 2 thuộc dãy thơm hay dãy béo đều dễ dàng phản ứng với HNO2 tạo thành nitrozamin (Nitroso) màu vàng: R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (Nitroso – màu vàng) − Amin bậc 3: Không phản ứng (không có hiện tượng gì).. NH CH R3 CH R2 COOH + H2N R3 COOH + H2N Rn COOH+ .. + H2N 4 COOH + nH2O hay2enzim H SO CH2 Rn COOH + Phản ứng màu với Cu(OH)2 cho dung dịch màu xanh tím (dùng để nhận biết protein).và ω . e) Anilin và nhiều protein có phản ứng thế dễ dàng nguyên tử H của vòng benzen NH2 NH2 Br Br (trắng) Br (dd) + 3Br2(dd) + 3HBr(dd) 34 .. + Tác dụng với dẫn xuất halogen: R NH2 + CH3I R NHCH3 + HI b) Amino axit có tính chất của nhóm COOH Tính axit RCH(NH2)COOH + NaOH RCH(NH2)COONa + H2O Phản ứng este hoá: 2 4 RCH(NH2)COOH + R1OH RCH(NH2)COOR1 + H2O c) Amino axit có phản ứng giữa nhóm COOH và nhóm NH2 Tạo muối nội (ion lưỡng cực): H SO H3N+ CH COO- H2N CH COOH R R Phản ứng trùng ngưng của các ε .amino axit tạo poliamit: NH [CH2]5 CO n + nH2O d) Protein có phản ứng của nhóm peptit CO-NH + Phản ứng thuỷ phân: H 2N CH 1 R H2 N nH2N [CH2]5 COOH to CO HN CH R1 CH CO HN CH R2 CH CO ..

C2H5–NH2 + HONO → C2H5–OH + N2↑ + H2O  + NaNO + HCl  2 2. R – NH2 + HCl  R – NH3Cl → 35 . CH3NH2 + H–COOH  H–COONH3CH3 → metylamoni fomiat 7. 3R – OH + NH3  (R)3N + 3H2O → C2H5OH → 20. P 17. H2N + H2SO4 180oC H2N NH2 SO3H + H2O 13. R–NO2 + 6 [ H ]  R–NH2 + 2H2O → Fe + HCl C6H5–NH2 + 2H2O 15.B . R(R’)N – H +HO – N=O  R(R’)N – N =O + H2O → (nitroso – màu vàng)  → 5. R – Cl + NH3  R – NH2 + HCl 1000C 21. R – OH + NH3  R–NH2 + H2O → Al 2O3. C6H5NH2 + H2SO4  C6H5NH3HSO4 → 11. CH3NH3Cl + NaOH  CH3NH2 + NaCl + H2O → 9. C6H5NH2 + HCl  C6H5NH3Cl → phenylamoni clorua 8. NH2 Br Br (dd) + 3Br2(dd) Br Fe + HCl + 3HBr(dd) 14. P 18. C6H5–NH2+HONO+HCl → C 6 H 5 N ≡ N  Cl +2H2O    +   3. P 19. R–NO2 + 6HCl + 3Fe  R–NH2 + 3FeCl2 + 2H2O → Al 2O3. C6H5–NO2 + 6 [ H ]  → Cũng có thể viết: 16. C 6 H 5 N ≡ N  Cl + H2O  C6H5OH + N2↑+ HCl →   t0 4. 2R – OH + NH3  (R)2NH + 2H2O → Al 2O3. CH3 – NH2 + H2O ← CH3 – NH3+ + OH 6.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP NaNO + HCl 2 1. 2C6H5NH2 + H2SO4  [C6H5NH3]2SO4 → 12. C6H5NH2 + CH3COOH  CH3COONH3C6H5 → 10.

C. amoniac < etylamin < phenylamin. nH2N[CH2]5COOH nH2N[CH2]6COOH xt. B. thêm vài giọt dung dịch H2SO4. 3R – Cl + NH3  (R)3N + 3HCl 1000 C  →  → 26. ClH3N–R–COOH + 2NaOH  H2N–R–COONa + NaCl + H2O → HCl 38. 2(H2N)bR(COOH)a + aNa2O  2(H2N)b R(COONa)a + aH2O → HCl  → 32. [H3N+–R–COOR’]Cl. H2N–R–COOH + R’–OH + HCl ←  [H3N+–R–COOR’]Cl. H2NR(COOH)a + aNaOH  H2N(COONa)a + aH2O → 28.C2H5OH → 22.2 Cách thuận lợi nhất để nhận biết lọ đựng dung dịch CH3NH2 là A. C. 2(H2N)bR(COOH)a + aBa(OH)2  [(H2N)bR(COO)a]2Baa + 2aH2O → 1 29. phenylamin và amoniac đúng là A.1 Sự sắp xếp theo trật tự tăng dần tính bazơ giữa etylamin.BÀI TẬP TRẮC NGHIỆM I. to. 2R – Cl + NH3  (R)2NH + 2HCl 1000 C C2H5OH → 25.BÀI TẬP CƠ BẢN Câu 3. thêm vài giọt dung dịch Na2CO3 D. B. Đưa đầu đũa thuỷ tinh đã nhúng vào dung dịch HCl đậm đặc lên phía trên miệng lọ đựng dung dịch CH3NH2. Câu 3. 2(H2N)bR(COOH)a + bH2SO4  [(H3N)bR(COOH)a]2(SO4)b → 37. to.+ NH3  H2N–R–COOR’ + NH4Cl → 35. phenylamin < amoniac < etylamin. 36 xt. phenylamin < etylamin < amoniac. CH3CH(Br)COOH + 3NH3  CH3CH(NH2)COONH4 + NH4Br → C. 41. H2N–R–COOH ← H2N–R–COO. H2N–R–COOH + HONO  HO–R–COOH + N2↑ + H2O → 39.+ H+ ← H3N+–R – COO  27. p . H2N–R–COOH + Na  H2N–R–COONa + H2 → 2 30. H2N–R–COOH + HCl  ClH3N–R–COOH → 36. p NH[CH2]5CO n + nH2O HN[CH2]6CO n + nH2O 40. R – Cl + NH3  R – NH3Cl 1000C 23. D.+ H2O  34. H2N–R–COOH + R’–OH ←  H2N–R–COOR’ + H2O  HCl   → 33. (H2N)b R (COOH)a + aNa  (H2N)bR(COONa)a + → a 2 H2 31. R – NH3Cl + NaOH  R – NH2 + NaCl + H2O → C2H5OH → 24. etylamin < amoniac < phenylamin. nhận biết bằng mùi.

CH2(NH2)COOH. D. Đốt cháy hoàn toàn 8. 4. 190. C. B. 191.2g CO2. CH2(NH2)COOCH3. CH(NH2)2COOCH3.8 Este A được điều chế từ amino axit B (chỉ chứa C. 4. thì số mắt xích alanin trong phân tử A là bao nhiêu? A. 6.4 Số lượng đồng phân amin bậc 2 ứng với công thức phân tử C4H11N là A. D. C. 5. Nếu phân tử khối của A là 50. Câu 3. Tỉ khối hơi của A so với H2 là 44. B. H.5 Số lượng đồng phân amin có chứa vòng benzen ứng với công thức phân tử C7H9N là A. glixerol. Câu 3. Amino axit thường tồn tại dưới dạng …(5)…cân bằng với dạng …(6)… (1) (2) (3) (4) (5) (6) A.9 Thuốc thử nào dưới đây dùng để phân biệt các dung dịch glucozơ. Câu 3. HCl. D. B. 3.7 Có 3 chất hữu cơ gồm NH2CH2COOH. 2. D. D.10 Khi thuỷ phân 500g protein A thu được 170g alanin. CH2(NH2)COOCH3.12 lít N2 (đktc). B. xeton metyl axit lưỡng tính nguyên tử cation Câu 3. N) và ancol metylic. AgNO3/NH3. NaOH. B. CH3CH2COOH và CH3[CH2]3NH2. CH3OH/HCl. 37 . C. CH2(NH2)COOH. 2. O. Câu 3. C. trong phân tử của nó vừa có nhóm …(1)…vừa có nhóm …(2)…nên vừa có tính chất …(3)…vừa có tính chất … (4)…. quỳ tím. Câu 3. Để nhận ra dung dịch của các hợp chất trên.3 Số lượng đồng phân ứng với công thức phân tử C3H9N là A. C. hiđroxyl metylen khử oxi hoá cation anion D.3g H2O và 1. 189. C. 5. 3. CH(NH2)2COOH. B. NaOH. B. 192. etanol và lòng trắng trứng? A. CH(NH2)2COOH. amino cacboxyl bazơ Axit phân tử cực C. 5. chỉ cần dùng thuốc thử nào sau đây? A.9g este A thu được 13. 2. D.5. Câu 3. amin cacbonyl oxi hoá Axit phân tử phân tử ion lưỡng B. C. CH(NH2)2COOCH3. 4. HNO3. B lần lượt là A.6 Amino axit là một hợp chất hữu cơ tạp chức.000. 3. Công thức cấu tạo thu gọn của A. D.Câu 3. Cu(OH)2.

Câu 3.11 Chất nào sau đây không có phản ứng với dung dịch C2H5NH2 trong H2O? A. HCl. B. H2SO4. C. NaOH. D. quỳ tím. Câu 3.12 Glixin phản ứng được với tất cả các chất trong nhóm chất nào sau đây (điều kiện phản ứng xem như có đủ): A. Quỳ tím , HCl , NH3 , C2H5OH. B. NaOH, HCl, C2H5OH, CH2 COOH.
NH2

C. Phenoltalein , HCl , C2H5OH , Na. D. Na , NaOH , Br2 , C2H5OH. Câu 3.13 Tìm công thức cấu tạo của hợp chất hữu cơ X chứa 32% C; 6,667% H; 42,667% O; 18,666% N. Biết phân tử X có một nguyên tử N và X có khả năng tham gia phản ứng trùng ngưng. A. H2NCH2COOH. B. C2H5NO2. C. HCOONH3CH3. D. CH3COONH4. Câu 3.14 Hợp chất hữu cơ A có công thức phân tử là C3H7O2N, A tác dụng được với dung dịch NaOH, dung dịch HCl và làm mất màu dung dịch brom. Công thức cấu tạo đúng của A là A. CH3CH(NH2)COOH. B. CH2=CHCOONH4. C. HCOOCH2CH2NH2. D. H2NCH2CH2COOH. Câu 3.15 Cho các chất: etylen glicol (1), axit aminoaxetic (2), axit oxalic (3), axit acrylic (4). Những chất có thể tham gia phản ứng trùng ngưng là A. (1), (2), (3). B. (1), (2). C. Chỉ có (2). D. Cả bốn chất. Câu 3.16 Có các dung dịch chứa trong các lọ mất nhãn sau: Lòng trắng trứng, hồ tinh bột, glixerol. Thuốc thử có thể dùng để phân biệt các dung dịch trên là A. Cu(OH)2. B. I2. C. AgNO3. D. cả A, B đều đúng. Câu 3.17 Số đồng phân của hợp chất hữu cơ thơm có công thức phân tử C7H7NO2 là A. 7. B. 6. C. 5. D. 8. Câu 3.18 Số đồng phân của các chất có công thức phân tử C4H10O (1), C4H9Cl (2), C4H10 (3), C4H11N (4) theo chiều tăng dần là A. (3), (2), (1), (4). B. (4), (1), (2), (3). C. (2), (4), (1), (3). D. (4), (3), (2), (1). 38

Câu 3.19 Cho sơ đồ phản ứng: NaOH C9H17O4N (X)  C5H7O4NNa2 (Y) + 2C2H5OH. → Công thức cấu tạo thu gọn của X, Y lần lượt là A. C2H5OOCCH2CH(NH2)CH2COOC2H5, NaOOCCH2CH(NH2)CH2COONa. B. CH3OOCCH2CH(NH2)CH2COOC3H7, NaOOCCH2CH(NH2)CH2COONa. C. HOOCCH2CH(NH2)CH2COOC4H9, NaOOCCH2CH(NH2)CH2COONa. D. CH3OOCCH2CH(NH2)CH2COOCH(CH3)2, NaOOCCH2CH(NH2)CH2COONa. Câu 3.20 Chọn phát biểu đúng về hợp chất tạp chức: A. Hợp chất hữu cơ có từ hai loại nhóm chức trở lên. B. Hợp chất hữu cơ có từ hai nhóm chức trở lên. C. Hợp chất hữu cơ có nhiều nhóm chức. D. Hợp chất hữu cơ có hai nhóm chức. Câu 3.21 Trong sơ đồ sau, công thức cấu tạo thu gọn phù hợp của A, B, C, D, E lần lượt là
2 2 2 2 + NH 3 + dd NaOH → → → → Etan  A  B  C  D  E  → → 1:1 Cu 1:1 Mn2+ Glixin. A. C2H5Cl, C2H5OH , CH3CHO, CH3COOH , CH3COOCl. B. C2H5Cl, C2H5OH , CH3CHO, CH3COOH, CH2ClCOOH. C. C2H5Cl, C2H5OH , CH3 COCH3, CH3COOH, CH2ClCOOH. D. C2H5Cl, C2H5OH , CH3COOH, CH3COCH3, CH2ClCOOH. Câu 3.22 Cho 3 chất hữu cơ: NH2CH2COOH (1); CH3CH2CH2CH2NH2 (2); CH3CH2COOH (3). Nhiệt độ nóng chảy của chúng được xếp theo trình tự giảm dần là A. (2) < (3) < (1). B. (1) > (3) > (2). C. (3) < (2) < (1). D. (2) > (1) > (3). Câu 3.23 Hợp chất đa chức và hợp chất tạp chức giống nhau ở chỗ A. đều là hợp chất có nhiều nhóm chức. B. đều là hợp chất chứa các nhóm chức giống nhau. C. phân tử luôn có liên kết π. D. mạch cacbon trong phân tử có liên kết π . Câu 3.24 X là một axit α -monoamino monocacboxylic, có tỉ khối hơi so với không khí là 3,07. X là A. glixin. B. alanin. C. axit α - aminobutiric. D. axit glutamic.

+ Cl

+O

+O

+ Cl

39

Câu 3.25 Khi đun nóng chất béo với dung dịch kiềm “....”
A. luôn thu được glixerol và phản ứng xảy ra thuận nghịch. B. luôn thu được glixerol, phản ứng xảy ra nhanh hơn và một chiều. C. luôn thu được muối của axit béo và phản ứng xảy ra thuận nghịch. D. luôn thu được xà phòng, phản ứng xảy ra chậm hơn. Chọn một phương án trong số các phương án trên để điền vào chỗ trống trong câu sao cho đúng ý nghĩa hoá học.

Câu 3.26 Amino axit là
A. hợp chất hữu cơ đa chức, có chứa 2 nhóm chức COOH và NH2. B. hợp chất hữu cơ đa chức, có chứa 2 loại nhóm chức COOH và NH2. C. hợp chất hữu cơ tạp chức, có chứa 2 nhóm chức COOH và NH2. D. hợp chất hữu cơ tạp chức, có chứa 2 loại nhóm chức COOH và NH2.

Câu 3.27 Công thức tổng quát của amino axit là A. RCH(NH2)COOH. B. R(NH2)x(COOH)y. C. R(NH2)(COOH). D. RCH(NH3Cl)COOH. Câu 3.28 Chọn câu phát biểu sai: A. Amino axit là hợp chất hữu cơ tạp chức. B. Tính bazơ của C6H5NH2 yếu hơn NH3. C. Công thức tổng quát của amin no, mạch hở, đơn chức là CnH2n + 3N (n ≥ 1). D. Dung dịch của các amino axit đều làm quỳ tím chuyển sang màu đỏ. Câu 3.29 Hai phương trình phản ứng hoá học sau, chứng minh được nhận định rằng: H2NCH2COOH + NaOH → H2NCH2COONa + H2O. H2NCH2COOH + HCl → HOOCCH2NH3Cl. A. Glixin là một axit. B. Glixin là một bazơ. C. Glixin là một chất lưỡng tính. D. Glixin là một chất trung tính. Câu 3.30 Hợp chất hữu cơ X có công thức cấu tạo thu gọn: HOOCCH2CH2CH(NH2)COOH. Tên gọi của X là A. glixin. B. alanin. C. axit ađipic. D. axit glutamic. Câu 3.31 Cho sơ đồ chuyển hoá sau:
X
H2SO4 - Na2SO4

Y

C2H5OH, H2SO4, to - Na2SO4

CH3

CH

COO

C2H5

NH3HSO4
CH COONa, CH3 CH COOH.

Công thức cấu tạo phù hợp của X, Y lần lượt là
A. CH3 C. CH3 CH COONa, CH3 CH COOH. B. CH3 D. CH3 NH2 CH COONa, CH3 NH2 NH2 CH COOH. NH3HSO4 NH3HSO4 CH COOH, CH3 NH3HSO4 NH2 CH COOH. NH2

Câu 3.32 Phương trình phản ứng hoá học sau chứng minh được rằng: H2NCH2COOH + C2H5OH 40
H+, to

H2NCH2COOC2H5 + H2O.

B.39 Sản phẩm của phản ứng este hoá giữa amino axit X và metanol thu được este có tỉ khối hơi so với propin bằng 2. D. D. triphenylamin. Protein có trong mọi bộ phận của cơ thể động vật là hợp chất hữu cơ đa chức. H nối với O của ancol linh động hơn axit. C.A. Các protein đều chứa các nguyên tố C .36 Chọn câu phát biểu sai: A.40 Cho dung dịch metylamin đến dư vào các dung dịch sau: FeCl3. C. điphenylamin. NaOOC – CH2 – CH2 – CH(NH2) – COOH. NH2 C6H5 C. C6H5 NH2 D. C đều sai. B. Câu 3. HOOC – CH2 – CH2 – CH(NH2) – COOH. C. Amino axit có tính lưỡng tính. có công thức cấu tạo thu gọn là A. protein bị thuỷ phân tạo ra các amino axit.225. H nối với O của axit linh động hơn ancol. Câu 3.38 Tính bazơ của amin nào trong số các amin sau đây là yếu nhất ? A. alanin. B. không xác định được. C. HOOC – CH2 – CH2 – CH(NH2) – COONH4. Zn(NO3)2.37 Để điều chế glixin theo sơ đồ: Axit axetic → axit cloaxetic → glixin.34 Muối của axit glutamic dùng làm bột ngọt (còn gọi là mì chính).33 Điều khẳng định nào sau đây là sai ? A. 41 . Câu 3. D. CH2 CH COOH.35 Công thức cấu tạo thu gọn của axit 2 – amino – 3 – phenylpropanoic là A. Amin đơn chức đều chứa một số lẻ nguyên tử H trong phân tử. H . D. Clo và amin. C. Amino axit tham gia phản ứng trùng ngưng. Cần dùng thêm các chất phản ứng nào sau đây (không kể xúc tác): A. Glixin có nhóm COOH. Tên gọi của X là A. D. Câu 3. B. Câu 3. NaOOC – CH2 – CH2 – CH(NH2) – COONa. B. C. B. Câu 3. axit glutamic. Ở nhiệt độ thường dưới tác dụng của men. C. CH3 CH2 CH C6H5 NH2 COOH. D. B. D. Axit clohiđric và muối amoni. tất cả A. glixin. anilin. CH3 CH2 CH NH2 C6H5 COOH. 0. CH3COOK thì số lượng kết tủa thu được là A. B. Hiđroclorua và amoniac. B. Phân tử khối của một amin đơn chức luôn là số chẵn. Câu 3. 1. O . B. Glixin có nhóm NH2. Câu 3. Một số protein bị đông tụ khi đun nóng. Clo và amoniac. CuSO4. N. CH2 CH COOH.

Câu 3. C3H9N và C4H11N.3M.42 Cho dung dịch metylamin đến dư vào các dung dịch sau: (CH3COO)2Cu. X còn có khả năng tham gia phản ứng trùng hợp. Sự đông tụ của protit.45 Hỗn hợp (X) gồm hai amin đơn chức. C. D. D. riêu cua nổi lên được giải thích là do: A. Có phản ứng hoá học của NaCl với chất có trong nước lọc khi xay (giã) cua. 1. Tính bazơ của các amin đều mạnh hơn NH3.04g hỗn hợp Y gồm hai amin đơn chức. C.41 Cho 15g hỗn hợp các amin gồm anilin. Câu 3. Biết trong hỗn hợp. 42 . CH3 CH2 CH2 CH2 C NH2.825g. metylamin. mạch hở tác dụng vừa đủ với dung dịch HCl thu được 5. C = O. không làm mất màu dung dịch Br2. 2. B. Ngoài ra.C.46 Cho 3. (CH3COO)2Pb. CH3COOAg. C. khí H2. D. CH5N và C2H7N. 0. khi tác dụng với dung dịch NaOH chỉ thu được sản phẩm hữu cơ duy nhất. D. CH2 CH2 NH O C. kết quả khác. Câu 3. Khối lượng sản phẩm thu được có giá trị là A. H2N[CH2]4 CHO.44 Điều chế anilin bằng cách khử nitrobenzen thì dùng chất khử nào sau đây ? A. Tất cả các nguyên nhân nêu ở A.123g. Các amin đều kết hợp với proton. C. Câu 3. số mol hai amin bằng nhau. C. 0.52g X tác dụng vừa đủ với 200ml dung dịch HCl thu được 2. no. NH3. cacbon. D. không đủ dữ kiện để tính. C.1M. D.02 mol và 0. (CH3COO)2Mg. 16. B. Công thức tổng quát của amin no. kết quả khác.06 mol và 0.47 Hợp chất hữu cơ (X) có công thức phân tử CxHyNO có khối lượng phân tử bằng 113u. B. C. Câu 3.98g muối. D. B. 21. Metylamin có tính bazơ mạnh hơn anilin.48 Hãy chỉ ra câu sai trong các câu sau: A.43 Khi nấu canh cua. D. thì số lượng kết tủa thu được là A. mạch hở là CnH2n+2+kNk. Các chất bẩn trong cua chưa được làm sạch hết. đietylmetylamin tác dụng vừa đủ với 50ml dung dịch HCl 1M. 20. 0. kết quả khác. B. Câu 3. C. 2. C3H9N và C2H7N. 0. Cho 1.2M.04 mol và 0. X có đặc điểm cấu tạo và các tính chất sau: phân tử có mạch cacbon không phân nhánh. Công thức cấu tạo của X là CH2 CH2 CH2 A.18g. D. Tổng số mol hai amin và nồng độ mol/l của dung dịch HCl là A. B. Câu 3. Câu 3. B.96g muối. B. 3. Công thức phân tử của hai amin là A. 3. đimetylamin. Fe + dung dịch HCl. B.

54 Dung dịch X chứa HCl và H2SO4 có pH = 2. CH3 . CH3 Câu 3.52 Khi đốt cháy hoàn toàn một amin đơn chất X. C2H5NH2 và C4H9NH2.6g khí cacbonic. D. A và C đúng. Câu 3. D.BÀI TẬP NÂNG CAO Câu 3. CH3-CH2-CH2-NH2.68g hỗn hợp muối. CH3-CH2-CH2-NH2. Để trung hoà hoàn toàn 0. C3H9N. etylamin.44 lít khí nitơ. C3H9N. D. đơn chức là đồng đẳng liên tiếp của nhau. Câu 3. 8. 9. C4H9N. C4H11N. X có công thức phân tử là A.53 Cho 20g hỗn hợp gồm 3 amin no. C5H13N. C. Công thức cấu tạo của A. B. CH3 . đimetylamin. đơn chức. C4H11N. là đồng đẳng liên tiếp. 43 .50 Có hai amin bậc một gồm A (đồng đẳng của anilin) và B (đồng đẳng của metylamin). C2H7N. C5H11N. Câu 3. Nếu 3 amin trên được trộn theo tỉ lệ số mol 1:10:5 và thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là A. 9. CH5N và C2H7N. C2H7N và C3H9N. B lần lượt là NH2 NH2 A. B. C5H13N. C. B. cô cạn dung dịch thu được 31. C4H9-NH2. C2H7N. CH3-C6H4-NH2 . Công thức phân tử của hai amin lần lượt là A. C3H7N. D. Giả thiết không khí chỉ gồm nitơ và oxi. 12. 7. Đốt cháy hoàn toàn 3. C. trong đó nitơ chiếm 80% thể tích (các V đo ở đktc).6g hơi nước và 69. etylamin hoặc đimetylamin. thu được 2. C3H9N. C4H11N. thu được 17.6g H2O. C3H7NH2 và C4H9NH2. D. CH3-C6H4-NH2 .49 Đốt cháy hoàn toàn hỗn hợp hai amin no. Khi đốt cháy amin B thấy VCO2 : VH2O = 2 : 3 . đơn chức. B. CH3-CH-NH2. etylamin. C3H9N. C. CH3N.4 lít N2 (các V đo ở đktc). tác dụng vừa đủ với dung dịch HCl. D. Công thức phân tử của 2 amin là A.21g amin A sinh ra khí CO 2.125g H2O.59g hỗn hợp 2 amin no. C. hơi H2O và 336 cm3 khí N2 (đktc). C3H9N và C4H11N. Giá trị m và tên gọi của amin là A.4 lít khí CO2 và 1. người ta thu được 10.51 Đốt cháy hoàn toàn m g một amin A bằng lượng không khí vừa đủ. 8. bậc I (có số nguyên tử C nhỏ hơn hoặc bằng 4) phải dùng một lít dung dịch X.Câu 3. C. CH3NH2 và C4H9NH2. B. C2H7N. kết quả khác. II.24 lít khí CO2 (đktc) và 3. Biết rằng tên của A có tiếp đầu ngữ “para”. B.

8 ≤ X < 2.2. B tác dụng với H mới sinh tạo ra B’. Amino axit là loại hợp chất hữu cơ . C4H9NO2. 0.5. H2NC3H6COOH. Công thức cấu tạo thu gọn của A. Mặt khác. cả A. H2NC3H6COOH. B.5M. Biết A tác dụng với cả HCl và Na2O. Biết X là amin bậc I.55 Khi đốt cháy mỗi đồng đẳng của ankylamin. C3H5COONH4. C4H9NO2. amino nguyên tử hiđro luỡng tính luỡng tính luỡng tính C. C3H5COONH4.Câu 3. B” tác dụng với NaOH tạo ra B’.59 Những từ hay cụm từ thích hợp với những chỗ trống ở các câu trong đoạn văn sau là Amin là những hợp chất hữu cơ được tạo thành …(1)…một hay nhiều …(2)… trong phân tử amoniac bởi …(3)….. D. công thức cấu tạo thu gọn có thể có của X là A. B’ tác dụng với HCl tạo ra B”.57 Các chất A. Câu 3. C.75 < X ≤ 1. C. Câu 3.08g CO2. Vì có nhóm …(6)… và nhóm …(7)… trong phân tử. B. C4H9NO2. C. 0. C4H9NO2. C tác dụng với NaOH tạo ra muối và NH 3. Câu 3. 0. khi thay thế khi thay thế khi thay thế nguy ên tử hiđr o (2) nguyên tử hiđro cacboxyl (3) một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon một hay nhiều gốc hiđrocacbon (4) luỡng tính tạp chức tạp chức tạp chức (5) đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino đồng thời nhóm cacboxyl và nhóm amino (6) tạp chức (7) cacboxyl (8) amino (9) trùng ngưng trùng ngưng trùng ngưng trùng ngưng B.56 Đốt cháy hoàn toàn một amin thơm X thu được 3. D. D.(4)…mà phân tử chứa …(5)…. CH3NHC6H3(NH2)2. A tác dụng với dung dịch axit tạo thành muối amin bậc I. C đều đúng. amino axit biểu hiện tính chất …(8)…và tính chất đặc biệt là phản ứng …(9)… (1) A.58 Một hợp chất hữu cơ A mạch thẳng có công thức phân tử là C3H10O2N2.1 mol X cần 600ml dung dịch HCl 0. A và B đều đúng. A và B đều sai. C có cùng công thức phân tử C 4H9O2N. B. C3H5COONH4. thì tỉ lệ thể tích X = VCO2 : VH2O biến đổi như thế nào theo số lượng nguyên tử cacbon tăng dần trong phân tử ? A. B. 0. Để trung hoà 0. B. Câu 3. B. H2NCH2CH2COONH4. A tác dụng với kiềm tạo thành NH3. C. H2NCH2C6H3(NH2)2. C lần lượt là A. C3H5COONH4.99g H2O và 336ml N2 (đktc).4 ≤ X < 1. nguyên tử hiđro khi thay thế amino cacboxyl D.. amino cacboxyl 44 . D. H2NC3H6COOH. CH3CH(NH2)COONH4.4 ≤ X < 1. H2NC3H6COOH. 0. CH3C6H2(NH2)3. Công thức cấu tạo của A là A.

cả A.Câu 3. B. tất cả đều sai. HOOCCH2CH(NH2)COOH.8g.62 Hợp chất X chứa các nguyên tố C. N và có phân tử khối là 89. O. N trong đó hiđro chiếm 9.15g dung dịch HCl 20% được dung dịch A. không phân nhánh . Đốt cháy hoàn toàn một lượng X thu được CO2 và N2 theo tỉ lệ thể tích 4:1.1 mol A phản ứng vừa hết với 100ml dung dịch HCl 1M tạo ra 18. D. khi đốt cháy thu được khí nitơ ở dạng đơn chất. Biết A có cấu tạo mạch không phân nhánh và nhóm amino ở vị trí α . Để tác dụng hết với các chất trong dung dịch A. H2NCH2COOH. C. D. H2N[CH2]4COOH. kết quả khác.7g chất X. CH3COONH4 hoặc HCOONH3CH3. B.61 Khi đốt cháy hoàn toàn đồng đẳng X của axit aminoaxetic.64 Cho a g hỗn hợp hai amino axit A. 45 . ngoài ra còn tác dụng được với nước brom. HOOCCH(NH2)COOH.63 Hợp chất hữu cơ X có phân tử khối nhỏ hơn phân tử khối của benzen. Công thức cấu tạo thu gọn có thể có của X là A.05g A khi tác dụng với một lượng NaOH dư. Biết 0.65g muối khan. Mặt khác. H2NCH2CH2COOH. H2N[CH2]3COOH. Câu 3.09%. Câu 3. B đều no. D. C. chỉ chứa nguyên tố C. H2N[CH2]4COOH. B. C. Biết X tác dụng với dung dịch NaOH và dung dịch HCl. Mặt khác.928 lít khí CO2 (đo ở 27. H2NCH(NH2)[CH2]2COOH. B. Đốt cháy 7. cần 140ml dung dịch KOH 3M. H2NCH2COOH. Biết rằng. Câu 3. C2H5COONH4 hoặc HCOONH3CH3. Công thức cấu tạo thu gọn của A là A. C đều sai. nitơ chiếm 18. thu được VCO2 : VH 2O = 6 : 7 .5 mol N2. X là hợp chất nào sau đây? A. B đều đúng. thì thấy khối lượng bình này tăng thêm 32. B. B. X là hợp chất nào sau đây? A. 1 chức amino tác dụng với 40. C. đốt cháy a g hỗn hợp hai amino axit trên và cho sản phẩm cháy qua dung dịch NaOH dư. thu được 4. H2NCH(NH2)COOH. C. H2NCH2CH2COOH. Câu 3. H2NCH2COOH. CH2=CH-COONH4. B. Biết rằng. CH3CH(NH2)COOH. mạch hở. B.37. Khi đốt cháy 1 mol X thu được hơi nước.35g muối. 1atm). tạo ra 28. H2N-CH=CH-COOH. 3 mol CO2 và 0. Cho tỉ lệ phân tử khối của chúng là 1. 22. chứa 1 chức axit. D. CH2=C(NH2)-COOH.60 Amino axit X chứa một nhóm chức amin bậc I trong phân tử. CH3CH(NH2)CH2COOH. H2N[CH2]3COOH. Câu 3. H2N[CH2]3COOH. C đều sai. H.65 A là một amino axit trong phân tử ngoài các nhóm cacboxyl và amino không có nhóm chức nào khác. CH3NH[CH2]2COOH. H2NCH2COOH. X vừa tác dụng được với dung dịch HCl vừa tác dụng được với dung dịch NaOH. Công thức cấu tạo thu gọn của X là A. cả A. CH3NHCH2COOH. CH3NH[CH2]3COOH. cả A.18%. H2NCH2COOH.3oC. D. Công thức cấu tạo thu gọn của hai amino axit lần lượt là A. O. H.

C. Câu 3. HOOCCH2CH2CH(NH2)COOH. oxi. NC4H8(COOH)2. khi lọc dung dịch thu được 4. Câu 3. X có công thức cấu tạo nào sau đây? A. C.Ở nhiệt độ thường dưới tác dụng của men. B. CH3CH(NH2)COOH. (1). (3).0g kết tủa. (4) p-nitrotoluen. B. D. Câu 3.Một số protein bị … khi đun nóng hoặc khi cho thêm một số hoá chất. B. (5) metylamin.75g muối của X. Cho 15. (4). D. C3H8O2N2. B. kết quả khác.73 Hợp chất X chứa các nguyên tố C. (2) < (1) < (3) < (4) < (5) < (6). CH3CH2NH2. H2NCH2CH2NH2. D.02 mol một amin bậc I (X) với lượng oxi vừa đủ.82g (Y). C3H8ON2. Các amino axit đều tan trong nước. nitơ. thấy khối lượng bình đựng nước vôi trong tăng 3. (3). B. (1). kết quả khác.70 Cho các chất: (1) amoniac. B. (4). (2) anilin. (3) cacbon. H2NCH2CH2COOH. 46 . CH3NHCH2COOH. D. CH4ON2. thu được 18. CH3CH(NH2)2. D. Công thức phân tử của X là A. (1) mọi bộ phận của cơ thể. Câu 3. Thuỷ phân protein bằng axit khi đun nóng sẽ cho một hỗn hợp các amino axit. Lấy một lượng axit aminoaxetic (X) và 3. N(CH2COOH)3. Trình tự tính bazơ tăng dần theo chiều từ trái sang phải là A. Câu 3. B. CH3CH2CH(NH2)COOH.Protein có trong … .1g X tác dụng với dung dịch HCl dư.72 Amino axit (Y) có công thức dạng NCxHy(COOH)m. H.71 Đốt cháy hoàn toàn 0. (4). Biết phân tử X có 2 nguyên tử nitơ. C.68 Hãy điền những từ hoặc cụm từ thích hợp vào các chỗ trống ở các câu sau . (4). B. (6) đimetylamin. Công thức cấu tạo thu gọn của (Y) là A. (2). (1) < (2) < (4) < (3) < (5) < (6). (4) < (3) < (2) < (1) < (5) < (6). C.344 lít (đktc). (2). (3) p-nitroanilin. Đốt cháy hoàn toàn lượng (X) và (Y) trên. C. (1). Câu 3. D.67 Chọn phát biểu sai: A. protein … tạo ra các amino axit. C. hiđro.C. CH3CH2CH(NH2)COOH. D. H2NCH2CH2COOH. (2). thể tích khí oxi cần dùng để đốt cháy hết (Y) nhiều hơn để đốt cháy hết (X) là 1. Mọi amin đơn chức đều chứa một số lẻ số nguyên tử H trong phân tử.69 Câu khẳng định nào sau đây luôn đúng: A. thu toàn bộ sản phẩm qua bình chứa nước vôi trong dư. B. . (1) < (4) < (3) < (2) < (5) < (6).2g và còn lại 0. D. Phân tử khối của một amin đơn chức luôn là số chẵn.448 lít (đktc) một khí không bị hấp thụ. (3). C. B và C đều đúng. D.66 X là một α -amino axit no chỉ chứa một nhóm –NH2 và một nhóm –COOH. Dung dịch amino axit không làm giấy quỳ đổi màu. (2). Công thức cấu tạo của X là A. (2) bị thuỷ phân. Hai chất (X) và (Y) có cùng số mol. Câu 3. (1). O. Amin luôn luôn phản ứng với H+. (3). (4) đông tụ Những từ hoặc cụm từ thích hợp theo trình tự từ trên xuống là A. Phân tử khối của một amino axit (gồm một chức amino và một chức cacboxyl) luôn luôn là số lẻ. C đều đúng. N với tỉ lệ khối lượng tương ứng là 3:1:4:7. C.Các protein đều chứa các nguyên tố … . Câu 3.

3 C 3.18 A 3.…) n Monome → Polime n Monome → Polime+ nH2O Polime trùng hợp Polime trùng ngưng n.71 D 3.40 B 3.67 D 3.26 D 3. POLIME A.M = M.43 C 3.68 B 3.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.7 D 3.6 B 3.31 C 3.n n.58 C 3.18 Có liên kết đôi hoặc vòng Có hai nhóm chức có khả không bền năng phản ứng trở lên Trùng ngưng Định nghĩa Quá trình Sản phẩm Khối luợng Điều kiện của monome 47 .69 D 3.62 C 3.51 D 3.5 D 3.73 A 3.37 D 3.10 C 3.42 C 3.46 A 3.56 D 3. đồng thời giải phóng những phân tử nhỏ (như H2O.29 C 3.1 C 3.Theo phản ứng polime hoá.24 B 3.70 C CHƯƠNG IV.38 C 3.22 B 3. ta phân biệt polime trùng hợp và polime trùng ngưng. Phản ứng Trùng hợp Mục so sánh Là quá trình kết hợp nhiều phân tử nhỏ giống nhau hoặc tương tự nhau (monome) thành phân tử lớn (polime) Là quá trình kết hợp nhiều phân tử nhỏ thành phân tử lớn (polime).32 D 3.23 A 3.15 A 3.50 B 3.11 C 3.34 B 3.n + n.55 C 3.54 D 3.16 A 3.48 B 3.25 B 3. .13 A 3.60 A 3.72 C 3.41 A 3.4 B 3. polime nhân tạo (bán tổng hợp).12 B 3.35 B 3.19 A 3.44 D 3.Theo nguồn gốc.64 D 3.63 B 3.49 A 3.65 C 3.30 D 3.66 D 3.9 C 3.59 C 3.53 A 3.47 A 3. Khái niệm về polime Polime là các hợp chất có phân tử khối rất lớn do nhiều đơn vị nhỏ gọi là mắt xích liên kết với nhau tạo nên.2 D 3. .21 B 3.36 A 3.ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG III 3. polime tổng hợp.45 A 5.39 B 3.52 C 3.14 B 3.Số mắt xích (n) trong phân tử polime được gọi là hệ số polime hoá hay độ polime hoá.27 B 3.33 A 3. .28 D 3. ta phân biệt polime thiên nhiên.20 A 3.17 A 3.57 D 3.8 C 3.M = M’.61 A 3.

-COOCH2. Tính chất a) Tính chất vật lí Hầu hết polime là chất rắn. dài và mảnh.Phản ứng khâu mạch polime: Phản ứng tạo cầu nối giữa các mạch (cầu -S-S. Đa số polime có tính dẻo.Vật liệu compozit: vật liệu tổ hợp gồm polime làm nhựa nền và các vật liệu vô cơ. Thí dụ: t CH2 CH n + nCH3COONa CH CH2 n + nNaOH OCOCH3 OH .2. p CH2 CH n Cl poli(vinyl clorua) (PVC) c) Nhựa PS 48 .Phản ứng cắt mạch polime: Polime bị giải trùng ở nhiệt độ thích hợp. bền.Phân tử polime có thể có cấu tạo điều hoà (nếu các mắt xích nối với nhau theo một trật tự xác định) và không điều hoà (nếu các mắt xích nối với nhau không theo một trật tự nào cả). dạng mạch phân nhánh và dạng mạch không gian. to. .Phân tử polime có thể tồn tại ở dạng mạch không phân nhánh. 3. .Keo dán hữu cơ: vật liệu polime có khả năng kết nối chắc chắn hai mảnh vật liệu khác. 4. một số tan trong các dung môi hữu cơ. Nhựa a) Nhựa PE nCH2 CH2 xt. . b) Tính chất hoá học: có 3 loại phản ứng . Khái niệm về các vật liệu polime o . B . không bay hơi. .dễ bị thuỷ phân khi có mặt axit hay bazơ. hữu cơ khác. .Tơ: vật liệu polime hình sợi. Cấu trúc . một số có tính dai.Phản ứng giữ nguyên mạch polime: Phản ứng cộng vào liên kết đôi hoặc thay thế các nhóm chức ngoại mạch. to.hay -CH2-) thành polime mạng không gian hoặc phản ứng kéo dài thêm mạch polime. . một số polime có tính đàn hồi.Chất dẻo: vật liệu polime có tính dẻo.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. p CH2 etilen CH2 n polietilen(PE) b) Nhựa PVC nCH2 CH Cl vinyl clorua xt. không có nhiệt nóng chảy xác định.Cao su: vật liệu có tính đàn hồi. có thể kéo thành sợi. Polime có nhóm chức trong mạch như –CO-NH.

p CH CH2 n OCOCH3 Thuỷ phân PVA trong môi trường kiềm: CH CH2 n + nNaOH OCOCH3 to CH2 CH n + nCH3COONa OH CH3 CH CH2 n COOCH3 poli(metyl metacrylat) (PMM) e) Nhựa PMM (thuỷ tinh hữu cơ .. OH OH n + nHCHO H . 49 . to.plexiglas) nCH2 CH COOCH3 xt.t + o CH2 n + nH2O − Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. CH2 CH2 CH2OH CH2 CH2 OH .. to. p CH CH2 C6H5 n d) Nhựa PVA nCH2 CH OCOCH3 xt. OH . p CH3 metyl metacrylat f) Nhựa PPF Poli(phenol . − Nhựa novolac: Nếu dư phenol và xúc tác axit.fomanđehit) (PPF) có 3 dạng: nhựa novolac. − Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. to. nhựa rezit.. nhựa rezol.nCH C6H5 CH2 xt..

.. 2..3-đien (butađien) b) Cao su isopren polibutađien (cao su buna) C CH CH2 CH3 2-metylbuta-1.3-dien (isopren) c) Cao su buna – S nCH2 CH CH CH2 + nCH C6 H 5 nCH2 xt.. H2C . Cao su a) Cao su buna Na.. Tơ a) Tơ capron (nilon – 6) 50 .. xt CH2 CH CH CH2 CH C6 H 5 CH2 n d) Cao su buna – N nCH2 CH CH CH2 + nCH CN o CH2 t . p C CH CH2 n CH3 poliisopren (cao su isopren) CH2 o CH2 t . xt CH2 CH C Cl CH2 n f) Cao su flopren nCH2 C F xt... p. . p.CH2 OH OH CH2 OH CH2 OH CH2 CH2 OH CH2 CH2 OH CH2 CH2 CH2 . t nCH2=CH− CH=CH2  → 0 ( CH 2 CH = CH CH 2 )n buta-1.. p. . H2 C . to. p CH2 C F CH CH2 n 3... xt CH2 CH CH CH2 CH CN CH2 n e) Cao su clopren nCH2 CH C CH2 Cl CH CH2 to.. to..

p HN[CH2]6CO n + nH2O NH[CH2]6NHCO[CH2]4CO n + 2nH2O d) Tơ clorin CH2 CH CH2 Cl CH Cl n 2 + n 2 Cl2 xt. D.nH2N[CH2]5COOH n CH2 CH2 CH2 CH2 xt. to. tơ tằm. D. to. tơ tằm. NH[CH2]6CO n . C. p n 2 n + HCl 2 Cl Cl e) Tơ dacron (lapsan) nHOOC C6H4 COOH + nHO CH2 CH2 axit terephtalic etylen glicol CO OH C6H4 CO O CH2 CH2 O n + 2nH2O poli(etylen terephtalat) (lapsan) C. to. 3 → → 2 → 4 → 5 → 1. tơ nilon dễ cháy.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 4. metan (3). tơ nilon mềm mại. NH[CH2]6NHCO[CH2]4CO n . rượu etylic (4). tơ tằm. p CH2 C=O NH xt.6 có công thức là A. 6 → 4 → 2 → 5 → 3 → 1. p NH[CH2]5CO n b) Tơ enang (nilon – 7) nH2N[CH2]6COOH c) Tơ nilon – 6. 4 → 6 → 3 → 2 → 5 → 1. p CH2 CH CH CH Cl xt. axetilen (6). 51 . Câu 4. Len. NHCH(CH3)CO n . Len. Len. đivinyl (5). Len. 6 B.3 Không nên ủi (là) quá nóng quần áo bằng nilon.2 Tơ nilon – 6. C. 2 → 6 → 3 → 4 → 5 → 1.CO . vì: A. tơ nilon kém bền với nhiệt.1 Hợp chất đầu và các hợp chất trung gian trong quá trình điều chế ra cao su buna (1) là: etilen (2). Hãy sắp xếp các chất theo đúng thứ tự xảy ra trong quá trình điều chế A. NH[CH2]5CO n . tơ nilon có các nhóm (. to. p NH[CH2]5CO n + nH2O xt. to. len. C. to. B. Câu 4. B.NH -) trong phân tử kém bền với nhiệt. tơ tằm. D. tơ tằm.6) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH xt.

Tên gọi của X . vinylaxetilen.12 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – S? 52 . Phản ứng đồng trùng hợp. Câu 4. etanol. butađien. CH3–CH3(4) A. B. H2S. D. CH2 C. Polivinyl axetat (PVA). Tất cả đều sai. tơ axetat. C. (1). (3). (1). Y . D. C. B. Câu 4. Phản ứng đồng trùng ngưng. D. (3). C.4 Những phân tử nào sau đây có thể tham gia phản ứng trùng hợp ? CH2=CH2(1). vinylaxetilen. B. B. Phản ứng trùng ngưng. n . cacbon. nhựa phenol-fomanđehit. B. Z trong sơ đồ trên lần lượt là A.8 Cao su buna . Câu 4. tơ poliamit. chỗ vải đó bị đen lại do có sản phẩm tạo thành là A. B. (2). Polimetyl acrylat (PMA).11 Tơ enang thuộc loại A. butađien. butađien. tơ tằm. etanol.5 Khi H2SO4 đậm đặc rơi vào quần áo bằng vải sợi bông.9 Thuỷ tinh plexiglas là polime nào sau đây? A. Câu 4. C. (3). C. D. nhựa dẻo. Polimetyl metacrylat (PMM). nhựa bakelít.6 Cho sơ đồ sau: CH4 → X → Y → Z → cao su buna. (3). D. Axetilen. CH2=CH–Cl(3). (4). C. Anđehit axetic. (2). Phản ứng trùng hợp. Câu 4.S được điều chế bằng : A. CH CH2 C6H5 n .10 Tên của polime có công thức sau là OH CH2 n A. Câu 4. D. D. B. C. CH2 CH CH CH2 n . (2). Etilen. Câu 4. (1). Câu 4. CH2 C(COOCH3) CH3 n D. CH CH CH2 CH CH2 C6H5 . CH ≡ CH(2). tơ polieste. Axetilen. B.Câu 4. S. polistiren. butađien. PbS.7 Cao su buna – S có công thức là A.

xt CH2 CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. xt CH3 CH2 CH CH CH2 n CH C6H5 CH2 Câu 4. p.13 Phản ứng nào sau đây tạo ra sản phẩm là cao su isopren? A. p. B.14 Phản ứng nào sau đây tạo ra sản phẩm là cao su cloropren? A. Cl . xt to. CH3 CH2 + mCH C6H5 o CH2 t . p. A.CH2 C CH CH2 . nCH2 B.16 Để điều chế nilon . p. xt to. p. axit axetic. nCH2 D. m CH3 CH2 + mCH C6H5 o CH2 t . nCH2 D. CH2 CH2 n n . nCH2 C. CH2 CH2 n n . xt CH2 CH2 to.17 Phản ứng nào sau đây tạo ra sản phẩm là cao su buna – N? 53 . m . C. xt to. nCH2 B. nCH2 CH CH CH CH CH C Cl C CH CH2 to. . nCH2 C. C.A. p. CH3 Câu 4. p. . xt CH2 CH2 CH2 CH CH CH2 n .CH3 CH2 C CH B. Công thức cấu tạo thu gọn của X là . axit oxalic. . D.CH2 CH3 CH CH CH2 . CH C CH2 n CH3 CH2 CH CH CH2 n CH C6H5 CH2 .6. nCH2 C. xt to. p. nCH2 CH CH CH CH CH C Cl C CH CH2 CH2 CH2 to. nCH2 CH CH CH CH CH C Cl C CH CH2 to.6 người ta dùng axit nào để trùng ngưng với hexametylen điamin ? A. nCH2 D.CH3 C C CH2 . m CH3 CH2 + mCH C6H5 to. xt CH2 CH2 CH2 CH CH CH CH C Cl C CH2 n . CH C CH2 n . xt CH2 CH2 to. p. p. p. xt Câu 4. X tham gia phản ứng trùng hợp được một loại cao su. D.15 Hiđro hoá hợp chất hữu cơ X được isopentan. axit stearic. p. nCH2 B. axit ađipic. Câu 4.

p.A. B. metyl acrylat. caprolactam. nhựa PVC. xt C6H5 n Câu 4. xt CH2 CH2 CH C CH C Cl CH2 CH2 to. Câu 4. nCH2 CH D. nhựa bakelít.CH2 CH COOCH3.21 Tơ enang được điều chế bằng cách A. xt CH3 n n . B. A. B. nCH2 CH CH C CH2 CH3 C Cl CH2 to.23 Chất có khả năng trùng hợp thành cao su là B. trùng ngưng alanin.19 Sản phẩm của phản ứng trùng hợp metyl metacrylat được gọi là A.26 Một polime Y có cấu tạo mạch như sau: 54 .CH2 C CH CH2. trùng ngưng HOOC-(CH2)4-COOH. C. axit metacrylic. chất dẻo. B. D. caprolactam. thuỷ tinh hữu cơ. D.CH2 CH3 CH CH2 CH2 CH3. phenol. D. D.CH3 CH3 CH2 C CH. trùng hợp axit acrylic. D. axit caproic. B. Câu 4. m C. stiren. C. CH3 C C CH2. Câu 4. nCH2 CH CH CH2 + nCH CN CH o CH2 t . axit metacrylic.CH2 CH OCOCH3. p.25 Tơ poliamit là những polime tổng hợp có chứa nhiều nhóm A. –CH(CN)– trong phân tử. axit metacrylic.20 Tơ capron được điều chế từ monome nào sau đây ? A.CH2 CH CH2 OH. D. Câu 4. D. C. C. Câu 4. nCH2 B. trùng ngưng H2N-(CH2)6-COOH. –NH– trong phân tử. D. C. B. –CO– trong phân tử.22 Nhựa PS được điều chế từ monome nào sau đây? A. B. Câu 4. xt CH2 CH CH2 CH o CH2 + mCH CH2 t . C. CH CH CH2 CH2 CH CN CH2 n .24 Từ monome nào sau đây có thể điều chế được poli(vinyl ancol) ? A. metyl metacrylat. .CH2 CH COOC2H5. Câu 4. C. –CO–NH– trong phân tử. phenol. p. p. CH C6H5 CH2 . Câu 4.18 Tên của monome tạo ra polime có công thức CH3 C CH2 n COOH là A. C. axit acrylic.

còn tinh bột và xenlulozơ là loại polime tổng hợp. B. Câu 4.32 Hệ số trùng hợp (số mắt xích) của tơ nilon – 6. Vậy. C. CH3-C6H4CH2OH . Tỉ lệ số mắt xích (butađien : stiren) trong loại polime trên là A. Polietilen và poli(vinyl clorua) là loại polime thiên nhiên. Công thức cấu tạo thu gọn của X.3 – đien (butađien). C6H5CH=CH2. B. trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo ? B. C6H5CH2CH2OH. − 2− 2− CH CH . D. D. 4.30 Chọn câu phát biểu sai: A. II – BÀI TẬP NÂNG CAO Câu 4. Câu 4.27 Tiến hành clo hoá poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin.28 Tơ capron (nilon – 6) có công thức là NH[CH2]5CO n . B. Các vật liệu polime thường là chất rắn không bay hơi.29 Tiến hành phản ứng đồng trùng hợp giữa stiren và buta – 1. Polime là những chất có phân tử khối rất lớn do nhiều mắt xích liên kết với nhau. t o .31 Cho sơ đồ phản ứng sau: → xt . C. D. 2. → X có công thức phân tử C8H10O không tác dụng với NaOH. C. D. 1 : 3. 1 : 1. p − H 2O X  Y  polime. 2 : 3. − 2− 2− 2− CH CH CH .731 gam Br2. − 2− CH . B. Câu 4. C6H5CH2CH2OH. C6H5CH2CHO.B. C. C6H5COCH3.… − 2− 2− 2− 2− 2− 2− 2− 2− … CH CH CH CH CH CH CH CH Công thức một mắt xích của polime Y là A. D.834 gam X phản ứng vừa hết với 1. Câu 4. NH[CH2]6CO n . Hầu hết các polime không tan trong nước và các dung môi thông thường. C.6 có phân tử khối (M = 2500) là 55 . 3. 1.18% clo theo khối lượng. C. Y lần lượt là: A. Cứ 2. A. 1 : 2. C6H5CH(CH3)OH. NHCH(CH3)CO n . − 2− 2− 2− 2− CH CH CH CH . thu được polime X. NH[CH2]6NHCO[CH2]4CO n . D. Câu 4. A. Trong X có chứa 66. C6H5CH=CH2.

(1). C. (1). PE. thu được một loại polime. 4576 m3. cao su lưu hoá. (4). D. (2). Hãy cho biết sơ đồ chuyển hoá nào sau đây có thể dùng để điều chế poli(vinyl clorua) ? A. y 5 Câu 4. D. D. phenyl clorua (10). PVC. x 3 = . cao su lưu hoá. 56 . vinyl clorua (5). C. cao su buna. (5). y 2 D. (5). amilozơ. (2). (5). PE. C. = . xenlulozơ. (7). (6).cao su buna. (4). (3). Chọn các chất thích hợp cho sơ đồ đó là A. benzen (3). Đốt cháy hoàn toàn một lượng polime này. (4). Câu 4.33 Điều chế nhựa phenol-fomanđehit (1). Biết CH4 chiếm 95% thể tích khí thiên nhiên. amilozơ. (9). (3). B. anđehit fomic (4). Câu 4. Câu 4. 12. PVC. (2).38 Cho các chất sau: butan (1). D. etilen (4). xenlulozơ. (1) → (2) → (4) → (5) → (6). PVC. etin (2). poli(vinyl ancol).35 Cho các polime : PE. (6). Polime có dạng cấu trúc mạch không phân nhánh là A. B. (3). Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 x 2 A. etilen (9). (1). ancol vinylic. C. (7). axeton. amilopectin. (8). B. amilozơ . B. PVC. (1) → (4) → (5) → (6). xenlulozơ. cao su buna. (9).69% CO2 về thể tích. PE. (10). 6235 m3. axetilen (8). B. x 3 = . (5). (1) → (3) → (2) → (5) → (6). (7). amilopectin.34 Đun nóng poli (vinyl axetat) với kiềm ở điều kiện thích hợp ta thu được sản phẩm trong đó có A. D. 11. ancol etylic. = . benzyl clorua (6).37 Đồng trùng hợp đimetyl buta–1. Câu 4. vậy để điều chế một tấn  0% PVC thì số m3 khí thiên nhiên (đktc) cần là A. metan (3).36 Chất dẻo PVC được điều chế theo sơ đồ sau: CH 4  H = 1 → A  H = 9%→ B  H = 9 → PVC. thu được hỗn hợp khí và hơi (CO2. cao su buna . phenol (5). B.A. N2) trong đó có 57.  5%  5 Câu 4. C. (8). amilozơ. natri phenolat (7). y 3 y 3 C. amilopectin.3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y. xenlulozơ. B. 13. các chất đầu và chất trung gian trong quá trình điều chế là: metan (2). 5883 m3. PVC. (6). 10. (1). (3). 7225 m3. (2). PE. D. nhựa PVC (6). H2O. cả A và B. C.

C. mẫu da thật cho mùi khét. Câu 4. cả A. D. p HN[CH2]6CO xt.42 Xét các phản ứng sau đây. B.41 Đun nóng vinyl axetat với kiềm ở điều kiện thích hợp. NH[CH2]6NHCO[CH2]4CO n + 2nH2O . C. C đều đúng. to.39 Khi cho hai chất X và Y trùng ngưng tạo ra polime Z có công thức O CH2 CH2 O C C6H4 C n O O . Công thức của X. HO-C6H4-OH. mềm mại hơn tơ nhân tạo. ancol etylic. B. Cl Cl Cl 2 (2) nNH2[CH2]6NH2 + nHOOC[CH2]4COOH (3) CH2 CH CH2 CH Cl Cl n 2 2 xt. C. D.40 Có thể phân biệt các đồ dùng làm bằng da thật và da nhân tạo (PVC) bằng cách nào sau đây? A. len). còn da nhân tạo thì bóng. còn mẫu lụa sản xuất từ tơ nhân tạo không cho mùi khét. nhẵn Câu 4. Dùng dao cắt ngang hai mẫu da. 57 . tơ xenlulozơ axetat) và tơ thiên nhiên (tơ tằm. anđehit axetic. B. C. Y lần lượt là A. hai phản ứng (2) và (3). D. ancol vinylic. da thật mềm mại hơn da nhân tạo. khét. HO-CH2-CH2-OH. da thật ở vết cắt bị xơ. Đốt hai mẫu da. chỉ phản ứng (1). So sánh khả năng thấm nước của chúng. axeton. mẫu lụa sản xuất từ tơ thiên nhiên cho mùi khét. B. to. ta thu được sản phẩm trong đó có: A. B. da thật dễ thấm nước hơn. lụa sản xuất từ tơ thiên nhiên dễ may hơn lụa sản xuất từ tơ nhân tạo. chỉ phản ứng (3). len) người ta dùng cách nào sau đây? A. So sánh độ mềm mại của chúng. lụa sản xuất từ tơ thiên nhiên có độ bóng cao hơn lụa sản xuất từ tơ nhân tạo. Dùng kim may (máy may) may thử vài đường chỉ trên lụa. HOOC-CH2CH2-COOH. phản ứng nào thuộc loại phản ứng trùng ngưng ? (1) nH2N[CH2]6COOH xt. p + n Cl2 A. HOOC-C6H4-COOH. hai phản ứng (1) và (2). Câu 4. n CH2 CH CH CH n + 2HCl . So sánh độ bóng của lụa. Câu 4. tơ thiên nhiên (tơ tằm. D. HO-C6H4-COOH. So sánh độ mềm mại của chúng. C. to. còn da nhân tạo không cho mùi D.Câu 4. HO-CH2-COOH. B. p n + nH2O . Đốt hai mẫu lụa.43 Để phân biệt lụa sản xuất từ tơ nhân tạo (tơ visco.

9 A 4. Câu 4. (2).16 D 4. (7) tơ axetat. Câu 4.27 B 4.5 A 4. tơ axetat. (7). protein. tơ visco. 58 . (3).6 C 4.49 Khi đốt cháy một loại polime chỉ thu được khí CO 2 và hơi H2O với tỉ lệ n CO2 : n H2O = 1:1 .MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. CH3COOCH = CH2.8 B 4.44 Polime X (chứa C. Loại tơ có nguồn gốc xenlulozơ là A.25 A 4. (6) nilon – 6. A.17 C 4.19 D 4. tinh bột. Vậy. (7). ĐẠI CƯƠNG VỀ KIM LOẠI A.20 B 4. poli(vinyl clorua).12 D 4.43 C 4.31 C 4. C. – CH = CCl – .37 A 4. – CCl = CCl – .32 B 4. 171kg và 82kg. (1). H. (3).10 A 4.33B 4.6. (2). số thứ tự nhóm A (số electron ngoài cùng).28 A 4.22 D 4. C. (5) tơ visco.36 A 4. D.40 C CHƯƠNG V. Công thức một mắt xích của X là A.2 C 4. 2. CH2 = CHCOOCH2CH = CH2.39 A 4.44 A 4. C2H5COOCH2CH = CH2.34 C 4.45 Tơ lapsan thuộc loại A.30 D 4.29 B 4. D.49 B 4. CH2 = CH – COOCH3.48 Cho các polime sau đây: (1) tơ tằm. C.7 C 4. Câu 4.35 D 4. 3 electron ở lớp ngoài cùng. (2).42 C 4.4 D 4. tơ poliamit. C. Câu 4. B.000.14 B 4. (4) tơ enang.47 A 4. chu kì (số lớp electron).13 C 4.Câu 4. (2) sợi bông. (5).38 D 4. (5). 65kg và 40kg. B.46 Polime ( CH 2 CH(OH) ) n là sản phẩm của phản ứng trùng hợp sau đó thuỷ phân trong môi trường kiềm của monome nào sau đây ? A.11 B 4. (6). – CHCl – CHCl – . Câu 4.46 B 4. D. số thứ tự nhóm B (số electron ngoài cùng + số electron kề ngoài cùng chưa bão hoà).26 D 4. C.15 C 4.48 B 4.18 C 4. (6). tơ polieste. 175kg và 70kg. Vị trí của kim loại: ô nguyên tố (Z).45 C 4. Cl) có hệ số trùng hợp là 560 và phân tử khối là 35. polietilen.24 B 4. D.21 C 4. B.23 A 4. 215kg và 80kg. – CH2 – CHCl – . (6). D.3 B 4. B. polime trên thuộc loại nào trong số các polime sau ? A.41 C 4. 2. D. Cấu tạo của kim loại: thường có 1. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IV 4. B. B.1 A 4. (3) sợi đay.47 Muốn tổng hợp 120kg poli(metyl metacrylat) thì khối lượng của axit và ancol tương ứng cần dùng là bao nhiêu ? Biết hiệu suất quá trình este hoá và trùng hợp lần lượt là 60% và 80%. C.

dẫn điện. nhưng cứng hơn kim loại nguyên chất. các điện cực cùng tiếp xúc với 1 dung dịch chất điện li. H2SO4 đặc oxi hoá kim loại (trừ Pt. 6. IIA (trừ Be. 8. Na + 2H2O → 2NaOH + H2 . Cr thụ động trong dd HNO3 đặc nguội. Na) khử ion của kim loại yếu hơn trong dd muối thành kim loại tự do. 4.Dãy điện hoá kim loại cho phép dự đoán chiều phản ứng giữa 2 cặp oxi hoá khử : chất oxi hoá mạnh nhất sẽ oxi hoá chất khử mạnh nhất sinh ra chất oxi hoá yếu hơn và chất khử yếu hơn. Nhớ thứ tự các cặp oxi hoá khử sau : Cu2+/Cu Fe3+/Fe2+ Ag+/Ag 2 Fe3+ + Cu → Cu2+ + 2Fe2+ Fe3+ không oxi hoá Ag. . Mg) khử H2O ở t0 thường thành H2. Tính chất hoá học chung: tính khử : M  M n+ + ne → . trong đó các electron của kim loại được chuyển trực tiếp đến các chất trong môi trường. 5. Hợp kim có t0 nóng chảy thấp hơn.Ăn mòn điện hoá là quá trình oxi hoá . K.Fe. Tính chất vật lí chung của kim loại: tính dẻo. 59 . Hợp kim: là vật liệu kim loại có chứa một kim loại cơ bản và một số kim loại khác hay với một vài hợp kim.Tác dụng với dd muối Kim loại mạnh (trừ Ba. với cặp kim loại A─B. hợp chất khử chứa nguyên tố có số oxi hoá thấp lên cao và nó bị khử xuống mức oxi hoá thấp hơn. Liên kết kim loại: lực hút tĩnh điện giữa các electron tự do và các ion dương kim loại.Tác dụng với phi kim : xM + M+ y O2 → MxOy 2 n Cl2 → MCln 2 n H2 2 .3.Ăn mòn hoá học là quá trình oxi hoá . Cấu tạo của đơn chất kim loại: mạng tinh thể gồm có các ion dương dao động liên tục ở các nút mạng và các electron tự do chuyển động hỗn loạn giữa các ion dương. ánh kim do các electron tự do gây ra. Fe + Cu2+ → Fe2+ + Cu . Ca. Al.Tác dụng với H2O IA. 9. H2SO4 đặc nguội.khử. Sự ăn mòn kim loại: là sự oxi hoá kim loại do tác dụng của các chất trong môi trường xung quanh : M → Mn+ + ne . các điện cực tiếp xúc với nhau. . phi kim. muốn B được bảo vệ thì A phải có tính khử mạnh hơn B.Tác dụng với dd HNO3. Au). . trong đó kim loại bị oxi hoá do tác dụng của dung dịch chất điện li và tạo nên dòng electron chuyển dời từ cực âm đến cực dương. dẫn nhiệt. .Tác dụng với axit HCl. . dẫn điện và dẫn nhiệt kém hơn kim loại nguyên chất. H2SO4 loãng : M + n H+ → Mn+ + Kim loại sau H không khử được H+ thành H2.Chú ý rằng. H2SO4 đặc Dung dịch HNO3.khử.3 điều kiện cần và đủ để kim loại bị ăn mòn điện hoá : các điện cực khác chất. 3Cu + 8HNO3 → 3Cu(NO3)2 + 2NO + 4H2O .

* Phương pháp điện phân dung dịch để điều chế kim loại sau Al. Al. Al) và oxit của kim loại cần điều chế (sau Al). 60 . K. b) It = ne. ne là số mol electron trao đổi trong quá trình điện phân. Công thức của định luật Farađay a) m = A 1 . m là lượng chất thoát ra ở điện cực theo gam. * Phương pháp điện phân nóng chảy để điều chế kim loại IA. . A là nguyên tử khối (hoặc phân tử khối). IIA. Na) * Phương pháp nhiệt luyện cần có 1 trong 4 chất khử (H2.96500 Trong đó I là cường độ dòng điện tính bằng Ampe. CO. t là thời gian điện phân tính bằng giây. C. t là thời gian điện phân tính bằng giây.10.It n 96500 Trong đó I là cường độ dòng điện tính bằng Ampe. Ca.Các phương pháp điều chế kim loại : * Phương pháp thuỷ luyện cần có dung dịch muối của kim loại cần điều chế (sau Al) và kim loại có tính khử mạnh hơn (trừ Ba. Nguyên tắc điều chế kim loại: là sự khử ion kim loại : Mn+ + ne → M . 11. n là hoá trị (hoặc số mol electrron trao đổi tính cho 1 mol chất thoát ra ở điện cực.

dư  Fe(NO3)3 + 3Ag → t 14. Fe2(SO4)3 + Cu  CuSO4 + 2FeSO4 → 12. Fe + S  → t0 3. CuSO4 + H2O  Cu + → 26.B. CuCl2  Cu + Cl2 → 0 1 O2 + H2SO4 2 1 ñpdd 25. Fe + CuSO4  FeSO4 + Cu → 10. Fe + 3AgNO3. Fe + 2HCl  → 0 2FeCl3 FeS Fe3O4 FeCl2 + H2 5. Fe + 4HNO3  Fe(NO3)3 + NO + 2H2O → >570 C 6. 2NaOH  2Na + O2 + H2O → 2 ñpnc 20. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 61 . 2FeCl3 + Fe  3FeCl2 → 11. Fe + H2O → FeO + H2 1 7. MgCl2  Mg + Cl2 → ñpdd 23. Fe + 2AgNO3  Fe(NO3)2 + 2Ag → 13.MỘT SỐ PHẢN ỨNG THƯỜNG GẶP t 1. Ba + 2H2O  Ba(OH)2 + H2 → 0 9. Na + H2O  NaOH + H2 → 2 8. H2 + PbO  H2O + Pb → t0 15. Fe2O3 + 3CO  2Fe + 3CO2 → t0 16. 3Fe3O4 + 8Al  4Al2O3 + 9Fe → 3 ñpnc 17. 2NaCl  2 Na + Cl2 → 1 ñpnc 19. Al2O3  2Al + O2 → 2 ñpnc 18. 3Fe + 2O2  → 4. 2AgNO3 + H2O  2Ag + O2 + 2HNO3 → 2 ñpdd 24. 2Fe + 3Cl2  → 0 t 2.

63. nhóm IIA. 36. ô 26. B. nhóm IIB.C . B. ô 20. chu kì 3. liên kết sinh ra bởi lực hút tĩnh điện giữa ion dương và các ion âm.2 Ion M có cấu hình electron ở lớp ngoài cùng là 3s 23p6. Ba. D. Ca2+. 83%. Ca2+. các electron tự do. Số g muối tạo ra là A. nhóm VIIIA. ô 18. chu kì 4. Cl. liên kết giữa các nguyên tử bằng các cặp electron dùng chung. K+. C. Ar. B. Cl.7. liên kết sinh ra bởi lực hút tĩnh điện giữa nguyên tử H tích điện dương và nguyên tử O tích điện âm.6g khí H2 bay ra. Câu 5.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 5. Vị trí M trong bảng hệ thống tuần hoàn là A.5M.5 Cation M có cấu hình electron ở phân lớp ngoài cùng là 2p6. + Câu 5. chu kì 4. chu kì 4.7. B. ô 20.7. chu kì 4. nhóm VIIIB.4g hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 0.4 Cho cấu hình electron: 1s22s22p63s23p6. C. ô 26. C. B. Cl. 82%. Cl-. ô 18. D.8 Liên kết kim loại là A. ion âm phi kim và ion dương kim loại. K. chu kì 3. Ar. nhóm VIIIA. chu kì 4. 53. chu kì 4. 62 . nhóm IIA. Nguyên tử M là A.7. Câu 5.Ni. D. K+. Na.6 Hoà tan 1. các ion dương kim loại và các electron tự do.7 Hoà tan hoàn toàn 15. 35. Câu 5. 81%. C. Kim loại đó là A.9 Trong hợp kim Al. Ar. B. Be.3 Trong mạng tinh thể kim loại có A. B. C. liên kết sinh ra bởi lực hút tĩnh điện giữa các ion dương và các electron tự do. D.44g một kim loại hoá trị II trong 150ml dung dịch H 2SO40. ô 26. nhóm VIIIB. C. cứ 10 mol Al thì có 1 mol Ni. Câu 5. Mg. C. Ca. Muốn trung hoà axit dư trong dung dịch thu được phải dùng hết 30ml dung dịch NaOH 1M. F. Câu 5. Ar. Câu 5. D. Phần trăm khối lượng của Al trong hợp kim là A. nhóm IIB. 2+ Câu 5.1 Vị trí của nguyên tử M (Z = 26) trong bảng hệ thống tuần hoàn là A. D. 84%. ô 26. B. C. B. D. D. C. D. F. Dãy gồm các nguyên tử và ion có cấu hình electron trên là A. các nguyên tử kim loại.

X ( Ag). B. Cu3Al2.1%. X ( Ag). Ag+. Cu). C.Fe khử Cu2+ thành Cu. C.18 Cho lá sắt vào dung dịch HCl loãng có một lượng nhỏ CuSO4 thấy H2 thoát ra càng lúc càng nhanh do A. B. B. Y ( Cu2+. Y lần lượt là A.1%. B. B. Câu 5. Câu 5. Câu 5. Câu 5. ánh kim. Pb(NO3)2.Câu 5. Sn(NO3)2. Ag. Câu 5. Cu2+. Thêm dung dịch HCl vào dung dịch trên. dẫn nhiệt cao hơn kim loại nguyên chất. dẫn điện. B. Y (Cu2+). Phản ứng xong. Cu2+. D. X ( Ag. ánh kim. B. Cd. Al3+. Lá sắt bị ăn mòn kiểu điện hoá.11 Hoà tan 0. Pb là ngâm hỗn hợp trong dung dịch X dư.1%. Fe. X (Fe).17 Để bảo vệ vỏ tàu đi biển phần ngâm dưới nước người ta nối nó với A. Cu. Sn. D. C. Cu3Al. C.12 Tính chất vật lí chung của kim loại là A. CuAl.15 Một phương pháp hoá học làm sạch một loại thuỷ ngân có lẫn Zn. Câu 5. C. Câu 5. B. dẫn nhiệt. Câu 5. 63%. C. 61%.94g.10 Ngâm 2. Cu.24g ion M 2+. ánh kim. C. D. Ag+. Câu 5. Pb2+. Ni. tính dẻo hơn kim loại nguyên chất. dẫn điện. Hg(NO3)2. 74. Y (Cu2+). D. Y ( Cu2+. tính cứng hơn kim loại nguyên chất. D.16 Ngâm một lá kẽm nhỏ trong một dung dịch có chứa 2. Pb(NO3)2. Lá sắt bị ăn mòn kiểu hoá học.Zn trong dung dịch HCl đến phản ứng hoàn toàn thu được 0. 63 . dẫn nhiệt. C.896 lít H2 (đktc). CuSO4. 62%. nhiệt độ nóng chảy cao hơn kim loại nguyên chất. X. D. Tính dẻo. Fe2+). dẫn điện. ánh kim. D. Thành phần % của Fe là A. khối lượng lá kẽm tăng thêm 0. 73.398g kết tủa. D.3% Al. AgNO3. Tính mềm. Sn. 72. B. X có thể là A. Nhiệt độ nóng chảy cao. Ag+. Cu2+. CuAl3.20 Cho bột Cu đến dư vào dung dịch hỗn hợp gồm Fe(NO3)3 và AgNO3 thu được chất rắn X và dung dịch Y. B. 75. C.5g hợp kim của Ag vào dung dịch HNO3. 60%. dẫn điện. Ag+. Zn. Cu2+.Fe tan trong dung dịch HCl tạo khí H2. AlCl3. Fe2+). dẫn nhiệt. tính dẫn điện. NaCl. C. Ni khử được các ion kim loại A. Na+. Zn(NO3)2.33g hợp kim Fe. ZnCl2. Công thức hoá học của hợp kim là A. M là A. dẫn nhiệt.14 Một hợp kim Cu-Al chứa 12. Mg2+. C.1%.19 Ngâm một lá Ni lần lượt trong những dung dịch muối sau : MgSO4. B. D. D. Câu 5. D. thu được 0.13 Hợp kim có A. Thành phần %Ag trong hợp kim là A. Tính cứng.

.23 Cho các ion : Fe . Fe . Cl-. sau đó kết tủa không tan. Fe3+/ Fe2+. D.Ag+/Ag. Ba2+. Ag . Fe2+. Fe2O3. Ag. Fe2+/ Fe. D. Fe2+. Cu. Fe2+/ Fe. (1) và (2). Ag+/ Ag. Ag. Câu 5. B. B. C. sau đó kết tủa tan. CO32-. Fe2+/ Fe. Fe3+.26 Cho các cặp oxi hoá. ống nghiệm (2) một đinh Fe đã làm sạch.khử : Al3+/Al. Cu. Fe2+/ Fe. xuất hiện Cu màu đỏ. Tách Ag ra khỏi hỗn hợp với khối lượng không đổi người ta dùng dung dịch A. Al3+. ta thu được chất rắn là A. D. xuất hiện Cu màu đỏ. Câu 5. Ag+. Fe2+. Fe2+. AgNO3. B.khử : Al3+/Al. C. Cu2+/ Cu. Fe3+. D. C. có khí thoát ra. dung dịch có màu xanh. NO3-. C. Fe3+. Kim loại Cu khử được các ion trong các cặp oxi hoá trên là A. Fe3+/Fe2+.khử xếp theo chiều tính oxi hoá của ion kim loại tăng. Fe2+/ Fe. Câu 5. B. Al3+. Cu2+/ Cu. Cu2+/Cu. Fe3+. 2+ + C. Fe3+/ Fe2+. B. Ag+/Ag. C. xuất hiện kết tủa xanh. 64 . B. B. Cu. (1).22 Ngâm một lá Zn trong 200ml dung dịch AgNO3 0. B. Câu 5. Ion Cu2+ bị khử thành Cu trong thí nghiệm A. Ag+/Ag. Khi phản ứng kết thúc khối lượng lá Zn A. tăng 0. D. FeCl3. D. Cu2+/ Cu. Ag+. Fe2+. (2). C. Ag+. Fe. Ag+/Ag.24 Có một hỗn hợp gồm: Fe.Câu 5. Cu2+/Cu. B. Ag+/Ag. 2+ Câu 5. Cu2+. Fe2+. C. xuất hiện kết tủa xanh. Fe3+/ Fe2+. Al3+.29 Thả Na vào dung dịch CuSO4 quan sát thấy hiện tượng A. C. C. Cu2+. Al3+. Câu 5. Ag+. Cu2+.27 Cho các cặp oxi hoá. Cu2+/Cu. Fe2+. D.30 Có 2 ống nghiệm đựng dung dịch CuSO4. dung dịch mất màu xanh. Fe2+/ Fe. D. Fe3+. Cu2+. tăng 1. Al. Trong dung dịch A chỉ chứa một loại anion là A. Cho vào ống nghiệm (1) một miếng nhỏ Na. Cu(NO3)2. Kim loại khử được ion Fe3+ thành Fe là A.1M.51g. FeCl2. Ag+ và các kim loại : Fe. Cu2+.43g. giảm 1. Fe3+. Cu. D. SO42-. Ag+. có khí thoát ra. Fe3+.21 Chọn một dãy chất tính oxi hoá tăng A. Al3+.51g. Fe(OH)3. giảm 0. Chọn một dãy điện hoá gồm các cặp oxi hoá.43g. Câu 5. D. Fe3+/ Fe2+.25 Trong một dung dịch A có chứa đồng thời các cation sau : K+. không bị khử. Ag+. tính khử của kim loại giảm A. Fe3+/ Fe2+. FeO. Câu 5. B.28 Khi nung Fe(OH)2 trong không khí ẩm đến khối lượng không đổi. Fe3O4. Câu 5.

B. Fe.12g bột Fe và 0. Thành phần % theo khối lượng của Fe và Si trong quặng này lần lượt là A. Al.37 Điện phân NaCl nóng chảy với điện cực trơ. có màng ngăn 2 điện cực. 23.Câu 5. Câu 5. dung dịch H2SO4 loãng.40 Hoà tan m g Ba vào nước thu được 1 lít dung dịch có pH = 12. Câu 5.7%. điện phân CaCl2 nóng chảy. D. Cl2 ở anot.33 Ngâm một lá kim loại có khối lượng 50g trong dung dịch HCl. 3. 0. 0. D.87%. Câu 5. Ba. 9000C. điện phân Ca(NO3)2 nóng chảy.1M. D. MgO cần dùng 7g khí CO. 54%.685g. Điều kiện phản ứng và hoá chất thích hợp cho sơ đồ trên lần lượt là A. 0.39 Điện phân (điện cực trơ) dung dịch muối sunfat của một kim loại hoá trị II với cường độ dòng điện 3A. 25.32 Nhúng một que sắt nặng 5g vào 50ml dung dịch CuSO 4 15% (D = 1. B. D.7%. B. 2.154g. 53%. Giá trị của m là A. C. Nồng độ C% của dung dịch CuSO4 còn lại là A. C. 56%.06M. B. 9000C.38 Một loại quặng sắt chứa 80% Fe2O3 và 10% SiO2. 24. Số gam chất rắn thu được sau phản ứng là A.12 g/ml).36 Từ dung dịch CuSO4 để điều chế Cu. C. sau 1930 giây thấy khối lượng catot tăng 1.92 gam. C. Na. Sau khi thu được 336ml H2 (đktc) thì thấy khối lượng lá kim loại giảm 1. C. Nồng độ mol/lít của dung dịch CuSO4 trước phản ứng là A.31 Cho 1. 9. Mg.34 Để khử hoàn toàn 30g hỗn hợp gồm CuO. dung dịch HNO3. dung dịch HCl. Sau phản ứng khối lượng kim loại có trong bình là 1. Fe. B. Cu.04M. 65 . Cu. Câu 5. Câu 5. Na ở catot. Hg. Câu 5. 8. Khi que sắt đã được mạ kín thì có khối lượng là 5. Fe 2O3 Fe3O4. FeO. 4. 9000C. C.35 Cho sơ đồ : CaCO3 → CaO → CaCl2 → Ca. B.9%. B. Câu 5. NaClO.7%. C. D. Na ở anot. Fe. Cl2 ở anot. điện phân CaSO4 nóng chảy. Câu 5. dung dịch HCl. Fe. 0. điện phân dung dịch CaCl2. D. D.88g. Tên kim loại là A. 52%. C. 26. 3.53%. 9.74g. Câu 5. 0.7%. Cl2 ở catot.12M.68%. 4.6%. 9000C. B. 2. H2 ở catot. D.24g bột Mg vào một bình chứa sẵn 250ml dung dịch CuSO4. C.15g. B. B. người ta thu được A. C. người ta dùng A. D.15g. Ag. 3. Kim loại đó là A. 8. Ni. NaOH. D.

Rót 250ml dung dịch này vào cốc đựng mạt sắt. B. D. phản ứng xong thấy khối lượng đinh Fe tăng thêm 1. D. CaCl2.42 Điện phân nóng chảy muối clorua của kim loại M. 2+ Câu 5. Chất rắn sau phản ứng tan trong dung dịch HCl dư tạo 13.Câu 5.44 Ion Mg bị khử trong trường hợp A. Câu 5. Al.75g.25g.48 Có 5 mẫu kim loại: Mg. Ba.26g. B. Ngâm một đinh Fe trong dung dịch còn lại sau điện phân.36 lít. 27. Câu 5.12 lít khí (đktc) ở anot. Thể tích khí NO (đktc) thu được là A. Al. B. Ca. 1. Fe. Cl2. Kim loại M là A. 66 . 0.45 Sau một thời gian điện phân dung dịch CuCl2 thu được 1.8g. 6. Ba. C. Fe. C.41 Điện phân muối clorua nóng chảy của kim loại M thu được 12g kim loại và 0. D. MgCl2. 4. Cho dd MgCl2 tác dụng dd Na2CO3.50 Có dung dịch HCl 0. Điện phân MgCl2 nóng chảy. Câu 5. Câu 5. Câu 5. 28. C.63g. C. D.2g Cu vào 500 ml dung dịch NaNO3 1M. Al.2g.43 Điện phân dung dịch NaOH với điện cực trơ. NaOH. Mg. Điện phân dung dịch MgCl2.1M. Fe. Cu.14g.6g.2g kim loại M (hoá trị không đổi) tác dụng với 0. người ta lọc lấy dung dịch có pH = 2. Mg. C.7g.75g. B. Al. Mg. Mg. KCl. B. 9. B. 2. M là A. Ba. Cu. C. Al.49 Cho 19. C. NaClO. Thả Na vào dung dịch MgCl2.46 Hoà tan hoàn toàn 10g hỗn hợp Al và Mg trong dung dịch HCl thu được 0. Câu 5. Mg.5g khí H2. Ca. B. Muối clorua đó là A. Ở catot thu được 7. 3. D.3 mol khí. Câu 5. D. 2g.24 lít. D. C. Ba. C. Cu.15 mol O 2. D. 28. 0. Khi cô cạn dung dịch thu được số gam muối khan là A. Al. C. Mg. người ta thu được sản phẩm là A.2 gam kim loại và 6. Câu 5. Số gam Cu điều chế được từ các thí nghiệm trên là A. Fe. 27. Ba.25g. 3. D. NaCl. D. B. B. Khối lượng sắt đã tham gia phản ứng là A.72 lít khí (đktc). 0. không có màng ngăn 2 điện cực.47 Cho 16.48 lít. Na. Nếu chỉ dùng thêm dung dịch H2SO4 loãng thì có thể nhận biết A.2g.72 lít. B. 12. sau đó thêm 500ml dung dịch HCl 2M. NaCl.44 lít khí (đktc). Sau một thời gian.

dung dịch NaHCO3. D.Câu 5. Dung dịch H2SO4 loãng.52 và 8. D.51 Cho 0.60 Cho phương trình phản ứng : a X + b Y(NO3)a → a X(NO3)b + b Y Biết dung dịch X(NO3)b có màu xanh. Na2CO3 + Ca(OH)2 → CaCO3 + 2 NaOH. Dung dịch HCl. C. bari. n CO2 = n Ca(OH)2 . 0.92. Câu 5. Ag.232M. Câu 5. n CO2 < n Ca(OH)2 . Dung dịch HNO3. Ag. Câu 5.76. 4. Câu 5. C. B. dung dịch HCl. Số g mỗi muối trong hỗn hợp là A. CaO + CO2 → CaCO3.02. B. C.6. 1.59 Dùng một thuốc thử phân biệt Fe2O3 và Fe3O4. D.52 Cho dòng khí CO2 liên tục đi qua cốc đựng dung dịch Ca(OH)2.44g hỗn hợp 2 muối. Tên kim loại đó là A. D. lượng kết tủa thu được lớn nhất là A. Nồng độ mol/l của dung dịch CuSO4 đã pha chế là A. Hai kim loại X. Cho X vào một lượng nước dư. C. B. D. Câu 5. CaSO4.3625M. Cu. 0.53 Hiện tượng tạo thành các thạch nhũ trong các hang động được giải thích bằng phản ứng A. n CO2 > n Ca(OH)2 . canxi. B.5H2O trong nước được 500ml dung dịch.55 Hoà tan 1. C. sau khi kết thúc phản ứng thu được 8. D.96 lít khí H 2 và m g một chất rắn. D.27g. 1. C. magie. Số phương trình phản ứng hoá học (dạng phân tử) xảy ra khi cho các chất tác dụng với nhau từng đôi một là A. Ca(HCO3)2 → CaCO3 + CO2 + H2O. D. Câu 5. 3. 2. thuốc thử đó là A.725M. Câu 5.84 và 10. BeSO4. 0. 5. Cu. B. Công thức của muối sunfat là A.2. Fe.0g một kim loại hoá trị II trong dung dịch HCl.55g muối khan.7g. Giá trị của m là A. 2.42 và 11. Để phản ứng hết với dung dịch này cần 20ml dung dịch BaCl2 0. MgSO4. Câu 5. Dung dịch CuSO4. B. C.58 Cho các chất: CaCO3.54g.11 mol khí CO2 đi qua dung dịch NaOH sinh ra 11. Cu. B. Fe. sau đó cô cạn dung dịch thu được 5.54 Một hỗn hợp X gồm Na và Al được trộn theo tỉ lệ mol 1: 2. dung dịch NaOH. Câu 5. BaSO4.56 Hoà tan 2. Mg.57 Hoà tan 58g muối CuSO4. B. B. C. D. B. C. n CO2 = 2 n Ca(OH)2 . 0. CO2 + Ca(OH)2 → CaCO3 + H2O.464M. 0. D. 0.8g muối sunfat của một kim loại nhóm IIA trong nước rồi pha loãng cho đủ 50ml dung dịch.75M.68 và 9. Y lần lượt là A. 67 . 0. 0.4g. kẽm. C.

8g. MnO4. Fe(NO3)2.4M đến khi dung dịch hết màu xanh. D. MgSO4. B. d mol SO42-. 3a + 2b = c + d. B. 0.66 Một kim loại dùng để loại bỏ tạp chất Fe2(SO4)3 trong dung dịch FeSO4 là A. 3a + 2b = c + 2d. Zn. không bị khử không bị oxi hoá. C. MgSO4. Giá trị m là A.là A. C. D. C.6 lít. Fe2(SO4)3. 24. Câu 5. 0. 9. bị khử. 2a + 2b = c + d.63 Khuấy một thanh kim loại M hoá trị 2 trong 200ml dung dịch Cu(NO3)2 0. C.64 mol khí Cl2 ở anot. C. B. C.67 Cho hỗn hợp X gồm Mg và Fe vào dung dịch axit H 2SO4 đặc nóng đến khi các phản ứng xảy ra hoàn toàn. bị oxi hoá. D. AgNO3. 10.69 Cho Cu vào hỗn hợp gồm NaNO3 và H2SO4 loãng. 27. Cu.1 mol khí duy nhất NO (đktc). 68 . 3. 9. D. Fe. 0. dung dịch KMnO4 bị mất màu là do A. b mol Cu2+. MnO4. Fe và các dung dịch muối Cu(NO3)2. B. B. dư thu được 0.Câu 5. Số phương trình phản ứng hoá học xảy ra khi cho kim loại và muối tác dụng với nhau là A.4 lít. Ba. Ag.80g. Chất tan có trong dung dịch Y là A. C. 65.70 m g phoi sắt để ngoài không khí lâu ngày bị gỉ tạo thành hỗn hợp A có khối lượng 12g gồm 4 chất rắn. Biết rằng toàn bộ Cu sinh ra đều bám hết vào thanh M. Câu 5.không màu trong môi trường axit.65 Có các kim loại Cu. B. D. D.62 Điện phân nóng chảy 76g muối MCl2 thu được 0. FeSO4.2 lít.68 Trong một cốc nước chứa a mol Al3+. D. Câu 5.bị oxi hoá. thu được dung dịch Y và một phần sắt không tan.08g. B. Cu. C. d là A. Cho A tác dụng hết với dung dịch HNO3 loãng. Câu 5. Biết hiệu suất phản ứng điện phân là 80%. vừa bị khử vừa bị oxi hoá. 1. V có giá trị là A. MgSO4. 56.64 Khi phản ứng với Fe2+ trong môi trường axit dư. Câu 5. B. Mg. C.61 Cho a g kim loại M tác dụng vừa đủ với V lít dung dịch HCl 2M thu được (a + 21. c mol Cl-.10. Fe2(SO4)3. MgSO4. D. D.3 lít. 2. khối lượng thanh M tăng 0. c. Biểu thức liên hệ giữa a.64g.tạo thành phức với Fe2+. B. Câu 5. 4.08g. B. Tên của M là A. C. Ag. b. II – BÀI TẬP NÂNG CAO Câu 5.3) g muối MCln. 0. Câu 5. Câu 5.bị khử thành Mn2+. Ca. 2a + 3b = 2c + d. D. MnO4. Vai trò của ion NO3. FeSO4. MnO4. Nguyên tử khối của M là A.

0. . Nếu cho X tác dụng hết với dung dịch HNO3 loãng.0. Câu 5. Hoà tan hết hỗn hợp X bằng H2SO4 đặc. D. sau một thời gian thu được m g hỗn hợp X gồm các oxit và sắt dư.48 lít.25g.52g.77 Cho 10. C.78 Cho 11g hỗn hợp nhiều kim loại trước hiđro tác dụng với dung dịch H2SO4 loãng.21 %.025 mol khí NO thoát ra. 35.24 lít. D.5g. không tác dụng với nước và đứng trước Cu. Câu 5. 20g. 0.24 lít. 3. 35g. 27. 0. 37. Al tác dụng hết với dung dịch HCl dư thu được 5. Giá trị của V là A. D. C. 26g.224 lít. Đem Cu cho tan hết trong dung dịch HNO3 loãng dư. C.12 lít NO duy nhất (đktc). 1. C. C.2g sắt để ngoài không khí bị gỉ thành 13.36 lít. 29g. D.72 lít khí (đktc). 2. Câu 5. 26%. 25.Phần 2: hoà tan hết trong dung dịch HNO3 loãng thu được V lít khí NO (đktc). B.336 lít. Cho A tác dụng hết với dung dịch HNO3 loãng. Cô cạn dung dịch thì số gam muối khan là A.36 lít H2 (đktc). Cô cạn dung dịch thì số gam muối khan thu được là A. Thành phần % về khối lượng Mg trong hỗn hợp X là A.76 Cho 36. 2.36 lít. X2 có hoá trị không đổi.6 lít. C. 5.01%.63 lít. Giá trị m là A. 0. thu được Cu. 27g. 4. B.75 Hỗn hợp X gồm 2 kim loại X1. 3. Câu 5.72 Oxi hoá m g sắt ngoài không khí.79 Cho 22g hỗn hợp muối cacbonat của kim loại IA và IIA tác dụng với dung dịch HCl dư thu được 0.5M được dung dịch Z và 4. 18. Sr và Ba. 69 .6 lít khí (đktc).98g. nóng thu được 5. Câu 5. C. Hoà tan hết X bằng dung dịch HNO3 thấy có 0. B.6 lít SO2 (đktc). Giá trị m là A.8g.71 11. B. 24g. V có giá trị là A.3 mol khí (đktc). D. 28g. Vậy 2 kim loại đó là A.87g hỗn hợp X gồm Mg và Al vào 250ml dung dịch Y chứa axit HCl 1M và H2SO4 0. 3. được 3g hỗn hợp rắn gồm 4 chất.53g. B. Câu 5. D.3g. Cô cạn dung dịch thì số gam muối khan thu được là A. Câu 5. Ca và Sr. B. Cho X tan hết trong dung dịch CuSO 4 dư. Câu 5. B.2g hỗn hợp 3 kim loại Mg. dư thu được V lít NO (đktc) duy nhất. D.4 mol khí CO2. B. Câu 5. dư thì thể tích N2 (đktc) là A. 2.87g. 22g.Câu 5. C. Mg và Ca. C.224 lít.7g. C.6g chất rắn A.8g hỗn hợp 2 muối cacbonat của 2 kim loại thuộc nhóm II ở 2 chu kì kế tiếp nhau khi tác dụng hết với dung dịch HCl thu được 0.368 lít H 2 (đktc). B. D. 2. 3. Zn. Be và Mg. D. dư thu được 6.2.2g.8g bột sắt ngoài không khí. Chia X thành phần bằng nhau: . B. 3.74 Hỗn hợp X gồm 2 kim loại đều có hoá trị không đổi. được 1. 36%. 25.Phần 1: hoà tan hết trong dung dịch chứa HCl và H2SO4 loãng thu được 3.242 lít.80 Cho 3.95g.73 Nung nóng 16. 0.336 lít. D. 39.252g.

Câu 5.81 Hoà tan hoàn toàn 2,81g hỗn hợp gồm Fe2O3, Al2O3, MgO, ZnO trong 500ml dung dịch axit H2SO4 0,2M (vừa đủ). Cô cạn dung dịch sau phản ứng, muối sunfat khan thu được có khối lượng là A. 6,81g. B. 10,81g. C. 5,81g. D. 4,81g. Câu 5.82 Cho 1,935g hỗn hợp gồm 2 kim loại Mg và Al tác dụng với 125ml dung dịch gồm HCl 1M và H2SO4 loãng 0,28M, thu được dung dịch X và 2,184 lít H 2 (đktc). Cô cạn dung dịch, thu được số gam muối là A. 9,7325g. B. 9,3725g. C. 9,7532g. D. 9,2357g. Câu 5.83 Cho 10g hỗn hợp gồm Al và một kim loại M (hoá trị x) tác dụng với 100ml dung dịch gồm H2SO4 aM và HCl 3aM, thu được 5,6 lít H2 (đktc), dung dịch X và 1,7g chất rắn. Khối lượng muối thu được là A. 2,85g. B. 2,855g. C. 28,55g. D. 28,5g. Câu 5.84 Cho 7,2g Mg tác dụng hết với dung dịch HNO 3 loãng, dư thu được 6,72 lít khí Y và dung dịch Z. Làm bay hơi Z thu được 47,4g chất rắn khan. Công thức phân tử của khí Y là A. N2O. B. NO. C. N2. D. NO2. Câu 5.85 Đốt nóng một hỗn hợp X gồm Al và Fe3O4 trong điều kiện không có không khí được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: Phần 1: tác dụng với dung dịch NaOH dư thu được 3,36 lít H2 (đktc). Phần 2 : tác dụng với dung dịch HCl dư thu được 13,44 lít H 2 (đktc). Thành phần % về khối lượng của Al trong hỗn hợp X là (hiệu suất phản ứng 100%) A. 27,95%. B. 2,795%. C. 72,05%. D. 7,205%. Câu 5.86 Cho hỗn hợp A gồm bột Al và Fe3O4. Nung nóng A ở nhiệt độ cao trong môi trường không có không khí để phản ứng xảy ra hoàn toàn thu được hỗn hợp B. Nghiền nhỏ B rồi chia làm 2 phần: - Phần 1 (ít) tác dụng với dung dịch NaOH dư thu được 1,176 lít H2 (đktc). Tách riêng chất không tan đem hoà tan trong dung dịch HCl dư thu được 1,008 lít khí (đktc) - Phần 2 (nhiều) tác dụng với dung dịch HCl dư thu được 6,552 lít khí (đktc).Khối lượng hỗn hợp A là A. 22,02g. B. 8,1g. C. 13,92g. D. 3,465g. Câu 5.87 Một hỗn hợp gồm Na, Ba có tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí B. Thể tích dung dịch HCl 0,1 M để trung hoà

1 dung dịch A là 10

A. 0,4 lít. B. 0,2 lít. C. 0,6 lít. D. 6 lít. Câu 5.88 Cho m gam hỗn hợp X gồm K và Al tác dụng với nước dư thu được 0,25 mol khí. Nếu cho m gam X tác dụng với Ba(OH)2 dư thu được 0,4 mol khí (các phản ứng đều xảy ra hoàn toàn). m có giá trị là A. 12,8g. B. 16g. C. 18g. D. 10,95g.

70

Câu 5.89 Dùng CO khử m g Fe2O3 ở nhiệt độ cao được 0,4 mol CO2 và hỗn hợp rắn X (gồm 4 chất). Hoà tan hết X cần 0,9 lít dung dịch HCl 1M thấy có 0,25 mol khí thoát ra. Giá trị m là A. 32g. B. 40g. C. 80g. D. 3,2g. Câu 5.90 Dùng CO khử m g Fe2O3 ở nhiệt độ cao thu được 1,1 gam CO2 và chất rắn X gồm 3 oxit. X phản ứng vừa đủ với 0,25 lít dung dịch H2SO4 loãng 0,5M. Giá trị m là A. 8,0g. B. 4,0g. C. 1,6g. D. 3,2g. Câu 5.91 Cho 0,1 mol CO (đktc) từ từ đi qua ống sứ nung nóng đựng 4 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Hỗn hợp khí thu được sau phản ứng có tỉ khối hơi so với H2 bằng 20. Công thức của oxit sắt và thành phần % CO 2 theo thể tích trong hỗn hợp khí sau phản ứng là A. FeO ; 75% B. Fe2O3 ; 75% C. Fe2O3 ; 65% D. Fe3O4 ; 75% Câu 5.92 Một dung dịch có chứa 2 cation là Fe2+ (0,1 mol); Al3+ (0,2 mol) và 2 anion Cl- (x mol), SO42- (y mol). Khi cô cạn dung dịch thu được 46,9 gam chất rắn khan. x và y có giá trị lần lượt là A. 0,02 và 0,03. B. 0,03 và 0,02. C. 0,2 và 0,3. D. 0,3 và 0,2. Câu 5.93 Thêm V lít dung dịch Na2CO3 1M vào một dung dịch có chứa đồng thời các ion − − sau: Ba2+; Ca2+; Mg2+; 0,2 mol Cl ; 0,3 mol NO3 . Để tạo lượng kết tủa lớn nhất thì giá trị của V là B. 0,25 lít. A. 2,5 lít. C. 0,5 lít. D. 5 lít. Câu 5.94 Hoà tan 16,2g Al trong dung dịch HNO3 loãng, dư thu được hỗn hợp khí gồm NO và N2 có tỉ khối hơi so với H2 là 14,4. Thể tích (tính theo lít) của NO, N2 lần lượt là A. 2,24 và 3,36. B. 0,224 và 0,336. C. 22,4 và 33,6. D. 2,24 và 4,48. Câu 5.95 Cho 13,5g nhôm tác dụng vừa đủ với dung dịch HNO 3 0,86M thu được hỗn hợp khí gồm NO và N2O có tỉ khối hơi đối với H 2 bằng 19,2. Thể tích dung dịch HNO3 cần dùng là A. 2,2 lít. B. 0,22 lít. C. 0,46 lít. D. 4,65 lít. Câu 5.96 Hoà tan một hợp kim Ba-Na với tỉ lệ mol 1:1 vào nước được dung dịch A và 0,3 mol khí. Thêm m g NaOH vào

1 dung dịch A ta được dung dịch B. Cho dung dịch B tác 10

dụng với 100ml dung dịch Al2(SO4)3 0,2M được kết tủa C. Giá trị m để được kết tủa C lớn nhất, nhỏ nhất lần lượt là A. 2,4g và 4g. B. 4g và 2,4g. C. 4,8g và 6,4g. D. 6,4g và 4,8g. Câu 5.97 Rót 150ml dung dịch NaOH 7M vào 50ml dung dịch Al 2(SO4)3 2M. Khối lượng chất dư sau thí nghiệm là A. 10g. B. 14g. C. 12g. D. 16g.

71

Câu 5.98 Dung dịch chứa 16,8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3, thêm vào 13,68g Al2(SO4)3 thu được kết tủa và dung dịch A. Đun nóng kết tủa đến khối lượng không đổi được chất rắn B. Khối lượng chất rắn B là A. 2,12g. B. 21,2g. C. 42,2g. D. 4,22g. Câu 5.99 Cho 18,9g muối Na2SO3 tác dụng hết với dung dịch HCl thu được khí A (đktc). Dẫn khí A vào dung dịch Ba(OH)2 dư. Sau khi hấp thụ, khối lượng dung dịch sẽ A. tăng 22,95g. B. giảm 22,95g. C. tăng 20,25g. D. giảm 20,25g. Câu 5.100 Đốt cháy hoàn toàn 0,336 lít C3H8 (đktc) bằng lượng oxi vừa đủ. Thu được toàn bộ sản phẩm cháy cho vào 35 ml dung dịch Ca(OH) 2 1M. Sau khi hấp thụ, khối lượng dung dịch A. tăng 0,56g. B. giảm 0,56g. C. tăng 5,6g. D. giảm 5,6g. Câu 5.101 m g hỗn hợp Mg, Al tác dụng với 250ml dung dịch X chứa hỗn hợp HCl 1M và H2SO4 0,5M sinh ra 5,32 lít H2 (đktc) và dung dịch Y (coi Vdung dịch không đổi). dung dịch có pH là A. 1. B. 7. C. 2. D. 6. Câu 5.102 Trộn 100ml dung dịch gồm Ba(OH)2 0,1M và NaOH 0,1M với 400ml dung dịch gồm H2SO4 0,0375M và HCl 0,0125M thu được dung dịch X. pH của dung dịch X là A. 2. B. 7. C. 6. D. 1.

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG V
5.1 A 5.11 A 5.21 A 5.31 A 5.41 A 5.51 A 5.61 C 5.71 A 5.81 B 5.91 B 5.101 A 5.2 A 5.12 A 5.22 B 5.32 D 5.42 B 5.52 A 5.62 A 5.72 A 5.82 A 5.92 C 5.102 A 5.3 C 5.13 A 5.23 A 5.33 A 5.43 B 5.53 B 5.63 B 5.73 C 5.83 C 5.93 A 5.4 D 5.14 A 5.24 C 5.34 D 5.44 B 5.54 C 5.64 A 5.74 A 5.84 D 5.94 A 5.5 D 5.15 D 5.25 B 5.35 D 5.45 A 5.55 B 5.65 C 5.75 D 5.85 A 5.95 A 5.6 A 5.16 C 5.26 D 5.36 C 5.46 A 5.56 A 5.66 A 5.76 C 5.86 A 5.96 A 5.7 B 5.17 A 5.27 A 5.37 A 5.47 B 5.57 A 5.67 C 5.77 B 5.87 C 5.97 A 5.8 A 5.18 B 5.28 B 5.38 A 5.48 D 5.58 D 5.68 B 5.78 B 5.88 D 5.98 D 5.9 B 5.19 C 5.29 B 5.39 B 5.49 C 5.59 C 5.69 A 5.79 D 5.89 A 5.99 B 5.10 D 5.20 A 5.30 B 5.40 A 5.50 D 5.60 B 5.70 B 5.80 A 5.90 A 5.100 A

72

+ OH.+ H+ → H2O + CO2 HCO3. Kim loại kiềm (IA): Li.KNO3. oxit axit.CaCO3 bị nhiệt phân. hay dung dịch muối khác. H2O (trừ Be). kém bền với nhiệt HCO3. có màng ngăn hai điện cực. muối. dung dịch axit. Na. tác dụng với axit. Ba. Fr 2. Tính chất của một số hiđroxit .CHƯƠNG VI. Ra 3. Ca(HCO3)2 lưỡng tính. Cs. IIA đều có tính khử (IIA khử yếu hơn IA). và tan cả trong nước có hoà tan CO2 t0 CaCO3  CaO + CO2 →  → CaCO3 + H2O + CO2 ← Ca(HCO3)2  0 0 . mang gần như đầy đủ tính chất chung của muối như tác dụng với dung dịch axit mạnh. Ca(NO3)2 bị phân huỷ ở t > 330 C thành muối nitrit và oxi 1 t0 KNO3  KNO2 + O2 → 2 t0 Ca(NO3)2  Ca(NO2)2 + O2 → 73 . IIA có số oxi hoá +1. ns2 4.Khi cho CO2. P2O5 hay axit H2S. tan trong axit mạnh. Tất cả các kim loại ở hai nhóm này đều tác dụng với phi kim. SO2. +2. Mg. 5. Ca. H3PO4 … vào dung dịch bazơ. . ñpdd 2NaCl + 2H2O  2NaOH + H2 + Cl2 → (nếu không có màng ngăn : 2NaOH + Cl2 → NaCl + NaClO + H2O) 9. Tính khử: IA. và tăng theo chiều Z tăng : M → Mn+ + ne (n = 1. KIM LOẠI KIỀM.NaOH. 2). để xác định muối sinh ra. IIA: ns1. Rb. Cấu hình electron ở lớp ngoài cùng của IA. Sr. Kim loại kiềm thổ (IIA): Be. Điều chế bazơ tan: sử dụng phương pháp điện phân dung dịch muối tương ứng với điện cực trơ. Điều chế IA.+ H2O t0 Ca(HCO3)2  CaCO3 + H2O + CO2 → .→ CO32.NaHCO3. . 6. Sơ lược về muối cacbonat và hiđrocacbonat . → 2 ñpnc 4MOH  4M + O2 + 2H2O → 7. KIM LOẠI KIỀM THỔ VÀ NHÔM A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.Na2CO3 dễ tan trong nước. Ca(OH)2 có đầy đủ tính chất của một dung dịch bazơ như làm quỳ tím hoá xanh. bazơ mạnh. IIA: sử dụng phương pháp điện phân nóng chảy n ñpnc MXn  M + X2 (X = halogen). Số oxi hoá: trong các hợp chất IA. ta nên dùng công thức phân tử của các muối để xác định tỉ lệ giữa số mol nguyên tử kim loại với số mol nguyên tử phi kim trong oxit axit (axit) 8.

4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O t0 13. MgCl2. Nước cứng tạm thời chứa muối Ca(HCO3)2 hay Mg(HCO3)2. tham gia phản ứng nhiệt nhôm. K + Cl2  KCl → 2 t0 5. H2O vì trên bề mặt nhôm được phủ kín một lớp Al2O3 bảo vệ.10. Mg2+ trong nước cứng. Nước cứng . IIA. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O t0 11. CaSO4.Vật bằng nhôm bền trong không khí.Nhôm có tính khử mạnh (Al → Al3+ + 3e) nhưng kém kim loại nhóm IA. . B .Cách làm mềm nước cứng tạm thời: đun. Nhôm . Ca + 2H2O → Ca(OH)2 + H2 16. 2K + 2H2O → 2KOH + H2 15. Al(OH)3 lưỡng tính. chu kì 3. Na + HCl → NaCl + H2 2 8. MgSO4). . 2Al + 6H2O → 2Al(OH)3 + 3H2 74 . Ca + Cl2  CaCl2 → 3 t0 6.Nước cứng là nước chứa nhiều ion Ca2+.Al2O3. Al + Cl2  AlCl3 → 2 1 7. 2Al + 6H2SO4 đặc  Al2(SO4)3 + 3SO2 + 6H2O → 14.Cách làm mềm nước cứng vĩnh cửu dùng Na2CO3 hoặc Na3PO4. Al + 4HNO3 đặc  Al(NO3)3 + NO + 2H2O → 12. . Al + 3HCl → AlCl3 + H2 2 10. . Mg + O2  MgO → 2 3 t0 3.Nguyên tắc làm mềm nước cứng là làm giảm nồng độ các ion Ca2+. 11.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1 t0 1. . . nhóm IIIA.Nhôm bị phá huỷ trong kiềm. .Vị trí Al trong bảng tuần hoàn: ô 13. 2Na + O2  Na2O → 2 1 t0 2.Điện phân Al2O3 nóng chảy (không thể điện phân nóng chảy AlCl3) để điều chế Al kim loại. Mg + 2HCl → MgCl2 + H2 3 9. . Mg2+. Nước cứng vĩnh cửu chứa muối clorua hay sunfat của Ca2+ hay Mg2+ (CaCl2. dùng bazơ tan. dd Na2CO3. 2Al + O2  Al2O3 → 2 1 t0 4.

17. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. NaHCO3 + HCl → NaCl + CO2↑ + H2O 37. NaHCO3 + NaOH → Na2CO3 + H2O 38. 2KNO3 + 3C + S  N2 + 3CO2 + K2S → t0 44. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. 2NaOH  2Na + O2 + H2O → 2 ñpnc 23. Na2CO3 + 2HCl → 2NaCl + H2O + CO2↑ 39. CaCO3 + H2O + CO2 ← Ca(HCO3)2  t 41. Mg + CuSO4 → MgSO4 + Cu t0 19. Mg(HCO3)2  MgCO3 + CO2↑ + H2O → 36.+ NH3 → MgNH4PO4 ↓ (màu trắng) 50. CaCO3  CaO + CO2 → t0 42. Ca(NO3)2  Ca(NO2)2 + O2 → t0 45. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. Al(OH)3 + NaOH → Na[Al(OH)4] 0 ñpdd 75 . 2NaCl + 2H2O  2NaOH + H2 + Cl2 coù ng ngaê maø n 26. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. Ca(OH)2 + CO2 → CaCO3 + H2O 30. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. NaOH + CO2 → NaHCO3 27. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. 2KNO3  2KNO2 + O2 → t0 43. 2Al + Fe2O3  Al2O3 + 2Fe → 20. NaOH + HCl → NaCl + H2O 31. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2↓ 32. CaCO3 + 2HCl → CaCl2 + H2O + CO2↑  → 40. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 ñpnc 21. MgCl2  Mg + Cl2 → ñpnc 24. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. Mg2+ + HPO42. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 t0 33. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. 2NaHCO3  Na2CO3 + CO2↑ + H2O → t0 34. Ca(HCO3)2  CaCO3 + CO2↑ + H2O → t0 35. 2NaCl  2Na + Cl2 → 1 ñpnc 22. 2Mg(NO3)2  2MgO + 4NO2 + O2 → 46. 2Al2O3  4Al + 3O2 → → 25. 2NaOH + CO2 → Na2CO3 + H2O 29.

M+ là cation: A.8 gam kali kim loại vào 36. B. K+. D. 48g. 25. C. 126g. B. 11. 4.3 Nồng độ phần trăm của dung dịch tạo thành khi hoà tan 7. Câu 6.1 Cation M+ có cấu hình electron ở lớp ngoài cùng là 3s23p6. 12. Câu 6. B. Có nhiệt độ nóng chảy thấp nhất trong tất cả kim loại. KCl.54. Na .119g.1g hỗn hợp 2 kim loại kiềm ở hai chu kì kế tiếp nhau trong bảng tuần hoàn tác dụng hết với nước thu được 1. 68% . Có số oxi hoá +1 trong các hợp chất. B. 24g. NaHSO4 .7 Nung 100g hỗn hợp gồm Na2CO3 và NaHCO3 cho đến khi khối lượng của hỗn hợp không đổi được 69g chất rắn. D.2 Tính chất không phải của kim loại kiềm là A.BÀI TẬP TRẮC NGHIỆM I. C. C.5 Cho 200g CaCO3 tác dụng hoàn toàn với dung dịch H2SO4 loãng để lấy khí CO2 sục vào dung dịch chứa 60g NaOH. 168g. B. LiCl. 68%. D. Câu 6. Câu 6. D.4 Điện phân muối clorua kim loại kiềm nóng chảy thu được 0. NaCl. C. Khối lượng kiềm là A.8g. Ag+. B. Công thức phân tử của muối kim loại kiềm là A. 2. 25. 84% . B. + C. Câu 6. NH4Cl. C. B. 16% . 76 . 2Al(OH)3  Al2O3 + 3H2O → C. 16%.69g.8 Cho 3. Khối lượng muối natri thu được là A. 12. Độ cứng cao.BÀI TẬP CƠ BẢN Câu 6. D. RbCl.45%.72%. 32% . 32%. KCl.Cu+.4g.12 lít H2 (đktc) và dung dịch kiềm. C. Câu 6. Na2CO3.04 mol khí ở anot và 3. 16. B. C. C. 50g.9g.8g. Kim loại kiềm có tính khử mạnh.79%. 84%. D. Câu 6.9 Dung dịch muối có pH > 7 là A. D.6 Cho 197g BaCO3 tác dụng hoàn toàn với dung dịch HCl để lấy khí CO2 sục vào dung dịch chứa 84g KOH.57%.2 gam nước là A. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl t0 55. Thành phần % theo khối lượng của Na2CO3 và NaHCO3 lần lượt là A. D. Câu 6.12 gam kim loại ở catot. D.6g. 12. Khối lượng muối thu được là A.

5. B. B. B. Điện phân CaCl2 nóng chảy.25g muối clorua của một kim loại hoá trị II và một lượng muối nitrat của kim loại đó có số mol bằng số mol muối clorua thì thấy khác nhau 7. 2.18 Kim loại thuộc nhóm IIA không tác dụng với nước ngay cả ở nhiệt độ cao là A. 3. Số gam CaCO3 và MgCO3 lần lượt là A. Ca. 4.55g. D. Mg. 40. Câu 6. Ca. D. Sục 1. Câu 6. Điện phân dung dịch CaCl2 với điện cực trơ. Câu 6. B. Thành phần % theo khối lượng của CaCO3 và MgCO3 trong hỗn hợp lần lượt là A. Mg. Câu 6.13 Khi lấy 14. Câu 6. Ba. BaCO3 . 4.1 gam muối clorua. 4 và 4.36 và 4.85%. B.15% và 40.2 và 4.2g hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2. Để trung hoà axit dư phải dùng hết 30ml dung dịch NaOH 1M. B.6%.48 và 3. BaSO4 .8g CaO tác dụng với một lượng nước dư thu được dung dịch X. C. 7. 2. D. Câu 6.19 Trường hợp ion canxi bị khử thành Ca là A.68 lít khí CO2 (đktc) vào dung dịch X. C.12 Hoà tan hoàn toàn 1.48. Ca. Mg.17 Có 5 chất bột trắng là: NaCl. Chỉ dùng nước và khí CO2 phân biệt được số chất là A. 29. B. C. 4. D. B. D.4% và 29.36.0 gam kim loại nhóm IIA tác dụng hết với dung dịch HCl tạo ra 11. C. Ba. Cho dung dịch CaCl2 tác dụng với dung dịch AgNO3.95g.5g. pH < 7. Be. Be. Mg. 77 . pH > 7.15 Hoà tan 8. D. Câu 6. pH = 7.016 lít CO2 (đktc). C.84g hỗn hợp CaCO3 và MgCO3 tác dụng hết với dung dịch HCl thu được 0. có màng ngăn.5M. 3.15%.2. C. Ba. C. B. Be.85% và 59. C.10 Cho a mol NO2 hấp thụ hoàn toàn vào dung dịch chứa a mol NaOH. Câu 6. Na2CO3 . 6.14 Cho 4.5g.16 Cho 2. 4. Kim loại đó là A.44g kim loại hoá trị II trong 150ml dung dịch H2SO4 0. Ca. pH = 5. D. 70. khối lượng kết tủa thu được là A. D.4%. Dung dịch thu được có pH A.11 Cho 2. Kim loại đó là A. D.25. Câu 6.05g.6% và 70. 59. Na2SO4 . C.Câu 6. Kim loại đó là A. Ba. C. Be.03 mol khí CO2. B.

B.8 atm). 3+ Câu 6.4g Ca(OH)2 .01 mol Mg2+. D. C. 2.25g. Ca(OH)2. Câu 6.28 Trong phương pháp trao đổi ion để làm mềm nước cứng người ta dùng A. B. C. 0.05 mol HCO3–. Nước khoáng.24 Dung dịch làm mềm nước cứng tạm thời và vĩnh cửu là A.22 Cho 10 lít hỗn hợp khí (đktc) gồm CO và CO2 trong đó CO2 chiếm 39. D. Na2CO3 + Ca(OH)2 CaCO3 + 2NaOH. Tính mềm. D. 0. Tính cứng tạm thời. Ca(OH)2. 0. 0. B. 100%. 12. Na3PO4. 0. NaNO3. B. 0. D.21 Khi nung 40g quặng đôlômit thu được 11. C. Thành phần % theo khối lượng của CaCO3. C. B. B.05g. vĩnh cửu. C. 0.23 Một loại nước có chứa nhiều muối Ca(HCO3)2 thuộc loại A. Dùng H2 khử Al2O3 ở nhiệt độ cao. D. 14. Tính cứng toàn phần.20 Phân biệt dung dịch Ca(HCO3)2 với dung dịch CaCl2 bằng A. C.D.MgCO3 trong quặng là A. D. B. Câu 6. Dung dịch Na2CO3.25 Trong một bình nước có chứa 0.29 Ion Al bị khử trong trường hợp A. B. D. B. Na2CO3 + CaCl2 CaCO3 + 2NaCl. Dung dịch Na3PO4. 40%. C. tạm thời.5g. 92%. C. Na2CO3 + Ca(HCO3)2 CaCO3 + 2NaHCO3.02 mol Cl– ta được nước cứng A.05 mol HCO3–. Zeolít.26 Đun sôi nước chứa 0.2% (theo thể tích) đi qua dung dịch chứa 7. Điện phân dung dịch AlCl3 với điện cực trơ có màng ngăn. D. Câu 6. Số g chất kết tủa sau phản ứng là A. C. Thả Na vào dung dịch Al2(SO4)3.01 mol Na+. D. Dung dịch NaCl. Điện phân Al2O3 nóng chảy. 4. Câu 6.02 mol Ca2+. Nước trong bình có A. HCl. B. Câu 6. nước mềm. Tính cứng vĩnh cửu. C. Nước cứng toàn phần. Na2CO3.02 mol Cl– . Câu 6. Na2CO3 + 2HCl 2NaCl + H2O + CO2. 0.65g. Na2CO3.02 mol Ca2+. Câu 6. Câu 6. Dung dịch HCl.27 Một phương trình phản ứng hoá học giải thích việc dùng dung dịch Na2CO3 làm mềm nước cứng vĩnh cửu là A.01 mol Na+. 78 . 0. Câu 6.2 lít khí CO2 (0oC. 50%. Cho dung dịch Ca(OH)2 tác dụng với dung dịch HCl. Nước cứng tạm thời. Nước cứng vĩnh cửu.01 mol Mg2+. D. toàn phần.

t0. dẫn điện. Y. Lúc đầu đều có kết tủa keo trắng. C. C. 2Al(OH)3 Al2O3 + 3H2O. NaAlO2 + H2O + HCl Al(OH)3 + NaCl. B. ở (2) kết tủa không tan. C. ở (2) kết tủa tan. t0. chu kì 3. H2SO4 loãng.32 Chọn câu không đúng A. HCl. NaHCO3. HCl. 2Al(OH)3 2Al + 3H2O + O2. D. H2SO4 đặc nóng. D. 3 D. HCl. Nhôm có tính khử mạnh chỉ sau kim loại kiềm và kiềm thổ. Câu 6. ô 13. HCl. dung dịch NH3 (2) lần lượt đến dư vào ống đựng dung dịch AlCl3 thấy A. đpnc. Ba(OH)2. Nhôm bị phá hủy trong môi trường kiềm. Lúc đầu đều có kết tủa keo trắng. nhóm IIIB. Vị trí M trong bảng tuần hoàn là A.33 Trong những chất sau. Lúc đ ầu đều có kết tủa keo trắng. Nhôm là kim loại nhẹ. B. 2 3+ Câu 6.31 Cation M có cấu hình electron ở lớp ngoài cùng là 2s22p6. ô 13. NaOH đủ. (2) lần lượt là A. sau đó kết tủa tan ra. B. E (dung dịch) và (1). đpnc. ZnSO4.35 Để làm kết tủa hoàn toàn Al(OH)3 người ta thực hiện phản ứng A.Câu 6.36 Cho dần từng giọt dung dịch NaOH (1). Al(OH)3 + NaOH Na[Al(OH)4]. đpnc.34 Cho sơ đồ : +X +Y +Z → Al → Al2(SO4)3 → Al(OH)3  Ba [ Al(OH) 4 ] 2 Al(OH)3 Al2O3 Al. dẫn nhiệt tốt. B. ô 13. Câu 6. X. Al2O3 + 3H2O 2Al(OH)3. NaOH dư. đpnc. D. Câu 6. H2SO4 đặc nguội. Câu 6. NaOH. ô 13.30 Phương trình phản ứng hoá học chứng minh Al(OH)3 có tính axit là A. chất không có tính lưỡng tính là A. B. Al2O3. nhóm IB. AlCl3 + 3H2O + 3NH3 Al(OH)3 + 3NH4Cl. C. AlCl3 + 3NaOH Al(OH)3 + 3NaCl. Lúc đầu đều có kết tủa keo trắng. D. nhóm IA. nhóm IIIA. sau đó kết tủa không tan ra. t0. B. Nhôm là kim loại lưỡng tính. chu kì 3. Câu 6. Ba(OH)2. ở (1) kết tủa tan. chu kì 3. H2SO4 loãng. t0. ở (1) kết tủa không tan. B. Ba(OH)2. Al(OH)3 . 79 . D. C. C. Ba(OH)2. NaOH dư. C. D. Z. Al(OH)3 + 3HCl AlCl3 + 3H2O. chu kì 3.

(2) là NaOH. ở (1) không hiện tượng. ở (1) không hiện tượng.8. B. Câu 6. Fe. kết tủa trắng tăng dần rồi tan. B. Al. 4. 0.41 Có 4 mẫu bột kim loại là Na. ở (1) kết tủa tan. 60%. D. D. 13. D.4g bột Al vào 150ml dung dịch hỗn hợp chứa Fe(NO3)3 1M và Cu(NO3)2 1M.nH2O. 80%. ở (1) không hiện tượng.39 Cho từ từ đến dư dung dịch NaOH lần lượt vào các dung dịch đựng Na+ (1). Câu 6.42 Cho 100ml dung dịch AlCl3 1M tác dụng với 200ml dung dịch NaOH.37 Cho dần từng giọt dung dịch HCl (1) .43 Hoà tan 5. Kết tủa tạo thành được làm khô và nung đến khi khối lượng không đổi cân nặng 2.16g Al.75M và 0. ở (3) xuất hiện kết tủa trắng không tan.95. (2) là NaOH. D. Al3+ (2). Mg2+ (3) ta quan sát thấy A. B.40 Có 2 lọ không ghi nhãn đựng dung dịch AlCl 3 (1) và dung dịch NaOH (2). Kết thúc phản ứng thu được số gam chất rắn là A. B. ở (2) xuất hiện kết tủa trắng.Al2(SO4)3. C. C. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa rồi tan ra.Câu 6. B. 10. CO 2 (2) lần lượt vào ống đựng dung dịch Na[Al(OH)4] thấy A. (2) là NaOH. Nồng độ mol/l của dung dịch NaOH ban đầu là A.35M và 0. Câu 6. Mg.2. Lúc đầu đều có kết tủa keo trắng.75M.75M và 0. Al2O3. D. rồi không tan. Câu 6. nhận ra (1) là AlCl3 . C. ở (2) xuất hiện kết tủa trắng rồi tan. C. 1. 2. C.24H2O. Chỉ dùng thêm nước làm thuốc thử thì số kim loại có thể phân biệt được là A. không tan. B. 2.44 Điện phân Al2O3 nóng chảy với dòng điện cường độ 9. B. Na3AlF6. B. sau đó kết tủa không tan ra.2. sau đó kết tủa tan ra. ở (2) kết tủa không tan. ở (1) không hiện tượng. rồi kết tủa không tan. Câu 6. không tan. D. ở (1) kết tủa không tan. 15. (2) là NaOH. Câu 6.24H2O. C.55g. 3. D. C. ở (2) kết tủa tan. Hiệu suất điện phân là A.75M và 0. 2.65A trong thời gian 3000 giây thu được 2. Lúc đầu đều có kết tủa keo trắng. nhận ra (1) là AlCl3 . kết tủa trắng tăng dần. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. nhận ra (1) là AlCl3 . Câu 6. Lúc đầu đều có kết tủa keo trắng. 13. Cho từ từ từng giọt dung dịch (1) vào dung dịch (2) thấy (2) có kết tủa. MgSO4.75M. ở (3) xuất hiện kết tủa trắng. D. 80 .35M. 0.Al2(SO4)3.35M. C. Không dùng thêm chất khác. 70%. người ta phân biệt chúng bằng cách A. nhận ra (1) là AlCl3 . Lúc đầu đều có kết tủa keo trắng. Cho từ từ từng giọt dung dịch (2) vào dung dịch (1) thấy (1) có kết tủa trắng. ở (2) và (3) xuất hiện kết tủa trắng rồi tan. K2SO4.38 Phèn chua có công thức là A. 90%.

B. x có giá trị là A.96 lít khí.10. Mặt khác. dung dịch NaOH. 3. D. Na.6 lít khí. Al2O3 đựng trong các lọ riêng biệt là dung dịch A. Câu 6. Câu 6. 11. dư thu được V lít khí NO (đktc) và dung dịch X. C.46 Chỉ dùng các chất ban đầu là NaCl. (Các phản ứng đều xảy ra hoàn toàn. AlCl3 . 3. m có giá trị là A. B. thu được 3.02g.24 lít khí (đktc). amoniac. Dung dịch Na2CO3. C. m có giá trị là A. các thể tích khí đo ở đktc). C. 4. C. 14. D. Al(OH)3. 11.5g hỗn hợp kim loại gồm Mg.80g. C. 12. B. 2. B. Công thức của oxit là A. Câu 6. 81 . 16g. D. 12.10g. Sau đó cô cạn dung dịch thu được x gam muối khan. C. MgO. H2O. Ca. Câu 6.32 gam nhôm kim loại bằng dung dịch HNO3 loãng.6000 lít.Câu 6. Al(OH)3. B. CuO. D.53 Hỗn hợp X gồm K và Al. AlCl3. C.5088 lít. H2SO4 đặc nguội. Câu 6. là A. Câu 6. Al và Fe bằng dung dịch HCl.45g. Cô cạn dung dịch X thu được 35. Mg. BaO. B.06g oxit của kim loại M (có hoá trị n) tan trong HNO3 dư thì thu được 5.2g.48 Một hoá chất để phân biệt các dung dịch riêng biệt NaCl. D. D. D.00g. 3.136 lít khí (đktc) và m g muối clorua. Cô cạn dung dịch X được m g chất rắn. 18g. C. C. Al (điều kiện phản ứng coi như có đủ) có thể điều chế được A.44g. 5. Al2O3 D. 3. B. Dung dịch Na2CO3. Dung dịch NaOH. CaCl2 . 13. NaOH. m nhận giá trị bằng A.22g muối khan. Dung dịch HCl. B. HCl đặc.95g. ZnO. 12. thu được 2. D. 9. B. Al. Câu 6. Câu 6.54 Hoà tan 4. B.49 Hoà tan hết 10g hỗn hợp muối cacbonat của kim loại IA và IIA bằng dung dịch HCl dư.47 Một hoá chất để phân biệt Al.4800 lít.50 Hoà tan hết 3.52 gam muối. H2O.22g hỗn hợp kim loại gồm K. m g X tác dụng với nước dư được 5. C.34g.20g.15. Na và Ba vào nước được 500ml dung dịch X có pH = 13.4048 lít. AlCl3 là A. Câu 6.05g.51 Cho 2. Al2O3 .45 Một thuốc thử phân biệt 3 chất rắn Mg.6g. D. Giá trị của V là A.52 Cho 3. H2O.8g. dung dịch HCl. m g X tác dụng với dung dịch Ba(OH)2 dư thu được 8.07g. 4.

20ml. 3. D. Cũng lượng hợp kim trên tác dụng vừa đủ với dung dịch NaOH thu được 6. 2. 4. dư thu được 10.9g.4g. C. C.88 lít H2(đktc). 6. 210ml.Câu 6.2g hỗn hợp Al và Al2O3 tác dụng với dung dịch NaOH dư thu được 16.72 lít.2%.8 lít H2 (00C. 18kg C. 8. C. 69. Hỗn hợp sau phản ứng nhiệt nhôm nếu đem tác dụng với NaOH dư thu được 6. Câu 6. C. 2.60 31. 6. D.68%. 34. D.7g. 21ml. 102kg.2%.8atm). B. 5.8%.04g hỗn hợp Fe và Cu tác dụng với dung dịch HNO 3 loãng thu được 0. B. 8. 36.8g. 3. 27g.6g nước để thu được dung dịch có nồng độ 14% là A. 7. B.59 Khối lượng Al2O3 và khối lượng cacbon bị tiêu hao cần để sản xuất được 0.1 mol Ba và 0.72 lít H2 (đktc). B.896 lít NO (đktc).102kg. Khối lượng Al trong hỗn hợp ban đầu là A.2 mol Al vào nước dư thì thể tích khí thoát ra (đktc) là A. 63. Biết đã dùng dư 10ml thì thể tích dung dịch NaOH 4M đã lấy ban đầu là A.96 lít. % Al trong hợp kim là A. nóng.08 lít H2 (đktc). Ca. 4.3%. 10200kg . C. % Fe theo khối lượng là A. K. 9%. 180kg B.6%.57 Cho 9g hợp kim Al tác dụng với dung dịch NaOH đặc.55 Khối lượng K2O cần lấy để hoà tan vào 70.84g muối sunfat.48 lít. % Al tính theo khối lượng là A. và khí thoát ra ở anot chỉ là CO2) có giá trị lần lượt bằng A. 82 .56 Cho hỗn hợp 0. 54g. Câu 6.62 3. C. D.61 Hỗn hợp Al và Fe3O4 đem nung không có không khí. 4. Câu 6.63 2. D. B.24 lít. Kim loại là A. Câu 6. Al. 6.32%.46%.92%. D.72 lít H2(đktc). B. 200ml. Fe. Câu 6. D.4g.54 tấn Al bằng phương pháp điện phân nóng chảy Al2O3 với anot bằng cacbon (coi như hiệu suất điện phân bằng 100%. D.96 lít H2 (đktc).4g. 90%. B. 0. C. 73%. C. nếu đem tác dụng với dung dịch HCl dư thu được 26.1020kg. 180kg D.52g một kim loại tan hết trong dung dịch H 2SO4 loãng thu được 6.58 Hợp kim Al-Mg tác dụng vừa đủ với dung dịch HCl thu được 8.1800kg Câu 6. B. Câu 6. 9. Câu 6.

36g.7H2O. dung dịch thu được cho bay hơi H2O được 55. 13.8g so với ban đầu. anot là nơi xảy ra A. Giá trị a là A. Al B. D. Nhiệt phân hoàn toàn X. E0 (pin) = E0 (catot) + E0 (anot).sự oxi hoá chất khử. 42. D. 62.BÀI TẬP NÂNG CAO Câu 6. 8. 83 . 11g. Thêm H2SO4 vào 20ml dung dịch trên thấy làm mất màu 30ml dung dịch KMnO 4 0. B.64 Cho a g hỗn hợp gồm Al và Fe tác dụng với dung dịch NaOH dư thu được 1 thể tích H2 bằng thể tích của 9. 4. C. D. E0 (pin) = E0 (anot) − E0 (catot). a có giá trị là A. electron.72 Trong pin điện hoá. D. 16. 3. 6. E0 (pin) = E0 (catot) – E0 (anot).12g. Fe C. ion. Câu 6.96 lít H2 (đktc).72 lít. 2. E0 (pin) = E0 (anot) + E0 (catot). Khối lượng chất rắn Y là A. 21. C. tiếp tục thêm vào dung dịch sau phản ứng 13.2g.7H2O tác dụng với H2O thu được 300ml dung dịch. D. C. Câu 6. B.5g.5g. B.55g. C. sự khử chất oxi hoá.2g Fe.5g.22g. Nếu cho a g hỗn hợp trên tác dụng với dung dịch HCl dư thì được 8.22g. C. 0.71 Trong pin điện hoá. B. 5. sự khử chất oxi hoá. D.Câu 6. C. Giá trị a là A.0136g.69 50g một lá kim loại tan hết trong dung dịch HCl thu được 336ml H 2(đktc) và thấy khối lượng lá kim loại giảm 1. sự điện li dung dịch muối. 6. 625. sự điện phân dung dịch muối. sự oxi hoá chất khử B. Câu 6. 0.6g. C. D. Câu 6. thu được chất rắn Y. sự điện li dung dịch muối. B. nguyên tử Zn. B.70 Suất điện động chuẩn E0 (pin) tính bằng A. catot là nơi xảy ra A.8g NaOH tác dụng với dung dịch chứa 8g Fe2(SO4)3. Mg D.255g.2g. Thể tích H2 (đktc) là A.36 lít. B.68 Cho dung dịch chứa 16. Câu 6. 1. Câu 6.48 lít. nguyên tử Cu. Na II. Còn nếu cho a g hỗn hợp trên tác dụng với dung dịch CuSO4 dư thì được chất rắn có khối lượng tăng thêm 0. C. 0.73 Trong cầu muối của pin điện hoá Zn – Cu xảy ra sự di chuyển các A. 4.6 gam FeSO4.66 Cho a g FeSO4.1M. Câu 6.96 lít. Tên lá kim loại là A. sự điện phân dung dịch muối.136g. D. B.6g O2 (đktc).67 Khi khử hoàn toàn a g hỗn hợp gồm Fe và Fe 2O3 ở nhiệt độ cao thu đựơc 11.68g Al2(SO4)3 nữa thì thu được kết tủa X. C. Câu 6.68%.6255g. D.65 Cho Fe tác dụng với dung dịch H2SO4 loãng.

79V. B. B.6H2O. Câu 6. 20. B. Fe + 3Ag3+ → Fe3+ + 3Ag D. C. Câu 6.Câu 6.6H2O. + 0. D.82 Cho 5.81 Cho 5g Na có lẫn Na2O và tạp chất trơ tác dụng với H2O thu được dung dịch X và 1. 0. Thành phần % theo khối lượng của tạp chất trơ là A. C. Câu 6. 0.yMgCl2. Na2CO3. CaCO3. Câu 6. 0. Nồng độ mol/lít của dung dịch NaOH đã dùng là A.5H2O.36g so với trước khi nung.4%.10V và E0(Cu2+/Cu) = +0. Công thức hoá học của muối cacbonat là A. D.6H2O.1.MgCl2. C.56M. 12. Sau điện phân còn lại 100g dung dịch 24%.66V. 2Ag+ + Fe → Fe2+ + 2Ag B.78 Cho công thức hoá học của muối cacnalít là xKCl. Dung dịch X trung hoà vừa đủ 200ml dung dịch HCl 1M. MgCO3.MgCl2. thu được 0.8M.76V. 0. C.H2O.34V. 1.2%. 24%. Cô cạn X thu được 7. D.76V.6%. 84 .8%. C. 0. Công thức hoá học của muối ngậm nước là A. Na2CO3.77 Hoà tan 2.78g chất kết tủa. Fe2+ + 2Ag → 2Ag+ + Fe C. KCl. Nồng độ % của dung dịch NaOH trước điện phân là A. C.32g. 0 Câu 6.1M. + 1.6g muối sunfat trung hoà khan.zH2O. Na2CO3.09V. C.28M.12M hoặc 0. Mặt khác khi cho 5. Câu 6.75 Suất điện động chuẩn của pin điện hoá Sn −Ag là A.08M.1g cacnalít thì khối lượng giảm 4. B. 2. Biết 25cm3 dung dịch này tác dụng vừa đủ với 17.2MgCl2.0. D.2MgCl2. B. B. Công thức hoá học của cacnalit là A.khử Ag+/Ag và Fe2+/Fe là A. 77%.04M hoặc 0.44V. D. D. B. Biết khi nung nóng 11.44V. 2. FeCO3.875 lít khí Y (đktc). B. lọc lấy kết tủa đem nung đến khối lượng không đổi thì được chất rắn có khối lượng giảm 0.42g Al2(SO4)3 tác dụng với 250ml dung dịch NaOH aM. 1.7%.74 Phản ứng xảy ra trong pin điện hoá được cấu tạo bởi cặp oxi hoá.xH2O trong 250cm3 nước cất.10H2O.2M hoặc 2.5g muối Na2CO3. KCl.76 Biết E pin (Zn – Cu) = 1. C.5cm3 dung dịch HCl 0. 2KCl. D.79 Cho 3. Na2CO3.24M hoặc 0.8g muối cacbonat của một kim loại hoá trị II hoà tan trong dung dịch H2SO4 loãng vừa đủ. thu được một chất khí và dung dịch X. Fe3+ + 3Ag → Fe + 3Ag3+ Câu 6. –1. thế điện cực chuẩn (E0) của cặp oxi hoá – khử Zn2+/Zn là A. D.55g cacnalít tác dụng với dung dịch KOH dư.94V.26%. − 0.6H2O. 2KCl. 7.80 Điện phân dung dịch NaOH với cường độ không đổi là 10A trong 268 giờ. Câu 6. ZnCO3.7H2O.

3 D. sau một thời gian thu được 4.90 Nguyên tố R có tổng số hạt (p.86 Hỗn hợp X gồm a mol Al và 0. C. 0. Fe(NO3)2 và Fe(NO3)3 C. . Khối lượng Zn trong hỗn hợp là A. D. 7. Thành phần % theo khối lượng của Al trong X là A. D. lúc đầu không thấy kết tủa. D. B.Fe(NO3)2. 0.675 mol SO2.1s22s22p63s23p1.89%. 3 D. n. 1s22s22p63s2. Câu 6. NH4+.76g hỗn hợp 2 kim loại và dung dịch Y. 35. D. 5.12.2 Câu 6.6g hỗn hợp chất rắn.16g kết tủa và 0.4 C. 23. 2.32g kết tủa.8.6g. 15. Cl-. nóng.Fe(NO3)3 và HNO3 D. 0.Thí nghiệm 2: X tác dụng với dung dịch BaCl2 dư thu được 9.11g. 58. SO42-. Nếu cho 23.4. 10. Hấp thụ hoàn toàn X vào nước được 300ml dung dịch Y. đun nóng thu được 1.08%.87 Khuấy đều một lượng bột Fe và Fe3O4 vào dung dịch HNO3 loãng. Cu tác dụng với dung dịch H 2SO4 đặc. dư thu được 0.88 Cho dung dịch X chứa các ion Mg2+. Câu 6. 0. Fe. B.6.03%.96g chất rắn và hỗn hợp khí X.6 B. B.83 Nung 6. Dung dịch X chứa chất tan A. 1 B. B. Câu 6.15g hỗn hợp X gồm Zn và Cu vào 140ml dung dịch AgNO3 1M. 3.97%. B.22g. Thêm từ từ dung dịch HCl 1M vào X. D. 1.Thí nghiệm 1: X tác dụng với dung dịch NaOH dư.06 mol khí. Fe(NO3)3.84 Cho 21g hỗn hợp 2 kim loại K và Al hoà tan hoàn toàn trong nước được dung dịch X.58g Cu(NO3)2 trong bình kín.Câu 6.1s22s22p63s23p2. 4 Câu 6.89 Cho 5. 6. 2 C.8. C.2g so với ban đầu. NO và còn dư Fe. đến khi kết tủa hoàn toàn thì cần 400ml dung dịch HCl.4. pH của dung dịch Y là A.32g.2g. Giá trị của a là A.85 Cho 23. 1. nung nóng thấy khối lượng chất rắn trong ống giảm 7. e) là 40. 85 .56g. cấu hình electron của R là A. C. Chấm dứt phản ứng thu được dung dịch X. Tổng khối lượng các ion trong dung dịch X là A.4g X tác dụng với dung dịch H2SO4 loãng dư thu được khí Y. .95g. C. Số gam K là A. Dẫn từ từ toàn bộ Y vào ống chứa bột CuO dư. 41.4g X gồm Al.4g. R có hoá trị II. C.4 mol O2 thu được 64. 5. Câu 6. B. HNO3 Câu 6. Fe(NO3)2. 1s22s22p63s23p3.3 mol Mg phản ứng hết với hỗn hợp Y (vừa đủ) gồm b mol Cl2 và 0. Sau khi phản ứng xong được 15.

12 hoặc 0.12 hoặc 0. Câu 6.02M.Câu 6. B. Ba(OH)2. FeCl3.97 Thứ tự pH theo chiều tăng dần các dung dịch có cùng nồng độ mol của NH 3. Ba(OH)2. Giá trị của x là A. NH3. B. Vậy X có cấu hình electron là A. B. C. D. Mg. C.75M. Z = 8). AlCl3.[ KOH] = 0.44g. Ba(OH)2 là A.9M. B. C.64g kết tủa. Nồng độ mol/l của dung dịch CuSO4 ban đầu là A.5M. 1s22s22p2.đều có cấu hình electron ở phân lớp ngoài cùng là 2p 6. [ KOH] = 0. 3.94 Cho ion HXO3-. Số hạt mang điện của nguyên tử Y nhiều hơn X là 12 hạt. X và Y lần lượt là A. Để kết tủa hết ion Cu2+ còn lại trong dung dịch sau điện phân.9M.[ KOH] = 0.12 C.3M B. C.18M. C.2M.91 Nguyên tử của nguyên tố X có tổng số electron trong các phân lớp p là 7. B. NH3. C. X và Y lần lượt là A. nguyên tử của nguyên tố Y có tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện của X là 8.9M. Mặt khác cho 7.9M. Mg và Fe. O. 86 . 0. 0. Fe và Cu. 1s 2s 2p 3s 3p . O (A = 16. e) trong 2 nguyên tử kim loại X và Y là 142. Câu 6. O. 0.99 Điện phân 200ml dung dịch có chứa 2 muối là Cu(NO3)2 và AgNO3 với cường độ dòng điện là 0. Câu 6.1M. 1s22s22p63s23p3. 0.[KCldư] = 0. Câu 6. Câu 6. NH3. Khi trộn dung dịch X vào dung dịch Y tạo thành 1. Ba(OH)2. 1. O.35g hai kim loại kiềm thuộc 2 chu kì liên tiếp vào 500ml dung dịch HCl được dung dịch Y và 2. NH3. trong đó tổng số hạt mang điện nhiều hơn tổng số hạt không mang điện là 42 hạt. D. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 43 hạt. D. 2 2 6 2 4 C. MgCl2. Nồng độ mol các chất có trong dung dịch sau điện phân đã được pha loãng cho đủ 200ml là A.35M.1M. NaOH. NaOH. O. 0. 0.5M D. 1s22s22p63s23p63d64s2. B.15M C.75M thu được 23. n. B. D.52M. Z = 1).56g chất kết tủa. Nồng độ mol/l của dung dịch HCl là A.96 Cho x mol CO2 hấp thụ hoàn toàn vào 200ml dung dịch hỗn hợp gồm KOH 1M và Ba(OH)2 0. [ KOH] = 0.5g CuCl2 và 14. Ca và Fe. khi đó khối lượng cực âm tăng thêm 3.92 Cation X2+ và anion Y2. Be. Al và Fe.38. Ca. Biết H (A = 1. Câu 6. D. D.95 Tổng số hạt (p. Nồng độ mol/l của dung dịch CuSO4 trước điện phân là A. NaCl. B. Tổng các hạt trong ion đó là 123. Câu 6. Ba(OH)2. D. 0. 0. khối lượng dung dịch giảm 8g. NaOH. cường độ dòng điện là 5. cần dùng 100ml dung dịch H2S 0. 0. NaOH.275M.[KCldư] = 0. Ba.9g KCl có màng ngăn và địên cực trơ mất 2 giờ.62g Al trong 280ml dung dịch HNO3 1M thu được dung dịch X và khí NO (sản phẩm khử duy nhất). NaOH.8 lít khí H2 (đktc).1A.93 Hoà tan hoàn toàn 1.100 Điện phân 100ml một dung dịch có hoà tan 13. 1M. 0. 0. D.98 Sau một thời gian điện phân 200ml dung dịch CuSO4 với điện cực trơ. B.88 D.90. 3M Câu 6. C.804A đến khi bọt khí bắt đầu thoát ra ở cực âm thì mất 2 giờ. 0. Công thức hoá học của hợp chất tạo bởi X và Y là A. Câu 6.

344 lít H2 (đktc).61 6. lá (2) vào dung dịch Cu(NO 3)2 đến khi thấy số mol Pb(NO3)2 và Cu(NO3)2 trong hai dung dịch giảm như nhau thì nhấc ra.55 6.101 6.74 6. B.81 6. D. Lấy 2 lá kim loại M có khối lượng bằng nhau. cần 2.19 6.22 6. Câu 6. Zn. B.64 6.75 6.7 B 6.10 D A 6. B.31 6.69 6. 98.90 C A A A A A A B B B 6. thu được chất rắn và dung dịch X.60 C B A D D D A B C D 6.97 6.99 6.2 D 6.50 D A B C B B A A B A 6.2%.1 D 6. Câu 6. Fe3O4. Zn .20 A B C C A A D A B A 6.105 A A A A A 87 . 88%. FeO.36 6.92 6.57 6.72g hỗn hợp bột các chất Fe.62 6. Nhúng lá (1) vào dung dịch CuCl2.96 6.89 6.95 6. Cu.4% so với ban đầu.26 6. Mg.85 6.58 6.68 6.76 6. C.65 6.1M vào X đến khi dung dịch X bắt đầu có màu hồng. Fe 2O3 tác dụng với CO dư ở nhiệt độ cao thu được 3.1%.34 6.96g.27 6.8g một oxit của kim loại trong dãy điện hoá ở nhiệt độ cao.101 M là kim loại hoá trị II.105 4. lá (2) giảm 9.48 6. thấy đã dùng hết 40ml dung dịch KMnO4. 1.8g.102 6.8 B 6.93 6. 16. Công thức hoá học của oxit kim loại là A.18 6.016 lít khí H2 (đktc).12 6. ZnO.45 6. Fe2O3 .71 6.47 6.6% so với ban đầu. Mg.102 M là kim loại hoá trị II. B. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VI 6. Kim loại thu được đem hoà tan trong dung dịch HCl thu được 1.29 6.11 6.25 6.53 6.70 A A D A B C D D B A 6.77 6.9 6. 90%.86 6. D.14 6.5 A 6. M là A.15 6.43 6.37 6.21 6.24 6. CuO.Câu 6. 1. Cũng lượng hỗn hợp trên ngâm trong dung dịch CuSO4 dư thì khối lượng chất rắn thu được là 4.16 6.63 6.91 6.79 6. C.80 A B A A C A A A B A 6. Kết quả về khối lượng: lá (1) tăng 1. 49.32 6.78 6.103 Cho một cây đinh thép nặng 1.54 6. lá (2) vào dung dịch CdCl2 đến khi thấy số mol CuCl2 và CdCl2 trong hai dung dịch giảm như nhau thì nhấc ra.104 Khử 4.103 6. Kết quả về khối lượng : lá (1) tăng 19%.46 6. M là A.14g vào dung dịch H 2SO4 loãng dư. Cd.40 A D C B A C C A A C 6. D. C. %Fe trong đinh thép là A.42 6.92g Fe.30 A C C C C B A A B C 6. 1.56 6. Cu.104 6.100 A C A C A A A B B A 6.49 6. C. Khối lượng Fe trong hỗn hợp là A. Nhỏ từ từ dung dịch KMnO4 0.59 6.3 A 6.28 6.44g.39 6. Câu 6.6 A 6.17 6.84 6.82 6.2 %. D.87 6.6g. lá (2) tăng 8.33 6. B.94 6. D.41 6.13 6.51 6.88 6. Nhúng lá (1) vào dung dịch Pb(NO3)2.4 A 6. Lấy 2 lá kim loại M có khối lượng bằng nhau.72 6.44 6. Câu 6.98 6.83 6.23 6.73 6.68g. C.35 6.67 6.52 6. Fe.66 6.38 6.

E Fe3+ /Fe2+ = 0.Oxit và hiđroxit có tính bazơ. Fe : [Ar]3d64s2. Số oxi hoá +3 Số oxi hoá +6 .Tính khử.Oxit và hiđroxit có tính .Tính khử. 2. 0 0 0 0 .CHƯƠNG VII. 3.Tính oxi hoá.Tính khử và tính oxi hoá. . . Cu : [Ar]3d104s1. Số oxi hoá +3 . tính axit. Crom − Sắt − Đồng . 4. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 .Oxit và hiđroxit có tính bazơ. E Cu 2+ /Cu = 0.74V. t0 2 Cr2O3 (r) + NH 3 CrO3 + bột Al + Cl . Sơ đồ minh hoạ tính chất hoá học của crom + O . Sơ đồ minh hoạ tính chất hoá học đồng + + 88 . E Fe2+ /Fe = -0.Oxit và hiđroxit có lưỡng tính.Thế điện cực chuẩn E Cr3+ /Cr = -0.2 KI Cr +6 (dd) Kiềm Axit Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 . .Oxit và hiđroxit có tính bazơ. .Cấu hình electron nguyên tử Cr : [Ar]3d54s1.44V.Tính oxi hoá. CROM − SẮT − ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1.77V. t0 2 Nước CrCl3 (r) + Cl +Zn 2 +(O +H O) 2 2 H2CrO47 H2Cr2O Cr HCl H2SO4(l) Cr (dd) Axit Cr(OH)2 +2 Cr +3 +Br (dd) +SO2.34V. .

Fe + 2HCl  → FeCl2 + H2. . t 0 CuO (đen) 3 Cu2O (đỏ) Chất khử CO. HNO3.Bình Au Zn +2 Zn2+/Zn -0. +1. Fe + 6HNO3 đặc  → Fe(NO3)3 + 3NO2 + 3H2O. (+2) Ag+/Ag +0.76 Mạnh Sn +2. Fe + S  FeS. Sơ lược về các kim loại Ag. → t0 2. Sn. 5.26 Rất yếu T.Tính oxi hoá. 2Fe + 3Cl2  2FeCl3. 10000C Cu 0 Không khí.5H2O Cu(NO3)2.3H2O Không khí. 2Fe + 6H2SO4 đặc  Fe2(SO4)3 + 3SO2 + 6H2O.14 Yếu Pb +2.MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) t0 1. Zn. Fe + 4HNO3 loãng  → Fe(NO3)3 + NO + 2H2O. NH . Fe + H2SO4 loãng  → FeSO4 + H2.08 Rất yếu Ni +2. Au.Oxit và hiđroxit có tính bazơ. → 4. Ni. +3 (+3) Au3+/Au Ni2+/Ni +1. 8. → 7. +4 Sn2+/Sn -0.[Cu(NH3)4]2+ NH3 Cu(OH)2 OH - H + HCl + O2. H2SO4 đ dd FeCl3. 89 . 5.5 -0. 3Fe + 2O2  Fe3O4. → 0 t 3. Pb Số oxi hoá Eo(V) Tính khử Ag +1. t0 6.13 Yếu B . t Không khi ẩm Khí Clo khô t0 CuCO3.Cu(OH)2 (r) CuCl2 (r) Số oxi hoá +2 . AgNO3 Cu2+ (dd) H + Kết tinh CuSO4. +4 Pb2+/Pb -0.

. 17. 29. 14. 31. 42. 11. 23. FeO + 2HCl  → FeCl2 + H2O. FeCl3 + 3NaOH  → Fe(OH)3 + 3NaCl. 0 t 3Fe2O3 + CO  2Fe3O4 + CO2. 40. 25. Fe2O3 + 6HCl  → 2FeCl3 + 3H2O. 43.. t0 4FeS2 + 11O2  2Fe2O3 + 8SO2... → Fe2O3 + 3H2SO4 loãng  → Fe2(SO4)3 + 3H2O. 2FeCl3 + Fe  → 3FeCl2. 30. 19.. → 0 t Fe2O3 + 3CO  2Fe + 3CO2. Fe2O3 + 3H2SO4  → Fe2(SO4)3 + 3H2O. 35. 41. 90 Fe (dư) + HNO3  → Fe(NO3)2 + . t0 3FeO + 10HNO3 đặc  3Fe(NO3)3 + NO + 5H2O. → t0 2Cr + 3S  Cr2S3. t0 FeO + CO  Fe + CO2. 27. 21. → FeO + H2SO4 loãng  → FeSO4 + H2O. 32. t0 2Fe(OH)3  Fe2O3 + 3H2O.9. >5700 C Fe + H2O → FeO + H2. 22. 34.. 33. 2FeCl3 + 2KI  → 2FeCl2 + 2KCl + I2. Fe + 3AgNO3 (dư)  → Fe(NO3)3 + . Fe + CuSO4  → FeSO4 + Cu. Fe(OH)3 + 3HCl  → FeCl3 + 3H2O. 44. 36. → 0 t 2FeO + 4H2SO4 đặc  Fe2(SO4)3 + SO2 + 4H2O. → Fe(OH)2 + 2HCl  → FeCl2 + 2H2O. 13. 2FeCl2 + Cl2  → 2FeCl3. → t0 4Cr + 3O2  2Cr2O3. 4Fe(OH)2 + O2 + 2H2O  → 4Fe(OH)3. Fe (dư) + H2SO4 (đặc)  → FeSO4 + . 2FeCl3 + Cu  → 2FeCl2 + CuCl2. FeCl2 + 2NaOH  → Fe(OH)2 + 2NaCl.. 26. Fe + 2AgNO3  → Fe(NO3)2 + 2Ag. 24. 20. 37. 16.. 38. 10. → . → 0 t 2Cr + 3Cl2  2CrCl3.. Fe(OH)2 + H2SO4  → FeSO4 + 2H2O. 10FeSO4 + 2KMnO4 + 8H2SO4  → 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O.. 12. 39. 2FeS2 + 14H2SO4  → Fe2(SO4)3 + 15SO2 + 14H2O. <5700 C 3Fe + 4H2O → Fe3O4 + 4H2. 28. → t0 Fe2O3 + CO  2FeO + CO2. 18. → 2Fe(OH)3 + 3H2SO4  → Fe2(SO4)3 + 6H2O. 15..

→ t0 2Cu + O2  2CuO. 2Cr + 3SnCl2  → 2CrCl3 + 3Sn. 2CrCl2 + Cl2  → 2CrCl3. 58. 69. 66. 79. 4CrCl2 + O2 + 4HCl  → 4CrCl3 + 2H2O. 2CrCl3 + 3Cl2 + 16NaOH  → 2Na2CrO4 + 12NaCl + 8H2O. 78. 63. K2Cr2O7+6KI+7H2SO4  Cr2(SO4)3+4K2SO4+3I2+7H2O. CrCl3 + 3NaOH  → Cr(OH)3 + 3NaCl. K2Cr2O7 + 3H2S + 4H2SO4  → Cr2(SO4)3 +3S + K2SO4 + 7H2O. 74. 71. Na2Cr2O7 + S  → Na2SO4 + Cr2O3. 53. → t0 2Na2Cr2O7  2Na2O + 2Cr2O3 + 3O2. 56. 61. 52. → CrO3 + H2O  → H2CrO4. 2CrO3 + H2O  → H2Cr2O7. 65. 60. 50. Cr(OH)3 + 3HCl  → CrCl3 + 3H2O. 75. 54. 73. 2CrCl3 + Zn  → ZnCl2 + 2CrCl2. to 4Cr(OH)2 + O2 + 2H2O  4Cr(OH)3. 0 t Cr2O3 + 2Al  2Cr + Al2O3. 67.45. 70. → >1000 C 2CrO + O2  2Cr2O3. 4200 C 4CrO3  2Cr2O3 + 3O2. 49. 77. 47. → K2Cr2O7 + 6FeSO4 + 7H2SO4  → 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. CrCl2 + 2NaOH  → Cr(OH)2 + 2NaCl. 0 t (NH4)2Cr2O7  Cr2O3 + N2 + 4H2O. 55. → 2Na2CrO4 + H2SO4  → Na2Cr2O7 + Na2SO4 + H2O. Na2Cr2O7 + 14HCl  → 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 0 t Cu + Cl2  CuCl2. 64. → 2CrO3 + 2NH3  → Cr2O3 + N2 + 3H2O. 62. 68. 46. 72. 59. 57. Cr2O3 + 3H2SO4  → Cr2(SO4)3 + 3H2O. 80. 76. → Cr(OH)2 + 2HCl  → CrCl2 + 2H2O. Cr + 2HCl  → CrCl2 + H2. 2Cr2O3 + 8NaOH + 3O2  → 4Na2CrO4 + 4H2O. 2NaCrO2 + 3Br2 + 8NaOH  → 2Na2CrO4 + 6NaBr +4H2O 2Na2Cr2O7 + 3C  → 2Na2CO3 + CO2 + 2Cr2O3. Cr + H2SO4  → CrSO4 + H2. K2Cr2O7 + 3K2SO3 + 4H2SO4  → Cr2(SO4)3 + 4K2SO4 + 4H2O. Cr(OH)3 + NaOH  → Na[Cr(OH)4] (hay NaCrO2). o t 2Cr(OH)3  Cr2O3 + 3H2O. 48. → 91 . → CrO + 2HCl  → CrCl2 + H2O. 51.

→ 0 t Ni + Cl2  NiCl2. 86. → t0 Zn + O2  2ZnO. 106. 90. 99. CuO + 2HCl  → CuCl2 + H2O. 89. Sn + 2HCl  → SnCl2 + H2. → Cu + 2H2SO4 đặc  → CuSO4 + SO2 + 2H2O. 94. 83. → t0 CuO + Cu  Cu2O. → ñieä phaâ dung dò n n ch CuCl2  Cu + Cl2. → Cu2O + H2SO4 loãng  → CuSO4 + Cu + H2O. → 3Pb + 8HNO3 loãng  → 3Pb(NO3)2 + 2NO + 4H2O. Cu + 2AgNO3  → Cu(NO3)2 + 2Ag. 101. 96. → ñieä phaâ dung dò n n ch 2Cu(NO3)2 + 2H2O  2Cu + 4HNO3 + O2. Cu + 2FeCl3  → CuCl2 + 2FeCl2. 111. 113. 3Cu + 8NaNO3 + 4H2SO4  → 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. → Cu(OH)2 + 4NH3  → [Cu(NH3)4]2+ + 2OH-. 5000 C 2Ni + O2  2NiO. 2Cu + 4HCl + O2  → 2CuCl2 + 2H2O. → ñieä phaâ dung dò n n ch 2CuSO4 + 2H2O  2Cu + 2H2SO4 + O2. 0 t Cu(OH)2  CuO + H2O. 91. 92. 104. → t0 Pb + S  PbS. → t0 3CuO + 2NH3  N2 + 3Cu + 3H2O. → 0 t CuCO3. Cu(OH)2 + 2HCl  → CuCl2 + 2H2O. 110. → t0 CuO + CO  Cu + CO2. 0 t 2Cu(NO3)2  2CuO + 2NO2 + 3O2. → 0 . 102. 87. CuS + 4H2SO4 đặc  → CuSO4 + 4SO2 + 4H2O. → 0 t Zn + S  ZnS. → 0 t 2Pb + O2  2PbO. 88. 107. 116. 82.81. 115. 0 t CuO + H2  Cu + H2O. 100. 105. 98. → t0 Zn + Cl2  ZnCl2. 85. 84. Cu + 4HNO3 đặc  → Cu(NO3)2 + 2NO2 + 2H2O. 3Cu + 8HNO3 loãng  → 3Cu(NO3)2 + 2NO + 4H2O. 109. Cu(OH)2 + H2SO4  → CuSO4 + 2H2O. 92 t Cu + S  CuS. 108. t0 Sn + O2  SnO2. 103. 112.Cu(OH)2  2CuO + CO2 + H2O. → CuS + 2AgNO3  → 2AgS + Cu(NO3)2. 95. 114. 97. CuO + H2SO4  → CuSO4 + H2O. 93.

D. B. D. Phản ứng tự oxi hoá. ZnSO4. O2. +3. Zn(HCO3)2. +6. [Ar]3d5. Cr2O3. D. B. Phản ứng oxi hoá. Na. Phản ứng phân huỷ không phải là oxi hoá. Câu 7. Ag.2 Cấu hình electron nào sau đây là của ion Fe3+ ? A. +2. ZnO. C. +6. ZnSO4. B. MgSO4.5 Khi nung Na2Cr2O7 thu được Na2O. 2Ag + 2H2S + O2  → 2Ag2S + 2H2O. Xiđerit. C . → Au +HNO3 + 3HCl  → AuCl3 + 2H2O + NO.117. C. +6. Câu 7. Mg. Câu 7. +3. Na. Ag2O + H2O2  → 2Ag + H2O + O2. [Ar]3d .7 Hợp chất nào sau đây không có tính chất lưỡng tính ? A. D. 120. Câu 7. → ñieä phaâ dung dò n n ch 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2. C. D. D. t0 2AgNO3  2Ag + 2NO2 + O2. Phản ứng trên thuộc loại phản ứng nào sau đây ? A.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ? A. B.khử. 118. D. Ag + 2HNO3(đặc)  → AgNO3 + NO2 + H2O. +4. Phản ứng oxi hoá. Manhetit. B. +4. +4. B. Ba. Mg. Câu 7. Câu 7.khử. Hematit. Ag.khử nội phân tử. +2. 122. [Ar]3d10. 124.khử phức tạp. Fe.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ? A. 2Ag + O3  → Ag2O + O2. [Ar]3d . 4 C. Ba.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ? 93 . Na. [Ar]3d6. C. B. C. +1. CaSO4. Pirit sắt. Mg. Câu 7. Hg. Câu 7. 121. [Ar]3d3. [Ar]3d8.6.4 Các số oxi hoá đặc trưng của crom là ? A.BÀI TẬP TRẮC NGHIỆM I – BÀI TẬP CƠ BẢN Câu 7. C. 123. Zn(OH)2. Đó là muối nào sau đây ? A. D. − 5Sn 2+ + 2 MnO4 + 16 H + → 5Sn4+ + 2 Mn2+ + 8 H2 O. Cấu hình electron của ion Cu2+ là A. B. +6. 9 C. 119. [Ar]3d7. MnSO4. +2.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư.

Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan. Cu có khả năng tan trong dung dịch FeCl3.15 Cho biết câu sai trong các câu sau : A. B.. C đều đúng. NO2. H2SO4 loãng. Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy. D. B. Lá 2 đốt trong khí clo dư thu được m2g muối. Al-Cu.13 Có 2 lá sắt khối lượng bằng nhau. m2>m1. C. D. Cu2S(4). NH3. D. a. Câu 7. HCl. để bảo quản dung dịch muối sắt (II). Tăng lên. B.10 Phân biệt 3 mẫu hợp kim sau : Al-Fe. Câu 7. Crom là kim loại có tính khử mạnh hơn sắt. Câu 7. D.16 Trong phòng thí nghiệm. Fe2O3(2). Câu 7.A. b. CuS(3).. D. Kim loại Cr có thể cắt được thuỷ tinh. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép. Fe3O4(3).14 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất : FeO(1). Dung dịch : KOH. Hoá chất cần dùng là : A. Giảm đi. dung dịch HCl. FeS(4). CrO là oxít bazơ. dung dịch H2SO4. FeSO4(6). Dung dịch : NaOH. N2O. sắt kim loại. Các chất có % khối lượng đồng bằng nhau là……………. người ta thường cho vào đó : A. Câu 7. Câu 7.12 Cho biết câu nào không đúng trong các câu sau: A. Câu 7. D. a. D. C. B. B. dung dịch NaOH. Cả A.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau : 94 . B. Cu2O(2). m1=m2. m1>m2. C.5H2O(6). C. Chất có phần trăm khối lượng sắt nhỏ nhất là………… Câu 7. Câu 7. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2.. C. Không thay đổi. HNO3 đặc nguội. FeS2(5). NO. Fe2(SO4)3(7).17 Điền đáp án đúng nhất vào dấu (…) trong câu sau: Cho các chất: CuO(1). Chất có % khối lượng đồng nhỏ nhất là……………. Chất có phần trăm khối lượng sắt lớn nhất là………… b. Không xác định được. Cu-Fe bằng phương pháp hoá học. Mối liên hệ giữa m1 và m2 là A. CuSO4(5).11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ? A. Ag có khả năng tan trong dung dịch FeCl3. CuSO4. dung dịch AgNO3. FeSO3(8). C. Chất có % khối lượng đồng lớn nhất là……………. B. B. c. C. Fe có khả năng tan trong dung dịch FeCl3.

3584 lít.92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0.68.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi. xăng.16. D. Câu 7. Đốt cháy hết phần 2 trong oxi thu được 4.0896 lít.16M và H2SO4 0. Câu 7. 1. B. M (trong 5. Câu 7.6g.36. CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả. Chọn câu đúng trong các câu sau : A. CuSO4 có thể dùng làm khô khí NH3. 2.84. Câu 7.5 mol. D. 0. Câu 7.672 lít. D. Câu 7. Ngâm lá kẽm vào dung dịch.26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO 4. C. Câu 7. Kim loại đó là kim loại nào ? A.3999g .48 lít. Cho AgNO3 vào dung dịch.52g hỗn hợp A) lần lượt là A.84g muối sunfat. sấy khô. cân nặng 4. D.52g một kim loại tác dụng hết với H2SO4 loãng. thu được 6.448 lít. 7. B. 2. D. C. sau một thời gian lấy đinh sắt ra. Thể tích khí (ở đktc) là A.36g hỗn hợp gồm Fe3O4 và oxit của M. FeCl2. C. Cu có thể tan trong dung dịch FeCl2. số gam của Fe. 3.100g. C.24 Lấy 5.16. 27. Phần 1 tác dụng hết với dung dịch HCl thu được 2.36 lít. FeCl3. Fe3O4.27 Hỗn hợp A gồm FeO. FeCl3. B. D. D.20 Cấu hình electron của Cr3+ là phương án nào ? A. [Ar]3d . Dung dịch thu được sau phản ứng gồm các chất A. dung dịch thu được cho bay hơi được tinh thể FeSO4. Mg.4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15. B. 18. 10.7H2O có khối lượng là 55. 2. C. 0. HCl. C. B. Fe. 4. Khối lượng của hỗn hợp A là bao nhiêu gam ? 95 . C. Trong hỗn hợp A mỗi oxit đều có 0. 3. [Ar]3d5. Câu 7. HCl. 0. Al.25 Cho Fe tác dụng với dung dịch H2SO4 loãng. 3 C. B. FeCl3. Fe2O3. 0. Ngâm lá sắt vào dung dịch.16. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư. C. HCl. 3. 3. Ngâm lá đồng vào dung dịch.33 lít. D. Khối lượng sắt tham gia phản ứng là bao nhiêu ? A.36. [Ar]3d4. FeCl2.252g. Câu 7.2857g. B. Khối lượng mol của M. B. 8.A.22 Cho 2. chia làm 2 phần bằng nhau. 0. 54. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ? A. [Ar]3d2. B. Cu có thể tan trong dung dịch AlCl3.999g.23 Cho 1. Zn.16 lít.016 lít hiđro (đktc). 2.19.36. 0. 1. D. 27. FeCl2.52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi.

16g. 464. 22. 2.48 lít khí duy nhất NO (đktc). 1. ZnO. 3. Câu 7.32 Cho 19. B. Câu 7. C.65.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao.34 Đốt 12. M là kim loại nào ? A. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư.2g kim loại M tác dụng với dung dịch HNO3 loãng. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ? A. B. dư thu được 4. 15.405g hỗn hợp Fe2O3. D. D. 30. C. 88. Biết hiệu suất của quá trình 96%. C.2 g/ml) đã tác dụng với thanh đồng là A.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H 2SO4 loãng thu được 560ml khí ở đktc. 0. 50.68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra.65.04 lít. Đáp số khác. Câu 7. Fe. B. Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là A. Câu 7.12 lít. 15. Zn. 0.56. C. Giá trị của m là A.8g đồng trong không khí thu được chất rắn X. 3.69. Câu 7. C. Thể tích dung dịch AgNO3 32% (D=1. C. Mg.36 lít. Câu 7.35 Đốt 12. 232. 22. Na2Cr2O7 còn dư 1 mol. 35. 0.2.84 lít. D.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%. D. C.5 lít. 177 ml. C. B. Khối lượng muối sunfat khan thu được là A. 21. B. Khối lượng chất rắn X là A. Hoà tan chất rắn X trên vào dung dịch HNO3 0. 10. Khối lượng kết tủa thu được là bao nhiêu gam ? A. 20. 88. Câu 7. CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0.8g đồng trong không khí thu được chất rắn X. D. Phản ứng này không thể xảy ra.1M. 21. B. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO 4 96 . Na2Cr2O7 đã hết. 54.2g. 177 lít.8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171.8 lít.5M thu được 448 ml khí NO (đktc). Na2Cr2O7 còn dư 0. D. C. 25. Cu. Câu 7.52g.5 mol. Câu 7. B.33 Cho 7.4. Vậy: A.56.36 Cho 1.A.5 ml. 116. 25. B. D.31 Một thanh đồng nặng 140.24 lít. Câu 7. C. Hoà tan chất rắn X trên vào dung dịch HNO3 0.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O. C.5M thu được 448 ml khí NO (đktc). Đáp số khác. 0.9333 lít D. B.08g. Cr2O3 và 48g oxi. B.405g D.

6. 14g. 11. B. 28g. Sau phản ứng thu được 1.41 Hỗn hợp X gồm Cu và Fe. 3. Oxit sắt đó là ? A. 1. 32g. Zn.8g. Câu 7.72 lít (đktc). sắt. Nguyên tố X là A.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X. 5%. D.76g chất rắn. C. 4. Câu 7. Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4. B. Câu 7. 3. n) là 82. sấy khô thấy khối lượng tăng 1. Giá trị của V là bao nhiêu ? A. 50g. B. Cr và Al trong hợp kim lần lượt là A. Đáp số khác. Thành phần phần trăm của Fe. 60. 75%. D. 2. 2. sau một thời gian lấy thanh sắt ra rửa sạch. Fe2O3.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e. Câu 7. C photpho. B. trong đó Cu chiếm 43. C.8 lít khí. Cho 14.95%.448 lít khí (đktc). 1. C. Các khí đo ở đktc.4g. 2. crom.05%. 83%.36 lít.4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1. Câu 7. 80%. 4.4. Cu. Câu 7. đem hoà tan vào dung dịch HCl thấy bay ra 0.2g. B.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32.2.40 Cho 100g hợp kim gồm có Fe. Fe.5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6. Tên của kim loại đã dùng là A. nếu sục thật 97 . D.2g.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X. 80%. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là A. C.24% khối lượng. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4. 55. D. C. B. B. 84%. Al. 4.38 Khử 2. 13%. Hiệu suất của phản ứng khử CuO là A. Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38. 1. C. D. FeO.48 lít. D. 9. 70%. cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1. trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22.8g.12 lít. D. Fe3O4. Mặt khác. 4%. Câu 7.8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra. C. p. 4%.thì thu được một chất rắn. 10.8g.5g. 12%. D. Không xác định được. Câu 7.98 lít khí.24 lít.4g. Câu 7. Có bao nhiêu gam Cu đã bám vào thanh sắt ? A. 2. B.8. D. 84%. 19.43 Nhúng thanh sắt vào dung dịch CuSO4.5g. brom. Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là A. 15%. B. C.48 lít NO (đktc). 85%. 60g.

9g. Câu 7. 69.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí. 46. Fe3O4 thấy có 4.0053 lít. 2. 0. B. D. thấy có 0.61g kết tủa trắng. B. C. Câu 7. Không xác định được. D. 6. chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO 3.6g. C.48 lít. B. B. 6. Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là A.6492 g AgCl. 0. 5. C. Thể tích CO (đktc) đã dùng là A.53 Khử 9. B.42)g muối khan. Fe2O3. FeCl2. Sau khi phản ứng kết thúc. 0. D. C. FeCl3. B. 5. 6. 8. Câu 7. D.672 lít. B.72 lít.36 lít.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO 3 tạo ra 2. B.89g. 3. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là A. nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26. nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6.24 lít. D. Câu 7.6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao. Những chất còn lại sau phản ứng.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH. Công thức của muối sắt đã dùng là A. 4. 27g.47 Một dung dịch có hoà tan 3. D. Thể tích hiđro đã dùng (170C và 725mmHg) là A. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3. 6. Đáp số khác. 4.6g. C.4 lít. m có giá trị là A.12 lít. Không xác định được.2g. Đáp số khác. 27g. 0. C. D. Câu 7.48 lít khí CO2 (đktc) thoát ra. 1.24 lít.196 lít khí CO2 (0oC và 0. 4 lít. FeCl2.2g Cu vào dung dịch HNO3 loãng.48 lít. thu được sắt và 2.64g. 4. Câu 7. Cả FeCl2 và FeCl3.72 lít hiđro (đktc). 22. C.88g nước.4g.25g sắt clorua tác dụng với dung dịch AgNO 3 dư tạo ra 8. Cả FeCl2 và FeCl3. D.84%. 3. 3. Câu 7. 16g.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư. 42g.92g. C. Thể tích CO (đktc) đã tham gia phản ứng là A. D. B.584 lít. Câu 7.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO. Thành phần phần trăm cacbon trong mẫu thép là A.54 Hoà tan hoàn toàn 19.4%.8 at) thoát ra.42%. 69. C.48 lít. thu được chất rắn có khối lượng 11.88 lít hiđro (đktc). Câu 7. 2.36 lít. sau đó làm bay hơi 98 . Công thức của muối sắt là A.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao.chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m 1 + 1.72 lít.08g. FeCl3.

0. . Đáp số khác. kim loại Cu. thu được chất rắn có khối lượng là 0. Câu 7. 48.63 Chỉ ra câu đúng trong các câu sau : 1. C. B.1 mol Fe3O4. B. 4. 32%. thu được 560ml hiđro. Khối lượng muối khan thu được sau phản ứng là A.61 Để khử ion Fe3+ trong dung dịch thành ion Fe2+ có thể dùng một lượng dư A. B. B.58 Chia 4g hỗn hợp bột kim loại gồm nhôm. Thêm dung dịch kiềm vào muối đicromat.84g. 0. 1. V1=V2. B. 64. C. 60%. 8. sắt và đồng thành 2 phần đều nhau.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb. C. Cho NaOH vào Y. B. C. C. Không đủ cơ sở để so sánh.4g. kim loại Ba. D. 40%. Giá trị của m là A. Câu 7. 3 và 2.59 Cho sơ đồ phản ứng sau : Cu + HNO3  → muối + NO + nước. 3 và 3.02. 68%. Câu 7.1 mol Fe2O3 và 0. Mối liên hệ giữa V1 và V2 là A.02. 2. D. Câu 7. Câu 7. Số mol của Al. thu được dung dịch Y.dung dịch và đun nóng. Fe và Sn. kim loại Mg. 3 và 8. Fe và Ni. 3 và 6. . 2. Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc).01. Lọc lấy kết tủa. Hoà tan X bằng dung dịch HCl dư. D. 32%. thu được kết tủa Z. D. 40. Fe trong 4g hỗn hợp lần lượt là: A. Khi nhúng các cặp kim loại trên vào dung dịch axit. B. 5. V1>V2.01. Câu 7.72g. nhôm trong hợp kim lần lượt là A. V1<V2. 60%. II – BÀI TẬP NÂNG CAO Câu 7. C. 32. D. 0.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V 1 lít khí (đktc). kim loại Ag. B. 0. D. D.01. 4. 40%.4g. thu được 336ml hiđro. Các khí đo ở đktc.448 lít khí không màu hoá nâu trong không khí (đo ở đktc). 68%. muối này chuyển thành muối cromat.57 Chất rắn X gồm 0. rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn. 99 . 0.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO 3 thấy thoát ra 0.Phần 2 : tác dụng với lượng dư dung dịch NaOH.02. Câu 7. Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là A. D. Phần trăm về khối lượng của đồng. 0. C.Phần 1 : tác dụng với lượng dư dung dịch HCl. số cặp kim loại trong đó Fe bị phá huỷ trước là A. Hợp chất Cr(II) có tính khử đặc trưng. Đáp số khác. C. còn hợp chất Cr(VI) có tính oxi hoá mạnh. 3.

K2CrO4. 3. 5. CrO. Câu 7.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. 6. Biết 0 ECr 3+ / Cr = −0. D. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1).64 Cho từng chất Fe. 2. Câu 7. D. (2) X1 + HNO3 → X4 + NO2 + H2O. 3. + (5) X4 + NaOH → X6  + NaNO3. 3. Cr2O3. 4. 5. 4. X2. C. FeO. D. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy. 8.khử là A. B. 5.68 Cho sơ đồ phản ứng : Cr + Sn2+  → Cr3+ + Sn (1) Cr + Cu2+  → Cr3+ + Cu (2) a. Fe(OH) 2. Fe(OH)3. Cr2O3. B. 3. B. C. màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. Fe3O4. KCr2O4. (3) X2 + Cl2 → X3. FeCO3 lần lượt phản ứng với HNO3 đặc nóng. 100 . Dung dịch X chứa chất có công thức phân tử là A. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước. FeSO4. 8. C. Cr(OH)3. Cr(OH)2 tác dụng được với dung dịch HCl còn CrO 3 tác dụng được với dung dịch NaOH. Na2CrO4. 1. 7. màu của dung dịch dần dần trở lại đỏ cam. B và C lần lượt là : A. 6. D. Na2Cr2O7. 8. 7. C. 5. -0. D. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ. 6.3.67 Cho các sơ đồ phản ứng : (1) X1 + HCl → X2 + H2. Cr(OH)2 đều có tính chất lưỡng tính. C. 6. Crom là kim loại có tính khử mạnh hơn sắt. 5. Na2Cr2O7. hệ số của ion Cr3+ sẽ là A. Na2CrO4. X5. 4. Câu 7. 7. A. 2. B. 1. chất B tác dụng với axit chuyển thành chất C có màu da cam. 2. 8. Các hợp chất Cr2O3. Nếu cho thêm vào một lượng KOH. b. K2CrO4. Nếu thêm vào đó một lượng H 2SO4. Suất điện động chuẩn của pin điện hoá là A. Kim loại crom có thể cắt được thuỷ tinh. K2Cr2O7. 7. 8.66 Dung dịch X có màu đỏ cam.88 V. Fe2(SO4)3. Câu 7. 3. 0. Fe(NO3)2. Số phản ứng thuộc loại oxi hoá. K2CrO4.6 V. B. X6 lần lượt là X1 A B C D Cu Fe Fe Fe X2 CuCl FeCl2 FeCl3 Fe(NO3)3 X3 CuCl2 FeCl3 FeC2 FeCl3 X4 Cu(NO3)2 Fe(NO3)3 Fe(NO3)3 Fe(NO3)2 X5 CuOH Fe(OH)2 Fe(OH)2 Fe(OH)3 X6 Cu(OH)2 Fe(OH)3 Fe(OH)3 Fe(OH)2 Câu 7. 5. (4) X2 + NaOH → X5  NaCl. X4. Công thức phân tử các chất A. Cr2O3. Fe(NO3)3. Fe2O3. Khi cân bằng 2 phản ứng trên. H2CrO4. Cr2O3. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo. (7) X5 + O2 + H2O → X6 Các chất X1. 2. Các hợp chất CrO. X3. 8. 1. K2Cr2O7. 74 V. B. K2Cr2O7.

B. D. D. 139.1g. Đáp số khác. 0. 101 . -0.08 V.72.272g. 2. B.0075 mol. Câu 7. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là A. 0. C.4 tấn. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ? A. Biết 0 ECr 3+ / Cr = −0. C. Đáp số khác.88 V. 2 tấn. D. 57%. 0. 0. 5. C. được 200 cm3 dung dịch. D.8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87. D. Câu 7.4 V.21g.69 Hoà tan 58g muối CuSO4. b. Đáp án khác. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M.6 V. b. 0. lấy lá kẽm ra khỏi dung dịch. a. 1. D.73.C. -0. 74g. Sau phản ứng. Câu 7. Biết 20 cm3 dung dịch này được axit hoá bằng H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0. 1. Nếu lấy quặng hematit trên đem luyện gang. 3. 16. 12. Câu 7.5 tấn. B.856g. B. C. D. C.8 tấn. 1.82 tấn.71 Khối lượng quặng chứa 92. Tăng 22. C.4 V.03M là A.02625g. Cho dần dần mạt sắt đến dư vào phương trình trên.5%) là : A.725 M. 74 V. a. 6 tấn.9g. 0.7%. Tăng 1. 0. 0.464 M. Giảm 1. Đáp số khác. rửa nhẹ.28 tấn.5 tấn.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước.432 M. được 500 ml dung dịch. D. B. D. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0. rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0.3265 tấn.9g.8 V. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2). B. c. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là A. 0. Đáp số khác. C. 113. a. -0. đem cân thấy lá kẽm có khối lượng là A.00075 mol. 1. C. 11. Suất điện động chuẩn của pin điện hoá là A. B.5H2O trong nước. sấy khô. D.03 M. Đáp số khác. D.00375 mol.2 tấn. B. c. Câu 7. B. b. Phần trăm theo khối lượng FeSO4 tinh khiết là A.856g. C. B.1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%) A. C. 90g.68g. 2. 0. 21%. 0. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu : A.

5M. A.5g.8g. 1: 6. Thể tích khí CO phản ứng (đktc) là A. Câu 7. Fe3O4. 1: 3. D.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3. Câu 7.32.78.6M. FeO và Fe2O3. kẽm tác dụng với oxi dư nung nóng thu được 46. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. 0.44g. Sn. Câu 7. Fe2O3.81.56 lít (đktc) NO (là sản phẩm khử duy nhất). 12. D. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư). B. 6. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19. B.44g. C. Câu 7.04g.76. 10.22. Pb. CuO.72 lít khí (có màu nâu đỏ) duy nhất (đktc). 20.22g hỗn hợp X gồm Fe. B. 300ml. C.68 lít. sắt. Lấy m1g X cho vào một ống sứ chịu nhiệt. 10. 63. D. 3. Fe3O4) với số mol bằng nhau.08g. Nung m g bột sắt trong oxi. Cho 23. C. Hoà tan hết hỗn hợp gồm 0. 2.72 lít.52. 20.3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất). Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng.88g.80. đồng.5g.5H2O cho m1 vào m2g dung dịch CuSO4 8%. 10.62.2M.88g. B. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư. Câu 7. Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là A. 2. FeO. 1. 5. C. 1M.12 lít.04g.685g.4g chất rắn X. Cr. B. B.24 lít.344 lít hiđro (đktc) và dung dịch chứa m g muối. 1: 4. 20. 5. 10. Câu 7. Câu 7. khối lượng chất rắn thu được giảm 4. 10. D. C.84 lít. Tính khối lượng m1. B.77.36 lít. 20. thu được 1.08g.25. 127. 1. 200ml. 100ml.75. 1: 5. B.52. 10. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2. 10. B. D.768 lít.2 mol FeS2 và 0.74. thu được 3g hỗn hợp chất rắn X. Giá trị của m là A. m2.24 lít khí NO duy nhất (đktc). Cho 40g hỗn hợp vàng. 2.685g D. 8. D. Giá trị của m là A. C. Câu 7. C. 400ml. 2. D. 3. Ni.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4. PbO bằng khí CO ở nhiệt độ cao. Hoà tan hoàn toàn 3.7. C. B.2g gồm Fe.8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+. bạc. khí CO 2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH) 2 thu được m2g kết tủa trắng. nung nóng rồi cho một luồng khí CO đi qua. 102 . 2. thoát ra 0. Giá trị của V (ở đktc) là A. Khử 16g hỗn hợp các oxit kim loại FeO. D. Giá trị m và nồng độ dung dịch HNO3 lần lượt là A. 56 lít. 9. Tỉ lệ là m2 A.98. 7. cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6. Kim loại X là A.27.

56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2. Số mol khí CO2 thu được là A. 15.15 mol.24 lít.136 lít khí (đktc) và m g muối sunfat.688 lít.2g Cu vào 1 lít dung dịch gồm H2SO4 0. 0. X là A.24 lít. C. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12. C. A. thu được 5g kết tủa. D. Mg.85g muối clorua khan. 5.2M. Chưa đủ dữ kiện để xác định. C. 4. Fe2O3. V nhận giá trị bằng A.36 lít. 18.36 lít.76g kết tủa trắng.12 lít.18g. C. Al. Al và Fe bằng dung dịch H 2SO4 loãng. 6.1g.04g. 3.9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao.48 lít. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0.02g. C. m nhận giá trị bằng A.2g B.85g kết tủa. 1. 5.6g. 1. Fe3O4. C. B.1M. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH) 2 0.92 Hoà tan hết 1. FeO.62g chất rắn.00g. C. Câu 7. sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO. thu được 9.83 Đốt cháy hết mg hỗn hợp A gồm (Zn. Công thức của sắt oxit là A. D. 1. Tính khối lượng m của X.05 và 0. 19. thu được 3.64g D. 2. Câu 7.0g C.72g hỗn hợp kim loại gồm Mg. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3. Giá trị của m là A. HCl. 3.Câu 7. Câu 7.08g.12 lít. Fe2O3. 2. Beri Câu 7.91 Hoà tan hết 5. 0. D. B. B.85 Cho 4. 11. 4. Zn.84 Để mg phoi bào sắt (X) ngoài không khí. 5.448 lít.16g. 16. Câu 7.1M.025 mol.3g. Fe3O4. 8. Mặt khác. Câu 7. Canxi B. dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0.344 lít.25g muối khan. thu được V lít khí (đktc) và 3.48 lít. B.89 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt.7g muối khan.6)g oxit. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7. thu được 5g kết tủa. B.36 lít khí SO2 duy nhất (đktc). 0. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16. C. 8. D. A.016 lít khí (đktc). B.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy). 19.05 mol. D. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15. 1. 10. Zn và Fe bằng dung dịch HCl. m có giá trị là A. 0. Thể tích khí NO duy nhất thu được ở đktc là .00g. Magie C. 0.05 và 0. B. 2. D.2g. 32. 7. 0. HBr) thì thể tích H2 (đktc) thu được là A. Câu 7.74g.5M và KNO3 0. Al) bằng oxi thu được (m +1.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy). 103 .26g Câu 7. D. Câu 7.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại.075 mol. C. 4. A. Bari D.86 Cho 19.3g hỗn hợp kim loại gồm Mg.224 lít.1M.

x = 0. A. Khử hoàn toàn 4. 5 g. Câu 7. D. x và y có giá trị là A. người ta thu được 6. Câu 7. C.81g hỗn hợp các oxit Fe3O4. CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0.2 mol và 2 anion Cl. Câu 7. x = 0. x = 0. MgO. Hoà tan X bằng dung lịch HNO3 loãng. 24g. Một dung dịch có chứa 2 cation là Fe2+ 0. Cô cạn x thu được m g muối.1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ? A. D. Giá trị của m là A. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0.98.75g hỗn hợp gồm 3 kim loại Fe.344 lít H2.88g khí CO2.336 lít. C. D. 0. sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt.19 C 7. D.016g hỗn hợp các oxit sắt (hỗn hợp X).94.728g bột Fe ta thu được 1.24 A 104 .02 và y = 0. m có giá trị là A.8 D 7.13 7.29 A 7.84g Fe và 0. 5.27 A 7. Câu 7.2g. 8g.15 B 7. Giá trị m là A. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG VII 7. Câu 7. 26g. B. B.12 khí (đktc) và dung dịch X. C. Tính a ? A.3g. B. m có giá trị là A. 20g.525g. C. x = 0.6 lít SO2 (đktc). FeO. Tìm công thức của oxit.99 Cho CO qua ống sứ chứa 15.72g. D.9g chất rắn khan.4g.032g hỗn hợp các oxit (hỗn hợp X).96. sau một thời gian thu được 13.30 C 7. 4. b/7 7. B.2g hỗn hợp CuO.22 C 7.2 B 7.16g. Fe2O3. D. Al.21 D 7. B.375g.48g.93.9 A 7. B. Không xác định được. 8. Kết quả khác.792g hỗn hợp bột gồm Fe và Cu ta thu được 1.4 7. Nung nóng 16.896 lít.12 D 7. FeO nung nóng. 7.17 a/2. thu được mg kết tủa Z.0224 lít. 3.672 lít. Oxit khác.4256 lít.101 Oxi hoá hoàn toàn 0.5 B 7. B.336 lít. C. C. SO42. Sục Y vào dung dịch nước vôi trong có dư.6 C 7.2g. 1. 0.6g rắn X và hỗn hợp khí Y. B.x mol. 0. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5. 6.896 lít. B.02. Kim loại thu được đem hoà tan hết bằng dung dịch H 2SO4 loãng thấy tạo ra 1.7 C 7. 5.18 D 7. Cho 2.448 lít khí NO duy nhất. dư. 22g. Al3+ 0.95. Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là A.72g hỗn hợp gồm 4 chất rắn khác nhau.21g . Câu 7. 3.1 mol. D. 0.03 và y = 0.016 lít H2 (đktc). 0. 5.20 C 7. b/6 c/1.102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian.Câu 7. C. C.y mol. Thể tích khí NO duy nhất bay ra (ở đktc) là A. 5.8g. thu được 46.3 . Câu 7. 0. 0. Câu 7. Fe3O4.2.2 và y = 0.5 g.23 C 7.14 C a/1.4 B 7. C.100 Oxi hoá hoàn toàn 0.8g bột sắt ngoài không khí.5g.3 B 7. D. D.25 C 7. 0. C. 7. Fe2O3.3 và y = 0.28 D 7. 10 g. D.0336 lít.1 B 7. Câu 7.26 A 7.11 B 7. Khi cô cạn dung dịch. Chưa thể xác định. B.97 Cho 1.8g một oxit của kim loại M thành kim loại cần 2.10 D 7.16 B 7.45g. 1. và sắt dư. 1. Zn tan hết trong dung dịch HCl thì thu được 1.03.

102 C 7.42 B 7.93 C 7.57 A 7.53 B 7.79 D 7.34 A 7.68.64 D 7.33 C 7.86 C 7.87 C 7.03(mol) − 3Cu + 2NO3 + 8H 0.49 D 7.44 B 7.47 B 7.61 B 7.41 D 7.50 B 7.35 B 7.7.43 D 7.65 B 7.100 D 7.72.31 B 7.91 C 7.08(mol) → 3Cu 2+ + 2NO + H2 O.89 C 7.46 C 7.b C 7.71 B 7.83 B 7.54 B 7.81 C 7.52 B 7.74 D 7.68.40 A 7.95 C 7.b B 7.98 B 7.67 B 7.70.90 A 7.016(mol) 105 .a B 7.72.94 C 0.75 A 7.c B 7.78 B 7.60 A 7.39 A 7.59 D 7.55 C 7.68.69.82 A 7.c B 7.69.85 A 7.62 D 7.51 B 7.88 B 7.70.76 A 7.66 A 7.92 B 7.97 C 7.56 A 7.80 A 7.36 C 7.016(mol) 0.73 A 7.b C 7.45 D 7.a A 7.99 A + 7.77 C 7.63 A 7.70.101 D 7.38 B 7.58 A 7. 0.37 A 7.84 D 7.32 B 7.96 C 7.a B 7.b C 7.a A 7.48 B 7.

MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Nhận biết một số anion Tt Anion Thuốc thử Dấu hiệu 1 OH– Quỳ tím Hoá xanh SO32– HSO3– + 2 H CO32– HCO3– SiO32– 3 SO42– Ba2+ 4 S2– Cl– Ag+ Br– I– 5 PO43– 6 NO3 – Phương trình phản ứng SO32– + 2HCl → SO2 + H2O CO32– + 2HCl → 2Cl– + CO2 SO2 làm mất màu dung dịch KMnO4 CO2 làm vẩn đục dung dịch Ca(OH)2 trong SiO32– + 2HCl → H2SiO3 + 2Cl– Ba2+ + SO42– → BaSO4↓ 2Ag+ + S2– → Ag2S↓ ↑ SO2 ↑ CO2 Ag+ 7 ClO3– 8 NO2– H2SO4 loãng. PHÂN BIỆT MỘT SỐ CHẤT VÔ CƠ & CHUẨN ĐỘ DUNG DỊCH A.CHƯƠNG VIII. vụn Cu Cô cạn. không ↑ NO2 nâu NO  NO2↑ (nâu) → khí Dùng phân biệt NO2– và NO3– (vì NO3– không có phản ứng này). ↓ keo trắng ↓ trắng ↓ đen ↓trắng vàng nhạt Ag+ + X– → AgX↓ vàng ↓ vàng (tan 3Ag+ + PO43– → Ag3PO4↓ trong HNO3) (↑) nâu NO2 3Cu+8H++2NO3–→2Cu2++2NO+4H2O dung dịch Cu2+ (2NO + O2 → 2NO2) xanh 106 .t. 3NaNO2 + H2SO4 (l) → Na2SO4+NaNO3+2NO↑+H2O H2SO4 (l) + O2 KK to. to O2↑ (que đóm t0 có MnO2 2KClO3  2KCl + 3O2↑ → bùng cháy) x.

Ca2+ + SO42 → CaSO4↓ (it tan) − Ba2+ + SO42 → BaSO4↓ − Mg2+ + 2OH → Mg(OH)2↓ − 11 Fe3+ 12 NH4+ OH .2. còn Fe2+ làm KK 2 + OH − mất màu Fe     Fe OH2 → ( ) ↓    Fe OH3 đỏ↓nâu →( ) dd thuốc ↓ trắng xanh − 2+ + 2+ 3+ MnO4 + 5Fe + 8H → Mn + 5Fe + tím khi có + + 4H2O mặt H ). Nhận biết một số cation Stt ion 1 2 3 4 Li Na+ K+ Ca2+ + Thuốc thử Dấu hiệu Đốt trên ngọn lửa vô sắc − Phương trình phản ứng (phương pháp vật lí) 5 Ba2+ 6 Ca2+ 7 Ba2+ 8 Mg2+ SO42 9 Cu2+ 10 Fe2+ − 2+ OH 2 Cu + 2OH → Cu(OH) ↓ (riêng với Fe3+ đặc +2 NH + 2H O Cu 2+  Cu(OH)2 ↓ → trưng nhất −2NH là dùng ion 2+ +4NH  [ Cu(NH 3 )4 ] → −2OH thioxianat SCN-. làm xanh quỳ ẩm) Fe + 3SCN → Fe(SCN) ↓ đỏ máu − Fe3+ + 3OH → Fe(OH)3↓ đỏ nâu NH4+ + OH → NH3↑ + H2O +3OH Al3+  Al(OH)3 ↓ → + OH  [ Al(OH) 4 ] → - 3+ 3 − - 13 Al3+ − 14 Zn 2+ 15 Be2+ 16 Pb2+ 17 Cr 3+ OH từ từ đến dư − +2OH ↓ trắng tan Zn 2+  Zn(OH) 2 ↓ → ngay khi 2− + OH  [ Zn(OH) 4 ] → OH– dư + OH − Be2+  Be( OH )2 ↓  BeO 2 − → → 2 Pb2+ →Pb(OH)2↓ →PbO22 ↓ xanh. tan ngay khi (OH–) dư dd H2S PbS ↓ đen − OH − 3  Cr 3+  Cr (OH )3 ↓   Cr ( OH )6 − → →     18 Pb 2+ (dd màu xanh) Pb + S → PbS↓ (màu đen) 2+ 2− 107 . to − ↓ đỏ máu ↓ đỏ nâu NH3 ↑ khai. − 3 4 + 2 3 - − Đỏ thẫm Vàng tươi Tím hồng Đỏ da cam Lục (hơi vàng) ↓ trắng ↓ trắng ↓ trắng ↓ xanh (nếu dùng dd NH3 thì tạo kết tủa xanh sau đó tan tạo ion phức màu xanh thẫm đặc trưng.

NaHCO3. 108 . to Hoá đen CuO Trắng hoá xanh 13 H2 14 SO3 15 N2 CuSO4 khan CuO (đen) Hoá đỏ (Cu) to Dung dịch Kết tủa BaCl2 trắng BaSO4 (còn lại sau cùng) CuSO4 + 5H2O → CuSO4. CO2. BaSO4. Na2CO3. Nhận biết một số chất khí Stt Khí 1 Cl2 2 I2 3 SO2 4 H2S 5 HCl 6 NH3 7 NO 8 NO2 9 CO 10 CO2 11 O2 12 Hơi H2O Thuốc thử Dung dịch (KI + hồ tinh bột) Hồ tinh bột Dấu hiệu Phương trình phản ứng Không màu Cl2 + 2KI → 2KCl+ I2 + I2 → hoá xanh (Hồ tinh bột) → xanh Không màu → hoá xanh SO2 + Br2 + 2H2O → 2HBr + H2SO4 5SO2+2KMnO4+ 2H2O → 2H2SO4+2MnSO4+K2SO4 Pb2+ + H2S → PbS↓ + 2H+ Ag+ + Cl– → AgCl↓ NH3 + H2O→ NH4OH NH3 + HCl → NH4Cl 2NO + O2 → 2NO2 3NO2 + H2O → 2HNO3 + NO dd Br2 hay Mất màu dd KMnO4 dung dịch dd Pb(NO3)2 dd AgNO3 Quỳ tím ẩm HCl (đậm đặc) Không khí Quỳ tím ẩm dd PdCl2 (hay + CuO đen) Cho ↓ đen Cho ↓ trắng Hoá xanh Tạo khói trắng Hoá nâu Hoá đỏ Tạo ↓ Pd CO + PdCl2 + H2O → (hoá đỏ Cu) Pd↓ + 2HCl + CO2↑ CO2 + Ca(OH)2 → CaCO3↓ + H2O t 2Cu + O2  2CuO → 0 ddCa(OH)2 Vẩn đục Cu (đỏ).3.BÀI TẬP TRẮC NGHIỆM Câu 8. điện phân) để phân biệt chúng thì chất khí phải chọn là A.1 Có 4 mẫu chất rắn màu trắng BaCO3. nếu chỉ dùng H2O và một chất khí (không dùng nhiệt độ. B.5H2O t CuO + H2  Cu↓ + H2O → 0 SO3 + H2O → H2SO4 H2SO4 + BaCl2 → BaSO4 + 2HCl B . O3.

8 Để làm khô khí amoniac người ta dùng hoá chất là A. HNO3 . đồng sunfat khan. dd HNO3 đặc. dd KMnO4 và dd Br2 C. NaCl. thuốc thử được chọn là A. Câu 8. Al. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. axit clo hiđric. C. D. D. Câu 8. C. bari clorua. D. Mg và Al 2O3. C. H2SO4 loãng. FeCl2. Câu 8. NaCl. CO2 và H2O. chỉ cần dùng một thuốc thử duy nhất là A. NaOH. KCl. NaNO3. H2SO4. B. KNO3. MgO.5 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. 109 . dd ammoniac. Quỳ tím. axit sunfuric đặc. H2O D. C. Dung dịch AgNO3 và dd phenolphthalein. Dung dịch Ba(OH)2 và dd AgNO3. nguội. B. dd H2SO4 đặc nguội. D. quỳ tím. kali hiđroxit. C. Dùng 2 hoá chất nào trong các cặp hoá chất sau đây để có thể phân biệt được các dd trên? A. Câu 8. Câu 8. B. D. dd HCl. Nếu chỉ được dùng một thuốc thử để nhận biết 5 chất lỏng trên. chỉ cần dùng duy nhất một dd là A. H2SO4 đặc nguội. AgNO3.6 Có 5 dd đựng trong 5 lọ mất nhãn là FeCl3. dd BaCl2. dd KOH Câu 8. D. mỗi ống nghiệm chứa một trong các dd HCl. vôi sống. ta có thể dùng A. SO2.3 Để loại bỏ Al ra khỏi hỗn hợp Al.7 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là NaAlO2. AlCl3.11 Có 4 ống nghiệm bị mất nhãn. H2.10 Để thu được Al(OH)3 từ hỗn hợp bột Al(OH)3. HCl. C. B. dd KOH. Cả A. C. NaOH. dd HNO3. dd PdCl2 và dd Br2. CuO. D. B. NH4NO3. D. không thể thực hiện được. để nhận biết 4 chất lỏng trên. C. Zn(OH)2. HCl. Câu 8. NaOH.4 Để phân biệt 3 khí CO. P2O5. H2SO4 đặc nóng B. kali sunfit và nhôm sunfat (đều có nồng độ khoảng 0. Fe3O4 và FeO người ta dùng A. BaCl2. B. Giấy quỳ tím và dd Ba(OH)2. Cu(OH)2. B. C. B. Câu 8. Câu 8.2 Có 4 lọ hoá chất bị mất nhãn đựng riêng biệt 4 dung dịch không màu sau đây: NH4Cl. B. ta có thể dùng dd A. NH3. BaCl2. SO2 ta có thể dùng thuốc thử là A. C đều đúng.C. dd HCl. dd BaCl2 và dd Br2.9 Để nhận biết 3 dd natri sunfat.1M). Câu 8. CO2. Na2CO3. Na2S. B. D. Có thể sử dụng thuốc thử nào sau đây đề phân biệt các lọ dung dịch trên? A.

15 Cho các dd: AgNO3. chỉ 2 trong 4 dung dịch. B. Al. D. B. Mg. dd HCl.14 Có 3 lọ đựng 3 chất bột riêng biệt: Al.12 Để chứng tỏ sự có mặt của ion NO3. dd FeCl2. B. Ag. giấy quỳ B. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. Al.18 Có 4 chất rắn riêng biệt gồm natri cacbonat. cả 3 dung dịch. dd H2SO4. natri sunfat và thạch cao sống (CaSO4. dd NaOH. Mg. H2O. Ca(OH)2. C. D. Fe3+. Fe. D. Câu 8. NO3. Ba. X là A. Mg. Giấy quỳ tím và dd AgNO3. B. đá vôi. vì Fe2+ và Fe3+ khi tác dụng với kiềm tạo kết tủa có màu sắc khác nhau. Fe. dd NaOH. Câu 8. C đều đúng Câu 8. tuỳ thuộc vào trật tự tiến hành các thí nghiệm. người ta ngâm mẫu bạc này vào một lượng dư dd A. HNO3 đặc nguội. Cu để chứng minh sự có mặt của các ion trong X. C. Ag. Câu 8. Ag. C. NO3-. Fe. HCl. CaO. D.D. Fe. Cu và vài giọt dd H2SO4đặc. B. cả 4 dung dịch. FeCl3 Câu 8. Cu có trong mẫu Ag và không làm thay đổi lượng Ag. CuSO4 khan.19 Dung dịch X có chứa các ion: NH4+. Ba. HCl. Fe2+. Một học sinh dùng các hoá chất dd NaOH. Fe3+.2H2O). Ba. Chỉ dùng thêm một hoá chất bên ngoài là dd H2SO4 loãng có thể nhận biết được tối đa bao nhiêu kim loại trong các dãy sau? A. H2SO4 loãng. đun nóng. C. Ag. Cl2 D. Câu 8. Để phân biệt 2 kim loại Al và Ag cần phải dùng A. B.13 Để loại bỏ tạp chất Fe. Ba. AgNO3. B. chỉ một trong 4 dung dịch. Ag. Có thể nhận biết 3 lọ trên bằng 1 thuốc thử duy nhất là A. C. CO2 B. Br2 (Hơi) C. ta có thể dùng A.ta nên dùng thuốc thử là A. D.17 Để làm khô khí H2S. Kết luận đúng là A. Câu 8. D. dd AgNO3. Dung dịch kiềm. Chỉ dùng H2O và một khí X có thể phân biệt được cả 4 chất. C. Câu 8. Al2O3. P2O5. 110 .trong dd chứa các ion: NH4+.16 Có 5 mẫu kim loại Ba. dd BaCl2. Cả A. C. Fe. Học sinh đó có thể chứng minh được sự tồn tại của cả 4 ion. H2SO4 đặc nguội.

Cl2. Ca(NO3)2. (1). O2. chỉ dùng AgNO3. C. D. (3). dd CuCl2 dư. (3). mỗi ống đựng 1 dd Na2CO3. (4) mẩu Cu(OH)2. Quỳ tím. B. Câu 8. Câu 8. MgCl2. (2). (1). (4). B. AlCl3. (5). C. MgCl2.28 Chỉ dùng Na2CO3 có thể phân biệt được mỗi dd trong dãy dd nào sau đây? A. (4) nước vôi trong.27 Có 3 lọ mất nhãn chứa 3 dd riêng biệt HCl. NaOH. Câu 8. D. (5). (3). HNO 3. (2) dd NaOH. dd muối sắt(III) dư. ta có thể dẫn khí qua: (1) dd bạc nitrat. MgCl2. dùng giấy quỳ tím trước. Có thể dùng thuốc thử nào sau đây để nhận biết chúng? A. (2). 111 . Fe(NO3)3. B. C. CaCl2. D. Fe(NO3)3. B. D. (1). Câu 8. C. D. FeCl2 thì chọn thuốc thử là A. dd phenolphthalein. NaAlO2. D. Ba(OH)2. Al. Hoá chất cần dùng và thứ tự thực hiện để nhận biết các chất đó là A. chỉ (1). dd NaOH. CO2 là: (1) dùng mẩu giấy quỳ tím ướt. NaCl. Câu 8. (3). (3). (4). D. AgNO3 sau. C. dd AlCl3. BaCl2. (2) mẩu bông tẩm nước. BaCl2. (NH4)2SO4. C. B. Na2CO3. MgSO4. NaCl. Câu 8. (1). (1). C. dùng AgNO3 trước.20 Có 4 ống nghiệm mất nhãn. HCl. Học sinh đó không chứng minh được sự tồn tại của Fe 2+ và Fe3+ vì chúng đều tạo kết tủa với kiềm. D. chỉ cần dùng một hoá chất là A. NaCl. AgNO3. (1).25 Chỉ dùng một dd làm thuốc thử để nhận biết các dd muối sau: Al(NO3)3. Phương pháp đúng là A. (2). (3).22 Thuốc thử duy nhất dùng để nhận biết NH4NO3. Câu 8. B.26 Tách Ag ra khỏi hỗn hợp bột gồm Ag. Al(NO3)3. C. (3). Câu 8. cả A. (1). B. NH4NO3. (2).D. Fe(NO3)3 và Cu(NO3)2 là A. dd NH3. Ba(NO3)2. KNO3. (5) mẩu AgCl. dd NH4Cl. Cu. D. B. NaNO3.21 Để nhận biết trong thành phần của khí nitơ có lẫn tạp chất hiđroclorua. (4). B. Các cách đúng là A. (3) nước cất có vài giọt quỳ tím. C đều đúng. Fe(NO3)2.24 Để thu được Al2O3 từ hỗn hợp bột Al2O3 và CuO mà khối lượng Al2O3 không thay đổi. B. Cả A. Câu 8. H2SO4 (loãng). Fe với khối lượng Ag không đổi.23 Một học sinh đề nghị các cách để nhận ra lọ chứa khí NH3 lẫn trong các lọ riêng biệt chứa các khí N2. dd muối Sắt(II) dư. C đều được. dd AgNO3 dư. NaOH. có thể dùng chất nào sau đây? A. MgCl2. Mg(NO3)2. NaNO3. dd HCl. (3) mẩu bông tẩm dd HCl đặc. C. giấy quỳ tím sau.

32 Có ba dd kali clorua.37 Chỉ dùng duy nhất một dd nào sau đây để tách lấy riêng Al ra khỏi hỗn hợp Al.B. kẽm sunfat. Ba. khí còn lại là N2. Na.29 Để thu được Ag tinh khiết từ hỗn hợp bột Ag-Fe. K. Câu 8. X là muối CuSO4.30 Có 4 dd đựng trong 4 lọ hoá chất mất nhãn là (NH4)2SO4. dd HCl. NaOH. B. dd NaOH loãng và dd HCl. Ca với axit H2SO4 đặc. Na. D. D. NH4Cl. C. Câu 8. D. K2SO4. dd HClđặc. Câu 8. quỳ tím ẩm. dd Ca(OH)2 vừa đủ. dd Ba(OH)2. C. C. dd Ca(OH)2 . H2O. NH4NO3. dd Ba(OH)2. B.33 Để loại được H2SO4 có lẫn trong dd HNO3.35 Chỉ dùng một thuốc thử duy nhất nào sau đây để phân biệt hai khí SO2 và CO2? A. Cl2. khí (3) làm giấy có tẩm dd muối X hoá đen. (NH4)2SO4. NH4Cl. D.31 Chỉ có giấy màu ẩm. H2S và Cl2 do có hiện tượng: khí (1) làm tàn lửa cháy bùng lên. Câu 8. khí (2) là Cl2. SiO2 dùng cho sản xuất Al người ta dùng chất nào trong số các chất sau đây là tốt nhất? A. Câu 8. dd NaOH. C. để nhận biết 4 chất lỏng trên. dd NaOH đặc nóng và CO2. C. B. NH4NO3. FeCl3. X là muối Pb(NO3)2.Câu 8. C. (NH4)2SO4. D. và giấy tẩm dd muối X người ta có thể phân biệt 4 lọ chứa khí riêng biệt O2. B đều đúng. Câu 8. dd H2SO4 đặc nguội. Ba.38 Để làm sạch quặng boxit thường có lẫn Fe2O3. D. AgNO3. giấy quỳ tím. dd AgNO3 vừa đủ. dd H2SO4. Mg. Na. D. Ca mà khối lượng Al không thay đổi (giả sử phản ứng của Mg. kali sunfit. CO2.36 Chỉ dùng H2O có thể phân biệt được các chất trong dãy A. chỉ cần dùng dd A. dd Ba(NO3)2 vừa đủ. dd NaOH. khí (1) là O2. NH4Cl. khí (2) làm mất màu của giấy. KOH. D. C. dd NaOH loãng và CO2. D. CuSO4. C.34 Có 5 lọ đựng riêng biệt các khí sau: N2. O2. ta dùng A. B. Na. C. Câu 8. dd Br2. Thuốc thử có thể dùng để nhận biết ba dd trên đơn giản nhất là A. B. khí (3) là Cl2. C. NH3. D. HNO3 đặc nguội. 112 . dd NaOH đặc nóng và HCl. B. người ta dùng dư hoá chất nào sau đây? A. B. Ba(OH)2. NH4NO3. K. NH4Cl. Câu 8. nguội không thay đổi đáng kể nồng độ và không sinh nhiệt)? A. Kết luận sai là A. dd BaCl2. Để xác định lọ đựng khí NH3 chỉ cần dùng thuốc thử duy nhất là A. lửa. khí (1) là O2. dd HCl. dd H2SO4 loãng. N2. BaCl2. B. B. AgNO3. Câu 8. cả A. X là muối CuSO4.

B. chỉ cần dùng giấy quỳ tím. dd H2SO4 và dd BaCl2. Thuốc thử để phân biệt các dd đó là A. axit sunfuric. BaCO3. H2SO4. BaCl2. dd HCl. B. C. Câu 8.44 Có các dd Al(NO3)3.5 D 8.11 D 8. H2O.15 A 8. Nếu chỉ dùng thêm một thuốc thử để phân biệt 4 chất trên. B. ĐÁP ÁN 8. Mg và Al 2O3. AgNO3. B. Câu 8. nguội. D.19 C 8. dd KOH. C.18 D 8. Câu 8.26 C 8. Al. NaOH và O2. K2CO3. NaNO3. dd HCl.23 C 8.42 Có 4 chất rắn trong 4 lọ riêng biệt gồm NaOH. dd NaOH. LiNO3 (đều có nồng độ khoảng 0. BaCl2.21 C 8. Để xác định thành phần cấu tạo và hoá trị các nguyên tố trong X.12 D 8. Câu 8.3 C 8.1 B 8.30 A 8. H2SO4. C. 2. D.45 Nếu chỉ dùng một thuốc thử duy nhất để phân biệt 3 dd NaOH. Mg(NO3)2. C. cả A. D. D. B. bari hiđroxit. dd BaCl2. Số dd không hoà tan được đồng kim loại là A.29 B 8.9 B 8.43 “Để phân biệt các dd riêng biệt gồm NaCl. Zn. chì clorua.17 8.28 D 8. 1. C. thuốc thử được chọn là A. Hãy chọn đáp án để nối thêm vào phần còn trống sao cho kết luận trên luôn đúng. B. A. chỉ cần dùng một chất duy nhất là A.22 D 8. dd HNO3 đặc. Y có thể dùng hoá chất nào sau đây? A. C đều đúng.41 Để nhận biết 4 dd: Na2SO4. D. C.Câu 8. KOH ta có thể …”.10 A 8.27 D A 113 . dd H2SO4 và dd AgNO3.16 B 8. FeCl2. dd CH3COOAg. natri hiđroxit.4 A 8. B. chỉ cần Fe kim loại. không cần dùng bất kể hoá chất nào.1M) bị mất nhãn.39 Cho các dd: FeCl3. CuSO4.2 B 8. HCl.40 Đốt cháy Fe trong clo dư thu được chất X.20 D 8. quỳ tím Câu 8. H2SO4 thì chọn A. 4. D. 3.7 A 8. nung sắt với lưu huỳnh thu được chất Y.6 C 8. quỳ tím. Câu 8. và hỗn hợp NaNO3 và KHSO4. D.25 B 8.8 A 8. Na2CO3. dd HNO3 và dd Ba(OH)2. B. NH3. C.24 C C 8.14 8.13 D 8.

37 A 8.38 D 8.43 A 8. * Hoá học đã góp phần giải quyết vấn đề năng lượng và nhiên liệu như thế nào trong hiện tại và tương lai? Hoá học đã nghiên cứu góp phần sản xuất và sử dụng nguồn nhiên liệu. 2. nhu cầu của nhân loại về các vật liệu mới với những tính năng vật lí và hoá học.Vật liệu mới: 114 .Điều chế etanol từ crackinh dầu mỏ để thay thế xăng. sinh học mới ngày càng cao.36 A 8. khí tự nhiên… không phải là vô tận mà có giới hạn và ngày càng cạn kiệt.42 D 8.Năng lượng được sản sinh ra trong các lò phản ứng hạt nhân được sử dụng cho mục đích hoà bình. than đá. năng lượng thuỷ triều… . XÃ HỘI.MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. năng lượng mặt trời.Vật liệu có nguồn gốc vô cơ. . * Hoá học đã góp phần giải quyết vấn đề về vật liệu như thế nào? .33 A 8.Sản xuất ra chất thay cho xăng từ nguồn nguyên liệu vô tận là không khí và nước.35 C 8. năng lượng gió. HOÁ HỌC VÀ VẤN ĐỀ PHÁT TRIỂN KINH TẾ.31 B 8.Sản xuất khí than khô và khí than ướt từ than đá và nước. năng lượng địa nhiệt. .39 C 8. Vấn đề năng lượng và nhiên liệu * Vấn đề về năng lượng và về nhiên liệu đang đặt ra cho nhân loại hiện nay là : . MÔI TRƯỜNG A. . Như : .Khai thác và sử dụng năng lượng hoá thạch còn là một trong những nguyên nhân chủ yếu gây nên ô nhiễm môi trường và làm thay đổi khí hậu toàn cầu.8. Vấn đề vật liệu * Vấn đề về vật liệu đang đặt ra cho nhân loại là gì ? Cùng với sự phát triển của các ngành kinh tế và khoa học kĩ thuật. nhiên liệu hoá thạch như dầu mỏ.Các nguồn năng lượng.40 B CHƯƠNG IX.41 B 8. .34 A 8. dầu.Điều chế khí metan trong lò biogaz.Năng lượng điện hoá trong pin điện hoá hoặc acquy.32 C 8.Năng lượng thuỷ điện.45 D 8.44 B 8. năng lượng nhân tạo thay thế.Vật liệu có nguồn gốc hữu cơ. . . . .

. sợi hoá học có nhiều ưu điểm nổi bật.Góp phần nghiên cứu thành phần hoá học của một số dược liệu tự nhiên.Vật liệu quang điện tử. thực phẩm đang đặt ra thách thức lớn cho nhân loại hiện nay . vì vậy tơ sợi tự nhiên không thể đáp ứng đủ nhu cầu về số lượng cũng như chất lượng. .Phòng chống những căn bệnh. . nạn dịch của thế kỉ. .Góp phần sản xuất ra tơ. 4.Dân số thế giới ngày càng tăng. . chất ma tuý và cách phòng chống ma tuý (dưới dạng những viên thuốc tân dược.Nghiên cứu ra các loại vacxin. Hoá học và vấn đề may mặc * Vấn đề may mặc đang đặt ra cho nhân loại hiện nay là : . * Hoá học đã góp phần giải quyết vấn đề về lương thực. . . 3.Sản xuất các loại phân bón hoá học.Vật liệu compozit.Diện tích trồng trọt ngày càng bị thu hẹp. hợp thời trang..Vật liệu nano (còn gọi là vật liệu nanomet) . Hoá học và vấn đề thực phẩm * Vấn đề lương thực.Thuốc tránh thai. viên để uống. bột trắng dùng để hít.Nghiên cứu chế biến thức ăn tổng hợp. .Các vật liệu cơ bản để chế tạo các thiết bị chuyên dụng trong các nhà máy dệt và trong ngành dệt may. dung dịch để tiêm chích). 115 . động vật: .… . . . .Tổng hợp hoá chất diệt nấm bệnh.Dân số thế giới gia tăng không ngừng.Sản xuất nhiều loại phẩm nhuộm. * Chất gây nghiện. 4.Tổng hợp hoá chất có tác dụng diệt trừ cỏ dại. Hoá học và vấn đề sức khỏe con người * Dược phẩm . mà còn mặc đẹp. thực phẩm cho nhân loại như : nghiên cứu và sản xuất các chất hoá học có tác dụng bảo vệ. * Hoá học góp phần giải quyết vấn đề may mặc của nhân loại như : . .Vấn đề vi phạm vệ sinh an toàn thực phẩm.Nhu cầu của con người không chỉ mặc ấm. .Sản xuất những hoá chất bảo quản lương thực và thực phẩm. phát triển thực vật.Thuốc bổ dưỡng cơ thể.

chất có hại cho cây trồng vượt quá nồng độ được quy định.Luôn nói không với ma tuý. máy đo pH. NH3. làm diệt vong một số loại sinh vật. dầu. sử dụng chúng như là một loại thuốc chữa bệnh.… * Ô nhiễm môi trường đất Đất bị ô nhiễm có chứa độc tố. B. 116 . các chất hữu cơ tổng hợp. các vi sinh vật gây bệnh. sắc kí. Khí butan (gaz) D. thí dụ CO.. Tiêm chích ma tuý có thể gây trụy tim mạch dễ dẫn đến tử vong. chất độc hoá học. Hoá học và vấn đề ô nhiễm môi trường Tác hại của ô nhiễm môi trường (không khí. hô hấp.… Thí dụ : hiện tượng thủng tầng ôzôn. nước) gây suy giảm sức khỏe của con người.1. Thu khí metan từ khí bùn ao. Người ta đã sản xuất khí metan thay thế một phần cho nguồn nguyên liệu hoá thạch bằng cách nào sau đây ? A.Hoá học đã nghiên cứu ma tuý. gây thay đổi khí hậu toàn cầu. sinh lí. B. 4. * Nhận biết môi trường bị ô nhiễm a) Quan sát qua mùi. B.… * Ô nhiễm nước Nước ô nhiễm thường có chứa các chất thải hữu cơ. C. … * Ô nhiễm không khí Không khí bị ô nhiễm thường có chứa quá mức cho phép nồng độ các khí CO2. không khí dựa trên cơ sở khoa học hoá học có kết hợp với khoa học vật lí và sinh học. bụi. Nhiên liệu nào sau đây thuộc loại nhiên liệu sạch đang được nghiên cứu sử dụng thay thế một số nhiên liệu khác gây ô nhiễm môi trường ? A. các hoá chất vô cơ. * Vai trò của hoá học trong việc xử lí chất ô nhiễm Xử lí ô nhiễm đất. các chất phóng xạ. HCl. SO2. Lên men các chất thải hữu cơ như phân gia súc trong lò biogaz. như rối loạn tiêu hoá. rối loạn chức năng thần kinh. nước. các chất dinh dưỡng thực vật. hiệu ứng nhà kính. mưa axit. .BÀI TẬP TRẮC NGHIỆM Câu 9. CH4 và một số khí độc khác. rối loạn tuần hoàn.2.… một số vi khuẩn gây bệnh.… b) Xác định chất ô nhiễm bằng các thuốc thử. .Nghiện ma tuý sẽ dẫn đến rối loạn tâm. Khí hiđro. Câu 9. c) Bằng dụng cụ đo : nhiệt kế. Than đá. Xăng. đất. màu sắc.

khu vệ sinh chứa các khuẩn gây bệnh. 117 . Cách bảo quản thực phẩm (thịt. D. Năng lượng gió. Nước thải từ các bệnh viện. Loại thuốc nào sau đây thuộc loại gây nghiện cho con người ? A. SO2. B. Câu 9. Pb2+. 6% hỗn hợp CO2. Cho hơi nước đi qua than nóng đỏ trong lò. D. 20% O2. B. NH3. Nước từ các nhà máy nước hoặc nước giếng khoan không chứa các độc tố như asen.3. trong một số chất thải dạng dung dịch. C. Zn2+. 16% O2. D. Lên men ngũ cốc. fomon. Giấm ăn. Trường hợp nào sau đây được coi là nước không bị ô nhiễm ? A. B. Dùng nước đá hay ướp muối rồi sấy khô. H2. Nước vôi dư. Fe3+.9. Một trong những hướng con người đã nghiên cứu để tạo ra nguồn năng lượng nhân tạo to lớn để sử dụng cho mục đích hoà bình. moocphin. Trường hợp nào sau đây được coi là không khí sạch ? A. Ni2+. CH4 và bụi. Năng lượng mặt trời. Câu 9. chứa các ion : Cu2+. Không khí chứa 78% N2. D. 1% hỗn hợp CO2. sắt…quá mức cho phép. 2% hỗn hợp CO2. Amoxilin. C. CH4. C. B. Etanol. H2O. nước đá. Dùng phân đạm. Không khí chứa 78% N2. 18% O2.6.5. Câu 9. Khí nào sau đây gây ra hiện tượng mưa axit ? A. Sau bài thực hành hoá học. glucozơ. B. Nước thải nhà máy có chứa nồng độ lớn các ion kim loại nặng như Pb2+. 21% O2. Năng lượng hạt nhân.8. Penixilin. nước đá. C. Không khí chứa 78% N2. C. Panadol. Nước ruộng lúa chứa khoảng 1% thuốc trừ sâu và phân bón hoá học. C. B. Hg2+…Dùng chất nào sau đây để xử lí sơ bộ các chất thải trên ? A. H2O. Câu 9. đó là : A. D. D. Câu 9. HNO3.4. cá…) bằng cách nào sau đây được coi là an toàn ? A. C. Dùng fomon. Seđuxen. Hg2+. 4% hỗn hợp CO2. Câu 9.C. dùng nước đá khô. Câu 9. H2. Cd2+. Năng lượng thuỷ điện. B. D. H2O. Không khí chứa 78% N2. Vitamin C. HCl.7. H2. D. Thuốc cảm Pamin.

0. b.10.Câu 9. D. 0. C. Có thể điều chế Ancol etylic bằng 2 cách sau : . (Nên biết thêm : hàm lượng cho phép là 0. B. C. C.15. D.422 tấn. Trong công nghệ xử lí khí thải do quá trình hô hấp của các nhà du hành vũ trụ hay thuỷ thủ trong tàu ngầm người ta thường dùng hoá chất nào sau đây ? A. Chất khí CO (cacbon monoxit) có trong thành phần loại khí nào sau đây ? A. Câu 9. 4. Khí dầu mỏ. Câu 9.56 tấn. .2 A 9.0250 mg/l.6 A 9. B. người ta tiến hành như sau : Lấy 2 lít không khí rồi dẫn qua dung dịch Pb(NO 3)2 dư thì thu được 0. D. B. Biết hiệu suất của quá trình là 80%.1 D 118 9.0125 tấn. Nhiều loại sản phẩm hoá học được điều chế từ muối ăn trong nước biển như : HCl. tơ sợi tổng hợp. 1. 17.0225 mg/l. 8. B.422 tấn. 5. B. 1. Ancol etylic là sản phẩm trung gian từ đó sản xuất được cao su nhân tạo. Than hoạt tính. Tính hàm lượng khí đó trong không khí. H2S.2 tấn. Hiệu suất của quá trình là 80%.0 tấn. Khí lò cao.2 tấn.3 D 9.422 tấn. 27.11. D. A. Không khí. 1. nước Gia-ven.Cho khí etilen (lấy từ cracking dầu mỏ) hợp nước có xúc tác. Tính khối lượng NaCl cần thiết để sản xuất 15 tấn NaOH.0257 mg/l. NaOH.12. Hãy cho biết hiện tượng đó chứng tỏ trong không khí đã có khí nào trong các khí sau đây ? A.3585 mg chất kết tủa màu đen. Biết rằng hao hụt trong quá trình sản xuất là 25%. 3. Có thể điều chế thuốc diệt nấm 5% CuSO4 theo sơ đồ sau : CuS → CuO → CuSO 4 . NaOH rắn. D. 15. D. B. Na2CO3. C. 0. Câu 9.01 mg/l).3 tấn.13. A. 12. 0. Câu 9. 2.55 tấn. Câu 9. Để đánh giá độ nhiễm bẩn không khí của một nhà máy.4 tấn. C.15 tấn nguyên liệu chứa 80% CuS.4 C 9.0253 mg/l. Na2O2 rắn. SO2.Cho lên men các nguyên liệu chứa tinh bột.30 tấn. C.14.5 C 9. KClO3 rắn. B. coi hiệu suất phản ứng là 100%.7 D 9.3 tấn ancol etylic. Hãy tính lượng ngũ cốc chứa 65% tinh bột để sản xuất được 2. A. Khí tự nhiên. A. ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI CHƯƠNG IX 9. D. NH3. a. Tính khối lượng dung dịch CuSO4 5% thu được từ 0. C. CO2.8 A .

C 9.b A C 119 .9.10 D 9.14 C 9.15.a 9.12 D 9.9.15.13 B 9.11 A 9.