LÝ THUYẾT VÀ BÀI TẬP ANKAN

1.1 Đọc tên quốc tế (IUPAC) các chất sau :
a. CH3-CH(CH3)-CH2-CH3
2-metylbutan (isopentan)
b. CH3-CH2-CH(CH3)-CH2-CH3 3-metylpentan
c. CH3-CH(Br)-CH(C2H5)-CH3 2-brom-3-etylbutan
d. CH3-CHCl-CHCl-CH(CH3)-CH2-CH3 2,3-dibrom-4-metylhexan
e. CH3-CH(CH3)-CH2-CH(CH3)-CH(CH3)-CH3 2,3,5-trimetylhexan
1.2 Từ các tên gọi hãy viết công thức cấu tạo của các chất :
a. 4-etyl-2,3-đimetyl hexan CH3-CH(CH3)-CH(CH3)-CH(C2H5)-CH2-CH3
d. 3,3,5-tri metyl octan
CH3-CH2-C(CH3)2-CH2-CH(CH3)-CH2-CH2-CH3
b. 6-etyl -2,2-đimetyl octan
CH3-C(CH3)2-CH2-CH2-CH2-CH(C2H5)-CH2-CH3
e. 3-etyl-2,3-đi metyl heptan CH3-CH(CH3)-C(C2H5)(CH3)-CH2-CH2-CH2-CH3
c. 1-brom-2-clo-3-metyl pentan CHBr-CHCl-CH(CH 3)-CH2-CH3
1.3 Viết các phương trình phản ứng theo sơ đồ chuyển hóa sau :
CH3Cl → CH2Cl2 → CHCl3 → CCl4
a. CH3COONa → CH4
C2H2 → C2H6 → C2H4 → etan
0

CaO ,t
CH3COONa + NaOH 
→ CH4↑ + Na2CO3
as
CH4 + Cl2 → CH3Cl + HCl
clometan (metyl clorua)

as
CH3Cl + Cl2 
→ CH2Cl2 + HCl

ñiclo metan (mrtylen clrrua)

as
CH2Cl2 + Cl2 
→ CHCl 3 + HCl

triclometan (clorofom)

as
CHCl 3 + Cl2 
→ CCl4

+

HCl

15000
l ln

→ C2H2 +3H2
2CH4 
0

Ni ,t
→ C2H6
C2H2 + 2H2 → 
5000 C , xt
C2H6 
→ C2H4 +H2
Ni ,t 0
C2H4 + H2 
→ C2H6
C2H6 → C2H5Cl → C4H10 → C4H8 → n−butan
b. C4H10
isopropylclorua
C3H6 → propan
n−propylclorua.
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH3 + CH2=CH2
as
CH3-CH3 + Cl2 → CH3-CH2Cl +HCl
t 0C , xt
2CH3-CH2Cl + 2Na 
→ CH3-CH2-CH2-CH3 + 2NaCl
5000 C , xt
CH3-CH2-CH2-CH3 
→ CH2=CH-CH2-CH3 + H2
Ni ,t 0
CH2=CH-CH2-CH3 + H2 
→ CH3-CH2-CH2-CH3
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH=CH2 +CH4
Ni ,t 0
CH3-CH=CH2 + H2 
→ CH3-CH2-CH3
CH3-CH2-CH3 + Cl2
CH3-CHCl-CH3 (isopropylclorua) + HCl
CH2Cl-CH2-CH3 (propylclorua) + HCl

Propan + Cl2 CH 2Cl − CH 2 − CH 3 + HCl as CH3-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 3 + HCl CH 2 = CH − CH 3 + H 2 t 0C . a. phản ứng nhiệt (cho biết sản nào được ưu tiên).com/videos/boss-fucks-employee-6591. xt CH3-CH2-CH2-CH3  → CH 2 = CH 2 + CH 3 − CH 3 CH = CH − CH − CH + H 2 3 2  2 http://www. Viết các đồng phân và gọi tên theo danh pháp quốc tế các hợp chất ứng với công thức phân tử sau: C5H12 * C5H12 CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. n−Hecxan → n−butan → etan → etylclorua.6 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a. 5000 C .c. xt CH3-CH2-CH2-CH2-CH2-CH3  → CH3-CH2-CH2-CH3 + CH2=CH2 0 500 C .rawtube. B cùng công thức phân tử C5H12 tác dụng với Cl2 theo tỉ lệ mol 1:1 thì A chỉ tạo 1 dẫn xuất duy nhất còn B tạo 4 dẫn xuất. Viết công thức cấu tạo của A. Ankan A có tỉ khối hơi so với H2 bằng 36.2 dimetylpropan (neopentan) . B và các dẫn xuất clo của chúng. Dặt CTTQ của ankan A: Cn H 2 n + 2 (với n>0) MA d A/ H 2 = ⇒ M A = M H 2 . CH 2Cl − CH (CH 3 ) − CH 2 − CH 2Cl + HCl CH Cl − CH (CH ) − CHCl − CH + HCl  2 3 3  as CH3-CH(CH3)-CH2-CH3 + Cl2 → CH 3 − CCl (CH 3 ) − CH 2 − CH 3 + HCl CH 2Cl − CH (CH 3 ) − CH 2 − CH 3 + HCl as CH3-C(CH3)2-CH3 + Cl2  → CH2Cl-C(CH3)2-CH3 + HCl 1. Viết phương trình phản ứng clo hóa (tỉ lệ 1 : 1). CnH2n+2 as CnH2n+2 + Cl2  → CnH2n+1Cl + HCl Cn H 2 n + H 2 t 0C . n-butan CH 2Cl − CH 2 − CH 2 − CH 3 + HCl as CH3-CH2-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 2 − CH 3 + HCl CH 2 = CH − CH 3 + CH 4  t 0C . phản ứng đề hiđrohóa.html c.5 Hai chất A. xt CH3-CH2-CH3  → CH 2 = CH 2 + CH 4 b.36=72=14n+2→n=2 MH2 CTPT của A: C5H12 CTCT: CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. xt CnH2n+2  (n1+ n2 =n) → Cn1 H 2 n1 + Cn 2 H 2 n 2+ 2 Câu 2.d A/ H 2 =2. xt CH3-CH2-CH2-CH3  → CH2-CH3 + CH2=CH2 as CH3-CH3 + Cl2 → CH3-CH2Cl +HCl 1.2 dimetylpropan (neopentan) 1.4.

Đốt cháy hoàn toàn 1 lít ankan A sinh ra 3 lít CO2. Dặt CTTQ của ankan A: Cn H 2 n + 2 MD = Cn H 2 n + 2 + 1l (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3l 1 n = ⇒n=3 1 3 CTPT của A: C3H6 CTCT của A: CH3-CH2-CH3 b.7 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a.2 mol 30 8. Ankan Y có %H=25% . Dặt CTTQ của ankan X: Cn H 2 n + 2 12n.6 g CO2 và 0.100 = 80 ⇒ n = 2 %C= 14n + 2 CTPT của X: C2H6 CTCT của X: CH3-CH3 d. Hóa hơi 12g ankan D thấy chiếm một thể tích bằng thể tích của 5g etan đo ở cùng điều kiện.6 mol H2O. Công thức đơn giản nhất của B là C3H7. Các thể tích đo cùng điều kiện. Đốt cháy hoàn toàn một hiđrocacbon Y thu được 17. Dặt CTTQ của ankan A: Cn H 2 n + 2 Ta có : Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 1 + (3n+ 1) /2 = n + n + 1 → n= 1 CTPT của B: CH4 d. ankan B có CTPT có dạng (C3H7)n → C3n H 7 n vì là ankan nên: 7n=2. 4 mol 44 .8 = 44 =14n+2→n=3 0.b. Dặt CTTQ của ankan D: Cn H 2 n + 2 Vhơi của D = Vhơi của etan →nD=nC2H6= 6 = 0. Dặt CTTQ của ankan Y: Cn H 2 n + 2 (2n + 2). Dặt CTTQ của ankan Y: Cn H 2 n + 2 nCO 2 = 17. 6 = 0.3n + 2 → n=2 Ta có : Cn H 2 n + 2 ( C3H7)n CTPT của B : C6H14 c. Đốt cháy hoàn toàn 1 ankan B với lượng O2 vừa đủ thì thấy tổng số mol các chất trước phản ứng bằng tổng số mol các chất sau phản ứng. Ankan X có %C= 80% .100 = 25 ⇒ n = 1 %H= 14n + 2 CTPT của Y: CH4 f. 2 CTPT của D: C3H6 CTCT của D: CH3-CH2-CH3 1.

.  mC3H8 = %mC2 H 6 = MX = mC2 H 6 .. nhhX x + y .2 gam và bình II có 30 gam kết tủa.. 4 mhhX 7.. 18 . Vì nH 2O > nCO2 → hiđrocacbon Z là ankan Ta có: Dặt CTTQ của ankan Z: Cn H 2 n + 2 Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3 4 n n +1 = ⇒n=3 3 4 CTPT của Y: C3H8 CTCT của Y: CH3-CH2.. Tính % khối lượng mỗi khí trong hỗn hợp X và dX/H2 = ? C2 H 6 x mol + O2 Ca ( OH )2 du 7..4 gam hỗn hợp X gồm etan và propan... %mC3 H8 = ⇒ d X / H2 = mC3 H8 ......... 4 = = = ..100 mhh = .. 4 M X .. + ......... m 2 g= H 2O C3 H 8 x mol + O2 a g hhX   → sp (CO2 + H 2O)  Ca ( OH ) du 2 → bình II có 30 g ↓ =mCaCO3 = mCO2 C4 H10 y mol   mCaCO3 .. Cho toàn bộ sản phẩm cháy vào dung dịch Ca(OH)2 dư sau phản ứng thấy khối lượng bình đựng Ca(OH)2 tăng lên 34.....8 Đốt cháy hoàn toàn 7.18=142x + 204y=34..... Cho toàn bộ sản phẩm cháy lần lượt qua bình I đựng dd H2SO4đđ và bình II đựng dd Ca(OH)2 dư..... ⇒ ⇒ từ (1) và (2) ta có hệ pt:  142 x + 204 y = 34. 4  x = . Đốt cháy hoàn toàn một hiđrocacbon Z thu được CO2 và H2O theo tỷ lệ Vco2 :Vhơi nước = 3 : 4.18 = (2x + 3y). Sau thí nghiệm thấy khối lượng bình I tăng 7.44 + (3x + 4y).... C3H8 + 5O2 → 3 CO2 + 4H2O x 3x 4x .....6 n n +1 = ⇒n=2 0. H 2 SO4 dac   → bìănh I t ng 7... 4 g (1) Ta có: C2H6 + 7/2O2 → 2 CO2 + 3H2O x 2x 3x C3H8 + 5 O2 → 3CO2 + 4 H2O y 3y 4y bình tăng 34. 7.. 7. mH 2O ......100 mhh = ....6g= mCO2 + mH 2O = nCO2 .6g= mCO2 + mH 2 o C3 H 8 y mol mhh = mC2 H6 + mC3 H8 = 30 x + 42 y = 7.9..6 CTPT của Y: C2H6 CTCT của Y: CH3-CH3 e.4 0. 6  y = ...CH3 1.. nCO 2 = nCaCO3 = = = 18 .100 =. Tính % khối lượng và % theo số mol mỗi khí trong hỗn hợp ban đầu....... nH 2O = = = . 4 7...6 gam.......100 = ... 4 g hhX   → sp (CO2 + H 2O)   → bình tăng 34. = = M H2 2 1... 4 0.Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 0.....44 + nH 2O ...6g (2)  mC2 H 6 = 30 x + 42 y = 7...... Đốt cháy hoàn toàn a gam hỗn hợp gồm etan và butan...

2 + 37. * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 MX d X / C2 H 4 = ⇒ M X = d X / H 2 ..1mol ⇒ mH 2O = 2..6 M kk Vậy hai parafin là kế cận trong dãy đồng đẳng là C4H10 và C5H12 * nC4 H10 nC5 H12 = 5 − n 0.8 gam hỗn hợp X gồm hai ankan sau phản ứng thu được 57.5 M H2 Vậy hai ankan là liên tiếp trong dãy đồng đẳng là CH4 và C2H6 * nCH 4 nC2 H6 = 2 − n 0.6 g 44 44 mH = 19. a. Xác định ctpt của 2 parafin này và tính % mỗi chất về thể tích. mCO2 57.3.M kk = 2. 2 g ⇒ nH = 4. 4 = = ⇒ %VCH = 40% 4 nC2 H6 n − 1 0.. Xác định công thức phân tử và % thể tích hỗn hợp.M C2 H 4 = 0.875. Xác định hai ankan nói trên và tính % theo thể tích của hh X.3.2 = 23 = 14n + 2 ⇒ n = 1.8 − 15.28 = 24. Biết hai ankan là liên tiếp trong dãy đồìng đẳng.. * Đặt CT chung hh 2 parafin là: Cn H 2 n + 2 M d X / kk = X ⇒ M X = d X / kk .5 1 → %VCH 4 = 50% %VC2 H6 = 50% c) Một hh 2 parafin kế cận trong dãy đồng đẳng có tỉ khối hơi đối với không khí bằng 2.. 4 = ⇒ %VC H = 40% 4 10 n − 4 0. * Đặt CT chung hhX là: Cn H 2 n + 2 d X / H2 = MX ⇒ M X = d X / H 2 . 6 = 4. 2 ⇒ nH 2O = 2.29 = 66.11 a) Hỗn hợp X gồm hai ankan có dX/H2 = 11.18 = 37.1. Đốt cháy hoàn toàn 19. ta có hệ pt: 1. b.2 gam CO2.8 − 19..7 = 14n + 2 ⇒ n = 4.5..M H 2 = 11. Nếu 2 ankan trên là đồng đẳng liên tiếp.5 1 = = n − 1 0..8 = 75.6 M C2 H 4 Vậy 2 ankan thể khí là CH4 và C2H4 * nCH 4 2 − n 0.875.. 6 %VC5 H12 = 60% → d) Một hỗn hợp 2 ankan thể khí ở đktc có tỉ khối đối với C2H4 bằng 0.12.8 mhhX + mO2 = mCO2 + mH 2O ⇒ mO2 = 57.12 = .12 = 15..5 = 14n + 2 ⇒ n = 1.C4H10 + 13/2 O2 → 4CO2 + 5H2O y 4y 5y nH 2O = 4 x + 5 y = ..2 = 4. nCO2 = 3x + 4 y = . Tính khối lượng nước tạo thành và số mol O2 phản ứng.2 mol ⇒ nH = nH 2O ..5. 6 %VC2 H 6 = 60% 1.2 g * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 Cn H 2 n + 2 + 3n + 1 O2 → 2 nCO2 + ( n + 1) H 2O . Hãy xác định 2 ankan đó và tính % theo khối lượng mỗi ankan.. 2 mC = .

Tìm công thức phân tử và % theo thể tích của hai hiđrocacbon này. 1. Dẫn sản phẩm lần lượt qua bình 1 đựng CaCl2 khan rồi bình 2 đựng dung dịch KOH. B và tính m = ? Biết A.1. B trong hh X. 25 Ta có: 1. Tính hiệu suất từng sản phẩm và hiệu suất chung của phản ứng. Đốt cháy 20. tính m? b.15.13.43gam và bình 2 tăng 9. Tính thể tích khí CO2 ở (đktc) và khối lượng nước tạo thành. 67 mol 4 nC2 H6 n − 1 0. 75 = = ⇒ %VCH = 75% %VC2 H 6 = 25% 4 nC2 H6 n − 1 0.357 mol 18 3n + 1 Cn H 2 n + 2 + O2 → 2 nH O = 2 nCO2 = 9. mạch hở có thành phần hơn kém nhau k nguyên tử cacbon thì thu được b gam CO2. a. Hỗn hợp X gồm ankan A và B có khối lượng phân tử hơn kém nhau 28 (đ.52 lít oxi (đktc). Tính % theo số mol các ankan trong hỗn hợp. Xác định ctpt và tính % theo thể tích mỗi hiđrocacbon trong hh. tính V (đkc).4 và m2 = 61. Nếu m1 = 25. Đốt cháy hoàn toàn 29. Đốt cháy một hỗn hợp gồm 2 hiđrocacbon đồng đẳng kế tiếp A. a. 67 Ta có: 1. b. 1. Đốt cháy hoàn toàn a gam hỗn hợp hai đồng đẳng của các hiđrocacbon no.1 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0. a.3 2.v. CaCl2 khan   → bìănh 1 t ng 6.82 m Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 6.C).23 mol % nC2 H 6 = 0. Đốt cháy hoàn toàn m(g) hh X cho hỗn hợp sản phẩm khí và hơi sau phản ứng đi qua bình 1 đựng dung dịch H 2SO4đđ và bình 2 đựng dung dịch KOH thì khối lượng bình 1 tăng m1(g) và bình 2 tăng m2(g).357 n n +1 = ⇒ n = 1.1 n n +1 = ⇒ n = 1.17. 43gam= m Cn H 2 n + 2 H 2O + O2 V (l ) hhX   → sp (CO2 + H 2O)  dung dich KOH g= = CO2 Cn +1 H 2( n +1) + 2  → bìănh 2 t ng 9. Biết 2 hiđrocacbon đều là chất khí ở điều kiện thường. Xác định công thức phân tử của A.82 = 0.8 gam. b. Lập công thức hai ankan.82 gam. Tính khối lượng CO2 và H2O tạo thành và tìm ctpt của 2 ankan. . 67 0. 43 = 0. B thu được CO 2 và H2O theo tỉ lệ số mol lần lượt là 11 : 14. Xác định công thức phân tử và % theo số mol của A.4 gam một hỗn hợp 2 hiđrocacbon no mạch hở cần dùng 51.952 gam n-propyl bromua.223 0.6. 223 mol 44 nCO2 0. 1.16.14. B đều là chất khí ở đkt. Hấp thụ toàn bộ sản phẩm vào bình Ba(OH)2 thấy khối lượng bình tăng 134. Khi brom hóa 22 gam propan người ta thu được 33. 23 = = ⇒ % nCH = 0.2 gam hỗn hợp 2 ankan kế tiếp nhau trong dãy đồng đẳng.25 1.18. 1.223 + ( n + 1) H 2O 0.357 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0. Đốt cháy V(lít) hỗn hợp hai ankan kế tiếp trong dãy đồng đẳng. Nếu m1 = 32. Sau thí nghiệm khối lượng bình 1 tăng 6. 1.19*.2 và m2 = 44.3 2.948 gam isopropyl bromua và 2.

k. Nếu cho khí còn lại qua KOH dư thể tích giảm đi 83. Xác định công thức phân tử và viết công thức cấu tạo các đồng phân của A.20** Một hỗn hợp X gồm hiđrocacbon (A) và O2 dư đem đốt cháy hoàn toàn thu sản phẩm làm lạnh thì thể tích giảm 50 %. b = 8.36 (g) và k = 2. Đồng phân nào của A khi phản ứng thế với Cl2 cho một sản phẩm duy nhất. b. Tính thành phần % về thể tích của A và oxi trong hỗn hợp X. c. Cho a = 2.72 (g) . Tìm khoảng xác định của số nguyên tử C trong hiđrocacbon theo a. 1. b. a. b.a. Tìm công thức của các hiđrocacbon và tính % theo khối lượng của chúng trong hỗn hợp. .3 % số còn lại.

Sign up to vote on this title
UsefulNot useful