LÝ THUYẾT VÀ BÀI TẬP ANKAN

1.1 Đọc tên quốc tế (IUPAC) các chất sau :
a. CH3-CH(CH3)-CH2-CH3
2-metylbutan (isopentan)
b. CH3-CH2-CH(CH3)-CH2-CH3 3-metylpentan
c. CH3-CH(Br)-CH(C2H5)-CH3 2-brom-3-etylbutan
d. CH3-CHCl-CHCl-CH(CH3)-CH2-CH3 2,3-dibrom-4-metylhexan
e. CH3-CH(CH3)-CH2-CH(CH3)-CH(CH3)-CH3 2,3,5-trimetylhexan
1.2 Từ các tên gọi hãy viết công thức cấu tạo của các chất :
a. 4-etyl-2,3-đimetyl hexan CH3-CH(CH3)-CH(CH3)-CH(C2H5)-CH2-CH3
d. 3,3,5-tri metyl octan
CH3-CH2-C(CH3)2-CH2-CH(CH3)-CH2-CH2-CH3
b. 6-etyl -2,2-đimetyl octan
CH3-C(CH3)2-CH2-CH2-CH2-CH(C2H5)-CH2-CH3
e. 3-etyl-2,3-đi metyl heptan CH3-CH(CH3)-C(C2H5)(CH3)-CH2-CH2-CH2-CH3
c. 1-brom-2-clo-3-metyl pentan CHBr-CHCl-CH(CH 3)-CH2-CH3
1.3 Viết các phương trình phản ứng theo sơ đồ chuyển hóa sau :
CH3Cl → CH2Cl2 → CHCl3 → CCl4
a. CH3COONa → CH4
C2H2 → C2H6 → C2H4 → etan
0

CaO ,t
CH3COONa + NaOH 
→ CH4↑ + Na2CO3
as
CH4 + Cl2 → CH3Cl + HCl
clometan (metyl clorua)

as
CH3Cl + Cl2 
→ CH2Cl2 + HCl

ñiclo metan (mrtylen clrrua)

as
CH2Cl2 + Cl2 
→ CHCl 3 + HCl

triclometan (clorofom)

as
CHCl 3 + Cl2 
→ CCl4

+

HCl

15000
l ln

→ C2H2 +3H2
2CH4 
0

Ni ,t
→ C2H6
C2H2 + 2H2 → 
5000 C , xt
C2H6 
→ C2H4 +H2
Ni ,t 0
C2H4 + H2 
→ C2H6
C2H6 → C2H5Cl → C4H10 → C4H8 → n−butan
b. C4H10
isopropylclorua
C3H6 → propan
n−propylclorua.
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH3 + CH2=CH2
as
CH3-CH3 + Cl2 → CH3-CH2Cl +HCl
t 0C , xt
2CH3-CH2Cl + 2Na 
→ CH3-CH2-CH2-CH3 + 2NaCl
5000 C , xt
CH3-CH2-CH2-CH3 
→ CH2=CH-CH2-CH3 + H2
Ni ,t 0
CH2=CH-CH2-CH3 + H2 
→ CH3-CH2-CH2-CH3
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH=CH2 +CH4
Ni ,t 0
CH3-CH=CH2 + H2 
→ CH3-CH2-CH3
CH3-CH2-CH3 + Cl2
CH3-CHCl-CH3 (isopropylclorua) + HCl
CH2Cl-CH2-CH3 (propylclorua) + HCl

xt CnH2n+2  (n1+ n2 =n) → Cn1 H 2 n1 + Cn 2 H 2 n 2+ 2 Câu 2.com/videos/boss-fucks-employee-6591. Propan + Cl2 CH 2Cl − CH 2 − CH 3 + HCl as CH3-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 3 + HCl CH 2 = CH − CH 3 + H 2 t 0C . n-butan CH 2Cl − CH 2 − CH 2 − CH 3 + HCl as CH3-CH2-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 2 − CH 3 + HCl CH 2 = CH − CH 3 + CH 4  t 0C .2 dimetylpropan (neopentan) . xt CH3-CH2-CH2-CH3  → CH 2 = CH 2 + CH 3 − CH 3 CH = CH − CH − CH + H 2 3 2  2 http://www.rawtube.c. xt CH3-CH2-CH2-CH2-CH2-CH3  → CH3-CH2-CH2-CH3 + CH2=CH2 0 500 C . Ankan A có tỉ khối hơi so với H2 bằng 36. xt CH3-CH2-CH3  → CH 2 = CH 2 + CH 4 b. n−Hecxan → n−butan → etan → etylclorua. Viết phương trình phản ứng clo hóa (tỉ lệ 1 : 1).36=72=14n+2→n=2 MH2 CTPT của A: C5H12 CTCT: CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2.4. CH 2Cl − CH (CH 3 ) − CH 2 − CH 2Cl + HCl CH Cl − CH (CH ) − CHCl − CH + HCl  2 3 3  as CH3-CH(CH3)-CH2-CH3 + Cl2 → CH 3 − CCl (CH 3 ) − CH 2 − CH 3 + HCl CH 2Cl − CH (CH 3 ) − CH 2 − CH 3 + HCl as CH3-C(CH3)2-CH3 + Cl2  → CH2Cl-C(CH3)2-CH3 + HCl 1.5 Hai chất A.6 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a. B và các dẫn xuất clo của chúng.2 dimetylpropan (neopentan) 1. xt CH3-CH2-CH2-CH3  → CH2-CH3 + CH2=CH2 as CH3-CH3 + Cl2 → CH3-CH2Cl +HCl 1. 5000 C .html c. phản ứng đề hiđrohóa. Viết các đồng phân và gọi tên theo danh pháp quốc tế các hợp chất ứng với công thức phân tử sau: C5H12 * C5H12 CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. Viết công thức cấu tạo của A. B cùng công thức phân tử C5H12 tác dụng với Cl2 theo tỉ lệ mol 1:1 thì A chỉ tạo 1 dẫn xuất duy nhất còn B tạo 4 dẫn xuất. CnH2n+2 as CnH2n+2 + Cl2  → CnH2n+1Cl + HCl Cn H 2 n + H 2 t 0C .d A/ H 2 =2. Dặt CTTQ của ankan A: Cn H 2 n + 2 (với n>0) MA d A/ H 2 = ⇒ M A = M H 2 . a. phản ứng nhiệt (cho biết sản nào được ưu tiên).

Các thể tích đo cùng điều kiện. 2 CTPT của D: C3H6 CTCT của D: CH3-CH2-CH3 1. Ankan Y có %H=25% . Công thức đơn giản nhất của B là C3H7.7 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a. Dặt CTTQ của ankan Y: Cn H 2 n + 2 nCO 2 = 17.8 = 44 =14n+2→n=3 0. 4 mol 44 . Dặt CTTQ của ankan A: Cn H 2 n + 2 Ta có : Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 1 + (3n+ 1) /2 = n + n + 1 → n= 1 CTPT của B: CH4 d.6 mol H2O.100 = 25 ⇒ n = 1 %H= 14n + 2 CTPT của Y: CH4 f. Đốt cháy hoàn toàn một hiđrocacbon Y thu được 17.100 = 80 ⇒ n = 2 %C= 14n + 2 CTPT của X: C2H6 CTCT của X: CH3-CH3 d. Dặt CTTQ của ankan D: Cn H 2 n + 2 Vhơi của D = Vhơi của etan →nD=nC2H6= 6 = 0. Ankan X có %C= 80% .6 g CO2 và 0.2 mol 30 8. ankan B có CTPT có dạng (C3H7)n → C3n H 7 n vì là ankan nên: 7n=2. Dặt CTTQ của ankan Y: Cn H 2 n + 2 (2n + 2).3n + 2 → n=2 Ta có : Cn H 2 n + 2 ( C3H7)n CTPT của B : C6H14 c. Dặt CTTQ của ankan A: Cn H 2 n + 2 MD = Cn H 2 n + 2 + 1l (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3l 1 n = ⇒n=3 1 3 CTPT của A: C3H6 CTCT của A: CH3-CH2-CH3 b.b. Dặt CTTQ của ankan X: Cn H 2 n + 2 12n. Đốt cháy hoàn toàn 1 ankan B với lượng O2 vừa đủ thì thấy tổng số mol các chất trước phản ứng bằng tổng số mol các chất sau phản ứng. Hóa hơi 12g ankan D thấy chiếm một thể tích bằng thể tích của 5g etan đo ở cùng điều kiện. 6 = 0. Đốt cháy hoàn toàn 1 lít ankan A sinh ra 3 lít CO2.

.. 4 = = = . C3H8 + 5O2 → 3 CO2 + 4H2O x 3x 4x . Đốt cháy hoàn toàn một hiđrocacbon Z thu được CO2 và H2O theo tỷ lệ Vco2 :Vhơi nước = 3 : 4..  mC3H8 = %mC2 H 6 = MX = mC2 H 6 ..2 gam và bình II có 30 gam kết tủa... Đốt cháy hoàn toàn a gam hỗn hợp gồm etan và butan..... Vì nH 2O > nCO2 → hiđrocacbon Z là ankan Ta có: Dặt CTTQ của ankan Z: Cn H 2 n + 2 Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3 4 n n +1 = ⇒n=3 3 4 CTPT của Y: C3H8 CTCT của Y: CH3-CH2.. 18 .....6g (2)  mC2 H 6 = 30 x + 42 y = 7. 4 mhhX 7....6 CTPT của Y: C2H6 CTCT của Y: CH3-CH3 e. 4 g (1) Ta có: C2H6 + 7/2O2 → 2 CO2 + 3H2O x 2x 3x C3H8 + 5 O2 → 3CO2 + 4 H2O y 3y 4y bình tăng 34....100 mhh = .4 gam hỗn hợp X gồm etan và propan........44 + (3x + 4y).18 = (2x + 3y)...6 gam.. nCO 2 = nCaCO3 = = = 18 .6g= mCO2 + mH 2O = nCO2 . Cho toàn bộ sản phẩm cháy vào dung dịch Ca(OH)2 dư sau phản ứng thấy khối lượng bình đựng Ca(OH)2 tăng lên 34... 4 0.. 7.100 = ... 6  y = ... = = M H2 2 1.. Tính % khối lượng và % theo số mol mỗi khí trong hỗn hợp ban đầu.44 + nH 2O .. Sau thí nghiệm thấy khối lượng bình I tăng 7.....CH3 1.. %mC3 H8 = ⇒ d X / H2 = mC3 H8 ... 4 M X ...... 4  x = . 4 g hhX   → sp (CO2 + H 2O)   → bình tăng 34.... Cho toàn bộ sản phẩm cháy lần lượt qua bình I đựng dd H2SO4đđ và bình II đựng dd Ca(OH)2 dư..... Tính % khối lượng mỗi khí trong hỗn hợp X và dX/H2 = ? C2 H 6 x mol + O2 Ca ( OH )2 du 7...Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 0...8 Đốt cháy hoàn toàn 7. + .100 =...4 0....100 mhh = .. H 2 SO4 dac   → bìănh I t ng 7.6g= mCO2 + mH 2 o C3 H 8 y mol mhh = mC2 H6 + mC3 H8 = 30 x + 42 y = 7.... mH 2O .. ⇒ ⇒ từ (1) và (2) ta có hệ pt:  142 x + 204 y = 34. nhhX x + y .....18=142x + 204y=34.... 4 7....9.... 7...6 n n +1 = ⇒n=2 0. m 2 g= H 2O C3 H 8 x mol + O2 a g hhX   → sp (CO2 + H 2O)  Ca ( OH ) du 2 → bình II có 30 g ↓ =mCaCO3 = mCO2 C4 H10 y mol   mCaCO3 ..... nH 2O = = = ..

Đốt cháy hoàn toàn 19.11 a) Hỗn hợp X gồm hai ankan có dX/H2 = 11.. 2 g ⇒ nH = 4.. Biết hai ankan là liên tiếp trong dãy đồìng đẳng. 6 %VC5 H12 = 60% → d) Một hỗn hợp 2 ankan thể khí ở đktc có tỉ khối đối với C2H4 bằng 0.2 mol ⇒ nH = nH 2O .2 gam CO2. 4 = = ⇒ %VCH = 40% 4 nC2 H6 n − 1 0.12 = . * Đặt CT chung hh 2 parafin là: Cn H 2 n + 2 M d X / kk = X ⇒ M X = d X / kk .7 = 14n + 2 ⇒ n = 4. ta có hệ pt: 1..8 − 15. Xác định hai ankan nói trên và tính % theo thể tích của hh X.3.8 mhhX + mO2 = mCO2 + mH 2O ⇒ mO2 = 57.M H 2 = 11.1mol ⇒ mH 2O = 2. Xác định ctpt của 2 parafin này và tính % mỗi chất về thể tích. 6 %VC2 H 6 = 60% 1.5 1 = = n − 1 0. * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 MX d X / C2 H 4 = ⇒ M X = d X / H 2 .1. 2 ⇒ nH 2O = 2.5.8 = 75.C4H10 + 13/2 O2 → 4CO2 + 5H2O y 4y 5y nH 2O = 4 x + 5 y = .6 M kk Vậy hai parafin là kế cận trong dãy đồng đẳng là C4H10 và C5H12 * nC4 H10 nC5 H12 = 5 − n 0. 6 = 4.2 = 23 = 14n + 2 ⇒ n = 1..6 M C2 H 4 Vậy 2 ankan thể khí là CH4 và C2H4 * nCH 4 2 − n 0.3.5.875. nCO2 = 3x + 4 y = .2 g * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 Cn H 2 n + 2 + 3n + 1 O2 → 2 nCO2 + ( n + 1) H 2O ... Hãy xác định 2 ankan đó và tính % theo khối lượng mỗi ankan. * Đặt CT chung hhX là: Cn H 2 n + 2 d X / H2 = MX ⇒ M X = d X / H 2 . 2 mC = .12. 2 + 37.M C2 H 4 = 0..18 = 37..8 gam hỗn hợp X gồm hai ankan sau phản ứng thu được 57. a. mCO2 57. Nếu 2 ankan trên là đồng đẳng liên tiếp. 4 = ⇒ %VC H = 40% 4 10 n − 4 0.5 = 14n + 2 ⇒ n = 1.6 g 44 44 mH = 19. Xác định công thức phân tử và % thể tích hỗn hợp.875.2 = 4.28 = 24.29 = 66.8 − 19....5 1 → %VCH 4 = 50% %VC2 H6 = 50% c) Một hh 2 parafin kế cận trong dãy đồng đẳng có tỉ khối hơi đối với không khí bằng 2..12 = 15.5 M H2 Vậy hai ankan là liên tiếp trong dãy đồng đẳng là CH4 và C2H6 * nCH 4 nC2 H6 = 2 − n 0. b. Tính khối lượng nước tạo thành và số mol O2 phản ứng..M kk = 2.

a. tính m? b.1 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0.223 + ( n + 1) H 2O 0. tính V (đkc).13. B đều là chất khí ở đkt. 67 mol 4 nC2 H6 n − 1 0.C). b. Đốt cháy hoàn toàn a gam hỗn hợp hai đồng đẳng của các hiđrocacbon no.52 lít oxi (đktc). Tìm công thức phân tử và % theo thể tích của hai hiđrocacbon này. 1.223 0. Lập công thức hai ankan.3 2. Đốt cháy hoàn toàn m(g) hh X cho hỗn hợp sản phẩm khí và hơi sau phản ứng đi qua bình 1 đựng dung dịch H 2SO4đđ và bình 2 đựng dung dịch KOH thì khối lượng bình 1 tăng m1(g) và bình 2 tăng m2(g). CaCl2 khan   → bìănh 1 t ng 6. 1. Xác định công thức phân tử của A.15.43gam và bình 2 tăng 9. 1. . 1. 43gam= m Cn H 2 n + 2 H 2O + O2 V (l ) hhX   → sp (CO2 + H 2O)  dung dich KOH g= = CO2 Cn +1 H 2( n +1) + 2  → bìănh 2 t ng 9. B và tính m = ? Biết A.4 gam một hỗn hợp 2 hiđrocacbon no mạch hở cần dùng 51. Tính khối lượng CO2 và H2O tạo thành và tìm ctpt của 2 ankan.952 gam n-propyl bromua. Tính thể tích khí CO2 ở (đktc) và khối lượng nước tạo thành. Dẫn sản phẩm lần lượt qua bình 1 đựng CaCl2 khan rồi bình 2 đựng dung dịch KOH. 67 0.17.19*. Hỗn hợp X gồm ankan A và B có khối lượng phân tử hơn kém nhau 28 (đ.6.357 mol 18 3n + 1 Cn H 2 n + 2 + O2 → 2 nH O = 2 nCO2 = 9.2 gam hỗn hợp 2 ankan kế tiếp nhau trong dãy đồng đẳng. 75 = = ⇒ %VCH = 75% %VC2 H 6 = 25% 4 nC2 H6 n − 1 0.357 n n +1 = ⇒ n = 1. Tính % theo số mol các ankan trong hỗn hợp. Sau thí nghiệm khối lượng bình 1 tăng 6.v.14. Đốt cháy hoàn toàn 29. 1.16.25 1. b. a. 23 = = ⇒ % nCH = 0.948 gam isopropyl bromua và 2. a. 67 Ta có: 1.82 gam.2 và m2 = 44. B thu được CO 2 và H2O theo tỉ lệ số mol lần lượt là 11 : 14. 223 mol 44 nCO2 0. Đốt cháy V(lít) hỗn hợp hai ankan kế tiếp trong dãy đồng đẳng.1 n n +1 = ⇒ n = 1. Đốt cháy một hỗn hợp gồm 2 hiđrocacbon đồng đẳng kế tiếp A. B trong hh X. mạch hở có thành phần hơn kém nhau k nguyên tử cacbon thì thu được b gam CO2. Đốt cháy 20. 25 Ta có: 1.23 mol % nC2 H 6 = 0. Nếu m1 = 25. Khi brom hóa 22 gam propan người ta thu được 33. Hấp thụ toàn bộ sản phẩm vào bình Ba(OH)2 thấy khối lượng bình tăng 134. Nếu m1 = 32. Xác định công thức phân tử và % theo số mol của A.18.82 = 0.4 và m2 = 61.3 2. 43 = 0. Xác định ctpt và tính % theo thể tích mỗi hiđrocacbon trong hh.1.8 gam.357 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0.82 m Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 6. Tính hiệu suất từng sản phẩm và hiệu suất chung của phản ứng. Biết 2 hiđrocacbon đều là chất khí ở điều kiện thường.

c. a. Tính thành phần % về thể tích của A và oxi trong hỗn hợp X.a. 1. k. Tìm khoảng xác định của số nguyên tử C trong hiđrocacbon theo a.36 (g) và k = 2. Đồng phân nào của A khi phản ứng thế với Cl2 cho một sản phẩm duy nhất.20** Một hỗn hợp X gồm hiđrocacbon (A) và O2 dư đem đốt cháy hoàn toàn thu sản phẩm làm lạnh thì thể tích giảm 50 %. . b = 8. b. Cho a = 2. Tìm công thức của các hiđrocacbon và tính % theo khối lượng của chúng trong hỗn hợp. Nếu cho khí còn lại qua KOH dư thể tích giảm đi 83.72 (g) . b.3 % số còn lại. b. Xác định công thức phân tử và viết công thức cấu tạo các đồng phân của A.

Sign up to vote on this title
UsefulNot useful