LÝ THUYẾT VÀ BÀI TẬP ANKAN

1.1 Đọc tên quốc tế (IUPAC) các chất sau :
a. CH3-CH(CH3)-CH2-CH3
2-metylbutan (isopentan)
b. CH3-CH2-CH(CH3)-CH2-CH3 3-metylpentan
c. CH3-CH(Br)-CH(C2H5)-CH3 2-brom-3-etylbutan
d. CH3-CHCl-CHCl-CH(CH3)-CH2-CH3 2,3-dibrom-4-metylhexan
e. CH3-CH(CH3)-CH2-CH(CH3)-CH(CH3)-CH3 2,3,5-trimetylhexan
1.2 Từ các tên gọi hãy viết công thức cấu tạo của các chất :
a. 4-etyl-2,3-đimetyl hexan CH3-CH(CH3)-CH(CH3)-CH(C2H5)-CH2-CH3
d. 3,3,5-tri metyl octan
CH3-CH2-C(CH3)2-CH2-CH(CH3)-CH2-CH2-CH3
b. 6-etyl -2,2-đimetyl octan
CH3-C(CH3)2-CH2-CH2-CH2-CH(C2H5)-CH2-CH3
e. 3-etyl-2,3-đi metyl heptan CH3-CH(CH3)-C(C2H5)(CH3)-CH2-CH2-CH2-CH3
c. 1-brom-2-clo-3-metyl pentan CHBr-CHCl-CH(CH 3)-CH2-CH3
1.3 Viết các phương trình phản ứng theo sơ đồ chuyển hóa sau :
CH3Cl → CH2Cl2 → CHCl3 → CCl4
a. CH3COONa → CH4
C2H2 → C2H6 → C2H4 → etan
0

CaO ,t
CH3COONa + NaOH 
→ CH4↑ + Na2CO3
as
CH4 + Cl2 → CH3Cl + HCl
clometan (metyl clorua)

as
CH3Cl + Cl2 
→ CH2Cl2 + HCl

ñiclo metan (mrtylen clrrua)

as
CH2Cl2 + Cl2 
→ CHCl 3 + HCl

triclometan (clorofom)

as
CHCl 3 + Cl2 
→ CCl4

+

HCl

15000
l ln

→ C2H2 +3H2
2CH4 
0

Ni ,t
→ C2H6
C2H2 + 2H2 → 
5000 C , xt
C2H6 
→ C2H4 +H2
Ni ,t 0
C2H4 + H2 
→ C2H6
C2H6 → C2H5Cl → C4H10 → C4H8 → n−butan
b. C4H10
isopropylclorua
C3H6 → propan
n−propylclorua.
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH3 + CH2=CH2
as
CH3-CH3 + Cl2 → CH3-CH2Cl +HCl
t 0C , xt
2CH3-CH2Cl + 2Na 
→ CH3-CH2-CH2-CH3 + 2NaCl
5000 C , xt
CH3-CH2-CH2-CH3 
→ CH2=CH-CH2-CH3 + H2
Ni ,t 0
CH2=CH-CH2-CH3 + H2 
→ CH3-CH2-CH2-CH3
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH=CH2 +CH4
Ni ,t 0
CH3-CH=CH2 + H2 
→ CH3-CH2-CH3
CH3-CH2-CH3 + Cl2
CH3-CHCl-CH3 (isopropylclorua) + HCl
CH2Cl-CH2-CH3 (propylclorua) + HCl

Ankan A có tỉ khối hơi so với H2 bằng 36. phản ứng nhiệt (cho biết sản nào được ưu tiên).6 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a. n-butan CH 2Cl − CH 2 − CH 2 − CH 3 + HCl as CH3-CH2-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 2 − CH 3 + HCl CH 2 = CH − CH 3 + CH 4  t 0C . xt CH3-CH2-CH2-CH3  → CH 2 = CH 2 + CH 3 − CH 3 CH = CH − CH − CH + H 2 3 2  2 http://www.d A/ H 2 =2.4. phản ứng đề hiđrohóa.2 dimetylpropan (neopentan) . Viết các đồng phân và gọi tên theo danh pháp quốc tế các hợp chất ứng với công thức phân tử sau: C5H12 * C5H12 CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. Dặt CTTQ của ankan A: Cn H 2 n + 2 (với n>0) MA d A/ H 2 = ⇒ M A = M H 2 . xt CH3-CH2-CH2-CH2-CH2-CH3  → CH3-CH2-CH2-CH3 + CH2=CH2 0 500 C .c. Viết phương trình phản ứng clo hóa (tỉ lệ 1 : 1). B cùng công thức phân tử C5H12 tác dụng với Cl2 theo tỉ lệ mol 1:1 thì A chỉ tạo 1 dẫn xuất duy nhất còn B tạo 4 dẫn xuất.2 dimetylpropan (neopentan) 1. n−Hecxan → n−butan → etan → etylclorua. xt CnH2n+2  (n1+ n2 =n) → Cn1 H 2 n1 + Cn 2 H 2 n 2+ 2 Câu 2.html c. B và các dẫn xuất clo của chúng. xt CH3-CH2-CH3  → CH 2 = CH 2 + CH 4 b. CnH2n+2 as CnH2n+2 + Cl2  → CnH2n+1Cl + HCl Cn H 2 n + H 2 t 0C . CH 2Cl − CH (CH 3 ) − CH 2 − CH 2Cl + HCl CH Cl − CH (CH ) − CHCl − CH + HCl  2 3 3  as CH3-CH(CH3)-CH2-CH3 + Cl2 → CH 3 − CCl (CH 3 ) − CH 2 − CH 3 + HCl CH 2Cl − CH (CH 3 ) − CH 2 − CH 3 + HCl as CH3-C(CH3)2-CH3 + Cl2  → CH2Cl-C(CH3)2-CH3 + HCl 1. a.rawtube.5 Hai chất A. 5000 C . Propan + Cl2 CH 2Cl − CH 2 − CH 3 + HCl as CH3-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 3 + HCl CH 2 = CH − CH 3 + H 2 t 0C .com/videos/boss-fucks-employee-6591.36=72=14n+2→n=2 MH2 CTPT của A: C5H12 CTCT: CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. xt CH3-CH2-CH2-CH3  → CH2-CH3 + CH2=CH2 as CH3-CH3 + Cl2 → CH3-CH2Cl +HCl 1. Viết công thức cấu tạo của A.

6 g CO2 và 0.3n + 2 → n=2 Ta có : Cn H 2 n + 2 ( C3H7)n CTPT của B : C6H14 c.2 mol 30 8. ankan B có CTPT có dạng (C3H7)n → C3n H 7 n vì là ankan nên: 7n=2. 2 CTPT của D: C3H6 CTCT của D: CH3-CH2-CH3 1. Dặt CTTQ của ankan A: Cn H 2 n + 2 Ta có : Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 1 + (3n+ 1) /2 = n + n + 1 → n= 1 CTPT của B: CH4 d. Ankan Y có %H=25% .7 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a.8 = 44 =14n+2→n=3 0.100 = 25 ⇒ n = 1 %H= 14n + 2 CTPT của Y: CH4 f. Dặt CTTQ của ankan A: Cn H 2 n + 2 MD = Cn H 2 n + 2 + 1l (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3l 1 n = ⇒n=3 1 3 CTPT của A: C3H6 CTCT của A: CH3-CH2-CH3 b. 6 = 0. Công thức đơn giản nhất của B là C3H7. Dặt CTTQ của ankan D: Cn H 2 n + 2 Vhơi của D = Vhơi của etan →nD=nC2H6= 6 = 0. Hóa hơi 12g ankan D thấy chiếm một thể tích bằng thể tích của 5g etan đo ở cùng điều kiện.b. Dặt CTTQ của ankan Y: Cn H 2 n + 2 nCO 2 = 17. Dặt CTTQ của ankan X: Cn H 2 n + 2 12n. 4 mol 44 . Đốt cháy hoàn toàn 1 lít ankan A sinh ra 3 lít CO2. Các thể tích đo cùng điều kiện. Dặt CTTQ của ankan Y: Cn H 2 n + 2 (2n + 2). Đốt cháy hoàn toàn một hiđrocacbon Y thu được 17.6 mol H2O. Ankan X có %C= 80% .100 = 80 ⇒ n = 2 %C= 14n + 2 CTPT của X: C2H6 CTCT của X: CH3-CH3 d. Đốt cháy hoàn toàn 1 ankan B với lượng O2 vừa đủ thì thấy tổng số mol các chất trước phản ứng bằng tổng số mol các chất sau phản ứng.

. 4 g (1) Ta có: C2H6 + 7/2O2 → 2 CO2 + 3H2O x 2x 3x C3H8 + 5 O2 → 3CO2 + 4 H2O y 3y 4y bình tăng 34.... 4  x = .... H 2 SO4 dac   → bìănh I t ng 7.. nhhX x + y .. Vì nH 2O > nCO2 → hiđrocacbon Z là ankan Ta có: Dặt CTTQ của ankan Z: Cn H 2 n + 2 Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3 4 n n +1 = ⇒n=3 3 4 CTPT của Y: C3H8 CTCT của Y: CH3-CH2. Tính % khối lượng và % theo số mol mỗi khí trong hỗn hợp ban đầu.CH3 1. m 2 g= H 2O C3 H 8 x mol + O2 a g hhX   → sp (CO2 + H 2O)  Ca ( OH ) du 2 → bình II có 30 g ↓ =mCaCO3 = mCO2 C4 H10 y mol   mCaCO3 ..100 mhh = ....18 = (2x + 3y)... Cho toàn bộ sản phẩm cháy vào dung dịch Ca(OH)2 dư sau phản ứng thấy khối lượng bình đựng Ca(OH)2 tăng lên 34.....2 gam và bình II có 30 gam kết tủa. Tính % khối lượng mỗi khí trong hỗn hợp X và dX/H2 = ? C2 H 6 x mol + O2 Ca ( OH )2 du 7.100 mhh = ....6g (2)  mC2 H 6 = 30 x + 42 y = 7.18=142x + 204y=34.. 4 g hhX   → sp (CO2 + H 2O)   → bình tăng 34. C3H8 + 5O2 → 3 CO2 + 4H2O x 3x 4x .6 CTPT của Y: C2H6 CTCT của Y: CH3-CH3 e.6g= mCO2 + mH 2 o C3 H 8 y mol mhh = mC2 H6 + mC3 H8 = 30 x + 42 y = 7...... Đốt cháy hoàn toàn một hiđrocacbon Z thu được CO2 và H2O theo tỷ lệ Vco2 :Vhơi nước = 3 : 4....... 18 ..... Cho toàn bộ sản phẩm cháy lần lượt qua bình I đựng dd H2SO4đđ và bình II đựng dd Ca(OH)2 dư.... 4 mhhX 7..6 gam.Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 0.6 n n +1 = ⇒n=2 0... Đốt cháy hoàn toàn a gam hỗn hợp gồm etan và butan.. %mC3 H8 = ⇒ d X / H2 = mC3 H8 .. ⇒ ⇒ từ (1) và (2) ta có hệ pt:  142 x + 204 y = 34...4 gam hỗn hợp X gồm etan và propan...100 = ... nCO 2 = nCaCO3 = = = 18 . 7.8 Đốt cháy hoàn toàn 7... 4 M X .......... nH 2O = = = ..6g= mCO2 + mH 2O = nCO2 ... 7... 4 7..44 + nH 2O ........  mC3H8 = %mC2 H 6 = MX = mC2 H 6 .. Sau thí nghiệm thấy khối lượng bình I tăng 7..4 0....... + .... 4 = = = .. mH 2O .44 + (3x + 4y).100 =.. = = M H2 2 1.. 6  y = ....9. 4 0.

2 g * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 Cn H 2 n + 2 + 3n + 1 O2 → 2 nCO2 + ( n + 1) H 2O . 2 ⇒ nH 2O = 2.28 = 24.1.. mCO2 57.5 1 = = n − 1 0.. b. a. Tính khối lượng nước tạo thành và số mol O2 phản ứng.5.8 − 19. 4 = = ⇒ %VCH = 40% 4 nC2 H6 n − 1 0.5..6 M C2 H 4 Vậy 2 ankan thể khí là CH4 và C2H4 * nCH 4 2 − n 0.8 − 15.8 mhhX + mO2 = mCO2 + mH 2O ⇒ mO2 = 57..5 M H2 Vậy hai ankan là liên tiếp trong dãy đồng đẳng là CH4 và C2H6 * nCH 4 nC2 H6 = 2 − n 0.2 mol ⇒ nH = nH 2O . Đốt cháy hoàn toàn 19...875.2 = 4. Xác định ctpt của 2 parafin này và tính % mỗi chất về thể tích.2 = 23 = 14n + 2 ⇒ n = 1.3.29 = 66... Nếu 2 ankan trên là đồng đẳng liên tiếp.12 = . 2 mC = .6 M kk Vậy hai parafin là kế cận trong dãy đồng đẳng là C4H10 và C5H12 * nC4 H10 nC5 H12 = 5 − n 0..11 a) Hỗn hợp X gồm hai ankan có dX/H2 = 11.2 gam CO2.18 = 37.M C2 H 4 = 0.8 gam hỗn hợp X gồm hai ankan sau phản ứng thu được 57.6 g 44 44 mH = 19.8 = 75..M H 2 = 11.875.1mol ⇒ mH 2O = 2.12 = 15. 6 %VC2 H 6 = 60% 1. 2 + 37. Hãy xác định 2 ankan đó và tính % theo khối lượng mỗi ankan..12. 2 g ⇒ nH = 4..5 = 14n + 2 ⇒ n = 1.. Xác định hai ankan nói trên và tính % theo thể tích của hh X. * Đặt CT chung hh 2 parafin là: Cn H 2 n + 2 M d X / kk = X ⇒ M X = d X / kk . * Đặt CT chung hhX là: Cn H 2 n + 2 d X / H2 = MX ⇒ M X = d X / H 2 . Xác định công thức phân tử và % thể tích hỗn hợp. 4 = ⇒ %VC H = 40% 4 10 n − 4 0.5 1 → %VCH 4 = 50% %VC2 H6 = 50% c) Một hh 2 parafin kế cận trong dãy đồng đẳng có tỉ khối hơi đối với không khí bằng 2.7 = 14n + 2 ⇒ n = 4. nCO2 = 3x + 4 y = .3.C4H10 + 13/2 O2 → 4CO2 + 5H2O y 4y 5y nH 2O = 4 x + 5 y = .M kk = 2. ta có hệ pt: 1. Biết hai ankan là liên tiếp trong dãy đồìng đẳng. * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 MX d X / C2 H 4 = ⇒ M X = d X / H 2 . 6 %VC5 H12 = 60% → d) Một hỗn hợp 2 ankan thể khí ở đktc có tỉ khối đối với C2H4 bằng 0. 6 = 4.

Tính khối lượng CO2 và H2O tạo thành và tìm ctpt của 2 ankan. 43gam= m Cn H 2 n + 2 H 2O + O2 V (l ) hhX   → sp (CO2 + H 2O)  dung dich KOH g= = CO2 Cn +1 H 2( n +1) + 2  → bìănh 2 t ng 9. tính m? b. 1. CaCl2 khan   → bìănh 1 t ng 6. a. Khi brom hóa 22 gam propan người ta thu được 33. B trong hh X.16. B thu được CO 2 và H2O theo tỉ lệ số mol lần lượt là 11 : 14.4 gam một hỗn hợp 2 hiđrocacbon no mạch hở cần dùng 51. Tính thể tích khí CO2 ở (đktc) và khối lượng nước tạo thành. Xác định công thức phân tử và % theo số mol của A. 67 0. b. Xác định công thức phân tử của A. 75 = = ⇒ %VCH = 75% %VC2 H 6 = 25% 4 nC2 H6 n − 1 0.82 m Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 6. 1. 43 = 0. 223 mol 44 nCO2 0. Dẫn sản phẩm lần lượt qua bình 1 đựng CaCl2 khan rồi bình 2 đựng dung dịch KOH.v.6.C). 67 mol 4 nC2 H6 n − 1 0.18.3 2. Đốt cháy hoàn toàn m(g) hh X cho hỗn hợp sản phẩm khí và hơi sau phản ứng đi qua bình 1 đựng dung dịch H 2SO4đđ và bình 2 đựng dung dịch KOH thì khối lượng bình 1 tăng m1(g) và bình 2 tăng m2(g). Đốt cháy một hỗn hợp gồm 2 hiđrocacbon đồng đẳng kế tiếp A.2 gam hỗn hợp 2 ankan kế tiếp nhau trong dãy đồng đẳng.25 1. Tính hiệu suất từng sản phẩm và hiệu suất chung của phản ứng.82 gam. a.952 gam n-propyl bromua.357 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0.13.1.23 mol % nC2 H 6 = 0.43gam và bình 2 tăng 9.15. Đốt cháy hoàn toàn a gam hỗn hợp hai đồng đẳng của các hiđrocacbon no. 67 Ta có: 1.19*.3 2. . Đốt cháy V(lít) hỗn hợp hai ankan kế tiếp trong dãy đồng đẳng. 25 Ta có: 1.1 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0. B đều là chất khí ở đkt.82 = 0.1 n n +1 = ⇒ n = 1. Xác định ctpt và tính % theo thể tích mỗi hiđrocacbon trong hh. Lập công thức hai ankan.4 và m2 = 61. Biết 2 hiđrocacbon đều là chất khí ở điều kiện thường.52 lít oxi (đktc). b. Nếu m1 = 32. 1. Sau thí nghiệm khối lượng bình 1 tăng 6.8 gam. 23 = = ⇒ % nCH = 0. Nếu m1 = 25.2 và m2 = 44. 1. tính V (đkc). Tính % theo số mol các ankan trong hỗn hợp.357 mol 18 3n + 1 Cn H 2 n + 2 + O2 → 2 nH O = 2 nCO2 = 9. mạch hở có thành phần hơn kém nhau k nguyên tử cacbon thì thu được b gam CO2.17.14. Hấp thụ toàn bộ sản phẩm vào bình Ba(OH)2 thấy khối lượng bình tăng 134.223 0.948 gam isopropyl bromua và 2. Đốt cháy hoàn toàn 29. Tìm công thức phân tử và % theo thể tích của hai hiđrocacbon này. B và tính m = ? Biết A. 1.223 + ( n + 1) H 2O 0. a. Đốt cháy 20. Hỗn hợp X gồm ankan A và B có khối lượng phân tử hơn kém nhau 28 (đ.357 n n +1 = ⇒ n = 1.

Đồng phân nào của A khi phản ứng thế với Cl2 cho một sản phẩm duy nhất. c. Tìm khoảng xác định của số nguyên tử C trong hiđrocacbon theo a. b. Cho a = 2. Nếu cho khí còn lại qua KOH dư thể tích giảm đi 83.36 (g) và k = 2.72 (g) . k. b = 8. Tính thành phần % về thể tích của A và oxi trong hỗn hợp X. 1. . b.3 % số còn lại.20** Một hỗn hợp X gồm hiđrocacbon (A) và O2 dư đem đốt cháy hoàn toàn thu sản phẩm làm lạnh thì thể tích giảm 50 %. a. b. Xác định công thức phân tử và viết công thức cấu tạo các đồng phân của A. Tìm công thức của các hiđrocacbon và tính % theo khối lượng của chúng trong hỗn hợp.a.

Sign up to vote on this title
UsefulNot useful