LÝ THUYẾT VÀ BÀI TẬP ANKAN

1.1 Đọc tên quốc tế (IUPAC) các chất sau :
a. CH3-CH(CH3)-CH2-CH3
2-metylbutan (isopentan)
b. CH3-CH2-CH(CH3)-CH2-CH3 3-metylpentan
c. CH3-CH(Br)-CH(C2H5)-CH3 2-brom-3-etylbutan
d. CH3-CHCl-CHCl-CH(CH3)-CH2-CH3 2,3-dibrom-4-metylhexan
e. CH3-CH(CH3)-CH2-CH(CH3)-CH(CH3)-CH3 2,3,5-trimetylhexan
1.2 Từ các tên gọi hãy viết công thức cấu tạo của các chất :
a. 4-etyl-2,3-đimetyl hexan CH3-CH(CH3)-CH(CH3)-CH(C2H5)-CH2-CH3
d. 3,3,5-tri metyl octan
CH3-CH2-C(CH3)2-CH2-CH(CH3)-CH2-CH2-CH3
b. 6-etyl -2,2-đimetyl octan
CH3-C(CH3)2-CH2-CH2-CH2-CH(C2H5)-CH2-CH3
e. 3-etyl-2,3-đi metyl heptan CH3-CH(CH3)-C(C2H5)(CH3)-CH2-CH2-CH2-CH3
c. 1-brom-2-clo-3-metyl pentan CHBr-CHCl-CH(CH 3)-CH2-CH3
1.3 Viết các phương trình phản ứng theo sơ đồ chuyển hóa sau :
CH3Cl → CH2Cl2 → CHCl3 → CCl4
a. CH3COONa → CH4
C2H2 → C2H6 → C2H4 → etan
0

CaO ,t
CH3COONa + NaOH 
→ CH4↑ + Na2CO3
as
CH4 + Cl2 → CH3Cl + HCl
clometan (metyl clorua)

as
CH3Cl + Cl2 
→ CH2Cl2 + HCl

ñiclo metan (mrtylen clrrua)

as
CH2Cl2 + Cl2 
→ CHCl 3 + HCl

triclometan (clorofom)

as
CHCl 3 + Cl2 
→ CCl4

+

HCl

15000
l ln

→ C2H2 +3H2
2CH4 
0

Ni ,t
→ C2H6
C2H2 + 2H2 → 
5000 C , xt
C2H6 
→ C2H4 +H2
Ni ,t 0
C2H4 + H2 
→ C2H6
C2H6 → C2H5Cl → C4H10 → C4H8 → n−butan
b. C4H10
isopropylclorua
C3H6 → propan
n−propylclorua.
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH3 + CH2=CH2
as
CH3-CH3 + Cl2 → CH3-CH2Cl +HCl
t 0C , xt
2CH3-CH2Cl + 2Na 
→ CH3-CH2-CH2-CH3 + 2NaCl
5000 C , xt
CH3-CH2-CH2-CH3 
→ CH2=CH-CH2-CH3 + H2
Ni ,t 0
CH2=CH-CH2-CH3 + H2 
→ CH3-CH2-CH2-CH3
0

500 C , xt
CH3-CH2-CH2-CH3 
→ CH3-CH=CH2 +CH4
Ni ,t 0
CH3-CH=CH2 + H2 
→ CH3-CH2-CH3
CH3-CH2-CH3 + Cl2
CH3-CHCl-CH3 (isopropylclorua) + HCl
CH2Cl-CH2-CH3 (propylclorua) + HCl

d A/ H 2 =2.36=72=14n+2→n=2 MH2 CTPT của A: C5H12 CTCT: CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. phản ứng đề hiđrohóa. B cùng công thức phân tử C5H12 tác dụng với Cl2 theo tỉ lệ mol 1:1 thì A chỉ tạo 1 dẫn xuất duy nhất còn B tạo 4 dẫn xuất. n-butan CH 2Cl − CH 2 − CH 2 − CH 3 + HCl as CH3-CH2-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 2 − CH 3 + HCl CH 2 = CH − CH 3 + CH 4  t 0C .5 Hai chất A. Ankan A có tỉ khối hơi so với H2 bằng 36.rawtube. CnH2n+2 as CnH2n+2 + Cl2  → CnH2n+1Cl + HCl Cn H 2 n + H 2 t 0C .html c. Viết các đồng phân và gọi tên theo danh pháp quốc tế các hợp chất ứng với công thức phân tử sau: C5H12 * C5H12 CH3-CH2-CH2-CH2-CH3 pentan CH3-CH(CH3)-CH2-CH3 2-metylbutan (isopentan) CH3-C(CH3)2-CH3 2. Viết phương trình phản ứng clo hóa (tỉ lệ 1 : 1). n−Hecxan → n−butan → etan → etylclorua. 5000 C .4. xt CH3-CH2-CH2-CH3  → CH2-CH3 + CH2=CH2 as CH3-CH3 + Cl2 → CH3-CH2Cl +HCl 1.com/videos/boss-fucks-employee-6591. xt CH3-CH2-CH2-CH3  → CH 2 = CH 2 + CH 3 − CH 3 CH = CH − CH − CH + H 2 3 2  2 http://www.2 dimetylpropan (neopentan) 1. xt CH3-CH2-CH3  → CH 2 = CH 2 + CH 4 b. CH 2Cl − CH (CH 3 ) − CH 2 − CH 2Cl + HCl CH Cl − CH (CH ) − CHCl − CH + HCl  2 3 3  as CH3-CH(CH3)-CH2-CH3 + Cl2 → CH 3 − CCl (CH 3 ) − CH 2 − CH 3 + HCl CH 2Cl − CH (CH 3 ) − CH 2 − CH 3 + HCl as CH3-C(CH3)2-CH3 + Cl2  → CH2Cl-C(CH3)2-CH3 + HCl 1. xt CH3-CH2-CH2-CH2-CH2-CH3  → CH3-CH2-CH2-CH3 + CH2=CH2 0 500 C . a. phản ứng nhiệt (cho biết sản nào được ưu tiên). B và các dẫn xuất clo của chúng.2 dimetylpropan (neopentan) . Dặt CTTQ của ankan A: Cn H 2 n + 2 (với n>0) MA d A/ H 2 = ⇒ M A = M H 2 . Propan + Cl2 CH 2Cl − CH 2 − CH 3 + HCl as CH3-CH2-CH3 + Cl2  → CH 3 − CHCl − CH 3 + HCl CH 2 = CH − CH 3 + H 2 t 0C .6 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a. xt CnH2n+2  (n1+ n2 =n) → Cn1 H 2 n1 + Cn 2 H 2 n 2+ 2 Câu 2.c. Viết công thức cấu tạo của A.

Đốt cháy hoàn toàn 1 lít ankan A sinh ra 3 lít CO2.6 mol H2O.100 = 25 ⇒ n = 1 %H= 14n + 2 CTPT của Y: CH4 f.8 = 44 =14n+2→n=3 0. Ankan Y có %H=25% . Các thể tích đo cùng điều kiện. Ankan X có %C= 80% . Đốt cháy hoàn toàn 1 ankan B với lượng O2 vừa đủ thì thấy tổng số mol các chất trước phản ứng bằng tổng số mol các chất sau phản ứng. Hóa hơi 12g ankan D thấy chiếm một thể tích bằng thể tích của 5g etan đo ở cùng điều kiện. Dặt CTTQ của ankan A: Cn H 2 n + 2 MD = Cn H 2 n + 2 + 1l (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3l 1 n = ⇒n=3 1 3 CTPT của A: C3H6 CTCT của A: CH3-CH2-CH3 b. Dặt CTTQ của ankan X: Cn H 2 n + 2 12n.2 mol 30 8. 6 = 0.7 Xác định công thức phân tử và viết công thức cấu tạo của các hiđrocacbon trong mỗi trường hợp sau : a. Dặt CTTQ của ankan D: Cn H 2 n + 2 Vhơi của D = Vhơi của etan →nD=nC2H6= 6 = 0. Dặt CTTQ của ankan A: Cn H 2 n + 2 Ta có : Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 1 + (3n+ 1) /2 = n + n + 1 → n= 1 CTPT của B: CH4 d. Đốt cháy hoàn toàn một hiđrocacbon Y thu được 17.100 = 80 ⇒ n = 2 %C= 14n + 2 CTPT của X: C2H6 CTCT của X: CH3-CH3 d.3n + 2 → n=2 Ta có : Cn H 2 n + 2 ( C3H7)n CTPT của B : C6H14 c. Công thức đơn giản nhất của B là C3H7. 2 CTPT của D: C3H6 CTCT của D: CH3-CH2-CH3 1. Dặt CTTQ của ankan Y: Cn H 2 n + 2 (2n + 2). Dặt CTTQ của ankan Y: Cn H 2 n + 2 nCO 2 = 17.b. ankan B có CTPT có dạng (C3H7)n → C3n H 7 n vì là ankan nên: 7n=2.6 g CO2 và 0. 4 mol 44 .

100 =. nH 2O = = = . 4  x = . Cho toàn bộ sản phẩm cháy vào dung dịch Ca(OH)2 dư sau phản ứng thấy khối lượng bình đựng Ca(OH)2 tăng lên 34. 4 M X . Đốt cháy hoàn toàn một hiđrocacbon Z thu được CO2 và H2O theo tỷ lệ Vco2 :Vhơi nước = 3 : 4...6 n n +1 = ⇒n=2 0.. Cho toàn bộ sản phẩm cháy lần lượt qua bình I đựng dd H2SO4đđ và bình II đựng dd Ca(OH)2 dư.... 4 = = = ...6 gam.. 4 g hhX   → sp (CO2 + H 2O)   → bình tăng 34..18=142x + 204y=34.44 + nH 2O ....100 mhh = ......100 mhh = .. nCO 2 = nCaCO3 = = = 18 .. = = M H2 2 1. Vì nH 2O > nCO2 → hiđrocacbon Z là ankan Ta có: Dặt CTTQ của ankan Z: Cn H 2 n + 2 Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 3 4 n n +1 = ⇒n=3 3 4 CTPT của Y: C3H8 CTCT của Y: CH3-CH2........ Tính % khối lượng mỗi khí trong hỗn hợp X và dX/H2 = ? C2 H 6 x mol + O2 Ca ( OH )2 du 7......CH3 1..... mH 2O . 7.... nhhX x + y ... Tính % khối lượng và % theo số mol mỗi khí trong hỗn hợp ban đầu. + ...6g= mCO2 + mH 2O = nCO2 .8 Đốt cháy hoàn toàn 7..9. H 2 SO4 dac   → bìănh I t ng 7....6g (2)  mC2 H 6 = 30 x + 42 y = 7. m 2 g= H 2O C3 H 8 x mol + O2 a g hhX   → sp (CO2 + H 2O)  Ca ( OH ) du 2 → bình II có 30 g ↓ =mCaCO3 = mCO2 C4 H10 y mol   mCaCO3 ........6 CTPT của Y: C2H6 CTCT của Y: CH3-CH3 e....... Đốt cháy hoàn toàn a gam hỗn hợp gồm etan và butan.44 + (3x + 4y).6g= mCO2 + mH 2 o C3 H 8 y mol mhh = mC2 H6 + mC3 H8 = 30 x + 42 y = 7.....4 0.Cn H 2 n + 2 + (3n+ 1) /2 O2 → nCO2 + (n + 1)H2O 0..100 = . ⇒ ⇒ từ (1) và (2) ta có hệ pt:  142 x + 204 y = 34..... 4 mhhX 7..18 = (2x + 3y). 4 7... 4 g (1) Ta có: C2H6 + 7/2O2 → 2 CO2 + 3H2O x 2x 3x C3H8 + 5 O2 → 3CO2 + 4 H2O y 3y 4y bình tăng 34....  mC3H8 = %mC2 H 6 = MX = mC2 H 6 .2 gam và bình II có 30 gam kết tủa.... 6  y = . 18 . %mC3 H8 = ⇒ d X / H2 = mC3 H8 . 4 0.... 7. C3H8 + 5O2 → 3 CO2 + 4H2O x 3x 4x ..........4 gam hỗn hợp X gồm etan và propan.. Sau thí nghiệm thấy khối lượng bình I tăng 7...

Tính khối lượng nước tạo thành và số mol O2 phản ứng.C4H10 + 13/2 O2 → 4CO2 + 5H2O y 4y 5y nH 2O = 4 x + 5 y = .8 − 15.5 1 = = n − 1 0.3..29 = 66..875..12 = . Hãy xác định 2 ankan đó và tính % theo khối lượng mỗi ankan.18 = 37..8 = 75..5. 2 mC = .8 mhhX + mO2 = mCO2 + mH 2O ⇒ mO2 = 57.5 M H2 Vậy hai ankan là liên tiếp trong dãy đồng đẳng là CH4 và C2H6 * nCH 4 nC2 H6 = 2 − n 0. Xác định ctpt của 2 parafin này và tính % mỗi chất về thể tích.2 = 23 = 14n + 2 ⇒ n = 1. Đốt cháy hoàn toàn 19.11 a) Hỗn hợp X gồm hai ankan có dX/H2 = 11. * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 MX d X / C2 H 4 = ⇒ M X = d X / H 2 .8 − 19.12.6 M C2 H 4 Vậy 2 ankan thể khí là CH4 và C2H4 * nCH 4 2 − n 0. 2 g ⇒ nH = 4. Nếu 2 ankan trên là đồng đẳng liên tiếp. 2 + 37.. 2 ⇒ nH 2O = 2. 6 %VC5 H12 = 60% → d) Một hỗn hợp 2 ankan thể khí ở đktc có tỉ khối đối với C2H4 bằng 0.. a. 6 = 4.2 mol ⇒ nH = nH 2O .5 1 → %VCH 4 = 50% %VC2 H6 = 50% c) Một hh 2 parafin kế cận trong dãy đồng đẳng có tỉ khối hơi đối với không khí bằng 2.2 g * Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 Cn H 2 n + 2 + 3n + 1 O2 → 2 nCO2 + ( n + 1) H 2O . nCO2 = 3x + 4 y = . ta có hệ pt: 1. Biết hai ankan là liên tiếp trong dãy đồìng đẳng. Xác định công thức phân tử và % thể tích hỗn hợp.28 = 24..2 gam CO2. b. mCO2 57.12 = 15.6 g 44 44 mH = 19.7 = 14n + 2 ⇒ n = 4..1mol ⇒ mH 2O = 2.M H 2 = 11. 4 = ⇒ %VC H = 40% 4 10 n − 4 0.8 gam hỗn hợp X gồm hai ankan sau phản ứng thu được 57.2 = 4.3.. * Đặt CT chung hh 2 parafin là: Cn H 2 n + 2 M d X / kk = X ⇒ M X = d X / kk .5 = 14n + 2 ⇒ n = 1..6 M kk Vậy hai parafin là kế cận trong dãy đồng đẳng là C4H10 và C5H12 * nC4 H10 nC5 H12 = 5 − n 0. 6 %VC2 H 6 = 60% 1.M C2 H 4 = 0.1.5. * Đặt CT chung hhX là: Cn H 2 n + 2 d X / H2 = MX ⇒ M X = d X / H 2 . 4 = = ⇒ %VCH = 40% 4 nC2 H6 n − 1 0.. Xác định hai ankan nói trên và tính % theo thể tích của hh X.875.M kk = 2..

Tìm công thức phân tử và % theo thể tích của hai hiđrocacbon này. 75 = = ⇒ %VCH = 75% %VC2 H 6 = 25% 4 nC2 H6 n − 1 0. Đốt cháy hoàn toàn a gam hỗn hợp hai đồng đẳng của các hiđrocacbon no.1 n n +1 = ⇒ n = 1. 67 0. Đốt cháy hoàn toàn m(g) hh X cho hỗn hợp sản phẩm khí và hơi sau phản ứng đi qua bình 1 đựng dung dịch H 2SO4đđ và bình 2 đựng dung dịch KOH thì khối lượng bình 1 tăng m1(g) và bình 2 tăng m2(g).357 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0.1 Vậy 2 ankan đồng đẳng liên tiếp là CH4 và C2H6 nCH 4 2 − n 0. Nếu m1 = 25. B trong hh X. a.1.16. Khi brom hóa 22 gam propan người ta thu được 33.6.82 gam. 67 mol 4 nC2 H6 n − 1 0. 25 Ta có: 1. Xác định công thức phân tử và % theo số mol của A.19*. 1.C).2 và m2 = 44. Nếu m1 = 32.4 và m2 = 61.13.948 gam isopropyl bromua và 2. Sau thí nghiệm khối lượng bình 1 tăng 6. Biết 2 hiđrocacbon đều là chất khí ở điều kiện thường. Lập công thức hai ankan. Đốt cháy V(lít) hỗn hợp hai ankan kế tiếp trong dãy đồng đẳng.3 2.4 gam một hỗn hợp 2 hiđrocacbon no mạch hở cần dùng 51.v.15. Đốt cháy một hỗn hợp gồm 2 hiđrocacbon đồng đẳng kế tiếp A. Tính thể tích khí CO2 ở (đktc) và khối lượng nước tạo thành. 1. B và tính m = ? Biết A. Hỗn hợp X gồm ankan A và B có khối lượng phân tử hơn kém nhau 28 (đ.357 mol 18 3n + 1 Cn H 2 n + 2 + O2 → 2 nH O = 2 nCO2 = 9. 43 = 0.18. b. 23 = = ⇒ % nCH = 0. a. 1. tính V (đkc).357 n n +1 = ⇒ n = 1.17. 223 mol 44 nCO2 0.8 gam.952 gam n-propyl bromua. 43gam= m Cn H 2 n + 2 H 2O + O2 V (l ) hhX   → sp (CO2 + H 2O)  dung dich KOH g= = CO2 Cn +1 H 2( n +1) + 2  → bìănh 2 t ng 9. Tính hiệu suất từng sản phẩm và hiệu suất chung của phản ứng.223 0. Dẫn sản phẩm lần lượt qua bình 1 đựng CaCl2 khan rồi bình 2 đựng dung dịch KOH.2 gam hỗn hợp 2 ankan kế tiếp nhau trong dãy đồng đẳng. 1.3 2. tính m? b. Tính khối lượng CO2 và H2O tạo thành và tìm ctpt của 2 ankan.43gam và bình 2 tăng 9. . 1. Xác định ctpt và tính % theo thể tích mỗi hiđrocacbon trong hh. 67 Ta có: 1. Xác định công thức phân tử của A.25 1.223 + ( n + 1) H 2O 0. b.52 lít oxi (đktc).14. Đốt cháy hoàn toàn 29. Đốt cháy 20.82 = 0. B thu được CO 2 và H2O theo tỉ lệ số mol lần lượt là 11 : 14. B đều là chất khí ở đkt.82 m Đặt CT chung hỗn hợp 2 ankan thể khí là: Cn H 2 n + 2 6. CaCl2 khan   → bìănh 1 t ng 6. Tính % theo số mol các ankan trong hỗn hợp. a. Hấp thụ toàn bộ sản phẩm vào bình Ba(OH)2 thấy khối lượng bình tăng 134. mạch hở có thành phần hơn kém nhau k nguyên tử cacbon thì thu được b gam CO2.23 mol % nC2 H 6 = 0.

b. . Xác định công thức phân tử và viết công thức cấu tạo các đồng phân của A.a. c. Tìm công thức của các hiđrocacbon và tính % theo khối lượng của chúng trong hỗn hợp. b = 8. Tìm khoảng xác định của số nguyên tử C trong hiđrocacbon theo a. k. Tính thành phần % về thể tích của A và oxi trong hỗn hợp X. a.20** Một hỗn hợp X gồm hiđrocacbon (A) và O2 dư đem đốt cháy hoàn toàn thu sản phẩm làm lạnh thì thể tích giảm 50 %. Nếu cho khí còn lại qua KOH dư thể tích giảm đi 83. 1. b. Đồng phân nào của A khi phản ứng thế với Cl2 cho một sản phẩm duy nhất.3 % số còn lại. b.36 (g) và k = 2.72 (g) . Cho a = 2.