BAØI TAÄP PHAÛN ÖÙNG OXI HOÙA-KHÖÛ 1.

BAØI TAÄP XAÙC ÑÒNH SOÁ OXI HOAÙ Baøi 1: Xaùc ñònh soá oxi hoaù cuûa caùc nguyeân toá trong caùc hôïp chaát, ion sau: N : NH3 , NH4+, H2N-NH2 (hidrazin), NH2OH (hidroxylamin), NO2-, NO3O : H2O, O2- (ion oxit), H2O2 , O22- (ion peoxit) P : H3P, H3PO3 , H3PO4, HPO42- , PO43-, P4O6 , P4O10 , POCl3 , H4P2O7 S : H2S, S2-, S2O32- , S4O6 , SO32- , SO42Mn : Mn2+, Mn(OH)2 , MnO2 , MnO42-, MnO4-, Mn2(CO)10, CH3Mn(CO)5 Cr: Cr2+ , Cr3+ , Cr(OH)3, CrO2- , Cr2O72-, CrO42Fe: Fe2+, Fe(OH)2, Fe3+, Fe(OH)3, Fe(H2O)3(OH)3, [Fe(CN)4]2-, Fe(CO)5, Fe(CO)4 Cu : Cu+, Cu2O, CuCl, CuCl2, Cu(NH3)2+, Cu2+, CuO, Cu(NH3)42+ Ag : AgCl, AgBr, AgI, Ag(NH3)+ Pt : Pt(NH3)42+, PtCl62Au : Au+, Au3+, Au(CN)4Hg : Hg22+ , Hg2Cl2, Hg2SO4, Hg2+, HgO U : UO2+, UO22+, U3+, U4+ Zn : Zn(H2O)2(OH)2, Zn(H2O)(OH)3C : CH3OH, HCHO, HCCOH, C6H12O6, C6H5OH, C6H5NO2, C6H5CH=CH2 Co : Co2(CO)9, HCo(CO)4 Ni : Ni(CO)4 Baøi 2: Xaùc ñònh soá oxi hoaù cuûa caùc nguyeân toá in nghieâng trong caùc hôïp chaát sau:

Baøi 3: Xaùc ñònh soá oxi hoaù cuûa caùc nguyeân toá in nghieâng trong caùc hôïp chaát sau: 2. BAØI TAÄP CAÂN BAÈNG PHAÛN ÖÙNG OXI HOAÙ-KHÖÛ Baøi 1: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau theo phöông phaùp thaêng baèng e: Al + HNO3 --> Al(NO3)3 +NH4NO3 +H2O Fe(OH)2 + HNO3 --> Fe(NO3)3 +NO2 +H2O Mg + HNO3 --> Mg(NO3)2 +N2 +H2O FeCl2 + HNO3 --> Fe(NO3)3 +FeCl3+NO+H2O FeO + HNO3 --> Fe(NO3)3 +NO2 +H2O Mg + HNO3 --> Mg(NO3)2 +NO +H2O Fe + HNO3 --> Fe(NO3)3 +NO2 +H2O Fe3O4 + HNO3 --> Fe(NO3)3 +NO2 +H2O Baøi 2: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau: Cu2SFeS2+HNO3 --> CuSO4+Cu(NO3)2+Fe2(SO4)3+NO2+H2O HNO2 --> HNO3 + NO + H2O K2MnO4+H2O --> KMnO4 + MnO2 + KOH

H2O2 --> H2O + O2 KClO3 --> KClO4 + KCl CrO --> Cr2O3 + Cr CuCl (huyeàn phuø) --> Cu + CuCl2 HIO --> HIO3 +I2+H2O I2+NaOH (loaõng) --> NaI + NaIO + H2O I2+NaOH(noùng) --> NaI + NaIO3 + H2O NaClO --> NaCl+NaClO3 Cl2O --> Cl2+ClO2 ClO2 --> ClO3+Cl2 Na2SO3 --> Na2S +Na2SO4 Na2S2O3 --> Na2SO3+S KOH+Cl2 --> KCl+KClO4+H2O Baøi 5: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau: NH4NO2 --> N2+H2O NH4NO3 --> N2O+H2O S+H2SO4 --> SO2+H2O Fe+FeCl3 --> FeCl2 C+CO2 --> CO KBrO3 +KBr+H2SO4 --> K2SO4+Br2+H2O Baøi 6: Hoaøn thaønh vaø caân baèng caùc phaûn öùng oxi hoaù-khöû sau: FeO + HNO3(l) --> Fe(NO3)3 + NxOy + H2O FexOy + HNO3 --> Fe(NO3)3 + NaOb + H2O Fe + HNO3 --> Fe(NO3)3 + NxOy + H2O FexOy + CO --> Fe+CO2 Cu2FeSx + O2 --> Cu2O+Fe3O4 +… Baøi 7: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau: Fe + HNO3 --> Fe(NO3)3 + NO + NO2 + H2O (VNO=2VNO2) Al + HNO3 --> Al(NO3)3 + NO + NH4NO3 + H2O (nNO=nNH4NO3) Zn + H2SO4(ñ) --> ZnSO4 + S + SO2 + H2O (nS=nSO2) NH3 + KClO3 --> KNO3 + KCl + Cl2 + H2O (nKCl=nCl2) Mg +HNO3 --> Mg(NO3)2 + NO2 + NO +H2O (VNO2=VNO) Baøi 8: Caân baèng phaûn öùng oxi hoaù-khöû sau: KClO3+NH3 --> KNO3+KCl+Cl2+H2O NH3+NaClO --> NaNO3 +Cl2 +NaCl+H2O KClO+N2H4 --> KNO2+Cl2+ KCl+H2 Baøi 9: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau: CH2=CH2 + KMnO4 + H2SO4 --> CO2+MnSO4+K2SO4+H2O CH3CH=CH2+KMnO4+H2O --> CH3CHOHCH2OH+K2SO4+MnSO4+H2O CH3CH2OH+KMnO4+H2SO4 --> CH3COOH+K2SO4+MnSO4+H2O C2H2 +KMnO4 +H2O --> H2C2O4+KOH+MnO2 C6H5CH3 +KMnO4 + H2SO4 --> C6H5COOH +MnSO4+K2SO4 +H2O HOOC-COOH+KMnO4+H2SO4 -->CO2+K2SO4+MnSO4+H2O C6H5CH2CH3+KMnO4+H2SO4 --> C6H5COOH+CO2+K2SO4+MnSO4+H2O H2C2O4 +KMnO4 +H2SO4 --> CO2+K2SO4+MnSO4+H2O C2H5OH+K2Cr2O7 +H2SO4 --> CO2 + K2SO4+Cr2(SO4 )3+H2O CaC2O4 +KMnO4+H2SO4 --> CaSO4 +CO2 +K2SO4 +MnSO4+H2O C12H22O11 +H2SO4 --> CO2 +SO2 +H2O C3H5O9N3 --> CO2+H2O+N2+O2 Baøi 10: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau theo phöông .

+… Baøi 13: Hoaøn thaønh vaø caân baèng phaûn öùng oxi hoaù-khöû sau trong moâi tröôøng bazô: NO3.+ O3 +… H3AsO4 + I.+IO3.+ I.--> IO4.+ Br.+… --> MnO42.+ H2O --> …+ I2 +… Baøi 12: Hoaøn thaønh vaø caân baèng phaûn öùng oxi hoaù-khöû sau trong moâi tröôøng axit: ClO4.+ S4O62Bi(OH)3 + SnO22.+ I.+… --> NO2.+ Cl.+ … .+… --> I2 +… NO3.+… --> Cr3+ + Br2 + … Cr3+ + Cl2(k) +… --> Cr2O72.phaùp thaêng baèng ion-electron: KMnO4 + FeSO4 + H2SO4 --> Fe2(SO4)3 + MnSO4 + K2SO4 + H2O KMnO4 +KNO2 + H2SO4 -->KNO3 + MnSO4 + K2SO4 + H2O KMnO4 + K2SO3 + H2SO4 --> MnSO4 + K2SO4 + H2O KMnO4 + NaCl + H2SO4 --> MnSO4 + Cl2 + Na2SO4 + K2SO4 + H2O KMnO4 + HCl --> MnCl2 + Cl2 + KCl + H2O KMnO4 + PH3 + H2SO4 --> MnSO4 + H3PO4 + K2SO4 + H2O KMnO4 + Zn + H2SO4 --> MnSO4 + ZnSO4 + K2SO4 + H2O KMnO4 + K2SO3 + H2O --> MnO2 + K2SO4 + KOH KMnO4 + MnSO4 + H2O --> MnO2 + K2SO4 + H2SO4 KMnO4 + H2O2 --> MnO2 + O2 + KOH + H2O KMnO4 + K2SO3 + KOH --> K2MnO4 + K2SO4 + H2O KMnO4 + FeS + H2SO4 --> Fe2(SO4)3 + MnSO4 + K2SO4 + H2O KMnO4 +FeS2 + H2SO4 --> Fe2(SO4)3 + MnSO4 + K2SO4 + H2O KMnO4 +CuFeS2 +H2SO4 --> Fe2(SO4)3 +MnSO4 +CuSO4+K2SO4 + H2O K2Cr2O7 + FeSO4 +H2SO4 --> Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H2O K2Cr2O7 + K2SO3 + H2SO4 --> Cr2(SO4)3 + K2SO4 + H2O K2Cr2O7 + KI + H2SO4 --> Cr2(SO4)3 + I2 + K2SO4 + H2O K2Cr2O7 + H2S + H2SO4 --> Cr2(SO4)3 + S + K2SO4 + H2O K2Cr2O7 + HBr --> CrBr3 + Br2 + KBr + H2O K2Cr2O7 + HCl --> CrCl3 + Cl2 + KCl + H2O K2Cr2O7 + SnCl2 +HCl --> CrCl3 + SnCl4 + KCl + H2O K2CrO4 +(NH4)2S + H2O --> Cr(OH)3 + S + NH3 + KOH Baøi 11: Hoaøn thaønh vaø caân baèng caùc phaûn öùng oxi hoaù-khöû sau theo phöông phaùp thaêng baèng ion-eletron: I2 + --> I.+S +… MnO4.+ Al +… --> NH3 + Al3+ +… F2 + H2O --> F.+S2.+OH.+… --> HIO + ClH3AsO4 + H2C2O4 --> CO2 + HAsO2 + … Cr2O72.--> Bi + SnO32.+ H2O Cl2+I.+ CH3OH +… -->Cr3+ + HCOOH +… PbO2 + H2O2 +… --> O2 + Pb2+ + … Sb2O5 + H2S +… --> S + SbO+ +… IO3.+ I.+… --> HAsO2 + I2 +… Cr2O72.+… OCl-+ I.

(moâi tröôøng trung tính) MnO4.+… Baøi 14: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau: K2[Pt(NO2)4].nguoäi) --> PtO2+O2+KF+H2O (NH4)2[PtCl6] --> Pt(boät)+NH4Cl+Cl2 (NH4)2[PtCl6] --> Pt+NH4Cl+HCl+N2 K2[PtCl6]+KNO2+H2O --> K2[Pt(NO2)4]+KNO3+KCl+HCl H2[PtCl4]+N2H4.ClO.--> I2+NO (moâi tröôøng axit) Au+CN.2H2O --> KNO2+Pt+NO2+H2O K[PtF6]+H2 --> Pt+KF+HF K[PtF6] --> PtF4+F2+KF K[PtF6] +H2O --> PtO2+K2[PtF6]+O2+HF K[PtF6] +HCl(ñ) --> H2[PtF6]+Cl2+KCl K[PtF6]+KOH(ñ.(moâi tröôøng kieàm) .+… IO3.+Fe(OH)2+… -->Cl.+Cr(OH)3+ … --> CrO42.+ Fe(OH)3 BrO3.+O2 --> Au(CN)4.--> MnO42.+C +… --> CO32.--> O2 + I.+IO3.H2O --> Pt+NH4Cl+H2O+N2 H2[PtCl4]+HCl+KMnO4 --> H2[PtCl6]+MnCl2+H2O K2[Pt(CN)4] --> KCN+Pt+C2N2 K[Pt(C2H4)Cl3]+H2 --> Pt+C2H6+KCl+HCl RuO4+H2O2(l) --> RuO2+O2+H2O NiS+CO --> Ni+CO2+CS2 NiSO4+NaClO+NaOH(l) -->NiO(OH)+NaCl+Na2SO4+H2O Ni(NO3)2+NaOH(ñ)+Br2 --> NiO(OH)+NaNO3+NaBr+H2O CoCl2+NaNO2+CH3COOH --> Na3[Co(NO2)6]+ NaCl+Na(CH3COO)+ NO +H2O CoF3+N2O5 --> Co(NO3)3+NF3+O2 K2FeO4+H2SO4(l) --> Fe2(SO4)3+O2+K2SO4+H2O K2FeO4 --> K3FeO4+KFeO2+O2 Fe+SO2(aåm) --> FeSO3+FeSO3S NH4ReO4 --> ReO2+N2+H2O ReF6+NaOH(l) --> NaReO4+ReO2+NaF+H2O Tc2O7+CCl4 --> TcCl4+CCl2O+Cl2 K2MnO4 --> K3MnO4+MnO2+O2 (nK3MnO4=2nMnO2) K2MnO4+H2O --> KMnO4+MnO2+KOH K2MnO4+K2S2O6(O2) --> KMnO4+K2SO4 KMnO4 --> K2MnO4+MnO2+O2 KMnO4 --> K3MnO4+MnO2+O2 (nMnO2=2nK3MnO4) MnSO4+HNO3+NaBiO3 --> HMnO4+Bi(NO3)3+Na2SO4+NaNO3+H2O K2Cr2O7+C --> Cr2O3+K2CO3+CO W+HF+HNO3(ñ) --> H2[WO2F4]+NO+H2O SnO2+KNCS --> SnS+CO+N2+K2S CuS+HNO3 --> Cu(NO3)2+S+NO+H2O As2S3+HNO3 --> H3AsO4+H2SO4+NO2+H2O HgS+HCl+HNO3 --> HgCl2+NO+H2SO4+H2O Baøi 15 : Hoaøn thaønh vaø caân baèng phaûn öùng oxi hoaù-khöû sau: I-+NO2.+… ClO4.+O2 (moâi tröôøng kieàm) P --> PH3 + H2PO2.+ I.+Cl2 +… HO2.+I2 +… --> IO3.H2O+NH3.+BrO.

(NH4)2Cr2O7. Ca(NO3)2. NH4NO3. AgNO3. NH4NO2. Baøi 21: Döïa vaøo caùc giaù trò nhieät ñoäng tra ôû caùc baûng haõy döï ñoaùn saûn phaåm vaø caân baèng caùc phöông trình hoaù hoïc sau: a) Ti(r) + HF(dd)+ HNO3(dd) --> b) Ti(r) + HF(dd) --> c) Ti(r) + NaOH(ñaäm ñaëc)+ H2O --> d) Ti(r) + Cl2(k) --> . Cu(NO3)2.Zn +As2O3 --> AsH3+Zn2+ (moâi tröôøng axit) V --> HV6O173.noùng) --> b) KClO3(r)+S(r) --> c) NH4ClO4+P --> d) KClO3+P(r) --> e) Na2SO3(dd)+S --> f) Na2S(dd)+S --> g) Na2SO4(r)+C Baøi 19: Haõy döï ñoaùn saûn phaåm vaø caân baèng caùc phöông trình hoaù hoïc sau: a) Na2S2O3(dd) + I2(dd) --> b) Na2S2O3(dd) + Cl2(dd) --> c) H2SeO4(dd) + HCl(dd) --> d) SO2(k) + Cl2(k) --> e) H2S(k) + FeCl3(dd) --> f) Na2SO3(dd) + KI(dd) --> Baøi 20: Vieát phöông trình hoaù hoïc phaân huyû nhieät cuûa caùc muoái sau ñaây: KNO3.+H2 (moâi tröôøng kieàm) Baøi 16: Caân baèng caùc phaûn öùng oxi hoaù-khöû sau: HClO3 + HCl --> Cl2+ClO2+H2O (nCl2=nClO2) KMnO4 + SO2+ H2O --> MnSO4+ K2SO4+ H2SO4 HI+HNO3 --> I2+NO+ H2O NH3+NaOCl --> N2H4+NaCl+ H2O KCN+KMnO4+H2O --> KCNO+MnO2+KOH CrCl3+NaOCl+NaOH -->Na2CrO4+NaCl+H2O Baøi 17: Haõy döï ñoaùn saûn phaåm vaø caân baèng caùc phöông trình hoaù hoïc sau theo phöông phaùp thaêng baèng e hay thaêng baèng ionelectron (neáu coù): a) H2O2+K2Cr2O7+H2SO4 -->Cr2(SO4)3+… b) CrCl3+H2O2+NaOH --> Na2CrO4+… c) H2O2+HIO3 --> I2+… d) H2O2+KI+H2SO4(l) --> I2+… e) HClO3+FeSO4 +H2SO4 --> FeCl3+Cl2+… Baøi 18: Haõy döï ñoaùn saûn phaåm vaø caân baèng caùc phöông trình hoaù hoïc sau: a) KClO3+H2SO4(ñ. Pb(NO3)2. Hg(NO3)2.

D vaø vò trí cuûa A. Tyû leä soá nguyeân töû cuûa moãi nguyeân toá laø 2:3:4. Phaân töû A chöùa 9 nguyeân töû. trong ñoù soá haït mang ñieän nhieàu hôn soá haït khoâng mang ñieän laø 36.--> d) C2H5OH(dd)+K2Cr2O7(dd)+H2SO4 --> e) Cr3++ Br2 +OH.laø 23. goàm 3 nguyeân toá phikim. B cuøng moät phaân nhoùm chính vaø ôû 2 chu kyø kieân tieáp trong baûng tuaàn hoaøn.e) TiCl3(dd) + HCl(dd)+O2+ H2O --> f) TiCl3(dd) + FeCl3(dd) --> g) Ti(r) + HCl(ñ) --> h) TiO2(r) + C(r) + Cl2(k) --> Baøi 22: Haõy döï ñoaùn saûn phaåm vaø caân baèng caùc phöông trình hoaù hoïc sau: a) CrO3+HI(dd) I2 +… --> b) NaCrO2(dd)+KMnO4(dd) --> c) Cr3+ + MnO4.chöùa 2 nguyeân toá cuøng chu kyø. Vieát caáu hình electron cuûa nguyeân töû nguyeân toá A. D laø 2 nguyeân toá keá caän nhau trong 1 chu kyø. Toång soá haït trong A laø 116. B. D (ZA < ZB < ZC). Xaùc ñònh coâng thöùc hoaù hoïc vaø goïi teân A. B. B. Xaùc ñònh vò trí cuûa A trong baûng heä thoáng tuaàn hoaøn. n. Khoái löôïng nguyeân töû X lôùn hôn M laø 9. Toång soá proton trong A laø 42 vaø trong ion Y.A. thuoäc hai phaân nhoùn chính lieân tieáp. Trong phaân töû M2X coù toång soá haït p.B. a)Vieát caáu hình electron caùc ion M+ vaø X2-. b)Xaùc ñònh vò trí cuûa M vaø X trong baûng tuaàn tuaàn hoaøn. trong ñoù soá haït mang ñieän gaáp hai laàn soá haït khoâng mang ñieän. Soá khoái cuûa ion M+ lôùn hôn soá khoái cuûa ion X2.laø 31. electron laø 48. D trong baûng heä thoáng tuaàn hoaøn. Trong ñoù soá haït mang ñieän nhieàu hôn soá haït khoâng mang ñieän laø 44 haït. e laø 140. . Toång soá haït trong ion M+ nhieàu hôn trong ion X2. . .+ OH. * Baøi 5: Hôïp chaát A coù coâng thöùc phaân töû M2X. * Baøi 2: Cho 3 nguyeân toá A.Toång soá proton trong 2 haït nhaân A. nôtron. B laø 24.--> BAØI TAÄP CHÖÔNG 1: NGUYEÂN TÖÛ * Baøi 1: Nguyeân töû cuûa moät nguyeân toá A coù toång soá haït proton. Xaùc ñònh A. Toång soá 3 . * Baøi 4: Hôïp chaát A ñöôïc taïo thaønh töø cation X+ vaø anion Y-. * Baøi 3: Moät hôïp chaát caáu taïo töø cation M+ vaø anion X2-.

b) Cho 2. a) Xaùc ñònh M. ZB. Cho bieát X ñöôïc hình thaønh baèng lieân keát gì? * Baøi 7: a) Trong moät nguyeân töû trung hoaø ñieän coù 6 electron.loaïi haït trong X2. * Baøi 8: Moät nguyeân töû khi maát bôùt electron bieán thaønh ion döông. vaø khoái löôïng cuûa nguyeân töû ñoù. C. l = 1. Toång soá proton trong MX2 laø 58. nôtron. b)Trong moät nguyeân töû. b) Vieát caáu hình electrpn cuûa nguyeân töû vaø cuûa ion R2– . Trong haït nhaân M coù n . X coù tính daãn ñieän. X. Xaùc ñònh nguyeân töû löông M’. electron baèng 24. Haõy xaùc ñònh M. khoái löôïng haït nhaân laø 27 ñvC.p=4. giaûi thích söï khaùc nhau giöõa caùc traïng thaùi naøy. Tri tuyeät ñoái cuûa ñieän tích ion baèng ñuùng soá electron maø nguyeân töû maát ñi hay nhaän theâm.37 soá nguyeân töû cuûa ñoàng vò Z. B c) Xaùc ñònh traïng thaùi vaät lyù cuûa hôïp chaát vôùi Hiñroâ cuûa A. X laø phi kim chu kyø 3. nôtron.34g hôïp chaát A taùc duïng vôùi dd M’(NO3)2 thu 2. Khi nhaän theâm electron bieán thaønh ion aâm. Z. Haõy vieát kyù hieäu haït nhaân cuûa hai ion ñoù. Bieát toång soá khoái laø 128. soá electron trong ion R4+ baèng 10. m = 0. toång soá haït mang ñieän laø 26. M laø moät kim loaïi. Cho hai ion R4+ vaø R4–. d) Hôïp chaát X taïo bôûi 3 nguyeân toá A. e) ÔÛ traïng thaùi loûng.8662g keát tuûa B. Tyû soá ( ZA + ZC ) / ZB = 3 Nguyeân töû C coù electron cuoái cuøng öùng vôùi boä 4 soá löôïng töû: n = 3.nhieàu hôn trong M+ laø 17. Xaùc ñònh soá khoái cuûa Y. Soá nôtron trong hai ion naøy ñeàu baèng 14. Vieát coâng thöùc caáu taïo cuûa X vaø goïi teân X. * Baøi 9: Moät nguyeân töû kí hieäu laø R coù toång soá caùc haït proton. mS = . .X vaø vò trí cuûa chuùng trong baûng heä thoáng tuaàn hoaøn. Z. trong haït nhaân cuûa X coù n’=p’. soá nguyeân töû cuûa ñoàng vò Y baèng 0. Tính soá proton.½ a) Vieát caáu hình electron cuûa C. Nguyeân toá M’ coù 2 ñoàng vò Y. Tính soá electron trong nguyeân töû trung hoaø ñieän R vaø trong ion R4–. B. nôtron trong nguyeân töû ñoù. Suy ra nguyeân toá A. Tính soá proton. C coù coâng thöùc ABC. * Baøi 6: Moät hôïp chaát A coù coâng thöùc MX2.67% veà khoái löôïng. B . khoái löôïng nguyeân töû baèng 12 ñvC. a) Vieát kyù hieäu haït nhaân cuûa nguyeân toá vaø goïi teân nguyeân toá ñoù. trong ñoù M chieám 46. Xaùc ñònh vò trí cuûa C trong baûng heä thoáng tuaàn hoaøn töø ñoùsuy ra nguyeân toá C b) Tính ZA.

* Baøi 10: Cho hai nguyeân töû A vaø A’ coù soá khoái laàn löôït baèng 79 vaø 81. Toång soá haït trong haït nhaân X lôùn hôn toång soá haït trong . Trong ñoù toång haït mang ñieän lôùn hôn toång soá haït khoâng mang ñieän laø 16 . Toång p . Neáu laø moät nguyeân toá thì nguyeân toá ñoù chieám vò trí naøo trong baûng HTTH? * Baøi 11: Cho hôïp chaát coù daïng MX . e trong MX laø 96. Toång soá haït trong X lôùn hôn toång soá haït trong M laø 18. M laø kim loaïi X laø phi kim .thì taäp hôïp caùc nguyeân töû thu ñöôïc coù khoái löôïng nguyeân töû trung bình baèng bao nhieâu? c) Taäp hôïp caùc nguyeân töû ñoù coù phaûi laø moät nguyeân toá hoaù hoïc hay khoâng.c) Cho bieát trong nguyeân töû ñoù coù bao nhieâu obital coù electron chieám giöõ. Hieäu soá giöõa soá nôtron vaø soá electron trong nguyeân töû A laø 9 coøn trong nguyeân töû B laø 11 a) Cho bieát A vaø A’ coù phaûi laø ñoàng vò vôùi nhau hay khoâng? b) Neáu troân laàn hai loaïi nguyeân töû A vaø A’ theo tyû leä laø: ………. n .

Sign up to vote on this title
UsefulNot useful