PHẢN ỨNG TÁCH NƯỚC CỦA RƯỢU ĐƠN CHỨC

Câu 1: Đun nóng một ancol no, đơn chức X với H2SO4 đặc ở nhiệt độ thích hợp thu được
chất hữu cơ Y. Tỉ khối hơi của Y so với X là 0,7. CTPT của X là
A. C2H5OH.
B. C3H7OH.
C. C4H9OH.
D.
C5H11OH.
Câu 2: Thực hiện phản ứng tách nước hỗn hợp X gồm ba rượu với H2SO4đặc ở 1700C,
thu được sản phẩm chỉ gồm hai anken và nước. Hỗn hợp X gồm
A. ba rượu no, đơn chức
B. ba rượu no, đơn chức trong đó có hai rượu là đồng phân.
C. hai rượu đồng phân và một rượu là CH3OH.
D. ba rượu no đa chức.
Câu 3: Cho hỗn hợp A gồm hai rượu no, đơn chức là đồng đẳng liên tiếp tách H2O
(H2SO4 đặc, 1400C ) thu được ba ete. Trong đó có một ete có khối lượng phân tử bằng
khối lượng phân tử của một trong hai rượu. A gồm
A. CH3OH.và C2H5OH.
B. C2H5OH và C3H7OH.
C. C2H5OH và C4H9OH.
D. C3H7OH và C4H9OH.
Câu 4: Đun nóng 15,2 gam hỗn hợp 2 rượu no đơn chức, là đồng đẳng kế tiếp với
H2SO4 đặc ở 140OC, thu được 12,5 gam hỗn hợp 3 ete (h = 100%). Công thức của 2 rượu

A. C3H7OH và C4H9OH.
B. CH3OH và C2H5OH.
C. C2H5OH và C3H7OH.
D. CH3OH và C3H7OH.
Câu 5: Thực hiện phản ứng tách nước một ancol no đơn chức X với H2SO4 đặc ở nhiệt độ
thích hợp, thu được chất hữu cơ Y. Tỉ khối hơi của Y so với X là 1,4375. Công thức của
X là
A. C2H5OH.
B. C3H7OH.
C. CH3OH.
D. C4H9OH.
Câu 6: Chia 27,6 gam hỗn hợp 3 ancol đơn chức thành 2 phần bằng nhau. Phần 1 cho tác
dụng hết với Na, thu được 3,36 lít khí H2 (đktc). Phần 2 tách nước thu được m gam hỗn
hợp 6 ete (h=100%). Giá trị của m là
A. 24,9.
B. 11,1.
C. 8,4.
D. 22,2.
Câu 7: Chia hỗn hợp 2 rượu no đơn chức thành 2 phần bằng nhau. Đốt cháy hoàn toàn
phần 1, thu được 2,24 lít khí CO2 (đktc). Phần 2 tách nước hoàn toàn thu được 2 anken.
Số gam H2O tạo thành khi đốt cháy hoàn toàn 2 anken trên là.
A. 3,6.
B. 2,4.
C. 1,8.
D. 1,2.
Câu 8: Đốt cháy hoàn toàn hỗn hợp X gồm 2 ancol (rượu) đơn chức, thuộc cùng dãy
đồng đẳng, thu được 13,2 gam CO2 và 8,28 gam H2O. Nếu cho X tách nước tạo ete
(h=100%) thì khối lượng 3 ete thu được là
A. 42,81.
B. 5,64.
C. 4,20.
D.
70,50.

propan-1-ol và butan-1-ol. B. D. 15. C. Câu 11: Đun nóng 12. C. Tên gọi của 2 rượu trong X là A. B. D.44. Câu 15: Cho m gam hỗn hợp 2 rượu no. 2 và 3 nguyên tử cacbon tách nước thì số lượng ete tối đa thu được là A.Câu 9: Cho 15. Câu 10: Đun nóng một ancol đơn chức X với H2SO4 đặc ở nhiệt độ thích hợp thu được chất hữu cơ Y và nước. etanol và propan-2-ol. etanol và propan-1-ol. C3H7OH C. 6.2 gam.609.2.4. CH3OH. 10. C. etanol và propan-1-ol. Các sản phẩm đều là sản phẩm chính. D. 3. rồi lấy anken thu được tác dụng với nước (xúc tác axit) thì thu được ancol (rượu) X. C.7. D. Giá trị của m là A. C.4 gam CH3OH và 13. . B. B. butan-1-ol và propan-1-ol. là đồng đẳng kế tiếp tác dụng với Na dư thu được 1. B. là đồng đẳng kế tiếp trong H2SO4 đặc ở 140oC thu được 10. Các phản ứng xảy ra hoàn toàn. etanol. đơn chức. C. 11. Tỉ khối hơi của Y so với X là 1. 3-metylbutan-1-ol. butan-1-ol và butan-2-ol.65 gam hỗn hợp Y gồm 3 ete (h = 100%). metanol.5 gam hỗn hợp 3 ete (h=100%). 2-metylbutan-2-ol. Tên gọi của X là A. 10. pentan-1-ol và butan-1-ol. D. bậc 1. Câu 12: Cho 3-metylbutan-2-ol tách nước ở điều kiện thích hợp. propan-2-ol. nếu tách nước để tạo ete (h = 100%) thì số gam ete thu được là A. 2 atm.96.4. D. metanol và etanol. Biết hiệu suất phản ứng của CH3OH và C2H5OH tương ứng là 50% và 60%. 3-metylbutan-2-ol.9 gam hỗn hợp 6 ete có số mol bằng nhau. B. propan-1-ol và butan-1-ol. Mặt khác cũng đun m gam hỗn hợp trên ở 140oC với H2SO4 đặc thu được 12. 14. Mặt khác.48. 2-metylbutan-3-ol. 12. Câu 13: Đun nóng hỗn hợp X gồm 6. 12. Công thức của X là A. Câu 14: Cho hỗn hợp X gồm các rượu no đơn chức chứa 1. B. thu được m gam hỗn hợp 3 ete. đơn chức.6 gam hỗn hợp X gồm 3 rượu no đơn chức với H2SO4 đặc ở 140oC thu được 13.90 gam hỗn hợp X gồm 2 rượu no. D. propan-2-ol và propan-1ol.6 gam hỗn hợp 2 ancol đơn chức qua bình đựng Na (dư) thấy khối lượng bình tăng 15. Cũng lượng hỗn hợp trên. 8. B. bậc 1.68 lít khí ở 0oC. D.8 gam C2H5OH với H2SO4đặc ở 140oC.0. đun nóng X với H2SO4 đặc ở 180oC thu được sản phẩm chỉ gồm 2 olefin và nước. etanol và propan-1-ol. Tên gọi 2 rượu trong X là A. Câu 16: Đun nóng 16. 9. C. Tên gọi của 3 rượu trong X là A. C2H5OH. C3H5OH. metanol và etanol. etanol. 8.

Nếu cho lượng X ở trên tách nước tạo ete (h=100%) thì số gam ete thu được là A. Câu 20: Đốt cháy hoàn toàn một ancol đơn chức X thu được 4.3-đimetylpentan-2-ol với H2SO4 đặc.20. 13. CH3-CH=C(CH3)-CH(CH3)2. D. Câu 18: Đốt cháy hoàn toàn 20. B.5 gam chất rắn. đun nóng 8. là đồng đẳng kế tiếp đun nóng với H2SO4 đặc ở 140OC thu được 7. C.72.25. (CH3)2C=C(CH3)-CH2-CH3. thì thu được m gam hỗn hợp 6 ete.3. 14.6. 12.1. 6. C. thu được 42.6 gam H2O. 8. C.Câu 17: Cho 0.90. CH3CH(CH3)CH2OH. B. C.5 gam gam hỗn hợp X gồm 3 rượu đơn chức tác dụng hết với Na.6 gam X tách nước tạo ete (h = 100%) thì số gam ete thu được là A.84. thu được sản phẩm chính là A. kế tiếp nhau trong dãy đồng đẳng tác dụng hết với 9. 1700C. B. Mặt khác. CH3CH(OH)CH2CH3. D. CH3OCH2CH2CH3. Tên gọi của 2 rượu trong X là A. C.2. 3.7. 5. pentan-1-ol và butan-1-ol. 6.4 mol hỗn hợp X gồm 2 rượu no.24 gam CO2 và 24.28 gam H2O. . 2. Câu 19: Cho 8. Câu 24: Đun nóng 2. Nếu cho 15.64 gam hỗn hợp X gồm 3 rượu đơn chức. thì thu được m gam hỗn hợp 6 ete.64 gam hỗn hợp X với H2SO4 đặc ở 140oC (với hiệu suất phản ứng của mỗi rượu là 50%). Câu 22 (A-07): Khi tách nước từ một chất X có công thức phân tử C4H10O tạo thành 3 anken là đồng phân của nhau (tính cả đồng phân hình học). B. . thuộc cùng dãy đồng đẳng. bậc 1. Tham gia phản ứng ete hoá có 50% lượng rượu có khối lượng phân tử nhỏ và 40% lượng rượu có khối lượng phân tử lớn. C. propan-1-ol và butan-1-ol.2 gam Na.8 lít khí H2 (đktc). 8.04. D.5 gam hỗn hợp X với H2SO4 đặc ở 140oC (với hiệu suất phản ứng của mỗi rượu là 80%). metanol và etanol. Giá trị của m là A. D.704 gam hỗn hợp 3 ete. 18. Giá trị của m là A. đun nóng 20. D.0. Câu 21: Cho 15. 17. (CH3)3COH. etanol và propan-1-ol. đơn chức. B. B.4 gam CO2 và 3. 4. D. 10. B.4. CH3-CH2-CH(CH3)-C(CH3)=CH2. CH2=CH-CH(CH3)-CH(CH3)2.52. 7. D. Công thức cấu tạo thu gọn của X là A.0.75.1. thu được 2. Mặt khác. thu được 24. C.6 gam hỗn hợp X gồm 2 ancol (rượu) đơn chức.

Sign up to vote on this title
UsefulNot useful